application-5163d87e.js

js humancoders.com collected 2026-10-02 14:57:53 UTC 1,590,903 bytes, 44,339 lines download raw bytes

vendor: 1,719 bytes, lines 1-46

1var __create = Object.create;
2var __getProtoOf = Object.getPrototypeOf;
3var __defProp = Object.defineProperty;
4var __getOwnPropNames = Object.getOwnPropertyNames;
5var __getOwnPropDesc = Object.getOwnPropertyDescriptor;
6var __hasOwnProp = Object.prototype.hasOwnProperty;
7function __accessProp(key) {
8  return this[key];
9}
10var __toESMCache_node;
11var __toESMCache_esm;
12var __toESM = (mod, isNodeMode, target) => {
13  var canCache = mod != null && typeof mod === "object";
14  if (canCache) {
15    var cache = isNodeMode ? __toESMCache_node ??= new WeakMap : __toESMCache_esm ??= new WeakMap;
16    var cached = cache.get(mod);
17    if (cached)
18      return cached;
19  }
20  target = mod != null ? __create(__getProtoOf(mod)) : {};
21  const to = isNodeMode || !mod || !mod.__esModule || !__hasOwnProp.call(mod, "default") ? __defProp(target, "default", { value: mod, enumerable: true }) : target;
22  if (mod && typeof mod === "object" || typeof mod === "function") {
23    for (let key of __getOwnPropNames(mod))
24      if (!__hasOwnProp.call(to, key))
25        __defProp(to, key, {
26          get: __accessProp.bind(mod, key),
27          enumerable: true
28        });
29  }
30  if (canCache)
31    cache.set(mod, to);
32  return to;
33};
34var __toCommonJS = (from) => {
35  var entry = (__moduleCache ??= new WeakMap).get(from), desc;
36  if (entry)
37    return entry;
38  entry = __defProp({}, "__esModule", { value: true });
39  if (from && typeof from === "object" || typeof from === "function") {
40    for (var key of __getOwnPropNames(from))
41      if (!__hasOwnProp.call(entry, key))
42        __defProp(entry, key, {
43          get: __accessProp.bind(from, key),
44          enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable
45        });
46  }

47  __moduleCache.set(from, entry);
48  return entry;
49};
50var __moduleCache;
51var __commonJS = (cb, mod) => () => (mod || cb((mod = { exports: {} }).exports, mod), mod.exports);
52var __returnValue = (v) => v;
53function __exportSetter(name, newValue) {
54  this[name] = __returnValue.bind(null, newValue);
55}
56var __export = (target, all2) => {
57  for (var name in all2)
58    __defProp(target, name, {
59      get: all2[name],
60      enumerable: true,
61      configurable: true,
62      set: __exportSetter.bind(all2, name)
63    });
64};
65var __esm = (fn2, res, err) => () => {
66  if (fn2)
67    try {
68      res = fn2(fn2 = 0);
69    } catch (e) {
70      err = [e];
71    }
72  if (err)
73    throw err[0];
74  return res;
75};
76

vendor: 215,185 bytes, lines 77-5910

77// node_modules/jquery/dist/jquery.js
78var require_jquery = __commonJS(function(exports2, module2) {
79  /*!
80   * jQuery JavaScript Library v3.7.1
81   * https://jquery.com/
82   *
83   * Copyright OpenJS Foundation and other contributors
84   * Released under the MIT license
85   * https://jquery.org/license
86   *
87   * Date: 2023-08-28T13:37Z
88   */
89  (function(global2, factory) {
90    if (typeof module2 === "object" && typeof module2.exports === "object") {
91      module2.exports = global2.document ? factory(global2, true) : function(w) {
92        if (!w.document) {
93          throw new Error("jQuery requires a window with a document");
94        }
95        return factory(w);
96      };
97    } else {
98      factory(global2);
99    }
100  })(typeof window !== "undefined" ? window : exports2, function(window2, noGlobal) {
101    var arr = [];
102    var getProto = Object.getPrototypeOf;
103    var slice = arr.slice;
104    var flat = arr.flat ? function(array) {
105      return arr.flat.call(array);
106    } : function(array) {
107      return arr.concat.apply([], array);
108    };
109    var push = arr.push;
110    var indexOf = arr.indexOf;
111    var class2type = {};
112    var toString = class2type.toString;
113    var hasOwn = class2type.hasOwnProperty;
114    var fnToString = hasOwn.toString;
115    var ObjectFunctionString = fnToString.call(Object);
116    var support = {};
117    var isFunction = function isFunction(obj2) {
118      return typeof obj2 === "function" && typeof obj2.nodeType !== "number" && typeof obj2.item !== "function";
119    };
120    var isWindow = function isWindow(obj2) {
121      return obj2 != null && obj2 === obj2.window;
122    };
123    var document2 = window2.document;
124    var preservedScriptAttributes = {
125      type: true,
126      src: true,
127      nonce: true,
128      noModule: true
129    };
130    function DOMEval(code, node, doc) {
131      doc = doc || document2;
132      var i, val, script = doc.createElement("script");
133      script.text = code;
134      if (node) {
135        for (i in preservedScriptAttributes) {
136          val = node[i] || node.getAttribute && node.getAttribute(i);
137          if (val) {
138            script.setAttribute(i, val);
139          }
140        }
141      }
142      doc.head.appendChild(script).parentNode.removeChild(script);
143    }
144    function toType(obj2) {
145      if (obj2 == null) {
146        return obj2 + "";
147      }
148      return typeof obj2 === "object" || typeof obj2 === "function" ? class2type[toString.call(obj2)] || "object" : typeof obj2;
149    }
150    var version = "3.7.1", rhtmlSuffix = /HTML$/i, jQuery2 = function(selector, context) {
151      return new jQuery2.fn.init(selector, context);
152    };
153    jQuery2.fn = jQuery2.prototype = {
154      jquery: version,
155      constructor: jQuery2,
156      length: 0,
157      toArray: function() {
158        return slice.call(this);
159      },
160      get: function(num) {
161        if (num == null) {
162          return slice.call(this);
163        }
164        return num < 0 ? this[num + this.length] : this[num];
165      },
166      pushStack: function(elems) {
167        var ret2 = jQuery2.merge(this.constructor(), elems);
168        ret2.prevObject = this;
169        return ret2;
170      },
171      each: function(callback) {
172        return jQuery2.each(this, callback);
173      },
174      map: function(callback) {
175        return this.pushStack(jQuery2.map(this, function(elem, i) {
176          return callback.call(elem, i, elem);
177        }));
178      },
179      slice: function() {
180        return this.pushStack(slice.apply(this, arguments));
181      },
182      first: function() {
183        return this.eq(0);
184      },
185      last: function() {
186        return this.eq(-1);
187      },
188      even: function() {
189        return this.pushStack(jQuery2.grep(this, function(_elem, i) {
190          return (i + 1) % 2;
191        }));
192      },
193      odd: function() {
194        return this.pushStack(jQuery2.grep(this, function(_elem, i) {
195          return i % 2;
196        }));
197      },
198      eq: function(i) {
199        var len = this.length, j = +i + (i < 0 ? len : 0);
200        return this.pushStack(j >= 0 && j < len ? [this[j]] : []);
201      },
202      end: function() {
203        return this.prevObject || this.constructor();
204      },
205      push,
206      sort: arr.sort,
207      splice: arr.splice
208    };
209    jQuery2.extend = jQuery2.fn.extend = function() {
210      var options2, name, src, copy, copyIsArray, clone2, target = arguments[0] || {}, i = 1, length = arguments.length, deep = false;
211      if (typeof target === "boolean") {
212        deep = target;
213        target = arguments[i] || {};
214        i++;
215      }
216      if (typeof target !== "object" && !isFunction(target)) {
217        target = {};
218      }
219      if (i === length) {
220        target = this;
221        i--;
222      }
223      for (;i < length; i++) {
224        if ((options2 = arguments[i]) != null) {
225          for (name in options2) {
226            copy = options2[name];
227            if (name === "__proto__" || target === copy) {
228              continue;
229            }
230            if (deep && copy && (jQuery2.isPlainObject(copy) || (copyIsArray = Array.isArray(copy)))) {
231              src = target[name];
232              if (copyIsArray && !Array.isArray(src)) {
233                clone2 = [];
234              } else if (!copyIsArray && !jQuery2.isPlainObject(src)) {
235                clone2 = {};
236              } else {
237                clone2 = src;
238              }
239              copyIsArray = false;
240              target[name] = jQuery2.extend(deep, clone2, copy);
241            } else if (copy !== undefined) {
242              target[name] = copy;
243            }
244          }
245        }
246      }
247      return target;
248    };
249    jQuery2.extend({
250      expando: "jQuery" + (version + Math.random()).replace(/\D/g, ""),
251      isReady: true,
252      error: function(msg) {
253        throw new Error(msg);
254      },
255      noop: function() {},
256      isPlainObject: function(obj2) {
257        var proto, Ctor;
258        if (!obj2 || toString.call(obj2) !== "[object Object]") {
259          return false;
260        }
261        proto = getProto(obj2);
262        if (!proto) {
263          return true;
264        }
265        Ctor = hasOwn.call(proto, "constructor") && proto.constructor;
266        return typeof Ctor === "function" && fnToString.call(Ctor) === ObjectFunctionString;
267      },
268      isEmptyObject: function(obj2) {
269        var name;
270        for (name in obj2) {
271          return false;
272        }
273        return true;
274      },
275      globalEval: function(code, options2, doc) {
276        DOMEval(code, { nonce: options2 && options2.nonce }, doc);
277      },
278      each: function(obj2, callback) {
279        var length, i = 0;
280        if (isArrayLike(obj2)) {
281          length = obj2.length;
282          for (;i < length; i++) {
283            if (callback.call(obj2[i], i, obj2[i]) === false) {
284              break;
285            }
286          }
287        } else {
288          for (i in obj2) {
289            if (callback.call(obj2[i], i, obj2[i]) === false) {
290              break;
291            }
292          }
293        }
294        return obj2;
295      },
296      text: function(elem) {
297        var node, ret2 = "", i = 0, nodeType = elem.nodeType;
298        if (!nodeType) {
299          while (node = elem[i++]) {
300            ret2 += jQuery2.text(node);
301          }
302        }
303        if (nodeType === 1 || nodeType === 11) {
304          return elem.textContent;
305        }
306        if (nodeType === 9) {
307          return elem.documentElement.textContent;
308        }
309        if (nodeType === 3 || nodeType === 4) {
310          return elem.nodeValue;
311        }
312        return ret2;
313      },
314      makeArray: function(arr, results) {
315        var ret2 = results || [];
316        if (arr != null) {
317          if (isArrayLike(Object(arr))) {
318            jQuery2.merge(ret2, typeof arr === "string" ? [arr] : arr);
319          } else {
320            push.call(ret2, arr);
321          }
322        }
323        return ret2;
324      },
325      inArray: function(elem, arr, i) {
326        return arr == null ? -1 : indexOf.call(arr, elem, i);
327      },
328      isXMLDoc: function(elem) {
329        var namespace = elem && elem.namespaceURI, docElem = elem && (elem.ownerDocument || elem).documentElement;
330        return !rhtmlSuffix.test(namespace || docElem && docElem.nodeName || "HTML");
331      },
332      merge: function(first, second) {
333        var len = +second.length, j = 0, i = first.length;
334        for (;j < len; j++) {
335          first[i++] = second[j];
336        }
337        first.length = i;
338        return first;
339      },
340      grep: function(elems, callback, invert) {
341        var callbackInverse, matches = [], i = 0, length = elems.length, callbackExpect = !invert;
342        for (;i < length; i++) {
343          callbackInverse = !callback(elems[i], i);
344          if (callbackInverse !== callbackExpect) {
345            matches.push(elems[i]);
346          }
347        }
348        return matches;
349      },
350      map: function(elems, callback, arg) {
351        var length, value, i = 0, ret2 = [];
352        if (isArrayLike(elems)) {
353          length = elems.length;
354          for (;i < length; i++) {
355            value = callback(elems[i], i, arg);
356            if (value != null) {
357              ret2.push(value);
358            }
359          }
360        } else {
361          for (i in elems) {
362            value = callback(elems[i], i, arg);
363            if (value != null) {
364              ret2.push(value);
365            }
366          }
367        }
368        return flat(ret2);
369      },
370      guid: 1,
371      support
372    });
373    if (typeof Symbol === "function") {
374      jQuery2.fn[Symbol.iterator] = arr[Symbol.iterator];
375    }
376    jQuery2.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "), function(_i, name) {
377      class2type["[object " + name + "]"] = name.toLowerCase();
378    });
379    function isArrayLike(obj2) {
380      var length = !!obj2 && "length" in obj2 && obj2.length, type = toType(obj2);
381      if (isFunction(obj2) || isWindow(obj2)) {
382        return false;
383      }
384      return type === "array" || length === 0 || typeof length === "number" && length > 0 && length - 1 in obj2;
385    }
386    function nodeName(elem, name) {
387      return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
388    }
389    var pop = arr.pop;
390    var sort = arr.sort;
391    var splice = arr.splice;
392    var whitespace = "[\\x20\\t\\r\\n\\f]";
393    var rtrimCSS = new RegExp("^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g");
394    jQuery2.contains = function(a, b) {
395      var bup = b && b.parentNode;
396      return a === bup || !!(bup && bup.nodeType === 1 && (a.contains ? a.contains(bup) : a.compareDocumentPosition && a.compareDocumentPosition(bup) & 16));
397    };
398    var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
399    function fcssescape(ch, asCodePoint) {
400      if (asCodePoint) {
401        if (ch === "\x00") {
402          return "ï¿½";
403        }
404        return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
405      }
406      return "\\" + ch;
407    }
408    jQuery2.escapeSelector = function(sel) {
409      return (sel + "").replace(rcssescape, fcssescape);
410    };
411    var preferredDoc = document2, pushNative = push;
412    (function() {
413      var i, Expr, outermostContext, sortInput, hasDuplicate, push = pushNative, document2, documentElement, documentIsHTML, rbuggyQSA, matches, expando = jQuery2.expando, dirruns = 0, done = 0, classCache = createCache(), tokenCache = createCache(), compilerCache = createCache(), nonnativeSelectorCache = createCache(), sortOrder = function(a, b) {
414        if (a === b) {
415          hasDuplicate = true;
416        }
417        return 0;
418      }, booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|" + "loop|multiple|open|readonly|required|scoped", identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\x00-\\x7f])+", attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + "*([*^$|!~]?=)" + whitespace + `*(?:'((?:\\\\.|[^\\\\'])*)'|"((?:\\\\.|[^\\\\"])*)"|(` + identifier + "))|)" + whitespace + "*\\]", pseudos = ":(" + identifier + ")(?:\\((" + `('((?:\\\\.|[^\\\\'])*)'|"((?:\\\\.|[^\\\\"])*)")|` + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + ".*" + ")\\)|)", rwhitespace = new RegExp(whitespace + "+", "g"), rcomma = new RegExp("^" + whitespace + "*," + whitespace + "*"), rleadingCombinator = new RegExp("^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*"), rdescend = new RegExp(whitespace + "|>"), rpseudo = new RegExp(pseudos), ridentifier = new RegExp("^" + identifier + "$"), matchExpr = {
419        ID: new RegExp("^#(" + identifier + ")"),
420        CLASS: new RegExp("^\\.(" + identifier + ")"),
421        TAG: new RegExp("^(" + identifier + "|[*])"),
422        ATTR: new RegExp("^" + attributes),
423        PSEUDO: new RegExp("^" + pseudos),
424        CHILD: new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i"),
425        bool: new RegExp("^(?:" + booleans + ")$", "i"),
426        needsContext: new RegExp("^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i")
427      }, rinputs = /^(?:input|select|textarea|button)$/i, rheader = /^h\d$/i, rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, rsibling = /[+~]/, runescape = new RegExp("\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g"), funescape = function(escape2, nonHex) {
428        var high = "0x" + escape2.slice(1) - 65536;
429        if (nonHex) {
430          return nonHex;
431        }
432        return high < 0 ? String.fromCharCode(high + 65536) : String.fromCharCode(high >> 10 | 55296, high & 1023 | 56320);
433      }, unloadHandler = function() {
434        setDocument();
435      }, inDisabledFieldset = addCombinator(function(elem) {
436        return elem.disabled === true && nodeName(elem, "fieldset");
437      }, { dir: "parentNode", next: "legend" });
438      function safeActiveElement() {
439        try {
440          return document2.activeElement;
441        } catch (err) {}
442      }
443      try {
444        push.apply(arr = slice.call(preferredDoc.childNodes), preferredDoc.childNodes);
445        arr[preferredDoc.childNodes.length].nodeType;
446      } catch (e) {
447        push = {
448          apply: function(target, els) {
449            pushNative.apply(target, slice.call(els));
450          },
451          call: function(target) {
452            pushNative.apply(target, slice.call(arguments, 1));
453          }
454        };
455      }
456      function find(selector, context, results, seed) {
457        var m2, i, elem, nid, match, groups, newSelector, newContext = context && context.ownerDocument, nodeType = context ? context.nodeType : 9;
458        results = results || [];
459        if (typeof selector !== "string" || !selector || nodeType !== 1 && nodeType !== 9 && nodeType !== 11) {
460          return results;
461        }
462        if (!seed) {
463          setDocument(context);
464          context = context || document2;
465          if (documentIsHTML) {
466            if (nodeType !== 11 && (match = rquickExpr.exec(selector))) {
467              if (m2 = match[1]) {
468                if (nodeType === 9) {
469                  if (elem = context.getElementById(m2)) {
470                    if (elem.id === m2) {
471                      push.call(results, elem);
472                      return results;
473                    }
474                  } else {
475                    return results;
476                  }
477                } else {
478                  if (newContext && (elem = newContext.getElementById(m2)) && find.contains(context, elem) && elem.id === m2) {
479                    push.call(results, elem);
480                    return results;
481                  }
482                }
483              } else if (match[2]) {
484                push.apply(results, context.getElementsByTagName(selector));
485                return results;
486              } else if ((m2 = match[3]) && context.getElementsByClassName) {
487                push.apply(results, context.getElementsByClassName(m2));
488                return results;
489              }
490            }
491            if (!nonnativeSelectorCache[selector + " "] && (!rbuggyQSA || !rbuggyQSA.test(selector))) {
492              newSelector = selector;
493              newContext = context;
494              if (nodeType === 1 && (rdescend.test(selector) || rleadingCombinator.test(selector))) {
495                newContext = rsibling.test(selector) && testContext(context.parentNode) || context;
496                if (newContext != context || !support.scope) {
497                  if (nid = context.getAttribute("id")) {
498                    nid = jQuery2.escapeSelector(nid);
499                  } else {
500                    context.setAttribute("id", nid = expando);
501                  }
502                }
503                groups = tokenize(selector);
504                i = groups.length;
505                while (i--) {
506                  groups[i] = (nid ? "#" + nid : ":scope") + " " + toSelector(groups[i]);
507                }
508                newSelector = groups.join(",");
509              }
510              try {
511                push.apply(results, newContext.querySelectorAll(newSelector));
512                return results;
513              } catch (qsaError) {
514                nonnativeSelectorCache(selector, true);
515              } finally {
516                if (nid === expando) {
517                  context.removeAttribute("id");
518                }
519              }
520            }
521          }
522        }
523        return select2(selector.replace(rtrimCSS, "$1"), context, results, seed);
524      }
525      function createCache() {
526        var keys = [];
527        function cache(key, value) {
528          if (keys.push(key + " ") > Expr.cacheLength) {
529            delete cache[keys.shift()];
530          }
531          return cache[key + " "] = value;
532        }
533        return cache;
534      }
535      function markFunction(fn2) {
536        fn2[expando] = true;
537        return fn2;
538      }
539      function assert(fn2) {
540        var el = document2.createElement("fieldset");
541        try {
542          return !!fn2(el);
543        } catch (e) {
544          return false;
545        } finally {
546          if (el.parentNode) {
547            el.parentNode.removeChild(el);
548          }
549          el = null;
550        }
551      }
552      function createInputPseudo(type) {
553        return function(elem) {
554          return nodeName(elem, "input") && elem.type === type;
555        };
556      }
557      function createButtonPseudo(type) {
558        return function(elem) {
559          return (nodeName(elem, "input") || nodeName(elem, "button")) && elem.type === type;
560        };
561      }
562      function createDisabledPseudo(disabled) {
563        return function(elem) {
564          if ("form" in elem) {
565            if (elem.parentNode && elem.disabled === false) {
566              if ("label" in elem) {
567                if ("label" in elem.parentNode) {
568                  return elem.parentNode.disabled === disabled;
569                } else {
570                  return elem.disabled === disabled;
571                }
572              }
573              return elem.isDisabled === disabled || elem.isDisabled !== !disabled && inDisabledFieldset(elem) === disabled;
574            }
575            return elem.disabled === disabled;
576          } else if ("label" in elem) {
577            return elem.disabled === disabled;
578          }
579          return false;
580        };
581      }
582      function createPositionalPseudo(fn2) {
583        return markFunction(function(argument) {
584          argument = +argument;
585          return markFunction(function(seed, matches) {
586            var j, matchIndexes = fn2([], seed.length, argument), i = matchIndexes.length;
587            while (i--) {
588              if (seed[j = matchIndexes[i]]) {
589                seed[j] = !(matches[j] = seed[j]);
590              }
591            }
592          });
593        });
594      }
595      function testContext(context) {
596        return context && typeof context.getElementsByTagName !== "undefined" && context;
597      }
598      function setDocument(node) {
599        var subWindow, doc = node ? node.ownerDocument || node : preferredDoc;
600        if (doc == document2 || doc.nodeType !== 9 || !doc.documentElement) {
601          return document2;
602        }
603        document2 = doc;
604        documentElement = document2.documentElement;
605        documentIsHTML = !jQuery2.isXMLDoc(document2);
606        matches = documentElement.matches || documentElement.webkitMatchesSelector || documentElement.msMatchesSelector;
607        if (documentElement.msMatchesSelector && preferredDoc != document2 && (subWindow = document2.defaultView) && subWindow.top !== subWindow) {
608          subWindow.addEventListener("unload", unloadHandler);
609        }
610        support.getById = assert(function(el) {
611          documentElement.appendChild(el).id = jQuery2.expando;
612          return !document2.getElementsByName || !document2.getElementsByName(jQuery2.expando).length;
613        });
614        support.disconnectedMatch = assert(function(el) {
615          return matches.call(el, "*");
616        });
617        support.scope = assert(function() {
618          return document2.querySelectorAll(":scope");
619        });
620        support.cssHas = assert(function() {
621          try {
622            document2.querySelector(":has(*,:jqfake)");
623            return false;
624          } catch (e) {
625            return true;
626          }
627        });
628        if (support.getById) {
629          Expr.filter.ID = function(id) {
630            var attrId = id.replace(runescape, funescape);
631            return function(elem) {
632              return elem.getAttribute("id") === attrId;
633            };
634          };
635          Expr.find.ID = function(id, context) {
636            if (typeof context.getElementById !== "undefined" && documentIsHTML) {
637              var elem = context.getElementById(id);
638              return elem ? [elem] : [];
639            }
640          };
641        } else {
642          Expr.filter.ID = function(id) {
643            var attrId = id.replace(runescape, funescape);
644            return function(elem) {
645              var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
646              return node && node.value === attrId;
647            };
648          };
649          Expr.find.ID = function(id, context) {
650            if (typeof context.getElementById !== "undefined" && documentIsHTML) {
651              var node, i, elems, elem = context.getElementById(id);
652              if (elem) {
653                node = elem.getAttributeNode("id");
654                if (node && node.value === id) {
655                  return [elem];
656                }
657                elems = context.getElementsByName(id);
658                i = 0;
659                while (elem = elems[i++]) {
660                  node = elem.getAttributeNode("id");
661                  if (node && node.value === id) {
662                    return [elem];
663                  }
664                }
665              }
666              return [];
667            }
668          };
669        }
670        Expr.find.TAG = function(tag, context) {
671          if (typeof context.getElementsByTagName !== "undefined") {
672            return context.getElementsByTagName(tag);
673          } else {
674            return context.querySelectorAll(tag);
675          }
676        };
677        Expr.find.CLASS = function(className, context) {
678          if (typeof context.getElementsByClassName !== "undefined" && documentIsHTML) {
679            return context.getElementsByClassName(className);
680          }
681        };
682        rbuggyQSA = [];
683        assert(function(el) {
684          var input;
685          documentElement.appendChild(el).innerHTML = "<a id='" + expando + "' href='' disabled='disabled'></a>" + "<select id='" + expando + "-\r\\' disabled='disabled'>" + "<option selected=''></option></select>";
686          if (!el.querySelectorAll("[selected]").length) {
687            rbuggyQSA.push("\\[" + whitespace + "*(?:value|" + booleans + ")");
688          }
689          if (!el.querySelectorAll("[id~=" + expando + "-]").length) {
690            rbuggyQSA.push("~=");
691          }
692          if (!el.querySelectorAll("a#" + expando + "+*").length) {
693            rbuggyQSA.push(".#.+[+~]");
694          }
695          if (!el.querySelectorAll(":checked").length) {
696            rbuggyQSA.push(":checked");
697          }
698          input = document2.createElement("input");
699          input.setAttribute("type", "hidden");
700          el.appendChild(input).setAttribute("name", "D");
701          documentElement.appendChild(el).disabled = true;
702          if (el.querySelectorAll(":disabled").length !== 2) {
703            rbuggyQSA.push(":enabled", ":disabled");
704          }
705          input = document2.createElement("input");
706          input.setAttribute("name", "");
707          el.appendChild(input);
708          if (!el.querySelectorAll("[name='']").length) {
709            rbuggyQSA.push("\\[" + whitespace + "*name" + whitespace + "*=" + whitespace + `*(?:''|"")`);
710          }
711        });
712        if (!support.cssHas) {
713          rbuggyQSA.push(":has");
714        }
715        rbuggyQSA = rbuggyQSA.length && new RegExp(rbuggyQSA.join("|"));
716        sortOrder = function(a, b) {
717          if (a === b) {
718            hasDuplicate = true;
719            return 0;
720          }
721          var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
722          if (compare) {
723            return compare;
724          }
725          compare = (a.ownerDocument || a) == (b.ownerDocument || b) ? a.compareDocumentPosition(b) : 1;
726          if (compare & 1 || !support.sortDetached && b.compareDocumentPosition(a) === compare) {
727            if (a === document2 || a.ownerDocument == preferredDoc && find.contains(preferredDoc, a)) {
728              return -1;
729            }
730            if (b === document2 || b.ownerDocument == preferredDoc && find.contains(preferredDoc, b)) {
731              return 1;
732            }
733            return sortInput ? indexOf.call(sortInput, a) - indexOf.call(sortInput, b) : 0;
734          }
735          return compare & 4 ? -1 : 1;
736        };
737        return document2;
738      }
739      find.matches = function(expr, elements) {
740        return find(expr, null, null, elements);
741      };
742      find.matchesSelector = function(elem, expr) {
743        setDocument(elem);
744        if (documentIsHTML && !nonnativeSelectorCache[expr + " "] && (!rbuggyQSA || !rbuggyQSA.test(expr))) {
745          try {
746            var ret2 = matches.call(elem, expr);
747            if (ret2 || support.disconnectedMatch || elem.document && elem.document.nodeType !== 11) {
748              return ret2;
749            }
750          } catch (e) {
751            nonnativeSelectorCache(expr, true);
752          }
753        }
754        return find(expr, document2, null, [elem]).length > 0;
755      };
756      find.contains = function(context, elem) {
757        if ((context.ownerDocument || context) != document2) {
758          setDocument(context);
759        }
760        return jQuery2.contains(context, elem);
761      };
762      find.attr = function(elem, name) {
763        if ((elem.ownerDocument || elem) != document2) {
764          setDocument(elem);
765        }
766        var fn2 = Expr.attrHandle[name.toLowerCase()], val = fn2 && hasOwn.call(Expr.attrHandle, name.toLowerCase()) ? fn2(elem, name, !documentIsHTML) : undefined;
767        if (val !== undefined) {
768          return val;
769        }
770        return elem.getAttribute(name);
771      };
772      find.error = function(msg) {
773        throw new Error("Syntax error, unrecognized expression: " + msg);
774      };
775      jQuery2.uniqueSort = function(results) {
776        var elem, duplicates = [], j = 0, i = 0;
777        hasDuplicate = !support.sortStable;
778        sortInput = !support.sortStable && slice.call(results, 0);
779        sort.call(results, sortOrder);
780        if (hasDuplicate) {
781          while (elem = results[i++]) {
782            if (elem === results[i]) {
783              j = duplicates.push(i);
784            }
785          }
786          while (j--) {
787            splice.call(results, duplicates[j], 1);
788          }
789        }
790        sortInput = null;
791        return results;
792      };
793      jQuery2.fn.uniqueSort = function() {
794        return this.pushStack(jQuery2.uniqueSort(slice.apply(this)));
795      };
796      Expr = jQuery2.expr = {
797        cacheLength: 50,
798        createPseudo: markFunction,
799        match: matchExpr,
800        attrHandle: {},
801        find: {},
802        relative: {
803          ">": { dir: "parentNode", first: true },
804          " ": { dir: "parentNode" },
805          "+": { dir: "previousSibling", first: true },
806          "~": { dir: "previousSibling" }
807        },
808        preFilter: {
809          ATTR: function(match) {
810            match[1] = match[1].replace(runescape, funescape);
811            match[3] = (match[3] || match[4] || match[5] || "").replace(runescape, funescape);
812            if (match[2] === "~=") {
813              match[3] = " " + match[3] + " ";
814            }
815            return match.slice(0, 4);
816          },
817          CHILD: function(match) {
818            match[1] = match[1].toLowerCase();
819            if (match[1].slice(0, 3) === "nth") {
820              if (!match[3]) {
821                find.error(match[0]);
822              }
823              match[4] = +(match[4] ? match[5] + (match[6] || 1) : 2 * (match[3] === "even" || match[3] === "odd"));
824              match[5] = +(match[7] + match[8] || match[3] === "odd");
825            } else if (match[3]) {
826              find.error(match[0]);
827            }
828            return match;
829          },
830          PSEUDO: function(match) {
831            var excess, unquoted = !match[6] && match[2];
832            if (matchExpr.CHILD.test(match[0])) {
833              return null;
834            }
835            if (match[3]) {
836              match[2] = match[4] || match[5] || "";
837            } else if (unquoted && rpseudo.test(unquoted) && (excess = tokenize(unquoted, true)) && (excess = unquoted.indexOf(")", unquoted.length - excess) - unquoted.length)) {
838              match[0] = match[0].slice(0, excess);
839              match[2] = unquoted.slice(0, excess);
840            }
841            return match.slice(0, 3);
842          }
843        },
844        filter: {
845          TAG: function(nodeNameSelector) {
846            var expectedNodeName = nodeNameSelector.replace(runescape, funescape).toLowerCase();
847            return nodeNameSelector === "*" ? function() {
848              return true;
849            } : function(elem) {
850              return nodeName(elem, expectedNodeName);
851            };
852          },
853          CLASS: function(className) {
854            var pattern = classCache[className + " "];
855            return pattern || (pattern = new RegExp("(^|" + whitespace + ")" + className + "(" + whitespace + "|$)")) && classCache(className, function(elem) {
856              return pattern.test(typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "");
857            });
858          },
859          ATTR: function(name, operator, check) {
860            return function(elem) {
861              var result = find.attr(elem, name);
862              if (result == null) {
863                return operator === "!=";
864              }
865              if (!operator) {
866                return true;
867              }
868              result += "";
869              if (operator === "=") {
870                return result === check;
871              }
872              if (operator === "!=") {
873                return result !== check;
874              }
875              if (operator === "^=") {
876                return check && result.indexOf(check) === 0;
877              }
878              if (operator === "*=") {
879                return check && result.indexOf(check) > -1;
880              }
881              if (operator === "$=") {
882                return check && result.slice(-check.length) === check;
883              }
884              if (operator === "~=") {
885                return (" " + result.replace(rwhitespace, " ") + " ").indexOf(check) > -1;
886              }
887              if (operator === "|=") {
888                return result === check || result.slice(0, check.length + 1) === check + "-";
889              }
890              return false;
891            };
892          },
893          CHILD: function(type, what, _argument, first, last) {
894            var simple = type.slice(0, 3) !== "nth", forward = type.slice(-4) !== "last", ofType = what === "of-type";
895            return first === 1 && last === 0 ? function(elem) {
896              return !!elem.parentNode;
897            } : function(elem, _context, xml) {
898              var cache, outerCache, node, nodeIndex, start, dir = simple !== forward ? "nextSibling" : "previousSibling", parent = elem.parentNode, name = ofType && elem.nodeName.toLowerCase(), useCache = !xml && !ofType, diff = false;
899              if (parent) {
900                if (simple) {
901                  while (dir) {
902                    node = elem;
903                    while (node = node[dir]) {
904                      if (ofType ? nodeName(node, name) : node.nodeType === 1) {
905                        return false;
906                      }
907                    }
908                    start = dir = type === "only" && !start && "nextSibling";
909                  }
910                  return true;
911                }
912                start = [forward ? parent.firstChild : parent.lastChild];
913                if (forward && useCache) {
914                  outerCache = parent[expando] || (parent[expando] = {});
915                  cache = outerCache[type] || [];
916                  nodeIndex = cache[0] === dirruns && cache[1];
917                  diff = nodeIndex && cache[2];
918                  node = nodeIndex && parent.childNodes[nodeIndex];
919                  while (node = ++nodeIndex && node && node[dir] || (diff = nodeIndex = 0) || start.pop()) {
920                    if (node.nodeType === 1 && ++diff && node === elem) {
921                      outerCache[type] = [dirruns, nodeIndex, diff];
922                      break;
923                    }
924                  }
925                } else {
926                  if (useCache) {
927                    outerCache = elem[expando] || (elem[expando] = {});
928                    cache = outerCache[type] || [];
929                    nodeIndex = cache[0] === dirruns && cache[1];
930                    diff = nodeIndex;
931                  }
932                  if (diff === false) {
933                    while (node = ++nodeIndex && node && node[dir] || (diff = nodeIndex = 0) || start.pop()) {
934                      if ((ofType ? nodeName(node, name) : node.nodeType === 1) && ++diff) {
935                        if (useCache) {
936                          outerCache = node[expando] || (node[expando] = {});
937                          outerCache[type] = [dirruns, diff];
938                        }
939                        if (node === elem) {
940                          break;
941                        }
942                      }
943                    }
944                  }
945                }
946                diff -= last;
947                return diff === first || diff % first === 0 && diff / first >= 0;
948              }
949            };
950          },
951          PSEUDO: function(pseudo, argument) {
952            var args2, fn2 = Expr.pseudos[pseudo] || Expr.setFilters[pseudo.toLowerCase()] || find.error("unsupported pseudo: " + pseudo);
953            if (fn2[expando]) {
954              return fn2(argument);
955            }
956            if (fn2.length > 1) {
957              args2 = [pseudo, pseudo, "", argument];
958              return Expr.setFilters.hasOwnProperty(pseudo.toLowerCase()) ? markFunction(function(seed, matches) {
959                var idx, matched = fn2(seed, argument), i = matched.length;
960                while (i--) {
961                  idx = indexOf.call(seed, matched[i]);
962                  seed[idx] = !(matches[idx] = matched[i]);
963                }
964              }) : function(elem) {
965                return fn2(elem, 0, args2);
966              };
967            }
968            return fn2;
969          }
970        },
971        pseudos: {
972          not: markFunction(function(selector) {
973            var input = [], results = [], matcher = compile(selector.replace(rtrimCSS, "$1"));
974            return matcher[expando] ? markFunction(function(seed, matches, _context, xml) {
975              var elem, unmatched = matcher(seed, null, xml, []), i = seed.length;
976              while (i--) {
977                if (elem = unmatched[i]) {
978                  seed[i] = !(matches[i] = elem);
979                }
980              }
981            }) : function(elem, _context, xml) {
982              input[0] = elem;
983              matcher(input, null, xml, results);
984              input[0] = null;
985              return !results.pop();
986            };
987          }),
988          has: markFunction(function(selector) {
989            return function(elem) {
990              return find(selector, elem).length > 0;
991            };
992          }),
993          contains: markFunction(function(text2) {
994            text2 = text2.replace(runescape, funescape);
995            return function(elem) {
996              return (elem.textContent || jQuery2.text(elem)).indexOf(text2) > -1;
997            };
998          }),
999          lang: markFunction(function(lang) {
1000            if (!ridentifier.test(lang || "")) {
1001              find.error("unsupported lang: " + lang);
1002            }
1003            lang = lang.replace(runescape, funescape).toLowerCase();
1004            return function(elem) {
1005              var elemLang;
1006              do {
1007                if (elemLang = documentIsHTML ? elem.lang : elem.getAttribute("xml:lang") || elem.getAttribute("lang")) {
1008                  elemLang = elemLang.toLowerCase();
1009                  return elemLang === lang || elemLang.indexOf(lang + "-") === 0;
1010                }
1011              } while ((elem = elem.parentNode) && elem.nodeType === 1);
1012              return false;
1013            };
1014          }),
1015          target: function(elem) {
1016            var hash = window2.location && window2.location.hash;
1017            return hash && hash.slice(1) === elem.id;
1018          },
1019          root: function(elem) {
1020            return elem === documentElement;
1021          },
1022          focus: function(elem) {
1023            return elem === safeActiveElement() && document2.hasFocus() && !!(elem.type || elem.href || ~elem.tabIndex);
1024          },
1025          enabled: createDisabledPseudo(false),
1026          disabled: createDisabledPseudo(true),
1027          checked: function(elem) {
1028            return nodeName(elem, "input") && !!elem.checked || nodeName(elem, "option") && !!elem.selected;
1029          },
1030          selected: function(elem) {
1031            if (elem.parentNode) {
1032              elem.parentNode.selectedIndex;
1033            }
1034            return elem.selected === true;
1035          },
1036          empty: function(elem) {
1037            for (elem = elem.firstChild;elem; elem = elem.nextSibling) {
1038              if (elem.nodeType < 6) {
1039                return false;
1040              }
1041            }
1042            return true;
1043          },
1044          parent: function(elem) {
1045            return !Expr.pseudos.empty(elem);
1046          },
1047          header: function(elem) {
1048            return rheader.test(elem.nodeName);
1049          },
1050          input: function(elem) {
1051            return rinputs.test(elem.nodeName);
1052          },
1053          button: function(elem) {
1054            return nodeName(elem, "input") && elem.type === "button" || nodeName(elem, "button");
1055          },
1056          text: function(elem) {
1057            var attr;
1058            return nodeName(elem, "input") && elem.type === "text" && ((attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text");
1059          },
1060          first: createPositionalPseudo(function() {
1061            return [0];
1062          }),
1063          last: createPositionalPseudo(function(_matchIndexes, length) {
1064            return [length - 1];
1065          }),
1066          eq: createPositionalPseudo(function(_matchIndexes, length, argument) {
1067            return [argument < 0 ? argument + length : argument];
1068          }),
1069          even: createPositionalPseudo(function(matchIndexes, length) {
1070            var i = 0;
1071            for (;i < length; i += 2) {
1072              matchIndexes.push(i);
1073            }
1074            return matchIndexes;
1075          }),
1076          odd: createPositionalPseudo(function(matchIndexes, length) {
1077            var i = 1;
1078            for (;i < length; i += 2) {
1079              matchIndexes.push(i);
1080            }
1081            return matchIndexes;
1082          }),
1083          lt: createPositionalPseudo(function(matchIndexes, length, argument) {
1084            var i;
1085            if (argument < 0) {
1086              i = argument + length;
1087            } else if (argument > length) {
1088              i = length;
1089            } else {
1090              i = argument;
1091            }
1092            for (;--i >= 0; ) {
1093              matchIndexes.push(i);
1094            }
1095            return matchIndexes;
1096          }),
1097          gt: createPositionalPseudo(function(matchIndexes, length, argument) {
1098            var i = argument < 0 ? argument + length : argument;
1099            for (;++i < length; ) {
1100              matchIndexes.push(i);
1101            }
1102            return matchIndexes;
1103          })
1104        }
1105      };
1106      Expr.pseudos.nth = Expr.pseudos.eq;
1107      for (i in { radio: true, checkbox: true, file: true, password: true, image: true }) {
1108        Expr.pseudos[i] = createInputPseudo(i);
1109      }
1110      for (i in { submit: true, reset: true }) {
1111        Expr.pseudos[i] = createButtonPseudo(i);
1112      }
1113      function setFilters() {}
1114      setFilters.prototype = Expr.filters = Expr.pseudos;
1115      Expr.setFilters = new setFilters;
1116      function tokenize(selector, parseOnly) {
1117        var matched, match, tokens, type, soFar, groups, preFilters, cached = tokenCache[selector + " "];
1118        if (cached) {
1119          return parseOnly ? 0 : cached.slice(0);
1120        }
1121        soFar = selector;
1122        groups = [];
1123        preFilters = Expr.preFilter;
1124        while (soFar) {
1125          if (!matched || (match = rcomma.exec(soFar))) {
1126            if (match) {
1127              soFar = soFar.slice(match[0].length) || soFar;
1128            }
1129            groups.push(tokens = []);
1130          }
1131          matched = false;
1132          if (match = rleadingCombinator.exec(soFar)) {
1133            matched = match.shift();
1134            tokens.push({
1135              value: matched,
1136              type: match[0].replace(rtrimCSS, " ")
1137            });
1138            soFar = soFar.slice(matched.length);
1139          }
1140          for (type in Expr.filter) {
1141            if ((match = matchExpr[type].exec(soFar)) && (!preFilters[type] || (match = preFilters[type](match)))) {
1142              matched = match.shift();
1143              tokens.push({
1144                value: matched,
1145                type,
1146                matches: match
1147              });
1148              soFar = soFar.slice(matched.length);
1149            }
1150          }
1151          if (!matched) {
1152            break;
1153          }
1154        }
1155        if (parseOnly) {
1156          return soFar.length;
1157        }
1158        return soFar ? find.error(selector) : tokenCache(selector, groups).slice(0);
1159      }
1160      function toSelector(tokens) {
1161        var i = 0, len = tokens.length, selector = "";
1162        for (;i < len; i++) {
1163          selector += tokens[i].value;
1164        }
1165        return selector;
1166      }
1167      function addCombinator(matcher, combinator, base) {
1168        var { dir, next: skip } = combinator, key = skip || dir, checkNonElements = base && key === "parentNode", doneName = done++;
1169        return combinator.first ? function(elem, context, xml) {
1170          while (elem = elem[dir]) {
1171            if (elem.nodeType === 1 || checkNonElements) {
1172              return matcher(elem, context, xml);
1173            }
1174          }
1175          return false;
1176        } : function(elem, context, xml) {
1177          var oldCache, outerCache, newCache = [dirruns, doneName];
1178          if (xml) {
1179            while (elem = elem[dir]) {
1180              if (elem.nodeType === 1 || checkNonElements) {
1181                if (matcher(elem, context, xml)) {
1182                  return true;
1183                }
1184              }
1185            }
1186          } else {
1187            while (elem = elem[dir]) {
1188              if (elem.nodeType === 1 || checkNonElements) {
1189                outerCache = elem[expando] || (elem[expando] = {});
1190                if (skip && nodeName(elem, skip)) {
1191                  elem = elem[dir] || elem;
1192                } else if ((oldCache = outerCache[key]) && oldCache[0] === dirruns && oldCache[1] === doneName) {
1193                  return newCache[2] = oldCache[2];
1194                } else {
1195                  outerCache[key] = newCache;
1196                  if (newCache[2] = matcher(elem, context, xml)) {
1197                    return true;
1198                  }
1199                }
1200              }
1201            }
1202          }
1203          return false;
1204        };
1205      }
1206      function elementMatcher(matchers) {
1207        return matchers.length > 1 ? function(elem, context, xml) {
1208          var i = matchers.length;
1209          while (i--) {
1210            if (!matchers[i](elem, context, xml)) {
1211              return false;
1212            }
1213          }
1214          return true;
1215        } : matchers[0];
1216      }
1217      function multipleContexts(selector, contexts, results) {
1218        var i = 0, len = contexts.length;
1219        for (;i < len; i++) {
1220          find(selector, contexts[i], results);
1221        }
1222        return results;
1223      }
1224      function condense(unmatched, map, filter, context, xml) {
1225        var elem, newUnmatched = [], i = 0, len = unmatched.length, mapped = map != null;
1226        for (;i < len; i++) {
1227          if (elem = unmatched[i]) {
1228            if (!filter || filter(elem, context, xml)) {
1229              newUnmatched.push(elem);
1230              if (mapped) {
1231                map.push(i);
1232              }
1233            }
1234          }
1235        }
1236        return newUnmatched;
1237      }
1238      function setMatcher(preFilter, selector, matcher, postFilter, postFinder, postSelector) {
1239        if (postFilter && !postFilter[expando]) {
1240          postFilter = setMatcher(postFilter);
1241        }
1242        if (postFinder && !postFinder[expando]) {
1243          postFinder = setMatcher(postFinder, postSelector);
1244        }
1245        return markFunction(function(seed, results, context, xml) {
1246          var temp, i, elem, matcherOut, preMap = [], postMap = [], preexisting = results.length, elems = seed || multipleContexts(selector || "*", context.nodeType ? [context] : context, []), matcherIn = preFilter && (seed || !selector) ? condense(elems, preMap, preFilter, context, xml) : elems;
1247          if (matcher) {
1248            matcherOut = postFinder || (seed ? preFilter : preexisting || postFilter) ? [] : results;
1249            matcher(matcherIn, matcherOut, context, xml);
1250          } else {
1251            matcherOut = matcherIn;
1252          }
1253          if (postFilter) {
1254            temp = condense(matcherOut, postMap);
1255            postFilter(temp, [], context, xml);
1256            i = temp.length;
1257            while (i--) {
1258              if (elem = temp[i]) {
1259                matcherOut[postMap[i]] = !(matcherIn[postMap[i]] = elem);
1260              }
1261            }
1262          }
1263          if (seed) {
1264            if (postFinder || preFilter) {
1265              if (postFinder) {
1266                temp = [];
1267                i = matcherOut.length;
1268                while (i--) {
1269                  if (elem = matcherOut[i]) {
1270                    temp.push(matcherIn[i] = elem);
1271                  }
1272                }
1273                postFinder(null, matcherOut = [], temp, xml);
1274              }
1275              i = matcherOut.length;
1276              while (i--) {
1277                if ((elem = matcherOut[i]) && (temp = postFinder ? indexOf.call(seed, elem) : preMap[i]) > -1) {
1278                  seed[temp] = !(results[temp] = elem);
1279                }
1280              }
1281            }
1282          } else {
1283            matcherOut = condense(matcherOut === results ? matcherOut.splice(preexisting, matcherOut.length) : matcherOut);
1284            if (postFinder) {
1285              postFinder(null, results, matcherOut, xml);
1286            } else {
1287              push.apply(results, matcherOut);
1288            }
1289          }
1290        });
1291      }
1292      function matcherFromTokens(tokens) {
1293        var checkContext, matcher, j, len = tokens.length, leadingRelative = Expr.relative[tokens[0].type], implicitRelative = leadingRelative || Expr.relative[" "], i = leadingRelative ? 1 : 0, matchContext = addCombinator(function(elem) {
1294          return elem === checkContext;
1295        }, implicitRelative, true), matchAnyContext = addCombinator(function(elem) {
1296          return indexOf.call(checkContext, elem) > -1;
1297        }, implicitRelative, true), matchers = [function(elem, context, xml) {
1298          var ret2 = !leadingRelative && (xml || context != outermostContext) || ((checkContext = context).nodeType ? matchContext(elem, context, xml) : matchAnyContext(elem, context, xml));
1299          checkContext = null;
1300          return ret2;
1301        }];
1302        for (;i < len; i++) {
1303          if (matcher = Expr.relative[tokens[i].type]) {
1304            matchers = [addCombinator(elementMatcher(matchers), matcher)];
1305          } else {
1306            matcher = Expr.filter[tokens[i].type].apply(null, tokens[i].matches);
1307            if (matcher[expando]) {
1308              j = ++i;
1309              for (;j < len; j++) {
1310                if (Expr.relative[tokens[j].type]) {
1311                  break;
1312                }
1313              }
1314              return setMatcher(i > 1 && elementMatcher(matchers), i > 1 && toSelector(tokens.slice(0, i - 1).concat({ value: tokens[i - 2].type === " " ? "*" : "" })).replace(rtrimCSS, "$1"), matcher, i < j && matcherFromTokens(tokens.slice(i, j)), j < len && matcherFromTokens(tokens = tokens.slice(j)), j < len && toSelector(tokens));
1315            }
1316            matchers.push(matcher);
1317          }
1318        }
1319        return elementMatcher(matchers);
1320      }
1321      function matcherFromGroupMatchers(elementMatchers, setMatchers) {
1322        var bySet = setMatchers.length > 0, byElement = elementMatchers.length > 0, superMatcher = function(seed, context, xml, results, outermost) {
1323          var elem, j, matcher, matchedCount = 0, i = "0", unmatched = seed && [], setMatched = [], contextBackup = outermostContext, elems = seed || byElement && Expr.find.TAG("*", outermost), dirrunsUnique = dirruns += contextBackup == null ? 1 : Math.random() || 0.1, len = elems.length;
1324          if (outermost) {
1325            outermostContext = context == document2 || context || outermost;
1326          }
1327          for (;i !== len && (elem = elems[i]) != null; i++) {
1328            if (byElement && elem) {
1329              j = 0;
1330              if (!context && elem.ownerDocument != document2) {
1331                setDocument(elem);
1332                xml = !documentIsHTML;
1333              }
1334              while (matcher = elementMatchers[j++]) {
1335                if (matcher(elem, context || document2, xml)) {
1336                  push.call(results, elem);
1337                  break;
1338                }
1339              }
1340              if (outermost) {
1341                dirruns = dirrunsUnique;
1342              }
1343            }
1344            if (bySet) {
1345              if (elem = !matcher && elem) {
1346                matchedCount--;
1347              }
1348              if (seed) {
1349                unmatched.push(elem);
1350              }
1351            }
1352          }
1353          matchedCount += i;
1354          if (bySet && i !== matchedCount) {
1355            j = 0;
1356            while (matcher = setMatchers[j++]) {
1357              matcher(unmatched, setMatched, context, xml);
1358            }
1359            if (seed) {
1360              if (matchedCount > 0) {
1361                while (i--) {
1362                  if (!(unmatched[i] || setMatched[i])) {
1363                    setMatched[i] = pop.call(results);
1364                  }
1365                }
1366              }
1367              setMatched = condense(setMatched);
1368            }
1369            push.apply(results, setMatched);
1370            if (outermost && !seed && setMatched.length > 0 && matchedCount + setMatchers.length > 1) {
1371              jQuery2.uniqueSort(results);
1372            }
1373          }
1374          if (outermost) {
1375            dirruns = dirrunsUnique;
1376            outermostContext = contextBackup;
1377          }
1378          return unmatched;
1379        };
1380        return bySet ? markFunction(superMatcher) : superMatcher;
1381      }
1382      function compile(selector, match) {
1383        var i, setMatchers = [], elementMatchers = [], cached = compilerCache[selector + " "];
1384        if (!cached) {
1385          if (!match) {
1386            match = tokenize(selector);
1387          }
1388          i = match.length;
1389          while (i--) {
1390            cached = matcherFromTokens(match[i]);
1391            if (cached[expando]) {
1392              setMatchers.push(cached);
1393            } else {
1394              elementMatchers.push(cached);
1395            }
1396          }
1397          cached = compilerCache(selector, matcherFromGroupMatchers(elementMatchers, setMatchers));
1398          cached.selector = selector;
1399        }
1400        return cached;
1401      }
1402      function select2(selector, context, results, seed) {
1403        var i, tokens, token, type, find, compiled = typeof selector === "function" && selector, match = !seed && tokenize(selector = compiled.selector || selector);
1404        results = results || [];
1405        if (match.length === 1) {
1406          tokens = match[0] = match[0].slice(0);
1407          if (tokens.length > 2 && (token = tokens[0]).type === "ID" && context.nodeType === 9 && documentIsHTML && Expr.relative[tokens[1].type]) {
1408            context = (Expr.find.ID(token.matches[0].replace(runescape, funescape), context) || [])[0];
1409            if (!context) {
1410              return results;
1411            } else if (compiled) {
1412              context = context.parentNode;
1413            }
1414            selector = selector.slice(tokens.shift().value.length);
1415          }
1416          i = matchExpr.needsContext.test(selector) ? 0 : tokens.length;
1417          while (i--) {
1418            token = tokens[i];
1419            if (Expr.relative[type = token.type]) {
1420              break;
1421            }
1422            if (find = Expr.find[type]) {
1423              if (seed = find(token.matches[0].replace(runescape, funescape), rsibling.test(tokens[0].type) && testContext(context.parentNode) || context)) {
1424                tokens.splice(i, 1);
1425                selector = seed.length && toSelector(tokens);
1426                if (!selector) {
1427                  push.apply(results, seed);
1428                  return results;
1429                }
1430                break;
1431              }
1432            }
1433          }
1434        }
1435        (compiled || compile(selector, match))(seed, context, !documentIsHTML, results, !context || rsibling.test(selector) && testContext(context.parentNode) || context);
1436        return results;
1437      }
1438      support.sortStable = expando.split("").sort(sortOrder).join("") === expando;
1439      setDocument();
1440      support.sortDetached = assert(function(el) {
1441        return el.compareDocumentPosition(document2.createElement("fieldset")) & 1;
1442      });
1443      jQuery2.find = find;
1444      jQuery2.expr[":"] = jQuery2.expr.pseudos;
1445      jQuery2.unique = jQuery2.uniqueSort;
1446      find.compile = compile;
1447      find.select = select2;
1448      find.setDocument = setDocument;
1449      find.tokenize = tokenize;
1450      find.escape = jQuery2.escapeSelector;
1451      find.getText = jQuery2.text;
1452      find.isXML = jQuery2.isXMLDoc;
1453      find.selectors = jQuery2.expr;
1454      find.support = jQuery2.support;
1455      find.uniqueSort = jQuery2.uniqueSort;
1456    })();
1457    var dir = function(elem, dir, until) {
1458      var matched = [], truncate = until !== undefined;
1459      while ((elem = elem[dir]) && elem.nodeType !== 9) {
1460        if (elem.nodeType === 1) {
1461          if (truncate && jQuery2(elem).is(until)) {
1462            break;
1463          }
1464          matched.push(elem);
1465        }
1466      }
1467      return matched;
1468    };
1469    var siblings = function(n, elem) {
1470      var matched = [];
1471      for (;n; n = n.nextSibling) {
1472        if (n.nodeType === 1 && n !== elem) {
1473          matched.push(n);
1474        }
1475      }
1476      return matched;
1477    };
1478    var rneedsContext = jQuery2.expr.match.needsContext;
1479    var rsingleTag = /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;
1480    function winnow(elements, qualifier, not) {
1481      if (isFunction(qualifier)) {
1482        return jQuery2.grep(elements, function(elem, i) {
1483          return !!qualifier.call(elem, i, elem) !== not;
1484        });
1485      }
1486      if (qualifier.nodeType) {
1487        return jQuery2.grep(elements, function(elem) {
1488          return elem === qualifier !== not;
1489        });
1490      }
1491      if (typeof qualifier !== "string") {
1492        return jQuery2.grep(elements, function(elem) {
1493          return indexOf.call(qualifier, elem) > -1 !== not;
1494        });
1495      }
1496      return jQuery2.filter(qualifier, elements, not);
1497    }
1498    jQuery2.filter = function(expr, elems, not) {
1499      var elem = elems[0];
1500      if (not) {
1501        expr = ":not(" + expr + ")";
1502      }
1503      if (elems.length === 1 && elem.nodeType === 1) {
1504        return jQuery2.find.matchesSelector(elem, expr) ? [elem] : [];
1505      }
1506      return jQuery2.find.matches(expr, jQuery2.grep(elems, function(elem) {
1507        return elem.nodeType === 1;
1508      }));
1509    };
1510    jQuery2.fn.extend({
1511      find: function(selector) {
1512        var i, ret2, len = this.length, self2 = this;
1513        if (typeof selector !== "string") {
1514          return this.pushStack(jQuery2(selector).filter(function() {
1515            for (i = 0;i < len; i++) {
1516              if (jQuery2.contains(self2[i], this)) {
1517                return true;
1518              }
1519            }
1520          }));
1521        }
1522        ret2 = this.pushStack([]);
1523        for (i = 0;i < len; i++) {
1524          jQuery2.find(selector, self2[i], ret2);
1525        }
1526        return len > 1 ? jQuery2.uniqueSort(ret2) : ret2;
1527      },
1528      filter: function(selector) {
1529        return this.pushStack(winnow(this, selector || [], false));
1530      },
1531      not: function(selector) {
1532        return this.pushStack(winnow(this, selector || [], true));
1533      },
1534      is: function(selector) {
1535        return !!winnow(this, typeof selector === "string" && rneedsContext.test(selector) ? jQuery2(selector) : selector || [], false).length;
1536      }
1537    });
1538    var rootjQuery, rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, init = jQuery2.fn.init = function(selector, context, root2) {
1539      var match, elem;
1540      if (!selector) {
1541        return this;
1542      }
1543      root2 = root2 || rootjQuery;
1544      if (typeof selector === "string") {
1545        if (selector[0] === "<" && selector[selector.length - 1] === ">" && selector.length >= 3) {
1546          match = [null, selector, null];
1547        } else {
1548          match = rquickExpr.exec(selector);
1549        }
1550        if (match && (match[1] || !context)) {
1551          if (match[1]) {
1552            context = context instanceof jQuery2 ? context[0] : context;
1553            jQuery2.merge(this, jQuery2.parseHTML(match[1], context && context.nodeType ? context.ownerDocument || context : document2, true));
1554            if (rsingleTag.test(match[1]) && jQuery2.isPlainObject(context)) {
1555              for (match in context) {
1556                if (isFunction(this[match])) {
1557                  this[match](context[match]);
1558                } else {
1559                  this.attr(match, context[match]);
1560                }
1561              }
1562            }
1563            return this;
1564          } else {
1565            elem = document2.getElementById(match[2]);
1566            if (elem) {
1567              this[0] = elem;
1568              this.length = 1;
1569            }
1570            return this;
1571          }
1572        } else if (!context || context.jquery) {
1573          return (context || root2).find(selector);
1574        } else {
1575          return this.constructor(context).find(selector);
1576        }
1577      } else if (selector.nodeType) {
1578        this[0] = selector;
1579        this.length = 1;
1580        return this;
1581      } else if (isFunction(selector)) {
1582        return root2.ready !== undefined ? root2.ready(selector) : selector(jQuery2);
1583      }
1584      return jQuery2.makeArray(selector, this);
1585    };
1586    init.prototype = jQuery2.fn;
1587    rootjQuery = jQuery2(document2);
1588    var rparentsprev = /^(?:parents|prev(?:Until|All))/, guaranteedUnique = {
1589      children: true,
1590      contents: true,
1591      next: true,
1592      prev: true
1593    };
1594    jQuery2.fn.extend({
1595      has: function(target) {
1596        var targets = jQuery2(target, this), l = targets.length;
1597        return this.filter(function() {
1598          var i = 0;
1599          for (;i < l; i++) {
1600            if (jQuery2.contains(this, targets[i])) {
1601              return true;
1602            }
1603          }
1604        });
1605      },
1606      closest: function(selectors, context) {
1607        var cur, i = 0, l = this.length, matched = [], targets = typeof selectors !== "string" && jQuery2(selectors);
1608        if (!rneedsContext.test(selectors)) {
1609          for (;i < l; i++) {
1610            for (cur = this[i];cur && cur !== context; cur = cur.parentNode) {
1611              if (cur.nodeType < 11 && (targets ? targets.index(cur) > -1 : cur.nodeType === 1 && jQuery2.find.matchesSelector(cur, selectors))) {
1612                matched.push(cur);
1613                break;
1614              }
1615            }
1616          }
1617        }
1618        return this.pushStack(matched.length > 1 ? jQuery2.uniqueSort(matched) : matched);
1619      },
1620      index: function(elem) {
1621        if (!elem) {
1622          return this[0] && this[0].parentNode ? this.first().prevAll().length : -1;
1623        }
1624        if (typeof elem === "string") {
1625          return indexOf.call(jQuery2(elem), this[0]);
1626        }
1627        return indexOf.call(this, elem.jquery ? elem[0] : elem);
1628      },
1629      add: function(selector, context) {
1630        return this.pushStack(jQuery2.uniqueSort(jQuery2.merge(this.get(), jQuery2(selector, context))));
1631      },
1632      addBack: function(selector) {
1633        return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector));
1634      }
1635    });
1636    function sibling(cur, dir) {
1637      while ((cur = cur[dir]) && cur.nodeType !== 1) {}
1638      return cur;
1639    }
1640    jQuery2.each({
1641      parent: function(elem) {
1642        var parent = elem.parentNode;
1643        return parent && parent.nodeType !== 11 ? parent : null;
1644      },
1645      parents: function(elem) {
1646        return dir(elem, "parentNode");
1647      },
1648      parentsUntil: function(elem, _i, until) {
1649        return dir(elem, "parentNode", until);
1650      },
1651      next: function(elem) {
1652        return sibling(elem, "nextSibling");
1653      },
1654      prev: function(elem) {
1655        return sibling(elem, "previousSibling");
1656      },
1657      nextAll: function(elem) {
1658        return dir(elem, "nextSibling");
1659      },
1660      prevAll: function(elem) {
1661        return dir(elem, "previousSibling");
1662      },
1663      nextUntil: function(elem, _i, until) {
1664        return dir(elem, "nextSibling", until);
1665      },
1666      prevUntil: function(elem, _i, until) {
1667        return dir(elem, "previousSibling", until);
1668      },
1669      siblings: function(elem) {
1670        return siblings((elem.parentNode || {}).firstChild, elem);
1671      },
1672      children: function(elem) {
1673        return siblings(elem.firstChild);
1674      },
1675      contents: function(elem) {
1676        if (elem.contentDocument != null && getProto(elem.contentDocument)) {
1677          return elem.contentDocument;
1678        }
1679        if (nodeName(elem, "template")) {
1680          elem = elem.content || elem;
1681        }
1682        return jQuery2.merge([], elem.childNodes);
1683      }
1684    }, function(name, fn2) {
1685      jQuery2.fn[name] = function(until, selector) {
1686        var matched = jQuery2.map(this, fn2, until);
1687        if (name.slice(-5) !== "Until") {
1688          selector = until;
1689        }
1690        if (selector && typeof selector === "string") {
1691          matched = jQuery2.filter(selector, matched);
1692        }
1693        if (this.length > 1) {
1694          if (!guaranteedUnique[name]) {
1695            jQuery2.uniqueSort(matched);
1696          }
1697          if (rparentsprev.test(name)) {
1698            matched.reverse();
1699          }
1700        }
1701        return this.pushStack(matched);
1702      };
1703    });
1704    var rnothtmlwhite = /[^\x20\t\r\n\f]+/g;
1705    function createOptions(options2) {
1706      var object = {};
1707      jQuery2.each(options2.match(rnothtmlwhite) || [], function(_, flag) {
1708        object[flag] = true;
1709      });
1710      return object;
1711    }
1712    jQuery2.Callbacks = function(options2) {
1713      options2 = typeof options2 === "string" ? createOptions(options2) : jQuery2.extend({}, options2);
1714      var firing, memory, fired, locked, list = [], queue = [], firingIndex = -1, fire = function() {
1715        locked = locked || options2.once;
1716        fired = firing = true;
1717        for (;queue.length; firingIndex = -1) {
1718          memory = queue.shift();
1719          while (++firingIndex < list.length) {
1720            if (list[firingIndex].apply(memory[0], memory[1]) === false && options2.stopOnFalse) {
1721              firingIndex = list.length;
1722              memory = false;
1723            }
1724          }
1725        }
1726        if (!options2.memory) {
1727          memory = false;
1728        }
1729        firing = false;
1730        if (locked) {
1731          if (memory) {
1732            list = [];
1733          } else {
1734            list = "";
1735          }
1736        }
1737      }, self2 = {
1738        add: function() {
1739          if (list) {
1740            if (memory && !firing) {
1741              firingIndex = list.length - 1;
1742              queue.push(memory);
1743            }
1744            (function add(args2) {
1745              jQuery2.each(args2, function(_, arg) {
1746                if (isFunction(arg)) {
1747                  if (!options2.unique || !self2.has(arg)) {
1748                    list.push(arg);
1749                  }
1750                } else if (arg && arg.length && toType(arg) !== "string") {
1751                  add(arg);
1752                }
1753              });
1754            })(arguments);
1755            if (memory && !firing) {
1756              fire();
1757            }
1758          }
1759          return this;
1760        },
1761        remove: function() {
1762          jQuery2.each(arguments, function(_, arg) {
1763            var index;
1764            while ((index = jQuery2.inArray(arg, list, index)) > -1) {
1765              list.splice(index, 1);
1766              if (index <= firingIndex) {
1767                firingIndex--;
1768              }
1769            }
1770          });
1771          return this;
1772        },
1773        has: function(fn2) {
1774          return fn2 ? jQuery2.inArray(fn2, list) > -1 : list.length > 0;
1775        },
1776        empty: function() {
1777          if (list) {
1778            list = [];
1779          }
1780          return this;
1781        },
1782        disable: function() {
1783          locked = queue = [];
1784          list = memory = "";
1785          return this;
1786        },
1787        disabled: function() {
1788          return !list;
1789        },
1790        lock: function() {
1791          locked = queue = [];
1792          if (!memory && !firing) {
1793            list = memory = "";
1794          }
1795          return this;
1796        },
1797        locked: function() {
1798          return !!locked;
1799        },
1800        fireWith: function(context, args2) {
1801          if (!locked) {
1802            args2 = args2 || [];
1803            args2 = [context, args2.slice ? args2.slice() : args2];
1804            queue.push(args2);
1805            if (!firing) {
1806              fire();
1807            }
1808          }
1809          return this;
1810        },
1811        fire: function() {
1812          self2.fireWith(this, arguments);
1813          return this;
1814        },
1815        fired: function() {
1816          return !!fired;
1817        }
1818      };
1819      return self2;
1820    };
1821    function Identity(v) {
1822      return v;
1823    }
1824    function Thrower(ex) {
1825      throw ex;
1826    }
1827    function adoptValue(value, resolve, reject, noValue) {
1828      var method;
1829      try {
1830        if (value && isFunction(method = value.promise)) {
1831          method.call(value).done(resolve).fail(reject);
1832        } else if (value && isFunction(method = value.then)) {
1833          method.call(value, resolve, reject);
1834        } else {
1835          resolve.apply(undefined, [value].slice(noValue));
1836        }
1837      } catch (value) {
1838        reject.apply(undefined, [value]);
1839      }
1840    }
1841    jQuery2.extend({
1842      Deferred: function(func) {
1843        var tuples = [
1844          [
1845            "notify",
1846            "progress",
1847            jQuery2.Callbacks("memory"),
1848            jQuery2.Callbacks("memory"),
1849            2
1850          ],
1851          [
1852            "resolve",
1853            "done",
1854            jQuery2.Callbacks("once memory"),
1855            jQuery2.Callbacks("once memory"),
1856            0,
1857            "resolved"
1858          ],
1859          [
1860            "reject",
1861            "fail",
1862            jQuery2.Callbacks("once memory"),
1863            jQuery2.Callbacks("once memory"),
1864            1,
1865            "rejected"
1866          ]
1867        ], state = "pending", promise = {
1868          state: function() {
1869            return state;
1870          },
1871          always: function() {
1872            deferred2.done(arguments).fail(arguments);
1873            return this;
1874          },
1875          catch: function(fn2) {
1876            return promise.then(null, fn2);
1877          },
1878          pipe: function() {
1879            var fns = arguments;
1880            return jQuery2.Deferred(function(newDefer) {
1881              jQuery2.each(tuples, function(_i, tuple) {
1882                var fn2 = isFunction(fns[tuple[4]]) && fns[tuple[4]];
1883                deferred2[tuple[1]](function() {
1884                  var returned = fn2 && fn2.apply(this, arguments);
1885                  if (returned && isFunction(returned.promise)) {
1886                    returned.promise().progress(newDefer.notify).done(newDefer.resolve).fail(newDefer.reject);
1887                  } else {
1888                    newDefer[tuple[0] + "With"](this, fn2 ? [returned] : arguments);
1889                  }
1890                });
1891              });
1892              fns = null;
1893            }).promise();
1894          },
1895          then: function(onFulfilled, onRejected, onProgress) {
1896            var maxDepth = 0;
1897            function resolve(depth, deferred2, handler, special) {
1898              return function() {
1899                var that = this, args2 = arguments, mightThrow = function() {
1900                  var returned, then;
1901                  if (depth < maxDepth) {
1902                    return;
1903                  }
1904                  returned = handler.apply(that, args2);
1905                  if (returned === deferred2.promise()) {
1906                    throw new TypeError("Thenable self-resolution");
1907                  }
1908                  then = returned && (typeof returned === "object" || typeof returned === "function") && returned.then;
1909                  if (isFunction(then)) {
1910                    if (special) {
1911                      then.call(returned, resolve(maxDepth, deferred2, Identity, special), resolve(maxDepth, deferred2, Thrower, special));
1912                    } else {
1913                      maxDepth++;
1914                      then.call(returned, resolve(maxDepth, deferred2, Identity, special), resolve(maxDepth, deferred2, Thrower, special), resolve(maxDepth, deferred2, Identity, deferred2.notifyWith));
1915                    }
1916                  } else {
1917                    if (handler !== Identity) {
1918                      that = undefined;
1919                      args2 = [returned];
1920                    }
1921                    (special || deferred2.resolveWith)(that, args2);
1922                  }
1923                }, process = special ? mightThrow : function() {
1924                  try {
1925                    mightThrow();
1926                  } catch (e) {
1927                    if (jQuery2.Deferred.exceptionHook) {
1928                      jQuery2.Deferred.exceptionHook(e, process.error);
1929                    }
1930                    if (depth + 1 >= maxDepth) {
1931                      if (handler !== Thrower) {
1932                        that = undefined;
1933                        args2 = [e];
1934                      }
1935                      deferred2.rejectWith(that, args2);
1936                    }
1937                  }
1938                };
1939                if (depth) {
1940                  process();
1941                } else {
1942                  if (jQuery2.Deferred.getErrorHook) {
1943                    process.error = jQuery2.Deferred.getErrorHook();
1944                  } else if (jQuery2.Deferred.getStackHook) {
1945                    process.error = jQuery2.Deferred.getStackHook();
1946                  }
1947                  window2.setTimeout(process);
1948                }
1949              };
1950            }
1951            return jQuery2.Deferred(function(newDefer) {
1952              tuples[0][3].add(resolve(0, newDefer, isFunction(onProgress) ? onProgress : Identity, newDefer.notifyWith));
1953              tuples[1][3].add(resolve(0, newDefer, isFunction(onFulfilled) ? onFulfilled : Identity));
1954              tuples[2][3].add(resolve(0, newDefer, isFunction(onRejected) ? onRejected : Thrower));
1955            }).promise();
1956          },
1957          promise: function(obj2) {
1958            return obj2 != null ? jQuery2.extend(obj2, promise) : promise;
1959          }
1960        }, deferred2 = {};
1961        jQuery2.each(tuples, function(i, tuple) {
1962          var list = tuple[2], stateString = tuple[5];
1963          promise[tuple[1]] = list.add;
1964          if (stateString) {
1965            list.add(function() {
1966              state = stateString;
1967            }, tuples[3 - i][2].disable, tuples[3 - i][3].disable, tuples[0][2].lock, tuples[0][3].lock);
1968          }
1969          list.add(tuple[3].fire);
1970          deferred2[tuple[0]] = function() {
1971            deferred2[tuple[0] + "With"](this === deferred2 ? undefined : this, arguments);
1972            return this;
1973          };
1974          deferred2[tuple[0] + "With"] = list.fireWith;
1975        });
1976        promise.promise(deferred2);
1977        if (func) {
1978          func.call(deferred2, deferred2);
1979        }
1980        return deferred2;
1981      },
1982      when: function(singleValue) {
1983        var remaining = arguments.length, i = remaining, resolveContexts = Array(i), resolveValues = slice.call(arguments), primary = jQuery2.Deferred(), updateFunc = function(i) {
1984          return function(value) {
1985            resolveContexts[i] = this;
1986            resolveValues[i] = arguments.length > 1 ? slice.call(arguments) : value;
1987            if (!--remaining) {
1988              primary.resolveWith(resolveContexts, resolveValues);
1989            }
1990          };
1991        };
1992        if (remaining <= 1) {
1993          adoptValue(singleValue, primary.done(updateFunc(i)).resolve, primary.reject, !remaining);
1994          if (primary.state() === "pending" || isFunction(resolveValues[i] && resolveValues[i].then)) {
1995            return primary.then();
1996          }
1997        }
1998        while (i--) {
1999          adoptValue(resolveValues[i], updateFunc(i), primary.reject);
2000        }
2001        return primary.promise();
2002      }
2003    });
2004    var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
2005    jQuery2.Deferred.exceptionHook = function(error, asyncError) {
2006      if (window2.console && window2.console.warn && error && rerrorNames.test(error.name)) {
2007        window2.console.warn("jQuery.Deferred exception: " + error.message, error.stack, asyncError);
2008      }
2009    };
2010    jQuery2.readyException = function(error) {
2011      window2.setTimeout(function() {
2012        throw error;
2013      });
2014    };
2015    var readyList = jQuery2.Deferred();
2016    jQuery2.fn.ready = function(fn2) {
2017      readyList.then(fn2).catch(function(error) {
2018        jQuery2.readyException(error);
2019      });
2020      return this;
2021    };
2022    jQuery2.extend({
2023      isReady: false,
2024      readyWait: 1,
2025      ready: function(wait) {
2026        if (wait === true ? --jQuery2.readyWait : jQuery2.isReady) {
2027          return;
2028        }
2029        jQuery2.isReady = true;
2030        if (wait !== true && --jQuery2.readyWait > 0) {
2031          return;
2032        }
2033        readyList.resolveWith(document2, [jQuery2]);
2034      }
2035    });
2036    jQuery2.ready.then = readyList.then;
2037    function completed() {
2038      document2.removeEventListener("DOMContentLoaded", completed);
2039      window2.removeEventListener("load", completed);
2040      jQuery2.ready();
2041    }
2042    if (document2.readyState === "complete" || document2.readyState !== "loading" && !document2.documentElement.doScroll) {
2043      window2.setTimeout(jQuery2.ready);
2044    } else {
2045      document2.addEventListener("DOMContentLoaded", completed);
2046      window2.addEventListener("load", completed);
2047    }
2048    var access = function(elems, fn2, key, value, chainable, emptyGet, raw) {
2049      var i = 0, len = elems.length, bulk = key == null;
2050      if (toType(key) === "object") {
2051        chainable = true;
2052        for (i in key) {
2053          access(elems, fn2, i, key[i], true, emptyGet, raw);
2054        }
2055      } else if (value !== undefined) {
2056        chainable = true;
2057        if (!isFunction(value)) {
2058          raw = true;
2059        }
2060        if (bulk) {
2061          if (raw) {
2062            fn2.call(elems, value);
2063            fn2 = null;
2064          } else {
2065            bulk = fn2;
2066            fn2 = function(elem, _key, value) {
2067              return bulk.call(jQuery2(elem), value);
2068            };
2069          }
2070        }
2071        if (fn2) {
2072          for (;i < len; i++) {
2073            fn2(elems[i], key, raw ? value : value.call(elems[i], i, fn2(elems[i], key)));
2074          }
2075        }
2076      }
2077      if (chainable) {
2078        return elems;
2079      }
2080      if (bulk) {
2081        return fn2.call(elems);
2082      }
2083      return len ? fn2(elems[0], key) : emptyGet;
2084    };
2085    var rmsPrefix = /^-ms-/, rdashAlpha = /-([a-z])/g;
2086    function fcamelCase(_all, letter) {
2087      return letter.toUpperCase();
2088    }
2089    function camelCase(string2) {
2090      return string2.replace(rmsPrefix, "ms-").replace(rdashAlpha, fcamelCase);
2091    }
2092    var acceptData = function(owner) {
2093      return owner.nodeType === 1 || owner.nodeType === 9 || !+owner.nodeType;
2094    };
2095    function Data() {
2096      this.expando = jQuery2.expando + Data.uid++;
2097    }
2098    Data.uid = 1;
2099    Data.prototype = {
2100      cache: function(owner) {
2101        var value = owner[this.expando];
2102        if (!value) {
2103          value = {};
2104          if (acceptData(owner)) {
2105            if (owner.nodeType) {
2106              owner[this.expando] = value;
2107            } else {
2108              Object.defineProperty(owner, this.expando, {
2109                value,
2110                configurable: true
2111              });
2112            }
2113          }
2114        }
2115        return value;
2116      },
2117      set: function(owner, data, value) {
2118        var prop, cache = this.cache(owner);
2119        if (typeof data === "string") {
2120          cache[camelCase(data)] = value;
2121        } else {
2122          for (prop in data) {
2123            cache[camelCase(prop)] = data[prop];
2124          }
2125        }
2126        return cache;
2127      },
2128      get: function(owner, key) {
2129        return key === undefined ? this.cache(owner) : owner[this.expando] && owner[this.expando][camelCase(key)];
2130      },
2131      access: function(owner, key, value) {
2132        if (key === undefined || key && typeof key === "string" && value === undefined) {
2133          return this.get(owner, key);
2134        }
2135        this.set(owner, key, value);
2136        return value !== undefined ? value : key;
2137      },
2138      remove: function(owner, key) {
2139        var i, cache = owner[this.expando];
2140        if (cache === undefined) {
2141          return;
2142        }
2143        if (key !== undefined) {
2144          if (Array.isArray(key)) {
2145            key = key.map(camelCase);
2146          } else {
2147            key = camelCase(key);
2148            key = key in cache ? [key] : key.match(rnothtmlwhite) || [];
2149          }
2150          i = key.length;
2151          while (i--) {
2152            delete cache[key[i]];
2153          }
2154        }
2155        if (key === undefined || jQuery2.isEmptyObject(cache)) {
2156          if (owner.nodeType) {
2157            owner[this.expando] = undefined;
2158          } else {
2159            delete owner[this.expando];
2160          }
2161        }
2162      },
2163      hasData: function(owner) {
2164        var cache = owner[this.expando];
2165        return cache !== undefined && !jQuery2.isEmptyObject(cache);
2166      }
2167    };
2168    var dataPriv = new Data;
2169    var dataUser = new Data;
2170    var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, rmultiDash = /[A-Z]/g;
2171    function getData(data) {
2172      if (data === "true") {
2173        return true;
2174      }
2175      if (data === "false") {
2176        return false;
2177      }
2178      if (data === "null") {
2179        return null;
2180      }
2181      if (data === +data + "") {
2182        return +data;
2183      }
2184      if (rbrace.test(data)) {
2185        return JSON.parse(data);
2186      }
2187      return data;
2188    }
2189    function dataAttr(elem, key, data) {
2190      var name;
2191      if (data === undefined && elem.nodeType === 1) {
2192        name = "data-" + key.replace(rmultiDash, "-$&").toLowerCase();
2193        data = elem.getAttribute(name);
2194        if (typeof data === "string") {
2195          try {
2196            data = getData(data);
2197          } catch (e) {}
2198          dataUser.set(elem, key, data);
2199        } else {
2200          data = undefined;
2201        }
2202      }
2203      return data;
2204    }
2205    jQuery2.extend({
2206      hasData: function(elem) {
2207        return dataUser.hasData(elem) || dataPriv.hasData(elem);
2208      },
2209      data: function(elem, name, data) {
2210        return dataUser.access(elem, name, data);
2211      },
2212      removeData: function(elem, name) {
2213        dataUser.remove(elem, name);
2214      },
2215      _data: function(elem, name, data) {
2216        return dataPriv.access(elem, name, data);
2217      },
2218      _removeData: function(elem, name) {
2219        dataPriv.remove(elem, name);
2220      }
2221    });
2222    jQuery2.fn.extend({
2223      data: function(key, value) {
2224        var i, name, data, elem = this[0], attrs = elem && elem.attributes;
2225        if (key === undefined) {
2226          if (this.length) {
2227            data = dataUser.get(elem);
2228            if (elem.nodeType === 1 && !dataPriv.get(elem, "hasDataAttrs")) {
2229              i = attrs.length;
2230              while (i--) {
2231                if (attrs[i]) {
2232                  name = attrs[i].name;
2233                  if (name.indexOf("data-") === 0) {
2234                    name = camelCase(name.slice(5));
2235                    dataAttr(elem, name, data[name]);
2236                  }
2237                }
2238              }
2239              dataPriv.set(elem, "hasDataAttrs", true);
2240            }
2241          }
2242          return data;
2243        }
2244        if (typeof key === "object") {
2245          return this.each(function() {
2246            dataUser.set(this, key);
2247          });
2248        }
2249        return access(this, function(value) {
2250          var data;
2251          if (elem && value === undefined) {
2252            data = dataUser.get(elem, key);
2253            if (data !== undefined) {
2254              return data;
2255            }
2256            data = dataAttr(elem, key);
2257            if (data !== undefined) {
2258              return data;
2259            }
2260            return;
2261          }
2262          this.each(function() {
2263            dataUser.set(this, key, value);
2264          });
2265        }, null, value, arguments.length > 1, null, true);
2266      },
2267      removeData: function(key) {
2268        return this.each(function() {
2269          dataUser.remove(this, key);
2270        });
2271      }
2272    });
2273    jQuery2.extend({
2274      queue: function(elem, type, data) {
2275        var queue;
2276        if (elem) {
2277          type = (type || "fx") + "queue";
2278          queue = dataPriv.get(elem, type);
2279          if (data) {
2280            if (!queue || Array.isArray(data)) {
2281              queue = dataPriv.access(elem, type, jQuery2.makeArray(data));
2282            } else {
2283              queue.push(data);
2284            }
2285          }
2286          return queue || [];
2287        }
2288      },
2289      dequeue: function(elem, type) {
2290        type = type || "fx";
2291        var queue = jQuery2.queue(elem, type), startLength = queue.length, fn2 = queue.shift(), hooks = jQuery2._queueHooks(elem, type), next = function() {
2292          jQuery2.dequeue(elem, type);
2293        };
2294        if (fn2 === "inprogress") {
2295          fn2 = queue.shift();
2296          startLength--;
2297        }
2298        if (fn2) {
2299          if (type === "fx") {
2300            queue.unshift("inprogress");
2301          }
2302          delete hooks.stop;
2303          fn2.call(elem, next, hooks);
2304        }
2305        if (!startLength && hooks) {
2306          hooks.empty.fire();
2307        }
2308      },
2309      _queueHooks: function(elem, type) {
2310        var key = type + "queueHooks";
2311        return dataPriv.get(elem, key) || dataPriv.access(elem, key, {
2312          empty: jQuery2.Callbacks("once memory").add(function() {
2313            dataPriv.remove(elem, [type + "queue", key]);
2314          })
2315        });
2316      }
2317    });
2318    jQuery2.fn.extend({
2319      queue: function(type, data) {
2320        var setter = 2;
2321        if (typeof type !== "string") {
2322          data = type;
2323          type = "fx";
2324          setter--;
2325        }
2326        if (arguments.length < setter) {
2327          return jQuery2.queue(this[0], type);
2328        }
2329        return data === undefined ? this : this.each(function() {
2330          var queue = jQuery2.queue(this, type, data);
2331          jQuery2._queueHooks(this, type);
2332          if (type === "fx" && queue[0] !== "inprogress") {
2333            jQuery2.dequeue(this, type);
2334          }
2335        });
2336      },
2337      dequeue: function(type) {
2338        return this.each(function() {
2339          jQuery2.dequeue(this, type);
2340        });
2341      },
2342      clearQueue: function(type) {
2343        return this.queue(type || "fx", []);
2344      },
2345      promise: function(type, obj2) {
2346        var tmp, count = 1, defer = jQuery2.Deferred(), elements = this, i = this.length, resolve = function() {
2347          if (!--count) {
2348            defer.resolveWith(elements, [elements]);
2349          }
2350        };
2351        if (typeof type !== "string") {
2352          obj2 = type;
2353          type = undefined;
2354        }
2355        type = type || "fx";
2356        while (i--) {
2357          tmp = dataPriv.get(elements[i], type + "queueHooks");
2358          if (tmp && tmp.empty) {
2359            count++;
2360            tmp.empty.add(resolve);
2361          }
2362        }
2363        resolve();
2364        return defer.promise(obj2);
2365      }
2366    });
2367    var pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source;
2368    var rcssNum = new RegExp("^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i");
2369    var cssExpand = ["Top", "Right", "Bottom", "Left"];
2370    var documentElement = document2.documentElement;
2371    var isAttached = function(elem) {
2372      return jQuery2.contains(elem.ownerDocument, elem);
2373    }, composed = { composed: true };
2374    if (documentElement.getRootNode) {
2375      isAttached = function(elem) {
2376        return jQuery2.contains(elem.ownerDocument, elem) || elem.getRootNode(composed) === elem.ownerDocument;
2377      };
2378    }
2379    var isHiddenWithinTree = function(elem, el) {
2380      elem = el || elem;
2381      return elem.style.display === "none" || elem.style.display === "" && isAttached(elem) && jQuery2.css(elem, "display") === "none";
2382    };
2383    function adjustCSS(elem, prop, valueParts, tween) {
2384      var adjusted, scale, maxIterations = 20, currentValue = tween ? function() {
2385        return tween.cur();
2386      } : function() {
2387        return jQuery2.css(elem, prop, "");
2388      }, initial = currentValue(), unit = valueParts && valueParts[3] || (jQuery2.cssNumber[prop] ? "" : "px"), initialInUnit = elem.nodeType && (jQuery2.cssNumber[prop] || unit !== "px" && +initial) && rcssNum.exec(jQuery2.css(elem, prop));
2389      if (initialInUnit && initialInUnit[3] !== unit) {
2390        initial = initial / 2;
2391        unit = unit || initialInUnit[3];
2392        initialInUnit = +initial || 1;
2393        while (maxIterations--) {
2394          jQuery2.style(elem, prop, initialInUnit + unit);
2395          if ((1 - scale) * (1 - (scale = currentValue() / initial || 0.5)) <= 0) {
2396            maxIterations = 0;
2397          }
2398          initialInUnit = initialInUnit / scale;
2399        }
2400        initialInUnit = initialInUnit * 2;
2401        jQuery2.style(elem, prop, initialInUnit + unit);
2402        valueParts = valueParts || [];
2403      }
2404      if (valueParts) {
2405        initialInUnit = +initialInUnit || +initial || 0;
2406        adjusted = valueParts[1] ? initialInUnit + (valueParts[1] + 1) * valueParts[2] : +valueParts[2];
2407        if (tween) {
2408          tween.unit = unit;
2409          tween.start = initialInUnit;
2410          tween.end = adjusted;
2411        }
2412      }
2413      return adjusted;
2414    }
2415    var defaultDisplayMap = {};
2416    function getDefaultDisplay(elem) {
2417      var temp, { ownerDocument: doc, nodeName } = elem, display = defaultDisplayMap[nodeName];
2418      if (display) {
2419        return display;
2420      }
2421      temp = doc.body.appendChild(doc.createElement(nodeName));
2422      display = jQuery2.css(temp, "display");
2423      temp.parentNode.removeChild(temp);
2424      if (display === "none") {
2425        display = "block";
2426      }
2427      defaultDisplayMap[nodeName] = display;
2428      return display;
2429    }
2430    function showHide(elements, show) {
2431      var display, elem, values = [], index = 0, length = elements.length;
2432      for (;index < length; index++) {
2433        elem = elements[index];
2434        if (!elem.style) {
2435          continue;
2436        }
2437        display = elem.style.display;
2438        if (show) {
2439          if (display === "none") {
2440            values[index] = dataPriv.get(elem, "display") || null;
2441            if (!values[index]) {
2442              elem.style.display = "";
2443            }
2444          }
2445          if (elem.style.display === "" && isHiddenWithinTree(elem)) {
2446            values[index] = getDefaultDisplay(elem);
2447          }
2448        } else {
2449          if (display !== "none") {
2450            values[index] = "none";
2451            dataPriv.set(elem, "display", display);
2452          }
2453        }
2454      }
2455      for (index = 0;index < length; index++) {
2456        if (values[index] != null) {
2457          elements[index].style.display = values[index];
2458        }
2459      }
2460      return elements;
2461    }
2462    jQuery2.fn.extend({
2463      show: function() {
2464        return showHide(this, true);
2465      },
2466      hide: function() {
2467        return showHide(this);
2468      },
2469      toggle: function(state) {
2470        if (typeof state === "boolean") {
2471          return state ? this.show() : this.hide();
2472        }
2473        return this.each(function() {
2474          if (isHiddenWithinTree(this)) {
2475            jQuery2(this).show();
2476          } else {
2477            jQuery2(this).hide();
2478          }
2479        });
2480      }
2481    });
2482    var rcheckableType = /^(?:checkbox|radio)$/i;
2483    var rtagName = /<([a-z][^\/\0>\x20\t\r\n\f]*)/i;
2484    var rscriptType = /^$|^module$|\/(?:java|ecma)script/i;
2485    (function() {
2486      var fragment = document2.createDocumentFragment(), div = fragment.appendChild(document2.createElement("div")), input = document2.createElement("input");
2487      input.setAttribute("type", "radio");
2488      input.setAttribute("checked", "checked");
2489      input.setAttribute("name", "t");
2490      div.appendChild(input);
2491      support.checkClone = div.cloneNode(true).cloneNode(true).lastChild.checked;
2492      div.innerHTML = "<textarea>x</textarea>";
2493      support.noCloneChecked = !!div.cloneNode(true).lastChild.defaultValue;
2494      div.innerHTML = "<option></option>";
2495      support.option = !!div.lastChild;
2496    })();
2497    var wrapMap = {
2498      thead: [1, "<table>", "</table>"],
2499      col: [2, "<table><colgroup>", "</colgroup></table>"],
2500      tr: [2, "<table><tbody>", "</tbody></table>"],
2501      td: [3, "<table><tbody><tr>", "</tr></tbody></table>"],
2502      _default: [0, "", ""]
2503    };
2504    wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
2505    wrapMap.th = wrapMap.td;
2506    if (!support.option) {
2507      wrapMap.optgroup = wrapMap.option = [1, "<select multiple='multiple'>", "</select>"];
2508    }
2509    function getAll(context, tag) {
2510      var ret2;
2511      if (typeof context.getElementsByTagName !== "undefined") {
2512        ret2 = context.getElementsByTagName(tag || "*");
2513      } else if (typeof context.querySelectorAll !== "undefined") {
2514        ret2 = context.querySelectorAll(tag || "*");
2515      } else {
2516        ret2 = [];
2517      }
2518      if (tag === undefined || tag && nodeName(context, tag)) {
2519        return jQuery2.merge([context], ret2);
2520      }
2521      return ret2;
2522    }
2523    function setGlobalEval(elems, refElements) {
2524      var i = 0, l = elems.length;
2525      for (;i < l; i++) {
2526        dataPriv.set(elems[i], "globalEval", !refElements || dataPriv.get(refElements[i], "globalEval"));
2527      }
2528    }
2529    var rhtml = /<|&#?\w+;/;
2530    function buildFragment(elems, context, scripts, selection, ignored) {
2531      var elem, tmp, tag, wrap, attached, j, fragment = context.createDocumentFragment(), nodes = [], i = 0, l = elems.length;
2532      for (;i < l; i++) {
2533        elem = elems[i];
2534        if (elem || elem === 0) {
2535          if (toType(elem) === "object") {
2536            jQuery2.merge(nodes, elem.nodeType ? [elem] : elem);
2537          } else if (!rhtml.test(elem)) {
2538            nodes.push(context.createTextNode(elem));
2539          } else {
2540            tmp = tmp || fragment.appendChild(context.createElement("div"));
2541            tag = (rtagName.exec(elem) || ["", ""])[1].toLowerCase();
2542            wrap = wrapMap[tag] || wrapMap._default;
2543            tmp.innerHTML = wrap[1] + jQuery2.htmlPrefilter(elem) + wrap[2];
2544            j = wrap[0];
2545            while (j--) {
2546              tmp = tmp.lastChild;
2547            }
2548            jQuery2.merge(nodes, tmp.childNodes);
2549            tmp = fragment.firstChild;
2550            tmp.textContent = "";
2551          }
2552        }
2553      }
2554      fragment.textContent = "";
2555      i = 0;
2556      while (elem = nodes[i++]) {
2557        if (selection && jQuery2.inArray(elem, selection) > -1) {
2558          if (ignored) {
2559            ignored.push(elem);
2560          }
2561          continue;
2562        }
2563        attached = isAttached(elem);
2564        tmp = getAll(fragment.appendChild(elem), "script");
2565        if (attached) {
2566          setGlobalEval(tmp);
2567        }
2568        if (scripts) {
2569          j = 0;
2570          while (elem = tmp[j++]) {
2571            if (rscriptType.test(elem.type || "")) {
2572              scripts.push(elem);
2573            }
2574          }
2575        }
2576      }
2577      return fragment;
2578    }
2579    var rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
2580    function returnTrue() {
2581      return true;
2582    }
2583    function returnFalse() {
2584      return false;
2585    }
2586    function on(elem, types, selector, data, fn2, one) {
2587      var origFn, type;
2588      if (typeof types === "object") {
2589        if (typeof selector !== "string") {
2590          data = data || selector;
2591          selector = undefined;
2592        }
2593        for (type in types) {
2594          on(elem, type, selector, data, types[type], one);
2595        }
2596        return elem;
2597      }
2598      if (data == null && fn2 == null) {
2599        fn2 = selector;
2600        data = selector = undefined;
2601      } else if (fn2 == null) {
2602        if (typeof selector === "string") {
2603          fn2 = data;
2604          data = undefined;
2605        } else {
2606          fn2 = data;
2607          data = selector;
2608          selector = undefined;
2609        }
2610      }
2611      if (fn2 === false) {
2612        fn2 = returnFalse;
2613      } else if (!fn2) {
2614        return elem;
2615      }
2616      if (one === 1) {
2617        origFn = fn2;
2618        fn2 = function(event) {
2619          jQuery2().off(event);
2620          return origFn.apply(this, arguments);
2621        };
2622        fn2.guid = origFn.guid || (origFn.guid = jQuery2.guid++);
2623      }
2624      return elem.each(function() {
2625        jQuery2.event.add(this, types, fn2, data, selector);
2626      });
2627    }
2628    jQuery2.event = {
2629      global: {},
2630      add: function(elem, types, handler, data, selector) {
2631        var handleObjIn, eventHandle, tmp, events, t, handleObj, special, handlers, type, namespaces, origType, elemData = dataPriv.get(elem);
2632        if (!acceptData(elem)) {
2633          return;
2634        }
2635        if (handler.handler) {
2636          handleObjIn = handler;
2637          handler = handleObjIn.handler;
2638          selector = handleObjIn.selector;
2639        }
2640        if (selector) {
2641          jQuery2.find.matchesSelector(documentElement, selector);
2642        }
2643        if (!handler.guid) {
2644          handler.guid = jQuery2.guid++;
2645        }
2646        if (!(events = elemData.events)) {
2647          events = elemData.events = Object.create(null);
2648        }
2649        if (!(eventHandle = elemData.handle)) {
2650          eventHandle = elemData.handle = function(e) {
2651            return typeof jQuery2 !== "undefined" && jQuery2.event.triggered !== e.type ? jQuery2.event.dispatch.apply(elem, arguments) : undefined;
2652          };
2653        }
2654        types = (types || "").match(rnothtmlwhite) || [""];
2655        t = types.length;
2656        while (t--) {
2657          tmp = rtypenamespace.exec(types[t]) || [];
2658          type = origType = tmp[1];
2659          namespaces = (tmp[2] || "").split(".").sort();
2660          if (!type) {
2661            continue;
2662          }
2663          special = jQuery2.event.special[type] || {};
2664          type = (selector ? special.delegateType : special.bindType) || type;
2665          special = jQuery2.event.special[type] || {};
2666          handleObj = jQuery2.extend({
2667            type,
2668            origType,
2669            data,
2670            handler,
2671            guid: handler.guid,
2672            selector,
2673            needsContext: selector && jQuery2.expr.match.needsContext.test(selector),
2674            namespace: namespaces.join(".")
2675          }, handleObjIn);
2676          if (!(handlers = events[type])) {
2677            handlers = events[type] = [];
2678            handlers.delegateCount = 0;
2679            if (!special.setup || special.setup.call(elem, data, namespaces, eventHandle) === false) {
2680              if (elem.addEventListener) {
2681                elem.addEventListener(type, eventHandle);
2682              }
2683            }
2684          }
2685          if (special.add) {
2686            special.add.call(elem, handleObj);
2687            if (!handleObj.handler.guid) {
2688              handleObj.handler.guid = handler.guid;
2689            }
2690          }
2691          if (selector) {
2692            handlers.splice(handlers.delegateCount++, 0, handleObj);
2693          } else {
2694            handlers.push(handleObj);
2695          }
2696          jQuery2.event.global[type] = true;
2697        }
2698      },
2699      remove: function(elem, types, handler, selector, mappedTypes) {
2700        var j, origCount, tmp, events, t, handleObj, special, handlers, type, namespaces, origType, elemData = dataPriv.hasData(elem) && dataPriv.get(elem);
2701        if (!elemData || !(events = elemData.events)) {
2702          return;
2703        }
2704        types = (types || "").match(rnothtmlwhite) || [""];
2705        t = types.length;
2706        while (t--) {
2707          tmp = rtypenamespace.exec(types[t]) || [];
2708          type = origType = tmp[1];
2709          namespaces = (tmp[2] || "").split(".").sort();
2710          if (!type) {
2711            for (type in events) {
2712              jQuery2.event.remove(elem, type + types[t], handler, selector, true);
2713            }
2714            continue;
2715          }
2716          special = jQuery2.event.special[type] || {};
2717          type = (selector ? special.delegateType : special.bindType) || type;
2718          handlers = events[type] || [];
2719          tmp = tmp[2] && new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)");
2720          origCount = j = handlers.length;
2721          while (j--) {
2722            handleObj = handlers[j];
2723            if ((mappedTypes || origType === handleObj.origType) && (!handler || handler.guid === handleObj.guid) && (!tmp || tmp.test(handleObj.namespace)) && (!selector || selector === handleObj.selector || selector === "**" && handleObj.selector)) {
2724              handlers.splice(j, 1);
2725              if (handleObj.selector) {
2726                handlers.delegateCount--;
2727              }
2728              if (special.remove) {
2729                special.remove.call(elem, handleObj);
2730              }
2731            }
2732          }
2733          if (origCount && !handlers.length) {
2734            if (!special.teardown || special.teardown.call(elem, namespaces, elemData.handle) === false) {
2735              jQuery2.removeEvent(elem, type, elemData.handle);
2736            }
2737            delete events[type];
2738          }
2739        }
2740        if (jQuery2.isEmptyObject(events)) {
2741          dataPriv.remove(elem, "handle events");
2742        }
2743      },
2744      dispatch: function(nativeEvent) {
2745        var i, j, ret2, matched, handleObj, handlerQueue, args2 = new Array(arguments.length), event = jQuery2.event.fix(nativeEvent), handlers = (dataPriv.get(this, "events") || Object.create(null))[event.type] || [], special = jQuery2.event.special[event.type] || {};
2746        args2[0] = event;
2747        for (i = 1;i < arguments.length; i++) {
2748          args2[i] = arguments[i];
2749        }
2750        event.delegateTarget = this;
2751        if (special.preDispatch && special.preDispatch.call(this, event) === false) {
2752          return;
2753        }
2754        handlerQueue = jQuery2.event.handlers.call(this, event, handlers);
2755        i = 0;
2756        while ((matched = handlerQueue[i++]) && !event.isPropagationStopped()) {
2757          event.currentTarget = matched.elem;
2758          j = 0;
2759          while ((handleObj = matched.handlers[j++]) && !event.isImmediatePropagationStopped()) {
2760            if (!event.rnamespace || handleObj.namespace === false || event.rnamespace.test(handleObj.namespace)) {
2761              event.handleObj = handleObj;
2762              event.data = handleObj.data;
2763              ret2 = ((jQuery2.event.special[handleObj.origType] || {}).handle || handleObj.handler).apply(matched.elem, args2);
2764              if (ret2 !== undefined) {
2765                if ((event.result = ret2) === false) {
2766                  event.preventDefault();
2767                  event.stopPropagation();
2768                }
2769              }
2770            }
2771          }
2772        }
2773        if (special.postDispatch) {
2774          special.postDispatch.call(this, event);
2775        }
2776        return event.result;
2777      },
2778      handlers: function(event, handlers) {
2779        var i, handleObj, sel, matchedHandlers, matchedSelectors, handlerQueue = [], delegateCount = handlers.delegateCount, cur = event.target;
2780        if (delegateCount && cur.nodeType && !(event.type === "click" && event.button >= 1)) {
2781          for (;cur !== this; cur = cur.parentNode || this) {
2782            if (cur.nodeType === 1 && !(event.type === "click" && cur.disabled === true)) {
2783              matchedHandlers = [];
2784              matchedSelectors = {};
2785              for (i = 0;i < delegateCount; i++) {
2786                handleObj = handlers[i];
2787                sel = handleObj.selector + " ";
2788                if (matchedSelectors[sel] === undefined) {
2789                  matchedSelectors[sel] = handleObj.needsContext ? jQuery2(sel, this).index(cur) > -1 : jQuery2.find(sel, this, null, [cur]).length;
2790                }
2791                if (matchedSelectors[sel]) {
2792                  matchedHandlers.push(handleObj);
2793                }
2794              }
2795              if (matchedHandlers.length) {
2796                handlerQueue.push({ elem: cur, handlers: matchedHandlers });
2797              }
2798            }
2799          }
2800        }
2801        cur = this;
2802        if (delegateCount < handlers.length) {
2803          handlerQueue.push({ elem: cur, handlers: handlers.slice(delegateCount) });
2804        }
2805        return handlerQueue;
2806      },
2807      addProp: function(name, hook) {
2808        Object.defineProperty(jQuery2.Event.prototype, name, {
2809          enumerable: true,
2810          configurable: true,
2811          get: isFunction(hook) ? function() {
2812            if (this.originalEvent) {
2813              return hook(this.originalEvent);
2814            }
2815          } : function() {
2816            if (this.originalEvent) {
2817              return this.originalEvent[name];
2818            }
2819          },
2820          set: function(value) {
2821            Object.defineProperty(this, name, {
2822              enumerable: true,
2823              configurable: true,
2824              writable: true,
2825              value
2826            });
2827          }
2828        });
2829      },
2830      fix: function(originalEvent) {
2831        return originalEvent[jQuery2.expando] ? originalEvent : new jQuery2.Event(originalEvent);
2832      },
2833      special: {
2834        load: {
2835          noBubble: true
2836        },
2837        click: {
2838          setup: function(data) {
2839            var el = this || data;
2840            if (rcheckableType.test(el.type) && el.click && nodeName(el, "input")) {
2841              leverageNative(el, "click", true);
2842            }
2843            return false;
2844          },
2845          trigger: function(data) {
2846            var el = this || data;
2847            if (rcheckableType.test(el.type) && el.click && nodeName(el, "input")) {
2848              leverageNative(el, "click");
2849            }
2850            return true;
2851          },
2852          _default: function(event) {
2853            var target = event.target;
2854            return rcheckableType.test(target.type) && target.click && nodeName(target, "input") && dataPriv.get(target, "click") || nodeName(target, "a");
2855          }
2856        },
2857        beforeunload: {
2858          postDispatch: function(event) {
2859            if (event.result !== undefined && event.originalEvent) {
2860              event.originalEvent.returnValue = event.result;
2861            }
2862          }
2863        }
2864      }
2865    };
2866    function leverageNative(el, type, isSetup) {
2867      if (!isSetup) {
2868        if (dataPriv.get(el, type) === undefined) {
2869          jQuery2.event.add(el, type, returnTrue);
2870        }
2871        return;
2872      }
2873      dataPriv.set(el, type, false);
2874      jQuery2.event.add(el, type, {
2875        namespace: false,
2876        handler: function(event) {
2877          var result, saved = dataPriv.get(this, type);
2878          if (event.isTrigger & 1 && this[type]) {
2879            if (!saved) {
2880              saved = slice.call(arguments);
2881              dataPriv.set(this, type, saved);
2882              this[type]();
2883              result = dataPriv.get(this, type);
2884              dataPriv.set(this, type, false);
2885              if (saved !== result) {
2886                event.stopImmediatePropagation();
2887                event.preventDefault();
2888                return result;
2889              }
2890            } else if ((jQuery2.event.special[type] || {}).delegateType) {
2891              event.stopPropagation();
2892            }
2893          } else if (saved) {
2894            dataPriv.set(this, type, jQuery2.event.trigger(saved[0], saved.slice(1), this));
2895            event.stopPropagation();
2896            event.isImmediatePropagationStopped = returnTrue;
2897          }
2898        }
2899      });
2900    }
2901    jQuery2.removeEvent = function(elem, type, handle) {
2902      if (elem.removeEventListener) {
2903        elem.removeEventListener(type, handle);
2904      }
2905    };
2906    jQuery2.Event = function(src, props) {
2907      if (!(this instanceof jQuery2.Event)) {
2908        return new jQuery2.Event(src, props);
2909      }
2910      if (src && src.type) {
2911        this.originalEvent = src;
2912        this.type = src.type;
2913        this.isDefaultPrevented = src.defaultPrevented || src.defaultPrevented === undefined && src.returnValue === false ? returnTrue : returnFalse;
2914        this.target = src.target && src.target.nodeType === 3 ? src.target.parentNode : src.target;
2915        this.currentTarget = src.currentTarget;
2916        this.relatedTarget = src.relatedTarget;
2917      } else {
2918        this.type = src;
2919      }
2920      if (props) {
2921        jQuery2.extend(this, props);
2922      }
2923      this.timeStamp = src && src.timeStamp || Date.now();
2924      this[jQuery2.expando] = true;
2925    };
2926    jQuery2.Event.prototype = {
2927      constructor: jQuery2.Event,
2928      isDefaultPrevented: returnFalse,
2929      isPropagationStopped: returnFalse,
2930      isImmediatePropagationStopped: returnFalse,
2931      isSimulated: false,
2932      preventDefault: function() {
2933        var e = this.originalEvent;
2934        this.isDefaultPrevented = returnTrue;
2935        if (e && !this.isSimulated) {
2936          e.preventDefault();
2937        }
2938      },
2939      stopPropagation: function() {
2940        var e = this.originalEvent;
2941        this.isPropagationStopped = returnTrue;
2942        if (e && !this.isSimulated) {
2943          e.stopPropagation();
2944        }
2945      },
2946      stopImmediatePropagation: function() {
2947        var e = this.originalEvent;
2948        this.isImmediatePropagationStopped = returnTrue;
2949        if (e && !this.isSimulated) {
2950          e.stopImmediatePropagation();
2951        }
2952        this.stopPropagation();
2953      }
2954    };
2955    jQuery2.each({
2956      altKey: true,
2957      bubbles: true,
2958      cancelable: true,
2959      changedTouches: true,
2960      ctrlKey: true,
2961      detail: true,
2962      eventPhase: true,
2963      metaKey: true,
2964      pageX: true,
2965      pageY: true,
2966      shiftKey: true,
2967      view: true,
2968      char: true,
2969      code: true,
2970      charCode: true,
2971      key: true,
2972      keyCode: true,
2973      button: true,
2974      buttons: true,
2975      clientX: true,
2976      clientY: true,
2977      offsetX: true,
2978      offsetY: true,
2979      pointerId: true,
2980      pointerType: true,
2981      screenX: true,
2982      screenY: true,
2983      targetTouches: true,
2984      toElement: true,
2985      touches: true,
2986      which: true
2987    }, jQuery2.event.addProp);
2988    jQuery2.each({ focus: "focusin", blur: "focusout" }, function(type, delegateType) {
2989      function focusMappedHandler(nativeEvent) {
2990        if (document2.documentMode) {
2991          var handle = dataPriv.get(this, "handle"), event = jQuery2.event.fix(nativeEvent);
2992          event.type = nativeEvent.type === "focusin" ? "focus" : "blur";
2993          event.isSimulated = true;
2994          handle(nativeEvent);
2995          if (event.target === event.currentTarget) {
2996            handle(event);
2997          }
2998        } else {
2999          jQuery2.event.simulate(delegateType, nativeEvent.target, jQuery2.event.fix(nativeEvent));
3000        }
3001      }
3002      jQuery2.event.special[type] = {
3003        setup: function() {
3004          var attaches;
3005          leverageNative(this, type, true);
3006          if (document2.documentMode) {
3007            attaches = dataPriv.get(this, delegateType);
3008            if (!attaches) {
3009              this.addEventListener(delegateType, focusMappedHandler);
3010            }
3011            dataPriv.set(this, delegateType, (attaches || 0) + 1);
3012          } else {
3013            return false;
3014          }
3015        },
3016        trigger: function() {
3017          leverageNative(this, type);
3018          return true;
3019        },
3020        teardown: function() {
3021          var attaches;
3022          if (document2.documentMode) {
3023            attaches = dataPriv.get(this, delegateType) - 1;
3024            if (!attaches) {
3025              this.removeEventListener(delegateType, focusMappedHandler);
3026              dataPriv.remove(this, delegateType);
3027            } else {
3028              dataPriv.set(this, delegateType, attaches);
3029            }
3030          } else {
3031            return false;
3032          }
3033        },
3034        _default: function(event) {
3035          return dataPriv.get(event.target, type);
3036        },
3037        delegateType
3038      };
3039      jQuery2.event.special[delegateType] = {
3040        setup: function() {
3041          var doc = this.ownerDocument || this.document || this, dataHolder = document2.documentMode ? this : doc, attaches = dataPriv.get(dataHolder, delegateType);
3042          if (!attaches) {
3043            if (document2.documentMode) {
3044              this.addEventListener(delegateType, focusMappedHandler);
3045            } else {
3046              doc.addEventListener(type, focusMappedHandler, true);
3047            }
3048          }
3049          dataPriv.set(dataHolder, delegateType, (attaches || 0) + 1);
3050        },
3051        teardown: function() {
3052          var doc = this.ownerDocument || this.document || this, dataHolder = document2.documentMode ? this : doc, attaches = dataPriv.get(dataHolder, delegateType) - 1;
3053          if (!attaches) {
3054            if (document2.documentMode) {
3055              this.removeEventListener(delegateType, focusMappedHandler);
3056            } else {
3057              doc.removeEventListener(type, focusMappedHandler, true);
3058            }
3059            dataPriv.remove(dataHolder, delegateType);
3060          } else {
3061            dataPriv.set(dataHolder, delegateType, attaches);
3062          }
3063        }
3064      };
3065    });
3066    jQuery2.each({
3067      mouseenter: "mouseover",
3068      mouseleave: "mouseout",
3069      pointerenter: "pointerover",
3070      pointerleave: "pointerout"
3071    }, function(orig, fix) {
3072      jQuery2.event.special[orig] = {
3073        delegateType: fix,
3074        bindType: fix,
3075        handle: function(event) {
3076          var ret2, target = this, { relatedTarget: related, handleObj } = event;
3077          if (!related || related !== target && !jQuery2.contains(target, related)) {
3078            event.type = handleObj.origType;
3079            ret2 = handleObj.handler.apply(this, arguments);
3080            event.type = fix;
3081          }
3082          return ret2;
3083        }
3084      };
3085    });
3086    jQuery2.fn.extend({
3087      on: function(types, selector, data, fn2) {
3088        return on(this, types, selector, data, fn2);
3089      },
3090      one: function(types, selector, data, fn2) {
3091        return on(this, types, selector, data, fn2, 1);
3092      },
3093      off: function(types, selector, fn2) {
3094        var handleObj, type;
3095        if (types && types.preventDefault && types.handleObj) {
3096          handleObj = types.handleObj;
3097          jQuery2(types.delegateTarget).off(handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, handleObj.selector, handleObj.handler);
3098          return this;
3099        }
3100        if (typeof types === "object") {
3101          for (type in types) {
3102            this.off(type, selector, types[type]);
3103          }
3104          return this;
3105        }
3106        if (selector === false || typeof selector === "function") {
3107          fn2 = selector;
3108          selector = undefined;
3109        }
3110        if (fn2 === false) {
3111          fn2 = returnFalse;
3112        }
3113        return this.each(function() {
3114          jQuery2.event.remove(this, types, fn2, selector);
3115        });
3116      }
3117    });
3118    var rnoInnerhtml = /<script|<style|<link/i, rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, rcleanScript = /^\s*<!\[CDATA\[|\]\]>\s*$/g;
3119    function manipulationTarget(elem, content) {
3120      if (nodeName(elem, "table") && nodeName(content.nodeType !== 11 ? content : content.firstChild, "tr")) {
3121        return jQuery2(elem).children("tbody")[0] || elem;
3122      }
3123      return elem;
3124    }
3125    function disableScript(elem) {
3126      elem.type = (elem.getAttribute("type") !== null) + "/" + elem.type;
3127      return elem;
3128    }
3129    function restoreScript(elem) {
3130      if ((elem.type || "").slice(0, 5) === "true/") {
3131        elem.type = elem.type.slice(5);
3132      } else {
3133        elem.removeAttribute("type");
3134      }
3135      return elem;
3136    }
3137    function cloneCopyEvent(src, dest) {
3138      var i, l, type, pdataOld, udataOld, udataCur, events;
3139      if (dest.nodeType !== 1) {
3140        return;
3141      }
3142      if (dataPriv.hasData(src)) {
3143        pdataOld = dataPriv.get(src);
3144        events = pdataOld.events;
3145        if (events) {
3146          dataPriv.remove(dest, "handle events");
3147          for (type in events) {
3148            for (i = 0, l = events[type].length;i < l; i++) {
3149              jQuery2.event.add(dest, type, events[type][i]);
3150            }
3151          }
3152        }
3153      }
3154      if (dataUser.hasData(src)) {
3155        udataOld = dataUser.access(src);
3156        udataCur = jQuery2.extend({}, udataOld);
3157        dataUser.set(dest, udataCur);
3158      }
3159    }
3160    function fixInput(src, dest) {
3161      var nodeName = dest.nodeName.toLowerCase();
3162      if (nodeName === "input" && rcheckableType.test(src.type)) {
3163        dest.checked = src.checked;
3164      } else if (nodeName === "input" || nodeName === "textarea") {
3165        dest.defaultValue = src.defaultValue;
3166      }
3167    }
3168    function domManip(collection, args2, callback, ignored) {
3169      args2 = flat(args2);
3170      var fragment, first, scripts, hasScripts, node, doc, i = 0, l = collection.length, iNoClone = l - 1, value = args2[0], valueIsFunction = isFunction(value);
3171      if (valueIsFunction || l > 1 && typeof value === "string" && !support.checkClone && rchecked.test(value)) {
3172        return collection.each(function(index) {
3173          var self2 = collection.eq(index);
3174          if (valueIsFunction) {
3175            args2[0] = value.call(this, index, self2.html());
3176          }
3177          domManip(self2, args2, callback, ignored);
3178        });
3179      }
3180      if (l) {
3181        fragment = buildFragment(args2, collection[0].ownerDocument, false, collection, ignored);
3182        first = fragment.firstChild;
3183        if (fragment.childNodes.length === 1) {
3184          fragment = first;
3185        }
3186        if (first || ignored) {
3187          scripts = jQuery2.map(getAll(fragment, "script"), disableScript);
3188          hasScripts = scripts.length;
3189          for (;i < l; i++) {
3190            node = fragment;
3191            if (i !== iNoClone) {
3192              node = jQuery2.clone(node, true, true);
3193              if (hasScripts) {
3194                jQuery2.merge(scripts, getAll(node, "script"));
3195              }
3196            }
3197            callback.call(collection[i], node, i);
3198          }
3199          if (hasScripts) {
3200            doc = scripts[scripts.length - 1].ownerDocument;
3201            jQuery2.map(scripts, restoreScript);
3202            for (i = 0;i < hasScripts; i++) {
3203              node = scripts[i];
3204              if (rscriptType.test(node.type || "") && !dataPriv.access(node, "globalEval") && jQuery2.contains(doc, node)) {
3205                if (node.src && (node.type || "").toLowerCase() !== "module") {
3206                  if (jQuery2._evalUrl && !node.noModule) {
3207                    jQuery2._evalUrl(node.src, {
3208                      nonce: node.nonce || node.getAttribute("nonce")
3209                    }, doc);
3210                  }
3211                } else {
3212                  DOMEval(node.textContent.replace(rcleanScript, ""), node, doc);
3213                }
3214              }
3215            }
3216          }
3217        }
3218      }
3219      return collection;
3220    }
3221    function remove2(elem, selector, keepData) {
3222      var node, nodes = selector ? jQuery2.filter(selector, elem) : elem, i = 0;
3223      for (;(node = nodes[i]) != null; i++) {
3224        if (!keepData && node.nodeType === 1) {
3225          jQuery2.cleanData(getAll(node));
3226        }
3227        if (node.parentNode) {
3228          if (keepData && isAttached(node)) {
3229            setGlobalEval(getAll(node, "script"));
3230          }
3231          node.parentNode.removeChild(node);
3232        }
3233      }
3234      return elem;
3235    }
3236    jQuery2.extend({
3237      htmlPrefilter: function(html) {
3238        return html;
3239      },
3240      clone: function(elem, dataAndEvents, deepDataAndEvents) {
3241        var i, l, srcElements, destElements, clone2 = elem.cloneNode(true), inPage = isAttached(elem);
3242        if (!support.noCloneChecked && (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery2.isXMLDoc(elem)) {
3243          destElements = getAll(clone2);
3244          srcElements = getAll(elem);
3245          for (i = 0, l = srcElements.length;i < l; i++) {
3246            fixInput(srcElements[i], destElements[i]);
3247          }
3248        }
3249        if (dataAndEvents) {
3250          if (deepDataAndEvents) {
3251            srcElements = srcElements || getAll(elem);
3252            destElements = destElements || getAll(clone2);
3253            for (i = 0, l = srcElements.length;i < l; i++) {
3254              cloneCopyEvent(srcElements[i], destElements[i]);
3255            }
3256          } else {
3257            cloneCopyEvent(elem, clone2);
3258          }
3259        }
3260        destElements = getAll(clone2, "script");
3261        if (destElements.length > 0) {
3262          setGlobalEval(destElements, !inPage && getAll(elem, "script"));
3263        }
3264        return clone2;
3265      },
3266      cleanData: function(elems) {
3267        var data, elem, type, special = jQuery2.event.special, i = 0;
3268        for (;(elem = elems[i]) !== undefined; i++) {
3269          if (acceptData(elem)) {
3270            if (data = elem[dataPriv.expando]) {
3271              if (data.events) {
3272                for (type in data.events) {
3273                  if (special[type]) {
3274                    jQuery2.event.remove(elem, type);
3275                  } else {
3276                    jQuery2.removeEvent(elem, type, data.handle);
3277                  }
3278                }
3279              }
3280              elem[dataPriv.expando] = undefined;
3281            }
3282            if (elem[dataUser.expando]) {
3283              elem[dataUser.expando] = undefined;
3284            }
3285          }
3286        }
3287      }
3288    });
3289    jQuery2.fn.extend({
3290      detach: function(selector) {
3291        return remove2(this, selector, true);
3292      },
3293      remove: function(selector) {
3294        return remove2(this, selector);
3295      },
3296      text: function(value) {
3297        return access(this, function(value) {
3298          return value === undefined ? jQuery2.text(this) : this.empty().each(function() {
3299            if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
3300              this.textContent = value;
3301            }
3302          });
3303        }, null, value, arguments.length);
3304      },
3305      append: function() {
3306        return domManip(this, arguments, function(elem) {
3307          if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
3308            var target = manipulationTarget(this, elem);
3309            target.appendChild(elem);
3310          }
3311        });
3312      },
3313      prepend: function() {
3314        return domManip(this, arguments, function(elem) {
3315          if (this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9) {
3316            var target = manipulationTarget(this, elem);
3317            target.insertBefore(elem, target.firstChild);
3318          }
3319        });
3320      },
3321      before: function() {
3322        return domManip(this, arguments, function(elem) {
3323          if (this.parentNode) {
3324            this.parentNode.insertBefore(elem, this);
3325          }
3326        });
3327      },
3328      after: function() {
3329        return domManip(this, arguments, function(elem) {
3330          if (this.parentNode) {
3331            this.parentNode.insertBefore(elem, this.nextSibling);
3332          }
3333        });
3334      },
3335      empty: function() {
3336        var elem, i = 0;
3337        for (;(elem = this[i]) != null; i++) {
3338          if (elem.nodeType === 1) {
3339            jQuery2.cleanData(getAll(elem, false));
3340            elem.textContent = "";
3341          }
3342        }
3343        return this;
3344      },
3345      clone: function(dataAndEvents, deepDataAndEvents) {
3346        dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
3347        deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
3348        return this.map(function() {
3349          return jQuery2.clone(this, dataAndEvents, deepDataAndEvents);
3350        });
3351      },
3352      html: function(value) {
3353        return access(this, function(value) {
3354          var elem = this[0] || {}, i = 0, l = this.length;
3355          if (value === undefined && elem.nodeType === 1) {
3356            return elem.innerHTML;
3357          }
3358          if (typeof value === "string" && !rnoInnerhtml.test(value) && !wrapMap[(rtagName.exec(value) || ["", ""])[1].toLowerCase()]) {
3359            value = jQuery2.htmlPrefilter(value);
3360            try {
3361              for (;i < l; i++) {
3362                elem = this[i] || {};
3363                if (elem.nodeType === 1) {
3364                  jQuery2.cleanData(getAll(elem, false));
3365                  elem.innerHTML = value;
3366                }
3367              }
3368              elem = 0;
3369            } catch (e) {}
3370          }
3371          if (elem) {
3372            this.empty().append(value);
3373          }
3374        }, null, value, arguments.length);
3375      },
3376      replaceWith: function() {
3377        var ignored = [];
3378        return domManip(this, arguments, function(elem) {
3379          var parent = this.parentNode;
3380          if (jQuery2.inArray(this, ignored) < 0) {
3381            jQuery2.cleanData(getAll(this));
3382            if (parent) {
3383              parent.replaceChild(elem, this);
3384            }
3385          }
3386        }, ignored);
3387      }
3388    });
3389    jQuery2.each({
3390      appendTo: "append",
3391      prependTo: "prepend",
3392      insertBefore: "before",
3393      insertAfter: "after",
3394      replaceAll: "replaceWith"
3395    }, function(name, original) {
3396      jQuery2.fn[name] = function(selector) {
3397        var elems, ret2 = [], insert = jQuery2(selector), last = insert.length - 1, i = 0;
3398        for (;i <= last; i++) {
3399          elems = i === last ? this : this.clone(true);
3400          jQuery2(insert[i])[original](elems);
3401          push.apply(ret2, elems.get());
3402        }
3403        return this.pushStack(ret2);
3404      };
3405    });
3406    var rnumnonpx = new RegExp("^(" + pnum + ")(?!px)[a-z%]+$", "i");
3407    var rcustomProp = /^--/;
3408    var getStyles = function(elem) {
3409      var view = elem.ownerDocument.defaultView;
3410      if (!view || !view.opener) {
3411        view = window2;
3412      }
3413      return view.getComputedStyle(elem);
3414    };
3415    var swap = function(elem, options2, callback) {
3416      var ret2, name, old = {};
3417      for (name in options2) {
3418        old[name] = elem.style[name];
3419        elem.style[name] = options2[name];
3420      }
3421      ret2 = callback.call(elem);
3422      for (name in options2) {
3423        elem.style[name] = old[name];
3424      }
3425      return ret2;
3426    };
3427    var rboxStyle = new RegExp(cssExpand.join("|"), "i");
3428    (function() {
3429      function computeStyleTests() {
3430        if (!div) {
3431          return;
3432        }
3433        container.style.cssText = "position:absolute;left:-11111px;width:60px;" + "margin-top:1px;padding:0;border:0";
3434        div.style.cssText = "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + "margin:auto;border:1px;padding:1px;" + "width:60%;top:1%";
3435        documentElement.appendChild(container).appendChild(div);
3436        var divStyle = window2.getComputedStyle(div);
3437        pixelPositionVal = divStyle.top !== "1%";
3438        reliableMarginLeftVal = roundPixelMeasures(divStyle.marginLeft) === 12;
3439        div.style.right = "60%";
3440        pixelBoxStylesVal = roundPixelMeasures(divStyle.right) === 36;
3441        boxSizingReliableVal = roundPixelMeasures(divStyle.width) === 36;
3442        div.style.position = "absolute";
3443        scrollboxSizeVal = roundPixelMeasures(div.offsetWidth / 3) === 12;
3444        documentElement.removeChild(container);
3445        div = null;
3446      }
3447      function roundPixelMeasures(measure) {
3448        return Math.round(parseFloat(measure));
3449      }
3450      var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, reliableTrDimensionsVal, reliableMarginLeftVal, container = document2.createElement("div"), div = document2.createElement("div");
3451      if (!div.style) {
3452        return;
3453      }
3454      div.style.backgroundClip = "content-box";
3455      div.cloneNode(true).style.backgroundClip = "";
3456      support.clearCloneStyle = div.style.backgroundClip === "content-box";
3457      jQuery2.extend(support, {
3458        boxSizingReliable: function() {
3459          computeStyleTests();
3460          return boxSizingReliableVal;
3461        },
3462        pixelBoxStyles: function() {
3463          computeStyleTests();
3464          return pixelBoxStylesVal;
3465        },
3466        pixelPosition: function() {
3467          computeStyleTests();
3468          return pixelPositionVal;
3469        },
3470        reliableMarginLeft: function() {
3471          computeStyleTests();
3472          return reliableMarginLeftVal;
3473        },
3474        scrollboxSize: function() {
3475          computeStyleTests();
3476          return scrollboxSizeVal;
3477        },
3478        reliableTrDimensions: function() {
3479          var table, tr, trChild, trStyle;
3480          if (reliableTrDimensionsVal == null) {
3481            table = document2.createElement("table");
3482            tr = document2.createElement("tr");
3483            trChild = document2.createElement("div");
3484            table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate";
3485            tr.style.cssText = "box-sizing:content-box;border:1px solid";
3486            tr.style.height = "1px";
3487            trChild.style.height = "9px";
3488            trChild.style.display = "block";
3489            documentElement.appendChild(table).appendChild(tr).appendChild(trChild);
3490            trStyle = window2.getComputedStyle(tr);
3491            reliableTrDimensionsVal = parseInt(trStyle.height, 10) + parseInt(trStyle.borderTopWidth, 10) + parseInt(trStyle.borderBottomWidth, 10) === tr.offsetHeight;
3492            documentElement.removeChild(table);
3493          }
3494          return reliableTrDimensionsVal;
3495        }
3496      });
3497    })();
3498    function curCSS(elem, name, computed) {
3499      var width, minWidth, maxWidth, ret2, isCustomProp = rcustomProp.test(name), style = elem.style;
3500      computed = computed || getStyles(elem);
3501      if (computed) {
3502        ret2 = computed.getPropertyValue(name) || computed[name];
3503        if (isCustomProp && ret2) {
3504          ret2 = ret2.replace(rtrimCSS, "$1") || undefined;
3505        }
3506        if (ret2 === "" && !isAttached(elem)) {
3507          ret2 = jQuery2.style(elem, name);
3508        }
3509        if (!support.pixelBoxStyles() && rnumnonpx.test(ret2) && rboxStyle.test(name)) {
3510          width = style.width;
3511          minWidth = style.minWidth;
3512          maxWidth = style.maxWidth;
3513          style.minWidth = style.maxWidth = style.width = ret2;
3514          ret2 = computed.width;
3515          style.width = width;
3516          style.minWidth = minWidth;
3517          style.maxWidth = maxWidth;
3518        }
3519      }
3520      return ret2 !== undefined ? ret2 + "" : ret2;
3521    }
3522    function addGetHookIf(conditionFn, hookFn) {
3523      return {
3524        get: function() {
3525          if (conditionFn()) {
3526            delete this.get;
3527            return;
3528          }
3529          return (this.get = hookFn).apply(this, arguments);
3530        }
3531      };
3532    }
3533    var cssPrefixes = ["Webkit", "Moz", "ms"], emptyStyle = document2.createElement("div").style, vendorProps = {};
3534    function vendorPropName(name) {
3535      var capName = name[0].toUpperCase() + name.slice(1), i = cssPrefixes.length;
3536      while (i--) {
3537        name = cssPrefixes[i] + capName;
3538        if (name in emptyStyle) {
3539          return name;
3540        }
3541      }
3542    }
3543    function finalPropName(name) {
3544      var final = jQuery2.cssProps[name] || vendorProps[name];
3545      if (final) {
3546        return final;
3547      }
3548      if (name in emptyStyle) {
3549        return name;
3550      }
3551      return vendorProps[name] = vendorPropName(name) || name;
3552    }
3553    var rdisplayswap = /^(none|table(?!-c[ea]).+)/, cssShow = { position: "absolute", visibility: "hidden", display: "block" }, cssNormalTransform = {
3554      letterSpacing: "0",
3555      fontWeight: "400"
3556    };
3557    function setPositiveNumber(_elem, value, subtract) {
3558      var matches = rcssNum.exec(value);
3559      return matches ? Math.max(0, matches[2] - (subtract || 0)) + (matches[3] || "px") : value;
3560    }
3561    function boxModelAdjustment(elem, dimension, box, isBorderBox, styles, computedVal) {
3562      var i = dimension === "width" ? 1 : 0, extra = 0, delta = 0, marginDelta = 0;
3563      if (box === (isBorderBox ? "border" : "content")) {
3564        return 0;
3565      }
3566      for (;i < 4; i += 2) {
3567        if (box === "margin") {
3568          marginDelta += jQuery2.css(elem, box + cssExpand[i], true, styles);
3569        }
3570        if (!isBorderBox) {
3571          delta += jQuery2.css(elem, "padding" + cssExpand[i], true, styles);
3572          if (box !== "padding") {
3573            delta += jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
3574          } else {
3575            extra += jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
3576          }
3577        } else {
3578          if (box === "content") {
3579            delta -= jQuery2.css(elem, "padding" + cssExpand[i], true, styles);
3580          }
3581          if (box !== "margin") {
3582            delta -= jQuery2.css(elem, "border" + cssExpand[i] + "Width", true, styles);
3583          }
3584        }
3585      }
3586      if (!isBorderBox && computedVal >= 0) {
3587        delta += Math.max(0, Math.ceil(elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - computedVal - delta - extra - 0.5)) || 0;
3588      }
3589      return delta + marginDelta;
3590    }
3591    function getWidthOrHeight(elem, dimension, extra) {
3592      var styles = getStyles(elem), boxSizingNeeded = !support.boxSizingReliable() || extra, isBorderBox = boxSizingNeeded && jQuery2.css(elem, "boxSizing", false, styles) === "border-box", valueIsBorderBox = isBorderBox, val = curCSS(elem, dimension, styles), offsetProp = "offset" + dimension[0].toUpperCase() + dimension.slice(1);
3593      if (rnumnonpx.test(val)) {
3594        if (!extra) {
3595          return val;
3596        }
3597        val = "auto";
3598      }
3599      if ((!support.boxSizingReliable() && isBorderBox || !support.reliableTrDimensions() && nodeName(elem, "tr") || val === "auto" || !parseFloat(val) && jQuery2.css(elem, "display", false, styles) === "inline") && elem.getClientRects().length) {
3600        isBorderBox = jQuery2.css(elem, "boxSizing", false, styles) === "border-box";
3601        valueIsBorderBox = offsetProp in elem;
3602        if (valueIsBorderBox) {
3603          val = elem[offsetProp];
3604        }
3605      }
3606      val = parseFloat(val) || 0;
3607      return val + boxModelAdjustment(elem, dimension, extra || (isBorderBox ? "border" : "content"), valueIsBorderBox, styles, val) + "px";
3608    }
3609    jQuery2.extend({
3610      cssHooks: {
3611        opacity: {
3612          get: function(elem, computed) {
3613            if (computed) {
3614              var ret2 = curCSS(elem, "opacity");
3615              return ret2 === "" ? "1" : ret2;
3616            }
3617          }
3618        }
3619      },
3620      cssNumber: {
3621        animationIterationCount: true,
3622        aspectRatio: true,
3623        borderImageSlice: true,
3624        columnCount: true,
3625        flexGrow: true,
3626        flexShrink: true,
3627        fontWeight: true,
3628        gridArea: true,
3629        gridColumn: true,
3630        gridColumnEnd: true,
3631        gridColumnStart: true,
3632        gridRow: true,
3633        gridRowEnd: true,
3634        gridRowStart: true,
3635        lineHeight: true,
3636        opacity: true,
3637        order: true,
3638        orphans: true,
3639        scale: true,
3640        widows: true,
3641        zIndex: true,
3642        zoom: true,
3643        fillOpacity: true,
3644        floodOpacity: true,
3645        stopOpacity: true,
3646        strokeMiterlimit: true,
3647        strokeOpacity: true
3648      },
3649      cssProps: {},
3650      style: function(elem, name, value, extra) {
3651        if (!elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style) {
3652          return;
3653        }
3654        var ret2, type, hooks, origName = camelCase(name), isCustomProp = rcustomProp.test(name), style = elem.style;
3655        if (!isCustomProp) {
3656          name = finalPropName(origName);
3657        }
3658        hooks = jQuery2.cssHooks[name] || jQuery2.cssHooks[origName];
3659        if (value !== undefined) {
3660          type = typeof value;
3661          if (type === "string" && (ret2 = rcssNum.exec(value)) && ret2[1]) {
3662            value = adjustCSS(elem, name, ret2);
3663            type = "number";
3664          }
3665          if (value == null || value !== value) {
3666            return;
3667          }
3668          if (type === "number" && !isCustomProp) {
3669            value += ret2 && ret2[3] || (jQuery2.cssNumber[origName] ? "" : "px");
3670          }
3671          if (!support.clearCloneStyle && value === "" && name.indexOf("background") === 0) {
3672            style[name] = "inherit";
3673          }
3674          if (!hooks || !("set" in hooks) || (value = hooks.set(elem, value, extra)) !== undefined) {
3675            if (isCustomProp) {
3676              style.setProperty(name, value);
3677            } else {
3678              style[name] = value;
3679            }
3680          }
3681        } else {
3682          if (hooks && "get" in hooks && (ret2 = hooks.get(elem, false, extra)) !== undefined) {
3683            return ret2;
3684          }
3685          return style[name];
3686        }
3687      },
3688      css: function(elem, name, extra, styles) {
3689        var val, num, hooks, origName = camelCase(name), isCustomProp = rcustomProp.test(name);
3690        if (!isCustomProp) {
3691          name = finalPropName(origName);
3692        }
3693        hooks = jQuery2.cssHooks[name] || jQuery2.cssHooks[origName];
3694        if (hooks && "get" in hooks) {
3695          val = hooks.get(elem, true, extra);
3696        }
3697        if (val === undefined) {
3698          val = curCSS(elem, name, styles);
3699        }
3700        if (val === "normal" && name in cssNormalTransform) {
3701          val = cssNormalTransform[name];
3702        }
3703        if (extra === "" || extra) {
3704          num = parseFloat(val);
3705          return extra === true || isFinite(num) ? num || 0 : val;
3706        }
3707        return val;
3708      }
3709    });
3710    jQuery2.each(["height", "width"], function(_i, dimension) {
3711      jQuery2.cssHooks[dimension] = {
3712        get: function(elem, computed, extra) {
3713          if (computed) {
3714            return rdisplayswap.test(jQuery2.css(elem, "display")) && (!elem.getClientRects().length || !elem.getBoundingClientRect().width) ? swap(elem, cssShow, function() {
3715              return getWidthOrHeight(elem, dimension, extra);
3716            }) : getWidthOrHeight(elem, dimension, extra);
3717          }
3718        },
3719        set: function(elem, value, extra) {
3720          var matches, styles = getStyles(elem), scrollboxSizeBuggy = !support.scrollboxSize() && styles.position === "absolute", boxSizingNeeded = scrollboxSizeBuggy || extra, isBorderBox = boxSizingNeeded && jQuery2.css(elem, "boxSizing", false, styles) === "border-box", subtract = extra ? boxModelAdjustment(elem, dimension, extra, isBorderBox, styles) : 0;
3721          if (isBorderBox && scrollboxSizeBuggy) {
3722            subtract -= Math.ceil(elem["offset" + dimension[0].toUpperCase() + dimension.slice(1)] - parseFloat(styles[dimension]) - boxModelAdjustment(elem, dimension, "border", false, styles) - 0.5);
3723          }
3724          if (subtract && (matches = rcssNum.exec(value)) && (matches[3] || "px") !== "px") {
3725            elem.style[dimension] = value;
3726            value = jQuery2.css(elem, dimension);
3727          }
3728          return setPositiveNumber(elem, value, subtract);
3729        }
3730      };
3731    });
3732    jQuery2.cssHooks.marginLeft = addGetHookIf(support.reliableMarginLeft, function(elem, computed) {
3733      if (computed) {
3734        return (parseFloat(curCSS(elem, "marginLeft")) || elem.getBoundingClientRect().left - swap(elem, { marginLeft: 0 }, function() {
3735          return elem.getBoundingClientRect().left;
3736        })) + "px";
3737      }
3738    });
3739    jQuery2.each({
3740      margin: "",
3741      padding: "",
3742      border: "Width"
3743    }, function(prefix, suffix) {
3744      jQuery2.cssHooks[prefix + suffix] = {
3745        expand: function(value) {
3746          var i = 0, expanded = {}, parts = typeof value === "string" ? value.split(" ") : [value];
3747          for (;i < 4; i++) {
3748            expanded[prefix + cssExpand[i] + suffix] = parts[i] || parts[i - 2] || parts[0];
3749          }
3750          return expanded;
3751        }
3752      };
3753      if (prefix !== "margin") {
3754        jQuery2.cssHooks[prefix + suffix].set = setPositiveNumber;
3755      }
3756    });
3757    jQuery2.fn.extend({
3758      css: function(name, value) {
3759        return access(this, function(elem, name, value) {
3760          var styles, len, map = {}, i = 0;
3761          if (Array.isArray(name)) {
3762            styles = getStyles(elem);
3763            len = name.length;
3764            for (;i < len; i++) {
3765              map[name[i]] = jQuery2.css(elem, name[i], false, styles);
3766            }
3767            return map;
3768          }
3769          return value !== undefined ? jQuery2.style(elem, name, value) : jQuery2.css(elem, name);
3770        }, name, value, arguments.length > 1);
3771      }
3772    });
3773    function Tween(elem, options2, prop, end, easing) {
3774      return new Tween.prototype.init(elem, options2, prop, end, easing);
3775    }
3776    jQuery2.Tween = Tween;
3777    Tween.prototype = {
3778      constructor: Tween,
3779      init: function(elem, options2, prop, end, easing, unit) {
3780        this.elem = elem;
3781        this.prop = prop;
3782        this.easing = easing || jQuery2.easing._default;
3783        this.options = options2;
3784        this.start = this.now = this.cur();
3785        this.end = end;
3786        this.unit = unit || (jQuery2.cssNumber[prop] ? "" : "px");
3787      },
3788      cur: function() {
3789        var hooks = Tween.propHooks[this.prop];
3790        return hooks && hooks.get ? hooks.get(this) : Tween.propHooks._default.get(this);
3791      },
3792      run: function(percent) {
3793        var eased, hooks = Tween.propHooks[this.prop];
3794        if (this.options.duration) {
3795          this.pos = eased = jQuery2.easing[this.easing](percent, this.options.duration * percent, 0, 1, this.options.duration);
3796        } else {
3797          this.pos = eased = percent;
3798        }
3799        this.now = (this.end - this.start) * eased + this.start;
3800        if (this.options.step) {
3801          this.options.step.call(this.elem, this.now, this);
3802        }
3803        if (hooks && hooks.set) {
3804          hooks.set(this);
3805        } else {
3806          Tween.propHooks._default.set(this);
3807        }
3808        return this;
3809      }
3810    };
3811    Tween.prototype.init.prototype = Tween.prototype;
3812    Tween.propHooks = {
3813      _default: {
3814        get: function(tween) {
3815          var result;
3816          if (tween.elem.nodeType !== 1 || tween.elem[tween.prop] != null && tween.elem.style[tween.prop] == null) {
3817            return tween.elem[tween.prop];
3818          }
3819          result = jQuery2.css(tween.elem, tween.prop, "");
3820          return !result || result === "auto" ? 0 : result;
3821        },
3822        set: function(tween) {
3823          if (jQuery2.fx.step[tween.prop]) {
3824            jQuery2.fx.step[tween.prop](tween);
3825          } else if (tween.elem.nodeType === 1 && (jQuery2.cssHooks[tween.prop] || tween.elem.style[finalPropName(tween.prop)] != null)) {
3826            jQuery2.style(tween.elem, tween.prop, tween.now + tween.unit);
3827          } else {
3828            tween.elem[tween.prop] = tween.now;
3829          }
3830        }
3831      }
3832    };
3833    Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
3834      set: function(tween) {
3835        if (tween.elem.nodeType && tween.elem.parentNode) {
3836          tween.elem[tween.prop] = tween.now;
3837        }
3838      }
3839    };
3840    jQuery2.easing = {
3841      linear: function(p) {
3842        return p;
3843      },
3844      swing: function(p) {
3845        return 0.5 - Math.cos(p * Math.PI) / 2;
3846      },
3847      _default: "swing"
3848    };
3849    jQuery2.fx = Tween.prototype.init;
3850    jQuery2.fx.step = {};
3851    var fxNow, inProgress, rfxtypes = /^(?:toggle|show|hide)$/, rrun = /queueHooks$/;
3852    function schedule() {
3853      if (inProgress) {
3854        if (document2.hidden === false && window2.requestAnimationFrame) {
3855          window2.requestAnimationFrame(schedule);
3856        } else {
3857          window2.setTimeout(schedule, jQuery2.fx.interval);
3858        }
3859        jQuery2.fx.tick();
3860      }
3861    }
3862    function createFxNow() {
3863      window2.setTimeout(function() {
3864        fxNow = undefined;
3865      });
3866      return fxNow = Date.now();
3867    }
3868    function genFx(type, includeWidth) {
3869      var which, i = 0, attrs = { height: type };
3870      includeWidth = includeWidth ? 1 : 0;
3871      for (;i < 4; i += 2 - includeWidth) {
3872        which = cssExpand[i];
3873        attrs["margin" + which] = attrs["padding" + which] = type;
3874      }
3875      if (includeWidth) {
3876        attrs.opacity = attrs.width = type;
3877      }
3878      return attrs;
3879    }
3880    function createTween(value, prop, animation) {
3881      var tween, collection = (Animation.tweeners[prop] || []).concat(Animation.tweeners["*"]), index = 0, length = collection.length;
3882      for (;index < length; index++) {
3883        if (tween = collection[index].call(animation, prop, value)) {
3884          return tween;
3885        }
3886      }
3887    }
3888    function defaultPrefilter(elem, props, opts) {
3889      var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, isBox = "width" in props || "height" in props, anim = this, orig = {}, style = elem.style, hidden = elem.nodeType && isHiddenWithinTree(elem), dataShow = dataPriv.get(elem, "fxshow");
3890      if (!opts.queue) {
3891        hooks = jQuery2._queueHooks(elem, "fx");
3892        if (hooks.unqueued == null) {
3893          hooks.unqueued = 0;
3894          oldfire = hooks.empty.fire;
3895          hooks.empty.fire = function() {
3896            if (!hooks.unqueued) {
3897              oldfire();
3898            }
3899          };
3900        }
3901        hooks.unqueued++;
3902        anim.always(function() {
3903          anim.always(function() {
3904            hooks.unqueued--;
3905            if (!jQuery2.queue(elem, "fx").length) {
3906              hooks.empty.fire();
3907            }
3908          });
3909        });
3910      }
3911      for (prop in props) {
3912        value = props[prop];
3913        if (rfxtypes.test(value)) {
3914          delete props[prop];
3915          toggle = toggle || value === "toggle";
3916          if (value === (hidden ? "hide" : "show")) {
3917            if (value === "show" && dataShow && dataShow[prop] !== undefined) {
3918              hidden = true;
3919            } else {
3920              continue;
3921            }
3922          }
3923          orig[prop] = dataShow && dataShow[prop] || jQuery2.style(elem, prop);
3924        }
3925      }
3926      propTween = !jQuery2.isEmptyObject(props);
3927      if (!propTween && jQuery2.isEmptyObject(orig)) {
3928        return;
3929      }
3930      if (isBox && elem.nodeType === 1) {
3931        opts.overflow = [style.overflow, style.overflowX, style.overflowY];
3932        restoreDisplay = dataShow && dataShow.display;
3933        if (restoreDisplay == null) {
3934          restoreDisplay = dataPriv.get(elem, "display");
3935        }
3936        display = jQuery2.css(elem, "display");
3937        if (display === "none") {
3938          if (restoreDisplay) {
3939            display = restoreDisplay;
3940          } else {
3941            showHide([elem], true);
3942            restoreDisplay = elem.style.display || restoreDisplay;
3943            display = jQuery2.css(elem, "display");
3944            showHide([elem]);
3945          }
3946        }
3947        if (display === "inline" || display === "inline-block" && restoreDisplay != null) {
3948          if (jQuery2.css(elem, "float") === "none") {
3949            if (!propTween) {
3950              anim.done(function() {
3951                style.display = restoreDisplay;
3952              });
3953              if (restoreDisplay == null) {
3954                display = style.display;
3955                restoreDisplay = display === "none" ? "" : display;
3956              }
3957            }
3958            style.display = "inline-block";
3959          }
3960        }
3961      }
3962      if (opts.overflow) {
3963        style.overflow = "hidden";
3964        anim.always(function() {
3965          style.overflow = opts.overflow[0];
3966          style.overflowX = opts.overflow[1];
3967          style.overflowY = opts.overflow[2];
3968        });
3969      }
3970      propTween = false;
3971      for (prop in orig) {
3972        if (!propTween) {
3973          if (dataShow) {
3974            if ("hidden" in dataShow) {
3975              hidden = dataShow.hidden;
3976            }
3977          } else {
3978            dataShow = dataPriv.access(elem, "fxshow", { display: restoreDisplay });
3979          }
3980          if (toggle) {
3981            dataShow.hidden = !hidden;
3982          }
3983          if (hidden) {
3984            showHide([elem], true);
3985          }
3986          anim.done(function() {
3987            if (!hidden) {
3988              showHide([elem]);
3989            }
3990            dataPriv.remove(elem, "fxshow");
3991            for (prop in orig) {
3992              jQuery2.style(elem, prop, orig[prop]);
3993            }
3994          });
3995        }
3996        propTween = createTween(hidden ? dataShow[prop] : 0, prop, anim);
3997        if (!(prop in dataShow)) {
3998          dataShow[prop] = propTween.start;
3999          if (hidden) {
4000            propTween.end = propTween.start;
4001            propTween.start = 0;
4002          }
4003        }
4004      }
4005    }
4006    function propFilter(props, specialEasing) {
4007      var index, name, easing, value, hooks;
4008      for (index in props) {
4009        name = camelCase(index);
4010        easing = specialEasing[name];
4011        value = props[index];
4012        if (Array.isArray(value)) {
4013          easing = value[1];
4014          value = props[index] = value[0];
4015        }
4016        if (index !== name) {
4017          props[name] = value;
4018          delete props[index];
4019        }
4020        hooks = jQuery2.cssHooks[name];
4021        if (hooks && "expand" in hooks) {
4022          value = hooks.expand(value);
4023          delete props[name];
4024          for (index in value) {
4025            if (!(index in props)) {
4026              props[index] = value[index];
4027              specialEasing[index] = easing;
4028            }
4029          }
4030        } else {
4031          specialEasing[name] = easing;
4032        }
4033      }
4034    }
4035    function Animation(elem, properties, options2) {
4036      var result, stopped, index = 0, length = Animation.prefilters.length, deferred2 = jQuery2.Deferred().always(function() {
4037        delete tick.elem;
4038      }), tick = function() {
4039        if (stopped) {
4040          return false;
4041        }
4042        var currentTime = fxNow || createFxNow(), remaining = Math.max(0, animation.startTime + animation.duration - currentTime), temp = remaining / animation.duration || 0, percent = 1 - temp, index = 0, length = animation.tweens.length;
4043        for (;index < length; index++) {
4044          animation.tweens[index].run(percent);
4045        }
4046        deferred2.notifyWith(elem, [animation, percent, remaining]);
4047        if (percent < 1 && length) {
4048          return remaining;
4049        }
4050        if (!length) {
4051          deferred2.notifyWith(elem, [animation, 1, 0]);
4052        }
4053        deferred2.resolveWith(elem, [animation]);
4054        return false;
4055      }, animation = deferred2.promise({
4056        elem,
4057        props: jQuery2.extend({}, properties),
4058        opts: jQuery2.extend(true, {
4059          specialEasing: {},
4060          easing: jQuery2.easing._default
4061        }, options2),
4062        originalProperties: properties,
4063        originalOptions: options2,
4064        startTime: fxNow || createFxNow(),
4065        duration: options2.duration,
4066        tweens: [],
4067        createTween: function(prop, end) {
4068          var tween = jQuery2.Tween(elem, animation.opts, prop, end, animation.opts.specialEasing[prop] || animation.opts.easing);
4069          animation.tweens.push(tween);
4070          return tween;
4071        },
4072        stop: function(gotoEnd) {
4073          var index = 0, length = gotoEnd ? animation.tweens.length : 0;
4074          if (stopped) {
4075            return this;
4076          }
4077          stopped = true;
4078          for (;index < length; index++) {
4079            animation.tweens[index].run(1);
4080          }
4081          if (gotoEnd) {
4082            deferred2.notifyWith(elem, [animation, 1, 0]);
4083            deferred2.resolveWith(elem, [animation, gotoEnd]);
4084          } else {
4085            deferred2.rejectWith(elem, [animation, gotoEnd]);
4086          }
4087          return this;
4088        }
4089      }), props = animation.props;
4090      propFilter(props, animation.opts.specialEasing);
4091      for (;index < length; index++) {
4092        result = Animation.prefilters[index].call(animation, elem, props, animation.opts);
4093        if (result) {
4094          if (isFunction(result.stop)) {
4095            jQuery2._queueHooks(animation.elem, animation.opts.queue).stop = result.stop.bind(result);
4096          }
4097          return result;
4098        }
4099      }
4100      jQuery2.map(props, createTween, animation);
4101      if (isFunction(animation.opts.start)) {
4102        animation.opts.start.call(elem, animation);
4103      }
4104      animation.progress(animation.opts.progress).done(animation.opts.done, animation.opts.complete).fail(animation.opts.fail).always(animation.opts.always);
4105      jQuery2.fx.timer(jQuery2.extend(tick, {
4106        elem,
4107        anim: animation,
4108        queue: animation.opts.queue
4109      }));
4110      return animation;
4111    }
4112    jQuery2.Animation = jQuery2.extend(Animation, {
4113      tweeners: {
4114        "*": [function(prop, value) {
4115          var tween = this.createTween(prop, value);
4116          adjustCSS(tween.elem, prop, rcssNum.exec(value), tween);
4117          return tween;
4118        }]
4119      },
4120      tweener: function(props, callback) {
4121        if (isFunction(props)) {
4122          callback = props;
4123          props = ["*"];
4124        } else {
4125          props = props.match(rnothtmlwhite);
4126        }
4127        var prop, index = 0, length = props.length;
4128        for (;index < length; index++) {
4129          prop = props[index];
4130          Animation.tweeners[prop] = Animation.tweeners[prop] || [];
4131          Animation.tweeners[prop].unshift(callback);
4132        }
4133      },
4134      prefilters: [defaultPrefilter],
4135      prefilter: function(callback, prepend) {
4136        if (prepend) {
4137          Animation.prefilters.unshift(callback);
4138        } else {
4139          Animation.prefilters.push(callback);
4140        }
4141      }
4142    });
4143    jQuery2.speed = function(speed, easing, fn2) {
4144      var opt = speed && typeof speed === "object" ? jQuery2.extend({}, speed) : {
4145        complete: fn2 || !fn2 && easing || isFunction(speed) && speed,
4146        duration: speed,
4147        easing: fn2 && easing || easing && !isFunction(easing) && easing
4148      };
4149      if (jQuery2.fx.off) {
4150        opt.duration = 0;
4151      } else {
4152        if (typeof opt.duration !== "number") {
4153          if (opt.duration in jQuery2.fx.speeds) {
4154            opt.duration = jQuery2.fx.speeds[opt.duration];
4155          } else {
4156            opt.duration = jQuery2.fx.speeds._default;
4157          }
4158        }
4159      }
4160      if (opt.queue == null || opt.queue === true) {
4161        opt.queue = "fx";
4162      }
4163      opt.old = opt.complete;
4164      opt.complete = function() {
4165        if (isFunction(opt.old)) {
4166          opt.old.call(this);
4167        }
4168        if (opt.queue) {
4169          jQuery2.dequeue(this, opt.queue);
4170        }
4171      };
4172      return opt;
4173    };
4174    jQuery2.fn.extend({
4175      fadeTo: function(speed, to, easing, callback) {
4176        return this.filter(isHiddenWithinTree).css("opacity", 0).show().end().animate({ opacity: to }, speed, easing, callback);
4177      },
4178      animate: function(prop, speed, easing, callback) {
4179        var empty = jQuery2.isEmptyObject(prop), optall = jQuery2.speed(speed, easing, callback), doAnimation = function() {
4180          var anim = Animation(this, jQuery2.extend({}, prop), optall);
4181          if (empty || dataPriv.get(this, "finish")) {
4182            anim.stop(true);
4183          }
4184        };
4185        doAnimation.finish = doAnimation;
4186        return empty || optall.queue === false ? this.each(doAnimation) : this.queue(optall.queue, doAnimation);
4187      },
4188      stop: function(type, clearQueue, gotoEnd) {
4189        var stopQueue = function(hooks) {
4190          var stop = hooks.stop;
4191          delete hooks.stop;
4192          stop(gotoEnd);
4193        };
4194        if (typeof type !== "string") {
4195          gotoEnd = clearQueue;
4196          clearQueue = type;
4197          type = undefined;
4198        }
4199        if (clearQueue) {
4200          this.queue(type || "fx", []);
4201        }
4202        return this.each(function() {
4203          var dequeue = true, index = type != null && type + "queueHooks", timers = jQuery2.timers, data = dataPriv.get(this);
4204          if (index) {
4205            if (data[index] && data[index].stop) {
4206              stopQueue(data[index]);
4207            }
4208          } else {
4209            for (index in data) {
4210              if (data[index] && data[index].stop && rrun.test(index)) {
4211                stopQueue(data[index]);
4212              }
4213            }
4214          }
4215          for (index = timers.length;index--; ) {
4216            if (timers[index].elem === this && (type == null || timers[index].queue === type)) {
4217              timers[index].anim.stop(gotoEnd);
4218              dequeue = false;
4219              timers.splice(index, 1);
4220            }
4221          }
4222          if (dequeue || !gotoEnd) {
4223            jQuery2.dequeue(this, type);
4224          }
4225        });
4226      },
4227      finish: function(type) {
4228        if (type !== false) {
4229          type = type || "fx";
4230        }
4231        return this.each(function() {
4232          var index, data = dataPriv.get(this), queue = data[type + "queue"], hooks = data[type + "queueHooks"], timers = jQuery2.timers, length = queue ? queue.length : 0;
4233          data.finish = true;
4234          jQuery2.queue(this, type, []);
4235          if (hooks && hooks.stop) {
4236            hooks.stop.call(this, true);
4237          }
4238          for (index = timers.length;index--; ) {
4239            if (timers[index].elem === this && timers[index].queue === type) {
4240              timers[index].anim.stop(true);
4241              timers.splice(index, 1);
4242            }
4243          }
4244          for (index = 0;index < length; index++) {
4245            if (queue[index] && queue[index].finish) {
4246              queue[index].finish.call(this);
4247            }
4248          }
4249          delete data.finish;
4250        });
4251      }
4252    });
4253    jQuery2.each(["toggle", "show", "hide"], function(_i, name) {
4254      var cssFn = jQuery2.fn[name];
4255      jQuery2.fn[name] = function(speed, easing, callback) {
4256        return speed == null || typeof speed === "boolean" ? cssFn.apply(this, arguments) : this.animate(genFx(name, true), speed, easing, callback);
4257      };
4258    });
4259    jQuery2.each({
4260      slideDown: genFx("show"),
4261      slideUp: genFx("hide"),
4262      slideToggle: genFx("toggle"),
4263      fadeIn: { opacity: "show" },
4264      fadeOut: { opacity: "hide" },
4265      fadeToggle: { opacity: "toggle" }
4266    }, function(name, props) {
4267      jQuery2.fn[name] = function(speed, easing, callback) {
4268        return this.animate(props, speed, easing, callback);
4269      };
4270    });
4271    jQuery2.timers = [];
4272    jQuery2.fx.tick = function() {
4273      var timer, i = 0, timers = jQuery2.timers;
4274      fxNow = Date.now();
4275      for (;i < timers.length; i++) {
4276        timer = timers[i];
4277        if (!timer() && timers[i] === timer) {
4278          timers.splice(i--, 1);
4279        }
4280      }
4281      if (!timers.length) {
4282        jQuery2.fx.stop();
4283      }
4284      fxNow = undefined;
4285    };
4286    jQuery2.fx.timer = function(timer) {
4287      jQuery2.timers.push(timer);
4288      jQuery2.fx.start();
4289    };
4290    jQuery2.fx.interval = 13;
4291    jQuery2.fx.start = function() {
4292      if (inProgress) {
4293        return;
4294      }
4295      inProgress = true;
4296      schedule();
4297    };
4298    jQuery2.fx.stop = function() {
4299      inProgress = null;
4300    };
4301    jQuery2.fx.speeds = {
4302      slow: 600,
4303      fast: 200,
4304      _default: 400
4305    };
4306    jQuery2.fn.delay = function(time, type) {
4307      time = jQuery2.fx ? jQuery2.fx.speeds[time] || time : time;
4308      type = type || "fx";
4309      return this.queue(type, function(next, hooks) {
4310        var timeout = window2.setTimeout(next, time);
4311        hooks.stop = function() {
4312          window2.clearTimeout(timeout);
4313        };
4314      });
4315    };
4316    (function() {
4317      var input = document2.createElement("input"), select2 = document2.createElement("select"), opt = select2.appendChild(document2.createElement("option"));
4318      input.type = "checkbox";
4319      support.checkOn = input.value !== "";
4320      support.optSelected = opt.selected;
4321      input = document2.createElement("input");
4322      input.value = "t";
4323      input.type = "radio";
4324      support.radioValue = input.value === "t";
4325    })();
4326    var boolHook, attrHandle = jQuery2.expr.attrHandle;
4327    jQuery2.fn.extend({
4328      attr: function(name, value) {
4329        return access(this, jQuery2.attr, name, value, arguments.length > 1);
4330      },
4331      removeAttr: function(name) {
4332        return this.each(function() {
4333          jQuery2.removeAttr(this, name);
4334        });
4335      }
4336    });
4337    jQuery2.extend({
4338      attr: function(elem, name, value) {
4339        var ret2, hooks, nType = elem.nodeType;
4340        if (nType === 3 || nType === 8 || nType === 2) {
4341          return;
4342        }
4343        if (typeof elem.getAttribute === "undefined") {
4344          return jQuery2.prop(elem, name, value);
4345        }
4346        if (nType !== 1 || !jQuery2.isXMLDoc(elem)) {
4347          hooks = jQuery2.attrHooks[name.toLowerCase()] || (jQuery2.expr.match.bool.test(name) ? boolHook : undefined);
4348        }
4349        if (value !== undefined) {
4350          if (value === null) {
4351            jQuery2.removeAttr(elem, name);
4352            return;
4353          }
4354          if (hooks && "set" in hooks && (ret2 = hooks.set(elem, value, name)) !== undefined) {
4355            return ret2;
4356          }
4357          elem.setAttribute(name, value + "");
4358          return value;
4359        }
4360        if (hooks && "get" in hooks && (ret2 = hooks.get(elem, name)) !== null) {
4361          return ret2;
4362        }
4363        ret2 = jQuery2.find.attr(elem, name);
4364        return ret2 == null ? undefined : ret2;
4365      },
4366      attrHooks: {
4367        type: {
4368          set: function(elem, value) {
4369            if (!support.radioValue && value === "radio" && nodeName(elem, "input")) {
4370              var val = elem.value;
4371              elem.setAttribute("type", value);
4372              if (val) {
4373                elem.value = val;
4374              }
4375              return value;
4376            }
4377          }
4378        }
4379      },
4380      removeAttr: function(elem, value) {
4381        var name, i = 0, attrNames = value && value.match(rnothtmlwhite);
4382        if (attrNames && elem.nodeType === 1) {
4383          while (name = attrNames[i++]) {
4384            elem.removeAttribute(name);
4385          }
4386        }
4387      }
4388    });
4389    boolHook = {
4390      set: function(elem, value, name) {
4391        if (value === false) {
4392          jQuery2.removeAttr(elem, name);
4393        } else {
4394          elem.setAttribute(name, name);
4395        }
4396        return name;
4397      }
4398    };
4399    jQuery2.each(jQuery2.expr.match.bool.source.match(/\w+/g), function(_i, name) {
4400      var getter = attrHandle[name] || jQuery2.find.attr;
4401      attrHandle[name] = function(elem, name, isXML) {
4402        var ret2, handle, lowercaseName = name.toLowerCase();
4403        if (!isXML) {
4404          handle = attrHandle[lowercaseName];
4405          attrHandle[lowercaseName] = ret2;
4406          ret2 = getter(elem, name, isXML) != null ? lowercaseName : null;
4407          attrHandle[lowercaseName] = handle;
4408        }
4409        return ret2;
4410      };
4411    });
4412    var rfocusable = /^(?:input|select|textarea|button)$/i, rclickable = /^(?:a|area)$/i;
4413    jQuery2.fn.extend({
4414      prop: function(name, value) {
4415        return access(this, jQuery2.prop, name, value, arguments.length > 1);
4416      },
4417      removeProp: function(name) {
4418        return this.each(function() {
4419          delete this[jQuery2.propFix[name] || name];
4420        });
4421      }
4422    });
4423    jQuery2.extend({
4424      prop: function(elem, name, value) {
4425        var ret2, hooks, nType = elem.nodeType;
4426        if (nType === 3 || nType === 8 || nType === 2) {
4427          return;
4428        }
4429        if (nType !== 1 || !jQuery2.isXMLDoc(elem)) {
4430          name = jQuery2.propFix[name] || name;
4431          hooks = jQuery2.propHooks[name];
4432        }
4433        if (value !== undefined) {
4434          if (hooks && "set" in hooks && (ret2 = hooks.set(elem, value, name)) !== undefined) {
4435            return ret2;
4436          }
4437          return elem[name] = value;
4438        }
4439        if (hooks && "get" in hooks && (ret2 = hooks.get(elem, name)) !== null) {
4440          return ret2;
4441        }
4442        return elem[name];
4443      },
4444      propHooks: {
4445        tabIndex: {
4446          get: function(elem) {
4447            var tabindex = jQuery2.find.attr(elem, "tabindex");
4448            if (tabindex) {
4449              return parseInt(tabindex, 10);
4450            }
4451            if (rfocusable.test(elem.nodeName) || rclickable.test(elem.nodeName) && elem.href) {
4452              return 0;
4453            }
4454            return -1;
4455          }
4456        }
4457      },
4458      propFix: {
4459        for: "htmlFor",
4460        class: "className"
4461      }
4462    });
4463    if (!support.optSelected) {
4464      jQuery2.propHooks.selected = {
4465        get: function(elem) {
4466          var parent = elem.parentNode;
4467          if (parent && parent.parentNode) {
4468            parent.parentNode.selectedIndex;
4469          }
4470          return null;
4471        },
4472        set: function(elem) {
4473          var parent = elem.parentNode;
4474          if (parent) {
4475            parent.selectedIndex;
4476            if (parent.parentNode) {
4477              parent.parentNode.selectedIndex;
4478            }
4479          }
4480        }
4481      };
4482    }
4483    jQuery2.each([
4484      "tabIndex",
4485      "readOnly",
4486      "maxLength",
4487      "cellSpacing",
4488      "cellPadding",
4489      "rowSpan",
4490      "colSpan",
4491      "useMap",
4492      "frameBorder",
4493      "contentEditable"
4494    ], function() {
4495      jQuery2.propFix[this.toLowerCase()] = this;
4496    });
4497    function stripAndCollapse(value) {
4498      var tokens = value.match(rnothtmlwhite) || [];
4499      return tokens.join(" ");
4500    }
4501    function getClass(elem) {
4502      return elem.getAttribute && elem.getAttribute("class") || "";
4503    }
4504    function classesToArray(value) {
4505      if (Array.isArray(value)) {
4506        return value;
4507      }
4508      if (typeof value === "string") {
4509        return value.match(rnothtmlwhite) || [];
4510      }
4511      return [];
4512    }
4513    jQuery2.fn.extend({
4514      addClass: function(value) {
4515        var classNames, cur, curValue, className, i, finalValue;
4516        if (isFunction(value)) {
4517          return this.each(function(j) {
4518            jQuery2(this).addClass(value.call(this, j, getClass(this)));
4519          });
4520        }
4521        classNames = classesToArray(value);
4522        if (classNames.length) {
4523          return this.each(function() {
4524            curValue = getClass(this);
4525            cur = this.nodeType === 1 && " " + stripAndCollapse(curValue) + " ";
4526            if (cur) {
4527              for (i = 0;i < classNames.length; i++) {
4528                className = classNames[i];
4529                if (cur.indexOf(" " + className + " ") < 0) {
4530                  cur += className + " ";
4531                }
4532              }
4533              finalValue = stripAndCollapse(cur);
4534              if (curValue !== finalValue) {
4535                this.setAttribute("class", finalValue);
4536              }
4537            }
4538          });
4539        }
4540        return this;
4541      },
4542      removeClass: function(value) {
4543        var classNames, cur, curValue, className, i, finalValue;
4544        if (isFunction(value)) {
4545          return this.each(function(j) {
4546            jQuery2(this).removeClass(value.call(this, j, getClass(this)));
4547          });
4548        }
4549        if (!arguments.length) {
4550          return this.attr("class", "");
4551        }
4552        classNames = classesToArray(value);
4553        if (classNames.length) {
4554          return this.each(function() {
4555            curValue = getClass(this);
4556            cur = this.nodeType === 1 && " " + stripAndCollapse(curValue) + " ";
4557            if (cur) {
4558              for (i = 0;i < classNames.length; i++) {
4559                className = classNames[i];
4560                while (cur.indexOf(" " + className + " ") > -1) {
4561                  cur = cur.replace(" " + className + " ", " ");
4562                }
4563              }
4564              finalValue = stripAndCollapse(cur);
4565              if (curValue !== finalValue) {
4566                this.setAttribute("class", finalValue);
4567              }
4568            }
4569          });
4570        }
4571        return this;
4572      },
4573      toggleClass: function(value, stateVal) {
4574        var classNames, className, i, self2, type = typeof value, isValidValue = type === "string" || Array.isArray(value);
4575        if (isFunction(value)) {
4576          return this.each(function(i) {
4577            jQuery2(this).toggleClass(value.call(this, i, getClass(this), stateVal), stateVal);
4578          });
4579        }
4580        if (typeof stateVal === "boolean" && isValidValue) {
4581          return stateVal ? this.addClass(value) : this.removeClass(value);
4582        }
4583        classNames = classesToArray(value);
4584        return this.each(function() {
4585          if (isValidValue) {
4586            self2 = jQuery2(this);
4587            for (i = 0;i < classNames.length; i++) {
4588              className = classNames[i];
4589              if (self2.hasClass(className)) {
4590                self2.removeClass(className);
4591              } else {
4592                self2.addClass(className);
4593              }
4594            }
4595          } else if (value === undefined || type === "boolean") {
4596            className = getClass(this);
4597            if (className) {
4598              dataPriv.set(this, "__className__", className);
4599            }
4600            if (this.setAttribute) {
4601              this.setAttribute("class", className || value === false ? "" : dataPriv.get(this, "__className__") || "");
4602            }
4603          }
4604        });
4605      },
4606      hasClass: function(selector) {
4607        var className, elem, i = 0;
4608        className = " " + selector + " ";
4609        while (elem = this[i++]) {
4610          if (elem.nodeType === 1 && (" " + stripAndCollapse(getClass(elem)) + " ").indexOf(className) > -1) {
4611            return true;
4612          }
4613        }
4614        return false;
4615      }
4616    });
4617    var rreturn = /\r/g;
4618    jQuery2.fn.extend({
4619      val: function(value) {
4620        var hooks, ret2, valueIsFunction, elem = this[0];
4621        if (!arguments.length) {
4622          if (elem) {
4623            hooks = jQuery2.valHooks[elem.type] || jQuery2.valHooks[elem.nodeName.toLowerCase()];
4624            if (hooks && "get" in hooks && (ret2 = hooks.get(elem, "value")) !== undefined) {
4625              return ret2;
4626            }
4627            ret2 = elem.value;
4628            if (typeof ret2 === "string") {
4629              return ret2.replace(rreturn, "");
4630            }
4631            return ret2 == null ? "" : ret2;
4632          }
4633          return;
4634        }
4635        valueIsFunction = isFunction(value);
4636        return this.each(function(i) {
4637          var val;
4638          if (this.nodeType !== 1) {
4639            return;
4640          }
4641          if (valueIsFunction) {
4642            val = value.call(this, i, jQuery2(this).val());
4643          } else {
4644            val = value;
4645          }
4646          if (val == null) {
4647            val = "";
4648          } else if (typeof val === "number") {
4649            val += "";
4650          } else if (Array.isArray(val)) {
4651            val = jQuery2.map(val, function(value) {
4652              return value == null ? "" : value + "";
4653            });
4654          }
4655          hooks = jQuery2.valHooks[this.type] || jQuery2.valHooks[this.nodeName.toLowerCase()];
4656          if (!hooks || !("set" in hooks) || hooks.set(this, val, "value") === undefined) {
4657            this.value = val;
4658          }
4659        });
4660      }
4661    });
4662    jQuery2.extend({
4663      valHooks: {
4664        option: {
4665          get: function(elem) {
4666            var val = jQuery2.find.attr(elem, "value");
4667            return val != null ? val : stripAndCollapse(jQuery2.text(elem));
4668          }
4669        },
4670        select: {
4671          get: function(elem) {
4672            var value, option, i, { options: options2, selectedIndex: index } = elem, one = elem.type === "select-one", values = one ? null : [], max = one ? index + 1 : options2.length;
4673            if (index < 0) {
4674              i = max;
4675            } else {
4676              i = one ? index : 0;
4677            }
4678            for (;i < max; i++) {
4679              option = options2[i];
4680              if ((option.selected || i === index) && !option.disabled && (!option.parentNode.disabled || !nodeName(option.parentNode, "optgroup"))) {
4681                value = jQuery2(option).val();
4682                if (one) {
4683                  return value;
4684                }
4685                values.push(value);
4686              }
4687            }
4688            return values;
4689          },
4690          set: function(elem, value) {
4691            var optionSet, option, options2 = elem.options, values = jQuery2.makeArray(value), i = options2.length;
4692            while (i--) {
4693              option = options2[i];
4694              if (option.selected = jQuery2.inArray(jQuery2.valHooks.option.get(option), values) > -1) {
4695                optionSet = true;
4696              }
4697            }
4698            if (!optionSet) {
4699              elem.selectedIndex = -1;
4700            }
4701            return values;
4702          }
4703        }
4704      }
4705    });
4706    jQuery2.each(["radio", "checkbox"], function() {
4707      jQuery2.valHooks[this] = {
4708        set: function(elem, value) {
4709          if (Array.isArray(value)) {
4710            return elem.checked = jQuery2.inArray(jQuery2(elem).val(), value) > -1;
4711          }
4712        }
4713      };
4714      if (!support.checkOn) {
4715        jQuery2.valHooks[this].get = function(elem) {
4716          return elem.getAttribute("value") === null ? "on" : elem.value;
4717        };
4718      }
4719    });
4720    var location2 = window2.location;
4721    var nonce = { guid: Date.now() };
4722    var rquery = /\?/;
4723    jQuery2.parseXML = function(data) {
4724      var xml, parserErrorElem;
4725      if (!data || typeof data !== "string") {
4726        return null;
4727      }
4728      try {
4729        xml = new window2.DOMParser().parseFromString(data, "text/xml");
4730      } catch (e) {}
4731      parserErrorElem = xml && xml.getElementsByTagName("parsererror")[0];
4732      if (!xml || parserErrorElem) {
4733        jQuery2.error("Invalid XML: " + (parserErrorElem ? jQuery2.map(parserErrorElem.childNodes, function(el) {
4734          return el.textContent;
4735        }).join(`
4736`) : data));
4737      }
4738      return xml;
4739    };
4740    var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, stopPropagationCallback = function(e) {
4741      e.stopPropagation();
4742    };
4743    jQuery2.extend(jQuery2.event, {
4744      trigger: function(event, data, elem, onlyHandlers) {
4745        var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, eventPath = [elem || document2], type = hasOwn.call(event, "type") ? event.type : event, namespaces = hasOwn.call(event, "namespace") ? event.namespace.split(".") : [];
4746        cur = lastElement = tmp = elem = elem || document2;
4747        if (elem.nodeType === 3 || elem.nodeType === 8) {
4748          return;
4749        }
4750        if (rfocusMorph.test(type + jQuery2.event.triggered)) {
4751          return;
4752        }
4753        if (type.indexOf(".") > -1) {
4754          namespaces = type.split(".");
4755          type = namespaces.shift();
4756          namespaces.sort();
4757        }
4758        ontype = type.indexOf(":") < 0 && "on" + type;
4759        event = event[jQuery2.expando] ? event : new jQuery2.Event(type, typeof event === "object" && event);
4760        event.isTrigger = onlyHandlers ? 2 : 3;
4761        event.namespace = namespaces.join(".");
4762        event.rnamespace = event.namespace ? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
4763        event.result = undefined;
4764        if (!event.target) {
4765          event.target = elem;
4766        }
4767        data = data == null ? [event] : jQuery2.makeArray(data, [event]);
4768        special = jQuery2.event.special[type] || {};
4769        if (!onlyHandlers && special.trigger && special.trigger.apply(elem, data) === false) {
4770          return;
4771        }
4772        if (!onlyHandlers && !special.noBubble && !isWindow(elem)) {
4773          bubbleType = special.delegateType || type;
4774          if (!rfocusMorph.test(bubbleType + type)) {
4775            cur = cur.parentNode;
4776          }
4777          for (;cur; cur = cur.parentNode) {
4778            eventPath.push(cur);
4779            tmp = cur;
4780          }
4781          if (tmp === (elem.ownerDocument || document2)) {
4782            eventPath.push(tmp.defaultView || tmp.parentWindow || window2);
4783          }
4784        }
4785        i = 0;
4786        while ((cur = eventPath[i++]) && !event.isPropagationStopped()) {
4787          lastElement = cur;
4788          event.type = i > 1 ? bubbleType : special.bindType || type;
4789          handle = (dataPriv.get(cur, "events") || Object.create(null))[event.type] && dataPriv.get(cur, "handle");
4790          if (handle) {
4791            handle.apply(cur, data);
4792          }
4793          handle = ontype && cur[ontype];
4794          if (handle && handle.apply && acceptData(cur)) {
4795            event.result = handle.apply(cur, data);
4796            if (event.result === false) {
4797              event.preventDefault();
4798            }
4799          }
4800        }
4801        event.type = type;
4802        if (!onlyHandlers && !event.isDefaultPrevented()) {
4803          if ((!special._default || special._default.apply(eventPath.pop(), data) === false) && acceptData(elem)) {
4804            if (ontype && isFunction(elem[type]) && !isWindow(elem)) {
4805              tmp = elem[ontype];
4806              if (tmp) {
4807                elem[ontype] = null;
4808              }
4809              jQuery2.event.triggered = type;
4810              if (event.isPropagationStopped()) {
4811                lastElement.addEventListener(type, stopPropagationCallback);
4812              }
4813              elem[type]();
4814              if (event.isPropagationStopped()) {
4815                lastElement.removeEventListener(type, stopPropagationCallback);
4816              }
4817              jQuery2.event.triggered = undefined;
4818              if (tmp) {
4819                elem[ontype] = tmp;
4820              }
4821            }
4822          }
4823        }
4824        return event.result;
4825      },
4826      simulate: function(type, elem, event) {
4827        var e = jQuery2.extend(new jQuery2.Event, event, {
4828          type,
4829          isSimulated: true
4830        });
4831        jQuery2.event.trigger(e, null, elem);
4832      }
4833    });
4834    jQuery2.fn.extend({
4835      trigger: function(type, data) {
4836        return this.each(function() {
4837          jQuery2.event.trigger(type, data, this);
4838        });
4839      },
4840      triggerHandler: function(type, data) {
4841        var elem = this[0];
4842        if (elem) {
4843          return jQuery2.event.trigger(type, data, elem, true);
4844        }
4845      }
4846    });
4847    var rbracket = /\[\]$/, rCRLF = /\r?\n/g, rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, rsubmittable = /^(?:input|select|textarea|keygen)/i;
4848    function buildParams(prefix, obj2, traditional, add) {
4849      var name;
4850      if (Array.isArray(obj2)) {
4851        jQuery2.each(obj2, function(i, v) {
4852          if (traditional || rbracket.test(prefix)) {
4853            add(prefix, v);
4854          } else {
4855            buildParams(prefix + "[" + (typeof v === "object" && v != null ? i : "") + "]", v, traditional, add);
4856          }
4857        });
4858      } else if (!traditional && toType(obj2) === "object") {
4859        for (name in obj2) {
4860          buildParams(prefix + "[" + name + "]", obj2[name], traditional, add);
4861        }
4862      } else {
4863        add(prefix, obj2);
4864      }
4865    }
4866    jQuery2.param = function(a, traditional) {
4867      var prefix, s = [], add = function(key, valueOrFunction) {
4868        var value = isFunction(valueOrFunction) ? valueOrFunction() : valueOrFunction;
4869        s[s.length] = encodeURIComponent(key) + "=" + encodeURIComponent(value == null ? "" : value);
4870      };
4871      if (a == null) {
4872        return "";
4873      }
4874      if (Array.isArray(a) || a.jquery && !jQuery2.isPlainObject(a)) {
4875        jQuery2.each(a, function() {
4876          add(this.name, this.value);
4877        });
4878      } else {
4879        for (prefix in a) {
4880          buildParams(prefix, a[prefix], traditional, add);
4881        }
4882      }
4883      return s.join("&");
4884    };
4885    jQuery2.fn.extend({
4886      serialize: function() {
4887        return jQuery2.param(this.serializeArray());
4888      },
4889      serializeArray: function() {
4890        return this.map(function() {
4891          var elements = jQuery2.prop(this, "elements");
4892          return elements ? jQuery2.makeArray(elements) : this;
4893        }).filter(function() {
4894          var type = this.type;
4895          return this.name && !jQuery2(this).is(":disabled") && rsubmittable.test(this.nodeName) && !rsubmitterTypes.test(type) && (this.checked || !rcheckableType.test(type));
4896        }).map(function(_i, elem) {
4897          var val = jQuery2(this).val();
4898          if (val == null) {
4899            return null;
4900          }
4901          if (Array.isArray(val)) {
4902            return jQuery2.map(val, function(val) {
4903              return { name: elem.name, value: val.replace(rCRLF, `\r
4904`) };
4905            });
4906          }
4907          return { name: elem.name, value: val.replace(rCRLF, `\r
4908`) };
4909        }).get();
4910      }
4911    });
4912    var r20 = /%20/g, rhash = /#.*$/, rantiCache = /([?&])_=[^&]*/, rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, rnoContent = /^(?:GET|HEAD)$/, rprotocol = /^\/\//, prefilters = {}, transports = {}, allTypes = "*/".concat("*"), originAnchor = document2.createElement("a");
4913    originAnchor.href = location2.href;
4914    function addToPrefiltersOrTransports(structure) {
4915      return function(dataTypeExpression, func) {
4916        if (typeof dataTypeExpression !== "string") {
4917          func = dataTypeExpression;
4918          dataTypeExpression = "*";
4919        }
4920        var dataType, i = 0, dataTypes = dataTypeExpression.toLowerCase().match(rnothtmlwhite) || [];
4921        if (isFunction(func)) {
4922          while (dataType = dataTypes[i++]) {
4923            if (dataType[0] === "+") {
4924              dataType = dataType.slice(1) || "*";
4925              (structure[dataType] = structure[dataType] || []).unshift(func);
4926            } else {
4927              (structure[dataType] = structure[dataType] || []).push(func);
4928            }
4929          }
4930        }
4931      };
4932    }
4933    function inspectPrefiltersOrTransports(structure, options2, originalOptions, jqXHR) {
4934      var inspected = {}, seekingTransport = structure === transports;
4935      function inspect(dataType) {
4936        var selected;
4937        inspected[dataType] = true;
4938        jQuery2.each(structure[dataType] || [], function(_, prefilterOrFactory) {
4939          var dataTypeOrTransport = prefilterOrFactory(options2, originalOptions, jqXHR);
4940          if (typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[dataTypeOrTransport]) {
4941            options2.dataTypes.unshift(dataTypeOrTransport);
4942            inspect(dataTypeOrTransport);
4943            return false;
4944          } else if (seekingTransport) {
4945            return !(selected = dataTypeOrTransport);
4946          }
4947        });
4948        return selected;
4949      }
4950      return inspect(options2.dataTypes[0]) || !inspected["*"] && inspect("*");
4951    }
4952    function ajaxExtend(target, src) {
4953      var key, deep, flatOptions = jQuery2.ajaxSettings.flatOptions || {};
4954      for (key in src) {
4955        if (src[key] !== undefined) {
4956          (flatOptions[key] ? target : deep || (deep = {}))[key] = src[key];
4957        }
4958      }
4959      if (deep) {
4960        jQuery2.extend(true, target, deep);
4961      }
4962      return target;
4963    }
4964    function ajaxHandleResponses(s, jqXHR, responses) {
4965      var ct, type, finalDataType, firstDataType, { contents, dataTypes } = s;
4966      while (dataTypes[0] === "*") {
4967        dataTypes.shift();
4968        if (ct === undefined) {
4969          ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
4970        }
4971      }
4972      if (ct) {
4973        for (type in contents) {
4974          if (contents[type] && contents[type].test(ct)) {
4975            dataTypes.unshift(type);
4976            break;
4977          }
4978        }
4979      }
4980      if (dataTypes[0] in responses) {
4981        finalDataType = dataTypes[0];
4982      } else {
4983        for (type in responses) {
4984          if (!dataTypes[0] || s.converters[type + " " + dataTypes[0]]) {
4985            finalDataType = type;
4986            break;
4987          }
4988          if (!firstDataType) {
4989            firstDataType = type;
4990          }
4991        }
4992        finalDataType = finalDataType || firstDataType;
4993      }
4994      if (finalDataType) {
4995        if (finalDataType !== dataTypes[0]) {
4996          dataTypes.unshift(finalDataType);
4997        }
4998        return responses[finalDataType];
4999      }
5000    }
5001    function ajaxConvert(s, response, jqXHR, isSuccess) {
5002      var conv2, current, conv, tmp, prev, converters = {}, dataTypes = s.dataTypes.slice();
5003      if (dataTypes[1]) {
5004        for (conv in s.converters) {
5005          converters[conv.toLowerCase()] = s.converters[conv];
5006        }
5007      }
5008      current = dataTypes.shift();
5009      while (current) {
5010        if (s.responseFields[current]) {
5011          jqXHR[s.responseFields[current]] = response;
5012        }
5013        if (!prev && isSuccess && s.dataFilter) {
5014          response = s.dataFilter(response, s.dataType);
5015        }
5016        prev = current;
5017        current = dataTypes.shift();
5018        if (current) {
5019          if (current === "*") {
5020            current = prev;
5021          } else if (prev !== "*" && prev !== current) {
5022            conv = converters[prev + " " + current] || converters["* " + current];
5023            if (!conv) {
5024              for (conv2 in converters) {
5025                tmp = conv2.split(" ");
5026                if (tmp[1] === current) {
5027                  conv = converters[prev + " " + tmp[0]] || converters["* " + tmp[0]];
5028                  if (conv) {
5029                    if (conv === true) {
5030                      conv = converters[conv2];
5031                    } else if (converters[conv2] !== true) {
5032                      current = tmp[0];
5033                      dataTypes.unshift(tmp[1]);
5034                    }
5035                    break;
5036                  }
5037                }
5038              }
5039            }
5040            if (conv !== true) {
5041              if (conv && s.throws) {
5042                response = conv(response);
5043              } else {
5044                try {
5045                  response = conv(response);
5046                } catch (e) {
5047                  return {
5048                    state: "parsererror",
5049                    error: conv ? e : "No conversion from " + prev + " to " + current
5050                  };
5051                }
5052              }
5053            }
5054          }
5055        }
5056      }
5057      return { state: "success", data: response };
5058    }
5059    jQuery2.extend({
5060      active: 0,
5061      lastModified: {},
5062      etag: {},
5063      ajaxSettings: {
5064        url: location2.href,
5065        type: "GET",
5066        isLocal: rlocalProtocol.test(location2.protocol),
5067        global: true,
5068        processData: true,
5069        async: true,
5070        contentType: "application/x-www-form-urlencoded; charset=UTF-8",
5071        accepts: {
5072          "*": allTypes,
5073          text: "text/plain",
5074          html: "text/html",
5075          xml: "application/xml, text/xml",
5076          json: "application/json, text/javascript"
5077        },
5078        contents: {
5079          xml: /\bxml\b/,
5080          html: /\bhtml/,
5081          json: /\bjson\b/
5082        },
5083        responseFields: {
5084          xml: "responseXML",
5085          text: "responseText",
5086          json: "responseJSON"
5087        },
5088        converters: {
5089          "* text": String,
5090          "text html": true,
5091          "text json": JSON.parse,
5092          "text xml": jQuery2.parseXML
5093        },
5094        flatOptions: {
5095          url: true,
5096          context: true
5097        }
5098      },
5099      ajaxSetup: function(target, settings2) {
5100        return settings2 ? ajaxExtend(ajaxExtend(target, jQuery2.ajaxSettings), settings2) : ajaxExtend(jQuery2.ajaxSettings, target);
5101      },
5102      ajaxPrefilter: addToPrefiltersOrTransports(prefilters),
5103      ajaxTransport: addToPrefiltersOrTransports(transports),
5104      ajax: function(url, options2) {
5105        if (typeof url === "object") {
5106          options2 = url;
5107          url = undefined;
5108        }
5109        options2 = options2 || {};
5110        var transport, cacheURL, responseHeadersString, responseHeaders, timeoutTimer, urlAnchor, completed, fireGlobals, i, uncached, s = jQuery2.ajaxSetup({}, options2), callbackContext = s.context || s, globalEventContext = s.context && (callbackContext.nodeType || callbackContext.jquery) ? jQuery2(callbackContext) : jQuery2.event, deferred2 = jQuery2.Deferred(), completeDeferred = jQuery2.Callbacks("once memory"), statusCode = s.statusCode || {}, requestHeaders = {}, requestHeadersNames = {}, strAbort = "canceled", jqXHR = {
5111          readyState: 0,
5112          getResponseHeader: function(key) {
5113            var match;
5114            if (completed) {
5115              if (!responseHeaders) {
5116                responseHeaders = {};
5117                while (match = rheaders.exec(responseHeadersString)) {
5118                  responseHeaders[match[1].toLowerCase() + " "] = (responseHeaders[match[1].toLowerCase() + " "] || []).concat(match[2]);
5119                }
5120              }
5121              match = responseHeaders[key.toLowerCase() + " "];
5122            }
5123            return match == null ? null : match.join(", ");
5124          },
5125          getAllResponseHeaders: function() {
5126            return completed ? responseHeadersString : null;
5127          },
5128          setRequestHeader: function(name, value) {
5129            if (completed == null) {
5130              name = requestHeadersNames[name.toLowerCase()] = requestHeadersNames[name.toLowerCase()] || name;
5131              requestHeaders[name] = value;
5132            }
5133            return this;
5134          },
5135          overrideMimeType: function(type) {
5136            if (completed == null) {
5137              s.mimeType = type;
5138            }
5139            return this;
5140          },
5141          statusCode: function(map) {
5142            var code;
5143            if (map) {
5144              if (completed) {
5145                jqXHR.always(map[jqXHR.status]);
5146              } else {
5147                for (code in map) {
5148                  statusCode[code] = [statusCode[code], map[code]];
5149                }
5150              }
5151            }
5152            return this;
5153          },
5154          abort: function(statusText) {
5155            var finalText = statusText || strAbort;
5156            if (transport) {
5157              transport.abort(finalText);
5158            }
5159            done(0, finalText);
5160            return this;
5161          }
5162        };
5163        deferred2.promise(jqXHR);
5164        s.url = ((url || s.url || location2.href) + "").replace(rprotocol, location2.protocol + "//");
5165        s.type = options2.method || options2.type || s.method || s.type;
5166        s.dataTypes = (s.dataType || "*").toLowerCase().match(rnothtmlwhite) || [""];
5167        if (s.crossDomain == null) {
5168          urlAnchor = document2.createElement("a");
5169          try {
5170            urlAnchor.href = s.url;
5171            urlAnchor.href = urlAnchor.href;
5172            s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== urlAnchor.protocol + "//" + urlAnchor.host;
5173          } catch (e) {
5174            s.crossDomain = true;
5175          }
5176        }
5177        if (s.data && s.processData && typeof s.data !== "string") {
5178          s.data = jQuery2.param(s.data, s.traditional);
5179        }
5180        inspectPrefiltersOrTransports(prefilters, s, options2, jqXHR);
5181        if (completed) {
5182          return jqXHR;
5183        }
5184        fireGlobals = jQuery2.event && s.global;
5185        if (fireGlobals && jQuery2.active++ === 0) {
5186          jQuery2.event.trigger("ajaxStart");
5187        }
5188        s.type = s.type.toUpperCase();
5189        s.hasContent = !rnoContent.test(s.type);
5190        cacheURL = s.url.replace(rhash, "");
5191        if (!s.hasContent) {
5192          uncached = s.url.slice(cacheURL.length);
5193          if (s.data && (s.processData || typeof s.data === "string")) {
5194            cacheURL += (rquery.test(cacheURL) ? "&" : "?") + s.data;
5195            delete s.data;
5196          }
5197          if (s.cache === false) {
5198            cacheURL = cacheURL.replace(rantiCache, "$1");
5199            uncached = (rquery.test(cacheURL) ? "&" : "?") + "_=" + nonce.guid++ + uncached;
5200          }
5201          s.url = cacheURL + uncached;
5202        } else if (s.data && s.processData && (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0) {
5203          s.data = s.data.replace(r20, "+");
5204        }
5205        if (s.ifModified) {
5206          if (jQuery2.lastModified[cacheURL]) {
5207            jqXHR.setRequestHeader("If-Modified-Since", jQuery2.lastModified[cacheURL]);
5208          }
5209          if (jQuery2.etag[cacheURL]) {
5210            jqXHR.setRequestHeader("If-None-Match", jQuery2.etag[cacheURL]);
5211          }
5212        }
5213        if (s.data && s.hasContent && s.contentType !== false || options2.contentType) {
5214          jqXHR.setRequestHeader("Content-Type", s.contentType);
5215        }
5216        jqXHR.setRequestHeader("Accept", s.dataTypes[0] && s.accepts[s.dataTypes[0]] ? s.accepts[s.dataTypes[0]] + (s.dataTypes[0] !== "*" ? ", " + allTypes + "; q=0.01" : "") : s.accepts["*"]);
5217        for (i in s.headers) {
5218          jqXHR.setRequestHeader(i, s.headers[i]);
5219        }
5220        if (s.beforeSend && (s.beforeSend.call(callbackContext, jqXHR, s) === false || completed)) {
5221          return jqXHR.abort();
5222        }
5223        strAbort = "abort";
5224        completeDeferred.add(s.complete);
5225        jqXHR.done(s.success);
5226        jqXHR.fail(s.error);
5227        transport = inspectPrefiltersOrTransports(transports, s, options2, jqXHR);
5228        if (!transport) {
5229          done(-1, "No Transport");
5230        } else {
5231          jqXHR.readyState = 1;
5232          if (fireGlobals) {
5233            globalEventContext.trigger("ajaxSend", [jqXHR, s]);
5234          }
5235          if (completed) {
5236            return jqXHR;
5237          }
5238          if (s.async && s.timeout > 0) {
5239            timeoutTimer = window2.setTimeout(function() {
5240              jqXHR.abort("timeout");
5241            }, s.timeout);
5242          }
5243          try {
5244            completed = false;
5245            transport.send(requestHeaders, done);
5246          } catch (e) {
5247            if (completed) {
5248              throw e;
5249            }
5250            done(-1, e);
5251          }
5252        }
5253        function done(status, nativeStatusText, responses, headers) {
5254          var isSuccess, success, error, response, modified, statusText = nativeStatusText;
5255          if (completed) {
5256            return;
5257          }
5258          completed = true;
5259          if (timeoutTimer) {
5260            window2.clearTimeout(timeoutTimer);
5261          }
5262          transport = undefined;
5263          responseHeadersString = headers || "";
5264          jqXHR.readyState = status > 0 ? 4 : 0;
5265          isSuccess = status >= 200 && status < 300 || status === 304;
5266          if (responses) {
5267            response = ajaxHandleResponses(s, jqXHR, responses);
5268          }
5269          if (!isSuccess && jQuery2.inArray("script", s.dataTypes) > -1 && jQuery2.inArray("json", s.dataTypes) < 0) {
5270            s.converters["text script"] = function() {};
5271          }
5272          response = ajaxConvert(s, response, jqXHR, isSuccess);
5273          if (isSuccess) {
5274            if (s.ifModified) {
5275              modified = jqXHR.getResponseHeader("Last-Modified");
5276              if (modified) {
5277                jQuery2.lastModified[cacheURL] = modified;
5278              }
5279              modified = jqXHR.getResponseHeader("etag");
5280              if (modified) {
5281                jQuery2.etag[cacheURL] = modified;
5282              }
5283            }
5284            if (status === 204 || s.type === "HEAD") {
5285              statusText = "nocontent";
5286            } else if (status === 304) {
5287              statusText = "notmodified";
5288            } else {
5289              statusText = response.state;
5290              success = response.data;
5291              error = response.error;
5292              isSuccess = !error;
5293            }
5294          } else {
5295            error = statusText;
5296            if (status || !statusText) {
5297              statusText = "error";
5298              if (status < 0) {
5299                status = 0;
5300              }
5301            }
5302          }
5303          jqXHR.status = status;
5304          jqXHR.statusText = (nativeStatusText || statusText) + "";
5305          if (isSuccess) {
5306            deferred2.resolveWith(callbackContext, [success, statusText, jqXHR]);
5307          } else {
5308            deferred2.rejectWith(callbackContext, [jqXHR, statusText, error]);
5309          }
5310          jqXHR.statusCode(statusCode);
5311          statusCode = undefined;
5312          if (fireGlobals) {
5313            globalEventContext.trigger(isSuccess ? "ajaxSuccess" : "ajaxError", [jqXHR, s, isSuccess ? success : error]);
5314          }
5315          completeDeferred.fireWith(callbackContext, [jqXHR, statusText]);
5316          if (fireGlobals) {
5317            globalEventContext.trigger("ajaxComplete", [jqXHR, s]);
5318            if (!--jQuery2.active) {
5319              jQuery2.event.trigger("ajaxStop");
5320            }
5321          }
5322        }
5323        return jqXHR;
5324      },
5325      getJSON: function(url, data, callback) {
5326        return jQuery2.get(url, data, callback, "json");
5327      },
5328      getScript: function(url, callback) {
5329        return jQuery2.get(url, undefined, callback, "script");
5330      }
5331    });
5332    jQuery2.each(["get", "post"], function(_i, method) {
5333      jQuery2[method] = function(url, data, callback, type) {
5334        if (isFunction(data)) {
5335          type = type || callback;
5336          callback = data;
5337          data = undefined;
5338        }
5339        return jQuery2.ajax(jQuery2.extend({
5340          url,
5341          type: method,
5342          dataType: type,
5343          data,
5344          success: callback
5345        }, jQuery2.isPlainObject(url) && url));
5346      };
5347    });
5348    jQuery2.ajaxPrefilter(function(s) {
5349      var i;
5350      for (i in s.headers) {
5351        if (i.toLowerCase() === "content-type") {
5352          s.contentType = s.headers[i] || "";
5353        }
5354      }
5355    });
5356    jQuery2._evalUrl = function(url, options2, doc) {
5357      return jQuery2.ajax({
5358        url,
5359        type: "GET",
5360        dataType: "script",
5361        cache: true,
5362        async: false,
5363        global: false,
5364        converters: {
5365          "text script": function() {}
5366        },
5367        dataFilter: function(response) {
5368          jQuery2.globalEval(response, options2, doc);
5369        }
5370      });
5371    };
5372    jQuery2.fn.extend({
5373      wrapAll: function(html) {
5374        var wrap;
5375        if (this[0]) {
5376          if (isFunction(html)) {
5377            html = html.call(this[0]);
5378          }
5379          wrap = jQuery2(html, this[0].ownerDocument).eq(0).clone(true);
5380          if (this[0].parentNode) {
5381            wrap.insertBefore(this[0]);
5382          }
5383          wrap.map(function() {
5384            var elem = this;
5385            while (elem.firstElementChild) {
5386              elem = elem.firstElementChild;
5387            }
5388            return elem;
5389          }).append(this);
5390        }
5391        return this;
5392      },
5393      wrapInner: function(html) {
5394        if (isFunction(html)) {
5395          return this.each(function(i) {
5396            jQuery2(this).wrapInner(html.call(this, i));
5397          });
5398        }
5399        return this.each(function() {
5400          var self2 = jQuery2(this), contents = self2.contents();
5401          if (contents.length) {
5402            contents.wrapAll(html);
5403          } else {
5404            self2.append(html);
5405          }
5406        });
5407      },
5408      wrap: function(html) {
5409        var htmlIsFunction = isFunction(html);
5410        return this.each(function(i) {
5411          jQuery2(this).wrapAll(htmlIsFunction ? html.call(this, i) : html);
5412        });
5413      },
5414      unwrap: function(selector) {
5415        this.parent(selector).not("body").each(function() {
5416          jQuery2(this).replaceWith(this.childNodes);
5417        });
5418        return this;
5419      }
5420    });
5421    jQuery2.expr.pseudos.hidden = function(elem) {
5422      return !jQuery2.expr.pseudos.visible(elem);
5423    };
5424    jQuery2.expr.pseudos.visible = function(elem) {
5425      return !!(elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length);
5426    };
5427    jQuery2.ajaxSettings.xhr = function() {
5428      try {
5429        return new window2.XMLHttpRequest;
5430      } catch (e) {}
5431    };
5432    var xhrSuccessStatus = {
5433      0: 200,
5434      1223: 204
5435    }, xhrSupported = jQuery2.ajaxSettings.xhr();
5436    support.cors = !!xhrSupported && "withCredentials" in xhrSupported;
5437    support.ajax = xhrSupported = !!xhrSupported;
5438    jQuery2.ajaxTransport(function(options2) {
5439      var callback, errorCallback;
5440      if (support.cors || xhrSupported && !options2.crossDomain) {
5441        return {
5442          send: function(headers, complete) {
5443            var i, xhr = options2.xhr();
5444            xhr.open(options2.type, options2.url, options2.async, options2.username, options2.password);
5445            if (options2.xhrFields) {
5446              for (i in options2.xhrFields) {
5447                xhr[i] = options2.xhrFields[i];
5448              }
5449            }
5450            if (options2.mimeType && xhr.overrideMimeType) {
5451              xhr.overrideMimeType(options2.mimeType);
5452            }
5453            if (!options2.crossDomain && !headers["X-Requested-With"]) {
5454              headers["X-Requested-With"] = "XMLHttpRequest";
5455            }
5456            for (i in headers) {
5457              xhr.setRequestHeader(i, headers[i]);
5458            }
5459            callback = function(type) {
5460              return function() {
5461                if (callback) {
5462                  callback = errorCallback = xhr.onload = xhr.onerror = xhr.onabort = xhr.ontimeout = xhr.onreadystatechange = null;
5463                  if (type === "abort") {
5464                    xhr.abort();
5465                  } else if (type === "error") {
5466                    if (typeof xhr.status !== "number") {
5467                      complete(0, "error");
5468                    } else {
5469                      complete(xhr.status, xhr.statusText);
5470                    }
5471                  } else {
5472                    complete(xhrSuccessStatus[xhr.status] || xhr.status, xhr.statusText, (xhr.responseType || "text") !== "text" || typeof xhr.responseText !== "string" ? { binary: xhr.response } : { text: xhr.responseText }, xhr.getAllResponseHeaders());
5473                  }
5474                }
5475              };
5476            };
5477            xhr.onload = callback();
5478            errorCallback = xhr.onerror = xhr.ontimeout = callback("error");
5479            if (xhr.onabort !== undefined) {
5480              xhr.onabort = errorCallback;
5481            } else {
5482              xhr.onreadystatechange = function() {
5483                if (xhr.readyState === 4) {
5484                  window2.setTimeout(function() {
5485                    if (callback) {
5486                      errorCallback();
5487                    }
5488                  });
5489                }
5490              };
5491            }
5492            callback = callback("abort");
5493            try {
5494              xhr.send(options2.hasContent && options2.data || null);
5495            } catch (e) {
5496              if (callback) {
5497                throw e;
5498              }
5499            }
5500          },
5501          abort: function() {
5502            if (callback) {
5503              callback();
5504            }
5505          }
5506        };
5507      }
5508    });
5509    jQuery2.ajaxPrefilter(function(s) {
5510      if (s.crossDomain) {
5511        s.contents.script = false;
5512      }
5513    });
5514    jQuery2.ajaxSetup({
5515      accepts: {
5516        script: "text/javascript, application/javascript, " + "application/ecmascript, application/x-ecmascript"
5517      },
5518      contents: {
5519        script: /\b(?:java|ecma)script\b/
5520      },
5521      converters: {
5522        "text script": function(text2) {
5523          jQuery2.globalEval(text2);
5524          return text2;
5525        }
5526      }
5527    });
5528    jQuery2.ajaxPrefilter("script", function(s) {
5529      if (s.cache === undefined) {
5530        s.cache = false;
5531      }
5532      if (s.crossDomain) {
5533        s.type = "GET";
5534      }
5535    });
5536    jQuery2.ajaxTransport("script", function(s) {
5537      if (s.crossDomain || s.scriptAttrs) {
5538        var script, callback;
5539        return {
5540          send: function(_, complete) {
5541            script = jQuery2("<script>").attr(s.scriptAttrs || {}).prop({ charset: s.scriptCharset, src: s.url }).on("load error", callback = function(evt) {
5542              script.remove();
5543              callback = null;
5544              if (evt) {
5545                complete(evt.type === "error" ? 404 : 200, evt.type);
5546              }
5547            });
5548            document2.head.appendChild(script[0]);
5549          },
5550          abort: function() {
5551            if (callback) {
5552              callback();
5553            }
5554          }
5555        };
5556      }
5557    });
5558    var oldCallbacks = [], rjsonp = /(=)\?(?=&|$)|\?\?/;
5559    jQuery2.ajaxSetup({
5560      jsonp: "callback",
5561      jsonpCallback: function() {
5562        var callback = oldCallbacks.pop() || jQuery2.expando + "_" + nonce.guid++;
5563        this[callback] = true;
5564        return callback;
5565      }
5566    });
5567    jQuery2.ajaxPrefilter("json jsonp", function(s, originalSettings, jqXHR) {
5568      var callbackName, overwritten, responseContainer, jsonProp = s.jsonp !== false && (rjsonp.test(s.url) ? "url" : typeof s.data === "string" && (s.contentType || "").indexOf("application/x-www-form-urlencoded") === 0 && rjsonp.test(s.data) && "data");
5569      if (jsonProp || s.dataTypes[0] === "jsonp") {
5570        callbackName = s.jsonpCallback = isFunction(s.jsonpCallback) ? s.jsonpCallback() : s.jsonpCallback;
5571        if (jsonProp) {
5572          s[jsonProp] = s[jsonProp].replace(rjsonp, "$1" + callbackName);
5573        } else if (s.jsonp !== false) {
5574          s.url += (rquery.test(s.url) ? "&" : "?") + s.jsonp + "=" + callbackName;
5575        }
5576        s.converters["script json"] = function() {
5577          if (!responseContainer) {
5578            jQuery2.error(callbackName + " was not called");
5579          }
5580          return responseContainer[0];
5581        };
5582        s.dataTypes[0] = "json";
5583        overwritten = window2[callbackName];
5584        window2[callbackName] = function() {
5585          responseContainer = arguments;
5586        };
5587        jqXHR.always(function() {
5588          if (overwritten === undefined) {
5589            jQuery2(window2).removeProp(callbackName);
5590          } else {
5591            window2[callbackName] = overwritten;
5592          }
5593          if (s[callbackName]) {
5594            s.jsonpCallback = originalSettings.jsonpCallback;
5595            oldCallbacks.push(callbackName);
5596          }
5597          if (responseContainer && isFunction(overwritten)) {
5598            overwritten(responseContainer[0]);
5599          }
5600          responseContainer = overwritten = undefined;
5601        });
5602        return "script";
5603      }
5604    });
5605    support.createHTMLDocument = function() {
5606      var body = document2.implementation.createHTMLDocument("").body;
5607      body.innerHTML = "<form></form><form></form>";
5608      return body.childNodes.length === 2;
5609    }();
5610    jQuery2.parseHTML = function(data, context, keepScripts) {
5611      if (typeof data !== "string") {
5612        return [];
5613      }
5614      if (typeof context === "boolean") {
5615        keepScripts = context;
5616        context = false;
5617      }
5618      var base, parsed, scripts;
5619      if (!context) {
5620        if (support.createHTMLDocument) {
5621          context = document2.implementation.createHTMLDocument("");
5622          base = context.createElement("base");
5623          base.href = document2.location.href;
5624          context.head.appendChild(base);
5625        } else {
5626          context = document2;
5627        }
5628      }
5629      parsed = rsingleTag.exec(data);
5630      scripts = !keepScripts && [];
5631      if (parsed) {
5632        return [context.createElement(parsed[1])];
5633      }
5634      parsed = buildFragment([data], context, scripts);
5635      if (scripts && scripts.length) {
5636        jQuery2(scripts).remove();
5637      }
5638      return jQuery2.merge([], parsed.childNodes);
5639    };
5640    jQuery2.fn.load = function(url, params, callback) {
5641      var selector, type, response, self2 = this, off = url.indexOf(" ");
5642      if (off > -1) {
5643        selector = stripAndCollapse(url.slice(off));
5644        url = url.slice(0, off);
5645      }
5646      if (isFunction(params)) {
5647        callback = params;
5648        params = undefined;
5649      } else if (params && typeof params === "object") {
5650        type = "POST";
5651      }
5652      if (self2.length > 0) {
5653        jQuery2.ajax({
5654          url,
5655          type: type || "GET",
5656          dataType: "html",
5657          data: params
5658        }).done(function(responseText) {
5659          response = arguments;
5660          self2.html(selector ? jQuery2("<div>").append(jQuery2.parseHTML(responseText)).find(selector) : responseText);
5661        }).always(callback && function(jqXHR, status) {
5662          self2.each(function() {
5663            callback.apply(this, response || [jqXHR.responseText, status, jqXHR]);
5664          });
5665        });
5666      }
5667      return this;
5668    };
5669    jQuery2.expr.pseudos.animated = function(elem) {
5670      return jQuery2.grep(jQuery2.timers, function(fn2) {
5671        return elem === fn2.elem;
5672      }).length;
5673    };
5674    jQuery2.offset = {
5675      setOffset: function(elem, options2, i) {
5676        var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, position = jQuery2.css(elem, "position"), curElem = jQuery2(elem), props = {};
5677        if (position === "static") {
5678          elem.style.position = "relative";
5679        }
5680        curOffset = curElem.offset();
5681        curCSSTop = jQuery2.css(elem, "top");
5682        curCSSLeft = jQuery2.css(elem, "left");
5683        calculatePosition = (position === "absolute" || position === "fixed") && (curCSSTop + curCSSLeft).indexOf("auto") > -1;
5684        if (calculatePosition) {
5685          curPosition = curElem.position();
5686          curTop = curPosition.top;
5687          curLeft = curPosition.left;
5688        } else {
5689          curTop = parseFloat(curCSSTop) || 0;
5690          curLeft = parseFloat(curCSSLeft) || 0;
5691        }
5692        if (isFunction(options2)) {
5693          options2 = options2.call(elem, i, jQuery2.extend({}, curOffset));
5694        }
5695        if (options2.top != null) {
5696          props.top = options2.top - curOffset.top + curTop;
5697        }
5698        if (options2.left != null) {
5699          props.left = options2.left - curOffset.left + curLeft;
5700        }
5701        if ("using" in options2) {
5702          options2.using.call(elem, props);
5703        } else {
5704          curElem.css(props);
5705        }
5706      }
5707    };
5708    jQuery2.fn.extend({
5709      offset: function(options2) {
5710        if (arguments.length) {
5711          return options2 === undefined ? this : this.each(function(i) {
5712            jQuery2.offset.setOffset(this, options2, i);
5713          });
5714        }
5715        var rect, win, elem = this[0];
5716        if (!elem) {
5717          return;
5718        }
5719        if (!elem.getClientRects().length) {
5720          return { top: 0, left: 0 };
5721        }
5722        rect = elem.getBoundingClientRect();
5723        win = elem.ownerDocument.defaultView;
5724        return {
5725          top: rect.top + win.pageYOffset,
5726          left: rect.left + win.pageXOffset
5727        };
5728      },
5729      position: function() {
5730        if (!this[0]) {
5731          return;
5732        }
5733        var offsetParent, offset, doc, elem = this[0], parentOffset = { top: 0, left: 0 };
5734        if (jQuery2.css(elem, "position") === "fixed") {
5735          offset = elem.getBoundingClientRect();
5736        } else {
5737          offset = this.offset();
5738          doc = elem.ownerDocument;
5739          offsetParent = elem.offsetParent || doc.documentElement;
5740          while (offsetParent && (offsetParent === doc.body || offsetParent === doc.documentElement) && jQuery2.css(offsetParent, "position") === "static") {
5741            offsetParent = offsetParent.parentNode;
5742          }
5743          if (offsetParent && offsetParent !== elem && offsetParent.nodeType === 1) {
5744            parentOffset = jQuery2(offsetParent).offset();
5745            parentOffset.top += jQuery2.css(offsetParent, "borderTopWidth", true);
5746            parentOffset.left += jQuery2.css(offsetParent, "borderLeftWidth", true);
5747          }
5748        }
5749        return {
5750          top: offset.top - parentOffset.top - jQuery2.css(elem, "marginTop", true),
5751          left: offset.left - parentOffset.left - jQuery2.css(elem, "marginLeft", true)
5752        };
5753      },
5754      offsetParent: function() {
5755        return this.map(function() {
5756          var offsetParent = this.offsetParent;
5757          while (offsetParent && jQuery2.css(offsetParent, "position") === "static") {
5758            offsetParent = offsetParent.offsetParent;
5759          }
5760          return offsetParent || documentElement;
5761        });
5762      }
5763    });
5764    jQuery2.each({ scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function(method, prop) {
5765      var top = prop === "pageYOffset";
5766      jQuery2.fn[method] = function(val) {
5767        return access(this, function(elem, method, val) {
5768          var win;
5769          if (isWindow(elem)) {
5770            win = elem;
5771          } else if (elem.nodeType === 9) {
5772            win = elem.defaultView;
5773          }
5774          if (val === undefined) {
5775            return win ? win[prop] : elem[method];
5776          }
5777          if (win) {
5778            win.scrollTo(!top ? val : win.pageXOffset, top ? val : win.pageYOffset);
5779          } else {
5780            elem[method] = val;
5781          }
5782        }, method, val, arguments.length);
5783      };
5784    });
5785    jQuery2.each(["top", "left"], function(_i, prop) {
5786      jQuery2.cssHooks[prop] = addGetHookIf(support.pixelPosition, function(elem, computed) {
5787        if (computed) {
5788          computed = curCSS(elem, prop);
5789          return rnumnonpx.test(computed) ? jQuery2(elem).position()[prop] + "px" : computed;
5790        }
5791      });
5792    });
5793    jQuery2.each({ Height: "height", Width: "width" }, function(name, type) {
5794      jQuery2.each({
5795        padding: "inner" + name,
5796        content: type,
5797        "": "outer" + name
5798      }, function(defaultExtra, funcName) {
5799        jQuery2.fn[funcName] = function(margin, value) {
5800          var chainable = arguments.length && (defaultExtra || typeof margin !== "boolean"), extra = defaultExtra || (margin === true || value === true ? "margin" : "border");
5801          return access(this, function(elem, type, value) {
5802            var doc;
5803            if (isWindow(elem)) {
5804              return funcName.indexOf("outer") === 0 ? elem["inner" + name] : elem.document.documentElement["client" + name];
5805            }
5806            if (elem.nodeType === 9) {
5807              doc = elem.documentElement;
5808              return Math.max(elem.body["scroll" + name], doc["scroll" + name], elem.body["offset" + name], doc["offset" + name], doc["client" + name]);
5809            }
5810            return value === undefined ? jQuery2.css(elem, type, extra) : jQuery2.style(elem, type, value, extra);
5811          }, type, chainable ? margin : undefined, chainable);
5812        };
5813      });
5814    });
5815    jQuery2.each([
5816      "ajaxStart",
5817      "ajaxStop",
5818      "ajaxComplete",
5819      "ajaxError",
5820      "ajaxSuccess",
5821      "ajaxSend"
5822    ], function(_i, type) {
5823      jQuery2.fn[type] = function(fn2) {
5824        return this.on(type, fn2);
5825      };
5826    });
5827    jQuery2.fn.extend({
5828      bind: function(types, data, fn2) {
5829        return this.on(types, null, data, fn2);
5830      },
5831      unbind: function(types, fn2) {
5832        return this.off(types, null, fn2);
5833      },
5834      delegate: function(selector, types, data, fn2) {
5835        return this.on(types, selector, data, fn2);
5836      },
5837      undelegate: function(selector, types, fn2) {
5838        return arguments.length === 1 ? this.off(selector, "**") : this.off(types, selector || "**", fn2);
5839      },
5840      hover: function(fnOver, fnOut) {
5841        return this.on("mouseenter", fnOver).on("mouseleave", fnOut || fnOver);
5842      }
5843    });
5844    jQuery2.each(("blur focus focusin focusout resize scroll click dblclick " + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + "change select submit keydown keypress keyup contextmenu").split(" "), function(_i, name) {
5845      jQuery2.fn[name] = function(data, fn2) {
5846        return arguments.length > 0 ? this.on(name, null, data, fn2) : this.trigger(name);
5847      };
5848    });
5849    var rtrim = /^[\s\uFEFF\xA0]+|([^\s\uFEFF\xA0])[\s\uFEFF\xA0]+$/g;
5850    jQuery2.proxy = function(fn2, context) {
5851      var tmp, args2, proxy;
5852      if (typeof context === "string") {
5853        tmp = fn2[context];
5854        context = fn2;
5855        fn2 = tmp;
5856      }
5857      if (!isFunction(fn2)) {
5858        return;
5859      }
5860      args2 = slice.call(arguments, 2);
5861      proxy = function() {
5862        return fn2.apply(context || this, args2.concat(slice.call(arguments)));
5863      };
5864      proxy.guid = fn2.guid = fn2.guid || jQuery2.guid++;
5865      return proxy;
5866    };
5867    jQuery2.holdReady = function(hold) {
5868      if (hold) {
5869        jQuery2.readyWait++;
5870      } else {
5871        jQuery2.ready(true);
5872      }
5873    };
5874    jQuery2.isArray = Array.isArray;
5875    jQuery2.parseJSON = JSON.parse;
5876    jQuery2.nodeName = nodeName;
5877    jQuery2.isFunction = isFunction;
5878    jQuery2.isWindow = isWindow;
5879    jQuery2.camelCase = camelCase;
5880    jQuery2.type = toType;
5881    jQuery2.now = Date.now;
5882    jQuery2.isNumeric = function(obj2) {
5883      var type = jQuery2.type(obj2);
5884      return (type === "number" || type === "string") && !isNaN(obj2 - parseFloat(obj2));
5885    };
5886    jQuery2.trim = function(text2) {
5887      return text2 == null ? "" : (text2 + "").replace(rtrim, "$1");
5888    };
5889    if (typeof define === "function" && define.amd) {
5890      define("jquery", [], function() {
5891        return jQuery2;
5892      });
5893    }
5894    var { jQuery: _jQuery, $: _$ } = window2;
5895    jQuery2.noConflict = function(deep) {
5896      if (window2.$ === jQuery2) {
5897        window2.$ = _$;
5898      }
5899      if (deep && window2.jQuery === jQuery2) {
5900        window2.jQuery = _jQuery;
5901      }
5902      return jQuery2;
5903    };
5904    if (typeof noGlobal === "undefined") {
5905      window2.jQuery = window2.$ = jQuery2;
5906    }
5907    return jQuery2;
5908  });
5909});
5910

vendor: 50,546 bytes, lines 5911-7133

5911// node_modules/popper.js/dist/umd/popper.js
5912var require_popper = __commonJS(function(exports2, module2) {
5913  (function(global2, factory) {
5914    typeof exports2 === "object" && typeof module2 !== "undefined" ? module2.exports = factory() : typeof define === "function" && define.amd ? define(factory) : global2.Popper = factory();
5915  })(exports2, function() {
5916    var isBrowser = typeof window !== "undefined" && typeof document !== "undefined" && typeof navigator !== "undefined";
5917    var timeoutDuration = function() {
5918      var longerTimeoutBrowsers = ["Edge", "Trident", "Firefox"];
5919      for (var i = 0;i < longerTimeoutBrowsers.length; i += 1) {
5920        if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
5921          return 1;
5922        }
5923      }
5924      return 0;
5925    }();
5926    function microtaskDebounce(fn2) {
5927      var called = false;
5928      return function() {
5929        if (called) {
5930          return;
5931        }
5932        called = true;
5933        window.Promise.resolve().then(function() {
5934          called = false;
5935          fn2();
5936        });
5937      };
5938    }
5939    function taskDebounce(fn2) {
5940      var scheduled = false;
5941      return function() {
5942        if (!scheduled) {
5943          scheduled = true;
5944          setTimeout(function() {
5945            scheduled = false;
5946            fn2();
5947          }, timeoutDuration);
5948        }
5949      };
5950    }
5951    var supportsMicroTasks = isBrowser && window.Promise;
5952    var debounce2 = supportsMicroTasks ? microtaskDebounce : taskDebounce;
5953    function isFunction(functionToCheck) {
5954      var getType = {};
5955      return functionToCheck && getType.toString.call(functionToCheck) === "[object Function]";
5956    }
5957    function getStyleComputedProperty(element, property) {
5958      if (element.nodeType !== 1) {
5959        return [];
5960      }
5961      var window2 = element.ownerDocument.defaultView;
5962      var css2 = window2.getComputedStyle(element, null);
5963      return property ? css2[property] : css2;
5964    }
5965    function getParentNode(element) {
5966      if (element.nodeName === "HTML") {
5967        return element;
5968      }
5969      return element.parentNode || element.host;
5970    }
5971    function getScrollParent(element) {
5972      if (!element) {
5973        return document.body;
5974      }
5975      switch (element.nodeName) {
5976        case "HTML":
5977        case "BODY":
5978          return element.ownerDocument.body;
5979        case "#document":
5980          return element.body;
5981      }
5982      var _getStyleComputedProp = getStyleComputedProperty(element), { overflow, overflowX, overflowY } = _getStyleComputedProp;
5983      if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) {
5984        return element;
5985      }
5986      return getScrollParent(getParentNode(element));
5987    }
5988    function getReferenceNode(reference) {
5989      return reference && reference.referenceNode ? reference.referenceNode : reference;
5990    }
5991    var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode);
5992    var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent);
5993    function isIE(version) {
5994      if (version === 11) {
5995        return isIE11;
5996      }
5997      if (version === 10) {
5998        return isIE10;
5999      }
6000      return isIE11 || isIE10;
6001    }
6002    function getOffsetParent(element) {
6003      if (!element) {
6004        return document.documentElement;
6005      }
6006      var noOffsetParent = isIE(10) ? document.body : null;
6007      var offsetParent = element.offsetParent || null;
6008      while (offsetParent === noOffsetParent && element.nextElementSibling) {
6009        offsetParent = (element = element.nextElementSibling).offsetParent;
6010      }
6011      var nodeName = offsetParent && offsetParent.nodeName;
6012      if (!nodeName || nodeName === "BODY" || nodeName === "HTML") {
6013        return element ? element.ownerDocument.documentElement : document.documentElement;
6014      }
6015      if (["TH", "TD", "TABLE"].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, "position") === "static") {
6016        return getOffsetParent(offsetParent);
6017      }
6018      return offsetParent;
6019    }
6020    function isOffsetContainer(element) {
6021      var nodeName = element.nodeName;
6022      if (nodeName === "BODY") {
6023        return false;
6024      }
6025      return nodeName === "HTML" || getOffsetParent(element.firstElementChild) === element;
6026    }
6027    function getRoot(node) {
6028      if (node.parentNode !== null) {
6029        return getRoot(node.parentNode);
6030      }
6031      return node;
6032    }
6033    function findCommonOffsetParent(element1, element2) {
6034      if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {
6035        return document.documentElement;
6036      }
6037      var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
6038      var start = order ? element1 : element2;
6039      var end = order ? element2 : element1;
6040      var range = document.createRange();
6041      range.setStart(start, 0);
6042      range.setEnd(end, 0);
6043      var commonAncestorContainer = range.commonAncestorContainer;
6044      if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {
6045        if (isOffsetContainer(commonAncestorContainer)) {
6046          return commonAncestorContainer;
6047        }
6048        return getOffsetParent(commonAncestorContainer);
6049      }
6050      var element1root = getRoot(element1);
6051      if (element1root.host) {
6052        return findCommonOffsetParent(element1root.host, element2);
6053      } else {
6054        return findCommonOffsetParent(element1, getRoot(element2).host);
6055      }
6056    }
6057    function getScroll(element) {
6058      var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : "top";
6059      var upperSide = side === "top" ? "scrollTop" : "scrollLeft";
6060      var nodeName = element.nodeName;
6061      if (nodeName === "BODY" || nodeName === "HTML") {
6062        var html = element.ownerDocument.documentElement;
6063        var scrollingElement = element.ownerDocument.scrollingElement || html;
6064        return scrollingElement[upperSide];
6065      }
6066      return element[upperSide];
6067    }
6068    function includeScroll(rect, element) {
6069      var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
6070      var scrollTop = getScroll(element, "top");
6071      var scrollLeft = getScroll(element, "left");
6072      var modifier = subtract ? -1 : 1;
6073      rect.top += scrollTop * modifier;
6074      rect.bottom += scrollTop * modifier;
6075      rect.left += scrollLeft * modifier;
6076      rect.right += scrollLeft * modifier;
6077      return rect;
6078    }
6079    function getBordersSize(styles, axis) {
6080      var sideA = axis === "x" ? "Left" : "Top";
6081      var sideB = sideA === "Left" ? "Right" : "Bottom";
6082      return parseFloat(styles["border" + sideA + "Width"]) + parseFloat(styles["border" + sideB + "Width"]);
6083    }
6084    function getSize(axis, body, html, computedStyle) {
6085      return Math.max(body["offset" + axis], body["scroll" + axis], html["client" + axis], html["offset" + axis], html["scroll" + axis], isIE(10) ? parseInt(html["offset" + axis]) + parseInt(computedStyle["margin" + (axis === "Height" ? "Top" : "Left")]) + parseInt(computedStyle["margin" + (axis === "Height" ? "Bottom" : "Right")]) : 0);
6086    }
6087    function getWindowSizes(document2) {
6088      var body = document2.body;
6089      var html = document2.documentElement;
6090      var computedStyle = isIE(10) && getComputedStyle(html);
6091      return {
6092        height: getSize("Height", body, html, computedStyle),
6093        width: getSize("Width", body, html, computedStyle)
6094      };
6095    }
6096    var classCallCheck = function(instance, Constructor) {
6097      if (!(instance instanceof Constructor)) {
6098        throw new TypeError("Cannot call a class as a function");
6099      }
6100    };
6101    var createClass = function() {
6102      function defineProperties(target, props) {
6103        for (var i = 0;i < props.length; i++) {
6104          var descriptor = props[i];
6105          descriptor.enumerable = descriptor.enumerable || false;
6106          descriptor.configurable = true;
6107          if ("value" in descriptor)
6108            descriptor.writable = true;
6109          Object.defineProperty(target, descriptor.key, descriptor);
6110        }
6111      }
6112      return function(Constructor, protoProps, staticProps) {
6113        if (protoProps)
6114          defineProperties(Constructor.prototype, protoProps);
6115        if (staticProps)
6116          defineProperties(Constructor, staticProps);
6117        return Constructor;
6118      };
6119    }();
6120    var defineProperty = function(obj2, key, value) {
6121      if (key in obj2) {
6122        Object.defineProperty(obj2, key, {
6123          value,
6124          enumerable: true,
6125          configurable: true,
6126          writable: true
6127        });
6128      } else {
6129        obj2[key] = value;
6130      }
6131      return obj2;
6132    };
6133    var _extends = Object.assign || function(target) {
6134      for (var i = 1;i < arguments.length; i++) {
6135        var source = arguments[i];
6136        for (var key in source) {
6137          if (Object.prototype.hasOwnProperty.call(source, key)) {
6138            target[key] = source[key];
6139          }
6140        }
6141      }
6142      return target;
6143    };
6144    function getClientRect(offsets) {
6145      return _extends({}, offsets, {
6146        right: offsets.left + offsets.width,
6147        bottom: offsets.top + offsets.height
6148      });
6149    }
6150    function getBoundingClientRect(element) {
6151      var rect = {};
6152      try {
6153        if (isIE(10)) {
6154          rect = element.getBoundingClientRect();
6155          var scrollTop = getScroll(element, "top");
6156          var scrollLeft = getScroll(element, "left");
6157          rect.top += scrollTop;
6158          rect.left += scrollLeft;
6159          rect.bottom += scrollTop;
6160          rect.right += scrollLeft;
6161        } else {
6162          rect = element.getBoundingClientRect();
6163        }
6164      } catch (e) {}
6165      var result = {
6166        left: rect.left,
6167        top: rect.top,
6168        width: rect.right - rect.left,
6169        height: rect.bottom - rect.top
6170      };
6171      var sizes = element.nodeName === "HTML" ? getWindowSizes(element.ownerDocument) : {};
6172      var width = sizes.width || element.clientWidth || result.width;
6173      var height = sizes.height || element.clientHeight || result.height;
6174      var horizScrollbar = element.offsetWidth - width;
6175      var vertScrollbar = element.offsetHeight - height;
6176      if (horizScrollbar || vertScrollbar) {
6177        var styles = getStyleComputedProperty(element);
6178        horizScrollbar -= getBordersSize(styles, "x");
6179        vertScrollbar -= getBordersSize(styles, "y");
6180        result.width -= horizScrollbar;
6181        result.height -= vertScrollbar;
6182      }
6183      return getClientRect(result);
6184    }
6185    function getOffsetRectRelativeToArbitraryNode(children, parent) {
6186      var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
6187      var isIE10 = isIE(10);
6188      var isHTML = parent.nodeName === "HTML";
6189      var childrenRect = getBoundingClientRect(children);
6190      var parentRect = getBoundingClientRect(parent);
6191      var scrollParent = getScrollParent(children);
6192      var styles = getStyleComputedProperty(parent);
6193      var borderTopWidth = parseFloat(styles.borderTopWidth);
6194      var borderLeftWidth = parseFloat(styles.borderLeftWidth);
6195      if (fixedPosition && isHTML) {
6196        parentRect.top = Math.max(parentRect.top, 0);
6197        parentRect.left = Math.max(parentRect.left, 0);
6198      }
6199      var offsets = getClientRect({
6200        top: childrenRect.top - parentRect.top - borderTopWidth,
6201        left: childrenRect.left - parentRect.left - borderLeftWidth,
6202        width: childrenRect.width,
6203        height: childrenRect.height
6204      });
6205      offsets.marginTop = 0;
6206      offsets.marginLeft = 0;
6207      if (!isIE10 && isHTML) {
6208        var marginTop = parseFloat(styles.marginTop);
6209        var marginLeft = parseFloat(styles.marginLeft);
6210        offsets.top -= borderTopWidth - marginTop;
6211        offsets.bottom -= borderTopWidth - marginTop;
6212        offsets.left -= borderLeftWidth - marginLeft;
6213        offsets.right -= borderLeftWidth - marginLeft;
6214        offsets.marginTop = marginTop;
6215        offsets.marginLeft = marginLeft;
6216      }
6217      if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== "BODY") {
6218        offsets = includeScroll(offsets, parent);
6219      }
6220      return offsets;
6221    }
6222    function getViewportOffsetRectRelativeToArtbitraryNode(element) {
6223      var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
6224      var html = element.ownerDocument.documentElement;
6225      var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
6226      var width = Math.max(html.clientWidth, window.innerWidth || 0);
6227      var height = Math.max(html.clientHeight, window.innerHeight || 0);
6228      var scrollTop = !excludeScroll ? getScroll(html) : 0;
6229      var scrollLeft = !excludeScroll ? getScroll(html, "left") : 0;
6230      var offset = {
6231        top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
6232        left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
6233        width,
6234        height
6235      };
6236      return getClientRect(offset);
6237    }
6238    function isFixed(element) {
6239      var nodeName = element.nodeName;
6240      if (nodeName === "BODY" || nodeName === "HTML") {
6241        return false;
6242      }
6243      if (getStyleComputedProperty(element, "position") === "fixed") {
6244        return true;
6245      }
6246      var parentNode = getParentNode(element);
6247      if (!parentNode) {
6248        return false;
6249      }
6250      return isFixed(parentNode);
6251    }
6252    function getFixedPositionOffsetParent(element) {
6253      if (!element || !element.parentElement || isIE()) {
6254        return document.documentElement;
6255      }
6256      var el = element.parentElement;
6257      while (el && getStyleComputedProperty(el, "transform") === "none") {
6258        el = el.parentElement;
6259      }
6260      return el || document.documentElement;
6261    }
6262    function getBoundaries(popper, reference, padding, boundariesElement) {
6263      var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false;
6264      var boundaries = { top: 0, left: 0 };
6265      var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, getReferenceNode(reference));
6266      if (boundariesElement === "viewport") {
6267        boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition);
6268      } else {
6269        var boundariesNode = undefined;
6270        if (boundariesElement === "scrollParent") {
6271          boundariesNode = getScrollParent(getParentNode(reference));
6272          if (boundariesNode.nodeName === "BODY") {
6273            boundariesNode = popper.ownerDocument.documentElement;
6274          }
6275        } else if (boundariesElement === "window") {
6276          boundariesNode = popper.ownerDocument.documentElement;
6277        } else {
6278          boundariesNode = boundariesElement;
6279        }
6280        var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition);
6281        if (boundariesNode.nodeName === "HTML" && !isFixed(offsetParent)) {
6282          var _getWindowSizes = getWindowSizes(popper.ownerDocument), { height, width } = _getWindowSizes;
6283          boundaries.top += offsets.top - offsets.marginTop;
6284          boundaries.bottom = height + offsets.top;
6285          boundaries.left += offsets.left - offsets.marginLeft;
6286          boundaries.right = width + offsets.left;
6287        } else {
6288          boundaries = offsets;
6289        }
6290      }
6291      padding = padding || 0;
6292      var isPaddingNumber = typeof padding === "number";
6293      boundaries.left += isPaddingNumber ? padding : padding.left || 0;
6294      boundaries.top += isPaddingNumber ? padding : padding.top || 0;
6295      boundaries.right -= isPaddingNumber ? padding : padding.right || 0;
6296      boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0;
6297      return boundaries;
6298    }
6299    function getArea(_ref) {
6300      var { width, height } = _ref;
6301      return width * height;
6302    }
6303    function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
6304      var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
6305      if (placement.indexOf("auto") === -1) {
6306        return placement;
6307      }
6308      var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
6309      var rects = {
6310        top: {
6311          width: boundaries.width,
6312          height: refRect.top - boundaries.top
6313        },
6314        right: {
6315          width: boundaries.right - refRect.right,
6316          height: boundaries.height
6317        },
6318        bottom: {
6319          width: boundaries.width,
6320          height: boundaries.bottom - refRect.bottom
6321        },
6322        left: {
6323          width: refRect.left - boundaries.left,
6324          height: boundaries.height
6325        }
6326      };
6327      var sortedAreas = Object.keys(rects).map(function(key) {
6328        return _extends({
6329          key
6330        }, rects[key], {
6331          area: getArea(rects[key])
6332        });
6333      }).sort(function(a, b) {
6334        return b.area - a.area;
6335      });
6336      var filteredAreas = sortedAreas.filter(function(_ref2) {
6337        var { width, height } = _ref2;
6338        return width >= popper.clientWidth && height >= popper.clientHeight;
6339      });
6340      var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
6341      var variation = placement.split("-")[1];
6342      return computedPlacement + (variation ? "-" + variation : "");
6343    }
6344    function getReferenceOffsets(state, popper, reference) {
6345      var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null;
6346      var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, getReferenceNode(reference));
6347      return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition);
6348    }
6349    function getOuterSizes(element) {
6350      var window2 = element.ownerDocument.defaultView;
6351      var styles = window2.getComputedStyle(element);
6352      var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0);
6353      var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0);
6354      var result = {
6355        width: element.offsetWidth + y,
6356        height: element.offsetHeight + x
6357      };
6358      return result;
6359    }
6360    function getOppositePlacement(placement) {
6361      var hash = { left: "right", right: "left", bottom: "top", top: "bottom" };
6362      return placement.replace(/left|right|bottom|top/g, function(matched) {
6363        return hash[matched];
6364      });
6365    }
6366    function getPopperOffsets(popper, referenceOffsets, placement) {
6367      placement = placement.split("-")[0];
6368      var popperRect = getOuterSizes(popper);
6369      var popperOffsets = {
6370        width: popperRect.width,
6371        height: popperRect.height
6372      };
6373      var isHoriz = ["right", "left"].indexOf(placement) !== -1;
6374      var mainSide = isHoriz ? "top" : "left";
6375      var secondarySide = isHoriz ? "left" : "top";
6376      var measurement = isHoriz ? "height" : "width";
6377      var secondaryMeasurement = !isHoriz ? "height" : "width";
6378      popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
6379      if (placement === secondarySide) {
6380        popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
6381      } else {
6382        popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
6383      }
6384      return popperOffsets;
6385    }
6386    function find(arr, check) {
6387      if (Array.prototype.find) {
6388        return arr.find(check);
6389      }
6390      return arr.filter(check)[0];
6391    }
6392    function findIndex(arr, prop, value) {
6393      if (Array.prototype.findIndex) {
6394        return arr.findIndex(function(cur) {
6395          return cur[prop] === value;
6396        });
6397      }
6398      var match = find(arr, function(obj2) {
6399        return obj2[prop] === value;
6400      });
6401      return arr.indexOf(match);
6402    }
6403    function runModifiers(modifiers, data, ends) {
6404      var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, "name", ends));
6405      modifiersToRun.forEach(function(modifier) {
6406        if (modifier["function"]) {
6407          console.warn("`modifier.function` is deprecated, use `modifier.fn`!");
6408        }
6409        var fn2 = modifier["function"] || modifier.fn;
6410        if (modifier.enabled && isFunction(fn2)) {
6411          data.offsets.popper = getClientRect(data.offsets.popper);
6412          data.offsets.reference = getClientRect(data.offsets.reference);
6413          data = fn2(data, modifier);
6414        }
6415      });
6416      return data;
6417    }
6418    function update() {
6419      if (this.state.isDestroyed) {
6420        return;
6421      }
6422      var data = {
6423        instance: this,
6424        styles: {},
6425        arrowStyles: {},
6426        attributes: {},
6427        flipped: false,
6428        offsets: {}
6429      };
6430      data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed);
6431      data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
6432      data.originalPlacement = data.placement;
6433      data.positionFixed = this.options.positionFixed;
6434      data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
6435      data.offsets.popper.position = this.options.positionFixed ? "fixed" : "absolute";
6436      data = runModifiers(this.modifiers, data);
6437      if (!this.state.isCreated) {
6438        this.state.isCreated = true;
6439        this.options.onCreate(data);
6440      } else {
6441        this.options.onUpdate(data);
6442      }
6443    }
6444    function isModifierEnabled(modifiers, modifierName) {
6445      return modifiers.some(function(_ref) {
6446        var { name, enabled } = _ref;
6447        return enabled && name === modifierName;
6448      });
6449    }
6450    function getSupportedPropertyName(property) {
6451      var prefixes = [false, "ms", "Webkit", "Moz", "O"];
6452      var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
6453      for (var i = 0;i < prefixes.length; i++) {
6454        var prefix = prefixes[i];
6455        var toCheck = prefix ? "" + prefix + upperProp : property;
6456        if (typeof document.body.style[toCheck] !== "undefined") {
6457          return toCheck;
6458        }
6459      }
6460      return null;
6461    }
6462    function destroy() {
6463      this.state.isDestroyed = true;
6464      if (isModifierEnabled(this.modifiers, "applyStyle")) {
6465        this.popper.removeAttribute("x-placement");
6466        this.popper.style.position = "";
6467        this.popper.style.top = "";
6468        this.popper.style.left = "";
6469        this.popper.style.right = "";
6470        this.popper.style.bottom = "";
6471        this.popper.style.willChange = "";
6472        this.popper.style[getSupportedPropertyName("transform")] = "";
6473      }
6474      this.disableEventListeners();
6475      if (this.options.removeOnDestroy) {
6476        this.popper.parentNode.removeChild(this.popper);
6477      }
6478      return this;
6479    }
6480    function getWindow(element) {
6481      var ownerDocument = element.ownerDocument;
6482      return ownerDocument ? ownerDocument.defaultView : window;
6483    }
6484    function attachToScrollParents(scrollParent, event, callback, scrollParents) {
6485      var isBody = scrollParent.nodeName === "BODY";
6486      var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
6487      target.addEventListener(event, callback, { passive: true });
6488      if (!isBody) {
6489        attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
6490      }
6491      scrollParents.push(target);
6492    }
6493    function setupEventListeners(reference, options2, state, updateBound) {
6494      state.updateBound = updateBound;
6495      getWindow(reference).addEventListener("resize", state.updateBound, { passive: true });
6496      var scrollElement = getScrollParent(reference);
6497      attachToScrollParents(scrollElement, "scroll", state.updateBound, state.scrollParents);
6498      state.scrollElement = scrollElement;
6499      state.eventsEnabled = true;
6500      return state;
6501    }
6502    function enableEventListeners() {
6503      if (!this.state.eventsEnabled) {
6504        this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
6505      }
6506    }
6507    function removeEventListeners(reference, state) {
6508      getWindow(reference).removeEventListener("resize", state.updateBound);
6509      state.scrollParents.forEach(function(target) {
6510        target.removeEventListener("scroll", state.updateBound);
6511      });
6512      state.updateBound = null;
6513      state.scrollParents = [];
6514      state.scrollElement = null;
6515      state.eventsEnabled = false;
6516      return state;
6517    }
6518    function disableEventListeners() {
6519      if (this.state.eventsEnabled) {
6520        cancelAnimationFrame(this.scheduleUpdate);
6521        this.state = removeEventListeners(this.reference, this.state);
6522      }
6523    }
6524    function isNumeric(n) {
6525      return n !== "" && !isNaN(parseFloat(n)) && isFinite(n);
6526    }
6527    function setStyles(element, styles) {
6528      Object.keys(styles).forEach(function(prop) {
6529        var unit = "";
6530        if (["width", "height", "top", "right", "bottom", "left"].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
6531          unit = "px";
6532        }
6533        element.style[prop] = styles[prop] + unit;
6534      });
6535    }
6536    function setAttributes(element, attributes) {
6537      Object.keys(attributes).forEach(function(prop) {
6538        var value = attributes[prop];
6539        if (value !== false) {
6540          element.setAttribute(prop, attributes[prop]);
6541        } else {
6542          element.removeAttribute(prop);
6543        }
6544      });
6545    }
6546    function applyStyle(data) {
6547      setStyles(data.instance.popper, data.styles);
6548      setAttributes(data.instance.popper, data.attributes);
6549      if (data.arrowElement && Object.keys(data.arrowStyles).length) {
6550        setStyles(data.arrowElement, data.arrowStyles);
6551      }
6552      return data;
6553    }
6554    function applyStyleOnLoad(reference, popper, options2, modifierOptions, state) {
6555      var referenceOffsets = getReferenceOffsets(state, popper, reference, options2.positionFixed);
6556      var placement = computeAutoPlacement(options2.placement, referenceOffsets, popper, reference, options2.modifiers.flip.boundariesElement, options2.modifiers.flip.padding);
6557      popper.setAttribute("x-placement", placement);
6558      setStyles(popper, { position: options2.positionFixed ? "fixed" : "absolute" });
6559      return options2;
6560    }
6561    function getRoundedOffsets(data, shouldRound) {
6562      var _data$offsets = data.offsets, { popper, reference } = _data$offsets;
6563      var { round, floor } = Math;
6564      var noRound = function noRound(v) {
6565        return v;
6566      };
6567      var referenceWidth = round(reference.width);
6568      var popperWidth = round(popper.width);
6569      var isVertical = ["left", "right"].indexOf(data.placement) !== -1;
6570      var isVariation = data.placement.indexOf("-") !== -1;
6571      var sameWidthParity = referenceWidth % 2 === popperWidth % 2;
6572      var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1;
6573      var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor;
6574      var verticalToInteger = !shouldRound ? noRound : round;
6575      return {
6576        left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left),
6577        top: verticalToInteger(popper.top),
6578        bottom: verticalToInteger(popper.bottom),
6579        right: horizontalToInteger(popper.right)
6580      };
6581    }
6582    var isFirefox = isBrowser && /Firefox/i.test(navigator.userAgent);
6583    function computeStyle(data, options2) {
6584      var { x, y } = options2;
6585      var popper = data.offsets.popper;
6586      var legacyGpuAccelerationOption = find(data.instance.modifiers, function(modifier) {
6587        return modifier.name === "applyStyle";
6588      }).gpuAcceleration;
6589      if (legacyGpuAccelerationOption !== undefined) {
6590        console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");
6591      }
6592      var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options2.gpuAcceleration;
6593      var offsetParent = getOffsetParent(data.instance.popper);
6594      var offsetParentRect = getBoundingClientRect(offsetParent);
6595      var styles = {
6596        position: popper.position
6597      };
6598      var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox);
6599      var sideA = x === "bottom" ? "top" : "bottom";
6600      var sideB = y === "right" ? "left" : "right";
6601      var prefixedProperty = getSupportedPropertyName("transform");
6602      var left = undefined, top = undefined;
6603      if (sideA === "bottom") {
6604        if (offsetParent.nodeName === "HTML") {
6605          top = -offsetParent.clientHeight + offsets.bottom;
6606        } else {
6607          top = -offsetParentRect.height + offsets.bottom;
6608        }
6609      } else {
6610        top = offsets.top;
6611      }
6612      if (sideB === "right") {
6613        if (offsetParent.nodeName === "HTML") {
6614          left = -offsetParent.clientWidth + offsets.right;
6615        } else {
6616          left = -offsetParentRect.width + offsets.right;
6617        }
6618      } else {
6619        left = offsets.left;
6620      }
6621      if (gpuAcceleration && prefixedProperty) {
6622        styles[prefixedProperty] = "translate3d(" + left + "px, " + top + "px, 0)";
6623        styles[sideA] = 0;
6624        styles[sideB] = 0;
6625        styles.willChange = "transform";
6626      } else {
6627        var invertTop = sideA === "bottom" ? -1 : 1;
6628        var invertLeft = sideB === "right" ? -1 : 1;
6629        styles[sideA] = top * invertTop;
6630        styles[sideB] = left * invertLeft;
6631        styles.willChange = sideA + ", " + sideB;
6632      }
6633      var attributes = {
6634        "x-placement": data.placement
6635      };
6636      data.attributes = _extends({}, attributes, data.attributes);
6637      data.styles = _extends({}, styles, data.styles);
6638      data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles);
6639      return data;
6640    }
6641    function isModifierRequired(modifiers, requestingName, requestedName) {
6642      var requesting = find(modifiers, function(_ref) {
6643        var name = _ref.name;
6644        return name === requestingName;
6645      });
6646      var isRequired = !!requesting && modifiers.some(function(modifier) {
6647        return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
6648      });
6649      if (!isRequired) {
6650        var _requesting = "`" + requestingName + "`";
6651        var requested = "`" + requestedName + "`";
6652        console.warn(requested + " modifier is required by " + _requesting + " modifier in order to work, be sure to include it before " + _requesting + "!");
6653      }
6654      return isRequired;
6655    }
6656    function arrow(data, options2) {
6657      var _data$offsets$arrow;
6658      if (!isModifierRequired(data.instance.modifiers, "arrow", "keepTogether")) {
6659        return data;
6660      }
6661      var arrowElement = options2.element;
6662      if (typeof arrowElement === "string") {
6663        arrowElement = data.instance.popper.querySelector(arrowElement);
6664        if (!arrowElement) {
6665          return data;
6666        }
6667      } else {
6668        if (!data.instance.popper.contains(arrowElement)) {
6669          console.warn("WARNING: `arrow.element` must be child of its popper element!");
6670          return data;
6671        }
6672      }
6673      var placement = data.placement.split("-")[0];
6674      var _data$offsets = data.offsets, { popper, reference } = _data$offsets;
6675      var isVertical = ["left", "right"].indexOf(placement) !== -1;
6676      var len = isVertical ? "height" : "width";
6677      var sideCapitalized = isVertical ? "Top" : "Left";
6678      var side = sideCapitalized.toLowerCase();
6679      var altSide = isVertical ? "left" : "top";
6680      var opSide = isVertical ? "bottom" : "right";
6681      var arrowElementSize = getOuterSizes(arrowElement)[len];
6682      if (reference[opSide] - arrowElementSize < popper[side]) {
6683        data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
6684      }
6685      if (reference[side] + arrowElementSize > popper[opSide]) {
6686        data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
6687      }
6688      data.offsets.popper = getClientRect(data.offsets.popper);
6689      var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
6690      var css2 = getStyleComputedProperty(data.instance.popper);
6691      var popperMarginSide = parseFloat(css2["margin" + sideCapitalized]);
6692      var popperBorderSide = parseFloat(css2["border" + sideCapitalized + "Width"]);
6693      var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
6694      sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
6695      data.arrowElement = arrowElement;
6696      data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ""), _data$offsets$arrow);
6697      return data;
6698    }
6699    function getOppositeVariation(variation) {
6700      if (variation === "end") {
6701        return "start";
6702      } else if (variation === "start") {
6703        return "end";
6704      }
6705      return variation;
6706    }
6707    var placements = ["auto-start", "auto", "auto-end", "top-start", "top", "top-end", "right-start", "right", "right-end", "bottom-end", "bottom", "bottom-start", "left-end", "left", "left-start"];
6708    var validPlacements = placements.slice(3);
6709    function clockwise(placement) {
6710      var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
6711      var index = validPlacements.indexOf(placement);
6712      var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
6713      return counter ? arr.reverse() : arr;
6714    }
6715    var BEHAVIORS = {
6716      FLIP: "flip",
6717      CLOCKWISE: "clockwise",
6718      COUNTERCLOCKWISE: "counterclockwise"
6719    };
6720    function flip(data, options2) {
6721      if (isModifierEnabled(data.instance.modifiers, "inner")) {
6722        return data;
6723      }
6724      if (data.flipped && data.placement === data.originalPlacement) {
6725        return data;
6726      }
6727      var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options2.padding, options2.boundariesElement, data.positionFixed);
6728      var placement = data.placement.split("-")[0];
6729      var placementOpposite = getOppositePlacement(placement);
6730      var variation = data.placement.split("-")[1] || "";
6731      var flipOrder = [];
6732      switch (options2.behavior) {
6733        case BEHAVIORS.FLIP:
6734          flipOrder = [placement, placementOpposite];
6735          break;
6736        case BEHAVIORS.CLOCKWISE:
6737          flipOrder = clockwise(placement);
6738          break;
6739        case BEHAVIORS.COUNTERCLOCKWISE:
6740          flipOrder = clockwise(placement, true);
6741          break;
6742        default:
6743          flipOrder = options2.behavior;
6744      }
6745      flipOrder.forEach(function(step, index) {
6746        if (placement !== step || flipOrder.length === index + 1) {
6747          return data;
6748        }
6749        placement = data.placement.split("-")[0];
6750        placementOpposite = getOppositePlacement(placement);
6751        var popperOffsets = data.offsets.popper;
6752        var refOffsets = data.offsets.reference;
6753        var floor = Math.floor;
6754        var overlapsRef = placement === "left" && floor(popperOffsets.right) > floor(refOffsets.left) || placement === "right" && floor(popperOffsets.left) < floor(refOffsets.right) || placement === "top" && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === "bottom" && floor(popperOffsets.top) < floor(refOffsets.bottom);
6755        var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
6756        var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
6757        var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
6758        var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
6759        var overflowsBoundaries = placement === "left" && overflowsLeft || placement === "right" && overflowsRight || placement === "top" && overflowsTop || placement === "bottom" && overflowsBottom;
6760        var isVertical = ["top", "bottom"].indexOf(placement) !== -1;
6761        var flippedVariationByRef = !!options2.flipVariations && (isVertical && variation === "start" && overflowsLeft || isVertical && variation === "end" && overflowsRight || !isVertical && variation === "start" && overflowsTop || !isVertical && variation === "end" && overflowsBottom);
6762        var flippedVariationByContent = !!options2.flipVariationsByContent && (isVertical && variation === "start" && overflowsRight || isVertical && variation === "end" && overflowsLeft || !isVertical && variation === "start" && overflowsBottom || !isVertical && variation === "end" && overflowsTop);
6763        var flippedVariation = flippedVariationByRef || flippedVariationByContent;
6764        if (overlapsRef || overflowsBoundaries || flippedVariation) {
6765          data.flipped = true;
6766          if (overlapsRef || overflowsBoundaries) {
6767            placement = flipOrder[index + 1];
6768          }
6769          if (flippedVariation) {
6770            variation = getOppositeVariation(variation);
6771          }
6772          data.placement = placement + (variation ? "-" + variation : "");
6773          data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
6774          data = runModifiers(data.instance.modifiers, data, "flip");
6775        }
6776      });
6777      return data;
6778    }
6779    function keepTogether(data) {
6780      var _data$offsets = data.offsets, { popper, reference } = _data$offsets;
6781      var placement = data.placement.split("-")[0];
6782      var floor = Math.floor;
6783      var isVertical = ["top", "bottom"].indexOf(placement) !== -1;
6784      var side = isVertical ? "right" : "bottom";
6785      var opSide = isVertical ? "left" : "top";
6786      var measurement = isVertical ? "width" : "height";
6787      if (popper[side] < floor(reference[opSide])) {
6788        data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
6789      }
6790      if (popper[opSide] > floor(reference[side])) {
6791        data.offsets.popper[opSide] = floor(reference[side]);
6792      }
6793      return data;
6794    }
6795    function toValue(str, measurement, popperOffsets, referenceOffsets) {
6796      var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/);
6797      var value = +split[1];
6798      var unit = split[2];
6799      if (!value) {
6800        return str;
6801      }
6802      if (unit.indexOf("%") === 0) {
6803        var element = undefined;
6804        switch (unit) {
6805          case "%p":
6806            element = popperOffsets;
6807            break;
6808          case "%":
6809          case "%r":
6810          default:
6811            element = referenceOffsets;
6812        }
6813        var rect = getClientRect(element);
6814        return rect[measurement] / 100 * value;
6815      } else if (unit === "vh" || unit === "vw") {
6816        var size = undefined;
6817        if (unit === "vh") {
6818          size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);
6819        } else {
6820          size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);
6821        }
6822        return size / 100 * value;
6823      } else {
6824        return value;
6825      }
6826    }
6827    function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
6828      var offsets = [0, 0];
6829      var useHeight = ["right", "left"].indexOf(basePlacement) !== -1;
6830      var fragments = offset.split(/(\+|\-)/).map(function(frag) {
6831        return frag.trim();
6832      });
6833      var divider = fragments.indexOf(find(fragments, function(frag) {
6834        return frag.search(/,|\s/) !== -1;
6835      }));
6836      if (fragments[divider] && fragments[divider].indexOf(",") === -1) {
6837        console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");
6838      }
6839      var splitRegex = /\s*,\s*|\s+/;
6840      var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
6841      ops = ops.map(function(op, index) {
6842        var measurement = (index === 1 ? !useHeight : useHeight) ? "height" : "width";
6843        var mergeWithPrevious = false;
6844        return op.reduce(function(a, b) {
6845          if (a[a.length - 1] === "" && ["+", "-"].indexOf(b) !== -1) {
6846            a[a.length - 1] = b;
6847            mergeWithPrevious = true;
6848            return a;
6849          } else if (mergeWithPrevious) {
6850            a[a.length - 1] += b;
6851            mergeWithPrevious = false;
6852            return a;
6853          } else {
6854            return a.concat(b);
6855          }
6856        }, []).map(function(str) {
6857          return toValue(str, measurement, popperOffsets, referenceOffsets);
6858        });
6859      });
6860      ops.forEach(function(op, index) {
6861        op.forEach(function(frag, index2) {
6862          if (isNumeric(frag)) {
6863            offsets[index] += frag * (op[index2 - 1] === "-" ? -1 : 1);
6864          }
6865        });
6866      });
6867      return offsets;
6868    }
6869    function offset(data, _ref) {
6870      var offset = _ref.offset;
6871      var { placement, offsets: _data$offsets } = data, { popper, reference } = _data$offsets;
6872      var basePlacement = placement.split("-")[0];
6873      var offsets = undefined;
6874      if (isNumeric(+offset)) {
6875        offsets = [+offset, 0];
6876      } else {
6877        offsets = parseOffset(offset, popper, reference, basePlacement);
6878      }
6879      if (basePlacement === "left") {
6880        popper.top += offsets[0];
6881        popper.left -= offsets[1];
6882      } else if (basePlacement === "right") {
6883        popper.top += offsets[0];
6884        popper.left += offsets[1];
6885      } else if (basePlacement === "top") {
6886        popper.left += offsets[0];
6887        popper.top -= offsets[1];
6888      } else if (basePlacement === "bottom") {
6889        popper.left += offsets[0];
6890        popper.top += offsets[1];
6891      }
6892      data.popper = popper;
6893      return data;
6894    }
6895    function preventOverflow(data, options2) {
6896      var boundariesElement = options2.boundariesElement || getOffsetParent(data.instance.popper);
6897      if (data.instance.reference === boundariesElement) {
6898        boundariesElement = getOffsetParent(boundariesElement);
6899      }
6900      var transformProp = getSupportedPropertyName("transform");
6901      var popperStyles = data.instance.popper.style;
6902      var { top, left } = popperStyles, transform = popperStyles[transformProp];
6903      popperStyles.top = "";
6904      popperStyles.left = "";
6905      popperStyles[transformProp] = "";
6906      var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options2.padding, boundariesElement, data.positionFixed);
6907      popperStyles.top = top;
6908      popperStyles.left = left;
6909      popperStyles[transformProp] = transform;
6910      options2.boundaries = boundaries;
6911      var order = options2.priority;
6912      var popper = data.offsets.popper;
6913      var check = {
6914        primary: function primary(placement) {
6915          var value = popper[placement];
6916          if (popper[placement] < boundaries[placement] && !options2.escapeWithReference) {
6917            value = Math.max(popper[placement], boundaries[placement]);
6918          }
6919          return defineProperty({}, placement, value);
6920        },
6921        secondary: function secondary(placement) {
6922          var mainSide = placement === "right" ? "left" : "top";
6923          var value = popper[mainSide];
6924          if (popper[placement] > boundaries[placement] && !options2.escapeWithReference) {
6925            value = Math.min(popper[mainSide], boundaries[placement] - (placement === "right" ? popper.width : popper.height));
6926          }
6927          return defineProperty({}, mainSide, value);
6928        }
6929      };
6930      order.forEach(function(placement) {
6931        var side = ["left", "top"].indexOf(placement) !== -1 ? "primary" : "secondary";
6932        popper = _extends({}, popper, check[side](placement));
6933      });
6934      data.offsets.popper = popper;
6935      return data;
6936    }
6937    function shift(data) {
6938      var placement = data.placement;
6939      var basePlacement = placement.split("-")[0];
6940      var shiftvariation = placement.split("-")[1];
6941      if (shiftvariation) {
6942        var _data$offsets = data.offsets, { reference, popper } = _data$offsets;
6943        var isVertical = ["bottom", "top"].indexOf(basePlacement) !== -1;
6944        var side = isVertical ? "left" : "top";
6945        var measurement = isVertical ? "width" : "height";
6946        var shiftOffsets = {
6947          start: defineProperty({}, side, reference[side]),
6948          end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
6949        };
6950        data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]);
6951      }
6952      return data;
6953    }
6954    function hide(data) {
6955      if (!isModifierRequired(data.instance.modifiers, "hide", "preventOverflow")) {
6956        return data;
6957      }
6958      var refRect = data.offsets.reference;
6959      var bound = find(data.instance.modifiers, function(modifier) {
6960        return modifier.name === "preventOverflow";
6961      }).boundaries;
6962      if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {
6963        if (data.hide === true) {
6964          return data;
6965        }
6966        data.hide = true;
6967        data.attributes["x-out-of-boundaries"] = "";
6968      } else {
6969        if (data.hide === false) {
6970          return data;
6971        }
6972        data.hide = false;
6973        data.attributes["x-out-of-boundaries"] = false;
6974      }
6975      return data;
6976    }
6977    function inner(data) {
6978      var placement = data.placement;
6979      var basePlacement = placement.split("-")[0];
6980      var _data$offsets = data.offsets, { popper, reference } = _data$offsets;
6981      var isHoriz = ["left", "right"].indexOf(basePlacement) !== -1;
6982      var subtractLength = ["top", "left"].indexOf(basePlacement) === -1;
6983      popper[isHoriz ? "left" : "top"] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? "width" : "height"] : 0);
6984      data.placement = getOppositePlacement(placement);
6985      data.offsets.popper = getClientRect(popper);
6986      return data;
6987    }
6988    var modifiers = {
6989      shift: {
6990        order: 100,
6991        enabled: true,
6992        fn: shift
6993      },
6994      offset: {
6995        order: 200,
6996        enabled: true,
6997        fn: offset,
6998        offset: 0
6999      },
7000      preventOverflow: {
7001        order: 300,
7002        enabled: true,
7003        fn: preventOverflow,
7004        priority: ["left", "right", "top", "bottom"],
7005        padding: 5,
7006        boundariesElement: "scrollParent"
7007      },
7008      keepTogether: {
7009        order: 400,
7010        enabled: true,
7011        fn: keepTogether
7012      },
7013      arrow: {
7014        order: 500,
7015        enabled: true,
7016        fn: arrow,
7017        element: "[x-arrow]"
7018      },
7019      flip: {
7020        order: 600,
7021        enabled: true,
7022        fn: flip,
7023        behavior: "flip",
7024        padding: 5,
7025        boundariesElement: "viewport",
7026        flipVariations: false,
7027        flipVariationsByContent: false
7028      },
7029      inner: {
7030        order: 700,
7031        enabled: false,
7032        fn: inner
7033      },
7034      hide: {
7035        order: 800,
7036        enabled: true,
7037        fn: hide
7038      },
7039      computeStyle: {
7040        order: 850,
7041        enabled: true,
7042        fn: computeStyle,
7043        gpuAcceleration: true,
7044        x: "bottom",
7045        y: "right"
7046      },
7047      applyStyle: {
7048        order: 900,
7049        enabled: true,
7050        fn: applyStyle,
7051        onLoad: applyStyleOnLoad,
7052        gpuAcceleration: undefined
7053      }
7054    };
7055    var Defaults = {
7056      placement: "bottom",
7057      positionFixed: false,
7058      eventsEnabled: true,
7059      removeOnDestroy: false,
7060      onCreate: function onCreate() {},
7061      onUpdate: function onUpdate() {},
7062      modifiers
7063    };
7064    var Popper = function() {
7065      function Popper(reference, popper) {
7066        var _this = this;
7067        var options2 = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
7068        classCallCheck(this, Popper);
7069        this.scheduleUpdate = function() {
7070          return requestAnimationFrame(_this.update);
7071        };
7072        this.update = debounce2(this.update.bind(this));
7073        this.options = _extends({}, Popper.Defaults, options2);
7074        this.state = {
7075          isDestroyed: false,
7076          isCreated: false,
7077          scrollParents: []
7078        };
7079        this.reference = reference && reference.jquery ? reference[0] : reference;
7080        this.popper = popper && popper.jquery ? popper[0] : popper;
7081        this.options.modifiers = {};
7082        Object.keys(_extends({}, Popper.Defaults.modifiers, options2.modifiers)).forEach(function(name) {
7083          _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options2.modifiers ? options2.modifiers[name] : {});
7084        });
7085        this.modifiers = Object.keys(this.options.modifiers).map(function(name) {
7086          return _extends({
7087            name
7088          }, _this.options.modifiers[name]);
7089        }).sort(function(a, b) {
7090          return a.order - b.order;
7091        });
7092        this.modifiers.forEach(function(modifierOptions) {
7093          if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
7094            modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
7095          }
7096        });
7097        this.update();
7098        var eventsEnabled = this.options.eventsEnabled;
7099        if (eventsEnabled) {
7100          this.enableEventListeners();
7101        }
7102        this.state.eventsEnabled = eventsEnabled;
7103      }
7104      createClass(Popper, [{
7105        key: "update",
7106        value: function update$$1() {
7107          return update.call(this);
7108        }
7109      }, {
7110        key: "destroy",
7111        value: function destroy$$1() {
7112          return destroy.call(this);
7113        }
7114      }, {
7115        key: "enableEventListeners",
7116        value: function enableEventListeners$$1() {
7117          return enableEventListeners.call(this);
7118        }
7119      }, {
7120        key: "disableEventListeners",
7121        value: function disableEventListeners$$1() {
7122          return disableEventListeners.call(this);
7123        }
7124      }]);
7125      return Popper;
7126    }();
7127    Popper.Utils = (typeof window !== "undefined" ? window : global).PopperUtils;
7128    Popper.placements = placements;
7129    Popper.Defaults = Defaults;
7130    return Popper;
7131  });
7132});
7133

vendor: 122,157 bytes, lines 7134-10370

7134// node_modules/bootstrap/dist/js/bootstrap.js
7135var require_bootstrap = __commonJS(function(exports2, module2) {
7136  /*!
7137    * Bootstrap v4.3.1 (https://getbootstrap.com/)
7138    * Copyright 2011-2019 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
7139    * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
7140    */
7141  (function(global2, factory) {
7142    typeof exports2 === "object" && typeof module2 !== "undefined" ? factory(exports2, require_jquery(), require_popper()) : typeof define === "function" && define.amd ? define(["exports", "jquery", "popper.js"], factory) : (global2 = global2 || self, factory(global2.bootstrap = {}, global2.jQuery, global2.Popper));
7143  })(exports2, function(exports3, $2, Popper) {
7144    $2 = $2 && $2.hasOwnProperty("default") ? $2["default"] : $2;
7145    Popper = Popper && Popper.hasOwnProperty("default") ? Popper["default"] : Popper;
7146    function _defineProperties(target, props) {
7147      for (var i = 0;i < props.length; i++) {
7148        var descriptor = props[i];
7149        descriptor.enumerable = descriptor.enumerable || false;
7150        descriptor.configurable = true;
7151        if ("value" in descriptor)
7152          descriptor.writable = true;
7153        Object.defineProperty(target, descriptor.key, descriptor);
7154      }
7155    }
7156    function _createClass(Constructor, protoProps, staticProps) {
7157      if (protoProps)
7158        _defineProperties(Constructor.prototype, protoProps);
7159      if (staticProps)
7160        _defineProperties(Constructor, staticProps);
7161      return Constructor;
7162    }
7163    function _defineProperty(obj2, key, value) {
7164      if (key in obj2) {
7165        Object.defineProperty(obj2, key, {
7166          value,
7167          enumerable: true,
7168          configurable: true,
7169          writable: true
7170        });
7171      } else {
7172        obj2[key] = value;
7173      }
7174      return obj2;
7175    }
7176    function _objectSpread(target) {
7177      for (var i = 1;i < arguments.length; i++) {
7178        var source = arguments[i] != null ? arguments[i] : {};
7179        var ownKeys = Object.keys(source);
7180        if (typeof Object.getOwnPropertySymbols === "function") {
7181          ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function(sym) {
7182            return Object.getOwnPropertyDescriptor(source, sym).enumerable;
7183          }));
7184        }
7185        ownKeys.forEach(function(key) {
7186          _defineProperty(target, key, source[key]);
7187        });
7188      }
7189      return target;
7190    }
7191    function _inheritsLoose(subClass, superClass) {
7192      subClass.prototype = Object.create(superClass.prototype);
7193      subClass.prototype.constructor = subClass;
7194      subClass.__proto__ = superClass;
7195    }
7196    var TRANSITION_END = "transitionend";
7197    var MAX_UID = 1e6;
7198    var MILLISECONDS_MULTIPLIER = 1000;
7199    function toType(obj2) {
7200      return {}.toString.call(obj2).match(/\s([a-z]+)/i)[1].toLowerCase();
7201    }
7202    function getSpecialTransitionEndEvent() {
7203      return {
7204        bindType: TRANSITION_END,
7205        delegateType: TRANSITION_END,
7206        handle: function handle(event) {
7207          if ($2(event.target).is(this)) {
7208            return event.handleObj.handler.apply(this, arguments);
7209          }
7210          return;
7211        }
7212      };
7213    }
7214    function transitionEndEmulator(duration) {
7215      var _this = this;
7216      var called = false;
7217      $2(this).one(Util.TRANSITION_END, function() {
7218        called = true;
7219      });
7220      setTimeout(function() {
7221        if (!called) {
7222          Util.triggerTransitionEnd(_this);
7223        }
7224      }, duration);
7225      return this;
7226    }
7227    function setTransitionEndSupport() {
7228      $2.fn.emulateTransitionEnd = transitionEndEmulator;
7229      $2.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
7230    }
7231    var Util = {
7232      TRANSITION_END: "bsTransitionEnd",
7233      getUID: function getUID(prefix) {
7234        do {
7235          prefix += ~~(Math.random() * MAX_UID);
7236        } while (document.getElementById(prefix));
7237        return prefix;
7238      },
7239      getSelectorFromElement: function getSelectorFromElement(element) {
7240        var selector = element.getAttribute("data-target");
7241        if (!selector || selector === "#") {
7242          var hrefAttr = element.getAttribute("href");
7243          selector = hrefAttr && hrefAttr !== "#" ? hrefAttr.trim() : "";
7244        }
7245        try {
7246          return document.querySelector(selector) ? selector : null;
7247        } catch (err) {
7248          return null;
7249        }
7250      },
7251      getTransitionDurationFromElement: function getTransitionDurationFromElement(element) {
7252        if (!element) {
7253          return 0;
7254        }
7255        var transitionDuration = $2(element).css("transition-duration");
7256        var transitionDelay = $2(element).css("transition-delay");
7257        var floatTransitionDuration = parseFloat(transitionDuration);
7258        var floatTransitionDelay = parseFloat(transitionDelay);
7259        if (!floatTransitionDuration && !floatTransitionDelay) {
7260          return 0;
7261        }
7262        transitionDuration = transitionDuration.split(",")[0];
7263        transitionDelay = transitionDelay.split(",")[0];
7264        return (parseFloat(transitionDuration) + parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;
7265      },
7266      reflow: function reflow(element) {
7267        return element.offsetHeight;
7268      },
7269      triggerTransitionEnd: function triggerTransitionEnd(element) {
7270        $2(element).trigger(TRANSITION_END);
7271      },
7272      supportsTransitionEnd: function supportsTransitionEnd() {
7273        return Boolean(TRANSITION_END);
7274      },
7275      isElement: function isElement(obj2) {
7276        return (obj2[0] || obj2).nodeType;
7277      },
7278      typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
7279        for (var property in configTypes) {
7280          if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
7281            var expectedTypes = configTypes[property];
7282            var value = config[property];
7283            var valueType = value && Util.isElement(value) ? "element" : toType(value);
7284            if (!new RegExp(expectedTypes).test(valueType)) {
7285              throw new Error(componentName.toUpperCase() + ": " + ('Option "' + property + '" provided type "' + valueType + '" ') + ('but expected type "' + expectedTypes + '".'));
7286            }
7287          }
7288        }
7289      },
7290      findShadowRoot: function findShadowRoot(element) {
7291        if (!document.documentElement.attachShadow) {
7292          return null;
7293        }
7294        if (typeof element.getRootNode === "function") {
7295          var root2 = element.getRootNode();
7296          return root2 instanceof ShadowRoot ? root2 : null;
7297        }
7298        if (element instanceof ShadowRoot) {
7299          return element;
7300        }
7301        if (!element.parentNode) {
7302          return null;
7303        }
7304        return Util.findShadowRoot(element.parentNode);
7305      }
7306    };
7307    setTransitionEndSupport();
7308    var NAME = "alert";
7309    var VERSION = "4.3.1";
7310    var DATA_KEY = "bs.alert";
7311    var EVENT_KEY = "." + DATA_KEY;
7312    var DATA_API_KEY = ".data-api";
7313    var JQUERY_NO_CONFLICT = $2.fn[NAME];
7314    var Selector = {
7315      DISMISS: '[data-dismiss="alert"]'
7316    };
7317    var Event2 = {
7318      CLOSE: "close" + EVENT_KEY,
7319      CLOSED: "closed" + EVENT_KEY,
7320      CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
7321    };
7322    var ClassName = {
7323      ALERT: "alert",
7324      FADE: "fade",
7325      SHOW: "show"
7326    };
7327    var Alert = /* @__PURE__ */ function() {
7328      function Alert(element) {
7329        this._element = element;
7330      }
7331      var _proto = Alert.prototype;
7332      _proto.close = function close(element) {
7333        var rootElement = this._element;
7334        if (element) {
7335          rootElement = this._getRootElement(element);
7336        }
7337        var customEvent = this._triggerCloseEvent(rootElement);
7338        if (customEvent.isDefaultPrevented()) {
7339          return;
7340        }
7341        this._removeElement(rootElement);
7342      };
7343      _proto.dispose = function dispose() {
7344        $2.removeData(this._element, DATA_KEY);
7345        this._element = null;
7346      };
7347      _proto._getRootElement = function _getRootElement(element) {
7348        var selector = Util.getSelectorFromElement(element);
7349        var parent = false;
7350        if (selector) {
7351          parent = document.querySelector(selector);
7352        }
7353        if (!parent) {
7354          parent = $2(element).closest("." + ClassName.ALERT)[0];
7355        }
7356        return parent;
7357      };
7358      _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
7359        var closeEvent = $2.Event(Event2.CLOSE);
7360        $2(element).trigger(closeEvent);
7361        return closeEvent;
7362      };
7363      _proto._removeElement = function _removeElement(element) {
7364        var _this = this;
7365        $2(element).removeClass(ClassName.SHOW);
7366        if (!$2(element).hasClass(ClassName.FADE)) {
7367          this._destroyElement(element);
7368          return;
7369        }
7370        var transitionDuration = Util.getTransitionDurationFromElement(element);
7371        $2(element).one(Util.TRANSITION_END, function(event) {
7372          return _this._destroyElement(element, event);
7373        }).emulateTransitionEnd(transitionDuration);
7374      };
7375      _proto._destroyElement = function _destroyElement(element) {
7376        $2(element).detach().trigger(Event2.CLOSED).remove();
7377      };
7378      Alert._jQueryInterface = function _jQueryInterface(config) {
7379        return this.each(function() {
7380          var $element = $2(this);
7381          var data = $element.data(DATA_KEY);
7382          if (!data) {
7383            data = new Alert(this);
7384            $element.data(DATA_KEY, data);
7385          }
7386          if (config === "close") {
7387            data[config](this);
7388          }
7389        });
7390      };
7391      Alert._handleDismiss = function _handleDismiss(alertInstance) {
7392        return function(event) {
7393          if (event) {
7394            event.preventDefault();
7395          }
7396          alertInstance.close(this);
7397        };
7398      };
7399      _createClass(Alert, null, [{
7400        key: "VERSION",
7401        get: function get() {
7402          return VERSION;
7403        }
7404      }]);
7405      return Alert;
7406    }();
7407    $2(document).on(Event2.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert));
7408    $2.fn[NAME] = Alert._jQueryInterface;
7409    $2.fn[NAME].Constructor = Alert;
7410    $2.fn[NAME].noConflict = function() {
7411      $2.fn[NAME] = JQUERY_NO_CONFLICT;
7412      return Alert._jQueryInterface;
7413    };
7414    var NAME$1 = "button";
7415    var VERSION$1 = "4.3.1";
7416    var DATA_KEY$1 = "bs.button";
7417    var EVENT_KEY$1 = "." + DATA_KEY$1;
7418    var DATA_API_KEY$1 = ".data-api";
7419    var JQUERY_NO_CONFLICT$1 = $2.fn[NAME$1];
7420    var ClassName$1 = {
7421      ACTIVE: "active",
7422      BUTTON: "btn",
7423      FOCUS: "focus"
7424    };
7425    var Selector$1 = {
7426      DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
7427      DATA_TOGGLE: '[data-toggle="buttons"]',
7428      INPUT: 'input:not([type="hidden"])',
7429      ACTIVE: ".active",
7430      BUTTON: ".btn"
7431    };
7432    var Event$1 = {
7433      CLICK_DATA_API: "click" + EVENT_KEY$1 + DATA_API_KEY$1,
7434      FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY$1 + DATA_API_KEY$1 + " " + ("blur" + EVENT_KEY$1 + DATA_API_KEY$1)
7435    };
7436    var Button = /* @__PURE__ */ function() {
7437      function Button(element) {
7438        this._element = element;
7439      }
7440      var _proto = Button.prototype;
7441      _proto.toggle = function toggle() {
7442        var triggerChangeEvent = true;
7443        var addAriaPressed = true;
7444        var rootElement = $2(this._element).closest(Selector$1.DATA_TOGGLE)[0];
7445        if (rootElement) {
7446          var input = this._element.querySelector(Selector$1.INPUT);
7447          if (input) {
7448            if (input.type === "radio") {
7449              if (input.checked && this._element.classList.contains(ClassName$1.ACTIVE)) {
7450                triggerChangeEvent = false;
7451              } else {
7452                var activeElement = rootElement.querySelector(Selector$1.ACTIVE);
7453                if (activeElement) {
7454                  $2(activeElement).removeClass(ClassName$1.ACTIVE);
7455                }
7456              }
7457            }
7458            if (triggerChangeEvent) {
7459              if (input.hasAttribute("disabled") || rootElement.hasAttribute("disabled") || input.classList.contains("disabled") || rootElement.classList.contains("disabled")) {
7460                return;
7461              }
7462              input.checked = !this._element.classList.contains(ClassName$1.ACTIVE);
7463              $2(input).trigger("change");
7464            }
7465            input.focus();
7466            addAriaPressed = false;
7467          }
7468        }
7469        if (addAriaPressed) {
7470          this._element.setAttribute("aria-pressed", !this._element.classList.contains(ClassName$1.ACTIVE));
7471        }
7472        if (triggerChangeEvent) {
7473          $2(this._element).toggleClass(ClassName$1.ACTIVE);
7474        }
7475      };
7476      _proto.dispose = function dispose() {
7477        $2.removeData(this._element, DATA_KEY$1);
7478        this._element = null;
7479      };
7480      Button._jQueryInterface = function _jQueryInterface(config) {
7481        return this.each(function() {
7482          var data = $2(this).data(DATA_KEY$1);
7483          if (!data) {
7484            data = new Button(this);
7485            $2(this).data(DATA_KEY$1, data);
7486          }
7487          if (config === "toggle") {
7488            data[config]();
7489          }
7490        });
7491      };
7492      _createClass(Button, null, [{
7493        key: "VERSION",
7494        get: function get() {
7495          return VERSION$1;
7496        }
7497      }]);
7498      return Button;
7499    }();
7500    $2(document).on(Event$1.CLICK_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function(event) {
7501      event.preventDefault();
7502      var button = event.target;
7503      if (!$2(button).hasClass(ClassName$1.BUTTON)) {
7504        button = $2(button).closest(Selector$1.BUTTON);
7505      }
7506      Button._jQueryInterface.call($2(button), "toggle");
7507    }).on(Event$1.FOCUS_BLUR_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function(event) {
7508      var button = $2(event.target).closest(Selector$1.BUTTON)[0];
7509      $2(button).toggleClass(ClassName$1.FOCUS, /^focus(in)?$/.test(event.type));
7510    });
7511    $2.fn[NAME$1] = Button._jQueryInterface;
7512    $2.fn[NAME$1].Constructor = Button;
7513    $2.fn[NAME$1].noConflict = function() {
7514      $2.fn[NAME$1] = JQUERY_NO_CONFLICT$1;
7515      return Button._jQueryInterface;
7516    };
7517    var NAME$2 = "carousel";
7518    var VERSION$2 = "4.3.1";
7519    var DATA_KEY$2 = "bs.carousel";
7520    var EVENT_KEY$2 = "." + DATA_KEY$2;
7521    var DATA_API_KEY$2 = ".data-api";
7522    var JQUERY_NO_CONFLICT$2 = $2.fn[NAME$2];
7523    var ARROW_LEFT_KEYCODE = 37;
7524    var ARROW_RIGHT_KEYCODE = 39;
7525    var TOUCHEVENT_COMPAT_WAIT = 500;
7526    var SWIPE_THRESHOLD = 40;
7527    var Default = {
7528      interval: 5000,
7529      keyboard: true,
7530      slide: false,
7531      pause: "hover",
7532      wrap: true,
7533      touch: true
7534    };
7535    var DefaultType = {
7536      interval: "(number|boolean)",
7537      keyboard: "boolean",
7538      slide: "(boolean|string)",
7539      pause: "(string|boolean)",
7540      wrap: "boolean",
7541      touch: "boolean"
7542    };
7543    var Direction = {
7544      NEXT: "next",
7545      PREV: "prev",
7546      LEFT: "left",
7547      RIGHT: "right"
7548    };
7549    var Event$2 = {
7550      SLIDE: "slide" + EVENT_KEY$2,
7551      SLID: "slid" + EVENT_KEY$2,
7552      KEYDOWN: "keydown" + EVENT_KEY$2,
7553      MOUSEENTER: "mouseenter" + EVENT_KEY$2,
7554      MOUSELEAVE: "mouseleave" + EVENT_KEY$2,
7555      TOUCHSTART: "touchstart" + EVENT_KEY$2,
7556      TOUCHMOVE: "touchmove" + EVENT_KEY$2,
7557      TOUCHEND: "touchend" + EVENT_KEY$2,
7558      POINTERDOWN: "pointerdown" + EVENT_KEY$2,
7559      POINTERUP: "pointerup" + EVENT_KEY$2,
7560      DRAG_START: "dragstart" + EVENT_KEY$2,
7561      LOAD_DATA_API: "load" + EVENT_KEY$2 + DATA_API_KEY$2,
7562      CLICK_DATA_API: "click" + EVENT_KEY$2 + DATA_API_KEY$2
7563    };
7564    var ClassName$2 = {
7565      CAROUSEL: "carousel",
7566      ACTIVE: "active",
7567      SLIDE: "slide",
7568      RIGHT: "carousel-item-right",
7569      LEFT: "carousel-item-left",
7570      NEXT: "carousel-item-next",
7571      PREV: "carousel-item-prev",
7572      ITEM: "carousel-item",
7573      POINTER_EVENT: "pointer-event"
7574    };
7575    var Selector$2 = {
7576      ACTIVE: ".active",
7577      ACTIVE_ITEM: ".active.carousel-item",
7578      ITEM: ".carousel-item",
7579      ITEM_IMG: ".carousel-item img",
7580      NEXT_PREV: ".carousel-item-next, .carousel-item-prev",
7581      INDICATORS: ".carousel-indicators",
7582      DATA_SLIDE: "[data-slide], [data-slide-to]",
7583      DATA_RIDE: '[data-ride="carousel"]'
7584    };
7585    var PointerType = {
7586      TOUCH: "touch",
7587      PEN: "pen"
7588    };
7589    var Carousel = /* @__PURE__ */ function() {
7590      function Carousel(element, config) {
7591        this._items = null;
7592        this._interval = null;
7593        this._activeElement = null;
7594        this._isPaused = false;
7595        this._isSliding = false;
7596        this.touchTimeout = null;
7597        this.touchStartX = 0;
7598        this.touchDeltaX = 0;
7599        this._config = this._getConfig(config);
7600        this._element = element;
7601        this._indicatorsElement = this._element.querySelector(Selector$2.INDICATORS);
7602        this._touchSupported = "ontouchstart" in document.documentElement || navigator.maxTouchPoints > 0;
7603        this._pointerEvent = Boolean(window.PointerEvent || window.MSPointerEvent);
7604        this._addEventListeners();
7605      }
7606      var _proto = Carousel.prototype;
7607      _proto.next = function next() {
7608        if (!this._isSliding) {
7609          this._slide(Direction.NEXT);
7610        }
7611      };
7612      _proto.nextWhenVisible = function nextWhenVisible() {
7613        if (!document.hidden && $2(this._element).is(":visible") && $2(this._element).css("visibility") !== "hidden") {
7614          this.next();
7615        }
7616      };
7617      _proto.prev = function prev() {
7618        if (!this._isSliding) {
7619          this._slide(Direction.PREV);
7620        }
7621      };
7622      _proto.pause = function pause(event) {
7623        if (!event) {
7624          this._isPaused = true;
7625        }
7626        if (this._element.querySelector(Selector$2.NEXT_PREV)) {
7627          Util.triggerTransitionEnd(this._element);
7628          this.cycle(true);
7629        }
7630        clearInterval(this._interval);
7631        this._interval = null;
7632      };
7633      _proto.cycle = function cycle(event) {
7634        if (!event) {
7635          this._isPaused = false;
7636        }
7637        if (this._interval) {
7638          clearInterval(this._interval);
7639          this._interval = null;
7640        }
7641        if (this._config.interval && !this._isPaused) {
7642          this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
7643        }
7644      };
7645      _proto.to = function to(index) {
7646        var _this = this;
7647        this._activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
7648        var activeIndex = this._getItemIndex(this._activeElement);
7649        if (index > this._items.length - 1 || index < 0) {
7650          return;
7651        }
7652        if (this._isSliding) {
7653          $2(this._element).one(Event$2.SLID, function() {
7654            return _this.to(index);
7655          });
7656          return;
7657        }
7658        if (activeIndex === index) {
7659          this.pause();
7660          this.cycle();
7661          return;
7662        }
7663        var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
7664        this._slide(direction, this._items[index]);
7665      };
7666      _proto.dispose = function dispose() {
7667        $2(this._element).off(EVENT_KEY$2);
7668        $2.removeData(this._element, DATA_KEY$2);
7669        this._items = null;
7670        this._config = null;
7671        this._element = null;
7672        this._interval = null;
7673        this._isPaused = null;
7674        this._isSliding = null;
7675        this._activeElement = null;
7676        this._indicatorsElement = null;
7677      };
7678      _proto._getConfig = function _getConfig(config) {
7679        config = _objectSpread({}, Default, config);
7680        Util.typeCheckConfig(NAME$2, config, DefaultType);
7681        return config;
7682      };
7683      _proto._handleSwipe = function _handleSwipe() {
7684        var absDeltax = Math.abs(this.touchDeltaX);
7685        if (absDeltax <= SWIPE_THRESHOLD) {
7686          return;
7687        }
7688        var direction = absDeltax / this.touchDeltaX;
7689        if (direction > 0) {
7690          this.prev();
7691        }
7692        if (direction < 0) {
7693          this.next();
7694        }
7695      };
7696      _proto._addEventListeners = function _addEventListeners() {
7697        var _this2 = this;
7698        if (this._config.keyboard) {
7699          $2(this._element).on(Event$2.KEYDOWN, function(event) {
7700            return _this2._keydown(event);
7701          });
7702        }
7703        if (this._config.pause === "hover") {
7704          $2(this._element).on(Event$2.MOUSEENTER, function(event) {
7705            return _this2.pause(event);
7706          }).on(Event$2.MOUSELEAVE, function(event) {
7707            return _this2.cycle(event);
7708          });
7709        }
7710        if (this._config.touch) {
7711          this._addTouchEventListeners();
7712        }
7713      };
7714      _proto._addTouchEventListeners = function _addTouchEventListeners() {
7715        var _this3 = this;
7716        if (!this._touchSupported) {
7717          return;
7718        }
7719        var start = function start(event) {
7720          if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
7721            _this3.touchStartX = event.originalEvent.clientX;
7722          } else if (!_this3._pointerEvent) {
7723            _this3.touchStartX = event.originalEvent.touches[0].clientX;
7724          }
7725        };
7726        var move = function move(event) {
7727          if (event.originalEvent.touches && event.originalEvent.touches.length > 1) {
7728            _this3.touchDeltaX = 0;
7729          } else {
7730            _this3.touchDeltaX = event.originalEvent.touches[0].clientX - _this3.touchStartX;
7731          }
7732        };
7733        var end = function end(event) {
7734          if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
7735            _this3.touchDeltaX = event.originalEvent.clientX - _this3.touchStartX;
7736          }
7737          _this3._handleSwipe();
7738          if (_this3._config.pause === "hover") {
7739            _this3.pause();
7740            if (_this3.touchTimeout) {
7741              clearTimeout(_this3.touchTimeout);
7742            }
7743            _this3.touchTimeout = setTimeout(function(event) {
7744              return _this3.cycle(event);
7745            }, TOUCHEVENT_COMPAT_WAIT + _this3._config.interval);
7746          }
7747        };
7748        $2(this._element.querySelectorAll(Selector$2.ITEM_IMG)).on(Event$2.DRAG_START, function(e) {
7749          return e.preventDefault();
7750        });
7751        if (this._pointerEvent) {
7752          $2(this._element).on(Event$2.POINTERDOWN, function(event) {
7753            return start(event);
7754          });
7755          $2(this._element).on(Event$2.POINTERUP, function(event) {
7756            return end(event);
7757          });
7758          this._element.classList.add(ClassName$2.POINTER_EVENT);
7759        } else {
7760          $2(this._element).on(Event$2.TOUCHSTART, function(event) {
7761            return start(event);
7762          });
7763          $2(this._element).on(Event$2.TOUCHMOVE, function(event) {
7764            return move(event);
7765          });
7766          $2(this._element).on(Event$2.TOUCHEND, function(event) {
7767            return end(event);
7768          });
7769        }
7770      };
7771      _proto._keydown = function _keydown(event) {
7772        if (/input|textarea/i.test(event.target.tagName)) {
7773          return;
7774        }
7775        switch (event.which) {
7776          case ARROW_LEFT_KEYCODE:
7777            event.preventDefault();
7778            this.prev();
7779            break;
7780          case ARROW_RIGHT_KEYCODE:
7781            event.preventDefault();
7782            this.next();
7783            break;
7784          default:
7785        }
7786      };
7787      _proto._getItemIndex = function _getItemIndex(element) {
7788        this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector$2.ITEM)) : [];
7789        return this._items.indexOf(element);
7790      };
7791      _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
7792        var isNextDirection = direction === Direction.NEXT;
7793        var isPrevDirection = direction === Direction.PREV;
7794        var activeIndex = this._getItemIndex(activeElement);
7795        var lastItemIndex = this._items.length - 1;
7796        var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
7797        if (isGoingToWrap && !this._config.wrap) {
7798          return activeElement;
7799        }
7800        var delta = direction === Direction.PREV ? -1 : 1;
7801        var itemIndex = (activeIndex + delta) % this._items.length;
7802        return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
7803      };
7804      _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
7805        var targetIndex = this._getItemIndex(relatedTarget);
7806        var fromIndex = this._getItemIndex(this._element.querySelector(Selector$2.ACTIVE_ITEM));
7807        var slideEvent = $2.Event(Event$2.SLIDE, {
7808          relatedTarget,
7809          direction: eventDirectionName,
7810          from: fromIndex,
7811          to: targetIndex
7812        });
7813        $2(this._element).trigger(slideEvent);
7814        return slideEvent;
7815      };
7816      _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
7817        if (this._indicatorsElement) {
7818          var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector$2.ACTIVE));
7819          $2(indicators).removeClass(ClassName$2.ACTIVE);
7820          var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
7821          if (nextIndicator) {
7822            $2(nextIndicator).addClass(ClassName$2.ACTIVE);
7823          }
7824        }
7825      };
7826      _proto._slide = function _slide(direction, element) {
7827        var _this4 = this;
7828        var activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
7829        var activeElementIndex = this._getItemIndex(activeElement);
7830        var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
7831        var nextElementIndex = this._getItemIndex(nextElement);
7832        var isCycling = Boolean(this._interval);
7833        var directionalClassName;
7834        var orderClassName;
7835        var eventDirectionName;
7836        if (direction === Direction.NEXT) {
7837          directionalClassName = ClassName$2.LEFT;
7838          orderClassName = ClassName$2.NEXT;
7839          eventDirectionName = Direction.LEFT;
7840        } else {
7841          directionalClassName = ClassName$2.RIGHT;
7842          orderClassName = ClassName$2.PREV;
7843          eventDirectionName = Direction.RIGHT;
7844        }
7845        if (nextElement && $2(nextElement).hasClass(ClassName$2.ACTIVE)) {
7846          this._isSliding = false;
7847          return;
7848        }
7849        var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
7850        if (slideEvent.isDefaultPrevented()) {
7851          return;
7852        }
7853        if (!activeElement || !nextElement) {
7854          return;
7855        }
7856        this._isSliding = true;
7857        if (isCycling) {
7858          this.pause();
7859        }
7860        this._setActiveIndicatorElement(nextElement);
7861        var slidEvent = $2.Event(Event$2.SLID, {
7862          relatedTarget: nextElement,
7863          direction: eventDirectionName,
7864          from: activeElementIndex,
7865          to: nextElementIndex
7866        });
7867        if ($2(this._element).hasClass(ClassName$2.SLIDE)) {
7868          $2(nextElement).addClass(orderClassName);
7869          Util.reflow(nextElement);
7870          $2(activeElement).addClass(directionalClassName);
7871          $2(nextElement).addClass(directionalClassName);
7872          var nextElementInterval = parseInt(nextElement.getAttribute("data-interval"), 10);
7873          if (nextElementInterval) {
7874            this._config.defaultInterval = this._config.defaultInterval || this._config.interval;
7875            this._config.interval = nextElementInterval;
7876          } else {
7877            this._config.interval = this._config.defaultInterval || this._config.interval;
7878          }
7879          var transitionDuration = Util.getTransitionDurationFromElement(activeElement);
7880          $2(activeElement).one(Util.TRANSITION_END, function() {
7881            $2(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName$2.ACTIVE);
7882            $2(activeElement).removeClass(ClassName$2.ACTIVE + " " + orderClassName + " " + directionalClassName);
7883            _this4._isSliding = false;
7884            setTimeout(function() {
7885              return $2(_this4._element).trigger(slidEvent);
7886            }, 0);
7887          }).emulateTransitionEnd(transitionDuration);
7888        } else {
7889          $2(activeElement).removeClass(ClassName$2.ACTIVE);
7890          $2(nextElement).addClass(ClassName$2.ACTIVE);
7891          this._isSliding = false;
7892          $2(this._element).trigger(slidEvent);
7893        }
7894        if (isCycling) {
7895          this.cycle();
7896        }
7897      };
7898      Carousel._jQueryInterface = function _jQueryInterface(config) {
7899        return this.each(function() {
7900          var data = $2(this).data(DATA_KEY$2);
7901          var _config = _objectSpread({}, Default, $2(this).data());
7902          if (typeof config === "object") {
7903            _config = _objectSpread({}, _config, config);
7904          }
7905          var action = typeof config === "string" ? config : _config.slide;
7906          if (!data) {
7907            data = new Carousel(this, _config);
7908            $2(this).data(DATA_KEY$2, data);
7909          }
7910          if (typeof config === "number") {
7911            data.to(config);
7912          } else if (typeof action === "string") {
7913            if (typeof data[action] === "undefined") {
7914              throw new TypeError('No method named "' + action + '"');
7915            }
7916            data[action]();
7917          } else if (_config.interval && _config.ride) {
7918            data.pause();
7919            data.cycle();
7920          }
7921        });
7922      };
7923      Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
7924        var selector = Util.getSelectorFromElement(this);
7925        if (!selector) {
7926          return;
7927        }
7928        var target = $2(selector)[0];
7929        if (!target || !$2(target).hasClass(ClassName$2.CAROUSEL)) {
7930          return;
7931        }
7932        var config = _objectSpread({}, $2(target).data(), $2(this).data());
7933        var slideIndex = this.getAttribute("data-slide-to");
7934        if (slideIndex) {
7935          config.interval = false;
7936        }
7937        Carousel._jQueryInterface.call($2(target), config);
7938        if (slideIndex) {
7939          $2(target).data(DATA_KEY$2).to(slideIndex);
7940        }
7941        event.preventDefault();
7942      };
7943      _createClass(Carousel, null, [{
7944        key: "VERSION",
7945        get: function get() {
7946          return VERSION$2;
7947        }
7948      }, {
7949        key: "Default",
7950        get: function get() {
7951          return Default;
7952        }
7953      }]);
7954      return Carousel;
7955    }();
7956    $2(document).on(Event$2.CLICK_DATA_API, Selector$2.DATA_SLIDE, Carousel._dataApiClickHandler);
7957    $2(window).on(Event$2.LOAD_DATA_API, function() {
7958      var carousels = [].slice.call(document.querySelectorAll(Selector$2.DATA_RIDE));
7959      for (var i = 0, len = carousels.length;i < len; i++) {
7960        var $carousel = $2(carousels[i]);
7961        Carousel._jQueryInterface.call($carousel, $carousel.data());
7962      }
7963    });
7964    $2.fn[NAME$2] = Carousel._jQueryInterface;
7965    $2.fn[NAME$2].Constructor = Carousel;
7966    $2.fn[NAME$2].noConflict = function() {
7967      $2.fn[NAME$2] = JQUERY_NO_CONFLICT$2;
7968      return Carousel._jQueryInterface;
7969    };
7970    var NAME$3 = "collapse";
7971    var VERSION$3 = "4.3.1";
7972    var DATA_KEY$3 = "bs.collapse";
7973    var EVENT_KEY$3 = "." + DATA_KEY$3;
7974    var DATA_API_KEY$3 = ".data-api";
7975    var JQUERY_NO_CONFLICT$3 = $2.fn[NAME$3];
7976    var Default$1 = {
7977      toggle: true,
7978      parent: ""
7979    };
7980    var DefaultType$1 = {
7981      toggle: "boolean",
7982      parent: "(string|element)"
7983    };
7984    var Event$3 = {
7985      SHOW: "show" + EVENT_KEY$3,
7986      SHOWN: "shown" + EVENT_KEY$3,
7987      HIDE: "hide" + EVENT_KEY$3,
7988      HIDDEN: "hidden" + EVENT_KEY$3,
7989      CLICK_DATA_API: "click" + EVENT_KEY$3 + DATA_API_KEY$3
7990    };
7991    var ClassName$3 = {
7992      SHOW: "show",
7993      COLLAPSE: "collapse",
7994      COLLAPSING: "collapsing",
7995      COLLAPSED: "collapsed"
7996    };
7997    var Dimension = {
7998      WIDTH: "width",
7999      HEIGHT: "height"
8000    };
8001    var Selector$3 = {
8002      ACTIVES: ".show, .collapsing",
8003      DATA_TOGGLE: '[data-toggle="collapse"]'
8004    };
8005    var Collapse = /* @__PURE__ */ function() {
8006      function Collapse(element, config) {
8007        this._isTransitioning = false;
8008        this._element = element;
8009        this._config = this._getConfig(config);
8010        this._triggerArray = [].slice.call(document.querySelectorAll('[data-toggle="collapse"][href="#' + element.id + '"],' + ('[data-toggle="collapse"][data-target="#' + element.id + '"]')));
8011        var toggleList = [].slice.call(document.querySelectorAll(Selector$3.DATA_TOGGLE));
8012        for (var i = 0, len = toggleList.length;i < len; i++) {
8013          var elem = toggleList[i];
8014          var selector = Util.getSelectorFromElement(elem);
8015          var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function(foundElem) {
8016            return foundElem === element;
8017          });
8018          if (selector !== null && filterElement.length > 0) {
8019            this._selector = selector;
8020            this._triggerArray.push(elem);
8021          }
8022        }
8023        this._parent = this._config.parent ? this._getParent() : null;
8024        if (!this._config.parent) {
8025          this._addAriaAndCollapsedClass(this._element, this._triggerArray);
8026        }
8027        if (this._config.toggle) {
8028          this.toggle();
8029        }
8030      }
8031      var _proto = Collapse.prototype;
8032      _proto.toggle = function toggle() {
8033        if ($2(this._element).hasClass(ClassName$3.SHOW)) {
8034          this.hide();
8035        } else {
8036          this.show();
8037        }
8038      };
8039      _proto.show = function show() {
8040        var _this = this;
8041        if (this._isTransitioning || $2(this._element).hasClass(ClassName$3.SHOW)) {
8042          return;
8043        }
8044        var actives;
8045        var activesData;
8046        if (this._parent) {
8047          actives = [].slice.call(this._parent.querySelectorAll(Selector$3.ACTIVES)).filter(function(elem) {
8048            if (typeof _this._config.parent === "string") {
8049              return elem.getAttribute("data-parent") === _this._config.parent;
8050            }
8051            return elem.classList.contains(ClassName$3.COLLAPSE);
8052          });
8053          if (actives.length === 0) {
8054            actives = null;
8055          }
8056        }
8057        if (actives) {
8058          activesData = $2(actives).not(this._selector).data(DATA_KEY$3);
8059          if (activesData && activesData._isTransitioning) {
8060            return;
8061          }
8062        }
8063        var startEvent = $2.Event(Event$3.SHOW);
8064        $2(this._element).trigger(startEvent);
8065        if (startEvent.isDefaultPrevented()) {
8066          return;
8067        }
8068        if (actives) {
8069          Collapse._jQueryInterface.call($2(actives).not(this._selector), "hide");
8070          if (!activesData) {
8071            $2(actives).data(DATA_KEY$3, null);
8072          }
8073        }
8074        var dimension = this._getDimension();
8075        $2(this._element).removeClass(ClassName$3.COLLAPSE).addClass(ClassName$3.COLLAPSING);
8076        this._element.style[dimension] = 0;
8077        if (this._triggerArray.length) {
8078          $2(this._triggerArray).removeClass(ClassName$3.COLLAPSED).attr("aria-expanded", true);
8079        }
8080        this.setTransitioning(true);
8081        var complete = function complete() {
8082          $2(_this._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).addClass(ClassName$3.SHOW);
8083          _this._element.style[dimension] = "";
8084          _this.setTransitioning(false);
8085          $2(_this._element).trigger(Event$3.SHOWN);
8086        };
8087        var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
8088        var scrollSize = "scroll" + capitalizedDimension;
8089        var transitionDuration = Util.getTransitionDurationFromElement(this._element);
8090        $2(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
8091        this._element.style[dimension] = this._element[scrollSize] + "px";
8092      };
8093      _proto.hide = function hide() {
8094        var _this2 = this;
8095        if (this._isTransitioning || !$2(this._element).hasClass(ClassName$3.SHOW)) {
8096          return;
8097        }
8098        var startEvent = $2.Event(Event$3.HIDE);
8099        $2(this._element).trigger(startEvent);
8100        if (startEvent.isDefaultPrevented()) {
8101          return;
8102        }
8103        var dimension = this._getDimension();
8104        this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
8105        Util.reflow(this._element);
8106        $2(this._element).addClass(ClassName$3.COLLAPSING).removeClass(ClassName$3.COLLAPSE).removeClass(ClassName$3.SHOW);
8107        var triggerArrayLength = this._triggerArray.length;
8108        if (triggerArrayLength > 0) {
8109          for (var i = 0;i < triggerArrayLength; i++) {
8110            var trigger = this._triggerArray[i];
8111            var selector = Util.getSelectorFromElement(trigger);
8112            if (selector !== null) {
8113              var $elem = $2([].slice.call(document.querySelectorAll(selector)));
8114              if (!$elem.hasClass(ClassName$3.SHOW)) {
8115                $2(trigger).addClass(ClassName$3.COLLAPSED).attr("aria-expanded", false);
8116              }
8117            }
8118          }
8119        }
8120        this.setTransitioning(true);
8121        var complete = function complete() {
8122          _this2.setTransitioning(false);
8123          $2(_this2._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).trigger(Event$3.HIDDEN);
8124        };
8125        this._element.style[dimension] = "";
8126        var transitionDuration = Util.getTransitionDurationFromElement(this._element);
8127        $2(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
8128      };
8129      _proto.setTransitioning = function setTransitioning(isTransitioning) {
8130        this._isTransitioning = isTransitioning;
8131      };
8132      _proto.dispose = function dispose() {
8133        $2.removeData(this._element, DATA_KEY$3);
8134        this._config = null;
8135        this._parent = null;
8136        this._element = null;
8137        this._triggerArray = null;
8138        this._isTransitioning = null;
8139      };
8140      _proto._getConfig = function _getConfig(config) {
8141        config = _objectSpread({}, Default$1, config);
8142        config.toggle = Boolean(config.toggle);
8143        Util.typeCheckConfig(NAME$3, config, DefaultType$1);
8144        return config;
8145      };
8146      _proto._getDimension = function _getDimension() {
8147        var hasWidth = $2(this._element).hasClass(Dimension.WIDTH);
8148        return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
8149      };
8150      _proto._getParent = function _getParent() {
8151        var _this3 = this;
8152        var parent;
8153        if (Util.isElement(this._config.parent)) {
8154          parent = this._config.parent;
8155          if (typeof this._config.parent.jquery !== "undefined") {
8156            parent = this._config.parent[0];
8157          }
8158        } else {
8159          parent = document.querySelector(this._config.parent);
8160        }
8161        var selector = '[data-toggle="collapse"][data-parent="' + this._config.parent + '"]';
8162        var children = [].slice.call(parent.querySelectorAll(selector));
8163        $2(children).each(function(i, element) {
8164          _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
8165        });
8166        return parent;
8167      };
8168      _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
8169        var isOpen = $2(element).hasClass(ClassName$3.SHOW);
8170        if (triggerArray.length) {
8171          $2(triggerArray).toggleClass(ClassName$3.COLLAPSED, !isOpen).attr("aria-expanded", isOpen);
8172        }
8173      };
8174      Collapse._getTargetFromElement = function _getTargetFromElement(element) {
8175        var selector = Util.getSelectorFromElement(element);
8176        return selector ? document.querySelector(selector) : null;
8177      };
8178      Collapse._jQueryInterface = function _jQueryInterface(config) {
8179        return this.each(function() {
8180          var $this = $2(this);
8181          var data = $this.data(DATA_KEY$3);
8182          var _config = _objectSpread({}, Default$1, $this.data(), typeof config === "object" && config ? config : {});
8183          if (!data && _config.toggle && /show|hide/.test(config)) {
8184            _config.toggle = false;
8185          }
8186          if (!data) {
8187            data = new Collapse(this, _config);
8188            $this.data(DATA_KEY$3, data);
8189          }
8190          if (typeof config === "string") {
8191            if (typeof data[config] === "undefined") {
8192              throw new TypeError('No method named "' + config + '"');
8193            }
8194            data[config]();
8195          }
8196        });
8197      };
8198      _createClass(Collapse, null, [{
8199        key: "VERSION",
8200        get: function get() {
8201          return VERSION$3;
8202        }
8203      }, {
8204        key: "Default",
8205        get: function get() {
8206          return Default$1;
8207        }
8208      }]);
8209      return Collapse;
8210    }();
8211    $2(document).on(Event$3.CLICK_DATA_API, Selector$3.DATA_TOGGLE, function(event) {
8212      if (event.currentTarget.tagName === "A") {
8213        event.preventDefault();
8214      }
8215      var $trigger = $2(this);
8216      var selector = Util.getSelectorFromElement(this);
8217      var selectors = [].slice.call(document.querySelectorAll(selector));
8218      $2(selectors).each(function() {
8219        var $target = $2(this);
8220        var data = $target.data(DATA_KEY$3);
8221        var config = data ? "toggle" : $trigger.data();
8222        Collapse._jQueryInterface.call($target, config);
8223      });
8224    });
8225    $2.fn[NAME$3] = Collapse._jQueryInterface;
8226    $2.fn[NAME$3].Constructor = Collapse;
8227    $2.fn[NAME$3].noConflict = function() {
8228      $2.fn[NAME$3] = JQUERY_NO_CONFLICT$3;
8229      return Collapse._jQueryInterface;
8230    };
8231    var NAME$4 = "dropdown";
8232    var VERSION$4 = "4.3.1";
8233    var DATA_KEY$4 = "bs.dropdown";
8234    var EVENT_KEY$4 = "." + DATA_KEY$4;
8235    var DATA_API_KEY$4 = ".data-api";
8236    var JQUERY_NO_CONFLICT$4 = $2.fn[NAME$4];
8237    var ESCAPE_KEYCODE = 27;
8238    var SPACE_KEYCODE = 32;
8239    var TAB_KEYCODE = 9;
8240    var ARROW_UP_KEYCODE = 38;
8241    var ARROW_DOWN_KEYCODE = 40;
8242    var RIGHT_MOUSE_BUTTON_WHICH = 3;
8243    var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
8244    var Event$4 = {
8245      HIDE: "hide" + EVENT_KEY$4,
8246      HIDDEN: "hidden" + EVENT_KEY$4,
8247      SHOW: "show" + EVENT_KEY$4,
8248      SHOWN: "shown" + EVENT_KEY$4,
8249      CLICK: "click" + EVENT_KEY$4,
8250      CLICK_DATA_API: "click" + EVENT_KEY$4 + DATA_API_KEY$4,
8251      KEYDOWN_DATA_API: "keydown" + EVENT_KEY$4 + DATA_API_KEY$4,
8252      KEYUP_DATA_API: "keyup" + EVENT_KEY$4 + DATA_API_KEY$4
8253    };
8254    var ClassName$4 = {
8255      DISABLED: "disabled",
8256      SHOW: "show",
8257      DROPUP: "dropup",
8258      DROPRIGHT: "dropright",
8259      DROPLEFT: "dropleft",
8260      MENURIGHT: "dropdown-menu-right",
8261      MENULEFT: "dropdown-menu-left",
8262      POSITION_STATIC: "position-static"
8263    };
8264    var Selector$4 = {
8265      DATA_TOGGLE: '[data-toggle="dropdown"]',
8266      FORM_CHILD: ".dropdown form",
8267      MENU: ".dropdown-menu",
8268      NAVBAR_NAV: ".navbar-nav",
8269      VISIBLE_ITEMS: ".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)"
8270    };
8271    var AttachmentMap = {
8272      TOP: "top-start",
8273      TOPEND: "top-end",
8274      BOTTOM: "bottom-start",
8275      BOTTOMEND: "bottom-end",
8276      RIGHT: "right-start",
8277      RIGHTEND: "right-end",
8278      LEFT: "left-start",
8279      LEFTEND: "left-end"
8280    };
8281    var Default$2 = {
8282      offset: 0,
8283      flip: true,
8284      boundary: "scrollParent",
8285      reference: "toggle",
8286      display: "dynamic"
8287    };
8288    var DefaultType$2 = {
8289      offset: "(number|string|function)",
8290      flip: "boolean",
8291      boundary: "(string|element)",
8292      reference: "(string|element)",
8293      display: "string"
8294    };
8295    var Dropdown = /* @__PURE__ */ function() {
8296      function Dropdown(element, config) {
8297        this._element = element;
8298        this._popper = null;
8299        this._config = this._getConfig(config);
8300        this._menu = this._getMenuElement();
8301        this._inNavbar = this._detectNavbar();
8302        this._addEventListeners();
8303      }
8304      var _proto = Dropdown.prototype;
8305      _proto.toggle = function toggle() {
8306        if (this._element.disabled || $2(this._element).hasClass(ClassName$4.DISABLED)) {
8307          return;
8308        }
8309        var parent = Dropdown._getParentFromElement(this._element);
8310        var isActive = $2(this._menu).hasClass(ClassName$4.SHOW);
8311        Dropdown._clearMenus();
8312        if (isActive) {
8313          return;
8314        }
8315        var relatedTarget = {
8316          relatedTarget: this._element
8317        };
8318        var showEvent = $2.Event(Event$4.SHOW, relatedTarget);
8319        $2(parent).trigger(showEvent);
8320        if (showEvent.isDefaultPrevented()) {
8321          return;
8322        }
8323        if (!this._inNavbar) {
8324          if (typeof Popper === "undefined") {
8325            throw new TypeError("Bootstrap's dropdowns require Popper.js (https://popper.js.org/)");
8326          }
8327          var referenceElement = this._element;
8328          if (this._config.reference === "parent") {
8329            referenceElement = parent;
8330          } else if (Util.isElement(this._config.reference)) {
8331            referenceElement = this._config.reference;
8332            if (typeof this._config.reference.jquery !== "undefined") {
8333              referenceElement = this._config.reference[0];
8334            }
8335          }
8336          if (this._config.boundary !== "scrollParent") {
8337            $2(parent).addClass(ClassName$4.POSITION_STATIC);
8338          }
8339          this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig());
8340        }
8341        if ("ontouchstart" in document.documentElement && $2(parent).closest(Selector$4.NAVBAR_NAV).length === 0) {
8342          $2(document.body).children().on("mouseover", null, $2.noop);
8343        }
8344        this._element.focus();
8345        this._element.setAttribute("aria-expanded", true);
8346        $2(this._menu).toggleClass(ClassName$4.SHOW);
8347        $2(parent).toggleClass(ClassName$4.SHOW).trigger($2.Event(Event$4.SHOWN, relatedTarget));
8348      };
8349      _proto.show = function show() {
8350        if (this._element.disabled || $2(this._element).hasClass(ClassName$4.DISABLED) || $2(this._menu).hasClass(ClassName$4.SHOW)) {
8351          return;
8352        }
8353        var relatedTarget = {
8354          relatedTarget: this._element
8355        };
8356        var showEvent = $2.Event(Event$4.SHOW, relatedTarget);
8357        var parent = Dropdown._getParentFromElement(this._element);
8358        $2(parent).trigger(showEvent);
8359        if (showEvent.isDefaultPrevented()) {
8360          return;
8361        }
8362        $2(this._menu).toggleClass(ClassName$4.SHOW);
8363        $2(parent).toggleClass(ClassName$4.SHOW).trigger($2.Event(Event$4.SHOWN, relatedTarget));
8364      };
8365      _proto.hide = function hide() {
8366        if (this._element.disabled || $2(this._element).hasClass(ClassName$4.DISABLED) || !$2(this._menu).hasClass(ClassName$4.SHOW)) {
8367          return;
8368        }
8369        var relatedTarget = {
8370          relatedTarget: this._element
8371        };
8372        var hideEvent = $2.Event(Event$4.HIDE, relatedTarget);
8373        var parent = Dropdown._getParentFromElement(this._element);
8374        $2(parent).trigger(hideEvent);
8375        if (hideEvent.isDefaultPrevented()) {
8376          return;
8377        }
8378        $2(this._menu).toggleClass(ClassName$4.SHOW);
8379        $2(parent).toggleClass(ClassName$4.SHOW).trigger($2.Event(Event$4.HIDDEN, relatedTarget));
8380      };
8381      _proto.dispose = function dispose() {
8382        $2.removeData(this._element, DATA_KEY$4);
8383        $2(this._element).off(EVENT_KEY$4);
8384        this._element = null;
8385        this._menu = null;
8386        if (this._popper !== null) {
8387          this._popper.destroy();
8388          this._popper = null;
8389        }
8390      };
8391      _proto.update = function update() {
8392        this._inNavbar = this._detectNavbar();
8393        if (this._popper !== null) {
8394          this._popper.scheduleUpdate();
8395        }
8396      };
8397      _proto._addEventListeners = function _addEventListeners() {
8398        var _this = this;
8399        $2(this._element).on(Event$4.CLICK, function(event) {
8400          event.preventDefault();
8401          event.stopPropagation();
8402          _this.toggle();
8403        });
8404      };
8405      _proto._getConfig = function _getConfig(config) {
8406        config = _objectSpread({}, this.constructor.Default, $2(this._element).data(), config);
8407        Util.typeCheckConfig(NAME$4, config, this.constructor.DefaultType);
8408        return config;
8409      };
8410      _proto._getMenuElement = function _getMenuElement() {
8411        if (!this._menu) {
8412          var parent = Dropdown._getParentFromElement(this._element);
8413          if (parent) {
8414            this._menu = parent.querySelector(Selector$4.MENU);
8415          }
8416        }
8417        return this._menu;
8418      };
8419      _proto._getPlacement = function _getPlacement() {
8420        var $parentDropdown = $2(this._element.parentNode);
8421        var placement = AttachmentMap.BOTTOM;
8422        if ($parentDropdown.hasClass(ClassName$4.DROPUP)) {
8423          placement = AttachmentMap.TOP;
8424          if ($2(this._menu).hasClass(ClassName$4.MENURIGHT)) {
8425            placement = AttachmentMap.TOPEND;
8426          }
8427        } else if ($parentDropdown.hasClass(ClassName$4.DROPRIGHT)) {
8428          placement = AttachmentMap.RIGHT;
8429        } else if ($parentDropdown.hasClass(ClassName$4.DROPLEFT)) {
8430          placement = AttachmentMap.LEFT;
8431        } else if ($2(this._menu).hasClass(ClassName$4.MENURIGHT)) {
8432          placement = AttachmentMap.BOTTOMEND;
8433        }
8434        return placement;
8435      };
8436      _proto._detectNavbar = function _detectNavbar() {
8437        return $2(this._element).closest(".navbar").length > 0;
8438      };
8439      _proto._getOffset = function _getOffset() {
8440        var _this2 = this;
8441        var offset = {};
8442        if (typeof this._config.offset === "function") {
8443          offset.fn = function(data) {
8444            data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets, _this2._element) || {});
8445            return data;
8446          };
8447        } else {
8448          offset.offset = this._config.offset;
8449        }
8450        return offset;
8451      };
8452      _proto._getPopperConfig = function _getPopperConfig() {
8453        var popperConfig = {
8454          placement: this._getPlacement(),
8455          modifiers: {
8456            offset: this._getOffset(),
8457            flip: {
8458              enabled: this._config.flip
8459            },
8460            preventOverflow: {
8461              boundariesElement: this._config.boundary
8462            }
8463          }
8464        };
8465        if (this._config.display === "static") {
8466          popperConfig.modifiers.applyStyle = {
8467            enabled: false
8468          };
8469        }
8470        return popperConfig;
8471      };
8472      Dropdown._jQueryInterface = function _jQueryInterface(config) {
8473        return this.each(function() {
8474          var data = $2(this).data(DATA_KEY$4);
8475          var _config = typeof config === "object" ? config : null;
8476          if (!data) {
8477            data = new Dropdown(this, _config);
8478            $2(this).data(DATA_KEY$4, data);
8479          }
8480          if (typeof config === "string") {
8481            if (typeof data[config] === "undefined") {
8482              throw new TypeError('No method named "' + config + '"');
8483            }
8484            data[config]();
8485          }
8486        });
8487      };
8488      Dropdown._clearMenus = function _clearMenus(event) {
8489        if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === "keyup" && event.which !== TAB_KEYCODE)) {
8490          return;
8491        }
8492        var toggles = [].slice.call(document.querySelectorAll(Selector$4.DATA_TOGGLE));
8493        for (var i = 0, len = toggles.length;i < len; i++) {
8494          var parent = Dropdown._getParentFromElement(toggles[i]);
8495          var context = $2(toggles[i]).data(DATA_KEY$4);
8496          var relatedTarget = {
8497            relatedTarget: toggles[i]
8498          };
8499          if (event && event.type === "click") {
8500            relatedTarget.clickEvent = event;
8501          }
8502          if (!context) {
8503            continue;
8504          }
8505          var dropdownMenu = context._menu;
8506          if (!$2(parent).hasClass(ClassName$4.SHOW)) {
8507            continue;
8508          }
8509          if (event && (event.type === "click" && /input|textarea/i.test(event.target.tagName) || event.type === "keyup" && event.which === TAB_KEYCODE) && $2.contains(parent, event.target)) {
8510            continue;
8511          }
8512          var hideEvent = $2.Event(Event$4.HIDE, relatedTarget);
8513          $2(parent).trigger(hideEvent);
8514          if (hideEvent.isDefaultPrevented()) {
8515            continue;
8516          }
8517          if ("ontouchstart" in document.documentElement) {
8518            $2(document.body).children().off("mouseover", null, $2.noop);
8519          }
8520          toggles[i].setAttribute("aria-expanded", "false");
8521          $2(dropdownMenu).removeClass(ClassName$4.SHOW);
8522          $2(parent).removeClass(ClassName$4.SHOW).trigger($2.Event(Event$4.HIDDEN, relatedTarget));
8523        }
8524      };
8525      Dropdown._getParentFromElement = function _getParentFromElement(element) {
8526        var parent;
8527        var selector = Util.getSelectorFromElement(element);
8528        if (selector) {
8529          parent = document.querySelector(selector);
8530        }
8531        return parent || element.parentNode;
8532      };
8533      Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
8534        if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $2(event.target).closest(Selector$4.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
8535          return;
8536        }
8537        event.preventDefault();
8538        event.stopPropagation();
8539        if (this.disabled || $2(this).hasClass(ClassName$4.DISABLED)) {
8540          return;
8541        }
8542        var parent = Dropdown._getParentFromElement(this);
8543        var isActive = $2(parent).hasClass(ClassName$4.SHOW);
8544        if (!isActive || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
8545          if (event.which === ESCAPE_KEYCODE) {
8546            var toggle = parent.querySelector(Selector$4.DATA_TOGGLE);
8547            $2(toggle).trigger("focus");
8548          }
8549          $2(this).trigger("click");
8550          return;
8551        }
8552        var items = [].slice.call(parent.querySelectorAll(Selector$4.VISIBLE_ITEMS));
8553        if (items.length === 0) {
8554          return;
8555        }
8556        var index = items.indexOf(event.target);
8557        if (event.which === ARROW_UP_KEYCODE && index > 0) {
8558          index--;
8559        }
8560        if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
8561          index++;
8562        }
8563        if (index < 0) {
8564          index = 0;
8565        }
8566        items[index].focus();
8567      };
8568      _createClass(Dropdown, null, [{
8569        key: "VERSION",
8570        get: function get() {
8571          return VERSION$4;
8572        }
8573      }, {
8574        key: "Default",
8575        get: function get() {
8576          return Default$2;
8577        }
8578      }, {
8579        key: "DefaultType",
8580        get: function get() {
8581          return DefaultType$2;
8582        }
8583      }]);
8584      return Dropdown;
8585    }();
8586    $2(document).on(Event$4.KEYDOWN_DATA_API, Selector$4.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event$4.KEYDOWN_DATA_API, Selector$4.MENU, Dropdown._dataApiKeydownHandler).on(Event$4.CLICK_DATA_API + " " + Event$4.KEYUP_DATA_API, Dropdown._clearMenus).on(Event$4.CLICK_DATA_API, Selector$4.DATA_TOGGLE, function(event) {
8587      event.preventDefault();
8588      event.stopPropagation();
8589      Dropdown._jQueryInterface.call($2(this), "toggle");
8590    }).on(Event$4.CLICK_DATA_API, Selector$4.FORM_CHILD, function(e) {
8591      e.stopPropagation();
8592    });
8593    $2.fn[NAME$4] = Dropdown._jQueryInterface;
8594    $2.fn[NAME$4].Constructor = Dropdown;
8595    $2.fn[NAME$4].noConflict = function() {
8596      $2.fn[NAME$4] = JQUERY_NO_CONFLICT$4;
8597      return Dropdown._jQueryInterface;
8598    };
8599    var NAME$5 = "modal";
8600    var VERSION$5 = "4.3.1";
8601    var DATA_KEY$5 = "bs.modal";
8602    var EVENT_KEY$5 = "." + DATA_KEY$5;
8603    var DATA_API_KEY$5 = ".data-api";
8604    var JQUERY_NO_CONFLICT$5 = $2.fn[NAME$5];
8605    var ESCAPE_KEYCODE$1 = 27;
8606    var Default$3 = {
8607      backdrop: true,
8608      keyboard: true,
8609      focus: true,
8610      show: true
8611    };
8612    var DefaultType$3 = {
8613      backdrop: "(boolean|string)",
8614      keyboard: "boolean",
8615      focus: "boolean",
8616      show: "boolean"
8617    };
8618    var Event$5 = {
8619      HIDE: "hide" + EVENT_KEY$5,
8620      HIDDEN: "hidden" + EVENT_KEY$5,
8621      SHOW: "show" + EVENT_KEY$5,
8622      SHOWN: "shown" + EVENT_KEY$5,
8623      FOCUSIN: "focusin" + EVENT_KEY$5,
8624      RESIZE: "resize" + EVENT_KEY$5,
8625      CLICK_DISMISS: "click.dismiss" + EVENT_KEY$5,
8626      KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY$5,
8627      MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY$5,
8628      MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY$5,
8629      CLICK_DATA_API: "click" + EVENT_KEY$5 + DATA_API_KEY$5
8630    };
8631    var ClassName$5 = {
8632      SCROLLABLE: "modal-dialog-scrollable",
8633      SCROLLBAR_MEASURER: "modal-scrollbar-measure",
8634      BACKDROP: "modal-backdrop",
8635      OPEN: "modal-open",
8636      FADE: "fade",
8637      SHOW: "show"
8638    };
8639    var Selector$5 = {
8640      DIALOG: ".modal-dialog",
8641      MODAL_BODY: ".modal-body",
8642      DATA_TOGGLE: '[data-toggle="modal"]',
8643      DATA_DISMISS: '[data-dismiss="modal"]',
8644      FIXED_CONTENT: ".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",
8645      STICKY_CONTENT: ".sticky-top"
8646    };
8647    var Modal = /* @__PURE__ */ function() {
8648      function Modal(element, config) {
8649        this._config = this._getConfig(config);
8650        this._element = element;
8651        this._dialog = element.querySelector(Selector$5.DIALOG);
8652        this._backdrop = null;
8653        this._isShown = false;
8654        this._isBodyOverflowing = false;
8655        this._ignoreBackdropClick = false;
8656        this._isTransitioning = false;
8657        this._scrollbarWidth = 0;
8658      }
8659      var _proto = Modal.prototype;
8660      _proto.toggle = function toggle(relatedTarget) {
8661        return this._isShown ? this.hide() : this.show(relatedTarget);
8662      };
8663      _proto.show = function show(relatedTarget) {
8664        var _this = this;
8665        if (this._isShown || this._isTransitioning) {
8666          return;
8667        }
8668        if ($2(this._element).hasClass(ClassName$5.FADE)) {
8669          this._isTransitioning = true;
8670        }
8671        var showEvent = $2.Event(Event$5.SHOW, {
8672          relatedTarget
8673        });
8674        $2(this._element).trigger(showEvent);
8675        if (this._isShown || showEvent.isDefaultPrevented()) {
8676          return;
8677        }
8678        this._isShown = true;
8679        this._checkScrollbar();
8680        this._setScrollbar();
8681        this._adjustDialog();
8682        this._setEscapeEvent();
8683        this._setResizeEvent();
8684        $2(this._element).on(Event$5.CLICK_DISMISS, Selector$5.DATA_DISMISS, function(event) {
8685          return _this.hide(event);
8686        });
8687        $2(this._dialog).on(Event$5.MOUSEDOWN_DISMISS, function() {
8688          $2(_this._element).one(Event$5.MOUSEUP_DISMISS, function(event) {
8689            if ($2(event.target).is(_this._element)) {
8690              _this._ignoreBackdropClick = true;
8691            }
8692          });
8693        });
8694        this._showBackdrop(function() {
8695          return _this._showElement(relatedTarget);
8696        });
8697      };
8698      _proto.hide = function hide(event) {
8699        var _this2 = this;
8700        if (event) {
8701          event.preventDefault();
8702        }
8703        if (!this._isShown || this._isTransitioning) {
8704          return;
8705        }
8706        var hideEvent = $2.Event(Event$5.HIDE);
8707        $2(this._element).trigger(hideEvent);
8708        if (!this._isShown || hideEvent.isDefaultPrevented()) {
8709          return;
8710        }
8711        this._isShown = false;
8712        var transition = $2(this._element).hasClass(ClassName$5.FADE);
8713        if (transition) {
8714          this._isTransitioning = true;
8715        }
8716        this._setEscapeEvent();
8717        this._setResizeEvent();
8718        $2(document).off(Event$5.FOCUSIN);
8719        $2(this._element).removeClass(ClassName$5.SHOW);
8720        $2(this._element).off(Event$5.CLICK_DISMISS);
8721        $2(this._dialog).off(Event$5.MOUSEDOWN_DISMISS);
8722        if (transition) {
8723          var transitionDuration = Util.getTransitionDurationFromElement(this._element);
8724          $2(this._element).one(Util.TRANSITION_END, function(event) {
8725            return _this2._hideModal(event);
8726          }).emulateTransitionEnd(transitionDuration);
8727        } else {
8728          this._hideModal();
8729        }
8730      };
8731      _proto.dispose = function dispose() {
8732        [window, this._element, this._dialog].forEach(function(htmlElement) {
8733          return $2(htmlElement).off(EVENT_KEY$5);
8734        });
8735        $2(document).off(Event$5.FOCUSIN);
8736        $2.removeData(this._element, DATA_KEY$5);
8737        this._config = null;
8738        this._element = null;
8739        this._dialog = null;
8740        this._backdrop = null;
8741        this._isShown = null;
8742        this._isBodyOverflowing = null;
8743        this._ignoreBackdropClick = null;
8744        this._isTransitioning = null;
8745        this._scrollbarWidth = null;
8746      };
8747      _proto.handleUpdate = function handleUpdate() {
8748        this._adjustDialog();
8749      };
8750      _proto._getConfig = function _getConfig(config) {
8751        config = _objectSpread({}, Default$3, config);
8752        Util.typeCheckConfig(NAME$5, config, DefaultType$3);
8753        return config;
8754      };
8755      _proto._showElement = function _showElement(relatedTarget) {
8756        var _this3 = this;
8757        var transition = $2(this._element).hasClass(ClassName$5.FADE);
8758        if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
8759          document.body.appendChild(this._element);
8760        }
8761        this._element.style.display = "block";
8762        this._element.removeAttribute("aria-hidden");
8763        this._element.setAttribute("aria-modal", true);
8764        if ($2(this._dialog).hasClass(ClassName$5.SCROLLABLE)) {
8765          this._dialog.querySelector(Selector$5.MODAL_BODY).scrollTop = 0;
8766        } else {
8767          this._element.scrollTop = 0;
8768        }
8769        if (transition) {
8770          Util.reflow(this._element);
8771        }
8772        $2(this._element).addClass(ClassName$5.SHOW);
8773        if (this._config.focus) {
8774          this._enforceFocus();
8775        }
8776        var shownEvent = $2.Event(Event$5.SHOWN, {
8777          relatedTarget
8778        });
8779        var transitionComplete = function transitionComplete() {
8780          if (_this3._config.focus) {
8781            _this3._element.focus();
8782          }
8783          _this3._isTransitioning = false;
8784          $2(_this3._element).trigger(shownEvent);
8785        };
8786        if (transition) {
8787          var transitionDuration = Util.getTransitionDurationFromElement(this._dialog);
8788          $2(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration);
8789        } else {
8790          transitionComplete();
8791        }
8792      };
8793      _proto._enforceFocus = function _enforceFocus() {
8794        var _this4 = this;
8795        $2(document).off(Event$5.FOCUSIN).on(Event$5.FOCUSIN, function(event) {
8796          if (document !== event.target && _this4._element !== event.target && $2(_this4._element).has(event.target).length === 0) {
8797            _this4._element.focus();
8798          }
8799        });
8800      };
8801      _proto._setEscapeEvent = function _setEscapeEvent() {
8802        var _this5 = this;
8803        if (this._isShown && this._config.keyboard) {
8804          $2(this._element).on(Event$5.KEYDOWN_DISMISS, function(event) {
8805            if (event.which === ESCAPE_KEYCODE$1) {
8806              event.preventDefault();
8807              _this5.hide();
8808            }
8809          });
8810        } else if (!this._isShown) {
8811          $2(this._element).off(Event$5.KEYDOWN_DISMISS);
8812        }
8813      };
8814      _proto._setResizeEvent = function _setResizeEvent() {
8815        var _this6 = this;
8816        if (this._isShown) {
8817          $2(window).on(Event$5.RESIZE, function(event) {
8818            return _this6.handleUpdate(event);
8819          });
8820        } else {
8821          $2(window).off(Event$5.RESIZE);
8822        }
8823      };
8824      _proto._hideModal = function _hideModal() {
8825        var _this7 = this;
8826        this._element.style.display = "none";
8827        this._element.setAttribute("aria-hidden", true);
8828        this._element.removeAttribute("aria-modal");
8829        this._isTransitioning = false;
8830        this._showBackdrop(function() {
8831          $2(document.body).removeClass(ClassName$5.OPEN);
8832          _this7._resetAdjustments();
8833          _this7._resetScrollbar();
8834          $2(_this7._element).trigger(Event$5.HIDDEN);
8835        });
8836      };
8837      _proto._removeBackdrop = function _removeBackdrop() {
8838        if (this._backdrop) {
8839          $2(this._backdrop).remove();
8840          this._backdrop = null;
8841        }
8842      };
8843      _proto._showBackdrop = function _showBackdrop(callback) {
8844        var _this8 = this;
8845        var animate = $2(this._element).hasClass(ClassName$5.FADE) ? ClassName$5.FADE : "";
8846        if (this._isShown && this._config.backdrop) {
8847          this._backdrop = document.createElement("div");
8848          this._backdrop.className = ClassName$5.BACKDROP;
8849          if (animate) {
8850            this._backdrop.classList.add(animate);
8851          }
8852          $2(this._backdrop).appendTo(document.body);
8853          $2(this._element).on(Event$5.CLICK_DISMISS, function(event) {
8854            if (_this8._ignoreBackdropClick) {
8855              _this8._ignoreBackdropClick = false;
8856              return;
8857            }
8858            if (event.target !== event.currentTarget) {
8859              return;
8860            }
8861            if (_this8._config.backdrop === "static") {
8862              _this8._element.focus();
8863            } else {
8864              _this8.hide();
8865            }
8866          });
8867          if (animate) {
8868            Util.reflow(this._backdrop);
8869          }
8870          $2(this._backdrop).addClass(ClassName$5.SHOW);
8871          if (!callback) {
8872            return;
8873          }
8874          if (!animate) {
8875            callback();
8876            return;
8877          }
8878          var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
8879          $2(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration);
8880        } else if (!this._isShown && this._backdrop) {
8881          $2(this._backdrop).removeClass(ClassName$5.SHOW);
8882          var callbackRemove = function callbackRemove() {
8883            _this8._removeBackdrop();
8884            if (callback) {
8885              callback();
8886            }
8887          };
8888          if ($2(this._element).hasClass(ClassName$5.FADE)) {
8889            var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
8890            $2(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration);
8891          } else {
8892            callbackRemove();
8893          }
8894        } else if (callback) {
8895          callback();
8896        }
8897      };
8898      _proto._adjustDialog = function _adjustDialog() {
8899        var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
8900        if (!this._isBodyOverflowing && isModalOverflowing) {
8901          this._element.style.paddingLeft = this._scrollbarWidth + "px";
8902        }
8903        if (this._isBodyOverflowing && !isModalOverflowing) {
8904          this._element.style.paddingRight = this._scrollbarWidth + "px";
8905        }
8906      };
8907      _proto._resetAdjustments = function _resetAdjustments() {
8908        this._element.style.paddingLeft = "";
8909        this._element.style.paddingRight = "";
8910      };
8911      _proto._checkScrollbar = function _checkScrollbar() {
8912        var rect = document.body.getBoundingClientRect();
8913        this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
8914        this._scrollbarWidth = this._getScrollbarWidth();
8915      };
8916      _proto._setScrollbar = function _setScrollbar() {
8917        var _this9 = this;
8918        if (this._isBodyOverflowing) {
8919          var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
8920          var stickyContent = [].slice.call(document.querySelectorAll(Selector$5.STICKY_CONTENT));
8921          $2(fixedContent).each(function(index, element) {
8922            var actualPadding = element.style.paddingRight;
8923            var calculatedPadding = $2(element).css("padding-right");
8924            $2(element).data("padding-right", actualPadding).css("padding-right", parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
8925          });
8926          $2(stickyContent).each(function(index, element) {
8927            var actualMargin = element.style.marginRight;
8928            var calculatedMargin = $2(element).css("margin-right");
8929            $2(element).data("margin-right", actualMargin).css("margin-right", parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
8930          });
8931          var actualPadding = document.body.style.paddingRight;
8932          var calculatedPadding = $2(document.body).css("padding-right");
8933          $2(document.body).data("padding-right", actualPadding).css("padding-right", parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
8934        }
8935        $2(document.body).addClass(ClassName$5.OPEN);
8936      };
8937      _proto._resetScrollbar = function _resetScrollbar() {
8938        var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
8939        $2(fixedContent).each(function(index, element) {
8940          var padding = $2(element).data("padding-right");
8941          $2(element).removeData("padding-right");
8942          element.style.paddingRight = padding ? padding : "";
8943        });
8944        var elements = [].slice.call(document.querySelectorAll("" + Selector$5.STICKY_CONTENT));
8945        $2(elements).each(function(index, element) {
8946          var margin = $2(element).data("margin-right");
8947          if (typeof margin !== "undefined") {
8948            $2(element).css("margin-right", margin).removeData("margin-right");
8949          }
8950        });
8951        var padding = $2(document.body).data("padding-right");
8952        $2(document.body).removeData("padding-right");
8953        document.body.style.paddingRight = padding ? padding : "";
8954      };
8955      _proto._getScrollbarWidth = function _getScrollbarWidth() {
8956        var scrollDiv = document.createElement("div");
8957        scrollDiv.className = ClassName$5.SCROLLBAR_MEASURER;
8958        document.body.appendChild(scrollDiv);
8959        var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
8960        document.body.removeChild(scrollDiv);
8961        return scrollbarWidth;
8962      };
8963      Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
8964        return this.each(function() {
8965          var data = $2(this).data(DATA_KEY$5);
8966          var _config = _objectSpread({}, Default$3, $2(this).data(), typeof config === "object" && config ? config : {});
8967          if (!data) {
8968            data = new Modal(this, _config);
8969            $2(this).data(DATA_KEY$5, data);
8970          }
8971          if (typeof config === "string") {
8972            if (typeof data[config] === "undefined") {
8973              throw new TypeError('No method named "' + config + '"');
8974            }
8975            data[config](relatedTarget);
8976          } else if (_config.show) {
8977            data.show(relatedTarget);
8978          }
8979        });
8980      };
8981      _createClass(Modal, null, [{
8982        key: "VERSION",
8983        get: function get() {
8984          return VERSION$5;
8985        }
8986      }, {
8987        key: "Default",
8988        get: function get() {
8989          return Default$3;
8990        }
8991      }]);
8992      return Modal;
8993    }();
8994    $2(document).on(Event$5.CLICK_DATA_API, Selector$5.DATA_TOGGLE, function(event) {
8995      var _this10 = this;
8996      var target;
8997      var selector = Util.getSelectorFromElement(this);
8998      if (selector) {
8999        target = document.querySelector(selector);
9000      }
9001      var config = $2(target).data(DATA_KEY$5) ? "toggle" : _objectSpread({}, $2(target).data(), $2(this).data());
9002      if (this.tagName === "A" || this.tagName === "AREA") {
9003        event.preventDefault();
9004      }
9005      var $target = $2(target).one(Event$5.SHOW, function(showEvent) {
9006        if (showEvent.isDefaultPrevented()) {
9007          return;
9008        }
9009        $target.one(Event$5.HIDDEN, function() {
9010          if ($2(_this10).is(":visible")) {
9011            _this10.focus();
9012          }
9013        });
9014      });
9015      Modal._jQueryInterface.call($2(target), config, this);
9016    });
9017    $2.fn[NAME$5] = Modal._jQueryInterface;
9018    $2.fn[NAME$5].Constructor = Modal;
9019    $2.fn[NAME$5].noConflict = function() {
9020      $2.fn[NAME$5] = JQUERY_NO_CONFLICT$5;
9021      return Modal._jQueryInterface;
9022    };
9023    var uriAttrs = ["background", "cite", "href", "itemtype", "longdesc", "poster", "src", "xlink:href"];
9024    var ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i;
9025    var DefaultWhitelist = {
9026      "*": ["class", "dir", "id", "lang", "role", ARIA_ATTRIBUTE_PATTERN],
9027      a: ["target", "href", "title", "rel"],
9028      area: [],
9029      b: [],
9030      br: [],
9031      col: [],
9032      code: [],
9033      div: [],
9034      em: [],
9035      hr: [],
9036      h1: [],
9037      h2: [],
9038      h3: [],
9039      h4: [],
9040      h5: [],
9041      h6: [],
9042      i: [],
9043      img: ["src", "alt", "title", "width", "height"],
9044      li: [],
9045      ol: [],
9046      p: [],
9047      pre: [],
9048      s: [],
9049      small: [],
9050      span: [],
9051      sub: [],
9052      sup: [],
9053      strong: [],
9054      u: [],
9055      ul: []
9056    };
9057    var SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi;
9058    var DATA_URL_PATTERN = /^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i;
9059    function allowedAttribute(attr, allowedAttributeList) {
9060      var attrName = attr.nodeName.toLowerCase();
9061      if (allowedAttributeList.indexOf(attrName) !== -1) {
9062        if (uriAttrs.indexOf(attrName) !== -1) {
9063          return Boolean(attr.nodeValue.match(SAFE_URL_PATTERN) || attr.nodeValue.match(DATA_URL_PATTERN));
9064        }
9065        return true;
9066      }
9067      var regExp = allowedAttributeList.filter(function(attrRegex) {
9068        return attrRegex instanceof RegExp;
9069      });
9070      for (var i = 0, l = regExp.length;i < l; i++) {
9071        if (attrName.match(regExp[i])) {
9072          return true;
9073        }
9074      }
9075      return false;
9076    }
9077    function sanitizeHtml(unsafeHtml, whiteList, sanitizeFn) {
9078      if (unsafeHtml.length === 0) {
9079        return unsafeHtml;
9080      }
9081      if (sanitizeFn && typeof sanitizeFn === "function") {
9082        return sanitizeFn(unsafeHtml);
9083      }
9084      var domParser = new window.DOMParser;
9085      var createdDocument = domParser.parseFromString(unsafeHtml, "text/html");
9086      var whitelistKeys = Object.keys(whiteList);
9087      var elements = [].slice.call(createdDocument.body.querySelectorAll("*"));
9088      var _loop = function _loop(i, len) {
9089        var el = elements[i];
9090        var elName = el.nodeName.toLowerCase();
9091        if (whitelistKeys.indexOf(el.nodeName.toLowerCase()) === -1) {
9092          el.parentNode.removeChild(el);
9093          return "continue";
9094        }
9095        var attributeList = [].slice.call(el.attributes);
9096        var whitelistedAttributes = [].concat(whiteList["*"] || [], whiteList[elName] || []);
9097        attributeList.forEach(function(attr) {
9098          if (!allowedAttribute(attr, whitelistedAttributes)) {
9099            el.removeAttribute(attr.nodeName);
9100          }
9101        });
9102      };
9103      for (var i = 0, len = elements.length;i < len; i++) {
9104        var _ret = _loop(i, len);
9105        if (_ret === "continue")
9106          continue;
9107      }
9108      return createdDocument.body.innerHTML;
9109    }
9110    var NAME$6 = "tooltip";
9111    var VERSION$6 = "4.3.1";
9112    var DATA_KEY$6 = "bs.tooltip";
9113    var EVENT_KEY$6 = "." + DATA_KEY$6;
9114    var JQUERY_NO_CONFLICT$6 = $2.fn[NAME$6];
9115    var CLASS_PREFIX = "bs-tooltip";
9116    var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", "g");
9117    var DISALLOWED_ATTRIBUTES = ["sanitize", "whiteList", "sanitizeFn"];
9118    var DefaultType$4 = {
9119      animation: "boolean",
9120      template: "string",
9121      title: "(string|element|function)",
9122      trigger: "string",
9123      delay: "(number|object)",
9124      html: "boolean",
9125      selector: "(string|boolean)",
9126      placement: "(string|function)",
9127      offset: "(number|string|function)",
9128      container: "(string|element|boolean)",
9129      fallbackPlacement: "(string|array)",
9130      boundary: "(string|element)",
9131      sanitize: "boolean",
9132      sanitizeFn: "(null|function)",
9133      whiteList: "object"
9134    };
9135    var AttachmentMap$1 = {
9136      AUTO: "auto",
9137      TOP: "top",
9138      RIGHT: "right",
9139      BOTTOM: "bottom",
9140      LEFT: "left"
9141    };
9142    var Default$4 = {
9143      animation: true,
9144      template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
9145      trigger: "hover focus",
9146      title: "",
9147      delay: 0,
9148      html: false,
9149      selector: false,
9150      placement: "top",
9151      offset: 0,
9152      container: false,
9153      fallbackPlacement: "flip",
9154      boundary: "scrollParent",
9155      sanitize: true,
9156      sanitizeFn: null,
9157      whiteList: DefaultWhitelist
9158    };
9159    var HoverState = {
9160      SHOW: "show",
9161      OUT: "out"
9162    };
9163    var Event$6 = {
9164      HIDE: "hide" + EVENT_KEY$6,
9165      HIDDEN: "hidden" + EVENT_KEY$6,
9166      SHOW: "show" + EVENT_KEY$6,
9167      SHOWN: "shown" + EVENT_KEY$6,
9168      INSERTED: "inserted" + EVENT_KEY$6,
9169      CLICK: "click" + EVENT_KEY$6,
9170      FOCUSIN: "focusin" + EVENT_KEY$6,
9171      FOCUSOUT: "focusout" + EVENT_KEY$6,
9172      MOUSEENTER: "mouseenter" + EVENT_KEY$6,
9173      MOUSELEAVE: "mouseleave" + EVENT_KEY$6
9174    };
9175    var ClassName$6 = {
9176      FADE: "fade",
9177      SHOW: "show"
9178    };
9179    var Selector$6 = {
9180      TOOLTIP: ".tooltip",
9181      TOOLTIP_INNER: ".tooltip-inner",
9182      ARROW: ".arrow"
9183    };
9184    var Trigger = {
9185      HOVER: "hover",
9186      FOCUS: "focus",
9187      CLICK: "click",
9188      MANUAL: "manual"
9189    };
9190    var Tooltip = /* @__PURE__ */ function() {
9191      function Tooltip(element, config) {
9192        if (typeof Popper === "undefined") {
9193          throw new TypeError("Bootstrap's tooltips require Popper.js (https://popper.js.org/)");
9194        }
9195        this._isEnabled = true;
9196        this._timeout = 0;
9197        this._hoverState = "";
9198        this._activeTrigger = {};
9199        this._popper = null;
9200        this.element = element;
9201        this.config = this._getConfig(config);
9202        this.tip = null;
9203        this._setListeners();
9204      }
9205      var _proto = Tooltip.prototype;
9206      _proto.enable = function enable() {
9207        this._isEnabled = true;
9208      };
9209      _proto.disable = function disable() {
9210        this._isEnabled = false;
9211      };
9212      _proto.toggleEnabled = function toggleEnabled() {
9213        this._isEnabled = !this._isEnabled;
9214      };
9215      _proto.toggle = function toggle(event) {
9216        if (!this._isEnabled) {
9217          return;
9218        }
9219        if (event) {
9220          var dataKey = this.constructor.DATA_KEY;
9221          var context = $2(event.currentTarget).data(dataKey);
9222          if (!context) {
9223            context = new this.constructor(event.currentTarget, this._getDelegateConfig());
9224            $2(event.currentTarget).data(dataKey, context);
9225          }
9226          context._activeTrigger.click = !context._activeTrigger.click;
9227          if (context._isWithActiveTrigger()) {
9228            context._enter(null, context);
9229          } else {
9230            context._leave(null, context);
9231          }
9232        } else {
9233          if ($2(this.getTipElement()).hasClass(ClassName$6.SHOW)) {
9234            this._leave(null, this);
9235            return;
9236          }
9237          this._enter(null, this);
9238        }
9239      };
9240      _proto.dispose = function dispose() {
9241        clearTimeout(this._timeout);
9242        $2.removeData(this.element, this.constructor.DATA_KEY);
9243        $2(this.element).off(this.constructor.EVENT_KEY);
9244        $2(this.element).closest(".modal").off("hide.bs.modal");
9245        if (this.tip) {
9246          $2(this.tip).remove();
9247        }
9248        this._isEnabled = null;
9249        this._timeout = null;
9250        this._hoverState = null;
9251        this._activeTrigger = null;
9252        if (this._popper !== null) {
9253          this._popper.destroy();
9254        }
9255        this._popper = null;
9256        this.element = null;
9257        this.config = null;
9258        this.tip = null;
9259      };
9260      _proto.show = function show() {
9261        var _this = this;
9262        if ($2(this.element).css("display") === "none") {
9263          throw new Error("Please use show on visible elements");
9264        }
9265        var showEvent = $2.Event(this.constructor.Event.SHOW);
9266        if (this.isWithContent() && this._isEnabled) {
9267          $2(this.element).trigger(showEvent);
9268          var shadowRoot = Util.findShadowRoot(this.element);
9269          var isInTheDom = $2.contains(shadowRoot !== null ? shadowRoot : this.element.ownerDocument.documentElement, this.element);
9270          if (showEvent.isDefaultPrevented() || !isInTheDom) {
9271            return;
9272          }
9273          var tip = this.getTipElement();
9274          var tipId = Util.getUID(this.constructor.NAME);
9275          tip.setAttribute("id", tipId);
9276          this.element.setAttribute("aria-describedby", tipId);
9277          this.setContent();
9278          if (this.config.animation) {
9279            $2(tip).addClass(ClassName$6.FADE);
9280          }
9281          var placement = typeof this.config.placement === "function" ? this.config.placement.call(this, tip, this.element) : this.config.placement;
9282          var attachment = this._getAttachment(placement);
9283          this.addAttachmentClass(attachment);
9284          var container = this._getContainer();
9285          $2(tip).data(this.constructor.DATA_KEY, this);
9286          if (!$2.contains(this.element.ownerDocument.documentElement, this.tip)) {
9287            $2(tip).appendTo(container);
9288          }
9289          $2(this.element).trigger(this.constructor.Event.INSERTED);
9290          this._popper = new Popper(this.element, tip, {
9291            placement: attachment,
9292            modifiers: {
9293              offset: this._getOffset(),
9294              flip: {
9295                behavior: this.config.fallbackPlacement
9296              },
9297              arrow: {
9298                element: Selector$6.ARROW
9299              },
9300              preventOverflow: {
9301                boundariesElement: this.config.boundary
9302              }
9303            },
9304            onCreate: function onCreate(data) {
9305              if (data.originalPlacement !== data.placement) {
9306                _this._handlePopperPlacementChange(data);
9307              }
9308            },
9309            onUpdate: function onUpdate(data) {
9310              return _this._handlePopperPlacementChange(data);
9311            }
9312          });
9313          $2(tip).addClass(ClassName$6.SHOW);
9314          if ("ontouchstart" in document.documentElement) {
9315            $2(document.body).children().on("mouseover", null, $2.noop);
9316          }
9317          var complete = function complete() {
9318            if (_this.config.animation) {
9319              _this._fixTransition();
9320            }
9321            var prevHoverState = _this._hoverState;
9322            _this._hoverState = null;
9323            $2(_this.element).trigger(_this.constructor.Event.SHOWN);
9324            if (prevHoverState === HoverState.OUT) {
9325              _this._leave(null, _this);
9326            }
9327          };
9328          if ($2(this.tip).hasClass(ClassName$6.FADE)) {
9329            var transitionDuration = Util.getTransitionDurationFromElement(this.tip);
9330            $2(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
9331          } else {
9332            complete();
9333          }
9334        }
9335      };
9336      _proto.hide = function hide(callback) {
9337        var _this2 = this;
9338        var tip = this.getTipElement();
9339        var hideEvent = $2.Event(this.constructor.Event.HIDE);
9340        var complete = function complete() {
9341          if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
9342            tip.parentNode.removeChild(tip);
9343          }
9344          _this2._cleanTipClass();
9345          _this2.element.removeAttribute("aria-describedby");
9346          $2(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
9347          if (_this2._popper !== null) {
9348            _this2._popper.destroy();
9349          }
9350          if (callback) {
9351            callback();
9352          }
9353        };
9354        $2(this.element).trigger(hideEvent);
9355        if (hideEvent.isDefaultPrevented()) {
9356          return;
9357        }
9358        $2(tip).removeClass(ClassName$6.SHOW);
9359        if ("ontouchstart" in document.documentElement) {
9360          $2(document.body).children().off("mouseover", null, $2.noop);
9361        }
9362        this._activeTrigger[Trigger.CLICK] = false;
9363        this._activeTrigger[Trigger.FOCUS] = false;
9364        this._activeTrigger[Trigger.HOVER] = false;
9365        if ($2(this.tip).hasClass(ClassName$6.FADE)) {
9366          var transitionDuration = Util.getTransitionDurationFromElement(tip);
9367          $2(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
9368        } else {
9369          complete();
9370        }
9371        this._hoverState = "";
9372      };
9373      _proto.update = function update() {
9374        if (this._popper !== null) {
9375          this._popper.scheduleUpdate();
9376        }
9377      };
9378      _proto.isWithContent = function isWithContent() {
9379        return Boolean(this.getTitle());
9380      };
9381      _proto.addAttachmentClass = function addAttachmentClass(attachment) {
9382        $2(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
9383      };
9384      _proto.getTipElement = function getTipElement() {
9385        this.tip = this.tip || $2(this.config.template)[0];
9386        return this.tip;
9387      };
9388      _proto.setContent = function setContent() {
9389        var tip = this.getTipElement();
9390        this.setElementContent($2(tip.querySelectorAll(Selector$6.TOOLTIP_INNER)), this.getTitle());
9391        $2(tip).removeClass(ClassName$6.FADE + " " + ClassName$6.SHOW);
9392      };
9393      _proto.setElementContent = function setElementContent($element, content) {
9394        if (typeof content === "object" && (content.nodeType || content.jquery)) {
9395          if (this.config.html) {
9396            if (!$2(content).parent().is($element)) {
9397              $element.empty().append(content);
9398            }
9399          } else {
9400            $element.text($2(content).text());
9401          }
9402          return;
9403        }
9404        if (this.config.html) {
9405          if (this.config.sanitize) {
9406            content = sanitizeHtml(content, this.config.whiteList, this.config.sanitizeFn);
9407          }
9408          $element.html(content);
9409        } else {
9410          $element.text(content);
9411        }
9412      };
9413      _proto.getTitle = function getTitle() {
9414        var title = this.element.getAttribute("data-original-title");
9415        if (!title) {
9416          title = typeof this.config.title === "function" ? this.config.title.call(this.element) : this.config.title;
9417        }
9418        return title;
9419      };
9420      _proto._getOffset = function _getOffset() {
9421        var _this3 = this;
9422        var offset = {};
9423        if (typeof this.config.offset === "function") {
9424          offset.fn = function(data) {
9425            data.offsets = _objectSpread({}, data.offsets, _this3.config.offset(data.offsets, _this3.element) || {});
9426            return data;
9427          };
9428        } else {
9429          offset.offset = this.config.offset;
9430        }
9431        return offset;
9432      };
9433      _proto._getContainer = function _getContainer() {
9434        if (this.config.container === false) {
9435          return document.body;
9436        }
9437        if (Util.isElement(this.config.container)) {
9438          return $2(this.config.container);
9439        }
9440        return $2(document).find(this.config.container);
9441      };
9442      _proto._getAttachment = function _getAttachment(placement) {
9443        return AttachmentMap$1[placement.toUpperCase()];
9444      };
9445      _proto._setListeners = function _setListeners() {
9446        var _this4 = this;
9447        var triggers = this.config.trigger.split(" ");
9448        triggers.forEach(function(trigger) {
9449          if (trigger === "click") {
9450            $2(_this4.element).on(_this4.constructor.Event.CLICK, _this4.config.selector, function(event) {
9451              return _this4.toggle(event);
9452            });
9453          } else if (trigger !== Trigger.MANUAL) {
9454            var eventIn = trigger === Trigger.HOVER ? _this4.constructor.Event.MOUSEENTER : _this4.constructor.Event.FOCUSIN;
9455            var eventOut = trigger === Trigger.HOVER ? _this4.constructor.Event.MOUSELEAVE : _this4.constructor.Event.FOCUSOUT;
9456            $2(_this4.element).on(eventIn, _this4.config.selector, function(event) {
9457              return _this4._enter(event);
9458            }).on(eventOut, _this4.config.selector, function(event) {
9459              return _this4._leave(event);
9460            });
9461          }
9462        });
9463        $2(this.element).closest(".modal").on("hide.bs.modal", function() {
9464          if (_this4.element) {
9465            _this4.hide();
9466          }
9467        });
9468        if (this.config.selector) {
9469          this.config = _objectSpread({}, this.config, {
9470            trigger: "manual",
9471            selector: ""
9472          });
9473        } else {
9474          this._fixTitle();
9475        }
9476      };
9477      _proto._fixTitle = function _fixTitle() {
9478        var titleType = typeof this.element.getAttribute("data-original-title");
9479        if (this.element.getAttribute("title") || titleType !== "string") {
9480          this.element.setAttribute("data-original-title", this.element.getAttribute("title") || "");
9481          this.element.setAttribute("title", "");
9482        }
9483      };
9484      _proto._enter = function _enter(event, context) {
9485        var dataKey = this.constructor.DATA_KEY;
9486        context = context || $2(event.currentTarget).data(dataKey);
9487        if (!context) {
9488          context = new this.constructor(event.currentTarget, this._getDelegateConfig());
9489          $2(event.currentTarget).data(dataKey, context);
9490        }
9491        if (event) {
9492          context._activeTrigger[event.type === "focusin" ? Trigger.FOCUS : Trigger.HOVER] = true;
9493        }
9494        if ($2(context.getTipElement()).hasClass(ClassName$6.SHOW) || context._hoverState === HoverState.SHOW) {
9495          context._hoverState = HoverState.SHOW;
9496          return;
9497        }
9498        clearTimeout(context._timeout);
9499        context._hoverState = HoverState.SHOW;
9500        if (!context.config.delay || !context.config.delay.show) {
9501          context.show();
9502          return;
9503        }
9504        context._timeout = setTimeout(function() {
9505          if (context._hoverState === HoverState.SHOW) {
9506            context.show();
9507          }
9508        }, context.config.delay.show);
9509      };
9510      _proto._leave = function _leave(event, context) {
9511        var dataKey = this.constructor.DATA_KEY;
9512        context = context || $2(event.currentTarget).data(dataKey);
9513        if (!context) {
9514          context = new this.constructor(event.currentTarget, this._getDelegateConfig());
9515          $2(event.currentTarget).data(dataKey, context);
9516        }
9517        if (event) {
9518          context._activeTrigger[event.type === "focusout" ? Trigger.FOCUS : Trigger.HOVER] = false;
9519        }
9520        if (context._isWithActiveTrigger()) {
9521          return;
9522        }
9523        clearTimeout(context._timeout);
9524        context._hoverState = HoverState.OUT;
9525        if (!context.config.delay || !context.config.delay.hide) {
9526          context.hide();
9527          return;
9528        }
9529        context._timeout = setTimeout(function() {
9530          if (context._hoverState === HoverState.OUT) {
9531            context.hide();
9532          }
9533        }, context.config.delay.hide);
9534      };
9535      _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
9536        for (var trigger in this._activeTrigger) {
9537          if (this._activeTrigger[trigger]) {
9538            return true;
9539          }
9540        }
9541        return false;
9542      };
9543      _proto._getConfig = function _getConfig(config) {
9544        var dataAttributes = $2(this.element).data();
9545        Object.keys(dataAttributes).forEach(function(dataAttr) {
9546          if (DISALLOWED_ATTRIBUTES.indexOf(dataAttr) !== -1) {
9547            delete dataAttributes[dataAttr];
9548          }
9549        });
9550        config = _objectSpread({}, this.constructor.Default, dataAttributes, typeof config === "object" && config ? config : {});
9551        if (typeof config.delay === "number") {
9552          config.delay = {
9553            show: config.delay,
9554            hide: config.delay
9555          };
9556        }
9557        if (typeof config.title === "number") {
9558          config.title = config.title.toString();
9559        }
9560        if (typeof config.content === "number") {
9561          config.content = config.content.toString();
9562        }
9563        Util.typeCheckConfig(NAME$6, config, this.constructor.DefaultType);
9564        if (config.sanitize) {
9565          config.template = sanitizeHtml(config.template, config.whiteList, config.sanitizeFn);
9566        }
9567        return config;
9568      };
9569      _proto._getDelegateConfig = function _getDelegateConfig() {
9570        var config = {};
9571        if (this.config) {
9572          for (var key in this.config) {
9573            if (this.constructor.Default[key] !== this.config[key]) {
9574              config[key] = this.config[key];
9575            }
9576          }
9577        }
9578        return config;
9579      };
9580      _proto._cleanTipClass = function _cleanTipClass() {
9581        var $tip = $2(this.getTipElement());
9582        var tabClass = $tip.attr("class").match(BSCLS_PREFIX_REGEX);
9583        if (tabClass !== null && tabClass.length) {
9584          $tip.removeClass(tabClass.join(""));
9585        }
9586      };
9587      _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) {
9588        var popperInstance = popperData.instance;
9589        this.tip = popperInstance.popper;
9590        this._cleanTipClass();
9591        this.addAttachmentClass(this._getAttachment(popperData.placement));
9592      };
9593      _proto._fixTransition = function _fixTransition() {
9594        var tip = this.getTipElement();
9595        var initConfigAnimation = this.config.animation;
9596        if (tip.getAttribute("x-placement") !== null) {
9597          return;
9598        }
9599        $2(tip).removeClass(ClassName$6.FADE);
9600        this.config.animation = false;
9601        this.hide();
9602        this.show();
9603        this.config.animation = initConfigAnimation;
9604      };
9605      Tooltip._jQueryInterface = function _jQueryInterface(config) {
9606        return this.each(function() {
9607          var data = $2(this).data(DATA_KEY$6);
9608          var _config = typeof config === "object" && config;
9609          if (!data && /dispose|hide/.test(config)) {
9610            return;
9611          }
9612          if (!data) {
9613            data = new Tooltip(this, _config);
9614            $2(this).data(DATA_KEY$6, data);
9615          }
9616          if (typeof config === "string") {
9617            if (typeof data[config] === "undefined") {
9618              throw new TypeError('No method named "' + config + '"');
9619            }
9620            data[config]();
9621          }
9622        });
9623      };
9624      _createClass(Tooltip, null, [{
9625        key: "VERSION",
9626        get: function get() {
9627          return VERSION$6;
9628        }
9629      }, {
9630        key: "Default",
9631        get: function get() {
9632          return Default$4;
9633        }
9634      }, {
9635        key: "NAME",
9636        get: function get() {
9637          return NAME$6;
9638        }
9639      }, {
9640        key: "DATA_KEY",
9641        get: function get() {
9642          return DATA_KEY$6;
9643        }
9644      }, {
9645        key: "Event",
9646        get: function get() {
9647          return Event$6;
9648        }
9649      }, {
9650        key: "EVENT_KEY",
9651        get: function get() {
9652          return EVENT_KEY$6;
9653        }
9654      }, {
9655        key: "DefaultType",
9656        get: function get() {
9657          return DefaultType$4;
9658        }
9659      }]);
9660      return Tooltip;
9661    }();
9662    $2.fn[NAME$6] = Tooltip._jQueryInterface;
9663    $2.fn[NAME$6].Constructor = Tooltip;
9664    $2.fn[NAME$6].noConflict = function() {
9665      $2.fn[NAME$6] = JQUERY_NO_CONFLICT$6;
9666      return Tooltip._jQueryInterface;
9667    };
9668    var NAME$7 = "popover";
9669    var VERSION$7 = "4.3.1";
9670    var DATA_KEY$7 = "bs.popover";
9671    var EVENT_KEY$7 = "." + DATA_KEY$7;
9672    var JQUERY_NO_CONFLICT$7 = $2.fn[NAME$7];
9673    var CLASS_PREFIX$1 = "bs-popover";
9674    var BSCLS_PREFIX_REGEX$1 = new RegExp("(^|\\s)" + CLASS_PREFIX$1 + "\\S+", "g");
9675    var Default$5 = _objectSpread({}, Tooltip.Default, {
9676      placement: "right",
9677      trigger: "click",
9678      content: "",
9679      template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
9680    });
9681    var DefaultType$5 = _objectSpread({}, Tooltip.DefaultType, {
9682      content: "(string|element|function)"
9683    });
9684    var ClassName$7 = {
9685      FADE: "fade",
9686      SHOW: "show"
9687    };
9688    var Selector$7 = {
9689      TITLE: ".popover-header",
9690      CONTENT: ".popover-body"
9691    };
9692    var Event$7 = {
9693      HIDE: "hide" + EVENT_KEY$7,
9694      HIDDEN: "hidden" + EVENT_KEY$7,
9695      SHOW: "show" + EVENT_KEY$7,
9696      SHOWN: "shown" + EVENT_KEY$7,
9697      INSERTED: "inserted" + EVENT_KEY$7,
9698      CLICK: "click" + EVENT_KEY$7,
9699      FOCUSIN: "focusin" + EVENT_KEY$7,
9700      FOCUSOUT: "focusout" + EVENT_KEY$7,
9701      MOUSEENTER: "mouseenter" + EVENT_KEY$7,
9702      MOUSELEAVE: "mouseleave" + EVENT_KEY$7
9703    };
9704    var Popover = /* @__PURE__ */ function(_Tooltip) {
9705      _inheritsLoose(Popover, _Tooltip);
9706      function Popover() {
9707        return _Tooltip.apply(this, arguments) || this;
9708      }
9709      var _proto = Popover.prototype;
9710      _proto.isWithContent = function isWithContent() {
9711        return this.getTitle() || this._getContent();
9712      };
9713      _proto.addAttachmentClass = function addAttachmentClass(attachment) {
9714        $2(this.getTipElement()).addClass(CLASS_PREFIX$1 + "-" + attachment);
9715      };
9716      _proto.getTipElement = function getTipElement() {
9717        this.tip = this.tip || $2(this.config.template)[0];
9718        return this.tip;
9719      };
9720      _proto.setContent = function setContent() {
9721        var $tip = $2(this.getTipElement());
9722        this.setElementContent($tip.find(Selector$7.TITLE), this.getTitle());
9723        var content = this._getContent();
9724        if (typeof content === "function") {
9725          content = content.call(this.element);
9726        }
9727        this.setElementContent($tip.find(Selector$7.CONTENT), content);
9728        $tip.removeClass(ClassName$7.FADE + " " + ClassName$7.SHOW);
9729      };
9730      _proto._getContent = function _getContent() {
9731        return this.element.getAttribute("data-content") || this.config.content;
9732      };
9733      _proto._cleanTipClass = function _cleanTipClass() {
9734        var $tip = $2(this.getTipElement());
9735        var tabClass = $tip.attr("class").match(BSCLS_PREFIX_REGEX$1);
9736        if (tabClass !== null && tabClass.length > 0) {
9737          $tip.removeClass(tabClass.join(""));
9738        }
9739      };
9740      Popover._jQueryInterface = function _jQueryInterface(config) {
9741        return this.each(function() {
9742          var data = $2(this).data(DATA_KEY$7);
9743          var _config = typeof config === "object" ? config : null;
9744          if (!data && /dispose|hide/.test(config)) {
9745            return;
9746          }
9747          if (!data) {
9748            data = new Popover(this, _config);
9749            $2(this).data(DATA_KEY$7, data);
9750          }
9751          if (typeof config === "string") {
9752            if (typeof data[config] === "undefined") {
9753              throw new TypeError('No method named "' + config + '"');
9754            }
9755            data[config]();
9756          }
9757        });
9758      };
9759      _createClass(Popover, null, [{
9760        key: "VERSION",
9761        get: function get() {
9762          return VERSION$7;
9763        }
9764      }, {
9765        key: "Default",
9766        get: function get() {
9767          return Default$5;
9768        }
9769      }, {
9770        key: "NAME",
9771        get: function get() {
9772          return NAME$7;
9773        }
9774      }, {
9775        key: "DATA_KEY",
9776        get: function get() {
9777          return DATA_KEY$7;
9778        }
9779      }, {
9780        key: "Event",
9781        get: function get() {
9782          return Event$7;
9783        }
9784      }, {
9785        key: "EVENT_KEY",
9786        get: function get() {
9787          return EVENT_KEY$7;
9788        }
9789      }, {
9790        key: "DefaultType",
9791        get: function get() {
9792          return DefaultType$5;
9793        }
9794      }]);
9795      return Popover;
9796    }(Tooltip);
9797    $2.fn[NAME$7] = Popover._jQueryInterface;
9798    $2.fn[NAME$7].Constructor = Popover;
9799    $2.fn[NAME$7].noConflict = function() {
9800      $2.fn[NAME$7] = JQUERY_NO_CONFLICT$7;
9801      return Popover._jQueryInterface;
9802    };
9803    var NAME$8 = "scrollspy";
9804    var VERSION$8 = "4.3.1";
9805    var DATA_KEY$8 = "bs.scrollspy";
9806    var EVENT_KEY$8 = "." + DATA_KEY$8;
9807    var DATA_API_KEY$6 = ".data-api";
9808    var JQUERY_NO_CONFLICT$8 = $2.fn[NAME$8];
9809    var Default$6 = {
9810      offset: 10,
9811      method: "auto",
9812      target: ""
9813    };
9814    var DefaultType$6 = {
9815      offset: "number",
9816      method: "string",
9817      target: "(string|element)"
9818    };
9819    var Event$8 = {
9820      ACTIVATE: "activate" + EVENT_KEY$8,
9821      SCROLL: "scroll" + EVENT_KEY$8,
9822      LOAD_DATA_API: "load" + EVENT_KEY$8 + DATA_API_KEY$6
9823    };
9824    var ClassName$8 = {
9825      DROPDOWN_ITEM: "dropdown-item",
9826      DROPDOWN_MENU: "dropdown-menu",
9827      ACTIVE: "active"
9828    };
9829    var Selector$8 = {
9830      DATA_SPY: '[data-spy="scroll"]',
9831      ACTIVE: ".active",
9832      NAV_LIST_GROUP: ".nav, .list-group",
9833      NAV_LINKS: ".nav-link",
9834      NAV_ITEMS: ".nav-item",
9835      LIST_ITEMS: ".list-group-item",
9836      DROPDOWN: ".dropdown",
9837      DROPDOWN_ITEMS: ".dropdown-item",
9838      DROPDOWN_TOGGLE: ".dropdown-toggle"
9839    };
9840    var OffsetMethod = {
9841      OFFSET: "offset",
9842      POSITION: "position"
9843    };
9844    var ScrollSpy = /* @__PURE__ */ function() {
9845      function ScrollSpy(element, config) {
9846        var _this = this;
9847        this._element = element;
9848        this._scrollElement = element.tagName === "BODY" ? window : element;
9849        this._config = this._getConfig(config);
9850        this._selector = this._config.target + " " + Selector$8.NAV_LINKS + "," + (this._config.target + " " + Selector$8.LIST_ITEMS + ",") + (this._config.target + " " + Selector$8.DROPDOWN_ITEMS);
9851        this._offsets = [];
9852        this._targets = [];
9853        this._activeTarget = null;
9854        this._scrollHeight = 0;
9855        $2(this._scrollElement).on(Event$8.SCROLL, function(event) {
9856          return _this._process(event);
9857        });
9858        this.refresh();
9859        this._process();
9860      }
9861      var _proto = ScrollSpy.prototype;
9862      _proto.refresh = function refresh() {
9863        var _this2 = this;
9864        var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
9865        var offsetMethod = this._config.method === "auto" ? autoMethod : this._config.method;
9866        var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
9867        this._offsets = [];
9868        this._targets = [];
9869        this._scrollHeight = this._getScrollHeight();
9870        var targets = [].slice.call(document.querySelectorAll(this._selector));
9871        targets.map(function(element) {
9872          var target;
9873          var targetSelector = Util.getSelectorFromElement(element);
9874          if (targetSelector) {
9875            target = document.querySelector(targetSelector);
9876          }
9877          if (target) {
9878            var targetBCR = target.getBoundingClientRect();
9879            if (targetBCR.width || targetBCR.height) {
9880              return [$2(target)[offsetMethod]().top + offsetBase, targetSelector];
9881            }
9882          }
9883          return null;
9884        }).filter(function(item) {
9885          return item;
9886        }).sort(function(a, b) {
9887          return a[0] - b[0];
9888        }).forEach(function(item) {
9889          _this2._offsets.push(item[0]);
9890          _this2._targets.push(item[1]);
9891        });
9892      };
9893      _proto.dispose = function dispose() {
9894        $2.removeData(this._element, DATA_KEY$8);
9895        $2(this._scrollElement).off(EVENT_KEY$8);
9896        this._element = null;
9897        this._scrollElement = null;
9898        this._config = null;
9899        this._selector = null;
9900        this._offsets = null;
9901        this._targets = null;
9902        this._activeTarget = null;
9903        this._scrollHeight = null;
9904      };
9905      _proto._getConfig = function _getConfig(config) {
9906        config = _objectSpread({}, Default$6, typeof config === "object" && config ? config : {});
9907        if (typeof config.target !== "string") {
9908          var id = $2(config.target).attr("id");
9909          if (!id) {
9910            id = Util.getUID(NAME$8);
9911            $2(config.target).attr("id", id);
9912          }
9913          config.target = "#" + id;
9914        }
9915        Util.typeCheckConfig(NAME$8, config, DefaultType$6);
9916        return config;
9917      };
9918      _proto._getScrollTop = function _getScrollTop() {
9919        return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
9920      };
9921      _proto._getScrollHeight = function _getScrollHeight() {
9922        return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
9923      };
9924      _proto._getOffsetHeight = function _getOffsetHeight() {
9925        return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
9926      };
9927      _proto._process = function _process() {
9928        var scrollTop = this._getScrollTop() + this._config.offset;
9929        var scrollHeight = this._getScrollHeight();
9930        var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
9931        if (this._scrollHeight !== scrollHeight) {
9932          this.refresh();
9933        }
9934        if (scrollTop >= maxScroll) {
9935          var target = this._targets[this._targets.length - 1];
9936          if (this._activeTarget !== target) {
9937            this._activate(target);
9938          }
9939          return;
9940        }
9941        if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
9942          this._activeTarget = null;
9943          this._clear();
9944          return;
9945        }
9946        var offsetLength = this._offsets.length;
9947        for (var i = offsetLength;i--; ) {
9948          var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === "undefined" || scrollTop < this._offsets[i + 1]);
9949          if (isActiveTarget) {
9950            this._activate(this._targets[i]);
9951          }
9952        }
9953      };
9954      _proto._activate = function _activate(target) {
9955        this._activeTarget = target;
9956        this._clear();
9957        var queries = this._selector.split(",").map(function(selector) {
9958          return selector + '[data-target="' + target + '"],' + selector + '[href="' + target + '"]';
9959        });
9960        var $link = $2([].slice.call(document.querySelectorAll(queries.join(","))));
9961        if ($link.hasClass(ClassName$8.DROPDOWN_ITEM)) {
9962          $link.closest(Selector$8.DROPDOWN).find(Selector$8.DROPDOWN_TOGGLE).addClass(ClassName$8.ACTIVE);
9963          $link.addClass(ClassName$8.ACTIVE);
9964        } else {
9965          $link.addClass(ClassName$8.ACTIVE);
9966          $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_LINKS + ", " + Selector$8.LIST_ITEMS).addClass(ClassName$8.ACTIVE);
9967          $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_ITEMS).children(Selector$8.NAV_LINKS).addClass(ClassName$8.ACTIVE);
9968        }
9969        $2(this._scrollElement).trigger(Event$8.ACTIVATE, {
9970          relatedTarget: target
9971        });
9972      };
9973      _proto._clear = function _clear() {
9974        [].slice.call(document.querySelectorAll(this._selector)).filter(function(node) {
9975          return node.classList.contains(ClassName$8.ACTIVE);
9976        }).forEach(function(node) {
9977          return node.classList.remove(ClassName$8.ACTIVE);
9978        });
9979      };
9980      ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
9981        return this.each(function() {
9982          var data = $2(this).data(DATA_KEY$8);
9983          var _config = typeof config === "object" && config;
9984          if (!data) {
9985            data = new ScrollSpy(this, _config);
9986            $2(this).data(DATA_KEY$8, data);
9987          }
9988          if (typeof config === "string") {
9989            if (typeof data[config] === "undefined") {
9990              throw new TypeError('No method named "' + config + '"');
9991            }
9992            data[config]();
9993          }
9994        });
9995      };
9996      _createClass(ScrollSpy, null, [{
9997        key: "VERSION",
9998        get: function get() {
9999          return VERSION$8;
10000        }
10001      }, {
10002        key: "Default",
10003        get: function get() {
10004          return Default$6;
10005        }
10006      }]);
10007      return ScrollSpy;
10008    }();
10009    $2(window).on(Event$8.LOAD_DATA_API, function() {
10010      var scrollSpys = [].slice.call(document.querySelectorAll(Selector$8.DATA_SPY));
10011      var scrollSpysLength = scrollSpys.length;
10012      for (var i = scrollSpysLength;i--; ) {
10013        var $spy = $2(scrollSpys[i]);
10014        ScrollSpy._jQueryInterface.call($spy, $spy.data());
10015      }
10016    });
10017    $2.fn[NAME$8] = ScrollSpy._jQueryInterface;
10018    $2.fn[NAME$8].Constructor = ScrollSpy;
10019    $2.fn[NAME$8].noConflict = function() {
10020      $2.fn[NAME$8] = JQUERY_NO_CONFLICT$8;
10021      return ScrollSpy._jQueryInterface;
10022    };
10023    var NAME$9 = "tab";
10024    var VERSION$9 = "4.3.1";
10025    var DATA_KEY$9 = "bs.tab";
10026    var EVENT_KEY$9 = "." + DATA_KEY$9;
10027    var DATA_API_KEY$7 = ".data-api";
10028    var JQUERY_NO_CONFLICT$9 = $2.fn[NAME$9];
10029    var Event$9 = {
10030      HIDE: "hide" + EVENT_KEY$9,
10031      HIDDEN: "hidden" + EVENT_KEY$9,
10032      SHOW: "show" + EVENT_KEY$9,
10033      SHOWN: "shown" + EVENT_KEY$9,
10034      CLICK_DATA_API: "click" + EVENT_KEY$9 + DATA_API_KEY$7
10035    };
10036    var ClassName$9 = {
10037      DROPDOWN_MENU: "dropdown-menu",
10038      ACTIVE: "active",
10039      DISABLED: "disabled",
10040      FADE: "fade",
10041      SHOW: "show"
10042    };
10043    var Selector$9 = {
10044      DROPDOWN: ".dropdown",
10045      NAV_LIST_GROUP: ".nav, .list-group",
10046      ACTIVE: ".active",
10047      ACTIVE_UL: "> li > .active",
10048      DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
10049      DROPDOWN_TOGGLE: ".dropdown-toggle",
10050      DROPDOWN_ACTIVE_CHILD: "> .dropdown-menu .active"
10051    };
10052    var Tab = /* @__PURE__ */ function() {
10053      function Tab(element) {
10054        this._element = element;
10055      }
10056      var _proto = Tab.prototype;
10057      _proto.show = function show() {
10058        var _this = this;
10059        if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $2(this._element).hasClass(ClassName$9.ACTIVE) || $2(this._element).hasClass(ClassName$9.DISABLED)) {
10060          return;
10061        }
10062        var target;
10063        var previous;
10064        var listElement = $2(this._element).closest(Selector$9.NAV_LIST_GROUP)[0];
10065        var selector = Util.getSelectorFromElement(this._element);
10066        if (listElement) {
10067          var itemSelector = listElement.nodeName === "UL" || listElement.nodeName === "OL" ? Selector$9.ACTIVE_UL : Selector$9.ACTIVE;
10068          previous = $2.makeArray($2(listElement).find(itemSelector));
10069          previous = previous[previous.length - 1];
10070        }
10071        var hideEvent = $2.Event(Event$9.HIDE, {
10072          relatedTarget: this._element
10073        });
10074        var showEvent = $2.Event(Event$9.SHOW, {
10075          relatedTarget: previous
10076        });
10077        if (previous) {
10078          $2(previous).trigger(hideEvent);
10079        }
10080        $2(this._element).trigger(showEvent);
10081        if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
10082          return;
10083        }
10084        if (selector) {
10085          target = document.querySelector(selector);
10086        }
10087        this._activate(this._element, listElement);
10088        var complete = function complete() {
10089          var hiddenEvent = $2.Event(Event$9.HIDDEN, {
10090            relatedTarget: _this._element
10091          });
10092          var shownEvent = $2.Event(Event$9.SHOWN, {
10093            relatedTarget: previous
10094          });
10095          $2(previous).trigger(hiddenEvent);
10096          $2(_this._element).trigger(shownEvent);
10097        };
10098        if (target) {
10099          this._activate(target, target.parentNode, complete);
10100        } else {
10101          complete();
10102        }
10103      };
10104      _proto.dispose = function dispose() {
10105        $2.removeData(this._element, DATA_KEY$9);
10106        this._element = null;
10107      };
10108      _proto._activate = function _activate(element, container, callback) {
10109        var _this2 = this;
10110        var activeElements = container && (container.nodeName === "UL" || container.nodeName === "OL") ? $2(container).find(Selector$9.ACTIVE_UL) : $2(container).children(Selector$9.ACTIVE);
10111        var active = activeElements[0];
10112        var isTransitioning = callback && active && $2(active).hasClass(ClassName$9.FADE);
10113        var complete = function complete() {
10114          return _this2._transitionComplete(element, active, callback);
10115        };
10116        if (active && isTransitioning) {
10117          var transitionDuration = Util.getTransitionDurationFromElement(active);
10118          $2(active).removeClass(ClassName$9.SHOW).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
10119        } else {
10120          complete();
10121        }
10122      };
10123      _proto._transitionComplete = function _transitionComplete(element, active, callback) {
10124        if (active) {
10125          $2(active).removeClass(ClassName$9.ACTIVE);
10126          var dropdownChild = $2(active.parentNode).find(Selector$9.DROPDOWN_ACTIVE_CHILD)[0];
10127          if (dropdownChild) {
10128            $2(dropdownChild).removeClass(ClassName$9.ACTIVE);
10129          }
10130          if (active.getAttribute("role") === "tab") {
10131            active.setAttribute("aria-selected", false);
10132          }
10133        }
10134        $2(element).addClass(ClassName$9.ACTIVE);
10135        if (element.getAttribute("role") === "tab") {
10136          element.setAttribute("aria-selected", true);
10137        }
10138        Util.reflow(element);
10139        if (element.classList.contains(ClassName$9.FADE)) {
10140          element.classList.add(ClassName$9.SHOW);
10141        }
10142        if (element.parentNode && $2(element.parentNode).hasClass(ClassName$9.DROPDOWN_MENU)) {
10143          var dropdownElement = $2(element).closest(Selector$9.DROPDOWN)[0];
10144          if (dropdownElement) {
10145            var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector$9.DROPDOWN_TOGGLE));
10146            $2(dropdownToggleList).addClass(ClassName$9.ACTIVE);
10147          }
10148          element.setAttribute("aria-expanded", true);
10149        }
10150        if (callback) {
10151          callback();
10152        }
10153      };
10154      Tab._jQueryInterface = function _jQueryInterface(config) {
10155        return this.each(function() {
10156          var $this = $2(this);
10157          var data = $this.data(DATA_KEY$9);
10158          if (!data) {
10159            data = new Tab(this);
10160            $this.data(DATA_KEY$9, data);
10161          }
10162          if (typeof config === "string") {
10163            if (typeof data[config] === "undefined") {
10164              throw new TypeError('No method named "' + config + '"');
10165            }
10166            data[config]();
10167          }
10168        });
10169      };
10170      _createClass(Tab, null, [{
10171        key: "VERSION",
10172        get: function get() {
10173          return VERSION$9;
10174        }
10175      }]);
10176      return Tab;
10177    }();
10178    $2(document).on(Event$9.CLICK_DATA_API, Selector$9.DATA_TOGGLE, function(event) {
10179      event.preventDefault();
10180      Tab._jQueryInterface.call($2(this), "show");
10181    });
10182    $2.fn[NAME$9] = Tab._jQueryInterface;
10183    $2.fn[NAME$9].Constructor = Tab;
10184    $2.fn[NAME$9].noConflict = function() {
10185      $2.fn[NAME$9] = JQUERY_NO_CONFLICT$9;
10186      return Tab._jQueryInterface;
10187    };
10188    var NAME$a = "toast";
10189    var VERSION$a = "4.3.1";
10190    var DATA_KEY$a = "bs.toast";
10191    var EVENT_KEY$a = "." + DATA_KEY$a;
10192    var JQUERY_NO_CONFLICT$a = $2.fn[NAME$a];
10193    var Event$a = {
10194      CLICK_DISMISS: "click.dismiss" + EVENT_KEY$a,
10195      HIDE: "hide" + EVENT_KEY$a,
10196      HIDDEN: "hidden" + EVENT_KEY$a,
10197      SHOW: "show" + EVENT_KEY$a,
10198      SHOWN: "shown" + EVENT_KEY$a
10199    };
10200    var ClassName$a = {
10201      FADE: "fade",
10202      HIDE: "hide",
10203      SHOW: "show",
10204      SHOWING: "showing"
10205    };
10206    var DefaultType$7 = {
10207      animation: "boolean",
10208      autohide: "boolean",
10209      delay: "number"
10210    };
10211    var Default$7 = {
10212      animation: true,
10213      autohide: true,
10214      delay: 500
10215    };
10216    var Selector$a = {
10217      DATA_DISMISS: '[data-dismiss="toast"]'
10218    };
10219    var Toast = /* @__PURE__ */ function() {
10220      function Toast(element, config) {
10221        this._element = element;
10222        this._config = this._getConfig(config);
10223        this._timeout = null;
10224        this._setListeners();
10225      }
10226      var _proto = Toast.prototype;
10227      _proto.show = function show() {
10228        var _this = this;
10229        $2(this._element).trigger(Event$a.SHOW);
10230        if (this._config.animation) {
10231          this._element.classList.add(ClassName$a.FADE);
10232        }
10233        var complete = function complete() {
10234          _this._element.classList.remove(ClassName$a.SHOWING);
10235          _this._element.classList.add(ClassName$a.SHOW);
10236          $2(_this._element).trigger(Event$a.SHOWN);
10237          if (_this._config.autohide) {
10238            _this.hide();
10239          }
10240        };
10241        this._element.classList.remove(ClassName$a.HIDE);
10242        this._element.classList.add(ClassName$a.SHOWING);
10243        if (this._config.animation) {
10244          var transitionDuration = Util.getTransitionDurationFromElement(this._element);
10245          $2(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
10246        } else {
10247          complete();
10248        }
10249      };
10250      _proto.hide = function hide(withoutTimeout) {
10251        var _this2 = this;
10252        if (!this._element.classList.contains(ClassName$a.SHOW)) {
10253          return;
10254        }
10255        $2(this._element).trigger(Event$a.HIDE);
10256        if (withoutTimeout) {
10257          this._close();
10258        } else {
10259          this._timeout = setTimeout(function() {
10260            _this2._close();
10261          }, this._config.delay);
10262        }
10263      };
10264      _proto.dispose = function dispose() {
10265        clearTimeout(this._timeout);
10266        this._timeout = null;
10267        if (this._element.classList.contains(ClassName$a.SHOW)) {
10268          this._element.classList.remove(ClassName$a.SHOW);
10269        }
10270        $2(this._element).off(Event$a.CLICK_DISMISS);
10271        $2.removeData(this._element, DATA_KEY$a);
10272        this._element = null;
10273        this._config = null;
10274      };
10275      _proto._getConfig = function _getConfig(config) {
10276        config = _objectSpread({}, Default$7, $2(this._element).data(), typeof config === "object" && config ? config : {});
10277        Util.typeCheckConfig(NAME$a, config, this.constructor.DefaultType);
10278        return config;
10279      };
10280      _proto._setListeners = function _setListeners() {
10281        var _this3 = this;
10282        $2(this._element).on(Event$a.CLICK_DISMISS, Selector$a.DATA_DISMISS, function() {
10283          return _this3.hide(true);
10284        });
10285      };
10286      _proto._close = function _close() {
10287        var _this4 = this;
10288        var complete = function complete() {
10289          _this4._element.classList.add(ClassName$a.HIDE);
10290          $2(_this4._element).trigger(Event$a.HIDDEN);
10291        };
10292        this._element.classList.remove(ClassName$a.SHOW);
10293        if (this._config.animation) {
10294          var transitionDuration = Util.getTransitionDurationFromElement(this._element);
10295          $2(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
10296        } else {
10297          complete();
10298        }
10299      };
10300      Toast._jQueryInterface = function _jQueryInterface(config) {
10301        return this.each(function() {
10302          var $element = $2(this);
10303          var data = $element.data(DATA_KEY$a);
10304          var _config = typeof config === "object" && config;
10305          if (!data) {
10306            data = new Toast(this, _config);
10307            $element.data(DATA_KEY$a, data);
10308          }
10309          if (typeof config === "string") {
10310            if (typeof data[config] === "undefined") {
10311              throw new TypeError('No method named "' + config + '"');
10312            }
10313            data[config](this);
10314          }
10315        });
10316      };
10317      _createClass(Toast, null, [{
10318        key: "VERSION",
10319        get: function get() {
10320          return VERSION$a;
10321        }
10322      }, {
10323        key: "DefaultType",
10324        get: function get() {
10325          return DefaultType$7;
10326        }
10327      }, {
10328        key: "Default",
10329        get: function get() {
10330          return Default$7;
10331        }
10332      }]);
10333      return Toast;
10334    }();
10335    $2.fn[NAME$a] = Toast._jQueryInterface;
10336    $2.fn[NAME$a].Constructor = Toast;
10337    $2.fn[NAME$a].noConflict = function() {
10338      $2.fn[NAME$a] = JQUERY_NO_CONFLICT$a;
10339      return Toast._jQueryInterface;
10340    };
10341    (function() {
10342      if (typeof $2 === "undefined") {
10343        throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");
10344      }
10345      var version = $2.fn.jquery.split(" ")[0].split(".");
10346      var minMajor = 1;
10347      var ltMajor = 2;
10348      var minMinor = 9;
10349      var minPatch = 1;
10350      var maxMajor = 4;
10351      if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
10352        throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0");
10353      }
10354    })();
10355    exports3.Util = Util;
10356    exports3.Alert = Alert;
10357    exports3.Button = Button;
10358    exports3.Carousel = Carousel;
10359    exports3.Collapse = Collapse;
10360    exports3.Dropdown = Dropdown;
10361    exports3.Modal = Modal;
10362    exports3.Popover = Popover;
10363    exports3.Scrollspy = ScrollSpy;
10364    exports3.Tab = Tab;
10365    exports3.Toast = Toast;
10366    exports3.Tooltip = Tooltip;
10367    Object.defineProperty(exports3, "__esModule", { value: true });
10368  });
10369});
10370

vendor: 8,283 bytes, lines 10371-10555

10371// node_modules/vanilla-lazyload/dist/lazyload.min.js
10372var require_lazyload_min = __commonJS(function(exports2, module2) {
10373  function _extends() {
10374    return (_extends = Object.assign || function(t) {
10375      for (var e = 1;e < arguments.length; e++) {
10376        var n = arguments[e];
10377        for (var o in n)
10378          Object.prototype.hasOwnProperty.call(n, o) && (t[o] = n[o]);
10379      }
10380      return t;
10381    }).apply(this, arguments);
10382  }
10383  function _typeof(t) {
10384    return (_typeof = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(t) {
10385      return typeof t;
10386    } : function(t) {
10387      return t && typeof Symbol == "function" && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t;
10388    })(t);
10389  }
10390  (function(t, e) {
10391    (typeof exports2 == "undefined" ? "undefined" : _typeof(exports2)) === "object" && typeof module2 != "undefined" ? module2.exports = e() : typeof define == "function" && define.amd ? define(e) : (t = t || self).LazyLoad = e();
10392  })(exports2, function() {
10393    var t = typeof window != "undefined", e = t && !("onscroll" in window) || typeof navigator != "undefined" && /(gle|ing|ro)bot|crawl|spider/i.test(navigator.userAgent), n = t && "IntersectionObserver" in window, o = t && "classList" in document.createElement("p"), r = { elements_selector: "img", container: e || t ? document : null, threshold: 300, thresholds: null, data_src: "src", data_srcset: "srcset", data_sizes: "sizes", data_bg: "bg", data_poster: "poster", class_loading: "loading", class_loaded: "loaded", class_error: "error", load_delay: 0, auto_unobserve: true, callback_enter: null, callback_exit: null, callback_reveal: null, callback_loaded: null, callback_error: null, callback_finish: null, use_native: false }, a = function(t, e) {
10394      var n, o = new t(e);
10395      try {
10396        n = new CustomEvent("LazyLoad::Initialized", { detail: { instance: o } });
10397      } catch (t) {
10398        (n = document.createEvent("CustomEvent")).initCustomEvent("LazyLoad::Initialized", false, false, { instance: o });
10399      }
10400      window.dispatchEvent(n);
10401    };
10402    var s = function(t, e) {
10403      return t.getAttribute("data-" + e);
10404    }, i = function(t, e, n) {
10405      var o = "data-" + e;
10406      n !== null ? t.setAttribute(o, n) : t.removeAttribute(o);
10407    }, c = function(t) {
10408      return s(t, "was-processed") === "true";
10409    }, l = function(t, e) {
10410      return i(t, "ll-timeout", e);
10411    }, u = function(t) {
10412      return s(t, "ll-timeout");
10413    }, d = function(t, e, n, o) {
10414      t && (o === undefined ? n === undefined ? t(e) : t(e, n) : t(e, n, o));
10415    }, f = function(t, e) {
10416      t.loadingCount += e, t._elements.length === 0 && t.loadingCount === 0 && d(t._settings.callback_finish, t);
10417    }, _ = function(t) {
10418      for (var e, n = [], o = 0;e = t.children[o]; o += 1)
10419        e.tagName === "SOURCE" && n.push(e);
10420      return n;
10421    }, v = function(t, e, n) {
10422      n && t.setAttribute(e, n);
10423    }, g = function(t, e) {
10424      v(t, "sizes", s(t, e.data_sizes)), v(t, "srcset", s(t, e.data_srcset)), v(t, "src", s(t, e.data_src));
10425    }, m2 = { IMG: function(t, e) {
10426      var n = t.parentNode;
10427      n && n.tagName === "PICTURE" && _(n).forEach(function(t) {
10428        g(t, e);
10429      });
10430      g(t, e);
10431    }, IFRAME: function(t, e) {
10432      v(t, "src", s(t, e.data_src));
10433    }, VIDEO: function(t, e) {
10434      _(t).forEach(function(t) {
10435        v(t, "src", s(t, e.data_src));
10436      }), v(t, "poster", s(t, e.data_poster)), v(t, "src", s(t, e.data_src)), t.load();
10437    } }, h = function(t, e) {
10438      var n, o, r = e._settings, a = t.tagName, i = m2[a];
10439      if (i)
10440        return i(t, r), f(e, 1), void (e._elements = (n = e._elements, o = t, n.filter(function(t) {
10441          return t !== o;
10442        })));
10443      (function(t, e) {
10444        var n = s(t, e.data_src), o = s(t, e.data_bg);
10445        n && (t.style.backgroundImage = 'url("'.concat(n, '")')), o && (t.style.backgroundImage = o);
10446      })(t, r);
10447    }, p = function(t, e) {
10448      o ? t.classList.add(e) : t.className += (t.className ? " " : "") + e;
10449    }, b = function(t, e) {
10450      o ? t.classList.remove(e) : t.className = t.className.replace(new RegExp("(^|\\s+)" + e + "(\\s+|$)"), " ").replace(/^\s+/, "").replace(/\s+$/, "");
10451    }, y = function(t, e, n) {
10452      t.addEventListener(e, n);
10453    }, E = function(t, e, n) {
10454      t.removeEventListener(e, n);
10455    }, w = function(t, e, n) {
10456      E(t, "load", e), E(t, "loadeddata", e), E(t, "error", n);
10457    }, I = function(t, e, n) {
10458      var o = n._settings, r = e ? o.class_loaded : o.class_error, a = e ? o.callback_loaded : o.callback_error, s = t.target;
10459      b(s, o.class_loading), p(s, r), d(a, s, n), f(n, -1);
10460    }, k = function(t, e) {
10461      var n = function n(r) {
10462        I(r, true, e), w(t, n, o);
10463      }, o = function o(r) {
10464        I(r, false, e), w(t, n, o);
10465      };
10466      (function(t, e, n) {
10467        y(t, "load", e), y(t, "loadeddata", e), y(t, "error", n);
10468      })(t, n, o);
10469    }, A = ["IMG", "IFRAME", "VIDEO"], L = function(t, e) {
10470      var n = e._observer;
10471      O(t, e), n && e._settings.auto_unobserve && n.unobserve(t);
10472    }, x = function(t) {
10473      var e = u(t);
10474      e && (clearTimeout(e), l(t, null));
10475    }, z = function(t, e) {
10476      var n = e._settings.load_delay, o = u(t);
10477      o || (o = setTimeout(function() {
10478        L(t, e), x(t);
10479      }, n), l(t, o));
10480    }, O = function(t, e, n) {
10481      var o = e._settings;
10482      !n && c(t) || (A.indexOf(t.tagName) > -1 && (k(t, e), p(t, o.class_loading)), h(t, e), function(t) {
10483        i(t, "was-processed", "true");
10484      }(t), d(o.callback_reveal, t, e), d(o.callback_set, t, e));
10485    }, N = function(t) {
10486      return !!n && (t._observer = new IntersectionObserver(function(e) {
10487        e.forEach(function(e) {
10488          return function(t) {
10489            return t.isIntersecting || t.intersectionRatio > 0;
10490          }(e) ? function(t, e, n) {
10491            var o = n._settings;
10492            d(o.callback_enter, t, e, n), o.load_delay ? z(t, n) : L(t, n);
10493          }(e.target, e, t) : function(t, e, n) {
10494            var o = n._settings;
10495            d(o.callback_exit, t, e, n), o.load_delay && x(t);
10496          }(e.target, e, t);
10497        });
10498      }, { root: (e = t._settings).container === document ? null : e.container, rootMargin: e.thresholds || e.threshold + "px" }), true);
10499      var e;
10500    }, C = ["IMG", "IFRAME"], M = function(t, e) {
10501      return function(t) {
10502        return t.filter(function(t) {
10503          return !c(t);
10504        });
10505      }((n = t || function(t) {
10506        return t.container.querySelectorAll(t.elements_selector);
10507      }(e), Array.prototype.slice.call(n)));
10508      var n;
10509    }, S = function(t) {
10510      var e = t._settings;
10511      e.container.querySelectorAll("." + e.class_error).forEach(function(t) {
10512        b(t, e.class_error), function(t) {
10513          i(t, "was-processed", null);
10514        }(t);
10515      }), t.update();
10516    }, R = function(e, n) {
10517      var o;
10518      this._settings = function(t) {
10519        return _extends({}, r, t);
10520      }(e), this.loadingCount = 0, N(this), this.update(n), o = this, t && window.addEventListener("online", function(t) {
10521        S(o);
10522      });
10523    };
10524    return R.prototype = { update: function(t) {
10525      var n, o = this, r = this._settings;
10526      (this._elements = M(t, r), !e && this._observer) ? (function(t) {
10527        return t.use_native && "loading" in HTMLImageElement.prototype;
10528      }(r) && ((n = this)._elements.forEach(function(t) {
10529        C.indexOf(t.tagName) !== -1 && (t.setAttribute("loading", "lazy"), O(t, n));
10530      }), this._elements = M(t, r)), this._elements.forEach(function(t) {
10531        o._observer.observe(t);
10532      })) : this.loadAll();
10533    }, destroy: function() {
10534      var t = this;
10535      this._observer && (this._elements.forEach(function(e) {
10536        t._observer.unobserve(e);
10537      }), this._observer = null), this._elements = null, this._settings = null;
10538    }, load: function(t, e) {
10539      O(t, this, e);
10540    }, loadAll: function() {
10541      var t = this;
10542      this._elements.forEach(function(e) {
10543        L(e, t);
10544      });
10545    } }, t && function(t, e) {
10546      if (e)
10547        if (e.length)
10548          for (var n, o = 0;n = e[o]; o += 1)
10549            a(t, n);
10550        else
10551          a(t, e);
10552    }(R, window.lazyLoadOptions), R;
10553  });
10554});
10555

vendor: 278 bytes, lines 10556-10564

10556// node_modules/@rails/actioncable/src/adapters.js
10557var adapters_default;
10558var init_adapters = __esm(() => {
10559  adapters_default = {
10560    logger: typeof console !== "undefined" ? console : undefined,
10561    WebSocket: typeof WebSocket !== "undefined" ? WebSocket : undefined
10562  };
10563});
10564

vendor: 316 bytes, lines 10565-10578

10565// node_modules/@rails/actioncable/src/logger.js
10566var logger_default;
10567var init_logger = __esm(() => {
10568  init_adapters();
10569  logger_default = {
10570    log(...messages) {
10571      if (this.enabled) {
10572        messages.push(Date.now());
10573        adapters_default.logger.log("[ActionCable]", ...messages);
10574      }
10575    }
10576  };
10577});
10578

vendor: 3,505 bytes, lines 10579-10677

10579// node_modules/@rails/actioncable/src/connection_monitor.js
10580class ConnectionMonitor {
10581  constructor(connection) {
10582    this.visibilityDidChange = this.visibilityDidChange.bind(this);
10583    this.connection = connection;
10584    this.reconnectAttempts = 0;
10585  }
10586  start() {
10587    if (!this.isRunning()) {
10588      this.startedAt = now();
10589      delete this.stoppedAt;
10590      this.startPolling();
10591      addEventListener("visibilitychange", this.visibilityDidChange);
10592      logger_default.log(`ConnectionMonitor started. stale threshold = ${this.constructor.staleThreshold} s`);
10593    }
10594  }
10595  stop() {
10596    if (this.isRunning()) {
10597      this.stoppedAt = now();
10598      this.stopPolling();
10599      removeEventListener("visibilitychange", this.visibilityDidChange);
10600      logger_default.log("ConnectionMonitor stopped");
10601    }
10602  }
10603  isRunning() {
10604    return this.startedAt && !this.stoppedAt;
10605  }
10606  recordMessage() {
10607    this.pingedAt = now();
10608  }
10609  recordConnect() {
10610    this.reconnectAttempts = 0;
10611    delete this.disconnectedAt;
10612    logger_default.log("ConnectionMonitor recorded connect");
10613  }
10614  recordDisconnect() {
10615    this.disconnectedAt = now();
10616    logger_default.log("ConnectionMonitor recorded disconnect");
10617  }
10618  startPolling() {
10619    this.stopPolling();
10620    this.poll();
10621  }
10622  stopPolling() {
10623    clearTimeout(this.pollTimeout);
10624  }
10625  poll() {
10626    this.pollTimeout = setTimeout(() => {
10627      this.reconnectIfStale();
10628      this.poll();
10629    }, this.getPollInterval());
10630  }
10631  getPollInterval() {
10632    const { staleThreshold, reconnectionBackoffRate } = this.constructor;
10633    const backoff = Math.pow(1 + reconnectionBackoffRate, Math.min(this.reconnectAttempts, 10));
10634    const jitterMax = this.reconnectAttempts === 0 ? 1 : reconnectionBackoffRate;
10635    const jitter = jitterMax * Math.random();
10636    return staleThreshold * 1000 * backoff * (1 + jitter);
10637  }
10638  reconnectIfStale() {
10639    if (this.connectionIsStale()) {
10640      logger_default.log(`ConnectionMonitor detected stale connection. reconnectAttempts = ${this.reconnectAttempts}, time stale = ${secondsSince(this.refreshedAt)} s, stale threshold = ${this.constructor.staleThreshold} s`);
10641      this.reconnectAttempts++;
10642      if (this.disconnectedRecently()) {
10643        logger_default.log(`ConnectionMonitor skipping reopening recent disconnect. time disconnected = ${secondsSince(this.disconnectedAt)} s`);
10644      } else {
10645        logger_default.log("ConnectionMonitor reopening");
10646        this.connection.reopen();
10647      }
10648    }
10649  }
10650  get refreshedAt() {
10651    return this.pingedAt ? this.pingedAt : this.startedAt;
10652  }
10653  connectionIsStale() {
10654    return secondsSince(this.refreshedAt) > this.constructor.staleThreshold;
10655  }
10656  disconnectedRecently() {
10657    return this.disconnectedAt && secondsSince(this.disconnectedAt) < this.constructor.staleThreshold;
10658  }
10659  visibilityDidChange() {
10660    if (document.visibilityState === "visible") {
10661      setTimeout(() => {
10662        if (this.connectionIsStale() || !this.connection.isOpen()) {
10663          logger_default.log(`ConnectionMonitor reopening stale connection on visibilitychange. visibilityState = ${document.visibilityState}`);
10664          this.connection.reopen();
10665        }
10666      }, 200);
10667    }
10668  }
10669}
10670var now = () => new Date().getTime(), secondsSince = (time) => (now() - time) / 1000, connection_monitor_default;
10671var init_connection_monitor = __esm(() => {
10672  init_logger();
10673  ConnectionMonitor.staleThreshold = 6;
10674  ConnectionMonitor.reconnectionBackoffRate = 0.15;
10675  connection_monitor_default = ConnectionMonitor;
10676});
10677

vendor: 621 bytes, lines 10678-10702

10678// node_modules/@rails/actioncable/src/internal.js
10679var internal_default;
10680var init_internal = __esm(() => {
10681  internal_default = {
10682    message_types: {
10683      welcome: "welcome",
10684      disconnect: "disconnect",
10685      ping: "ping",
10686      confirmation: "confirm_subscription",
10687      rejection: "reject_subscription"
10688    },
10689    disconnect_reasons: {
10690      unauthorized: "unauthorized",
10691      invalid_request: "invalid_request",
10692      server_restart: "server_restart",
10693      remote: "remote"
10694    },
10695    default_mount_path: "/cable",
10696    protocols: [
10697      "actioncable-v1-json",
10698      "actioncable-unsupported"
10699    ]
10700  };
10701});
10702

vendor: 5,270 bytes, lines 10703-10867

10703// node_modules/@rails/actioncable/src/connection.js
10704class Connection {
10705  constructor(consumer) {
10706    this.open = this.open.bind(this);
10707    this.consumer = consumer;
10708    this.subscriptions = this.consumer.subscriptions;
10709    this.monitor = new connection_monitor_default(this);
10710    this.disconnected = true;
10711  }
10712  send(data) {
10713    if (this.isOpen()) {
10714      this.webSocket.send(JSON.stringify(data));
10715      return true;
10716    } else {
10717      return false;
10718    }
10719  }
10720  open() {
10721    if (this.isActive()) {
10722      logger_default.log(`Attempted to open WebSocket, but existing socket is ${this.getState()}`);
10723      return false;
10724    } else {
10725      const socketProtocols = [...protocols, ...this.consumer.subprotocols || []];
10726      logger_default.log(`Opening WebSocket, current state is ${this.getState()}, subprotocols: ${socketProtocols}`);
10727      if (this.webSocket) {
10728        this.uninstallEventHandlers();
10729      }
10730      this.webSocket = new adapters_default.WebSocket(this.consumer.url, socketProtocols);
10731      this.installEventHandlers();
10732      this.monitor.start();
10733      return true;
10734    }
10735  }
10736  close({ allowReconnect } = { allowReconnect: true }) {
10737    if (!allowReconnect) {
10738      this.monitor.stop();
10739    }
10740    if (this.isOpen()) {
10741      return this.webSocket.close();
10742    }
10743  }
10744  reopen() {
10745    logger_default.log(`Reopening WebSocket, current state is ${this.getState()}`);
10746    if (this.isActive()) {
10747      try {
10748        return this.close();
10749      } catch (error) {
10750        logger_default.log("Failed to reopen WebSocket", error);
10751      } finally {
10752        logger_default.log(`Reopening WebSocket in ${this.constructor.reopenDelay}ms`);
10753        setTimeout(this.open, this.constructor.reopenDelay);
10754      }
10755    } else {
10756      return this.open();
10757    }
10758  }
10759  getProtocol() {
10760    if (this.webSocket) {
10761      return this.webSocket.protocol;
10762    }
10763  }
10764  isOpen() {
10765    return this.isState("open");
10766  }
10767  isActive() {
10768    return this.isState("open", "connecting");
10769  }
10770  triedToReconnect() {
10771    return this.monitor.reconnectAttempts > 0;
10772  }
10773  isProtocolSupported() {
10774    return indexOf.call(supportedProtocols, this.getProtocol()) >= 0;
10775  }
10776  isState(...states) {
10777    return indexOf.call(states, this.getState()) >= 0;
10778  }
10779  getState() {
10780    if (this.webSocket) {
10781      for (let state in adapters_default.WebSocket) {
10782        if (adapters_default.WebSocket[state] === this.webSocket.readyState) {
10783          return state.toLowerCase();
10784        }
10785      }
10786    }
10787    return null;
10788  }
10789  installEventHandlers() {
10790    for (let eventName in this.events) {
10791      const handler = this.events[eventName].bind(this);
10792      this.webSocket[`on${eventName}`] = handler;
10793    }
10794  }
10795  uninstallEventHandlers() {
10796    for (let eventName in this.events) {
10797      this.webSocket[`on${eventName}`] = function() {};
10798    }
10799  }
10800}
10801var message_types, protocols, supportedProtocols, indexOf, connection_default;
10802var init_connection = __esm(() => {
10803  init_adapters();
10804  init_connection_monitor();
10805  init_internal();
10806  init_logger();
10807  ({ message_types, protocols } = internal_default);
10808  supportedProtocols = protocols.slice(0, protocols.length - 1);
10809  indexOf = [].indexOf;
10810  Connection.reopenDelay = 500;
10811  Connection.prototype.events = {
10812    message(event) {
10813      if (!this.isProtocolSupported()) {
10814        return;
10815      }
10816      const { identifier, message, reason, reconnect, type } = JSON.parse(event.data);
10817      this.monitor.recordMessage();
10818      switch (type) {
10819        case message_types.welcome:
10820          if (this.triedToReconnect()) {
10821            this.reconnectAttempted = true;
10822          }
10823          this.monitor.recordConnect();
10824          return this.subscriptions.reload();
10825        case message_types.disconnect:
10826          logger_default.log(`Disconnecting. Reason: ${reason}`);
10827          return this.close({ allowReconnect: reconnect });
10828        case message_types.ping:
10829          return null;
10830        case message_types.confirmation:
10831          this.subscriptions.confirmSubscription(identifier);
10832          if (this.reconnectAttempted) {
10833            this.reconnectAttempted = false;
10834            return this.subscriptions.notify(identifier, "connected", { reconnected: true });
10835          } else {
10836            return this.subscriptions.notify(identifier, "connected", { reconnected: false });
10837          }
10838        case message_types.rejection:
10839          return this.subscriptions.reject(identifier);
10840        default:
10841          return this.subscriptions.notify(identifier, "received", message);
10842      }
10843    },
10844    open() {
10845      logger_default.log(`WebSocket onopen event, using '${this.getProtocol()}' subprotocol`);
10846      this.disconnected = false;
10847      if (!this.isProtocolSupported()) {
10848        logger_default.log("Protocol is unsupported. Stopping monitor and disconnecting.");
10849        return this.close({ allowReconnect: false });
10850      }
10851    },
10852    close(event) {
10853      logger_default.log("WebSocket onclose event");
10854      if (this.disconnected) {
10855        return;
10856      }
10857      this.disconnected = true;
10858      this.monitor.recordDisconnect();
10859      return this.subscriptions.notifyAll("disconnected", { willAttemptReconnect: this.monitor.isRunning() });
10860    },
10861    error() {
10862      logger_default.log("WebSocket onerror event");
10863    }
10864  };
10865  connection_default = Connection;
10866});
10867

vendor: 725 bytes, lines 10868-10895

10868// node_modules/@rails/actioncable/src/subscription.js
10869class Subscription {
10870  constructor(consumer, params = {}, mixin) {
10871    this.consumer = consumer;
10872    this.identifier = JSON.stringify(params);
10873    extend(this, mixin);
10874  }
10875  perform(action, data = {}) {
10876    data.action = action;
10877    return this.send(data);
10878  }
10879  send(data) {
10880    return this.consumer.send({ command: "message", identifier: this.identifier, data: JSON.stringify(data) });
10881  }
10882  unsubscribe() {
10883    return this.consumer.subscriptions.remove(this);
10884  }
10885}
10886var extend = function(object, properties) {
10887  if (properties != null) {
10888    for (let key in properties) {
10889      const value = properties[key];
10890      object[key] = value;
10891    }
10892  }
10893  return object;
10894};
10895

vendor: 1,516 bytes, lines 10896-10938

10896// node_modules/@rails/actioncable/src/subscription_guarantor.js
10897class SubscriptionGuarantor {
10898  constructor(subscriptions) {
10899    this.subscriptions = subscriptions;
10900    this.pendingSubscriptions = [];
10901  }
10902  guarantee(subscription) {
10903    if (this.pendingSubscriptions.indexOf(subscription) == -1) {
10904      logger_default.log(`SubscriptionGuarantor guaranteeing ${subscription.identifier}`);
10905      this.pendingSubscriptions.push(subscription);
10906    } else {
10907      logger_default.log(`SubscriptionGuarantor already guaranteeing ${subscription.identifier}`);
10908    }
10909    this.startGuaranteeing();
10910  }
10911  forget(subscription) {
10912    logger_default.log(`SubscriptionGuarantor forgetting ${subscription.identifier}`);
10913    this.pendingSubscriptions = this.pendingSubscriptions.filter((s) => s !== subscription);
10914  }
10915  startGuaranteeing() {
10916    this.stopGuaranteeing();
10917    this.retrySubscribing();
10918  }
10919  stopGuaranteeing() {
10920    clearTimeout(this.retryTimeout);
10921  }
10922  retrySubscribing() {
10923    this.retryTimeout = setTimeout(() => {
10924      if (this.subscriptions && typeof this.subscriptions.subscribe === "function") {
10925        this.pendingSubscriptions.map((subscription) => {
10926          logger_default.log(`SubscriptionGuarantor resubscribing ${subscription.identifier}`);
10927          this.subscriptions.subscribe(subscription);
10928        });
10929      }
10930    }, 500);
10931  }
10932}
10933var subscription_guarantor_default;
10934var init_subscription_guarantor = __esm(() => {
10935  init_logger();
10936  subscription_guarantor_default = SubscriptionGuarantor;
10937});
10938

vendor: 2,563 bytes, lines 10939-11014

10939// node_modules/@rails/actioncable/src/subscriptions.js
10940class Subscriptions {
10941  constructor(consumer) {
10942    this.consumer = consumer;
10943    this.guarantor = new subscription_guarantor_default(this);
10944    this.subscriptions = [];
10945  }
10946  create(channelName, mixin) {
10947    const channel = channelName;
10948    const params = typeof channel === "object" ? channel : { channel };
10949    const subscription = new Subscription(this.consumer, params, mixin);
10950    return this.add(subscription);
10951  }
10952  add(subscription) {
10953    this.subscriptions.push(subscription);
10954    this.consumer.ensureActiveConnection();
10955    this.notify(subscription, "initialized");
10956    this.subscribe(subscription);
10957    return subscription;
10958  }
10959  remove(subscription) {
10960    this.forget(subscription);
10961    if (!this.findAll(subscription.identifier).length) {
10962      this.sendCommand(subscription, "unsubscribe");
10963    }
10964    return subscription;
10965  }
10966  reject(identifier) {
10967    return this.findAll(identifier).map((subscription) => {
10968      this.forget(subscription);
10969      this.notify(subscription, "rejected");
10970      return subscription;
10971    });
10972  }
10973  forget(subscription) {
10974    this.guarantor.forget(subscription);
10975    this.subscriptions = this.subscriptions.filter((s) => s !== subscription);
10976    return subscription;
10977  }
10978  findAll(identifier) {
10979    return this.subscriptions.filter((s) => s.identifier === identifier);
10980  }
10981  reload() {
10982    return this.subscriptions.map((subscription) => this.subscribe(subscription));
10983  }
10984  notifyAll(callbackName, ...args2) {
10985    return this.subscriptions.map((subscription) => this.notify(subscription, callbackName, ...args2));
10986  }
10987  notify(subscription, callbackName, ...args2) {
10988    let subscriptions;
10989    if (typeof subscription === "string") {
10990      subscriptions = this.findAll(subscription);
10991    } else {
10992      subscriptions = [subscription];
10993    }
10994    return subscriptions.map((subscription) => typeof subscription[callbackName] === "function" ? subscription[callbackName](...args2) : undefined);
10995  }
10996  subscribe(subscription) {
10997    if (this.sendCommand(subscription, "subscribe")) {
10998      this.guarantor.guarantee(subscription);
10999    }
11000  }
11001  confirmSubscription(identifier) {
11002    logger_default.log(`Subscription confirmed ${identifier}`);
11003    this.findAll(identifier).map((subscription) => this.guarantor.forget(subscription));
11004  }
11005  sendCommand(subscription, command) {
11006    const { identifier } = subscription;
11007    return this.consumer.send({ command, identifier });
11008  }
11009}
11010var init_subscriptions = __esm(() => {
11011  init_logger();
11012  init_subscription_guarantor();
11013});
11014

vendor: 1,108 bytes, lines 11015-11062

11015// node_modules/@rails/actioncable/src/consumer.js
11016class Consumer {
11017  constructor(url) {
11018    this._url = url;
11019    this.subscriptions = new Subscriptions(this);
11020    this.connection = new connection_default(this);
11021    this.subprotocols = [];
11022  }
11023  get url() {
11024    return createWebSocketURL(this._url);
11025  }
11026  send(data) {
11027    return this.connection.send(data);
11028  }
11029  connect() {
11030    return this.connection.open();
11031  }
11032  disconnect() {
11033    return this.connection.close({ allowReconnect: false });
11034  }
11035  ensureActiveConnection() {
11036    if (!this.connection.isActive()) {
11037      return this.connection.open();
11038    }
11039  }
11040  addSubProtocol(subprotocol) {
11041    this.subprotocols = [...this.subprotocols, subprotocol];
11042  }
11043}
11044function createWebSocketURL(url) {
11045  if (typeof url === "function") {
11046    url = url();
11047  }
11048  if (url && !/^wss?:/i.test(url)) {
11049    const a = document.createElement("a");
11050    a.href = url;
11051    a.href = a.href;
11052    a.protocol = a.protocol.replace("http", "ws");
11053    return a.href;
11054  } else {
11055    return url;
11056  }
11057}
11058var init_consumer = __esm(() => {
11059  init_connection();
11060  init_subscriptions();
11061});
11062

vendor: 560 bytes, lines 11063-11083

11063// node_modules/@rails/actioncable/src/index.js
11064function createConsumer(url = getConfig("url") || internal_default.default_mount_path) {
11065  return new Consumer(url);
11066}
11067function getConfig(name) {
11068  const element = document.head.querySelector(`meta[name='action-cable-${name}']`);
11069  if (element) {
11070    return element.getAttribute("content");
11071  }
11072}
11073var init_src = __esm(() => {
11074  init_adapters();
11075  init_connection();
11076  init_connection_monitor();
11077  init_consumer();
11078  init_internal();
11079  init_logger();
11080  init_subscription_guarantor();
11081  init_subscriptions();
11082});
11083

vendor: 7,914 bytes, lines 11084-11270

11084// node_modules/smoothscroll-polyfill/dist/smoothscroll.js
11085var require_smoothscroll = __commonJS(function(exports2, module2) {
11086  (function() {
11087    function polyfill() {
11088      var w = window;
11089      var d = document;
11090      if ("scrollBehavior" in d.documentElement.style && w.__forceSmoothScrollPolyfill__ !== true) {
11091        return;
11092      }
11093      var Element2 = w.HTMLElement || w.Element;
11094      var SCROLL_TIME = 468;
11095      var original = {
11096        scroll: w.scroll || w.scrollTo,
11097        scrollBy: w.scrollBy,
11098        elementScroll: Element2.prototype.scroll || scrollElement,
11099        scrollIntoView: Element2.prototype.scrollIntoView
11100      };
11101      var now = w.performance && w.performance.now ? w.performance.now.bind(w.performance) : Date.now;
11102      function isMicrosoftBrowser(userAgent) {
11103        var userAgentPatterns = ["MSIE ", "Trident/", "Edge/"];
11104        return new RegExp(userAgentPatterns.join("|")).test(userAgent);
11105      }
11106      var ROUNDING_TOLERANCE = isMicrosoftBrowser(w.navigator.userAgent) ? 1 : 0;
11107      function scrollElement(x, y) {
11108        this.scrollLeft = x;
11109        this.scrollTop = y;
11110      }
11111      function ease(k) {
11112        return 0.5 * (1 - Math.cos(Math.PI * k));
11113      }
11114      function shouldBailOut(firstArg) {
11115        if (firstArg === null || typeof firstArg !== "object" || firstArg.behavior === undefined || firstArg.behavior === "auto" || firstArg.behavior === "instant") {
11116          return true;
11117        }
11118        if (typeof firstArg === "object" && firstArg.behavior === "smooth") {
11119          return false;
11120        }
11121        throw new TypeError("behavior member of ScrollOptions " + firstArg.behavior + " is not a valid value for enumeration ScrollBehavior.");
11122      }
11123      function hasScrollableSpace(el, axis) {
11124        if (axis === "Y") {
11125          return el.clientHeight + ROUNDING_TOLERANCE < el.scrollHeight;
11126        }
11127        if (axis === "X") {
11128          return el.clientWidth + ROUNDING_TOLERANCE < el.scrollWidth;
11129        }
11130      }
11131      function canOverflow(el, axis) {
11132        var overflowValue = w.getComputedStyle(el, null)["overflow" + axis];
11133        return overflowValue === "auto" || overflowValue === "scroll";
11134      }
11135      function isScrollable(el) {
11136        var isScrollableY = hasScrollableSpace(el, "Y") && canOverflow(el, "Y");
11137        var isScrollableX = hasScrollableSpace(el, "X") && canOverflow(el, "X");
11138        return isScrollableY || isScrollableX;
11139      }
11140      function findScrollableParent(el) {
11141        while (el !== d.body && isScrollable(el) === false) {
11142          el = el.parentNode || el.host;
11143        }
11144        return el;
11145      }
11146      function step(context) {
11147        var time = now();
11148        var value;
11149        var currentX;
11150        var currentY;
11151        var elapsed = (time - context.startTime) / SCROLL_TIME;
11152        elapsed = elapsed > 1 ? 1 : elapsed;
11153        value = ease(elapsed);
11154        currentX = context.startX + (context.x - context.startX) * value;
11155        currentY = context.startY + (context.y - context.startY) * value;
11156        context.method.call(context.scrollable, currentX, currentY);
11157        if (currentX !== context.x || currentY !== context.y) {
11158          w.requestAnimationFrame(step.bind(w, context));
11159        }
11160      }
11161      function smoothScroll(el, x, y) {
11162        var scrollable;
11163        var startX;
11164        var startY;
11165        var method;
11166        var startTime = now();
11167        if (el === d.body) {
11168          scrollable = w;
11169          startX = w.scrollX || w.pageXOffset;
11170          startY = w.scrollY || w.pageYOffset;
11171          method = original.scroll;
11172        } else {
11173          scrollable = el;
11174          startX = el.scrollLeft;
11175          startY = el.scrollTop;
11176          method = scrollElement;
11177        }
11178        step({
11179          scrollable,
11180          method,
11181          startTime,
11182          startX,
11183          startY,
11184          x,
11185          y
11186        });
11187      }
11188      w.scroll = w.scrollTo = function() {
11189        if (arguments[0] === undefined) {
11190          return;
11191        }
11192        if (shouldBailOut(arguments[0]) === true) {
11193          original.scroll.call(w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== "object" ? arguments[0] : w.scrollX || w.pageXOffset, arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : w.scrollY || w.pageYOffset);
11194          return;
11195        }
11196        smoothScroll.call(w, d.body, arguments[0].left !== undefined ? ~~arguments[0].left : w.scrollX || w.pageXOffset, arguments[0].top !== undefined ? ~~arguments[0].top : w.scrollY || w.pageYOffset);
11197      };
11198      w.scrollBy = function() {
11199        if (arguments[0] === undefined) {
11200          return;
11201        }
11202        if (shouldBailOut(arguments[0])) {
11203          original.scrollBy.call(w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== "object" ? arguments[0] : 0, arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : 0);
11204          return;
11205        }
11206        smoothScroll.call(w, d.body, ~~arguments[0].left + (w.scrollX || w.pageXOffset), ~~arguments[0].top + (w.scrollY || w.pageYOffset));
11207      };
11208      Element2.prototype.scroll = Element2.prototype.scrollTo = function() {
11209        if (arguments[0] === undefined) {
11210          return;
11211        }
11212        if (shouldBailOut(arguments[0]) === true) {
11213          if (typeof arguments[0] === "number" && arguments[1] === undefined) {
11214            throw new SyntaxError("Value could not be converted");
11215          }
11216          original.elementScroll.call(this, arguments[0].left !== undefined ? ~~arguments[0].left : typeof arguments[0] !== "object" ? ~~arguments[0] : this.scrollLeft, arguments[0].top !== undefined ? ~~arguments[0].top : arguments[1] !== undefined ? ~~arguments[1] : this.scrollTop);
11217          return;
11218        }
11219        var left = arguments[0].left;
11220        var top = arguments[0].top;
11221        smoothScroll.call(this, this, typeof left === "undefined" ? this.scrollLeft : ~~left, typeof top === "undefined" ? this.scrollTop : ~~top);
11222      };
11223      Element2.prototype.scrollBy = function() {
11224        if (arguments[0] === undefined) {
11225          return;
11226        }
11227        if (shouldBailOut(arguments[0]) === true) {
11228          original.elementScroll.call(this, arguments[0].left !== undefined ? ~~arguments[0].left + this.scrollLeft : ~~arguments[0] + this.scrollLeft, arguments[0].top !== undefined ? ~~arguments[0].top + this.scrollTop : ~~arguments[1] + this.scrollTop);
11229          return;
11230        }
11231        this.scroll({
11232          left: ~~arguments[0].left + this.scrollLeft,
11233          top: ~~arguments[0].top + this.scrollTop,
11234          behavior: arguments[0].behavior
11235        });
11236      };
11237      Element2.prototype.scrollIntoView = function() {
11238        if (shouldBailOut(arguments[0]) === true) {
11239          original.scrollIntoView.call(this, arguments[0] === undefined ? true : arguments[0]);
11240          return;
11241        }
11242        var scrollableParent = findScrollableParent(this);
11243        var parentRects = scrollableParent.getBoundingClientRect();
11244        var clientRects = this.getBoundingClientRect();
11245        if (scrollableParent !== d.body) {
11246          smoothScroll.call(this, scrollableParent, scrollableParent.scrollLeft + clientRects.left - parentRects.left, scrollableParent.scrollTop + clientRects.top - parentRects.top);
11247          if (w.getComputedStyle(scrollableParent).position !== "fixed") {
11248            w.scrollBy({
11249              left: parentRects.left,
11250              top: parentRects.top,
11251              behavior: "smooth"
11252            });
11253          }
11254        } else {
11255          w.scrollBy({
11256            left: clientRects.left,
11257            top: clientRects.top,
11258            behavior: "smooth"
11259          });
11260        }
11261      };
11262    }
11263    if (typeof exports2 === "object" && typeof module2 !== "undefined") {
11264      module2.exports = { polyfill };
11265    } else {
11266      polyfill();
11267    }
11268  })();
11269});
11270

vendor: 52,863 bytes, lines 11271-12584

11271// node_modules/scrollmagic/scrollmagic/uncompressed/ScrollMagic.js
11272var require_ScrollMagic = __commonJS(function(exports2, module2) {
11273  /*!
11274   * ScrollMagic v2.0.8 (2020-08-14)
11275   * The javascript library for magical scroll interactions.
11276   * (c) 2020 Jan Paepke (@janpaepke)
11277   * Project Website: http://scrollmagic.io
11278   * 
11279   * @version 2.0.8
11280   * @license Dual licensed under MIT license and GPL.
11281   * @author Jan Paepke - [email protected]
11282   *
11283   * @file ScrollMagic main library.
11284   */
11285  (function(root2, factory) {
11286    if (typeof define === "function" && define.amd) {
11287      define(factory);
11288    } else if (typeof exports2 === "object") {
11289      module2.exports = factory();
11290    } else {
11291      root2.ScrollMagic = factory();
11292    }
11293  })(exports2, function() {
11294    var ScrollMagic = function() {
11295      _util.log(2, "(COMPATIBILITY NOTICE) -> As of ScrollMagic 2.0.0 you need to use 'new ScrollMagic.Controller()' to create a new controller instance. Use 'new ScrollMagic.Scene()' to instance a scene.");
11296    };
11297    ScrollMagic.version = "2.0.8";
11298    if (typeof window !== "undefined") {
11299      window.addEventListener("mousewheel", undefined);
11300    }
11301    var PIN_SPACER_ATTRIBUTE = "data-scrollmagic-pin-spacer";
11302    ScrollMagic.Controller = function(options2) {
11303      var NAMESPACE = "ScrollMagic.Controller", SCROLL_DIRECTION_FORWARD = "FORWARD", SCROLL_DIRECTION_REVERSE = "REVERSE", SCROLL_DIRECTION_PAUSED = "PAUSED", DEFAULT_OPTIONS = CONTROLLER_OPTIONS.defaults;
11304      var Controller = this, _options = _util.extend({}, DEFAULT_OPTIONS, options2), _sceneObjects = [], _updateScenesOnNextCycle = false, _scrollPos = 0, _scrollDirection = SCROLL_DIRECTION_PAUSED, _isDocument = true, _viewPortSize = 0, _enabled = true, _updateTimeout, _refreshTimeout;
11305      var construct = function() {
11306        for (var key in _options) {
11307          if (!DEFAULT_OPTIONS.hasOwnProperty(key)) {
11308            log(2, 'WARNING: Unknown option "' + key + '"');
11309            delete _options[key];
11310          }
11311        }
11312        _options.container = _util.get.elements(_options.container)[0];
11313        if (!_options.container) {
11314          log(1, "ERROR creating object " + NAMESPACE + ": No valid scroll container supplied");
11315          throw NAMESPACE + " init failed.";
11316        }
11317        _isDocument = _options.container === window || _options.container === document.body || !document.body.contains(_options.container);
11318        if (_isDocument) {
11319          _options.container = window;
11320        }
11321        _viewPortSize = getViewportSize();
11322        _options.container.addEventListener("resize", onChange);
11323        _options.container.addEventListener("scroll", onChange);
11324        var ri = parseInt(_options.refreshInterval, 10);
11325        _options.refreshInterval = _util.type.Number(ri) ? ri : DEFAULT_OPTIONS.refreshInterval;
11326        scheduleRefresh();
11327        log(3, "added new " + NAMESPACE + " controller (v" + ScrollMagic.version + ")");
11328      };
11329      var scheduleRefresh = function() {
11330        if (_options.refreshInterval > 0) {
11331          _refreshTimeout = window.setTimeout(refresh, _options.refreshInterval);
11332        }
11333      };
11334      var getScrollPos = function() {
11335        return _options.vertical ? _util.get.scrollTop(_options.container) : _util.get.scrollLeft(_options.container);
11336      };
11337      var getViewportSize = function() {
11338        return _options.vertical ? _util.get.height(_options.container) : _util.get.width(_options.container);
11339      };
11340      var setScrollPos = this._setScrollPos = function(pos) {
11341        if (_options.vertical) {
11342          if (_isDocument) {
11343            window.scrollTo(_util.get.scrollLeft(), pos);
11344          } else {
11345            _options.container.scrollTop = pos;
11346          }
11347        } else {
11348          if (_isDocument) {
11349            window.scrollTo(pos, _util.get.scrollTop());
11350          } else {
11351            _options.container.scrollLeft = pos;
11352          }
11353        }
11354      };
11355      var updateScenes = function() {
11356        if (_enabled && _updateScenesOnNextCycle) {
11357          var scenesToUpdate = _util.type.Array(_updateScenesOnNextCycle) ? _updateScenesOnNextCycle : _sceneObjects.slice(0);
11358          _updateScenesOnNextCycle = false;
11359          var oldScrollPos = _scrollPos;
11360          _scrollPos = Controller.scrollPos();
11361          var deltaScroll = _scrollPos - oldScrollPos;
11362          if (deltaScroll !== 0) {
11363            _scrollDirection = deltaScroll > 0 ? SCROLL_DIRECTION_FORWARD : SCROLL_DIRECTION_REVERSE;
11364          }
11365          if (_scrollDirection === SCROLL_DIRECTION_REVERSE) {
11366            scenesToUpdate.reverse();
11367          }
11368          scenesToUpdate.forEach(function(scene, index) {
11369            log(3, "updating Scene " + (index + 1) + "/" + scenesToUpdate.length + " (" + _sceneObjects.length + " total)");
11370            scene.update(true);
11371          });
11372          if (scenesToUpdate.length === 0 && _options.loglevel >= 3) {
11373            log(3, "updating 0 Scenes (nothing added to controller)");
11374          }
11375        }
11376      };
11377      var debounceUpdate = function() {
11378        _updateTimeout = _util.rAF(updateScenes);
11379      };
11380      var onChange = function(e) {
11381        log(3, "event fired causing an update:", e.type);
11382        if (e.type == "resize") {
11383          _viewPortSize = getViewportSize();
11384          _scrollDirection = SCROLL_DIRECTION_PAUSED;
11385        }
11386        if (_updateScenesOnNextCycle !== true) {
11387          _updateScenesOnNextCycle = true;
11388          debounceUpdate();
11389        }
11390      };
11391      var refresh = function() {
11392        if (!_isDocument) {
11393          if (_viewPortSize != getViewportSize()) {
11394            var resizeEvent;
11395            try {
11396              resizeEvent = new Event("resize", {
11397                bubbles: false,
11398                cancelable: false
11399              });
11400            } catch (e) {
11401              resizeEvent = document.createEvent("Event");
11402              resizeEvent.initEvent("resize", false, false);
11403            }
11404            _options.container.dispatchEvent(resizeEvent);
11405          }
11406        }
11407        _sceneObjects.forEach(function(scene, index) {
11408          scene.refresh();
11409        });
11410        scheduleRefresh();
11411      };
11412      var log = this._log = function(loglevel, output) {
11413        if (_options.loglevel >= loglevel) {
11414          Array.prototype.splice.call(arguments, 1, 0, "(" + NAMESPACE + ") ->");
11415          _util.log.apply(window, arguments);
11416        }
11417      };
11418      this._options = _options;
11419      var sortScenes = function(ScenesArray) {
11420        if (ScenesArray.length <= 1) {
11421          return ScenesArray;
11422        } else {
11423          var scenes = ScenesArray.slice(0);
11424          scenes.sort(function(a, b) {
11425            return a.scrollOffset() > b.scrollOffset() ? 1 : -1;
11426          });
11427          return scenes;
11428        }
11429      };
11430      this.addScene = function(newScene) {
11431        if (_util.type.Array(newScene)) {
11432          newScene.forEach(function(scene, index) {
11433            Controller.addScene(scene);
11434          });
11435        } else if (newScene instanceof ScrollMagic.Scene) {
11436          if (newScene.controller() !== Controller) {
11437            newScene.addTo(Controller);
11438          } else if (_sceneObjects.indexOf(newScene) < 0) {
11439            _sceneObjects.push(newScene);
11440            _sceneObjects = sortScenes(_sceneObjects);
11441            newScene.on("shift.controller_sort", function() {
11442              _sceneObjects = sortScenes(_sceneObjects);
11443            });
11444            for (var key in _options.globalSceneOptions) {
11445              if (newScene[key]) {
11446                newScene[key].call(newScene, _options.globalSceneOptions[key]);
11447              }
11448            }
11449            log(3, "adding Scene (now " + _sceneObjects.length + " total)");
11450          }
11451        } else {
11452          log(1, "ERROR: invalid argument supplied for '.addScene()'");
11453        }
11454        return Controller;
11455      };
11456      this.removeScene = function(Scene) {
11457        if (_util.type.Array(Scene)) {
11458          Scene.forEach(function(scene, index) {
11459            Controller.removeScene(scene);
11460          });
11461        } else {
11462          var index = _sceneObjects.indexOf(Scene);
11463          if (index > -1) {
11464            Scene.off("shift.controller_sort");
11465            _sceneObjects.splice(index, 1);
11466            log(3, "removing Scene (now " + _sceneObjects.length + " left)");
11467            Scene.remove();
11468          }
11469        }
11470        return Controller;
11471      };
11472      this.updateScene = function(Scene, immediately) {
11473        if (_util.type.Array(Scene)) {
11474          Scene.forEach(function(scene, index) {
11475            Controller.updateScene(scene, immediately);
11476          });
11477        } else {
11478          if (immediately) {
11479            Scene.update(true);
11480          } else if (_updateScenesOnNextCycle !== true && Scene instanceof ScrollMagic.Scene) {
11481            _updateScenesOnNextCycle = _updateScenesOnNextCycle || [];
11482            if (_updateScenesOnNextCycle.indexOf(Scene) == -1) {
11483              _updateScenesOnNextCycle.push(Scene);
11484            }
11485            _updateScenesOnNextCycle = sortScenes(_updateScenesOnNextCycle);
11486            debounceUpdate();
11487          }
11488        }
11489        return Controller;
11490      };
11491      this.update = function(immediately) {
11492        onChange({
11493          type: "resize"
11494        });
11495        if (immediately) {
11496          updateScenes();
11497        }
11498        return Controller;
11499      };
11500      this.scrollTo = function(scrollTarget, additionalParameter) {
11501        if (_util.type.Number(scrollTarget)) {
11502          setScrollPos.call(_options.container, scrollTarget, additionalParameter);
11503        } else if (scrollTarget instanceof ScrollMagic.Scene) {
11504          if (scrollTarget.controller() === Controller) {
11505            Controller.scrollTo(scrollTarget.scrollOffset(), additionalParameter);
11506          } else {
11507            log(2, "scrollTo(): The supplied scene does not belong to this controller. Scroll cancelled.", scrollTarget);
11508          }
11509        } else if (_util.type.Function(scrollTarget)) {
11510          setScrollPos = scrollTarget;
11511        } else {
11512          var elem = _util.get.elements(scrollTarget)[0];
11513          if (elem) {
11514            while (elem.parentNode.hasAttribute(PIN_SPACER_ATTRIBUTE)) {
11515              elem = elem.parentNode;
11516            }
11517            var param = _options.vertical ? "top" : "left", containerOffset = _util.get.offset(_options.container), elementOffset = _util.get.offset(elem);
11518            if (!_isDocument) {
11519              containerOffset[param] -= Controller.scrollPos();
11520            }
11521            Controller.scrollTo(elementOffset[param] - containerOffset[param], additionalParameter);
11522          } else {
11523            log(2, "scrollTo(): The supplied argument is invalid. Scroll cancelled.", scrollTarget);
11524          }
11525        }
11526        return Controller;
11527      };
11528      this.scrollPos = function(scrollPosMethod) {
11529        if (!arguments.length) {
11530          return getScrollPos.call(Controller);
11531        } else {
11532          if (_util.type.Function(scrollPosMethod)) {
11533            getScrollPos = scrollPosMethod;
11534          } else {
11535            log(2, "Provided value for method 'scrollPos' is not a function. To change the current scroll position use 'scrollTo()'.");
11536          }
11537        }
11538        return Controller;
11539      };
11540      this.info = function(about) {
11541        var values = {
11542          size: _viewPortSize,
11543          vertical: _options.vertical,
11544          scrollPos: _scrollPos,
11545          scrollDirection: _scrollDirection,
11546          container: _options.container,
11547          isDocument: _isDocument
11548        };
11549        if (!arguments.length) {
11550          return values;
11551        } else if (values[about] !== undefined) {
11552          return values[about];
11553        } else {
11554          log(1, 'ERROR: option "' + about + '" is not available');
11555          return;
11556        }
11557      };
11558      this.loglevel = function(newLoglevel) {
11559        if (!arguments.length) {
11560          return _options.loglevel;
11561        } else if (_options.loglevel != newLoglevel) {
11562          _options.loglevel = newLoglevel;
11563        }
11564        return Controller;
11565      };
11566      this.enabled = function(newState) {
11567        if (!arguments.length) {
11568          return _enabled;
11569        } else if (_enabled != newState) {
11570          _enabled = !!newState;
11571          Controller.updateScene(_sceneObjects, true);
11572        }
11573        return Controller;
11574      };
11575      this.destroy = function(resetScenes) {
11576        window.clearTimeout(_refreshTimeout);
11577        var i = _sceneObjects.length;
11578        while (i--) {
11579          _sceneObjects[i].destroy(resetScenes);
11580        }
11581        _options.container.removeEventListener("resize", onChange);
11582        _options.container.removeEventListener("scroll", onChange);
11583        _util.cAF(_updateTimeout);
11584        log(3, "destroyed " + NAMESPACE + " (reset: " + (resetScenes ? "true" : "false") + ")");
11585        return null;
11586      };
11587      construct();
11588      return Controller;
11589    };
11590    var CONTROLLER_OPTIONS = {
11591      defaults: {
11592        container: window,
11593        vertical: true,
11594        globalSceneOptions: {},
11595        loglevel: 2,
11596        refreshInterval: 100
11597      }
11598    };
11599    ScrollMagic.Controller.addOption = function(name, defaultValue) {
11600      CONTROLLER_OPTIONS.defaults[name] = defaultValue;
11601    };
11602    ScrollMagic.Controller.extend = function(extension) {
11603      var oldClass = this;
11604      ScrollMagic.Controller = function() {
11605        oldClass.apply(this, arguments);
11606        this.$super = _util.extend({}, this);
11607        return extension.apply(this, arguments) || this;
11608      };
11609      _util.extend(ScrollMagic.Controller, oldClass);
11610      ScrollMagic.Controller.prototype = oldClass.prototype;
11611      ScrollMagic.Controller.prototype.constructor = ScrollMagic.Controller;
11612    };
11613    ScrollMagic.Scene = function(options2) {
11614      var NAMESPACE = "ScrollMagic.Scene", SCENE_STATE_BEFORE = "BEFORE", SCENE_STATE_DURING = "DURING", SCENE_STATE_AFTER = "AFTER", DEFAULT_OPTIONS = SCENE_OPTIONS.defaults;
11615      var Scene = this, _options = _util.extend({}, DEFAULT_OPTIONS, options2), _state = SCENE_STATE_BEFORE, _progress = 0, _scrollOffset = {
11616        start: 0,
11617        end: 0
11618      }, _triggerPos = 0, _enabled = true, _durationUpdateMethod, _controller;
11619      var construct = function() {
11620        for (var key in _options) {
11621          if (!DEFAULT_OPTIONS.hasOwnProperty(key)) {
11622            log(2, 'WARNING: Unknown option "' + key + '"');
11623            delete _options[key];
11624          }
11625        }
11626        for (var optionName in DEFAULT_OPTIONS) {
11627          addSceneOption(optionName);
11628        }
11629        validateOption();
11630      };
11631      var _listeners = {};
11632      this.on = function(names, callback) {
11633        if (_util.type.Function(callback)) {
11634          names = names.trim().split(" ");
11635          names.forEach(function(fullname) {
11636            var nameparts = fullname.split("."), eventname = nameparts[0], namespace = nameparts[1];
11637            if (eventname != "*") {
11638              if (!_listeners[eventname]) {
11639                _listeners[eventname] = [];
11640              }
11641              _listeners[eventname].push({
11642                namespace: namespace || "",
11643                callback
11644              });
11645            }
11646          });
11647        } else {
11648          log(1, "ERROR when calling '.on()': Supplied callback for '" + names + "' is not a valid function!");
11649        }
11650        return Scene;
11651      };
11652      this.off = function(names, callback) {
11653        if (!names) {
11654          log(1, "ERROR: Invalid event name supplied.");
11655          return Scene;
11656        }
11657        names = names.trim().split(" ");
11658        names.forEach(function(fullname, key) {
11659          var nameparts = fullname.split("."), eventname = nameparts[0], namespace = nameparts[1] || "", removeList = eventname === "*" ? Object.keys(_listeners) : [eventname];
11660          removeList.forEach(function(remove2) {
11661            var list = _listeners[remove2] || [], i = list.length;
11662            while (i--) {
11663              var listener = list[i];
11664              if (listener && (namespace === listener.namespace || namespace === "*") && (!callback || callback == listener.callback)) {
11665                list.splice(i, 1);
11666              }
11667            }
11668            if (!list.length) {
11669              delete _listeners[remove2];
11670            }
11671          });
11672        });
11673        return Scene;
11674      };
11675      this.trigger = function(name, vars) {
11676        if (name) {
11677          var nameparts = name.trim().split("."), eventname = nameparts[0], namespace = nameparts[1], listeners = _listeners[eventname];
11678          log(3, "event fired:", eventname, vars ? "->" : "", vars || "");
11679          if (listeners) {
11680            listeners.forEach(function(listener, key) {
11681              if (!namespace || namespace === listener.namespace) {
11682                listener.callback.call(Scene, new ScrollMagic.Event(eventname, listener.namespace, Scene, vars));
11683              }
11684            });
11685          }
11686        } else {
11687          log(1, "ERROR: Invalid event name supplied.");
11688        }
11689        return Scene;
11690      };
11691      Scene.on("change.internal", function(e) {
11692        if (e.what !== "loglevel" && e.what !== "tweenChanges") {
11693          if (e.what === "triggerElement") {
11694            updateTriggerElementPosition();
11695          } else if (e.what === "reverse") {
11696            Scene.update();
11697          }
11698        }
11699      }).on("shift.internal", function(e) {
11700        updateScrollOffset();
11701        Scene.update();
11702      });
11703      var log = this._log = function(loglevel, output) {
11704        if (_options.loglevel >= loglevel) {
11705          Array.prototype.splice.call(arguments, 1, 0, "(" + NAMESPACE + ") ->");
11706          _util.log.apply(window, arguments);
11707        }
11708      };
11709      this.addTo = function(controller) {
11710        if (!(controller instanceof ScrollMagic.Controller)) {
11711          log(1, "ERROR: supplied argument of 'addTo()' is not a valid ScrollMagic Controller");
11712        } else if (_controller != controller) {
11713          if (_controller) {
11714            _controller.removeScene(Scene);
11715          }
11716          _controller = controller;
11717          validateOption();
11718          updateDuration(true);
11719          updateTriggerElementPosition(true);
11720          updateScrollOffset();
11721          _controller.info("container").addEventListener("resize", onContainerResize);
11722          controller.addScene(Scene);
11723          Scene.trigger("add", {
11724            controller: _controller
11725          });
11726          log(3, "added " + NAMESPACE + " to controller");
11727          Scene.update();
11728        }
11729        return Scene;
11730      };
11731      this.enabled = function(newState) {
11732        if (!arguments.length) {
11733          return _enabled;
11734        } else if (_enabled != newState) {
11735          _enabled = !!newState;
11736          Scene.update(true);
11737        }
11738        return Scene;
11739      };
11740      this.remove = function() {
11741        if (_controller) {
11742          _controller.info("container").removeEventListener("resize", onContainerResize);
11743          var tmpParent = _controller;
11744          _controller = undefined;
11745          tmpParent.removeScene(Scene);
11746          Scene.trigger("remove");
11747          log(3, "removed " + NAMESPACE + " from controller");
11748        }
11749        return Scene;
11750      };
11751      this.destroy = function(reset) {
11752        Scene.trigger("destroy", {
11753          reset
11754        });
11755        Scene.remove();
11756        Scene.off("*.*");
11757        log(3, "destroyed " + NAMESPACE + " (reset: " + (reset ? "true" : "false") + ")");
11758        return null;
11759      };
11760      this.update = function(immediately) {
11761        if (_controller) {
11762          if (immediately) {
11763            if (_controller.enabled() && _enabled) {
11764              var scrollPos = _controller.info("scrollPos"), newProgress;
11765              if (_options.duration > 0) {
11766                newProgress = (scrollPos - _scrollOffset.start) / (_scrollOffset.end - _scrollOffset.start);
11767              } else {
11768                newProgress = scrollPos >= _scrollOffset.start ? 1 : 0;
11769              }
11770              Scene.trigger("update", {
11771                startPos: _scrollOffset.start,
11772                endPos: _scrollOffset.end,
11773                scrollPos
11774              });
11775              Scene.progress(newProgress);
11776            } else if (_pin && _state === SCENE_STATE_DURING) {
11777              updatePinState(true);
11778            }
11779          } else {
11780            _controller.updateScene(Scene, false);
11781          }
11782        }
11783        return Scene;
11784      };
11785      this.refresh = function() {
11786        updateDuration();
11787        updateTriggerElementPosition();
11788        return Scene;
11789      };
11790      this.progress = function(progress) {
11791        if (!arguments.length) {
11792          return _progress;
11793        } else {
11794          var doUpdate = false, oldState = _state, scrollDirection = _controller ? _controller.info("scrollDirection") : "PAUSED", reverseOrForward = _options.reverse || progress >= _progress;
11795          if (_options.duration === 0) {
11796            doUpdate = _progress != progress;
11797            _progress = progress < 1 && reverseOrForward ? 0 : 1;
11798            _state = _progress === 0 ? SCENE_STATE_BEFORE : SCENE_STATE_DURING;
11799          } else {
11800            if (progress < 0 && _state !== SCENE_STATE_BEFORE && reverseOrForward) {
11801              _progress = 0;
11802              _state = SCENE_STATE_BEFORE;
11803              doUpdate = true;
11804            } else if (progress >= 0 && progress < 1 && reverseOrForward) {
11805              _progress = progress;
11806              _state = SCENE_STATE_DURING;
11807              doUpdate = true;
11808            } else if (progress >= 1 && _state !== SCENE_STATE_AFTER) {
11809              _progress = 1;
11810              _state = SCENE_STATE_AFTER;
11811              doUpdate = true;
11812            } else if (_state === SCENE_STATE_DURING && !reverseOrForward) {
11813              updatePinState();
11814            }
11815          }
11816          if (doUpdate) {
11817            var eventVars = {
11818              progress: _progress,
11819              state: _state,
11820              scrollDirection
11821            }, stateChanged = _state != oldState;
11822            var trigger = function(eventName) {
11823              Scene.trigger(eventName, eventVars);
11824            };
11825            if (stateChanged) {
11826              if (oldState !== SCENE_STATE_DURING) {
11827                trigger("enter");
11828                trigger(oldState === SCENE_STATE_BEFORE ? "start" : "end");
11829              }
11830            }
11831            trigger("progress");
11832            if (stateChanged) {
11833              if (_state !== SCENE_STATE_DURING) {
11834                trigger(_state === SCENE_STATE_BEFORE ? "start" : "end");
11835                trigger("leave");
11836              }
11837            }
11838          }
11839          return Scene;
11840        }
11841      };
11842      var updateScrollOffset = function() {
11843        _scrollOffset = {
11844          start: _triggerPos + _options.offset
11845        };
11846        if (_controller && _options.triggerElement) {
11847          _scrollOffset.start -= _controller.info("size") * _options.triggerHook;
11848        }
11849        _scrollOffset.end = _scrollOffset.start + _options.duration;
11850      };
11851      var updateDuration = function(suppressEvents) {
11852        if (_durationUpdateMethod) {
11853          var varname = "duration";
11854          if (changeOption(varname, _durationUpdateMethod.call(Scene)) && !suppressEvents) {
11855            Scene.trigger("change", {
11856              what: varname,
11857              newval: _options[varname]
11858            });
11859            Scene.trigger("shift", {
11860              reason: varname
11861            });
11862          }
11863        }
11864      };
11865      var updateTriggerElementPosition = function(suppressEvents) {
11866        var elementPos = 0, telem = _options.triggerElement;
11867        if (_controller && (telem || _triggerPos > 0)) {
11868          if (telem) {
11869            if (telem.parentNode) {
11870              var controllerInfo = _controller.info(), containerOffset = _util.get.offset(controllerInfo.container), param = controllerInfo.vertical ? "top" : "left";
11871              while (telem.parentNode.hasAttribute(PIN_SPACER_ATTRIBUTE)) {
11872                telem = telem.parentNode;
11873              }
11874              var elementOffset = _util.get.offset(telem);
11875              if (!controllerInfo.isDocument) {
11876                containerOffset[param] -= _controller.scrollPos();
11877              }
11878              elementPos = elementOffset[param] - containerOffset[param];
11879            } else {
11880              log(2, "WARNING: triggerElement was removed from DOM and will be reset to", undefined);
11881              Scene.triggerElement(undefined);
11882            }
11883          }
11884          var changed = elementPos != _triggerPos;
11885          _triggerPos = elementPos;
11886          if (changed && !suppressEvents) {
11887            Scene.trigger("shift", {
11888              reason: "triggerElementPosition"
11889            });
11890          }
11891        }
11892      };
11893      var onContainerResize = function(e) {
11894        if (_options.triggerHook > 0) {
11895          Scene.trigger("shift", {
11896            reason: "containerResize"
11897          });
11898        }
11899      };
11900      var _validate = _util.extend(SCENE_OPTIONS.validate, {
11901        duration: function(val) {
11902          if (_util.type.String(val) && val.match(/^(\.|\d)*\d+%$/)) {
11903            var perc = parseFloat(val) / 100;
11904            val = function() {
11905              return _controller ? _controller.info("size") * perc : 0;
11906            };
11907          }
11908          if (_util.type.Function(val)) {
11909            _durationUpdateMethod = val;
11910            try {
11911              val = parseFloat(_durationUpdateMethod.call(Scene));
11912            } catch (e) {
11913              val = -1;
11914            }
11915          }
11916          val = parseFloat(val);
11917          if (!_util.type.Number(val) || val < 0) {
11918            if (_durationUpdateMethod) {
11919              _durationUpdateMethod = undefined;
11920              throw ['Invalid return value of supplied function for option "duration":', val];
11921            } else {
11922              throw ['Invalid value for option "duration":', val];
11923            }
11924          }
11925          return val;
11926        }
11927      });
11928      var validateOption = function(check) {
11929        check = arguments.length ? [check] : Object.keys(_validate);
11930        check.forEach(function(optionName, key) {
11931          var value;
11932          if (_validate[optionName]) {
11933            try {
11934              value = _validate[optionName](_options[optionName]);
11935            } catch (e) {
11936              value = DEFAULT_OPTIONS[optionName];
11937              var logMSG = _util.type.String(e) ? [e] : e;
11938              if (_util.type.Array(logMSG)) {
11939                logMSG[0] = "ERROR: " + logMSG[0];
11940                logMSG.unshift(1);
11941                log.apply(this, logMSG);
11942              } else {
11943                log(1, "ERROR: Problem executing validation callback for option '" + optionName + "':", e.message);
11944              }
11945            } finally {
11946              _options[optionName] = value;
11947            }
11948          }
11949        });
11950      };
11951      var changeOption = function(varname, newval) {
11952        var changed = false, oldval = _options[varname];
11953        if (_options[varname] != newval) {
11954          _options[varname] = newval;
11955          validateOption(varname);
11956          changed = oldval != _options[varname];
11957        }
11958        return changed;
11959      };
11960      var addSceneOption = function(optionName) {
11961        if (!Scene[optionName]) {
11962          Scene[optionName] = function(newVal) {
11963            if (!arguments.length) {
11964              return _options[optionName];
11965            } else {
11966              if (optionName === "duration") {
11967                _durationUpdateMethod = undefined;
11968              }
11969              if (changeOption(optionName, newVal)) {
11970                Scene.trigger("change", {
11971                  what: optionName,
11972                  newval: _options[optionName]
11973                });
11974                if (SCENE_OPTIONS.shifts.indexOf(optionName) > -1) {
11975                  Scene.trigger("shift", {
11976                    reason: optionName
11977                  });
11978                }
11979              }
11980            }
11981            return Scene;
11982          };
11983        }
11984      };
11985      this.controller = function() {
11986        return _controller;
11987      };
11988      this.state = function() {
11989        return _state;
11990      };
11991      this.scrollOffset = function() {
11992        return _scrollOffset.start;
11993      };
11994      this.triggerPosition = function() {
11995        var pos = _options.offset;
11996        if (_controller) {
11997          if (_options.triggerElement) {
11998            pos += _triggerPos;
11999          } else {
12000            pos += _controller.info("size") * Scene.triggerHook();
12001          }
12002        }
12003        return pos;
12004      };
12005      var _pin, _pinOptions;
12006      Scene.on("shift.internal", function(e) {
12007        var durationChanged = e.reason === "duration";
12008        if (_state === SCENE_STATE_AFTER && durationChanged || _state === SCENE_STATE_DURING && _options.duration === 0) {
12009          updatePinState();
12010        }
12011        if (durationChanged) {
12012          updatePinDimensions();
12013        }
12014      }).on("progress.internal", function(e) {
12015        updatePinState();
12016      }).on("add.internal", function(e) {
12017        updatePinDimensions();
12018      }).on("destroy.internal", function(e) {
12019        Scene.removePin(e.reset);
12020      });
12021      var updatePinState = function(forceUnpin) {
12022        if (_pin && _controller) {
12023          var containerInfo = _controller.info(), pinTarget = _pinOptions.spacer.firstChild;
12024          if (!forceUnpin && _state === SCENE_STATE_DURING) {
12025            if (_util.css(pinTarget, "position") != "fixed") {
12026              _util.css(pinTarget, {
12027                position: "fixed"
12028              });
12029              updatePinDimensions();
12030            }
12031            var fixedPos = _util.get.offset(_pinOptions.spacer, true), scrollDistance = _options.reverse || _options.duration === 0 ? containerInfo.scrollPos - _scrollOffset.start : Math.round(_progress * _options.duration * 10) / 10;
12032            fixedPos[containerInfo.vertical ? "top" : "left"] += scrollDistance;
12033            _util.css(_pinOptions.spacer.firstChild, {
12034              top: fixedPos.top,
12035              left: fixedPos.left
12036            });
12037          } else {
12038            var newCSS = {
12039              position: _pinOptions.inFlow ? "relative" : "absolute",
12040              top: 0,
12041              left: 0
12042            }, change = _util.css(pinTarget, "position") != newCSS.position;
12043            if (!_pinOptions.pushFollowers) {
12044              newCSS[containerInfo.vertical ? "top" : "left"] = _options.duration * _progress;
12045            } else if (_options.duration > 0) {
12046              if (_state === SCENE_STATE_AFTER && parseFloat(_util.css(_pinOptions.spacer, "padding-top")) === 0) {
12047                change = true;
12048              } else if (_state === SCENE_STATE_BEFORE && parseFloat(_util.css(_pinOptions.spacer, "padding-bottom")) === 0) {
12049                change = true;
12050              }
12051            }
12052            _util.css(pinTarget, newCSS);
12053            if (change) {
12054              updatePinDimensions();
12055            }
12056          }
12057        }
12058      };
12059      var updatePinDimensions = function() {
12060        if (_pin && _controller && _pinOptions.inFlow) {
12061          var after = _state === SCENE_STATE_AFTER, before = _state === SCENE_STATE_BEFORE, during = _state === SCENE_STATE_DURING, vertical = _controller.info("vertical"), pinTarget = _pinOptions.spacer.firstChild, marginCollapse = _util.isMarginCollapseType(_util.css(_pinOptions.spacer, "display")), css2 = {};
12062          if (_pinOptions.relSize.width || _pinOptions.relSize.autoFullWidth) {
12063            if (during) {
12064              _util.css(_pin, {
12065                width: _util.get.width(_pinOptions.spacer)
12066              });
12067            } else {
12068              _util.css(_pin, {
12069                width: "100%"
12070              });
12071            }
12072          } else {
12073            css2["min-width"] = _util.get.width(vertical ? _pin : pinTarget, true, true);
12074            css2.width = during ? css2["min-width"] : "auto";
12075          }
12076          if (_pinOptions.relSize.height) {
12077            if (during) {
12078              _util.css(_pin, {
12079                height: _util.get.height(_pinOptions.spacer) - (_pinOptions.pushFollowers ? _options.duration : 0)
12080              });
12081            } else {
12082              _util.css(_pin, {
12083                height: "100%"
12084              });
12085            }
12086          } else {
12087            css2["min-height"] = _util.get.height(vertical ? pinTarget : _pin, true, !marginCollapse);
12088            css2.height = during ? css2["min-height"] : "auto";
12089          }
12090          if (_pinOptions.pushFollowers) {
12091            css2["padding" + (vertical ? "Top" : "Left")] = _options.duration * _progress;
12092            css2["padding" + (vertical ? "Bottom" : "Right")] = _options.duration * (1 - _progress);
12093          }
12094          _util.css(_pinOptions.spacer, css2);
12095        }
12096      };
12097      var updatePinInContainer = function() {
12098        if (_controller && _pin && _state === SCENE_STATE_DURING && !_controller.info("isDocument")) {
12099          updatePinState();
12100        }
12101      };
12102      var updateRelativePinSpacer = function() {
12103        if (_controller && _pin && _state === SCENE_STATE_DURING && ((_pinOptions.relSize.width || _pinOptions.relSize.autoFullWidth) && _util.get.width(window) != _util.get.width(_pinOptions.spacer.parentNode) || _pinOptions.relSize.height && _util.get.height(window) != _util.get.height(_pinOptions.spacer.parentNode))) {
12104          updatePinDimensions();
12105        }
12106      };
12107      var onMousewheelOverPin = function(e) {
12108        if (_controller && _pin && _state === SCENE_STATE_DURING && !_controller.info("isDocument")) {
12109          e.preventDefault();
12110          _controller._setScrollPos(_controller.info("scrollPos") - ((e.wheelDelta || e[_controller.info("vertical") ? "wheelDeltaY" : "wheelDeltaX"]) / 3 || -e.detail * 30));
12111        }
12112      };
12113      this.setPin = function(element, settings2) {
12114        var defaultSettings = {
12115          pushFollowers: true,
12116          spacerClass: "scrollmagic-pin-spacer"
12117        };
12118        var pushFollowersActivelySet = settings2 && settings2.hasOwnProperty("pushFollowers");
12119        settings2 = _util.extend({}, defaultSettings, settings2);
12120        element = _util.get.elements(element)[0];
12121        if (!element) {
12122          log(1, "ERROR calling method 'setPin()': Invalid pin element supplied.");
12123          return Scene;
12124        } else if (_util.css(element, "position") === "fixed") {
12125          log(1, "ERROR calling method 'setPin()': Pin does not work with elements that are positioned 'fixed'.");
12126          return Scene;
12127        }
12128        if (_pin) {
12129          if (_pin === element) {
12130            return Scene;
12131          } else {
12132            Scene.removePin();
12133          }
12134        }
12135        _pin = element;
12136        var parentDisplay = _pin.parentNode.style.display, boundsParams = ["top", "left", "bottom", "right", "margin", "marginLeft", "marginRight", "marginTop", "marginBottom"];
12137        _pin.parentNode.style.display = "none";
12138        var inFlow = _util.css(_pin, "position") != "absolute", pinCSS = _util.css(_pin, boundsParams.concat(["display"])), sizeCSS = _util.css(_pin, ["width", "height"]);
12139        _pin.parentNode.style.display = parentDisplay;
12140        if (!inFlow && settings2.pushFollowers) {
12141          log(2, "WARNING: If the pinned element is positioned absolutely pushFollowers will be disabled.");
12142          settings2.pushFollowers = false;
12143        }
12144        window.setTimeout(function() {
12145          if (_pin && _options.duration === 0 && pushFollowersActivelySet && settings2.pushFollowers) {
12146            log(2, "WARNING: pushFollowers =", true, "has no effect, when scene duration is 0.");
12147          }
12148        }, 0);
12149        var spacer = _pin.parentNode.insertBefore(document.createElement("div"), _pin), spacerCSS = _util.extend(pinCSS, {
12150          position: inFlow ? "relative" : "absolute",
12151          boxSizing: "content-box",
12152          mozBoxSizing: "content-box",
12153          webkitBoxSizing: "content-box"
12154        });
12155        if (!inFlow) {
12156          _util.extend(spacerCSS, _util.css(_pin, ["width", "height"]));
12157        }
12158        _util.css(spacer, spacerCSS);
12159        spacer.setAttribute(PIN_SPACER_ATTRIBUTE, "");
12160        _util.addClass(spacer, settings2.spacerClass);
12161        _pinOptions = {
12162          spacer,
12163          relSize: {
12164            width: sizeCSS.width.slice(-1) === "%",
12165            height: sizeCSS.height.slice(-1) === "%",
12166            autoFullWidth: sizeCSS.width === "auto" && inFlow && _util.isMarginCollapseType(pinCSS.display)
12167          },
12168          pushFollowers: settings2.pushFollowers,
12169          inFlow
12170        };
12171        if (!_pin.___origStyle) {
12172          _pin.___origStyle = {};
12173          var pinInlineCSS = _pin.style, copyStyles = boundsParams.concat(["width", "height", "position", "boxSizing", "mozBoxSizing", "webkitBoxSizing"]);
12174          copyStyles.forEach(function(val) {
12175            _pin.___origStyle[val] = pinInlineCSS[val] || "";
12176          });
12177        }
12178        if (_pinOptions.relSize.width) {
12179          _util.css(spacer, {
12180            width: sizeCSS.width
12181          });
12182        }
12183        if (_pinOptions.relSize.height) {
12184          _util.css(spacer, {
12185            height: sizeCSS.height
12186          });
12187        }
12188        spacer.appendChild(_pin);
12189        _util.css(_pin, {
12190          position: inFlow ? "relative" : "absolute",
12191          margin: "auto",
12192          top: "auto",
12193          left: "auto",
12194          bottom: "auto",
12195          right: "auto"
12196        });
12197        if (_pinOptions.relSize.width || _pinOptions.relSize.autoFullWidth) {
12198          _util.css(_pin, {
12199            boxSizing: "border-box",
12200            mozBoxSizing: "border-box",
12201            webkitBoxSizing: "border-box"
12202          });
12203        }
12204        window.addEventListener("scroll", updatePinInContainer);
12205        window.addEventListener("resize", updatePinInContainer);
12206        window.addEventListener("resize", updateRelativePinSpacer);
12207        _pin.addEventListener("mousewheel", onMousewheelOverPin);
12208        _pin.addEventListener("DOMMouseScroll", onMousewheelOverPin);
12209        log(3, "added pin");
12210        updatePinState();
12211        return Scene;
12212      };
12213      this.removePin = function(reset) {
12214        if (_pin) {
12215          if (_state === SCENE_STATE_DURING) {
12216            updatePinState(true);
12217          }
12218          if (reset || !_controller) {
12219            var pinTarget = _pinOptions.spacer.firstChild;
12220            if (pinTarget.hasAttribute(PIN_SPACER_ATTRIBUTE)) {
12221              var style = _pinOptions.spacer.style, values = ["margin", "marginLeft", "marginRight", "marginTop", "marginBottom"], margins = {};
12222              values.forEach(function(val) {
12223                margins[val] = style[val] || "";
12224              });
12225              _util.css(pinTarget, margins);
12226            }
12227            _pinOptions.spacer.parentNode.insertBefore(pinTarget, _pinOptions.spacer);
12228            _pinOptions.spacer.parentNode.removeChild(_pinOptions.spacer);
12229            if (!_pin.parentNode.hasAttribute(PIN_SPACER_ATTRIBUTE)) {
12230              _util.css(_pin, _pin.___origStyle);
12231              delete _pin.___origStyle;
12232            }
12233          }
12234          window.removeEventListener("scroll", updatePinInContainer);
12235          window.removeEventListener("resize", updatePinInContainer);
12236          window.removeEventListener("resize", updateRelativePinSpacer);
12237          _pin.removeEventListener("mousewheel", onMousewheelOverPin);
12238          _pin.removeEventListener("DOMMouseScroll", onMousewheelOverPin);
12239          _pin = undefined;
12240          log(3, "removed pin (reset: " + (reset ? "true" : "false") + ")");
12241        }
12242        return Scene;
12243      };
12244      var _cssClasses, _cssClassElems = [];
12245      Scene.on("destroy.internal", function(e) {
12246        Scene.removeClassToggle(e.reset);
12247      });
12248      this.setClassToggle = function(element, classes) {
12249        var elems = _util.get.elements(element);
12250        if (elems.length === 0 || !_util.type.String(classes)) {
12251          log(1, "ERROR calling method 'setClassToggle()': Invalid " + (elems.length === 0 ? "element" : "classes") + " supplied.");
12252          return Scene;
12253        }
12254        if (_cssClassElems.length > 0) {
12255          Scene.removeClassToggle();
12256        }
12257        _cssClasses = classes;
12258        _cssClassElems = elems;
12259        Scene.on("enter.internal_class leave.internal_class", function(e) {
12260          var toggle = e.type === "enter" ? _util.addClass : _util.removeClass;
12261          _cssClassElems.forEach(function(elem, key) {
12262            toggle(elem, _cssClasses);
12263          });
12264        });
12265        return Scene;
12266      };
12267      this.removeClassToggle = function(reset) {
12268        if (reset) {
12269          _cssClassElems.forEach(function(elem, key) {
12270            _util.removeClass(elem, _cssClasses);
12271          });
12272        }
12273        Scene.off("start.internal_class end.internal_class");
12274        _cssClasses = undefined;
12275        _cssClassElems = [];
12276        return Scene;
12277      };
12278      construct();
12279      return Scene;
12280    };
12281    var SCENE_OPTIONS = {
12282      defaults: {
12283        duration: 0,
12284        offset: 0,
12285        triggerElement: undefined,
12286        triggerHook: 0.5,
12287        reverse: true,
12288        loglevel: 2
12289      },
12290      validate: {
12291        offset: function(val) {
12292          val = parseFloat(val);
12293          if (!_util.type.Number(val)) {
12294            throw ['Invalid value for option "offset":', val];
12295          }
12296          return val;
12297        },
12298        triggerElement: function(val) {
12299          val = val || undefined;
12300          if (val) {
12301            var elem = _util.get.elements(val)[0];
12302            if (elem && elem.parentNode) {
12303              val = elem;
12304            } else {
12305              throw ['Element defined in option "triggerElement" was not found:', val];
12306            }
12307          }
12308          return val;
12309        },
12310        triggerHook: function(val) {
12311          var translate = {
12312            onCenter: 0.5,
12313            onEnter: 1,
12314            onLeave: 0
12315          };
12316          if (_util.type.Number(val)) {
12317            val = Math.max(0, Math.min(parseFloat(val), 1));
12318          } else if (val in translate) {
12319            val = translate[val];
12320          } else {
12321            throw ['Invalid value for option "triggerHook": ', val];
12322          }
12323          return val;
12324        },
12325        reverse: function(val) {
12326          return !!val;
12327        },
12328        loglevel: function(val) {
12329          val = parseInt(val);
12330          if (!_util.type.Number(val) || val < 0 || val > 3) {
12331            throw ['Invalid value for option "loglevel":', val];
12332          }
12333          return val;
12334        }
12335      },
12336      shifts: ["duration", "offset", "triggerHook"]
12337    };
12338    ScrollMagic.Scene.addOption = function(name, defaultValue, validationCallback, shifts) {
12339      if (!(name in SCENE_OPTIONS.defaults)) {
12340        SCENE_OPTIONS.defaults[name] = defaultValue;
12341        SCENE_OPTIONS.validate[name] = validationCallback;
12342        if (shifts) {
12343          SCENE_OPTIONS.shifts.push(name);
12344        }
12345      } else {
12346        ScrollMagic._util.log(1, "[static] ScrollMagic.Scene -> Cannot add Scene option '" + name + "', because it already exists.");
12347      }
12348    };
12349    ScrollMagic.Scene.extend = function(extension) {
12350      var oldClass = this;
12351      ScrollMagic.Scene = function() {
12352        oldClass.apply(this, arguments);
12353        this.$super = _util.extend({}, this);
12354        return extension.apply(this, arguments) || this;
12355      };
12356      _util.extend(ScrollMagic.Scene, oldClass);
12357      ScrollMagic.Scene.prototype = oldClass.prototype;
12358      ScrollMagic.Scene.prototype.constructor = ScrollMagic.Scene;
12359    };
12360    ScrollMagic.Event = function(type, namespace, target, vars) {
12361      vars = vars || {};
12362      for (var key in vars) {
12363        this[key] = vars[key];
12364      }
12365      this.type = type;
12366      this.target = this.currentTarget = target;
12367      this.namespace = namespace || "";
12368      this.timeStamp = this.timestamp = Date.now();
12369      return this;
12370    };
12371    var _util = ScrollMagic._util = function(window2) {
12372      var U = {}, i;
12373      var floatval = function(number) {
12374        return parseFloat(number) || 0;
12375      };
12376      var _getComputedStyle = function(elem) {
12377        return elem.currentStyle ? elem.currentStyle : window2.getComputedStyle(elem);
12378      };
12379      var _dimension = function(which, elem, outer, includeMargin) {
12380        elem = elem === document ? window2 : elem;
12381        if (elem === window2) {
12382          includeMargin = false;
12383        } else if (!_type.DomElement(elem)) {
12384          return 0;
12385        }
12386        which = which.charAt(0).toUpperCase() + which.substr(1).toLowerCase();
12387        var dimension = (outer ? elem["offset" + which] || elem["outer" + which] : elem["client" + which] || elem["inner" + which]) || 0;
12388        if (outer && includeMargin) {
12389          var style = _getComputedStyle(elem);
12390          dimension += which === "Height" ? floatval(style.marginTop) + floatval(style.marginBottom) : floatval(style.marginLeft) + floatval(style.marginRight);
12391        }
12392        return dimension;
12393      };
12394      var _camelCase = function(str) {
12395        return str.replace(/^[^a-z]+([a-z])/g, "$1").replace(/-([a-z])/g, function(g) {
12396          return g[1].toUpperCase();
12397        });
12398      };
12399      U.extend = function(obj2) {
12400        obj2 = obj2 || {};
12401        for (i = 1;i < arguments.length; i++) {
12402          if (!arguments[i]) {
12403            continue;
12404          }
12405          for (var key in arguments[i]) {
12406            if (arguments[i].hasOwnProperty(key)) {
12407              obj2[key] = arguments[i][key];
12408            }
12409          }
12410        }
12411        return obj2;
12412      };
12413      U.isMarginCollapseType = function(str) {
12414        return ["block", "flex", "list-item", "table", "-webkit-box"].indexOf(str) > -1;
12415      };
12416      var lastTime = 0, vendors = ["ms", "moz", "webkit", "o"];
12417      var _requestAnimationFrame = window2.requestAnimationFrame;
12418      var _cancelAnimationFrame = window2.cancelAnimationFrame;
12419      for (i = 0;!_requestAnimationFrame && i < vendors.length; ++i) {
12420        _requestAnimationFrame = window2[vendors[i] + "RequestAnimationFrame"];
12421        _cancelAnimationFrame = window2[vendors[i] + "CancelAnimationFrame"] || window2[vendors[i] + "CancelRequestAnimationFrame"];
12422      }
12423      if (!_requestAnimationFrame) {
12424        _requestAnimationFrame = function(callback) {
12425          var currTime = new Date().getTime(), timeToCall = Math.max(0, 16 - (currTime - lastTime)), id = window2.setTimeout(function() {
12426            callback(currTime + timeToCall);
12427          }, timeToCall);
12428          lastTime = currTime + timeToCall;
12429          return id;
12430        };
12431      }
12432      if (!_cancelAnimationFrame) {
12433        _cancelAnimationFrame = function(id) {
12434          window2.clearTimeout(id);
12435        };
12436      }
12437      U.rAF = _requestAnimationFrame.bind(window2);
12438      U.cAF = _cancelAnimationFrame.bind(window2);
12439      var loglevels = ["error", "warn", "log"], console2 = window2.console || {};
12440      console2.log = console2.log || function() {};
12441      for (i = 0;i < loglevels.length; i++) {
12442        var method = loglevels[i];
12443        if (!console2[method]) {
12444          console2[method] = console2.log;
12445        }
12446      }
12447      U.log = function(loglevel) {
12448        if (loglevel > loglevels.length || loglevel <= 0)
12449          loglevel = loglevels.length;
12450        var now = new Date, time = ("0" + now.getHours()).slice(-2) + ":" + ("0" + now.getMinutes()).slice(-2) + ":" + ("0" + now.getSeconds()).slice(-2) + ":" + ("00" + now.getMilliseconds()).slice(-3), method = loglevels[loglevel - 1], args2 = Array.prototype.splice.call(arguments, 1), func = Function.prototype.bind.call(console2[method], console2);
12451        args2.unshift(time);
12452        func.apply(console2, args2);
12453      };
12454      var _type = U.type = function(v) {
12455        return Object.prototype.toString.call(v).replace(/^\[object (.+)\]$/, "$1").toLowerCase();
12456      };
12457      _type.String = function(v) {
12458        return _type(v) === "string";
12459      };
12460      _type.Function = function(v) {
12461        return _type(v) === "function";
12462      };
12463      _type.Array = function(v) {
12464        return Array.isArray(v);
12465      };
12466      _type.Number = function(v) {
12467        return !_type.Array(v) && v - parseFloat(v) + 1 >= 0;
12468      };
12469      _type.DomElement = function(o) {
12470        return typeof HTMLElement === "object" || typeof HTMLElement === "function" ? o instanceof HTMLElement || o instanceof SVGElement : o && typeof o === "object" && o !== null && o.nodeType === 1 && typeof o.nodeName === "string";
12471      };
12472      var _get = U.get = {};
12473      _get.elements = function(selector) {
12474        var arr = [];
12475        if (_type.String(selector)) {
12476          try {
12477            selector = document.querySelectorAll(selector);
12478          } catch (e) {
12479            return arr;
12480          }
12481        }
12482        if (_type(selector) === "nodelist" || _type.Array(selector) || selector instanceof NodeList) {
12483          for (var i = 0, ref = arr.length = selector.length;i < ref; i++) {
12484            var elem = selector[i];
12485            arr[i] = _type.DomElement(elem) ? elem : _get.elements(elem);
12486          }
12487        } else if (_type.DomElement(selector) || selector === document || selector === window2) {
12488          arr = [selector];
12489        }
12490        return arr;
12491      };
12492      _get.scrollTop = function(elem) {
12493        return elem && typeof elem.scrollTop === "number" ? elem.scrollTop : window2.pageYOffset || 0;
12494      };
12495      _get.scrollLeft = function(elem) {
12496        return elem && typeof elem.scrollLeft === "number" ? elem.scrollLeft : window2.pageXOffset || 0;
12497      };
12498      _get.width = function(elem, outer, includeMargin) {
12499        return _dimension("width", elem, outer, includeMargin);
12500      };
12501      _get.height = function(elem, outer, includeMargin) {
12502        return _dimension("height", elem, outer, includeMargin);
12503      };
12504      _get.offset = function(elem, relativeToViewport) {
12505        var offset = {
12506          top: 0,
12507          left: 0
12508        };
12509        if (elem && elem.getBoundingClientRect) {
12510          var rect = elem.getBoundingClientRect();
12511          offset.top = rect.top;
12512          offset.left = rect.left;
12513          if (!relativeToViewport) {
12514            offset.top += _get.scrollTop();
12515            offset.left += _get.scrollLeft();
12516          }
12517        }
12518        return offset;
12519      };
12520      U.addClass = function(elem, classname) {
12521        if (classname) {
12522          if (elem.classList)
12523            elem.classList.add(classname);
12524          else
12525            elem.className += " " + classname;
12526        }
12527      };
12528      U.removeClass = function(elem, classname) {
12529        if (classname) {
12530          if (elem.classList)
12531            elem.classList.remove(classname);
12532          else
12533            elem.className = elem.className.replace(new RegExp("(^|\\b)" + classname.split(" ").join("|") + "(\\b|$)", "gi"), " ");
12534        }
12535      };
12536      U.css = function(elem, options2) {
12537        if (_type.String(options2)) {
12538          return _getComputedStyle(elem)[_camelCase(options2)];
12539        } else if (_type.Array(options2)) {
12540          var obj2 = {}, style = _getComputedStyle(elem);
12541          options2.forEach(function(option, key) {
12542            obj2[option] = style[_camelCase(option)];
12543          });
12544          return obj2;
12545        } else {
12546          for (var option in options2) {
12547            var val = options2[option];
12548            if (val == parseFloat(val)) {
12549              val += "px";
12550            }
12551            elem.style[_camelCase(option)] = val;
12552          }
12553        }
12554      };
12555      return U;
12556    }(window || {});
12557    ScrollMagic.Scene.prototype.addIndicators = function() {
12558      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling addIndicators() due to missing Plugin 'debug.addIndicators'. Please make sure to include plugins/debug.addIndicators.js");
12559      return this;
12560    };
12561    ScrollMagic.Scene.prototype.removeIndicators = function() {
12562      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling removeIndicators() due to missing Plugin 'debug.addIndicators'. Please make sure to include plugins/debug.addIndicators.js");
12563      return this;
12564    };
12565    ScrollMagic.Scene.prototype.setTween = function() {
12566      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling setTween() due to missing Plugin 'animation.gsap'. Please make sure to include plugins/animation.gsap.js");
12567      return this;
12568    };
12569    ScrollMagic.Scene.prototype.removeTween = function() {
12570      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling removeTween() due to missing Plugin 'animation.gsap'. Please make sure to include plugins/animation.gsap.js");
12571      return this;
12572    };
12573    ScrollMagic.Scene.prototype.setVelocity = function() {
12574      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling setVelocity() due to missing Plugin 'animation.velocity'. Please make sure to include plugins/animation.velocity.js");
12575      return this;
12576    };
12577    ScrollMagic.Scene.prototype.removeVelocity = function() {
12578      ScrollMagic._util.log(1, "(ScrollMagic.Scene) -> ERROR calling removeVelocity() due to missing Plugin 'animation.velocity'. Please make sure to include plugins/animation.velocity.js");
12579      return this;
12580    };
12581    return ScrollMagic;
12582  });
12583});
12584

vendor: 3,519 bytes, lines 12585-12700

12585// node_modules/clone/clone.js
12586var require_clone = __commonJS(function(exports2, module2) {
12587  var clone2 = function() {
12588    function clone2(parent, circular, depth, prototype) {
12589      var filter;
12590      if (typeof circular === "object") {
12591        depth = circular.depth;
12592        prototype = circular.prototype;
12593        filter = circular.filter;
12594        circular = circular.circular;
12595      }
12596      var allParents = [];
12597      var allChildren = [];
12598      var useBuffer = typeof Buffer != "undefined";
12599      if (typeof circular == "undefined")
12600        circular = true;
12601      if (typeof depth == "undefined")
12602        depth = Infinity;
12603      function _clone(parent, depth) {
12604        if (parent === null)
12605          return null;
12606        if (depth == 0)
12607          return parent;
12608        var child;
12609        var proto;
12610        if (typeof parent != "object") {
12611          return parent;
12612        }
12613        if (clone2.__isArray(parent)) {
12614          child = [];
12615        } else if (clone2.__isRegExp(parent)) {
12616          child = new RegExp(parent.source, __getRegExpFlags(parent));
12617          if (parent.lastIndex)
12618            child.lastIndex = parent.lastIndex;
12619        } else if (clone2.__isDate(parent)) {
12620          child = new Date(parent.getTime());
12621        } else if (useBuffer && Buffer.isBuffer(parent)) {
12622          if (Buffer.allocUnsafe) {
12623            child = Buffer.allocUnsafe(parent.length);
12624          } else {
12625            child = new Buffer(parent.length);
12626          }
12627          parent.copy(child);
12628          return child;
12629        } else {
12630          if (typeof prototype == "undefined") {
12631            proto = Object.getPrototypeOf(parent);
12632            child = Object.create(proto);
12633          } else {
12634            child = Object.create(prototype);
12635            proto = prototype;
12636          }
12637        }
12638        if (circular) {
12639          var index = allParents.indexOf(parent);
12640          if (index != -1) {
12641            return allChildren[index];
12642          }
12643          allParents.push(parent);
12644          allChildren.push(child);
12645        }
12646        for (var i in parent) {
12647          var attrs;
12648          if (proto) {
12649            attrs = Object.getOwnPropertyDescriptor(proto, i);
12650          }
12651          if (attrs && attrs.set == null) {
12652            continue;
12653          }
12654          child[i] = _clone(parent[i], depth - 1);
12655        }
12656        return child;
12657      }
12658      return _clone(parent, depth);
12659    }
12660    clone2.clonePrototype = function clonePrototype(parent) {
12661      if (parent === null)
12662        return null;
12663      var c = function() {};
12664      c.prototype = parent;
12665      return new c;
12666    };
12667    function __objToStr(o) {
12668      return Object.prototype.toString.call(o);
12669    }
12670    clone2.__objToStr = __objToStr;
12671    function __isDate(o) {
12672      return typeof o === "object" && __objToStr(o) === "[object Date]";
12673    }
12674    clone2.__isDate = __isDate;
12675    function __isArray(o) {
12676      return typeof o === "object" && __objToStr(o) === "[object Array]";
12677    }
12678    clone2.__isArray = __isArray;
12679    function __isRegExp(o) {
12680      return typeof o === "object" && __objToStr(o) === "[object RegExp]";
12681    }
12682    clone2.__isRegExp = __isRegExp;
12683    function __getRegExpFlags(re) {
12684      var flags = "";
12685      if (re.global)
12686        flags += "g";
12687      if (re.ignoreCase)
12688        flags += "i";
12689      if (re.multiline)
12690        flags += "m";
12691      return flags;
12692    }
12693    clone2.__getRegExpFlags = __getRegExpFlags;
12694    return clone2;
12695  }();
12696  if (typeof module2 === "object" && module2.exports) {
12697    module2.exports = clone2;
12698  }
12699});
12700

vendor: 406 bytes, lines 12701-12714

12701// node_modules/defaults/index.js
12702var require_defaults = __commonJS(function(exports2, module2) {
12703  var clone2 = require_clone();
12704  module2.exports = function(options2, defaults) {
12705    options2 = options2 || {};
12706    Object.keys(defaults).forEach(function(key) {
12707      if (typeof options2[key] === "undefined") {
12708        options2[key] = clone2(defaults[key]);
12709      }
12710    });
12711    return options2;
12712  };
12713});
12714

vendor: 2,749 bytes, lines 12715-12862

12715// node_modules/wcwidth/combining.js
12716var require_combining = __commonJS(function(exports2, module2) {
12717  module2.exports = [
12718    [768, 879],
12719    [1155, 1158],
12720    [1160, 1161],
12721    [1425, 1469],
12722    [1471, 1471],
12723    [1473, 1474],
12724    [1476, 1477],
12725    [1479, 1479],
12726    [1536, 1539],
12727    [1552, 1557],
12728    [1611, 1630],
12729    [1648, 1648],
12730    [1750, 1764],
12731    [1767, 1768],
12732    [1770, 1773],
12733    [1807, 1807],
12734    [1809, 1809],
12735    [1840, 1866],
12736    [1958, 1968],
12737    [2027, 2035],
12738    [2305, 2306],
12739    [2364, 2364],
12740    [2369, 2376],
12741    [2381, 2381],
12742    [2385, 2388],
12743    [2402, 2403],
12744    [2433, 2433],
12745    [2492, 2492],
12746    [2497, 2500],
12747    [2509, 2509],
12748    [2530, 2531],
12749    [2561, 2562],
12750    [2620, 2620],
12751    [2625, 2626],
12752    [2631, 2632],
12753    [2635, 2637],
12754    [2672, 2673],
12755    [2689, 2690],
12756    [2748, 2748],
12757    [2753, 2757],
12758    [2759, 2760],
12759    [2765, 2765],
12760    [2786, 2787],
12761    [2817, 2817],
12762    [2876, 2876],
12763    [2879, 2879],
12764    [2881, 2883],
12765    [2893, 2893],
12766    [2902, 2902],
12767    [2946, 2946],
12768    [3008, 3008],
12769    [3021, 3021],
12770    [3134, 3136],
12771    [3142, 3144],
12772    [3146, 3149],
12773    [3157, 3158],
12774    [3260, 3260],
12775    [3263, 3263],
12776    [3270, 3270],
12777    [3276, 3277],
12778    [3298, 3299],
12779    [3393, 3395],
12780    [3405, 3405],
12781    [3530, 3530],
12782    [3538, 3540],
12783    [3542, 3542],
12784    [3633, 3633],
12785    [3636, 3642],
12786    [3655, 3662],
12787    [3761, 3761],
12788    [3764, 3769],
12789    [3771, 3772],
12790    [3784, 3789],
12791    [3864, 3865],
12792    [3893, 3893],
12793    [3895, 3895],
12794    [3897, 3897],
12795    [3953, 3966],
12796    [3968, 3972],
12797    [3974, 3975],
12798    [3984, 3991],
12799    [3993, 4028],
12800    [4038, 4038],
12801    [4141, 4144],
12802    [4146, 4146],
12803    [4150, 4151],
12804    [4153, 4153],
12805    [4184, 4185],
12806    [4448, 4607],
12807    [4959, 4959],
12808    [5906, 5908],
12809    [5938, 5940],
12810    [5970, 5971],
12811    [6002, 6003],
12812    [6068, 6069],
12813    [6071, 6077],
12814    [6086, 6086],
12815    [6089, 6099],
12816    [6109, 6109],
12817    [6155, 6157],
12818    [6313, 6313],
12819    [6432, 6434],
12820    [6439, 6440],
12821    [6450, 6450],
12822    [6457, 6459],
12823    [6679, 6680],
12824    [6912, 6915],
12825    [6964, 6964],
12826    [6966, 6970],
12827    [6972, 6972],
12828    [6978, 6978],
12829    [7019, 7027],
12830    [7616, 7626],
12831    [7678, 7679],
12832    [8203, 8207],
12833    [8234, 8238],
12834    [8288, 8291],
12835    [8298, 8303],
12836    [8400, 8431],
12837    [12330, 12335],
12838    [12441, 12442],
12839    [43014, 43014],
12840    [43019, 43019],
12841    [43045, 43046],
12842    [64286, 64286],
12843    [65024, 65039],
12844    [65056, 65059],
12845    [65279, 65279],
12846    [65529, 65531],
12847    [68097, 68099],
12848    [68101, 68102],
12849    [68108, 68111],
12850    [68152, 68154],
12851    [68159, 68159],
12852    [119143, 119145],
12853    [119155, 119170],
12854    [119173, 119179],
12855    [119210, 119213],
12856    [119362, 119364],
12857    [917505, 917505],
12858    [917536, 917631],
12859    [917760, 917999]
12860  ];
12861});
12862

vendor: 1,756 bytes, lines 12863-12919

12863// node_modules/wcwidth/index.js
12864var require_wcwidth = __commonJS(function(exports2, module2) {
12865  var defaults = require_defaults();
12866  var combining = require_combining();
12867  var DEFAULTS = {
12868    nul: 0,
12869    control: 0
12870  };
12871  module2.exports = function wcwidth2(str) {
12872    return wcswidth(str, DEFAULTS);
12873  };
12874  module2.exports.config = function(opts) {
12875    opts = defaults(opts || {}, DEFAULTS);
12876    return function wcwidth2(str) {
12877      return wcswidth(str, opts);
12878    };
12879  };
12880  function wcswidth(str, opts) {
12881    if (typeof str !== "string")
12882      return wcwidth2(str, opts);
12883    var s = 0;
12884    for (var i = 0;i < str.length; i++) {
12885      var n = wcwidth2(str.charCodeAt(i), opts);
12886      if (n < 0)
12887        return -1;
12888      s += n;
12889    }
12890    return s;
12891  }
12892  function wcwidth2(ucs, opts) {
12893    if (ucs === 0)
12894      return opts.nul;
12895    if (ucs < 32 || ucs >= 127 && ucs < 160)
12896      return opts.control;
12897    if (bisearch(ucs))
12898      return 0;
12899    return 1 + (ucs >= 4352 && (ucs <= 4447 || ucs == 9001 || ucs == 9002 || ucs >= 11904 && ucs <= 42191 && ucs != 12351 || ucs >= 44032 && ucs <= 55203 || ucs >= 63744 && ucs <= 64255 || ucs >= 65040 && ucs <= 65049 || ucs >= 65072 && ucs <= 65135 || ucs >= 65280 && ucs <= 65376 || ucs >= 65504 && ucs <= 65510 || ucs >= 131072 && ucs <= 196605 || ucs >= 196608 && ucs <= 262141));
12900  }
12901  function bisearch(ucs) {
12902    var min = 0;
12903    var max = combining.length - 1;
12904    var mid;
12905    if (ucs < combining[0][0] || ucs > combining[max][1])
12906      return false;
12907    while (max >= min) {
12908      mid = Math.floor((min + max) / 2);
12909      if (ucs > combining[mid][1])
12910        min = mid + 1;
12911      else if (ucs < combining[mid][0])
12912        max = mid - 1;
12913      else
12914        return true;
12915    }
12916    return false;
12917  }
12918});
12919

vendor: 388,716 bytes, lines 12920-24089

12920// node_modules/jquery.terminal/js/jquery.terminal.js
12921var require_jquery_terminal = __commonJS(function(exports, module) {
12922  (function(ctx) {
12923    var sprintf2 = function() {
12924      if (!sprintf2.cache.hasOwnProperty(arguments[0])) {
12925        sprintf2.cache[arguments[0]] = sprintf2.parse(arguments[0]);
12926      }
12927      return sprintf2.format.call(null, sprintf2.cache[arguments[0]], arguments);
12928    };
12929    sprintf2.format = function(parse_tree, argv) {
12930      var cursor = 1, tree_length = parse_tree.length, node_type = "", arg, output = [], i, k, match, pad, pad_character, pad_length;
12931      for (i = 0;i < tree_length; i++) {
12932        node_type = get_type2(parse_tree[i]);
12933        if (node_type === "string") {
12934          output.push(parse_tree[i]);
12935        } else if (node_type === "array") {
12936          match = parse_tree[i];
12937          if (match[2]) {
12938            arg = argv[cursor];
12939            for (k = 0;k < match[2].length; k++) {
12940              if (!arg.hasOwnProperty(match[2][k])) {
12941                throw sprintf2('[sprintf] property "%s" does not exist', match[2][k]);
12942              }
12943              arg = arg[match[2][k]];
12944            }
12945          } else if (match[1]) {
12946            arg = argv[match[1]];
12947          } else {
12948            arg = argv[cursor++];
12949          }
12950          if (/[^s]/.test(match[8]) && get_type2(arg) !== "number") {
12951            throw sprintf2("[sprintf] expecting number but found %s", get_type2(arg));
12952          }
12953          switch (match[8]) {
12954            case "b":
12955              arg = arg.toString(2);
12956              break;
12957            case "c":
12958              arg = String.fromCharCode(arg);
12959              break;
12960            case "d":
12961              arg = parseInt(arg, 10);
12962              break;
12963            case "e":
12964              arg = match[7] ? arg.toExponential(match[7]) : arg.toExponential();
12965              break;
12966            case "f":
12967              arg = match[7] ? parseFloat(arg).toFixed(match[7]) : parseFloat(arg);
12968              break;
12969            case "o":
12970              arg = arg.toString(8);
12971              break;
12972            case "s":
12973              arg = (arg = String(arg)) && match[7] ? arg.slice(0, match[7]) : arg;
12974              break;
12975            case "u":
12976              arg = arg >>> 0;
12977              break;
12978            case "x":
12979              arg = arg.toString(16);
12980              break;
12981            case "X":
12982              arg = arg.toString(16).toUpperCase();
12983              break;
12984          }
12985          arg = /[def]/.test(match[8]) && match[3] && arg >= 0 ? " +" + arg : arg;
12986          pad_character = match[4] ? match[4] === "0" ? "0" : match[4].charAt(1) : " ";
12987          pad_length = match[6] - String(arg).length;
12988          pad = match[6] ? str_repeat(pad_character, pad_length) : "";
12989          output.push(match[5] ? arg + pad : pad + arg);
12990        }
12991      }
12992      return output.join("");
12993    };
12994    sprintf2.cache = {};
12995    sprintf2.parse = function(fmt) {
12996      var _fmt = fmt, match = [], parse_tree = [], arg_names = 0;
12997      while (_fmt) {
12998        if ((match = /^[^\x25]+/.exec(_fmt)) !== null) {
12999          parse_tree.push(match[0]);
13000        } else if ((match = /^\x25{2}/.exec(_fmt)) !== null) {
13001          parse_tree.push("%");
13002        } else if ((match = /^\x25(?:([1-9]\d*)\$|\(([^\)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(_fmt)) !== null) {
13003          if (match[2]) {
13004            arg_names |= 1;
13005            var field_list = [], replacement_field = match[2], field_match = [];
13006            if ((field_match = /^([a-z_][a-z_\d]*)/i.exec(replacement_field)) !== null) {
13007              field_list.push(field_match[1]);
13008              while ((replacement_field = replacement_field.slice(field_match[0].length)) !== "") {
13009                if ((field_match = /^\.([a-z_][a-z_\d]*)/i.exec(replacement_field)) !== null) {
13010                  field_list.push(field_match[1]);
13011                } else if ((field_match = /^\[(\d+)\]/.exec(replacement_field)) !== null) {
13012                  field_list.push(field_match[1]);
13013                } else {
13014                  throw "[sprintf] huh?";
13015                }
13016              }
13017            } else {
13018              throw "[sprintf] huh?";
13019            }
13020            match[2] = field_list;
13021          } else {
13022            arg_names |= 2;
13023          }
13024          if (arg_names === 3) {
13025            throw "[sprintf] mixing positional and named placeholders is not (yet) supported";
13026          }
13027          parse_tree.push(match);
13028        } else {
13029          throw "[sprintf] huh?";
13030        }
13031        _fmt = _fmt.slice(match[0].length);
13032      }
13033      return parse_tree;
13034    };
13035    var vsprintf = function(fmt, argv, _argv) {
13036      _argv = argv.slice(0);
13037      _argv.splice(0, 0, fmt);
13038      return sprintf2.apply(null, _argv);
13039    };
13040    function get_type2(variable) {
13041      return Object.prototype.toString.call(variable).slice(8, -1).toLowerCase();
13042    }
13043    function str_repeat(input, multiplier) {
13044      for (var output = [];multiplier > 0; output[--multiplier] = input) {}
13045      return output.join("");
13046    }
13047    ctx.sprintf = sprintf2;
13048    ctx.vsprintf = vsprintf;
13049  })(typeof global !== "undefined" ? global : self || window);
13050  (function(factory, undefined2) {
13051    var root2;
13052    if (typeof window !== "undefined") {
13053      root2 = window;
13054    } else if (typeof self !== "undefined") {
13055      root2 = self;
13056    } else if (typeof global !== "undefined") {
13057      root2 = global;
13058    } else {
13059      throw new Error("Unknow context");
13060    }
13061    if (typeof define === "function" && define.amd) {
13062      define(["jquery", "wcwidth"], function(jquery, wcwidth2) {
13063        factory(jquery, wcwidth2, root2);
13064        return jquery;
13065      });
13066    } else if (typeof module === "object" && module.exports) {
13067      module.exports = function(root2, jQuery2, wcwidth2) {
13068        if (jQuery2 === undefined2) {
13069          if (typeof window !== "undefined") {
13070            jQuery2 = require_jquery();
13071          } else {
13072            jQuery2 = require_jquery()(root2);
13073          }
13074        }
13075        if (wcwidth2 === undefined2) {
13076          wcwidth2 = require_wcwidth();
13077        }
13078        factory(jQuery2, wcwidth2, root2);
13079        return jQuery2;
13080      };
13081    } else {
13082      if (!root2.jQuery) {
13083        root2.$ = root2.cash;
13084      }
13085      factory(root2.jQuery || root2.cash, root2.wcwidth, root2);
13086    }
13087  })(function($, wcwidth, root, undefined) {
13088    function debug(str) {
13089      if (false) {}
13090    }
13091    function DelayQueue() {
13092      var callbacks = $.Callbacks();
13093      var resolved = false;
13094      var self2 = this;
13095      this.resolve = function() {
13096        callbacks.fire();
13097        self2.resolved = resolved = true;
13098      };
13099      this.add = function(fn2) {
13100        if (resolved) {
13101          fn2();
13102        } else {
13103          callbacks.add(fn2);
13104        }
13105      };
13106    }
13107    function EventEmitter() {
13108      this._events = {};
13109    }
13110    EventEmitter.prototype.on = function(event, listener) {
13111      if (!this._events[event]) {
13112        this._events[event] = [];
13113      }
13114      this._events[event].push(listener);
13115    };
13116    EventEmitter.prototype.emit = function(event) {
13117      if (this._events[event]) {
13118        var args2 = Array.prototype.slice.call(arguments, 1);
13119        this._events[event].forEach(function(listener) {
13120          listener.apply(null, args2);
13121        });
13122      }
13123    };
13124    EventEmitter.prototype.off = function(event, listener) {
13125      if (!this._events[event]) {
13126        return;
13127      }
13128      if (!listener) {
13129        delete this._events[event];
13130      } else {
13131        this._events[event] = this._events[event].filter(function(l) {
13132          return l !== listener;
13133        });
13134      }
13135    };
13136    EventEmitter.prototype.once = function(event, listener) {
13137      var self2 = this;
13138      function wrapper() {
13139        self2.off(event, wrapper);
13140        listener.apply(null, arguments);
13141      }
13142      this.on(event, wrapper);
13143    };
13144    EventEmitter.prototype.wait_for = function(event) {
13145      var deferred2 = new $.Deferred;
13146      this.once(event, function() {
13147        deferred2.resolve();
13148      });
13149      return deferred2.promise();
13150    };
13151    $.omap = function(o, fn2) {
13152      var result = {};
13153      $.each(o, function(k, v) {
13154        result[k] = fn2.call(o, k, v);
13155      });
13156      return result;
13157    };
13158    $.fn.text_length = function() {
13159      return this.map(function() {
13160        return $(this).text().length;
13161      }).get().reduce(function(a, b) {
13162        return a + b;
13163      }, 0);
13164    };
13165    var Clone = {
13166      clone_object: function(object) {
13167        var tmp = {};
13168        if (typeof object === "object") {
13169          if (Array.isArray(object)) {
13170            return this.clone_array(object);
13171          } else if (object === null) {
13172            return object;
13173          } else {
13174            for (var key in object) {
13175              if (!object.hasOwnProperty(key)) {
13176                continue;
13177              }
13178              if (Array.isArray(object[key])) {
13179                tmp[key] = this.clone_array(object[key]);
13180              } else if (typeof object[key] === "object") {
13181                tmp[key] = this.clone_object(object[key]);
13182              } else {
13183                tmp[key] = object[key];
13184              }
13185            }
13186          }
13187        }
13188        return tmp;
13189      },
13190      clone_array: function(array) {
13191        if (!is_function(Array.prototype.map)) {
13192          throw new Error("Your browser don't support ES5 array map " + "use es5-shim");
13193        }
13194        return array.slice(0).map(function(item) {
13195          if (typeof item === "object") {
13196            return this.clone_object(item);
13197          } else {
13198            return item;
13199          }
13200        }.bind(this));
13201      }
13202    };
13203    var clone = function(object) {
13204      return Clone.clone_object(object);
13205    };
13206    if ("Map" in root && !("clear" in Map.prototype)) {
13207      Map.prototype.clear = function() {
13208        this.forEach(function(value, key, map) {
13209          map.delete(key);
13210        });
13211      };
13212    }
13213    var localStorage;
13214    (function() {
13215      var hasLS = function() {
13216        try {
13217          var testKey = "test", storage = window.localStorage;
13218          storage.setItem(testKey, "1");
13219          storage.removeItem(testKey);
13220          return true;
13221        } catch (error) {
13222          return false;
13223        }
13224      };
13225      var hasCookies = function() {
13226        try {
13227          document.cookie.split(";");
13228          return true;
13229        } catch (e) {
13230          return false;
13231        }
13232      };
13233      var isLS = hasLS();
13234      function wls(n, v) {
13235        var c;
13236        if (typeof n === "string" && typeof v === "string") {
13237          localStorage[n] = v;
13238          return true;
13239        } else if (typeof n === "object" && typeof v === "undefined") {
13240          for (c in n) {
13241            if (n.hasOwnProperty(c)) {
13242              localStorage[c] = n[c];
13243            }
13244          }
13245          return true;
13246        }
13247        return false;
13248      }
13249      function wc(n, v) {
13250        var dt, e, c;
13251        dt = new Date;
13252        dt.setTime(dt.getTime() + 31536000000);
13253        e = "; expires=" + dt.toGMTString();
13254        if (typeof n === "string" && typeof v === "string") {
13255          document.cookie = n + "=" + v + e + "; path=/";
13256          return true;
13257        } else if (typeof n === "object" && typeof v === "undefined") {
13258          for (c in n) {
13259            if (n.hasOwnProperty(c)) {
13260              document.cookie = c + "=" + n[c] + e + "; path=/";
13261            }
13262          }
13263          return true;
13264        }
13265        return false;
13266      }
13267      function rls(n) {
13268        return localStorage[n];
13269      }
13270      function rc(n) {
13271        var nn, ca, i, c;
13272        nn = n + "=";
13273        ca = document.cookie.split(";");
13274        for (i = 0;i < ca.length; i++) {
13275          c = ca[i];
13276          while (c.charAt(0) === " ") {
13277            c = c.slice(1, c.length);
13278          }
13279          if (c.indexOf(nn) === 0) {
13280            return c.slice(nn.length, c.length);
13281          }
13282        }
13283        return null;
13284      }
13285      function dls(n) {
13286        return delete localStorage[n];
13287      }
13288      function dc(n) {
13289        return wc(n, "", -1);
13290      }
13291      if (!hasCookies() && !isLS) {
13292        localStorage = {};
13293        $.extend({
13294          Storage: {
13295            set: wls,
13296            get: rls,
13297            remove: dls
13298          }
13299        });
13300      } else {
13301        if (isLS) {
13302          localStorage = window.localStorage;
13303        }
13304        $.extend({
13305          Storage: {
13306            set: isLS ? wls : wc,
13307            get: isLS ? rls : rc,
13308            remove: isLS ? dls : dc
13309          }
13310        });
13311      }
13312    })();
13313    var debounce = function() {
13314      var FUNC_ERROR_TEXT = "Expected a function";
13315      function isObject(value) {
13316        var type = typeof value;
13317        return value != null && (type == "object" || type == "function");
13318      }
13319      function now() {
13320        return Date.now();
13321      }
13322      return function debounce2(func, wait, options2) {
13323        var { max: nativeMax, min: nativeMin } = Math;
13324        var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true;
13325        if (typeof func != "function") {
13326          throw new TypeError(FUNC_ERROR_TEXT);
13327        }
13328        wait = wait || 0;
13329        if (isObject(options2)) {
13330          leading = !!options2.leading;
13331          maxing = "maxWait" in options2;
13332          maxWait = maxing ? nativeMax(options2.maxWait || 0, wait) : maxWait;
13333          trailing = "trailing" in options2 ? !!options2.trailing : trailing;
13334        }
13335        function invokeFunc(time) {
13336          var args2 = lastArgs, thisArg = lastThis;
13337          lastArgs = lastThis = undefined;
13338          lastInvokeTime = time;
13339          result = func.apply(thisArg, args2);
13340          return result;
13341        }
13342        function leadingEdge(time) {
13343          lastInvokeTime = time;
13344          timerId = setTimeout(timerExpired, wait);
13345          return leading ? invokeFunc(time) : result;
13346        }
13347        function remainingWait(time) {
13348          var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, timeWaiting = wait - timeSinceLastCall;
13349          return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting;
13350        }
13351        function shouldInvoke(time) {
13352          var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime;
13353          return lastCallTime === undefined || timeSinceLastCall >= wait || timeSinceLastCall < 0 || maxing && timeSinceLastInvoke >= maxWait;
13354        }
13355        function timerExpired() {
13356          var time = now();
13357          if (shouldInvoke(time)) {
13358            return trailingEdge(time);
13359          }
13360          timerId = setTimeout(timerExpired, remainingWait(time));
13361        }
13362        function trailingEdge(time) {
13363          timerId = undefined;
13364          if (trailing && lastArgs) {
13365            return invokeFunc(time);
13366          }
13367          lastArgs = lastThis = undefined;
13368          return result;
13369        }
13370        function cancel() {
13371          if (timerId !== undefined) {
13372            clearTimeout(timerId);
13373          }
13374          lastInvokeTime = 0;
13375          lastArgs = lastCallTime = lastThis = timerId = undefined;
13376        }
13377        function flush() {
13378          return timerId === undefined ? result : trailingEdge(now());
13379        }
13380        function debounced() {
13381          var time = now(), isInvoking = shouldInvoke(time);
13382          lastArgs = arguments;
13383          lastThis = this;
13384          lastCallTime = time;
13385          if (isInvoking) {
13386            if (timerId === undefined) {
13387              return leadingEdge(lastCallTime);
13388            }
13389            if (maxing) {
13390              timerId = setTimeout(timerExpired, wait);
13391              return invokeFunc(lastCallTime);
13392            }
13393          }
13394          if (timerId === undefined) {
13395            timerId = setTimeout(timerExpired, wait);
13396          }
13397          return result;
13398        }
13399        debounced.cancel = cancel;
13400        debounced.flush = flush;
13401        return debounced;
13402      };
13403    }();
13404    var jQuery = $;
13405    (function($2) {
13406      jQuery.fn.extend({
13407        everyTime: function(interval, label, fn2, times, belay) {
13408          return this.each(function() {
13409            jQuery.timer.add(this, interval, label, fn2, times, belay);
13410          });
13411        },
13412        oneTime: function(interval, label, fn2) {
13413          return this.each(function() {
13414            jQuery.timer.add(this, interval, label, fn2, 1);
13415          });
13416        },
13417        stopTime: function(label, fn2) {
13418          return this.each(function() {
13419            jQuery.timer.remove(this, label, fn2);
13420          });
13421        }
13422      });
13423      jQuery.extend({
13424        timer: {
13425          guid: 1,
13426          global: {},
13427          regex: /^([0-9]+)\s*(.*s)?$/,
13428          powers: {
13429            ms: 1,
13430            cs: 10,
13431            ds: 100,
13432            s: 1000,
13433            das: 1e4,
13434            hs: 1e5,
13435            ks: 1e6
13436          },
13437          timeParse: function(value) {
13438            if (value === undefined || value === null) {
13439              return null;
13440            }
13441            var result = this.regex.exec(value.toString().trim());
13442            if (result[2]) {
13443              var num = parseInt(result[1], 10);
13444              var mult = this.powers[result[2]] || 1;
13445              return num * mult;
13446            } else {
13447              return value;
13448            }
13449          },
13450          add: function(element, interval, label, fn2, times, belay) {
13451            var counter = 0;
13452            if (typeof label === "function") {
13453              if (!times) {
13454                times = fn2;
13455              }
13456              fn2 = label;
13457              label = interval;
13458            }
13459            interval = jQuery.timer.timeParse(interval);
13460            if (typeof interval !== "number" || isNaN(interval) || interval <= 0) {
13461              return;
13462            }
13463            if (times && times.constructor !== Number) {
13464              belay = !!times;
13465              times = 0;
13466            }
13467            times = times || 0;
13468            belay = belay || false;
13469            if (!element.$timers) {
13470              element.$timers = {};
13471            }
13472            if (!element.$timers[label]) {
13473              element.$timers[label] = {};
13474            }
13475            fn2.$timerID = fn2.$timerID || this.guid++;
13476            var handler = function() {
13477              if (belay && handler.inProgress) {
13478                return;
13479              }
13480              handler.inProgress = true;
13481              if (++counter > times && times !== 0 || fn2.call(element, counter) === false) {
13482                jQuery.timer.remove(element, label, fn2);
13483              }
13484              handler.inProgress = false;
13485            };
13486            handler.$timerID = fn2.$timerID;
13487            if (!element.$timers[label][fn2.$timerID]) {
13488              element.$timers[label][fn2.$timerID] = setInterval(handler, interval);
13489            }
13490            if (!this.global[label]) {
13491              this.global[label] = [];
13492            }
13493            this.global[label].push(element);
13494          },
13495          remove: function(element, label, fn2) {
13496            var timers = element.$timers, ret2;
13497            if (timers) {
13498              if (!label) {
13499                for (var lab in timers) {
13500                  if (timers.hasOwnProperty(lab)) {
13501                    this.remove(element, lab, fn2);
13502                  }
13503                }
13504              } else if (timers[label]) {
13505                if (fn2) {
13506                  if (fn2.$timerID) {
13507                    clearInterval(timers[label][fn2.$timerID]);
13508                    delete timers[label][fn2.$timerID];
13509                  }
13510                } else {
13511                  for (var _fn in timers[label]) {
13512                    if (timers[label].hasOwnProperty(_fn)) {
13513                      clearInterval(timers[label][_fn]);
13514                      delete timers[label][_fn];
13515                    }
13516                  }
13517                }
13518                for (ret2 in timers[label]) {
13519                  if (timers[label].hasOwnProperty(ret2)) {
13520                    break;
13521                  }
13522                }
13523                if (!ret2) {
13524                  ret2 = null;
13525                  delete timers[label];
13526                }
13527              }
13528              for (ret2 in timers) {
13529                if (timers.hasOwnProperty(ret2)) {
13530                  break;
13531                }
13532              }
13533              if (!ret2) {
13534                element.$timers = null;
13535              }
13536            }
13537          }
13538        }
13539      });
13540      if (/(msie) ([\w.]+)/.exec(navigator.userAgent.toLowerCase())) {
13541        $2(window).one("unload", function() {
13542          var global2 = jQuery.timer.global;
13543          for (var label in global2) {
13544            if (global2.hasOwnProperty(label)) {
13545              var els = global2[label], i = els.length;
13546              while (--i) {
13547                jQuery.timer.remove(els[i], label);
13548              }
13549            }
13550          }
13551        });
13552      }
13553    })(jQuery);
13554    (function(undef) {
13555      if (!String.prototype.split.toString().match(/\[native/)) {
13556        return;
13557      }
13558      var nativeSplit = String.prototype.split, compliantExecNpcg = /()??/.exec("")[1] === undef, self2;
13559      self2 = function(str, separator, limit) {
13560        if (Object.prototype.toString.call(separator) !== "[object RegExp]") {
13561          return nativeSplit.call(str, separator, limit);
13562        }
13563        var output = [], flags = (separator.ignoreCase ? "i" : "") + (separator.multiline ? "m" : "") + (separator.extended ? "x" : "") + (separator.sticky ? "y" : ""), lastLastIndex = 0, separator2, match, lastIndex, lastLength;
13564        separator = new RegExp(separator.source, flags + "g");
13565        str += "";
13566        if (!compliantExecNpcg) {
13567          separator2 = new RegExp("^" + separator.source + "$(?!\\s)", flags);
13568        }
13569        limit = limit === undef ? -1 >>> 0 : limit >>> 0;
13570        while (match = separator.exec(str)) {
13571          lastIndex = match.index + match[0].length;
13572          if (lastIndex > lastLastIndex) {
13573            output.push(str.slice(lastLastIndex, match.index));
13574            if (!compliantExecNpcg && match.length > 1) {
13575              match[0].replace(separator2, function() {
13576                for (var i = 1;i < arguments.length - 2; i++) {
13577                  if (arguments[i] === undef) {
13578                    match[i] = undef;
13579                  }
13580                }
13581              });
13582            }
13583            if (match.length > 1 && match.index < str.length) {
13584              Array.prototype.push.apply(output, match.slice(1));
13585            }
13586            lastLength = match[0].length;
13587            lastLastIndex = lastIndex;
13588            if (output.length >= limit) {
13589              break;
13590            }
13591          }
13592          if (separator.lastIndex === match.index) {
13593            separator.lastIndex++;
13594          }
13595        }
13596        if (lastLastIndex === str.length) {
13597          if (lastLength || !separator.test("")) {
13598            output.push("");
13599          }
13600        } else {
13601          output.push(str.slice(lastLastIndex));
13602        }
13603        return output.length > limit ? output.slice(0, limit) : output;
13604      };
13605      String.prototype.split = function(separator, limit) {
13606        return self2(this, separator, limit);
13607      };
13608      return self2;
13609    })();
13610    $.fn.caret = function(pos) {
13611      var target = this[0];
13612      var isContentEditable = target.contentEditable === "true";
13613      if (arguments.length === 0) {
13614        if (window.getSelection) {
13615          if (isContentEditable) {
13616            if (!this.is(":focus")) {
13617              target.focus();
13618            }
13619            var range1 = window.getSelection().getRangeAt(0), range2 = range1.cloneRange();
13620            range2.selectNodeContents(target);
13621            range2.setEnd(range1.endContainer, range1.endOffset);
13622            return range2.toString().length;
13623          }
13624          return target.selectionStart;
13625        }
13626        if (document.selection) {
13627          target.focus();
13628          if (isContentEditable) {
13629            var range1 = document.selection.createRange(), range2 = document.body.createTextRange();
13630            range2.moveToElementText(target);
13631            range2.setEndPoint("EndToEnd", range1);
13632            return range2.text.length;
13633          }
13634          var pos = 0, range = target.createTextRange(), range2 = document.selection.createRange().duplicate(), bookmark = range2.getBookmark();
13635          range.moveToBookmark(bookmark);
13636          while (range.moveStart("character", -1) !== 0)
13637            pos++;
13638          return pos;
13639        }
13640        return 0;
13641      }
13642      if (pos === -1)
13643        pos = this[isContentEditable ? "text" : "val"]().length;
13644      if (window.getSelection) {
13645        if (isContentEditable) {
13646          if (!this.is(":focus")) {
13647            target.focus();
13648          }
13649          var selection = window.getSelection();
13650          selection.collapse(selection.focusNode, pos);
13651        } else
13652          target.setSelectionRange(pos, pos);
13653      } else if (document.body.createTextRange) {
13654        var range = document.body.createTextRange();
13655        range.moveToElementText(target);
13656        range.moveStart("character", pos);
13657        range.collapse(true);
13658        range.select();
13659      }
13660      if (!isContentEditable && !this.is(":focus")) {
13661        target.focus();
13662      }
13663      return pos;
13664    };
13665    function make_callback_plugin(options2) {
13666      var factory_settings = $.extend({
13667        init: $.noop,
13668        destroy: $.noop,
13669        name: "event"
13670      }, options2);
13671      return function(callback, options2) {
13672        var trigger = arguments.length === 0;
13673        var unbind = arguments[0] === "unbind";
13674        if (!trigger && !unbind && !is_function(callback)) {
13675          throw new Error("Invalid argument, it need to a function or string " + '"unbind" or no arguments.');
13676        }
13677        if (unbind) {
13678          callback = is_function(arguments[1]) ? arguments[1] : null;
13679        }
13680        var data_name = "callbacks_" + factory_settings.name;
13681        return this.each(function() {
13682          var $this = $(this);
13683          var callbacks;
13684          function handler(arg) {
13685            callbacks.fireWith($this, [arg]);
13686          }
13687          if (trigger || unbind) {
13688            callbacks = $this.data(data_name);
13689            if (trigger) {
13690              callbacks && callbacks.fire();
13691            } else {
13692              if (callback && callbacks) {
13693                callbacks.remove(callback);
13694                if (!callbacks.has()) {
13695                  callbacks = null;
13696                }
13697              } else {
13698                callbacks = null;
13699              }
13700              if (!callbacks) {
13701                $this.removeData(data_name);
13702                factory_settings.destroy.call(this, handler, options2);
13703              }
13704            }
13705          } else if ($this.data(data_name)) {
13706            $(this).data(data_name).add(callback);
13707          } else {
13708            callbacks = $.Callbacks();
13709            callbacks.add(callback);
13710            $this.data(data_name, callbacks);
13711            factory_settings.init.call(this, handler, options2);
13712          }
13713        });
13714      };
13715    }
13716    $.fn.resizer = make_callback_plugin({
13717      name: "resize",
13718      init: function(handler, options2) {
13719        var settings2 = $.extend({
13720          prefix: ""
13721        }, options2);
13722        var $this = $(this);
13723        var resizer;
13724        var first = true;
13725        if ($this.is("body")) {
13726          $(window).on("resize.resizer", handler);
13727        } else if (window.ResizeObserver) {
13728          resizer = new ResizeObserver(function() {
13729            if (!first) {
13730              setTimeout(handler, 0);
13731            }
13732            first = false;
13733          });
13734          resizer.observe(this);
13735          $this.data("observer", resizer);
13736        } else {
13737          var iframe = $("<iframe/>").addClass(settings2.prefix + "resizer").appendTo(this)[0];
13738          $(iframe.contentWindow).on("resize", handler);
13739        }
13740      },
13741      destroy: function() {
13742        var $this = $(this);
13743        if (window.ResizeObserver) {
13744          var observer = $this.data("observer");
13745          if (observer) {
13746            observer.unobserve(this);
13747            $this.removeData("observer");
13748          }
13749        } else {
13750          var iframe = $this.find('> iframe[class$="resizer"]');
13751          if (iframe.length) {
13752            $(iframe[0].contentWindow).off("resize").remove();
13753            iframe.remove();
13754          } else if ($this.is("body")) {
13755            $(window).off("resize.resizer");
13756          }
13757        }
13758      }
13759    });
13760    $.fn.touch_scroll = make_callback_plugin({
13761      name: "touch",
13762      init: function(handler) {
13763        var origin;
13764        var previous;
13765        $(this).on("touchstart.scroll", function(e) {
13766          e = e.originalEvent;
13767          if (e.target.tagName.toLowerCase() !== "a" && e.touches.length === 1) {
13768            previous = origin = e.touches[0];
13769          }
13770        }).on("touchmove.scroll", function(e) {
13771          e = e.originalEvent;
13772          if (origin && e.touches.length === 1) {
13773            var current = e.touches[0];
13774            var ret2 = handler({
13775              origin,
13776              previous,
13777              current
13778            });
13779            if (ret2 === false) {
13780              e.preventDefault();
13781            }
13782            previous = current;
13783          }
13784        }).on("touchend.scroll", function() {
13785          if (origin || previous) {
13786            origin = previous = null;
13787          }
13788        });
13789      },
13790      destroy: function() {
13791        $(this).off("touchstart.scroll touchmove.scroll touchend.scroll");
13792      }
13793    });
13794    $.fn.on_load = function(options2) {
13795      var settings2 = $.extend({
13796        error: $.noop,
13797        load: $.noop,
13798        done: $.noop
13799      }, options2);
13800      var defers = [];
13801      this.find("img,iframe").each(function() {
13802        var self2 = $(this);
13803        var defer = new $.Deferred;
13804        self2.on("load", defer.resolve).on("error", function() {
13805          settings2.error(self2);
13806          defer.reject();
13807        });
13808        defers.push(defer);
13809      });
13810      settings2.load(!!defers.length);
13811      if (defers.length) {
13812        $.when.apply($, defers).then(function() {
13813          settings2.done(true);
13814        });
13815      } else {
13816        settings2.done(false);
13817      }
13818      return this;
13819    };
13820    function jquery_resolve(value) {
13821      var defer = jQuery.Deferred();
13822      defer.resolve(value);
13823      return defer.promise();
13824    }
13825    function always(value, callback) {
13826      if (is_function(value.finally)) {
13827        return value.finally(callback);
13828      }
13829      if (is_function(value.always)) {
13830        return value.always(callback);
13831      }
13832      return value;
13833    }
13834    function unpromise(value, callback, error) {
13835      if (value !== undefined) {
13836        if (is_promise(value)) {
13837          if (is_function(value.done)) {
13838            value = value.done(callback);
13839          } else if (is_function(value.then)) {
13840            value = value.then(callback);
13841          }
13842          if (is_function(value.catch) && is_function(error)) {
13843            value.catch(error);
13844          }
13845          return value;
13846        } else if (value instanceof Array) {
13847          var promises = value.filter(function(value) {
13848            return value && (is_function(value.done) || is_function(value.then));
13849          });
13850          if (promises.length) {
13851            var result = $.when.apply($, value).then(function() {
13852              return callback([].slice.call(arguments));
13853            });
13854            if (is_function(result.catch)) {
13855              result = result.catch(error);
13856            }
13857            return result;
13858          }
13859        }
13860        try {
13861          return callback(value);
13862        } catch (e) {
13863          if (is_function(error)) {
13864            error(e);
13865          } else {
13866            throw e;
13867          }
13868        }
13869      }
13870    }
13871    function defined(value) {
13872      return value === undefined ? true : value;
13873    }
13874    $.fn.is_fully_in_viewport = function() {
13875      function is_visible(node, container) {
13876        var box = node.getBoundingClientRect();
13877        var viewport = container[0].getBoundingClientRect();
13878        var top = box.top - viewport.top;
13879        var bottom = box.bottom - viewport.top;
13880        var height = container.height();
13881        return bottom > 0 && top <= height;
13882      }
13883      if (root.IntersectionObserver) {
13884        return function(container) {
13885          var node = this[0];
13886          var defer = jQuery.Deferred();
13887          var item_observer = new root.IntersectionObserver(function(entries) {
13888            defer.resolve(entries[0].isIntersecting && entries[0].ratio === 1);
13889            item_observer.unobserve(node);
13890          }, {
13891            root: container[0]
13892          });
13893          item_observer.observe(node);
13894          return defer.promise();
13895        };
13896      } else {
13897        return function(container) {
13898          return jquery_resolve(is_visible(this[0], container));
13899        };
13900      }
13901    }();
13902    var entity_re = /(&(?:[a-z\d]+|#\d+|#x[a-f\d]+);)/i;
13903    var space_re = /\s/;
13904    var combine_chr_re = /(.(?:[\u0300-\u036F]|[\u1AB0-\u1abE]|[\u1DC0-\u1DF9]|[\u1DFB-\u1DFF]|[\u20D0-\u20F0]|[\uFE20-\uFE2F])+)/;
13905    var astral_symbols_re = /([\uD800-\uDBFF][\uDC00-\uDFFF])/;
13906    var emoji_re = /(\uD83C\uDFF4\uDB40\uDC67\uDB40\uDC62(?:\uDB40\uDC77\uDB40\uDC6C\uDB40\uDC73|\uDB40\uDC73\uDB40\uDC63\uDB40\uDC74|\uDB40\uDC65\uDB40\uDC6E\uDB40\uDC67)\uDB40\uDC7F|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC68(?:\uD83C\uDFFF\u200D(?:\uD83E\uDD1D\u200D\uD83D\uDC68(?:\uD83C[\uDFFB-\uDFFE])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFE\u200D(?:\uD83E\uDD1D\u200D\uD83D\uDC68(?:\uD83C[\uDFFB-\uDFFD\uDFFF])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFD\u200D(?:\uD83E\uDD1D\u200D\uD83D\uDC68(?:\uD83C[\uDFFB\uDFFC\uDFFE\uDFFF])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFC\u200D(?:\uD83E\uDD1D\u200D\uD83D\uDC68(?:\uD83C[\uDFFB\uDFFD-\uDFFF])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFB\u200D(?:\uD83E\uDD1D\u200D\uD83D\uDC68(?:\uD83C[\uDFFC-\uDFFF])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D)?\uD83D\uDC68|(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67]))|\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|(?:\uD83D[\uDC68\uDC69])\u200D(?:\uD83D[\uDC66\uDC67])|[\u2695\u2696\u2708]\uFE0F|\uD83D[\uDC66\uDC67]|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|(?:\uD83C\uDFFF\u200D[\u2695\u2696\u2708]|\uD83C\uDFFE\u200D[\u2695\u2696\u2708]|\uD83C\uDFFD\u200D[\u2695\u2696\u2708]|\uD83C\uDFFC\u200D[\u2695\u2696\u2708]|\uD83C\uDFFB\u200D[\u2695\u2696\u2708])\uFE0F|\uD83C[\uDFFB-\uDFFF])|\uD83E\uDDD1(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D(?:\uD83E\uDD1D\u200D\uD83E\uDDD1(?:\uD83C[\uDFFB-\uDFFF])|\uD83C[\uDF3E\uDF73\uDF7C\uDF84\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\u200D(?:\uD83E\uDD1D\u200D\uD83E\uDDD1|\uD83C[\uDF3E\uDF73\uDF7C\uDF84\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD]))|\uD83D\uDC69(?:\u200D(?:\u2764\uFE0F\u200D(?:\uD83D\uDC8B\u200D(?:\uD83D[\uDC68\uDC69])|\uD83D[\uDC68\uDC69])|\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFF\u200D(?:\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFE\u200D(?:\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFD\u200D(?:\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFC\u200D(?:\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD])|\uD83C\uDFFB\u200D(?:\uD83C[\uDF3E\uDF73\uDF7C\uDF93\uDFA4\uDFA8\uDFEB\uDFED]|\uD83D[\uDCBB\uDCBC\uDD27\uDD2C\uDE80\uDE92]|\uD83E[\uDDAF-\uDDB3\uDDBC\uDDBD]))|\uD83D\uDC69\uD83C\uDFFF\u200D\uD83E\uDD1D\u200D(?:\uD83D[\uDC68\uDC69])(?:\uD83C[\uDFFB-\uDFFE])|\uD83D\uDC69\uD83C\uDFFE\u200D\uD83E\uDD1D\u200D(?:\uD83D[\uDC68\uDC69])(?:\uD83C[\uDFFB-\uDFFD\uDFFF])|\uD83D\uDC69\uD83C\uDFFD\u200D\uD83E\uDD1D\u200D(?:\uD83D[\uDC68\uDC69])(?:\uD83C[\uDFFB\uDFFC\uDFFE\uDFFF])|\uD83D\uDC69\uD83C\uDFFC\u200D\uD83E\uDD1D\u200D(?:\uD83D[\uDC68\uDC69])(?:\uD83C[\uDFFB\uDFFD-\uDFFF])|\uD83D\uDC69\uD83C\uDFFB\u200D\uD83E\uDD1D\u200D(?:\uD83D[\uDC68\uDC69])(?:\uD83C[\uDFFC-\uDFFF])|\uD83D\uDC69\u200D\uD83D\uDC66\u200D\uD83D\uDC66|\uD83D\uDC69\u200D\uD83D\uDC69\u200D(?:\uD83D[\uDC66\uDC67])|(?:\uD83D\uDC41\uFE0F\u200D\uD83D\uDDE8|\uD83D\uDC69(?:\uD83C\uDFFF\u200D[\u2695\u2696\u2708]|\uD83C\uDFFE\u200D[\u2695\u2696\u2708]|\uD83C\uDFFD\u200D[\u2695\u2696\u2708]|\uD83C\uDFFC\u200D[\u2695\u2696\u2708]|\uD83C\uDFFB\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|\uD83C\uDFF3\uFE0F\u200D\u26A7|\uD83E\uDDD1(?:(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2695\u2696\u2708]|\u200D[\u2695\u2696\u2708])|\uD83D\uDC3B\u200D\u2744|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC70\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD35\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDCD-\uDDCF\uDDD6-\uDDDD])(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642]|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uFE0F\u200D[\u2640\u2642]|(?:\uD83C[\uDFFB-\uDFFF])\u200D[\u2640\u2642])|\uD83C\uDFF4\u200D\u2620|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E-\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD35\uDD37-\uDD39\uDD3C-\uDD3E\uDDB8\uDDB9\uDDCD-\uDDCF\uDDD6-\uDDDF])\u200D[\u2640\u2642])\uFE0F|\uD83D\uDC69\u200D\uD83D\uDC67\u200D(?:\uD83D[\uDC66\uDC67])|\uD83C\uDFF3\uFE0F\u200D\uD83C\uDF08|\uD83D\uDC69\u200D\uD83D\uDC67|\uD83D\uDC69\u200D\uD83D\uDC66|\uD83D\uDC15\u200D\uD83E\uDDBA|\uD83C\uDDFD\uD83C\uDDF0|\uD83C\uDDF6\uD83C\uDDE6|\uD83C\uDDF4\uD83C\uDDF2|\uD83D\uDC08\u200D\u2B1B|\uD83E\uDDD1(?:\uD83C[\uDFFB-\uDFFF])|\uD83D\uDC69(?:\uD83C[\uDFFB-\uDFFF])|\uD83C\uDDFF(?:\uD83C[\uDDE6\uDDF2\uDDFC])|\uD83C\uDDFE(?:\uD83C[\uDDEA\uDDF9])|\uD83C\uDDFC(?:\uD83C[\uDDEB\uDDF8])|\uD83C\uDDFB(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDEE\uDDF3\uDDFA])|\uD83C\uDDFA(?:\uD83C[\uDDE6\uDDEC\uDDF2\uDDF3\uDDF8\uDDFE\uDDFF])|\uD83C\uDDF9(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDED\uDDEF-\uDDF4\uDDF7\uDDF9\uDDFB\uDDFC\uDDFF])|\uD83C\uDDF8(?:\uD83C[\uDDE6-\uDDEA\uDDEC-\uDDF4\uDDF7-\uDDF9\uDDFB\uDDFD-\uDDFF])|\uD83C\uDDF7(?:\uD83C[\uDDEA\uDDF4\uDDF8\uDDFA\uDDFC])|\uD83C\uDDF5(?:\uD83C[\uDDE6\uDDEA-\uDDED\uDDF0-\uDDF3\uDDF7-\uDDF9\uDDFC\uDDFE])|\uD83C\uDDF3(?:\uD83C[\uDDE6\uDDE8\uDDEA-\uDDEC\uDDEE\uDDF1\uDDF4\uDDF5\uDDF7\uDDFA\uDDFF])|\uD83C\uDDF2(?:\uD83C[\uDDE6\uDDE8-\uDDED\uDDF0-\uDDFF])|\uD83C\uDDF1(?:\uD83C[\uDDE6-\uDDE8\uDDEE\uDDF0\uDDF7-\uDDFB\uDDFE])|\uD83C\uDDF0(?:\uD83C[\uDDEA\uDDEC-\uDDEE\uDDF2\uDDF3\uDDF5\uDDF7\uDDFC\uDDFE\uDDFF])|\uD83C\uDDEF(?:\uD83C[\uDDEA\uDDF2\uDDF4\uDDF5])|\uD83C\uDDEE(?:\uD83C[\uDDE8-\uDDEA\uDDF1-\uDDF4\uDDF6-\uDDF9])|\uD83C\uDDED(?:\uD83C[\uDDF0\uDDF2\uDDF3\uDDF7\uDDF9\uDDFA])|\uD83C\uDDEC(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEE\uDDF1-\uDDF3\uDDF5-\uDDFA\uDDFC\uDDFE])|\uD83C\uDDEB(?:\uD83C[\uDDEE-\uDDF0\uDDF2\uDDF4\uDDF7])|\uD83C\uDDEA(?:\uD83C[\uDDE6\uDDE8\uDDEA\uDDEC\uDDED\uDDF7-\uDDFA])|\uD83C\uDDE9(?:\uD83C[\uDDEA\uDDEC\uDDEF\uDDF0\uDDF2\uDDF4\uDDFF])|\uD83C\uDDE8(?:\uD83C[\uDDE6\uDDE8\uDDE9\uDDEB-\uDDEE\uDDF0-\uDDF5\uDDF7\uDDFA-\uDDFF])|\uD83C\uDDE7(?:\uD83C[\uDDE6\uDDE7\uDDE9-\uDDEF\uDDF1-\uDDF4\uDDF6-\uDDF9\uDDFB\uDDFC\uDDFE\uDDFF])|\uD83C\uDDE6(?:\uD83C[\uDDE8-\uDDEC\uDDEE\uDDF1\uDDF2\uDDF4\uDDF6-\uDDFA\uDDFC\uDDFD\uDDFF])|[#\*0-9]\uFE0F\u20E3|(?:\uD83C[\uDFC3\uDFC4\uDFCA]|\uD83D[\uDC6E\uDC70\uDC71\uDC73\uDC77\uDC81\uDC82\uDC86\uDC87\uDE45-\uDE47\uDE4B\uDE4D\uDE4E\uDEA3\uDEB4-\uDEB6]|\uD83E[\uDD26\uDD35\uDD37-\uDD39\uDD3D\uDD3E\uDDB8\uDDB9\uDDCD-\uDDCF\uDDD6-\uDDDD])(?:\uD83C[\uDFFB-\uDFFF])|(?:\u26F9|\uD83C[\uDFCB\uDFCC]|\uD83D\uDD75)(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u261D\u270A-\u270D]|\uD83C[\uDF85\uDFC2\uDFC7]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66\uDC67\uDC6B-\uDC6D\uDC72\uDC74-\uDC76\uDC78\uDC7C\uDC83\uDC85\uDCAA\uDD74\uDD7A\uDD90\uDD95\uDD96\uDE4C\uDE4F\uDEC0\uDECC]|\uD83E[\uDD0C\uDD0F\uDD18-\uDD1C\uDD1E\uDD1F\uDD30-\uDD34\uDD36\uDD77\uDDB5\uDDB6\uDDBB\uDDD2-\uDDD5])(?:\uD83C[\uDFFB-\uDFFF])|(?:[\u231A\u231B\u23E9-\u23EC\u23F0\u23F3\u25FD\u25FE\u2614\u2615\u2648-\u2653\u267F\u2693\u26A1\u26AA\u26AB\u26BD\u26BE\u26C4\u26C5\u26CE\u26D4\u26EA\u26F2\u26F3\u26F5\u26FA\u26FD\u2705\u270A\u270B\u2728\u274C\u274E\u2753-\u2755\u2757\u2795-\u2797\u27B0\u27BF\u2B1B\u2B1C\u2B50\u2B55]|\uD83C[\uDC04\uDCCF\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE1A\uDE2F\uDE32-\uDE36\uDE38-\uDE3A\uDE50\uDE51\uDF00-\uDF20\uDF2D-\uDF35\uDF37-\uDF7C\uDF7E-\uDF93\uDFA0-\uDFCA\uDFCF-\uDFD3\uDFE0-\uDFF0\uDFF4\uDFF8-\uDFFF]|\uD83D[\uDC00-\uDC3E\uDC40\uDC42-\uDCFC\uDCFF-\uDD3D\uDD4B-\uDD4E\uDD50-\uDD67\uDD7A\uDD95\uDD96\uDDA4\uDDFB-\uDE4F\uDE80-\uDEC5\uDECC\uDED0-\uDED2\uDED5-\uDED7\uDEEB\uDEEC\uDEF4-\uDEFC\uDFE0-\uDFEB]|\uD83E[\uDD0C-\uDD3A\uDD3C-\uDD45\uDD47-\uDD78\uDD7A-\uDDCB\uDDCD-\uDDFF\uDE70-\uDE74\uDE78-\uDE7A\uDE80-\uDE86\uDE90-\uDEA8\uDEB0-\uDEB6\uDEC0-\uDEC2\uDED0-\uDED6])|(?:[#\*0-9\xA9\xAE\u203C\u2049\u2122\u2139\u2194-\u2199\u21A9\u21AA\u231A\u231B\u2328\u23CF\u23E9-\u23F3\u23F8-\u23FA\u24C2\u25AA\u25AB\u25B6\u25C0\u25FB-\u25FE\u2600-\u2604\u260E\u2611\u2614\u2615\u2618\u261D\u2620\u2622\u2623\u2626\u262A\u262E\u262F\u2638-\u263A\u2640\u2642\u2648-\u2653\u265F\u2660\u2663\u2665\u2666\u2668\u267B\u267E\u267F\u2692-\u2697\u2699\u269B\u269C\u26A0\u26A1\u26A7\u26AA\u26AB\u26B0\u26B1\u26BD\u26BE\u26C4\u26C5\u26C8\u26CE\u26CF\u26D1\u26D3\u26D4\u26E9\u26EA\u26F0-\u26F5\u26F7-\u26FA\u26FD\u2702\u2705\u2708-\u270D\u270F\u2712\u2714\u2716\u271D\u2721\u2728\u2733\u2734\u2744\u2747\u274C\u274E\u2753-\u2755\u2757\u2763\u2764\u2795-\u2797\u27A1\u27B0\u27BF\u2934\u2935\u2B05-\u2B07\u2B1B\u2B1C\u2B50\u2B55\u3030\u303D\u3297\u3299]|\uD83C[\uDC04\uDCCF\uDD70\uDD71\uDD7E\uDD7F\uDD8E\uDD91-\uDD9A\uDDE6-\uDDFF\uDE01\uDE02\uDE1A\uDE2F\uDE32-\uDE3A\uDE50\uDE51\uDF00-\uDF21\uDF24-\uDF93\uDF96\uDF97\uDF99-\uDF9B\uDF9E-\uDFF0\uDFF3-\uDFF5\uDFF7-\uDFFF]|\uD83D[\uDC00-\uDCFD\uDCFF-\uDD3D\uDD49-\uDD4E\uDD50-\uDD67\uDD6F\uDD70\uDD73-\uDD7A\uDD87\uDD8A-\uDD8D\uDD90\uDD95\uDD96\uDDA4\uDDA5\uDDA8\uDDB1\uDDB2\uDDBC\uDDC2-\uDDC4\uDDD1-\uDDD3\uDDDC-\uDDDE\uDDE1\uDDE3\uDDE8\uDDEF\uDDF3\uDDFA-\uDE4F\uDE80-\uDEC5\uDECB-\uDED2\uDED5-\uDED7\uDEE0-\uDEE5\uDEE9\uDEEB\uDEEC\uDEF0\uDEF3-\uDEFC\uDFE0-\uDFEB]|\uD83E[\uDD0C-\uDD3A\uDD3C-\uDD45\uDD47-\uDD78\uDD7A-\uDDCB\uDDCD-\uDDFF\uDE70-\uDE74\uDE78-\uDE7A\uDE80-\uDE86\uDE90-\uDEA8\uDEB0-\uDEB6\uDEC0-\uDEC2\uDED0-\uDED6])\uFE0F?|(?:[\u261D\u26F9\u270A-\u270D]|\uD83C[\uDF85\uDFC2-\uDFC4\uDFC7\uDFCA-\uDFCC]|\uD83D[\uDC42\uDC43\uDC46-\uDC50\uDC66-\uDC78\uDC7C\uDC81-\uDC83\uDC85-\uDC87\uDC8F\uDC91\uDCAA\uDD74\uDD75\uDD7A\uDD90\uDD95\uDD96\uDE45-\uDE47\uDE4B-\uDE4F\uDEA3\uDEB4-\uDEB6\uDEC0\uDECC]|\uD83E[\uDD0C\uDD0F\uDD18-\uDD1F\uDD26\uDD30-\uDD39\uDD3C-\uDD3E\uDD77\uDDB5\uDDB6\uDDB8\uDDB9\uDDBB\uDDCD-\uDDCF\uDDD1-\uDDDD]))/;
13907    var mobile_re = /(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino|android|ipad|playbook|silk/i;
13908    var tablet_re = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas\-|your|zeto|zte\-/i;
13909    var format_split_re = /(\[\[(?:-?[@!gbiusor])*;[^;]*;[^\]]*\](?:[^\]\\]*(?:\\\\)*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?)/i;
13910    var format_parts_re = /\[\[((?:-?[@!gbiusor])*);([^;]*);([^;\]]*);?([^;\]]*);?([^\]]*)\]([^\]\\]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]+)\]?/gi;
13911    var format_re = /\[\[((?:-?[@!gbiusor])*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]?/gi;
13912    var format_exist_re = /\[\[((?:-?[@!gbiusor])*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\]([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)\]/gi;
13913    var format_full_re = /^(\[\[(?:(?:-?[@!gbiusor])*;[^;\]]*;[^;\]]*(?:;|[^\]()]*);?[^\]]*)\])([^\]]*\\\][^\]]*|[^\]]*|[^[]*\[[^\]]*)(\])$/i;
13914    var format_begin_re = /(\[\[(?:-?[@!gbiusor])*;[^;]*;[^\]]*\])/i;
13915    var format_start_re = /^(\[\[(?:-?[@!gbiusor])*;[^;]*;[^\]]*\])/i;
13916    var format_end_re = /\[\[(?:-?[@!gbiusor])*;[^;]*;[^\]]*\]?$/i;
13917    var self_closing_re = /^(?:\[\[)?[^;]*@[^;]*;/;
13918    var color_re = /^(?:#([0-9a-f]{3}|[0-9a-f]{4}|[0-9a-f]{6}|[0-9a-f]{8})|rgba?\([^)]+\)|hsla?\([^)]+\))$/i;
13919    var url_re = /(\b(?:file|ftp|https?|blog:https?):\/\/(?:[^/\s]+\.[^/\s.]+)(?:\/[^\s]*)?(?:#[^\s]*)?)/gi;
13920    var url_nf_re = /\b(?![^"\s[\]]*])(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'\\<>\][)])+)/gi;
13921    var email_re = /((([^<>('")[\]\\.,;:\s@]+(\.[^<>()[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))/g;
13922    var url_full_re = /^(https?:\/\/(?:(?:(?!&[^;]+;)|(?=&amp;))[^\s"'<>\\\][)])+)$/gi;
13923    var email_full_re = /^((([^<>('")[\]\\.,;:\s@]+(\.[^<>()[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,})))$/g;
13924    var command_re = /((?:"[^"\\]*(?:\\[\S\s][^"\\]*)*"|'[^'\\]*(?:\\[\S\s][^'\\]*)*'|`[^`\\]*(?:\\[\S\s][^`\\]*)*`|\/[^\/\\]*(?:\\[\S\s][^\/\\]*)*\/[gimsuy]*(?=\s|$)|(?:\\\s|\S))+)(?=\s|$)/gi;
13925    var extended_command_re = /^\s*((terminal|cmd)::([a-z_]+)\(([\s\S]*)\))\s*$/;
13926    var format_exec_split_re = /(\[\[(?:-?[@!gbiusor])*;[^\]]+\](?:\\[[\]]|[^\]])*\]|\[\[[\s\S]+?\]\])/;
13927    var format_exec_re = /(\[\[[\s\S]+?\]\])/;
13928    var float_re = /^[-+]?[0-9]*\.?[0-9]+([eE][-+]?[0-9]+)?$/;
13929    var re_re = /^\/((?:\\\/|[^/]|\[[^\]]*\/[^\]]*\])+)\/([gimsuy]*)$/;
13930    var string_re = /("(?:[^"\\]|\\(?:\\\\)*"|\\\\)*"|'(?:[^'\\]|\\(?:\\\\)*'|\\\\)*'|`(?:[^`\\]|\\(?:\\\\)*`|\\\\)*`)/;
13931    var unclosed_strings_re = /^(?=((?:[^"']+|"[^"\\]*(?:\\[^][^"\\]*)*"|'[^'\\]*(?:\\[^][^'\\]*)*')*))\1./;
13932    var broken_image = '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 16 14"><title id="title2">rounded</title><path id="terminal-broken-image" d="m 14,10 h 2 v 1 a 3,3 0 0 1 -3,3 H 3 A 3,3 0 0 1 0,11 H 4.5 A 1.00012,1.00012 0 0 0 5.207,10.707 L 6.5,9.414 7.793,10.707 a 0.99963,0.99963 0 0 0 1.41406,0 l 2.36719,-2.36719 1.80127,1.44092 A 0.99807,0.99807 0 0 0 14,10 Z M 16,3 V 8 H 14.35059 L 12.12451,6.21924 A 0.99846,0.99846 0 0 0 10.793,6.293 L 8.5,8.586 7.207,7.293 a 0.99962,0.99962 0 0 0 -1.41406,0 L 4.08594,9 H 0 V 3 A 3,3 0 0 1 3,0 h 10 a 3,3 0 0 1 3,3 z M 6,4.5 A 1.5,1.5 0 1 0 4.5,6 1.5,1.5 0 0 0 6,4.5 Z" /></svg>';
13933    var use_broken_image = '<svg class="terminal-broken-image" role="presentation" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 16 14" xmlns:xlink="http://www.w3.org/1999/xlink"><use xlink:href="#terminal-broken-image"/></svg>';
13934    var animation_supported = function() {
13935      if (typeof document === "undefined") {
13936        return false;
13937      }
13938      var animation = false, domPrefixes = "Webkit Moz O ms Khtml".split(" "), elm = document.createElement("div");
13939      if (elm.style.animationName) {
13940        animation = true;
13941      }
13942      if (animation === false) {
13943        for (var i = 0;i < domPrefixes.length; i++) {
13944          var name = domPrefixes[i] + "AnimationName";
13945          if (elm.style[name] !== undefined) {
13946            animation = true;
13947            break;
13948          }
13949        }
13950      }
13951      elm = null;
13952      return animation;
13953    }();
13954    var agent = (root.navigator || window.navigator).userAgent;
13955    var is_IE = /MSIE|Trident/.test(agent) || /rv:11.0/i.test(agent);
13956    var is_IEMobile = /IEMobile/.test(agent);
13957    var is_ch_unit_supported = function() {
13958      if (is_IE && !is_IEMobile) {
13959        return false;
13960      }
13961      if (typeof document === "undefined") {
13962        return true;
13963      }
13964      var div = document.createElement("div");
13965      div.style.width = "1ch";
13966      return div.style.width === "1ch";
13967    }();
13968    var is_css_variables_supported = root.CSS && root.CSS.supports && root.CSS.supports("(--fake-var: 0)");
13969    var is_android = navigator.userAgent.toLowerCase().indexOf("android") !== -1;
13970    var is_key_native = function is_key_native2() {
13971      if (!(("KeyboardEvent" in root) && ("key" in root.KeyboardEvent.prototype))) {
13972        return false;
13973      }
13974      var proto = root.KeyboardEvent.prototype;
13975      var get = Object.getOwnPropertyDescriptor(proto, "key").get;
13976      return !!get.toString().match(/\[native code\]/);
13977    }();
13978    var is_browser = function() {
13979      try {
13980        return this === window;
13981      } catch (e) {
13982        return false;
13983      }
13984    }();
13985    var is_mobile = function(a) {
13986      var check = false;
13987      if (mobile_re.test(a) || tablet_re.test(a.substr(0, 4))) {
13988        check = true;
13989      }
13990      if (navigator.platform === "MacIntel" && navigator.maxTouchPoints > 1) {
13991        return true;
13992      }
13993      return check;
13994    }(navigator.userAgent || navigator.vendor || root.opera);
13995    var ch_unit_bug = false;
13996    if (is_browser) {
13997      $(function() {
13998        function width(e) {
13999          return e[0].getBoundingClientRect().width;
14000        }
14001        var base = '<span style="font-family: monospace;visibility:hidden;';
14002        var ch = $(base + 'width:1ch;overflow: hidden">&nbsp;</span>');
14003        ch.appendTo("body");
14004        var space = $(base + '">&nbsp;</span>').appendTo("body");
14005        ch_unit_bug = Math.abs(width(ch) - width(space)) > 0.0001;
14006        ch.remove();
14007        space.remove();
14008      });
14009    }
14010    function css(node, obj2, value) {
14011      if (node instanceof $.fn.init) {
14012        node.each(function() {
14013          css(this, obj2, value);
14014        });
14015      } else if ($.isPlainObject(obj2)) {
14016        Object.keys(obj2).forEach(function(key) {
14017          node.style.setProperty(key, obj2[key]);
14018        });
14019      } else if (typeof value === "undefined") {
14020        return node.style.getPropertyValue(obj2);
14021      } else {
14022        node.style.setProperty(obj2, value);
14023      }
14024    }
14025    function style_prop(name, value, important) {
14026      var props = [
14027        name + ":" + value + "px",
14028        name + ":" + "calc(" + value + "px / var(--pixel-density, 1))"
14029      ];
14030      if (important) {
14031        props = props.map(function(prop) {
14032          return prop + " !important";
14033        });
14034      }
14035      return props.join(";");
14036    }
14037    function a11y_hide(element) {
14038      element.attr({
14039        role: "presentation",
14040        "aria-hidden": "true"
14041      });
14042    }
14043    var excepctions = [];
14044    function alert_exception(label, e) {
14045      if (arguments[0] instanceof $.terminal.Exception) {
14046        label = arguments[0].type;
14047        e = arguments[0];
14048      }
14049      var message = (label ? label + ": " : "") + exception_message(e);
14050      if (excepctions.indexOf(message) === -1) {
14051        excepctions.push(message);
14052        setTimeout(function() {
14053          throw e;
14054        }, 0);
14055      }
14056    }
14057    function generate_id() {
14058      var firstPart = Math.random() * 46656 | 0;
14059      var secondPart = Math.random() * 46656 | 0;
14060      firstPart = ("000" + firstPart.toString(36)).slice(-3);
14061      secondPart = ("000" + secondPart.toString(36)).slice(-3);
14062      return firstPart + secondPart;
14063    }
14064    function remove(array, callback) {
14065      for (var index in array) {
14066        if (callback(array[index], index)) {
14067          array.splice(index, 1);
14068        }
14069      }
14070    }
14071    function scrollbar_event(e, node, pixel_density) {
14072      pixel_density = pixel_density || 1;
14073      var left = node.offset().left;
14074      var max_width = node.outerWidth() * pixel_density;
14075      return max_width <= e.clientX - left;
14076    }
14077    function exception_message(e) {
14078      if (typeof e === "string") {
14079        return e;
14080      } else if (typeof e.fileName === "string") {
14081        return e.fileName + ": " + e.message;
14082      } else {
14083        return e.message;
14084      }
14085    }
14086    function Cycle() {
14087      var data = [].slice.call(arguments);
14088      var pos = 0;
14089      $.extend(this, {
14090        get: function() {
14091          return data;
14092        },
14093        index: function() {
14094          return pos;
14095        },
14096        rotate: function(skip, init) {
14097          if (init === undefined) {
14098            init = pos;
14099          } else if (init === pos) {
14100            return;
14101          }
14102          if (!skip) {
14103            var defined2 = data.filter(function(item) {
14104              return typeof item !== "undefined";
14105            });
14106            if (!defined2.length) {
14107              return;
14108            }
14109          }
14110          if (!data.length) {
14111            return;
14112          }
14113          if (data.length === 1) {
14114            return data[0];
14115          } else {
14116            if (pos === data.length - 1) {
14117              pos = 0;
14118            } else {
14119              ++pos;
14120            }
14121            if (typeof data[pos] !== "undefined") {
14122              return data[pos];
14123            } else {
14124              return this.rotate(true, init);
14125            }
14126          }
14127        },
14128        length: function() {
14129          return data.length;
14130        },
14131        remove: function(index) {
14132          delete data[index];
14133        },
14134        active: function(item) {
14135          for (var i = data.length;i--; ) {
14136            if (data[i] === item) {
14137              pos = i;
14138              return;
14139            }
14140          }
14141          this.append(item);
14142          pos = data.length - 1;
14143        },
14144        front: function() {
14145          if (data.length) {
14146            var index = pos;
14147            var restart = false;
14148            while (!data[index]) {
14149              index++;
14150              if (index > data.length) {
14151                if (restart) {
14152                  break;
14153                }
14154                index = 0;
14155                restart = true;
14156              }
14157            }
14158            return data[index];
14159          }
14160        },
14161        map: function(fn2) {
14162          return data.map(function(item, i) {
14163            if (typeof item !== "undefined") {
14164              return fn2(item, i);
14165            }
14166            return null;
14167          }).filter(Boolean);
14168        },
14169        forEach: function(fn2) {
14170          return data.forEach(function(item, i) {
14171            if (typeof item !== "undefined") {
14172              fn2(item, i);
14173            }
14174          });
14175        },
14176        set: function(index, value) {
14177          if (!data[index]) {
14178            data[index] = value;
14179            return true;
14180          }
14181          return false;
14182        },
14183        append: function(item) {
14184          data.push(item);
14185        }
14186      });
14187    }
14188    function Stack(init) {
14189      var data = is_array(init) ? init : init ? [init] : [];
14190      $.extend(this, {
14191        data: function() {
14192          return data;
14193        },
14194        map: function(fn2) {
14195          return $.map(data, fn2);
14196        },
14197        size: function() {
14198          return data.length;
14199        },
14200        pop: function() {
14201          if (data.length === 0) {
14202            return null;
14203          } else {
14204            var value = data[data.length - 1];
14205            data = data.slice(0, data.length - 1);
14206            return value;
14207          }
14208        },
14209        push: function(value) {
14210          data = data.concat([value]);
14211          return value;
14212        },
14213        top: function() {
14214          return data.length > 0 ? data[data.length - 1] : null;
14215        },
14216        clone: function() {
14217          return new Stack(data.slice(0));
14218        }
14219      });
14220    }
14221    function WorkerCache(options2) {
14222      var settings2 = $.extend({
14223        validation: $.noop,
14224        action: $.noop,
14225        onCache: $.noop
14226      }, options2);
14227      this._onCache = settings2.onCache.bind(this);
14228      this._action = settings2.action.bind(this);
14229      this._validation = settings2.validation.bind(this);
14230      if ("Map" in root) {
14231        this._cache = new Map;
14232      }
14233    }
14234    WorkerCache.prototype.validate = function(key) {
14235      var valid = this._validation(key);
14236      var test = valid === undefined || valid === true;
14237      if (!test) {
14238        this._cache.clear();
14239      }
14240      return test;
14241    };
14242    WorkerCache.prototype.clear = function() {
14243      this._cache.clear();
14244    };
14245    WorkerCache.prototype.get = function(key) {
14246      if (!this._cache) {
14247        return this._action(key);
14248      }
14249      var value;
14250      if (this.validate(key) && this._cache.has(key)) {
14251        value = this._cache.get(key);
14252        this._onCache({ cache: value });
14253        return value;
14254      }
14255      value = this._action(key);
14256      this._cache.set(key, value);
14257      return value;
14258    };
14259    function History(name, size, memory) {
14260      var enabled = true;
14261      var storage_key = "";
14262      if (typeof name === "string" && name !== "") {
14263        storage_key = name + "_";
14264      }
14265      storage_key += "commands";
14266      var data;
14267      if (memory) {
14268        data = [];
14269      } else {
14270        data = $.Storage.get(storage_key);
14271        data = data ? JSON.parse(data) : [];
14272      }
14273      var pos = data.length - 1;
14274      $.extend(this, {
14275        append: function(item) {
14276          if (enabled) {
14277            if (data[data.length - 1] !== item) {
14278              data.push(item);
14279              if (size && data.length > size) {
14280                data = data.slice(-size);
14281              }
14282              pos = data.length - 1;
14283              if (!memory) {
14284                $.Storage.set(storage_key, JSON.stringify(data));
14285              }
14286            }
14287          }
14288        },
14289        set: function(new_data) {
14290          if (is_array(new_data)) {
14291            data = new_data;
14292            if (!memory) {
14293              $.Storage.set(storage_key, JSON.stringify(data));
14294            }
14295          }
14296        },
14297        data: function() {
14298          return data;
14299        },
14300        reset: function() {
14301          pos = data.length - 1;
14302        },
14303        last: function() {
14304          return data[data.length - 1];
14305        },
14306        end: function() {
14307          return pos === data.length - 1;
14308        },
14309        position: function() {
14310          return pos;
14311        },
14312        current: function() {
14313          return data[pos];
14314        },
14315        next: function() {
14316          var old = pos;
14317          if (pos < data.length - 1) {
14318            ++pos;
14319          }
14320          if (old !== pos) {
14321            return data[pos];
14322          }
14323        },
14324        previous: function() {
14325          var old = pos;
14326          if (pos > 0) {
14327            --pos;
14328          }
14329          if (old !== pos) {
14330            return data[pos];
14331          }
14332        },
14333        clear: function() {
14334          data = [];
14335          this.purge();
14336        },
14337        enabled: function() {
14338          return enabled;
14339        },
14340        enable: function() {
14341          enabled = true;
14342        },
14343        purge: function() {
14344          if (!memory) {
14345            $.Storage.remove(storage_key);
14346          }
14347        },
14348        disable: function() {
14349          enabled = false;
14350        },
14351        toggle: function(value) {
14352          if (typeof value === "undefined") {
14353            enabled = !enabled;
14354          } else {
14355            enabled = value;
14356          }
14357        }
14358      });
14359    }
14360    function OutputLines(settings2) {
14361      this._settings = settings2;
14362      this._lines = [];
14363      this._snapshot = [];
14364    }
14365    OutputLines.prototype.make_snapshot = function(snapshot) {
14366      this._snapshot.push(snapshot);
14367    };
14368    OutputLines.prototype.get_partial = function() {
14369      if (!this._snapshot.length) {
14370        return [];
14371      }
14372      var last = this._snapshot[this._snapshot.length - 1];
14373      return last;
14374    };
14375    OutputLines.prototype.update_snapshot = function(index, snapshot) {
14376      this._snapshot[index] = snapshot;
14377    };
14378    OutputLines.prototype.limit_snapshot = function(limit) {
14379      this._snapshot = this._snapshot.slice(limit);
14380    };
14381    OutputLines.prototype.clear_snapshot = function() {
14382      this._snapshot = [];
14383    };
14384    OutputLines.prototype.get_snapshot = function() {
14385      return this._snapshot.reduce(function(acc, arr) {
14386        if (!arr) {
14387          return acc;
14388        }
14389        return acc.concat(arr);
14390      }, []).join(`
14391`);
14392    };
14393    OutputLines.prototype.join = function() {
14394      var args2 = [].slice.call(arguments);
14395      if (args2.some(is_function)) {
14396        return function() {
14397          return args2.reduce(function(acc, arg) {
14398            if (is_function(acc)) {
14399              acc = acc();
14400            }
14401            if (is_function(arg)) {
14402              arg = arg();
14403            }
14404            if (is_promise(acc) || is_promise(arg)) {
14405              return $.when(acc, arg).then(function(acc, arg) {
14406                return acc + arg;
14407              });
14408            }
14409            return arg;
14410          });
14411        };
14412      } else if (args2.some(is_promise)) {
14413        return args2.reduce(function(acc, arg) {
14414          return $.when(acc, arg).then(function(acc, arg) {
14415            return acc + arg;
14416          });
14417        });
14418      }
14419      return args2.join("");
14420    };
14421    OutputLines.prototype.import = function(data) {
14422      this._lines = data;
14423    };
14424    OutputLines.prototype.push = function(data) {
14425      var value = data[0];
14426      var options2 = data[1];
14427      if (this.has_newline()) {
14428        this._lines.push(data);
14429      } else {
14430        var last_line = this.last_line();
14431        last_line[0] = this.join(last_line[0], value);
14432        last_line[1].newline = options2.newline;
14433      }
14434    };
14435    OutputLines.prototype.clear = function(fn2) {
14436      this._lines.forEach(function(line, i) {
14437        var options2 = line[1];
14438        if (is_function(options2.onClear)) {
14439          options2.onClear.call(self, fn2(i));
14440        }
14441      });
14442      this._lines = [];
14443      this._snapshot = [];
14444    };
14445    OutputLines.prototype.data = function() {
14446      return this._lines.filter(Boolean);
14447    };
14448    OutputLines.prototype.has_newline = function() {
14449      var line = this.last_line();
14450      if (!line) {
14451        return true;
14452      }
14453      return line[1].newline;
14454    };
14455    OutputLines.prototype.unmount = function(node) {
14456      var index = node.data("index");
14457      var line = this._lines[index];
14458      if (line) {
14459        var options2 = line[1];
14460        if (is_function(options2.unmount)) {
14461          options2.unmount.call(self, node);
14462        }
14463      }
14464    };
14465    OutputLines.prototype.last_line = function() {
14466      var lines = this.data();
14467      var len = lines.length;
14468      return lines[len - 1];
14469    };
14470    OutputLines.prototype.update = function(index, value, options2) {
14471      if (value === null) {
14472        delete this._lines[index];
14473        delete this._snapshot[index];
14474      } else {
14475        this._lines[index][0] = value;
14476        if (options2) {
14477          this._lines[index][1] = $.extend(this._lines[index][1], options2);
14478        }
14479        return this._lines[index][1];
14480      }
14481    };
14482    OutputLines.prototype.length = function() {
14483      return this._lines.length;
14484    };
14485    OutputLines.prototype.valid_index = function(index) {
14486      return !!this._lines[index];
14487    };
14488    OutputLines.prototype.render = function(cols, fn2) {
14489      var settings2 = this._settings();
14490      var lines_to_show = [];
14491      this._snapshot = [];
14492      if (settings2.outputLimit >= 0) {
14493        var limit;
14494        if (settings2.outputLimit === 0) {
14495          limit = cols;
14496        } else {
14497          limit = settings2.outputLimit;
14498        }
14499        this._lines.forEach(function(line, index) {
14500          var value = line[0];
14501          var options2 = line[1];
14502          lines_to_show.push({
14503            value,
14504            index,
14505            options: options2
14506          });
14507        });
14508        var pivot = lines_to_show.length - limit - 1;
14509        lines_to_show = lines_to_show.slice(pivot);
14510      } else {
14511        lines_to_show = this._lines.map(function(line, index) {
14512          return {
14513            value: line[0],
14514            index,
14515            options: line[1]
14516          };
14517        });
14518      }
14519      return fn2(lines_to_show);
14520    };
14521    function FormatBuffer(options2) {
14522      this._options = options2;
14523      if ("Map" in root) {
14524        this._format_cache = new Map;
14525      }
14526      this._output_buffer = [];
14527    }
14528    FormatBuffer.NEW_LINE = 1;
14529    FormatBuffer.prototype.format = function format(arg, newline, raw) {
14530      var use_cache = this._format_cache && this._settings.useCache;
14531      if (use_cache) {
14532        var args2 = JSON.stringify([arg, this._settings]);
14533        if (this._format_cache.has(args2)) {
14534          return this._format_cache.get(args2);
14535        }
14536      }
14537      var data = {
14538        line: $.terminal.format(arg, this._settings),
14539        raw,
14540        newline
14541      };
14542      if (use_cache) {
14543        this._format_cache.set(args2, data);
14544      }
14545      return data;
14546    };
14547    FormatBuffer.prototype.empty = function() {
14548      return !this._output_buffer.length;
14549    };
14550    FormatBuffer.prototype.append = function(arg, index, options2, raw) {
14551      this._settings = $.extend({
14552        useCache: true
14553      }, this._options(options2));
14554      this._output_buffer.push(FormatBuffer.NEW_LINE);
14555      if (arg instanceof Array) {
14556        for (var i = 0, len = arg.length;i < len; ++i) {
14557          if (arg[i] === "" || arg[i] === "\r") {
14558            this._output_buffer.push({ line: "", raw: "" });
14559          } else {
14560            var formatted = this.format(arg[i], i === len - 1, raw[i]);
14561            this._output_buffer.push(formatted);
14562          }
14563        }
14564      } else if (options2.raw) {
14565        this._output_buffer.push({ line: arg, raw });
14566      } else {
14567        this._output_buffer.push(this.format(arg, false, raw));
14568      }
14569      this._output_buffer.push({
14570        finalize: options2.finalize,
14571        index,
14572        raw: options2.raw,
14573        newline: options2.newline
14574      });
14575    };
14576    FormatBuffer.prototype.clear_cache = function() {
14577      if (this._format_cache) {
14578        this._format_cache.clear();
14579      }
14580    };
14581    FormatBuffer.prototype.output = function() {
14582      return this._output_buffer.slice();
14583    };
14584    FormatBuffer.prototype.is_empty = function() {
14585      return !this._output_buffer.length;
14586    };
14587    FormatBuffer.prototype.clear = function() {
14588      this._output_buffer = [];
14589    };
14590    FormatBuffer.prototype.sort = function() {
14591      var chunk = [];
14592      var chunks = [];
14593      for (var i = 0;i < this._output_buffer.length; i++) {
14594        var item = this._output_buffer[i];
14595        chunk.push(item);
14596        if (item !== FormatBuffer.NEW_LINE && "index" in item) {
14597          chunks.push(chunk);
14598          chunk = [];
14599        }
14600      }
14601      if (chunks.length === 1) {
14602        return;
14603      }
14604      chunks.sort(function(a, b) {
14605        return a[2].index - b[2].index;
14606      });
14607      this._output_buffer = [];
14608      chunks.forEach(function(chunk) {
14609        this._output_buffer = this._output_buffer.concat(chunk);
14610      }, this);
14611    };
14612    FormatBuffer.prototype.forEach = function(fn2) {
14613      var i = 0;
14614      while (i < this._output_buffer.length) {
14615        var data = this._output_buffer[i++];
14616        if (data === FormatBuffer.NEW_LINE) {
14617          fn2();
14618        } else {
14619          fn2(data);
14620        }
14621      }
14622    };
14623    FormatBuffer.prototype.flush = function(render) {
14624      this.forEach(render);
14625      this.clear();
14626    };
14627    function with_prompt(prompt, set, context) {
14628      function error(e) {
14629        var prompt = $.terminal.escape_brackets("[ERR]> ");
14630        set("[[;red;]" + prompt + "]");
14631        alert_exception("Prompt", e);
14632      }
14633      function done(prompt) {
14634        set(prompt);
14635        deferred2.resolve();
14636      }
14637      var deferred2 = new $.Deferred;
14638      switch (typeof prompt) {
14639        case "string":
14640          done(prompt);
14641          break;
14642        case "function":
14643          try {
14644            var ret2 = prompt.call(context, function(string2) {
14645              done(string2);
14646            });
14647            if (typeof ret2 === "string") {
14648              done(ret2);
14649            }
14650            if (ret2 && ret2.then) {
14651              ret2.then(done).catch(error);
14652            }
14653          } catch (e) {
14654            error(e);
14655          }
14656          break;
14657      }
14658      return deferred2.promise();
14659    }
14660    var cmd_index = 0;
14661    $.cmd = {
14662      defaults: {
14663        mask: false,
14664        caseSensitiveSearch: true,
14665        historySize: 60,
14666        prompt: "> ",
14667        enabled: true,
14668        history: true,
14669        onPositionChange: $.noop,
14670        onCommandChange: $.noop,
14671        inputStyle: "textarea",
14672        mobileDelete: is_mobile,
14673        onPaste: $.noop,
14674        clickTimeout: 200,
14675        holdTimeout: 400,
14676        holdRepeatTimeout: 200,
14677        mobileIgnoreAutoSpace: [",", ".", ")"],
14678        repeatTimeoutKeys: [],
14679        tabindex: 1,
14680        tabs: 4
14681      }
14682    };
14683    $.fn.cmd = function(options2) {
14684      var settings2 = $.extend({}, $.cmd.defaults, options2);
14685      function mobile_ignore_key(key) {
14686        return settings2.mobileIgnoreAutoSpace.length && settings2.mobileIgnoreAutoSpace.indexOf(key) !== -1 && is_android;
14687      }
14688      var self2 = this;
14689      var maybe_data = self2.data("cmd");
14690      if (maybe_data) {
14691        return maybe_data;
14692      }
14693      var id = cmd_index++;
14694      self2.addClass("cmd");
14695      var wrapper = $('<div class="cmd-wrapper"/>').appendTo(self2);
14696      wrapper.append('<span class="cmd-prompt"></span>');
14697      wrapper.append('<div class="cmd-cursor-line">' + "<span></span>" + '<span class="cmd-cursor">' + '<span data-text class="end"><span>&nbsp;</span></span>' + "</span>" + "<span></span>" + "</div>");
14698      var cursor_line = wrapper.find(".cmd-cursor-line");
14699      a11y_hide(cursor_line);
14700      var clip;
14701      if (is_mobile) {
14702        clip = function() {
14703          var $node = $('<div class="cmd-editable" contenteditable/>').attr({
14704            autocapitalize: "off",
14705            autocorrect: "off",
14706            autocomplete: "new-password",
14707            spellcheck: "false",
14708            tabindex: settings2.tabindex
14709          }).insertAfter(self2);
14710          $node.on("focus", function() {
14711            self2.enable();
14712          }).on("blur", function() {
14713            self2.disable();
14714          });
14715          var timer;
14716          var clip = {
14717            $node,
14718            val: function(value) {
14719              if (typeof value === "undefined") {
14720                return $node.text();
14721              } else {
14722                $node.html(value);
14723              }
14724            },
14725            reset: function() {
14726              clearTimeout(timer);
14727              timer = setTimeout(function() {
14728                $node.css({
14729                  top: "",
14730                  bottom: ""
14731                });
14732              }, 100);
14733            },
14734            focus: function() {
14735              css($node[0], {
14736                top: "calc(var(--terminal-scroll, 0) * 1px)"
14737              });
14738              clip.reset();
14739            },
14740            blur: function() {
14741              $node.css({
14742                top: "100%",
14743                bottom: 0
14744              }).blur();
14745              window.getSelection().removeAllRanges();
14746              clip.reset();
14747            }
14748          };
14749          return clip;
14750        }();
14751        self2.addClass("cmd-mobile");
14752      } else {
14753        clip = function() {
14754          var id = generate_id();
14755          var $node = $("<textarea>").attr({
14756            autocapitalize: "off",
14757            spellcheck: "false",
14758            id,
14759            tabindex: settings2.tabindex
14760          }).addClass("cmd-clipboard").appendTo(self2);
14761          $node.before('<label class="visually-hidden" for="' + id + '">' + "Clipboard textarea for jQuery Terminal</label>");
14762          return {
14763            $node,
14764            val: function(value) {
14765              if (typeof value === "undefined") {
14766                return $node.val();
14767              } else {
14768                return $node.val(value);
14769              }
14770            }
14771          };
14772        }();
14773        clip.val(" ");
14774      }
14775      if (settings2.width) {
14776        self2.width(settings2.width);
14777      }
14778      var num_chars;
14779      var char_width;
14780      var last_rendered_prompt;
14781      var prompt_last_line;
14782      var just_prompt_len;
14783      var prompt_offset = 0;
14784      var prompt_len;
14785      var prompt_node = self2.find(".cmd-prompt");
14786      var reverse_search = false;
14787      var rev_search_str = "";
14788      var reverse_search_position = null;
14789      var backup_prompt;
14790      var command = "";
14791      var last_command;
14792      var kill_text = "";
14793      var position = 0;
14794      var prompt;
14795      var enabled;
14796      var formatted_position = 0;
14797      var name, history2;
14798      var cursor = self2.find(".cmd-cursor");
14799      var animation;
14800      var restart_animation;
14801      var paste_count = 0;
14802      var line_marker = "ï¿¿";
14803      var line_marker_re = /\uFFFF$/;
14804      var empty_marker_re = /^\uFFFF$/;
14805      function get_char_pos(e) {
14806        var node = $(e.target);
14807        if (node.is("span,img,a")) {
14808          node = node.closest("[data-text]");
14809          return node.index() + node.parent("span").prevAll().find("[data-text]").length + node.closest('[role="presentation"]').prevUntil(".cmd-prompt").find("[data-text]").length;
14810        } else if (node.is('div[role="presentation"]')) {
14811          var last = !node.next().length;
14812          return node.find("[data-text]").length + node.prevUntil(".cmd-prompt").find("[data-text]").length - (last ? 0 : 1);
14813        }
14814      }
14815      var key_mapping = {
14816        SPACEBAR: " ",
14817        UP: "ArrowUP",
14818        DOWN: "ArrowDown",
14819        LEFT: "ArrowLeft",
14820        RIGHT: "ArrowRight",
14821        DEL: "Delete",
14822        MULTIPLY: "*",
14823        DIVIDE: "/",
14824        SUBTRACT: "-",
14825        ADD: "+"
14826      };
14827      function ie_key_fix(e) {
14828        var key = e.key.toUpperCase();
14829        if (key_mapping[key]) {
14830          return key_mapping[key];
14831        }
14832        return key;
14833      }
14834      function get_key(e) {
14835        if (e.key) {
14836          var key = ie_key_fix(e).toUpperCase();
14837          if (key === "CONTROL") {
14838            return "CTRL";
14839          } else {
14840            var combo = [];
14841            if (e.ctrlKey) {
14842              combo.push("CTRL");
14843            }
14844            if (e.metaKey && key !== "META") {
14845              combo.push("META");
14846            }
14847            if (e.shiftKey && key !== "SHIFT") {
14848              combo.push("SHIFT");
14849            }
14850            if (e.altKey && key !== "ALT") {
14851              combo.push("ALT");
14852            }
14853            if (combo.length && key === " ") {
14854              key = "SPACEBAR";
14855            }
14856            if (e.key) {
14857              combo.push(key);
14858            }
14859            return combo.join("+");
14860          }
14861        }
14862      }
14863      var keycodes = {
14864        3: "Cancel",
14865        6: "Help",
14866        8: "Backspace",
14867        9: "Tab",
14868        12: "Clear",
14869        13: "Enter",
14870        16: "Shift",
14871        17: "Control",
14872        18: "Alt",
14873        19: "Pause",
14874        20: "CapsLock",
14875        27: "Escape",
14876        28: "Convert",
14877        29: "NonConvert",
14878        30: "Accept",
14879        31: "ModeChange",
14880        32: " ",
14881        33: "PageUp",
14882        34: "PageDown",
14883        35: "End",
14884        36: "Home",
14885        37: "ArrowLeft",
14886        38: "ArrowUp",
14887        39: "ArrowRight",
14888        40: "ArrowDown",
14889        41: "Select",
14890        42: "Print",
14891        43: "Execute",
14892        44: "PrintScreen",
14893        45: "Insert",
14894        46: "Delete",
14895        48: ["0", ")"],
14896        49: ["1", "!"],
14897        50: ["2", "@"],
14898        51: ["3", "#"],
14899        52: ["4", "$"],
14900        53: ["5", "%"],
14901        54: ["6", "^"],
14902        55: ["7", "&"],
14903        56: ["8", "*"],
14904        57: ["9", "("],
14905        91: "OS",
14906        93: "ContextMenu",
14907        144: "NumLock",
14908        145: "ScrollLock",
14909        181: "VolumeMute",
14910        182: "VolumeDown",
14911        183: "VolumeUp",
14912        186: [";", ":"],
14913        187: ["=", "+"],
14914        188: [",", "<"],
14915        189: ["-", "_"],
14916        190: [".", ">"],
14917        191: ["/", "?"],
14918        192: ["`", "~"],
14919        219: ["[", "{"],
14920        220: ["\\", "|"],
14921        221: ["]", "}"],
14922        222: ["'", '"'],
14923        224: "Meta",
14924        225: "AltGraph",
14925        246: "Attn",
14926        247: "CrSel",
14927        248: "ExSel",
14928        249: "EraseEof",
14929        250: "Play",
14930        251: "ZoomOut"
14931      };
14932      var i;
14933      for (i = 1;i < 25; i++) {
14934        keycodes[111 + i] = "F" + i;
14935      }
14936      var letter = "";
14937      for (i = 65;i < 91; i++) {
14938        letter = String.fromCharCode(i);
14939        keycodes[i] = [letter.toLowerCase(), letter.toUpperCase()];
14940      }
14941      var reversed_keycodes = {};
14942      Object.keys(keycodes).forEach(function(which) {
14943        if (is_array(keycodes[which])) {
14944          keycodes[which].forEach(function(key) {
14945            reversed_keycodes[key.toUpperCase()] = which;
14946          });
14947        } else {
14948          reversed_keycodes[keycodes[which].toUpperCase()] = which;
14949        }
14950      });
14951      var keymap;
14952      var default_keymap = {
14953        "ALT+D": delete_forward({ clipboard: true }),
14954        "HOLD+ALT+D": delete_forward({ clipboard: true, hold: true }),
14955        "HOLD+DELETE": delete_forward({ clipboard: false, hold: true }),
14956        "HOLD+SHIFT+DELETE": delete_forward({ clipboard: false, hold: true }),
14957        ENTER: function() {
14958          if (history2 && command && !settings2.mask && (is_function(settings2.historyFilter) && settings2.historyFilter(command) || settings2.historyFilter instanceof RegExp && command.match(settings2.historyFilter) || !settings2.historyFilter)) {
14959            history2.append(command);
14960          }
14961          var tmp = command;
14962          if (!is_mobile) {
14963            clip.$node.blur();
14964          }
14965          history2.reset();
14966          self2.set("");
14967          clip.val("");
14968          prev_command = "";
14969          no_keydown = true;
14970          var promise;
14971          if (settings2.commands) {
14972            promise = settings2.commands.call(self2, tmp);
14973          }
14974          if (is_function(prompt)) {
14975            if (promise && is_function(promise.then)) {
14976              promise.then(function() {
14977                draw_prompt();
14978              });
14979            } else {
14980              draw_prompt();
14981            }
14982          }
14983          if (!is_mobile) {
14984            clip.$node.focus();
14985          }
14986          return false;
14987        },
14988        "SHIFT+ENTER": function() {
14989          self2.insert(`
14990`);
14991          return true;
14992        },
14993        BACKSPACE: backspace_key,
14994        "SHIFT+BACKSPACE": backspace_key,
14995        TAB: function() {
14996          self2.insert("\t");
14997        },
14998        "CTRL+D": function() {
14999          self2["delete"](1);
15000          return false;
15001        },
15002        DELETE: function() {
15003          self2["delete"](1);
15004          return true;
15005        },
15006        "HOLD+ARROWUP": up_arrow,
15007        ARROWUP: up_arrow,
15008        "CTRL+ARROWUP": prev_history,
15009        "CTRL+P": prev_history,
15010        ARROWDOWN: down_arrow,
15011        "HOLD+ARROWDOWN": down_arrow,
15012        "CTRL+N": next_history,
15013        "CTRL+ARROWDOWN": next_history,
15014        ARROWLEFT: left,
15015        "HOLD+ARROWLEFT": debounce(left, 10),
15016        "CTRL+B": left,
15017        "CTRL+ARROWLEFT": function() {
15018          var len = position - 1;
15019          var pos = 0;
15020          if (command[len] === " ") {
15021            --len;
15022          }
15023          for (var i = len;i > 0; --i) {
15024            if (command[i] === " " && command[i + 1] !== " ") {
15025              pos = i + 1;
15026              break;
15027            } else if (command[i] === `
15028` && command[i + 1] !== `
15029`) {
15030              pos = i;
15031              break;
15032            }
15033          }
15034          self2.position(pos);
15035        },
15036        "CTRL+R": function() {
15037          if (reverse_search) {
15038            reverse_history_search(true);
15039          } else {
15040            backup_prompt = prompt;
15041            draw_reverse_prompt();
15042            last_command = command;
15043            self2.set("");
15044            redraw();
15045            reverse_search = true;
15046          }
15047          return false;
15048        },
15049        "CTRL+G": function() {
15050          if (reverse_search) {
15051            prompt = backup_prompt;
15052            draw_prompt();
15053            self2.set(last_command);
15054            redraw();
15055            reverse_search = false;
15056            rev_search_str = "";
15057            return false;
15058          }
15059        },
15060        ARROWRIGHT: right,
15061        "HOLD+ARROWRIGHT": debounce(right, 10),
15062        "CTRL+F": right,
15063        "CTRL+ARROWRIGHT": function() {
15064          if (command[position] === " ") {
15065            ++position;
15066          }
15067          var re = /\S[\n\s]{2,}|[\n\s]+\S?/;
15068          var match = command.slice(position).match(re);
15069          if (!match || match[0].match(/^\s+$/)) {
15070            self2.position(bare_text(command).length);
15071          } else if (match[0][0] !== " ") {
15072            position += match.index + 1;
15073          } else {
15074            position += match.index + match[0].length - 1;
15075            if (match[0][match[0].length - 1] !== " ") {
15076              --position;
15077            }
15078          }
15079          redraw();
15080        },
15081        F12: return_true,
15082        END: end(true),
15083        "CTRL+END": end(),
15084        "CTRL+E": end(),
15085        HOME: home(true),
15086        "CTRL+HOME": home(),
15087        "CTRL+A": home(),
15088        "SHIFT+INSERT": paste_event,
15089        "CTRL+SHIFT+T": return_true,
15090        "CTRL+W": delete_backward({ clipboard: true, hold: false }),
15091        "CTRL+BACKSPACE": delete_backward({ clipboard: true, hold: false }),
15092        "HOLD+BACKSPACE": delete_backward({ clipboard: false, hold: true }),
15093        "HOLD+SHIFT+BACKSPACE": delete_backward({ clipboard: false, hold: true }),
15094        "CTRL+H": function() {
15095          if (command !== "" && position > 0) {
15096            self2["delete"](-1);
15097          }
15098          return false;
15099        },
15100        "CTRL+X": return_true,
15101        "CTRL+C": function() {
15102          return get_selected_html() === "";
15103        },
15104        "CTRL+T": return_true,
15105        "CTRL+Y": function() {
15106          if (kill_text !== "") {
15107            self2.insert(kill_text);
15108          }
15109        },
15110        "CTRL+V": paste_event,
15111        "META+V": paste_event,
15112        "CTRL+K": function() {
15113          var len = text(command).length;
15114          if (len > position) {
15115            kill_text = self2["delete"](len - position);
15116            text_to_clipboard(clip.$node, kill_text);
15117          }
15118          return false;
15119        },
15120        "CTRL+U": function() {
15121          if (command !== "" && position !== 0) {
15122            kill_text = self2["delete"](-position);
15123            text_to_clipboard(clip.$node, kill_text);
15124          }
15125          return false;
15126        },
15127        "CTRL+TAB": function() {
15128          return false;
15129        },
15130        "META+`": return_true,
15131        "META+R": return_true,
15132        "META+L": return_true
15133      };
15134      function delete_forward(options2) {
15135        options2 = options2 || {};
15136        if (options2.hold && !settings2.mobileDelete) {
15137          return function delete_character_forward() {
15138            self2["delete"](1);
15139            return false;
15140          };
15141        }
15142        return function delete_word_forward() {
15143          var re = / *[^ ]+ *(?= )|[^ ]+$/;
15144          var substring = command.slice(position);
15145          var m2 = substring.match(re);
15146          if (m2) {
15147            kill_text = m2[0];
15148            if (options2.clipboard) {
15149              text_to_clipboard(clip.$node, kill_text);
15150            }
15151          }
15152          self2.set(command.slice(0, position) + command.slice(position).replace(re, ""), true);
15153          return false;
15154        };
15155      }
15156      function delete_backward(options2) {
15157        options2 = options2 || {};
15158        if (options2.hold && !settings2.mobileDelete) {
15159          return function delete_character_backward() {
15160            self2["delete"](-1);
15161          };
15162        }
15163        return function delete_word_backward() {
15164          if (command !== "" && position !== 0) {
15165            var m2 = command.slice(0, position).match(/([^ ]* *$)/);
15166            if (m2[0].length) {
15167              kill_text = self2["delete"](-m2[0].length);
15168              if (options2.clipboard) {
15169                text_to_clipboard(clip.$node, kill_text);
15170              }
15171            }
15172          }
15173          return false;
15174        };
15175      }
15176      function return_true() {
15177        return true;
15178      }
15179      function paste_event() {
15180        clip.val("");
15181        paste_count = 0;
15182        if (self2.isenabled() && !clip.$node.is(":focus")) {
15183          clip.$node.trigger("focus", [true]);
15184        }
15185        clip.$node.one("input", paste);
15186        return true;
15187      }
15188      function paste() {
15189        if (paste_count++ > 0) {
15190          return;
15191        }
15192        function set() {
15193          clip.val(command);
15194          fix_editable();
15195        }
15196        function insert(text2) {
15197          self2.insert(text2);
15198          set();
15199        }
15200        if (self2.isenabled()) {
15201          self2.oneTime(100, function() {
15202            var value = clip.val().replace(/\r/g, "");
15203            if (is_function(settings2.onPaste)) {
15204              var ret2 = settings2.onPaste.call(self2, {
15205                target: self2,
15206                text: value
15207              });
15208              if (ret2 !== undefined) {
15209                if (ret2 && is_function(ret2.then || ret2.done)) {
15210                  (ret2.then || ret2.done).call(ret2, insert);
15211                } else if (typeof ret2 === "string") {
15212                  insert(ret2);
15213                } else if (ret2 === false) {
15214                  set();
15215                }
15216                return;
15217              }
15218            }
15219            insert(value);
15220          });
15221        }
15222      }
15223      function prev_history() {
15224        if (first_up_history) {
15225          last_command = command;
15226          self2.set(history2.current());
15227        } else {
15228          self2.set(history2.previous());
15229        }
15230        first_up_history = false;
15231        return false;
15232      }
15233      function next_history() {
15234        if (history2.end()) {
15235          first_up_history = true;
15236          self2.set(last_command);
15237        } else {
15238          self2.set(history2.next());
15239        }
15240        return false;
15241      }
15242      function have_newlines(string2) {
15243        return string2.match(/\n/);
15244      }
15245      function have_wrapping(string2, prompt_len) {
15246        var lengths = string2.split(`
15247`).map(function(line) {
15248          return $.terminal.length(line);
15249        });
15250        if (prompt_len) {
15251          lengths[0] += prompt_len;
15252        }
15253        var wrap = lengths.filter(function(len) {
15254          return len >= num_chars;
15255        });
15256        return !!wrap.length;
15257      }
15258      function simple_split_command_line(formatted) {
15259        var prompt = last_rendered_prompt;
15260        var lines = $.terminal.split_equal(prompt + formatted, num_chars);
15261        var re = new RegExp("^" + $.terminal.escape_regex(prompt));
15262        lines = lines.map($.terminal.unescape_brackets);
15263        lines[0] = lines[0].replace(re, "");
15264        return lines;
15265      }
15266      function up_arrow() {
15267        var before = $.terminal.substring(command, 0, position);
15268        var col = self2.column();
15269        var cursor_line = self2.find(".cmd-cursor-line");
15270        var line = cursor_line.prevUntil("span").length;
15271        if (line === 1 && col <= prompt_len) {
15272          self2.position(0);
15273          return false;
15274        }
15275        if (line === 0) {
15276          return prev_history();
15277        }
15278        if (have_newlines(before) || have_wrapping(before, prompt_len)) {
15279          var prev = cursor_line.prev();
15280          var is_splitted = prev.is(".cmd-end-line");
15281          var lines = simple_split_command_line(command);
15282          prev = lines[line - 1];
15283          var left_over = lines[line].substring(col).length;
15284          var diff;
15285          if (left_over > 0) {
15286            diff = col;
15287            if (line - 1 === 0) {
15288              diff -= prompt_len;
15289            }
15290            diff = col + prev.substring(diff).length;
15291            if (is_splitted) {
15292              ++diff;
15293            }
15294          } else {
15295            diff = col + 1;
15296          }
15297          self2.position(-diff, true);
15298          return false;
15299        } else {
15300          return prev_history();
15301        }
15302      }
15303      function down_arrow() {
15304        var after = $.terminal.substring(command, position);
15305        if (have_newlines(after) || have_wrapping(after)) {
15306          var lines = simple_split_command_line(command);
15307          var col = self2.column();
15308          var cursor_line = self2.find(".cmd-cursor-line");
15309          var $line = cursor_line.prevUntil("span");
15310          var line = $line.length;
15311          var is_ending = cursor_line.is(".cmd-end-line");
15312          var is_next_broken = cursor_line.next().is(".cmd-end-line");
15313          var next = lines[line + 1];
15314          if (!next) {
15315            return next_history();
15316          }
15317          var left_over = lines[line].substring(col).length;
15318          var diff;
15319          if (left_over === 0) {
15320            diff = next.length;
15321            if (is_next_broken) {
15322              diff++;
15323            }
15324          } else {
15325            diff = Math.min(col, next.length) + left_over;
15326            if (line === 0) {
15327              diff += prompt_len;
15328            }
15329            if (is_ending) {
15330              diff += 1;
15331            }
15332          }
15333          self2.position(diff, true);
15334          return false;
15335        } else {
15336          return next_history();
15337        }
15338      }
15339      function backspace_key() {
15340        if (reverse_search) {
15341          rev_search_str = rev_search_str.slice(0, -1);
15342          draw_reverse_prompt();
15343        } else if (command !== "" && position > 0) {
15344          self2["delete"](-1);
15345        }
15346        self2.oneTime(1, function() {
15347          no_keydown = true;
15348        });
15349      }
15350      function left() {
15351        if (position > 0) {
15352          self2.position(-1, true);
15353        }
15354      }
15355      function right() {
15356        if (position < bare_text(command).length) {
15357          self2.position(1, true);
15358        }
15359        return false;
15360      }
15361      function home(line) {
15362        function home() {
15363          self2.position(0);
15364        }
15365        if (line) {
15366          return function() {
15367            if (command.match(/\n/)) {
15368              var string2 = command.substring(0, self2.position());
15369              self2.position(string2.lastIndexOf(`
15370`) + 1);
15371            } else {
15372              home();
15373            }
15374          };
15375        } else {
15376          return home;
15377        }
15378      }
15379      function end(line) {
15380        function end() {
15381          self2.position(text(command).length);
15382        }
15383        if (line) {
15384          return function() {
15385            if (command.match(/\n/)) {
15386              var lines = command.split(`
15387`);
15388              var pos = self2.position();
15389              var sum = 0;
15390              for (var i = 0;i < lines.length; ++i) {
15391                sum += lines[i].length;
15392                if (sum > pos) {
15393                  self2.position(sum + i);
15394                  return;
15395                }
15396              }
15397            }
15398            end();
15399          };
15400        } else {
15401          return end;
15402        }
15403      }
15404      function mobile_focus() {
15405        var $clip = clip.$node;
15406        var focus = $clip.is(":focus");
15407        if (enabled) {
15408          if (!focus) {}
15409          self2.oneTime(10, function() {
15410            if (!$clip.is(":focus") && enabled) {
15411              $clip.trigger("focus", [true]);
15412            }
15413          });
15414        } else if (focus && !enabled) {
15415          $clip.trigger("blur", [true]);
15416        }
15417      }
15418      function fix_cursor() {
15419        if (animation_supported) {
15420          var style = window.getComputedStyle(cursor[0]);
15421          var animationName = style.getPropertyValue("--animation");
15422          animationName = animationName.replace(/^\s*|\s*$/g, "");
15423          var _class = self2.attr("class");
15424          if (_class.match(/-animation/)) {
15425            _class = _class.replace(/[a-z]+-animation/g, "");
15426          }
15427          if (animationName && !animationName.match(/blink/)) {
15428            var className = animationName.replace(/terminal-/, "") + "-animation";
15429            if (!_class.match(className)) {
15430              _class += " " + className;
15431            }
15432          }
15433          _class = _class.replace(/\s+/g, " ");
15434          if (_class !== self2.attr("class").replace(/\s+/g, " ")) {
15435            self2.attr("class", _class);
15436          }
15437        }
15438      }
15439      function fix_editable(position_only) {
15440        if (!self2.isenabled()) {
15441          return;
15442        }
15443        self2.oneTime(10, function() {
15444          if (!is_mobile && clip.val() !== command && !position_only) {
15445            clip.val(" " + command);
15446          }
15447          if (enabled) {
15448            self2.oneTime(10, function() {
15449              try {
15450                var pos = !is_mobile ? position + 1 : position;
15451                if (clip.$node.caret() !== pos) {
15452                  clip.$node.caret(pos);
15453                }
15454              } catch (e) {}
15455            });
15456          }
15457        });
15458      }
15459      if (animation_supported && !is_android) {
15460        animation = function(toggle) {
15461          if (toggle) {
15462            cursor.addClass("cmd-blink");
15463          } else {
15464            cursor.removeClass("cmd-blink");
15465          }
15466        };
15467        restart_animation = function() {
15468          var new_cursor = cursor.clone();
15469          new_cursor.insertBefore(cursor);
15470          cursor.remove();
15471          cursor = new_cursor;
15472        };
15473      } else {
15474        var animating = false;
15475        animation = function(toggle) {
15476          if (toggle && !animating) {
15477            animating = true;
15478            cursor.addClass("cmd-inverted cmd-blink");
15479            self2.everyTime(500, "blink", blink);
15480          } else if (animating && !toggle) {
15481            animating = false;
15482            self2.stopTime("blink", blink);
15483            cursor.removeClass("cmd-inverted cmd-blink");
15484          }
15485        };
15486        restart_animation = function() {
15487          animation(false);
15488          animation(true);
15489        };
15490      }
15491      function blink() {
15492        cursor.toggleClass("cmd-inverted");
15493      }
15494      function draw_reverse_prompt() {
15495        prompt = "(reverse-i-search)`" + rev_search_str + "': ";
15496        draw_prompt();
15497      }
15498      function clear_reverse_state() {
15499        prompt = backup_prompt;
15500        reverse_search = false;
15501        reverse_search_position = null;
15502        rev_search_str = "";
15503      }
15504      function reverse_history_search(next) {
15505        var history_data = history2.data();
15506        var regex, save_string;
15507        var len = history_data.length;
15508        if (next && reverse_search_position > 0) {
15509          len -= reverse_search_position;
15510        }
15511        if (rev_search_str.length > 0) {
15512          for (var j = rev_search_str.length;j > 0; j--) {
15513            save_string = $.terminal.escape_regex(rev_search_str.slice(0, j));
15514            if (settings2.caseSensitiveSearch) {
15515              regex = new RegExp(save_string);
15516            } else {
15517              regex = new RegExp(save_string, "i");
15518            }
15519            for (var i = len;i--; ) {
15520              if (regex.test(history_data[i])) {
15521                reverse_search_position = history_data.length - i;
15522                self2.position(history_data[i].indexOf(save_string));
15523                self2.set(history_data[i], true);
15524                redraw();
15525                if (rev_search_str.length !== j) {
15526                  rev_search_str = rev_search_str.slice(0, j);
15527                  draw_reverse_prompt();
15528                }
15529                return;
15530              }
15531            }
15532          }
15533        }
15534        rev_search_str = "";
15535      }
15536      function fix_brave_prompt(html) {
15537        var attr_re = /data-text="([^"]*[<>][^"]*)"/g;
15538        if (html.match(attr_re)) {
15539          return html.replace(attr_re, function(_, group) {
15540            return 'data-text="' + escape(group) + '"';
15541          });
15542        }
15543        return html;
15544      }
15545      function get_char_width() {
15546        var $prompt = self2.find(".cmd-prompt");
15547        var html = $prompt.html();
15548        $prompt.html("<span>&nbsp;</span>");
15549        var width = $prompt.find("span").get(0).getBoundingClientRect().width;
15550        $prompt.html(fix_brave_prompt(html));
15551        return width;
15552      }
15553      function get_num_chars2(char_width) {
15554        var width = self2.width();
15555        return Math.floor(width / char_width);
15556      }
15557      function process_cmd_line(string2) {
15558        function split(string2) {
15559          return $.terminal.split_equal(string2, num_chars);
15560        }
15561        function skip_empty(array) {
15562          var result = [];
15563          array.forEach(function(line, i) {
15564            if ($.terminal.strip(line).match(empty_marker_re)) {
15565              result[i] = false;
15566              if (i > 0) {
15567                result[i - 1] += line_marker;
15568              }
15569            } else {
15570              result[i] = array[i];
15571            }
15572          });
15573          return result.filter(function(line) {
15574            return line !== false;
15575          });
15576        }
15577        var line = prompt_node.find(".cmd-line");
15578        var prompt;
15579        if (line.length) {
15580          prompt = line.nextUntil(".cmd-line").text();
15581        } else {
15582          prompt = prompt_node.text();
15583        }
15584        prompt = prompt.replace("â", "");
15585        prompt = $.terminal.escape_brackets(prompt);
15586        var prompt_marker = get_prompt_marker();
15587        var re = new RegExp("^" + prompt_marker + $.terminal.escape_regex(prompt));
15588        var array;
15589        if (string2.match(/\n/)) {
15590          var tmp = string2.split(`
15591`);
15592          var first_len = num_chars - prompt_len - 1;
15593          for (var i = 0;i < tmp.length - 1; ++i) {
15594            tmp[i] += line_marker;
15595          }
15596          if (strlen(tmp[0]) > first_len) {
15597            array = split(prompt + tmp[0]);
15598            array[0] = array[0].replace(re, "");
15599            array = skip_empty(array);
15600          } else {
15601            array = [tmp[0]];
15602          }
15603          for (i = 1;i < tmp.length; ++i) {
15604            if (strlen(tmp[i]) > num_chars) {
15605              var splitted = split(tmp[i]);
15606              if (i < tmp.length - 1) {
15607                splitted = skip_empty(splitted);
15608              }
15609              array = array.concat(splitted);
15610            } else {
15611              array.push(tmp[i]);
15612            }
15613          }
15614        } else {
15615          array = split(prompt_marker + prompt + string2);
15616          array[0] = array[0].replace(re, "");
15617        }
15618        if (array.length > 1) {
15619          var len = $.terminal.length(array[array.length - 1]);
15620          if (len === num_chars) {
15621            array.push("");
15622          }
15623        }
15624        return array;
15625      }
15626      var cmd_line_worker = new WorkerCache({
15627        validation: function(key) {
15628          var result = false;
15629          if ((!this._previous_value || this._previous_value === key) && (!this._cols || this._cols === num_chars)) {
15630            result = true;
15631          }
15632          this._previous_value = key;
15633          this._cols = num_chars;
15634          return result;
15635        },
15636        action: process_cmd_line
15637      });
15638      function split_command_line(string2) {
15639        return cmd_line_worker.get(string2);
15640      }
15641      function formatting(string2, skip_formatted_position) {
15642        try {
15643          string2 = $.terminal.escape_formatting(string2);
15644          var format_options = $.extend({}, settings2, {
15645            unixFormattingEscapeBrackets: true,
15646            position,
15647            command: true
15648          });
15649          var formatted = $.terminal.apply_formatters(string2, format_options);
15650          var output = $.terminal.normalize(formatted[0]);
15651          var max = $.terminal.length(output);
15652          if (!skip_formatted_position) {
15653            formatted_position = formatted[1];
15654            if (formatted_position > max) {
15655              formatted_position = max;
15656            }
15657          }
15658          return output;
15659        } catch (e) {
15660          alert_exception("[Formatting]", e.stack);
15661          return string2;
15662        }
15663      }
15664      function format(string2, before) {
15665        var encoded = $.terminal.encode(wrap(string2), {
15666          tabs: settings2.tabs,
15667          before
15668        });
15669        return $.terminal.format(encoded, {
15670          charWidth: settings2.charWidth,
15671          allowedAttributes: settings2.allowedAttributes || []
15672        });
15673      }
15674      function wrap(string2) {
15675        return $.terminal.partition(string2).join("");
15676      }
15677      function length(str, raw) {
15678        return $.terminal.length(str, raw);
15679      }
15680      function is_multiline(str) {
15681        var len = strlen(text(str));
15682        return len > 0 && len > num_chars - prompt_len - 1 || str.match(/\n/);
15683      }
15684      function substring(str, start, end) {
15685        return $.terminal.substring(str, start, end);
15686      }
15687      function is_emoji_formatting(str) {
15688        if ($.terminal.is_formatting(str)) {
15689          return str.replace(format_parts_re, "$4").match(/^emoji /);
15690        }
15691        return false;
15692      }
15693      var redraw = function() {
15694        var before = cursor.prev();
15695        var after = cursor.next();
15696        var cursor_line = cursor.parent();
15697        function draw_cursor_line(string2, options2) {
15698          var end_line = string2.match(line_marker_re);
15699          if (end_line) {
15700            string2 = string2.replace(line_marker_re, " ");
15701          }
15702          cursor_line.toggleClass("cmd-end-line", !!end_line);
15703          var cursor_end_line = false;
15704          var settings2 = $.extend({
15705            prompt: "",
15706            last: false
15707          }, options2);
15708          var position = settings2.position;
15709          var len = length(string2);
15710          var prompt = settings2.prompt;
15711          var c;
15712          if (position === len) {
15713            before.html(format(string2));
15714            c = "&nbsp;";
15715            empty_cursor();
15716            after.html("");
15717          } else if (position === 0) {
15718            before.html("");
15719            c = substring(string2, 0, 1);
15720            cursor.html(format(c));
15721            after.html(format(substring(string2, 1), prompt + c));
15722          } else {
15723            var before_str = $.terminal.substring(string2, 0, position);
15724            before.html(format(before_str, prompt));
15725            c = substring(string2, position, position + 1);
15726            var c_before = (prompt + before_str).replace(/^.*\t/, "");
15727            cursor.html(format(c, c_before));
15728            if (position === len - 1) {
15729              cursor_end_line = true;
15730              after.html("");
15731            } else {
15732              if (c.match(/\t/)) {
15733                c_before = "";
15734              } else {
15735                c_before += c;
15736              }
15737              after.html(format(substring(string2, position + 1), c_before));
15738            }
15739          }
15740          if (ch_unit_bug) {
15741            if (typeof wcwidth !== "undefined") {
15742              var size = strlen(text(c));
15743              if (size === 1 && is_emoji_formatting(c)) {
15744                size = 2;
15745              }
15746              cursor.width(char_width * size);
15747            } else {
15748              cursor.width(char_width);
15749            }
15750          }
15751          cursor.toggleClass("cmd-end-line", cursor_end_line);
15752          fix_cursor();
15753          var cursor_len = $.terminal.length(cursor.text());
15754          if (cursor_len > 1) {
15755            var node = cursor.find("[data-text]")[0];
15756            node.style.setProperty("--length", cursor_len);
15757          }
15758          restart_animation();
15759        }
15760        function div(string2, before) {
15761          var end_line = string2.match(line_marker_re);
15762          var result = '<div role="presentation" aria-hidden="true"';
15763          if (end_line) {
15764            string2 = string2.replace(line_marker_re, " ");
15765            result += ' class="cmd-end-line"';
15766          }
15767          result += ">" + format(string2, before || "") + "</div>";
15768          return result;
15769        }
15770        function empty_cursor() {
15771          cursor.html('<span data-text class="end"><span>&nbsp;<span></span>');
15772        }
15773        function lines_after(lines) {
15774          var last_ins = cursor_line;
15775          $.each(lines, function(i, line) {
15776            last_ins = $(div(line)).insertAfter(last_ins);
15777          });
15778        }
15779        function lines_before(lines) {
15780          $.each(lines, function(i, line) {
15781            cursor_line.before(div(line, i === 0 ? prompt_last_line : ""));
15782          });
15783        }
15784        return function() {
15785          var string2;
15786          switch (typeof settings2.mask) {
15787            case "boolean":
15788              string2 = settings2.mask ? command.replace(/./g, "*") : command;
15789              break;
15790            case "string":
15791              string2 = command.replace(/./g, settings2.mask);
15792              break;
15793          }
15794          var formatted = formatting(string2);
15795          var pos;
15796          if (length(formatted) === text(string2).length) {
15797            pos = position;
15798          } else {
15799            pos = formatted_position;
15800          }
15801          var i;
15802          wrapper.css({
15803            display: "none"
15804          });
15805          wrapper.find("div:not(.cmd-cursor-line)").remove();
15806          before.html("");
15807          if (is_multiline(formatted)) {
15808            var tabs = formatted.match(/\t/g);
15809            var original_string = formatted;
15810            if (tabs) {
15811              formatted = formatted.replace(/\t/g, "\x00\x00\x00\x00");
15812            }
15813            var array = split_command_line(formatted);
15814            if (tabs) {
15815              array = $.map(array, function(line) {
15816                return line.replace(/\x00\x00\x00\x00/g, "\t");
15817              });
15818            }
15819            var first_len = length(array[0]);
15820            if (first_len === 0 && array.length === 1) {} else if (pos < first_len) {
15821              draw_cursor_line(array[0], {
15822                length: array.length,
15823                position: pos,
15824                prompt: prompt_last_line
15825              });
15826              lines_after(array.slice(1));
15827            } else if (pos === first_len) {
15828              cursor_line.before(div(array[0], prompt_last_line));
15829              draw_cursor_line(array[1] || "", {
15830                length: array.length,
15831                position: 0,
15832                last: array.length <= 2
15833              });
15834              if (array.length > 2) {
15835                lines_after(array.slice(2));
15836              }
15837            } else {
15838              var last = array.slice(-1)[0];
15839              var len = length(original_string);
15840              var from_last = len - pos;
15841              var last_len = length(last);
15842              var new_pos = 0;
15843              if (from_last === -1) {
15844                from_last = 0;
15845              }
15846              if (from_last <= last_len) {
15847                lines_before(array.slice(0, -1));
15848                if (last_len === from_last) {
15849                  new_pos = 0;
15850                } else {
15851                  new_pos = last_len - from_last;
15852                }
15853                draw_cursor_line(last, {
15854                  length: array.length,
15855                  position: new_pos,
15856                  last: true
15857                });
15858              } else {
15859                var line_index;
15860                var current;
15861                new_pos = pos;
15862                for (i = 0;i < array.length; ++i) {
15863                  var current_len = $.terminal.length(array[i]);
15864                  if (new_pos > current_len) {
15865                    new_pos -= current_len;
15866                  } else {
15867                    break;
15868                  }
15869                }
15870                current = array[i];
15871                line_index = i;
15872                if (new_pos === length(current)) {
15873                  new_pos = 0;
15874                  current = array[++line_index];
15875                  if (current === undefined) {
15876                    var msg = $.terminal.defaults.strings.redrawError;
15877                    throw new Error(msg);
15878                  }
15879                }
15880                draw_cursor_line(current, {
15881                  length: array.length,
15882                  position: new_pos
15883                });
15884                lines_before(array.slice(0, line_index));
15885                lines_after(array.slice(line_index + 1));
15886              }
15887            }
15888            self2.find(".cmd-cursor-line ~ div:last-of-type").append("<span></span>");
15889          } else if (formatted === "") {
15890            before.html("");
15891            empty_cursor();
15892            after.html("");
15893          } else {
15894            draw_cursor_line(formatted, {
15895              length: 1,
15896              position: pos
15897            });
15898          }
15899          var in_line = cursor_line.prevUntil(".cmd-prompt").length;
15900          if (is_css_variables_supported) {
15901            self2[0].style.setProperty("--cursor-line", in_line);
15902          } else {
15903            clip.$node.css("top", in_line * 14 + "px");
15904          }
15905          wrapper.css({
15906            display: ""
15907          });
15908        };
15909      }();
15910      var find_position = function() {
15911        function make_guess(string2, position) {
15912          var opts = $.extend({}, settings2, {
15913            position,
15914            command: true
15915          });
15916          return $.terminal.apply_formatters(string2, opts)[1];
15917        }
15918        function cmp(search_pos, pos, string2) {
15919          var guess = make_guess(string2, pos);
15920          if (guess === search_pos) {
15921            var next_guess = make_guess(string2, pos + 1);
15922            if (next_guess > search_pos) {
15923              return 0;
15924            }
15925            return 1;
15926          } else if (guess < search_pos) {
15927            return 1;
15928          } else {
15929            return -1;
15930          }
15931        }
15932        return function(string2, formatted_position) {
15933          if (formatted_position === 0) {
15934            return 0;
15935          }
15936          string2 = bare_text(string2);
15937          var codepoint_len = string2.length;
15938          var str = $.terminal.escape_brackets(command);
15939          var pos = binary_search(0, codepoint_len, formatted_position, cmp, [str]);
15940          var chars = $.terminal.split_characters(string2);
15941          if (codepoint_len > chars.length) {
15942            var len = 0;
15943            for (var i = 0;i < chars.length; ++i) {
15944              len += chars[i].length;
15945              if (len >= pos) {
15946                return len;
15947              }
15948            }
15949          }
15950          return pos;
15951        };
15952      }();
15953      function get_prompt_marker() {
15954        if (prompt_offset) {
15955          return new Array(prompt_offset + 1).join("ï¿¿");
15956        }
15957        return "";
15958      }
15959      var prev_prompt_data;
15960      var draw_prompt = function() {
15961        function format_prompt(prompt) {
15962          if (!prompt) {
15963            just_prompt_len = 0;
15964            prompt_len = prompt_offset;
15965            return prompt;
15966          }
15967          var prompt_marker = get_prompt_marker();
15968          var tmp_prompt = prompt_marker + prompt;
15969          var lines = $.terminal.split_equal(tmp_prompt, num_chars);
15970          lines = lines.map(function(line) {
15971            return line.replace(/^\uFFFF+/, "");
15972          });
15973          lines = lines.map(function(line) {
15974            if (!$.terminal.have_formatting(line)) {
15975              return "[[;;]" + $.terminal.escape_brackets(line) + "]";
15976            }
15977            return $.terminal.format_split(line).map(function(str) {
15978              if ($.terminal.is_formatting(str)) {
15979                return str;
15980              }
15981              return "[[;;]" + $.terminal.escape_brackets(str) + "]";
15982            }).join("");
15983          });
15984          var options2 = {
15985            charWidth: settings2.charWidth
15986          };
15987          prompt_last_line = lines[lines.length - 1];
15988          var encoded_last_line = $.terminal.encode(lines[lines.length - 1], {
15989            tabs: settings2.tabs
15990          });
15991          var last_line = $.terminal.format(encoded_last_line, options2);
15992          just_prompt_len = strlen(text(encoded_last_line));
15993          prompt_len = just_prompt_len + prompt_offset;
15994          return lines.slice(0, -1).map(function(line) {
15995            line = $.terminal.encode(line, {
15996              tabs: settings2.tabs
15997            });
15998            return '<span class="cmd-line">' + $.terminal.format(line, options2) + "</span>";
15999          }).concat([last_line]).join(`
16000`);
16001        }
16002        function set(prompt, options2) {
16003          if (prompt) {
16004            if (options2 && options2.formatters || !options2) {
16005              prompt = $.terminal.apply_formatters(prompt, { prompt: true });
16006              prompt = $.terminal.normalize(prompt);
16007            }
16008            prompt = crlf(prompt);
16009          }
16010          var formatted = format_prompt(prompt);
16011          last_rendered_prompt = prompt;
16012          formatted = formatted || $.terminal.format("[[;;]â]");
16013          if (prompt_node.html() !== formatted) {
16014            prompt_node.html(formatted);
16015            var spans = prompt_node.find("> span span");
16016            clip.$node.attr("data-cmd-prompt", prompt_node.text());
16017            if (is_ch_unit_supported) {
16018              prompt_node.hide();
16019              spans.each(function() {
16020                var self2 = $(this);
16021                var len = strlen(self2.text());
16022                if (len === 0) {
16023                  self2.css("width", 1);
16024                } else {
16025                  self2.css("width", len + "ch");
16026                }
16027              });
16028              prompt_node.show();
16029            }
16030          }
16031        }
16032        return function(options2) {
16033          if (prev_prompt_data && prev_prompt_data.set) {
16034            prev_prompt_data.set = $.noop;
16035            prev_prompt_data = null;
16036          }
16037          var data = prev_prompt_data = {
16038            set
16039          };
16040          with_prompt(prompt, function(prompt) {
16041            data.set(prompt, options2);
16042          }, self2);
16043        };
16044      }();
16045      function fire_change_command() {
16046        if (is_function(settings2.onCommandChange)) {
16047          settings2.onCommandChange.call(self2, command);
16048        }
16049      }
16050      function column(command, position, include_prompt) {
16051        var before = command.substring(0, position);
16052        if (position === 0 || !command.length) {
16053          return 0;
16054        }
16055        var re = /\n?([^\n]*)$/;
16056        var match = before.match(re);
16057        var col = match[1].length;
16058        if (!have_newlines(before) && (include_prompt || have_wrapping(before, prompt_len))) {
16059          col += prompt_len;
16060        }
16061        if (col === 0) {
16062          return col;
16063        }
16064        col %= num_chars;
16065        if (col === 0) {
16066          return num_chars;
16067        }
16068        return col;
16069      }
16070      $.extend(self2, {
16071        option: function(name, value) {
16072          if (typeof value === "undefined") {
16073            return settings2[name];
16074          } else {
16075            settings2[name] = value;
16076          }
16077          return self2;
16078        },
16079        name: function(string2) {
16080          if (string2 !== undefined) {
16081            name = string2;
16082            var enabled = history2 && history2.enabled() || !history2;
16083            history2 = new History(name, settings2.historySize, settings2.history === "memory");
16084            if (!enabled) {
16085              history2.disable();
16086            }
16087            return self2;
16088          } else {
16089            return name;
16090          }
16091        },
16092        purge: function() {
16093          history2.clear();
16094          return self2;
16095        },
16096        history: function() {
16097          return history2;
16098        },
16099        delete: function(n, stay) {
16100          var removed, string2;
16101          if (n === 0) {
16102            return "";
16103          } else if (n < 0) {
16104            if (position > 0) {
16105              removed = command.slice(0, position).slice(n);
16106              string2 = bare_text(command);
16107              string2 = string2.slice(0, position + n) + string2.slice(position, string2.length);
16108              if (!stay) {
16109                self2.position(position + n);
16110              }
16111            }
16112          } else if (command !== "") {
16113            string2 = text(command);
16114            if (position < string2.length) {
16115              removed = string2.slice(position).slice(0, n);
16116              string2 = string2.slice(0, position) + string2.slice(position + n, string2.length);
16117            }
16118          }
16119          if (removed) {
16120            command = string2;
16121          }
16122          redraw();
16123          fix_editable();
16124          fire_change_command();
16125          return removed;
16126        },
16127        set: function(string2, stay, silent) {
16128          if (string2 !== undefined) {
16129            var command_changed = string2 !== command;
16130            command = string2;
16131            if (!stay) {
16132              self2.position(bare_text(command).length);
16133            }
16134            redraw();
16135            fix_editable();
16136            if (!silent && command_changed) {
16137              fire_change_command();
16138            }
16139          }
16140          return self2;
16141        },
16142        keymap: function(new_keymap, value) {
16143          function wrap(key, fn2) {
16144            var original = default_keymap[key];
16145            if (is_function(original)) {
16146              original = original.bind(self2);
16147            }
16148            return function(e) {
16149              return fn2.call(self2, e, original);
16150            };
16151          }
16152          if (new_keymap === null) {
16153            keymap = default_keymap;
16154            return self2;
16155          } else if (typeof new_keymap === "undefined") {
16156            return keymap;
16157          } else if (typeof new_keymap === "string") {
16158            if (typeof value === "undefined") {
16159              if (keymap[new_keymap]) {
16160                return keymap[new_keymap];
16161              } else if (default_keymap[new_keymap]) {
16162                return default_keymap[new_keymap];
16163              }
16164            } else {
16165              keymap[new_keymap] = wrap(new_keymap, value);
16166            }
16167          } else {
16168            keymap = $.extend({}, keymap ? keymap : default_keymap, $.omap(new_keymap || {}, wrap));
16169            return self2;
16170          }
16171        },
16172        insert: function(string2, stay) {
16173          var bare_command = bare_text(command);
16174          var len = bare_text(string2).length;
16175          if (position === bare_command.length) {
16176            string2 = bare_command + string2;
16177          } else if (position === 0) {
16178            string2 = string2 + bare_command;
16179          } else {
16180            string2 = bare_command.slice(0, position) + string2 + bare_command.slice(position);
16181          }
16182          command = string2;
16183          if (!stay) {
16184            self2.position(len, true, true);
16185          }
16186          fix_editable();
16187          redraw();
16188          fire_change_command();
16189          return self2;
16190        },
16191        get: function() {
16192          return command;
16193        },
16194        commands: function(commands) {
16195          if (commands) {
16196            settings2.commands = commands;
16197            return self2;
16198          } else {
16199            return commands;
16200          }
16201        },
16202        destroy: function() {
16203          doc.unbind("keypress.cmd", keypress_event);
16204          doc.unbind("keydown.cmd", keydown_event);
16205          doc.unbind("input.cmd", input_event);
16206          self2.stopTime("blink", blink);
16207          self2.find(".cmd-wrapper").remove();
16208          self2.find(".cmd-prompt, .cmd-clipboard, .cmd-editable").remove();
16209          self2.removeClass("cmd").removeData("cmd").off(".cmd");
16210          return self2;
16211        },
16212        display_column: function(include_prompt) {
16213          var formatted = formatting(command);
16214          formatted = $.terminal.strip(formatted);
16215          return column(formatted, formatted_position, include_prompt);
16216        },
16217        column: function(include_prompt) {
16218          return column(command, position, include_prompt);
16219        },
16220        line: function() {
16221          var before = command.substring(0, position);
16222          if (position === 0 || !command.length) {
16223            return 0;
16224          }
16225          return before.split(/\n/).length - 1;
16226        },
16227        __set_prompt_margin: function(len) {
16228          prompt_offset = len;
16229          prompt_len = just_prompt_len + prompt_offset;
16230        },
16231        prompt: function(user_prompt, options2) {
16232          if (user_prompt === true) {
16233            return last_rendered_prompt;
16234          } else if (user_prompt === undefined) {
16235            return prompt;
16236          } else {
16237            var should_redraw = user_prompt !== prompt;
16238            if (typeof user_prompt === "string" || typeof user_prompt === "function") {
16239              prompt = user_prompt;
16240            } else {
16241              throw new Error("prompt must be a function or string");
16242            }
16243            if (should_redraw) {
16244              draw_prompt(options2);
16245              redraw();
16246            }
16247            return self2;
16248          }
16249        },
16250        kill_text: function() {
16251          return kill_text;
16252        },
16253        position: function(n, relative, silent) {
16254          if (typeof n === "number") {
16255            var pos = position;
16256            var len = bare_text(command).length;
16257            if (relative) {
16258              position += n;
16259            } else if (n < 0) {
16260              position = 0;
16261            } else if (n > len) {
16262              position = len;
16263            } else {
16264              position = n;
16265            }
16266            if (pos !== position) {
16267              redraw();
16268              if (!silent && is_function(settings2.onPositionChange)) {
16269                settings2.onPositionChange(position, formatted_position);
16270              }
16271              fix_editable(true);
16272            }
16273            return self2;
16274          } else {
16275            return position;
16276          }
16277        },
16278        refresh: function() {
16279          draw_prompt();
16280          redraw();
16281          fix_editable(true);
16282          return self2;
16283        },
16284        display_position: function(n, relative) {
16285          if (n === undefined) {
16286            return formatted_position;
16287          } else {
16288            var string2 = formatting($.terminal.escape_formatting(command), true);
16289            var len = length(string2);
16290            var command_len = bare_text(command).length;
16291            var new_formatted_pos;
16292            if (relative) {
16293              new_formatted_pos = formatted_position + n;
16294            } else if (n > len) {
16295              new_formatted_pos = len;
16296            } else {
16297              new_formatted_pos = n;
16298            }
16299            if (len === command_len) {
16300              formatted_position = new_formatted_pos;
16301              return self2.position(new_formatted_pos);
16302            }
16303            if (len === new_formatted_pos) {
16304              formatted_position = new_formatted_pos;
16305              return self2.position(command_len);
16306            }
16307            var pos = find_position(command, new_formatted_pos);
16308            if (pos !== -1) {
16309              formatted_position = new_formatted_pos;
16310              self2.position(pos);
16311            }
16312            return self2;
16313          }
16314        },
16315        visible: function() {
16316          var visible = self2.visible;
16317          return function() {
16318            visible.apply(self2, []);
16319            redraw();
16320            draw_prompt();
16321            return self2;
16322          };
16323        }(),
16324        show: function() {
16325          var show = self2.show;
16326          return function() {
16327            show.apply(self2, []);
16328            redraw();
16329            draw_prompt();
16330            return self2;
16331          };
16332        }(),
16333        resize: function(num) {
16334          char_width = get_char_width();
16335          var new_num_chars;
16336          if (typeof num === "number") {
16337            new_num_chars = num;
16338          } else {
16339            new_num_chars = get_num_chars2(char_width);
16340          }
16341          if (num_chars !== new_num_chars || arguments[0] === true) {
16342            num_chars = new_num_chars;
16343            draw_prompt();
16344            redraw();
16345          }
16346          return self2;
16347        },
16348        clear_cache: "Map" in root ? function() {
16349          cmd_line_worker.clear();
16350        } : function() {
16351          return self2;
16352        },
16353        invoke_key: function(shortcut) {
16354          if (!enabled) {
16355            warn('invoke_key("' + shortcut + '") called on disabled terminal');
16356          }
16357          var keys = shortcut.toUpperCase().split("+");
16358          var key = keys.pop();
16359          var ctrl = keys.indexOf("CTRL") !== -1;
16360          var shift = keys.indexOf("SHIFT") !== -1;
16361          var alt = keys.indexOf("ALT") !== -1;
16362          var meta = keys.indexOf("META") !== -1;
16363          var e = $.Event("keydown", {
16364            ctrlKey: ctrl,
16365            shiftKey: shift,
16366            altKey: alt,
16367            metaKey: meta,
16368            which: reversed_keycodes[key],
16369            key
16370          });
16371          var doc = $(document.documentElement || window);
16372          doc.trigger(e);
16373          e = $.Event("keypress");
16374          e.key = key;
16375          e.which = e.keyCode = 0;
16376          doc.trigger(e);
16377          return self2;
16378        },
16379        clip: function() {
16380          return clip;
16381        },
16382        enable: function(silent) {
16383          if (!enabled) {
16384            enabled = true;
16385            self2.addClass("enabled");
16386            try {
16387              if (!clip.$node.is(":focus")) {
16388                clip.$node.focus();
16389              }
16390              clip.$node.caret(position);
16391            } catch (e) {}
16392            animation(true);
16393            if (!silent && is_function(prompt)) {
16394              draw_prompt();
16395            }
16396            fix_cursor();
16397            fix_editable();
16398          }
16399          mobile_focus();
16400          return self2;
16401        },
16402        isenabled: function() {
16403          return enabled;
16404        },
16405        disable: function(focus) {
16406          enabled = false;
16407          self2.removeClass("enabled");
16408          animation(false);
16409          if (!focus) {
16410            mobile_focus();
16411          }
16412          return self2;
16413        },
16414        mask: function(new_mask) {
16415          if (typeof new_mask === "undefined") {
16416            return settings2.mask;
16417          } else {
16418            settings2.mask = new_mask;
16419            redraw();
16420            return self2;
16421          }
16422        }
16423      });
16424      self2.name(settings2.name || settings2.prompt || "");
16425      char_width = get_char_width();
16426      num_chars = get_num_chars2(char_width);
16427      if (settings2.prompt !== false) {
16428        prompt = settings2.prompt;
16429        draw_prompt();
16430      }
16431      if (settings2.enabled === true) {
16432        self2.enable();
16433      }
16434      if (!settings2.history) {
16435        history2.disable();
16436      }
16437      var first_up_history = true;
16438      var skip_keypress = false;
16439      var dead_key = false;
16440      var single_key = false;
16441      var no_keypress = false;
16442      var no_key = false;
16443      var no_keydown = true;
16444      var backspace = false;
16445      var process = false;
16446      var hold = false;
16447      var hold_pause = false;
16448      var skip_insert;
16449      var prev_command = "";
16450      var prev_shortcut;
16451      function is_backspace(e) {
16452        return e.key.toUpperCase() === "BACKSPACE" || e.which === 8;
16453      }
16454      function is_single(e) {
16455        return e.key && e.key.length === 1 && !e.ctrlKey;
16456      }
16457      function is_delay_key(key) {
16458        var specials = ["HOLD+SHIFT+BACKSPACE", "HOLD+BACKSPACE"];
16459        return specials.indexOf(key) !== -1 && settings2.mobileDelete || settings2.repeatTimeoutKeys.indexOf(key) !== -1;
16460      }
16461      function clear_reverse_search_key(e) {
16462        return e.which === 35 || e.which === 36 || e.which === 37 || e.which === 38 || e.which === 39 || e.which === 40 || e.which === 13 || e.which === 27;
16463      }
16464      var skip_keydown = false;
16465      function keydown_event(e) {
16466        debug('keydown "' + e.key + '" ' + e.fake + " " + e.which);
16467        var result;
16468        process = (e.key || "").toLowerCase() === "process" || e.which === 0;
16469        dead_key = no_keypress && single_key && !is_backspace(e);
16470        var have_key = typeof e.key !== "undefined";
16471        var key = String(e.key).toLowerCase();
16472        var unidentified_key = key === "unidentified";
16473        var skip_keymap;
16474        try {
16475          if (!e.fake) {
16476            single_key = is_single(e);
16477            no_key = !unidentified_key;
16478            backspace = have_key && is_backspace(e);
16479          }
16480        } catch (exception) {}
16481        if (unidentified_key) {
16482          no_keydown = true;
16483          return;
16484        }
16485        if (!e.fake && have_key && ["meta", "os"].indexOf(key) === -1) {
16486          no_keydown = false;
16487        }
16488        no_keypress = true;
16489        clip.$node.off("input", paste);
16490        var shortcut = get_key(e);
16491        if (is_function(settings2.keydown)) {
16492          if (have_key) {
16493            e.key = ie_key_fix(e);
16494          }
16495          result = settings2.keydown.call(self2, e);
16496          if (result !== undefined) {
16497            if (!result) {
16498              skip_insert = true;
16499            }
16500            if (result === true) {
16501              skip_keymap = true;
16502            } else {
16503              return result;
16504            }
16505          }
16506        }
16507        if (shortcut !== prev_shortcut) {
16508          clear_hold();
16509        }
16510        if (enabled || shortcut === "CTRL+C" && is_terminal_selected(self2)) {
16511          if (hold) {
16512            prev_shortcut = shortcut;
16513            shortcut = "HOLD+" + shortcut;
16514            if (hold_pause) {
16515              return;
16516            }
16517            if (settings2.holdRepeatTimeout > 0 && is_delay_key(shortcut)) {
16518              hold_pause = true;
16519              self2.oneTime(settings2.holdRepeatTimeout, "delay", function() {
16520                hold_pause = false;
16521              });
16522            }
16523          } else {
16524            self2.oneTime(settings2.holdTimeout, "hold", function() {
16525              hold = true;
16526            });
16527            prev_shortcut = shortcut;
16528          }
16529          if (!e.fake && is_android) {
16530            if (skip_keydown) {
16531              clear_hold();
16532              skip_keydown = false;
16533              return false;
16534            }
16535            if (mobile_ignore_key(shortcut)) {
16536              skip_keydown = true;
16537            } else if (mobile_ignore_key(prev_shortcut)) {
16538              skip_keydown = false;
16539            }
16540          }
16541          restart_animation();
16542          skip_insert = ["CTRL+V", "META+V"].indexOf(shortcut) !== -1;
16543          if (shortcut === "ENTER") {
16544            first_up_history = true;
16545          }
16546          if (reverse_search && clear_reverse_search_key(e)) {
16547            clear_reverse_state();
16548            draw_prompt();
16549            if (e.which === 27) {
16550              self2.set("");
16551            }
16552            redraw();
16553            if (e.which === 13) {
16554              keydown_event.call(this, e);
16555            }
16556          } else if (is_function(keymap[shortcut])) {
16557            result = keymap[shortcut](e);
16558            if (result === true) {
16559              return;
16560            }
16561            if (result !== undefined) {
16562              return result;
16563            }
16564          } else if (e.altKey) {
16565            return;
16566          } else {
16567            skip_keypress = false;
16568            return;
16569          }
16570        } else if (skip_keymap && is_function(keymap[shortcut])) {
16571          return false;
16572        }
16573      }
16574      function clear_hold() {
16575        self2.stopTime("hold");
16576        self2.stopTime("delay");
16577        hold_pause = hold = false;
16578      }
16579      var doc = $(document.documentElement || window);
16580      self2.keymap(settings2.keymap || {});
16581      function keypress_event(e) {
16582        debug('keypress "' + e.key + '" ' + e.fake);
16583        clear_hold();
16584        var result;
16585        if (!e.fake) {
16586          no_keypress = false;
16587        }
16588        if ((e.ctrlKey || e.metaKey) && !e.altKey) {
16589          return;
16590        }
16591        if (skip_keypress) {
16592          return;
16593        }
16594        if (is_function(settings2.keypress)) {
16595          result = settings2.keypress.call(self2, e);
16596          if (result !== undefined) {
16597            if (!result) {
16598              skip_insert = true;
16599            }
16600            return result;
16601          }
16602        }
16603        if (enabled) {
16604          if (e.fake) {
16605            return;
16606          }
16607          var key;
16608          if (is_key_native) {
16609            key = e.key;
16610            var normalized = key.toUpperCase();
16611            if (key_mapping[normalized]) {
16612              key = key_mapping[normalized];
16613            }
16614          }
16615          if (!key || no_key) {
16616            key = String.fromCharCode(e.which);
16617          }
16618          if ($.inArray(e.which, [13, 0, 8]) > -1) {
16619            if (e.keyCode === 123) {
16620              return;
16621            }
16622            return false;
16623          } else if (key && (!e.ctrlKey || e.ctrlKey && e.ctrlKey) && (!(e.altKey && e.which === 100) || e.altKey) && !dead_key) {
16624            if (reverse_search) {
16625              rev_search_str += key;
16626              reverse_history_search();
16627              draw_reverse_prompt();
16628            } else if (key.length === 1) {
16629              self2.insert(key);
16630            }
16631          }
16632        }
16633      }
16634      function event(type, chr, which) {
16635        var event = $.Event(type);
16636        event.which = which;
16637        event.key = chr;
16638        event.fake = true;
16639        doc.trigger(event);
16640      }
16641      var skip_input = false;
16642      function finalize_input_event() {
16643        prev_command = command;
16644        skip_insert = false;
16645        no_keydown = true;
16646      }
16647      function input_event() {
16648        debug("input " + no_keydown + " || " + process + " ((" + no_keypress + " || " + dead_key + ") && !" + skip_insert + " && (" + single_key + " || " + no_key + ") && !" + backspace + ")");
16649        var val = clip.val();
16650        if (!is_mobile) {
16651          val = val.replace(/^ /, "");
16652        }
16653        if (no_keydown || process || (no_keypress || dead_key) && !skip_insert && (single_key || no_key) && !backspace) {
16654          if (val && val === command) {
16655            finalize_input_event();
16656            return;
16657          }
16658          var pos = position;
16659          if (no_keydown) {
16660            var cmd = prev_command;
16661            backspace = cmd.slice(0, cmd.length - 1).length === val.length;
16662          }
16663          if (skip_input) {
16664            skip_input = false;
16665            clip.val(command);
16666            return;
16667          }
16668          if (reverse_search) {
16669            rev_search_str = val;
16670            reverse_history_search();
16671            draw_reverse_prompt();
16672          } else {
16673            var str = val.slice(position);
16674            if (str.length === 1 || backspace) {
16675              var chr = get_next_character(str);
16676              if (mobile_ignore_key(chr)) {
16677                skip_input = true;
16678              }
16679              if (no_keydown) {
16680                var keycode;
16681                if (backspace) {
16682                  keycode = 8;
16683                } else {
16684                  keycode = str.toUpperCase().charCodeAt(0);
16685                }
16686                event("keydown", backspace ? "Backspace" : str, keycode);
16687              }
16688              if (no_keypress && !backspace) {
16689                event("keypress", chr, str.charCodeAt(0));
16690              }
16691            }
16692            if (backspace) {
16693              prev_command = command;
16694              return;
16695            }
16696            if (skip_insert) {
16697              skip_insert = false;
16698              return;
16699            }
16700            self2.set(val);
16701          }
16702          if (backspace) {
16703            self2.position(pos - 1);
16704          } else {
16705            self2.position(pos + Math.abs(val.length - prev_command.length));
16706          }
16707        }
16708        finalize_input_event();
16709      }
16710      doc.bind("keypress.cmd", keypress_event);
16711      doc.bind("keydown.cmd", keydown_event);
16712      doc.bind("keyup.cmd", clear_hold);
16713      doc.bind("input.cmd", input_event);
16714      (function() {
16715        if (is_mobile) {
16716          $(self2[0]).add(clip.$node).on("touchstart.cmd", function() {
16717            if (!self2.isenabled()) {
16718              clip.focus();
16719            } else {
16720              clip.blur();
16721            }
16722          });
16723          self2.disable();
16724          return;
16725        }
16726        var was_down = false;
16727        var count = 0;
16728        self2.on("mousedown.cmd", function() {
16729          was_down = true;
16730        }).on("mouseup.cmd", function(e) {
16731          function trigger() {
16732            var $target = $(e.target);
16733            var is_prompt = $target.is(".cmd-prompt");
16734            if (!is_prompt && down && get_selected_html() === "") {
16735              if (enabled) {
16736                if ($target.is(".cmd")) {
16737                  self2.position(text(command).length);
16738                } else {
16739                  self2.display_position(get_char_pos(e));
16740                }
16741              }
16742            }
16743            count = 0;
16744          }
16745          var button;
16746          if (e.originalEvent === undefined) {
16747            button = e.button;
16748          } else {
16749            button = e.originalEvent.button;
16750          }
16751          if (button === 0 && get_selected_html() === "") {
16752            var name = "click_" + id;
16753            if (++count === 1) {
16754              var down = was_down;
16755              if (enabled) {
16756                if (settings2.clickTimeout === 0) {
16757                  trigger();
16758                } else {
16759                  self2.oneTime(settings2.clickTimeout, name, trigger);
16760                }
16761              } else {
16762                count = 0;
16763              }
16764            } else {
16765              self2.stopTime(name);
16766              count = 0;
16767            }
16768          }
16769          was_down = false;
16770        });
16771      })();
16772      self2.data("cmd", self2);
16773      if (!(("KeyboardEvent" in window) && ("key" in window.KeyboardEvent.prototype))) {
16774        setTimeout(function() {
16775          throw new Error("key event property not supported try https://github." + "com/inexorabletash/polyfill/blob/master/keyboard.js");
16776        }, 0);
16777      }
16778      return self2;
16779    };
16780    var strlen = function() {
16781      if (typeof wcwidth === "undefined") {
16782        return function(string2) {
16783          string2 = string2.replace(/\u200B/g, "");
16784          return $.terminal.length(string2);
16785        };
16786      } else {
16787        return wcwidth;
16788      }
16789    }();
16790    function count_selfclosing_formatting(string2) {
16791      var count = 0;
16792      if ($.terminal.have_formatting(string2)) {
16793        var re = new RegExp(format_parts_re.source, "i");
16794        $.terminal.format_split(string2).forEach(function(str) {
16795          if ($.terminal.is_formatting(str)) {
16796            var m2 = str.match(re);
16797            if (m2 && m2[1].match(/@/) && m2[6] === "") {
16798              count++;
16799            }
16800          }
16801        });
16802      }
16803      return count;
16804    }
16805    var entities = {
16806      "&amp;": "&",
16807      "&lt;": "<",
16808      "&gt;": ">",
16809      "&Agrave;": "Ã",
16810      "&Aacute;": "Ã",
16811      "&Acirc;": "Ã",
16812      "&Atilde;": "Ã",
16813      "&Auml;": "Ã",
16814      "&Aring;": "Ã",
16815      "&AElig;": "Ã",
16816      "&Ccedil;": "Ã",
16817      "&Egrave;": "Ã",
16818      "&Eacute;": "Ã",
16819      "&Ecirc;": "Ã",
16820      "&Euml;": "Ã",
16821      "&Igrave;": "Ã",
16822      "&Iacute;": "Ã",
16823      "&Icirc;": "Ã",
16824      "&Iuml;": "Ã",
16825      "&ETH;": "Ã",
16826      "&Ntilde;": "Ã",
16827      "&Ograve;": "Ã",
16828      "&Oacute;": "Ã",
16829      "&Ocirc;": "Ã",
16830      "&Otilde;": "Ã",
16831      "&Ouml;": "Ã",
16832      "&Oslash;": "Ã",
16833      "&Ugrave;": "Ã",
16834      "&Uacute;": "Ã",
16835      "&Ucirc;": "Ã",
16836      "&Uuml;": "Ã",
16837      "&Yacute;": "Ã",
16838      "&THORN;": "Ã",
16839      "&szlig;": "Ã",
16840      "&agrave;": "Ã ",
16841      "&aacute;": "Ã¡",
16842      "&acirc;": "Ã¢",
16843      "&atilde;": "Ã£",
16844      "&auml;": "Ã¤",
16845      "&aring;": "Ã¥",
16846      "&aelig;": "Ã¦",
16847      "&ccedil;": "Ã§",
16848      "&egrave;": "Ã¨",
16849      "&eacute;": "Ã©",
16850      "&ecirc;": "Ãª",
16851      "&euml;": "Ã«",
16852      "&igrave;": "Ã¬",
16853      "&iacute;": "Ã",
16854      "&icirc;": "Ã®",
16855      "&iuml;": "Ã¯",
16856      "&eth;": "Ã°",
16857      "&ntilde;": "Ã±",
16858      "&ograve;": "Ã²",
16859      "&oacute;": "Ã³",
16860      "&ocirc;": "Ã´",
16861      "&otilde;": "Ãµ",
16862      "&ouml;": "Ã¶",
16863      "&oslash;": "Ã¸",
16864      "&ugrave;": "Ã¹",
16865      "&uacute;": "Ãº",
16866      "&ucirc;": "Ã»",
16867      "&uuml;": "Ã¼",
16868      "&yacute;": "Ã½",
16869      "&thorn;": "Ã¾",
16870      "&yuml;": "Ã¿",
16871      "&nbsp;": "Â ",
16872      "&iexcl;": "Â¡",
16873      "&cent;": "Â¢",
16874      "&pound;": "Â£",
16875      "&curren;": "Â¤",
16876      "&yen;": "Â¥",
16877      "&brvbar;": "Â¦",
16878      "&sect;": "Â§",
16879      "&uml;": "Â¨",
16880      "&copy;": "Â©",
16881      "&ordf;": "Âª",
16882      "&laquo;": "Â«",
16883      "&not;": "Â¬",
16884      "&shy;": "Â",
16885      "&reg;": "Â®",
16886      "&macr;": "Â¯",
16887      "&deg;": "Â°",
16888      "&plusmn;": "Â±",
16889      "&sup2;": "Â²",
16890      "&sup3;": "Â³",
16891      "&acute;": "Â´",
16892      "&micro;": "Âµ",
16893      "&para;": "Â¶",
16894      "&cedil;": "Â¸",
16895      "&sup1;": "Â¹",
16896      "&ordm;": "Âº",
16897      "&raquo;": "Â»",
16898      "&frac14;": "Â¼",
16899      "&frac12;": "Â½",
16900      "&frac34;": "Â¾",
16901      "&iquest;": "Â¿",
16902      "&times;": "Ã",
16903      "&divide;": "Ã·",
16904      "&forall;": "â",
16905      "&part;": "â",
16906      "&exist;": "â",
16907      "&empty;": "â",
16908      "&nabla;": "â",
16909      "&isin;": "â",
16910      "&notin;": "â",
16911      "&ni;": "â",
16912      "&prod;": "â",
16913      "&sum;": "â",
16914      "&minus;": "â",
16915      "&lowast;": "â",
16916      "&radic;": "â",
16917      "&prop;": "â",
16918      "&infin;": "â",
16919      "&ang;": "â ",
16920      "&and;": "â§",
16921      "&or;": "â¨",
16922      "&cap;": "â©",
16923      "&cup;": "âª",
16924      "&int;": "â«",
16925      "&there4;": "â´",
16926      "&sim;": "â¼",
16927      "&cong;": "â",
16928      "&asymp;": "â",
16929      "&ne;": "â ",
16930      "&equiv;": "â¡",
16931      "&le;": "â¤",
16932      "&ge;": "â¥",
16933      "&sub;": "â",
16934      "&sup;": "â",
16935      "&nsub;": "â",
16936      "&sube;": "â",
16937      "&supe;": "â",
16938      "&oplus;": "â",
16939      "&otimes;": "â",
16940      "&perp;": "â¥",
16941      "&sdot;": "â",
16942      "&Alpha;": "Î",
16943      "&Beta;": "Î",
16944      "&Gamma;": "Î",
16945      "&Delta;": "Î",
16946      "&Epsilon;": "Î",
16947      "&Zeta;": "Î",
16948      "&Eta;": "Î",
16949      "&Theta;": "Î",
16950      "&Iota;": "Î",
16951      "&Kappa;": "Î",
16952      "&Lambda;": "Î",
16953      "&Mu;": "Î",
16954      "&Nu;": "Î",
16955      "&Xi;": "Î",
16956      "&Omicron;": "Î",
16957      "&Pi;": "Î ",
16958      "&Rho;": "Î¡",
16959      "&Sigma;": "Î£",
16960      "&Tau;": "Î¤",
16961      "&Upsilon;": "Î¥",
16962      "&Phi;": "Î¦",
16963      "&Chi;": "Î§",
16964      "&Psi;": "Î¨",
16965      "&Omega;": "Î©",
16966      "&alpha;": "Î±",
16967      "&beta;": "Î²",
16968      "&gamma;": "Î³",
16969      "&delta;": "Î´",
16970      "&epsilon;": "Îµ",
16971      "&zeta;": "Î¶",
16972      "&eta;": "Î·",
16973      "&theta;": "Î¸",
16974      "&iota;": "Î¹",
16975      "&kappa;": "Îº",
16976      "&lambda;": "Î»",
16977      "&mu;": "Î¼",
16978      "&nu;": "Î½",
16979      "&xi;": "Î¾",
16980      "&omicron;": "Î¿",
16981      "&pi;": "Ï",
16982      "&rho;": "Ï",
16983      "&sigmaf;": "Ï",
16984      "&sigma;": "Ï",
16985      "&tau;": "Ï",
16986      "&upsilon;": "Ï",
16987      "&phi;": "Ï",
16988      "&chi;": "Ï",
16989      "&psi;": "Ï",
16990      "&omega;": "Ï",
16991      "&thetasym;": "Ï",
16992      "&upsih;": "Ï",
16993      "&piv;": "Ï",
16994      "&OElig;": "Å",
16995      "&oelig;": "Å",
16996      "&Scaron;": "Å ",
16997      "&scaron;": "Å¡",
16998      "&Yuml;": "Å¸",
16999      "&fnof;": "Æ",
17000      "&circ;": "Ë",
17001      "&tilde;": "Ë",
17002      "&ensp;": "â",
17003      "&emsp;": "â",
17004      "&thinsp;": "â",
17005      "&zwnj;": "â",
17006      "&zwj;": "â",
17007      "&lrm;": "â",
17008      "&rlm;": "â",
17009      "&ndash;": "â",
17010      "&mdash;": "â",
17011      "&lsquo;": "â",
17012      "&rsquo;": "â",
17013      "&sbquo;": "â",
17014      "&ldquo;": "â",
17015      "&rdquo;": "â",
17016      "&bdquo;": "â",
17017      "&dagger;": "â ",
17018      "&Dagger;": "â¡",
17019      "&bull;": "â¢",
17020      "&hellip;": "â¦",
17021      "&permil;": "â°",
17022      "&prime;": "â²",
17023      "&Prime;": "â³",
17024      "&lsaquo;": "â¹",
17025      "&rsaquo;": "âº",
17026      "&oline;": "â¾",
17027      "&euro;": "â¬",
17028      "&trade;": "â¢",
17029      "&larr;": "â",
17030      "&uarr;": "â",
17031      "&rarr;": "â",
17032      "&darr;": "â",
17033      "&harr;": "â",
17034      "&crarr;": "âµ",
17035      "&lceil;": "â",
17036      "&rceil;": "â",
17037      "&lfloor;": "â",
17038      "&rfloor;": "â",
17039      "&loz;": "â",
17040      "&spades;": "â ",
17041      "&clubs;": "â£",
17042      "&hearts;": "â¥",
17043      "&diams;": "â¦"
17044    };
17045    function render_entities(str) {
17046      return str.replace(/&#(?:x([0-9a-f]+)|([0-9]+));/gi, function(_, hex, dec) {
17047        var code;
17048        if (hex) {
17049          code = parseInt(hex, 16);
17050        } else {
17051          code = parseInt(dec, 10);
17052        }
17053        return String.fromCharCode(code);
17054      }).replace(/(&[^;]+;)/g, function(_, entity) {
17055        return entities[entity] || entity;
17056      });
17057    }
17058    function bare_text(str) {
17059      if (!str.match(/&/)) {
17060        return str;
17061      }
17062      return render_entities(safe(str));
17063    }
17064    function text(str) {
17065      return bare_text($.terminal.strip(str));
17066    }
17067    function amp(str) {
17068      return str.replace(/&(?!#[0-9]+;|#x[0-9a-f]+;|[a-z]+;)/gi, "&amp;");
17069    }
17070    function safe(str) {
17071      if (!str.match(/[<>&]/)) {
17072        return str;
17073      }
17074      return amp(str).replace(/</g, "&lt;").replace(/>/g, "&gt;");
17075    }
17076    function crlf(str) {
17077      return str.replace(/\r/g, "");
17078    }
17079    function char_len(chr) {
17080      return entity_re.test(chr) ? 1 : chr.length;
17081    }
17082    function make_re_fn(re) {
17083      return function test_re(str) {
17084        var m2 = str.match(re);
17085        if (starts_with(m2)) {
17086          return m2[1];
17087        }
17088      };
17089    }
17090    function starts_with(match) {
17091      return match && match.index === 0;
17092    }
17093    function is_simple_text(str) {
17094      var re = [
17095        entity_re,
17096        emoji_re,
17097        combine_chr_re,
17098        astral_symbols_re
17099      ];
17100      for (var i = 0;i < re.length; ++i) {
17101        if (re[i].test(str)) {
17102          return false;
17103        }
17104      }
17105      return true;
17106    }
17107    function make_next_char_fun(string2) {
17108      var tests = [];
17109      [
17110        entity_re,
17111        emoji_re,
17112        combine_chr_re
17113      ].forEach(function(re) {
17114        if (re.test(string2)) {
17115          tests.push(make_re_fn(re));
17116        }
17117      });
17118      if (astral_symbols_re.test(string2)) {
17119        tests.push(function test_astral(string2) {
17120          var m1 = string2.match(astral_symbols_re);
17121          if (starts_with(m1)) {
17122            var m2 = string2.match(combine_chr_re);
17123            if (m2 && m2.index === 1) {
17124              return string2.slice(0, 3);
17125            }
17126            return m1[1];
17127          }
17128        });
17129      }
17130      return function next_char(string2) {
17131        for (var i = 0;i < tests.length; ++i) {
17132          var test = tests[i];
17133          var ret2 = test(string2);
17134          if (ret2) {
17135            return ret2;
17136          }
17137        }
17138        return string2[0];
17139      };
17140    }
17141    function get_next_character(string2) {
17142      var match_entity = string2.match(entity_re);
17143      if (starts_with(match_entity)) {
17144        return match_entity[1];
17145      }
17146      var match_combo = string2.match(combine_chr_re);
17147      if (starts_with(match_combo)) {
17148        return match_combo[1];
17149      }
17150      var match_emoji = string2.match(emoji_re);
17151      if (starts_with(match_emoji)) {
17152        return match_emoji[1];
17153      } else if (string2.charCodeAt(0) < 255) {
17154        return string2[0];
17155      } else {
17156        var astral_match = string2.match(astral_symbols_re);
17157        if (starts_with(astral_match)) {
17158          match_combo = string2.match(combine_chr_re);
17159          if (match_combo && match_combo.index === 1) {
17160            return string2.slice(0, 3);
17161          }
17162          return string2.slice(0, 2);
17163        } else {
17164          return string2[0];
17165        }
17166      }
17167    }
17168    function normalize_position(string2, position) {
17169      if (position === 0) {
17170        return position;
17171      }
17172      string2 = $.terminal.strip(string2);
17173      var result = $.terminal.split_characters(string2).reduce(function(acc, chr) {
17174        if (typeof acc === "number") {
17175          return acc;
17176        }
17177        var length = acc.length + char_len(chr);
17178        if (length >= position) {
17179          return acc.position + 1;
17180        }
17181        return {
17182          position: acc.position + 1,
17183          length
17184        };
17185      }, { position: 0, length: 0 });
17186      if (typeof result === "number") {
17187        return result;
17188      } else {
17189        return result.position;
17190      }
17191    }
17192    function style_to_string(styles) {
17193      return Object.keys(styles).map(function(prop) {
17194        return prop + ":" + styles[prop];
17195      }).join(";");
17196    }
17197    function escape_html_attr(value) {
17198      return value.replace(/"/g, "&quot;");
17199    }
17200    function char_width_object(len, options2) {
17201      var result = {};
17202      if (len === 0) {
17203        result["width"] = "1px";
17204      } else if (is_ch_unit_supported) {
17205        result["width"] = len + "ch";
17206      } else if (!is_css_variables_supported) {
17207        if (options2.charWidth) {
17208          result["width"] = options2.charWidth * len + "px";
17209        }
17210      } else {
17211        result["--length"] = len;
17212      }
17213      return result;
17214    }
17215    function char_width_prop(len, options2) {
17216      return style_to_string(char_width_object(len, options2));
17217    }
17218    function extra_css(text2, options2) {
17219      if (typeof wcwidth !== "undefined") {
17220        var bare = bare_text(text2);
17221        var len = strlen(bare);
17222        if (len > 1 && len !== $.terminal.length(bare)) {
17223          return char_width_object(len, options2);
17224        }
17225      }
17226    }
17227    function wide_characters(text2, options2) {
17228      if (typeof wcwidth !== "undefined") {
17229        var bare = bare_text(text2);
17230        var chars = $.terminal.split_characters(bare);
17231        if (chars.length === 1) {
17232          return text2;
17233        }
17234        var specs = chars.map(function(chr) {
17235          return {
17236            len: strlen(chr),
17237            chr
17238          };
17239        }).reduce(function(arr, spec) {
17240          var last = arr[arr.length - 1];
17241          if (last) {
17242            if (last.len !== spec.len) {
17243              return arr.concat([{
17244                sum: spec.len,
17245                len: spec.len,
17246                specs: [spec]
17247              }]);
17248            } else {
17249              arr.pop();
17250              return arr.concat([{
17251                sum: last.sum + spec.len,
17252                len: last.len,
17253                specs: last.specs.concat(spec)
17254              }]);
17255            }
17256          }
17257          return [{
17258            sum: spec.len,
17259            specs: [spec],
17260            len: spec.len
17261          }];
17262        }, []);
17263        return specs.map(function(spec) {
17264          if (spec.len === 1) {
17265            return make_string(spec);
17266          }
17267          var style = char_width_prop(spec.sum, options2);
17268          if (spec.sum === chars.length || !style.length) {
17269            return "<span>" + make_string(spec) + "</span>";
17270          } else if (spec.specs.length > 1) {
17271            return wrap(style, spec.specs.map(function(spec) {
17272              return wrap(char_width_prop(spec.len), spec.chr);
17273            }).join(""));
17274          } else {
17275            return wrap(style, make_string(spec));
17276          }
17277        }).join("");
17278      }
17279      function make_string(spec) {
17280        return spec.specs.map(function(spec) {
17281          return spec.chr;
17282        }).join("");
17283      }
17284      function wrap(style, str) {
17285        return '<span style="' + style + '">' + str + "</span>";
17286      }
17287      return text2;
17288    }
17289    function binary_search(start, end, search_pos, compare_fn, more_args) {
17290      var len = end - start;
17291      var mid = start + Math.floor(len / 2);
17292      var args2 = [search_pos, mid].concat(more_args);
17293      var cmp = compare_fn.apply(null, args2);
17294      if (cmp === 0) {
17295        return mid;
17296      } else if (cmp > 0 && len > 1) {
17297        return binary_search(mid, end, search_pos, compare_fn, more_args);
17298      } else if (cmp < 0 && len > 1) {
17299        return binary_search(start, mid, search_pos, compare_fn, more_args);
17300      } else {
17301        return -1;
17302      }
17303    }
17304    function is_terminal_selected(cmd) {
17305      if (is_function(window.getSelection)) {
17306        var selection = window.getSelection();
17307        if (selection.toString()) {
17308          var node = selection.getRangeAt(0).startContainer.parentNode;
17309          var term2 = $(node).closest(".terminal");
17310          return term2.length && (cmd && term2.find(".cmd").is(cmd) || !cmd);
17311        }
17312      }
17313    }
17314    function get_selected_html() {
17315      var html = "";
17316      if (is_function(window.getSelection)) {
17317        var sel = window.getSelection();
17318        if (sel.rangeCount) {
17319          var container = document.createElement("div");
17320          for (var i = 0, len = sel.rangeCount;i < len; ++i) {
17321            container.appendChild(sel.getRangeAt(i).cloneContents());
17322          }
17323          html = container.innerHTML;
17324        }
17325      }
17326      return html;
17327    }
17328    function with_selection(fn2) {
17329      var html = "";
17330      var ranges = [];
17331      if (is_function(window.getSelection)) {
17332        var selection = window.getSelection();
17333        if (selection.rangeCount) {
17334          var container = document.createElement("div");
17335          for (var i = 0, len = selection.rangeCount;i < len; ++i) {
17336            var range = selection.getRangeAt(i).cloneRange();
17337            ranges.push(range);
17338            container.appendChild(range.cloneContents());
17339          }
17340          html = container.innerHTML;
17341        }
17342      }
17343      fn2(html);
17344      if (ranges.length) {
17345        selection.removeAllRanges();
17346        ranges.forEach(function(range) {
17347          selection.addRange(range);
17348        });
17349      }
17350      return html !== "";
17351    }
17352    function process_selected_line() {
17353      var $self = $(this);
17354      var result = $self.text();
17355      if ($self.hasClass("cmd-end-line")) {
17356        result += `
17357`;
17358      }
17359      return result;
17360    }
17361    function process_div(element) {
17362      return $(element).find("> div, > span").map(process_selected_line).get().join(`
17363`).replace(/\n$/, "");
17364    }
17365    function process_selected_html(html) {
17366      var stdout;
17367      var text2 = "";
17368      var $html = $("<div>" + html + "</div>");
17369      if (html.match(/<\/div>/)) {
17370        stdout = $html.find("div[data-index]").map(function() {
17371          return process_div(this);
17372        }).get().join(`
17373`);
17374        if (!stdout && html.match(/style="width: 100%;?"/)) {
17375          stdout = process_div($html);
17376        }
17377        text2 = stdout;
17378      }
17379      var $prompt = $html.find(".cmd-prompt");
17380      if ($prompt.length) {
17381        if (text2.length) {
17382          text2 += `
17383`;
17384        }
17385        text2 += $prompt.text();
17386      }
17387      var $cmd_lines = $html.find('[role="presentation"]');
17388      if ($cmd_lines.length) {
17389        text2 += $cmd_lines.map(process_selected_line).get().join("");
17390      }
17391      if (!text2.length && html) {
17392        text2 = $html.text();
17393      }
17394      return text2.replace(/\xA0/g, " ");
17395    }
17396    var support_copy = function() {
17397      if (typeof document === "undefined") {
17398        return false;
17399      }
17400      if (!is_function(document.queryCommandSupported)) {
17401        return false;
17402      }
17403      return document.queryCommandSupported("copy");
17404    }();
17405    var text_to_clipboard;
17406    if (support_copy) {
17407      text_to_clipboard = function text_to_clipboard2($textarea, text2) {
17408        var val = $textarea.val();
17409        var had_focus = $textarea.is(":focus");
17410        var pos = $textarea.caret();
17411        if (window.navigator && window.navigator.clipboard) {
17412          navigator.clipboard.writeText(text2);
17413        } else if (had_focus) {
17414          $textarea.val(text2).focus();
17415          $textarea[0].select();
17416          document.execCommand("copy");
17417          $textarea.val(val);
17418          $textarea.caret(pos);
17419        } else {
17420          var $text = $("<textarea/>").css({
17421            position: "fixed",
17422            top: 0,
17423            left: 0
17424          }).appendTo("body");
17425          $text.val(text2).focus();
17426          $text[0].select();
17427          document.execCommand("copy");
17428          $text.blur();
17429          $text.remove();
17430        }
17431        return true;
17432      };
17433    } else {
17434      text_to_clipboard = $.noop;
17435    }
17436    var get_textarea_selection = function() {
17437      function noop() {
17438        return "";
17439      }
17440      if (typeof document === "undefined") {
17441        return noop;
17442      }
17443      var textarea = document.createElement("textarea");
17444      var selectionStart = "selectionStart" in textarea;
17445      textarea = null;
17446      if (selectionStart) {
17447        return function(textarea) {
17448          var length = textarea.selectionEnd - textarea.selectionStart;
17449          return textarea.value.substr(textarea.selectionStart, length);
17450        };
17451      } else if (document.selection) {
17452        return function() {
17453          var range = document.selection.createRange();
17454          return range.text();
17455        };
17456      } else {
17457        return noop;
17458      }
17459    }();
17460    function clear_textarea_selection(textarea) {
17461      textarea.selectionStart = textarea.selectionEnd = 0;
17462    }
17463    function common_string(string2, array, matchCase) {
17464      if (!array.length) {
17465        return "";
17466      }
17467      var type = string_case(string2);
17468      var result = [];
17469      for (var j = string2.length;j < array[0].length; ++j) {
17470        var push = false;
17471        var candidate = array[0].charAt(j), candidateLower = candidate.toLowerCase();
17472        for (var i = 1;i < array.length; ++i) {
17473          push = true;
17474          var current = array[i].charAt(j), currentLower = current.toLowerCase();
17475          if (candidate !== current) {
17476            if (matchCase || type === "mixed") {
17477              push = false;
17478              break;
17479            } else if (candidateLower === currentLower) {
17480              if (type === "lower") {
17481                candidate = candidate.toLowerCase();
17482              } else if (type === "upper") {
17483                candidate = candidate.toUpperCase();
17484              } else {
17485                push = false;
17486                break;
17487              }
17488            } else {
17489              push = false;
17490              break;
17491            }
17492          }
17493        }
17494        if (push) {
17495          result.push(candidate);
17496        } else {
17497          break;
17498        }
17499      }
17500      return string2 + result.join("");
17501    }
17502    function trigger_terminal_change(next) {
17503      terminals.forEach(function(term2) {
17504        term2.settings().onTerminalChange.call(term2, next);
17505      });
17506    }
17507    var select = function() {
17508      if (root.getSelection) {
17509        var selection = root.getSelection();
17510        if (selection.setBaseAndExtent) {
17511          return function(start, end) {
17512            var selection = root.getSelection();
17513            selection.setBaseAndExtent(start, 0, end, 1);
17514          };
17515        } else {
17516          return function(start, end) {
17517            var selection = root.getSelection();
17518            var range = document.createRange();
17519            range.setStart(start, 0);
17520            range.setEnd(end, end.childNodes.length);
17521            selection.removeAllRanges();
17522            selection.addRange(range);
17523          };
17524        }
17525      } else {
17526        return $.noop;
17527      }
17528    }();
17529    function process_command(original, fn2) {
17530      var string2 = original.trim();
17531      var array = string2.match(command_re) || [];
17532      if (array.length) {
17533        var name = array.shift();
17534        var args2 = $.map(array, function(arg) {
17535          if (arg.match(/^["']/)) {
17536            arg = arg.replace(/\n/g, "\\u0000\\u0000\\u0000\\u0000");
17537            arg = fn2(arg);
17538            return arg.replace(/\x00\x00\x00\x00/g, `
17539`);
17540          }
17541          return fn2(arg);
17542        });
17543        var quotes = $.map(array, function(arg) {
17544          var m2 = arg.match(/^(['"`]).*\1$/);
17545          return m2 && m2[1] || "";
17546        });
17547        var rest = string2.slice(name.length).trim();
17548        return {
17549          command: original,
17550          name,
17551          args: args2,
17552          args_quotes: quotes,
17553          rest
17554        };
17555      } else {
17556        return {
17557          command: original,
17558          name: "",
17559          args: [],
17560          args_quotes: [],
17561          rest: ""
17562        };
17563      }
17564    }
17565    function on_height_change(callback) {
17566      var scale = window.visualViewport.scale;
17567      var height = Math.round(window.visualViewport.height * scale);
17568      callback(height);
17569      window.visualViewport.addEventListener("resize", function() {
17570        var new_scale = window.visualViewport.scale;
17571        var new_height = Math.round(window.visualViewport.height * new_scale);
17572        if (height !== new_height) {
17573          height = new_height;
17574          callback(height);
17575        }
17576      });
17577    }
17578    $.terminal = {
17579      version: "2.45.2",
17580      date: "Mon, 21 Jul 2025 22:45:43 +0000",
17581      color_names: [
17582        "transparent",
17583        "currentcolor",
17584        "black",
17585        "silver",
17586        "gray",
17587        "white",
17588        "maroon",
17589        "red",
17590        "purple",
17591        "fuchsia",
17592        "green",
17593        "lime",
17594        "olive",
17595        "yellow",
17596        "navy",
17597        "blue",
17598        "teal",
17599        "aqua",
17600        "aliceblue",
17601        "antiquewhite",
17602        "aqua",
17603        "aquamarine",
17604        "azure",
17605        "beige",
17606        "bisque",
17607        "black",
17608        "blanchedalmond",
17609        "blue",
17610        "blueviolet",
17611        "brown",
17612        "burlywood",
17613        "cadetblue",
17614        "chartreuse",
17615        "chocolate",
17616        "coral",
17617        "cornflowerblue",
17618        "cornsilk",
17619        "crimson",
17620        "cyan",
17621        "darkblue",
17622        "darkcyan",
17623        "darkgoldenrod",
17624        "darkgray",
17625        "darkgreen",
17626        "darkgrey",
17627        "darkkhaki",
17628        "darkmagenta",
17629        "darkolivegreen",
17630        "darkorange",
17631        "darkorchid",
17632        "darkred",
17633        "darksalmon",
17634        "darkseagreen",
17635        "darkslateblue",
17636        "darkslategray",
17637        "darkslategrey",
17638        "darkturquoise",
17639        "darkviolet",
17640        "deeppink",
17641        "deepskyblue",
17642        "dimgray",
17643        "dimgrey",
17644        "dodgerblue",
17645        "firebrick",
17646        "floralwhite",
17647        "forestgreen",
17648        "fuchsia",
17649        "gainsboro",
17650        "ghostwhite",
17651        "gold",
17652        "goldenrod",
17653        "gray",
17654        "green",
17655        "greenyellow",
17656        "grey",
17657        "honeydew",
17658        "hotpink",
17659        "indianred",
17660        "indigo",
17661        "ivory",
17662        "khaki",
17663        "lavender",
17664        "lavenderblush",
17665        "lawngreen",
17666        "lemonchiffon",
17667        "lightblue",
17668        "lightcoral",
17669        "lightcyan",
17670        "lightgoldenrodyellow",
17671        "lightgray",
17672        "lightgreen",
17673        "lightgrey",
17674        "lightpink",
17675        "lightsalmon",
17676        "lightseagreen",
17677        "lightskyblue",
17678        "lightslategray",
17679        "lightslategrey",
17680        "lightsteelblue",
17681        "lightyellow",
17682        "lime",
17683        "limegreen",
17684        "linen",
17685        "magenta",
17686        "maroon",
17687        "mediumaquamarine",
17688        "mediumblue",
17689        "mediumorchid",
17690        "mediumpurple",
17691        "mediumseagreen",
17692        "mediumslateblue",
17693        "mediumspringgreen",
17694        "mediumturquoise",
17695        "mediumvioletred",
17696        "midnightblue",
17697        "mintcream",
17698        "mistyrose",
17699        "moccasin",
17700        "navajowhite",
17701        "navy",
17702        "oldlace",
17703        "olive",
17704        "olivedrab",
17705        "orange",
17706        "orangered",
17707        "orchid",
17708        "palegoldenrod",
17709        "palegreen",
17710        "paleturquoise",
17711        "palevioletred",
17712        "papayawhip",
17713        "peachpuff",
17714        "peru",
17715        "pink",
17716        "plum",
17717        "powderblue",
17718        "purple",
17719        "red",
17720        "rosybrown",
17721        "royalblue",
17722        "saddlebrown",
17723        "salmon",
17724        "sandybrown",
17725        "seagreen",
17726        "seashell",
17727        "sienna",
17728        "silver",
17729        "skyblue",
17730        "slateblue",
17731        "slategray",
17732        "slategrey",
17733        "snow",
17734        "springgreen",
17735        "steelblue",
17736        "tan",
17737        "teal",
17738        "thistle",
17739        "tomato",
17740        "turquoise",
17741        "violet",
17742        "wheat",
17743        "white",
17744        "whitesmoke",
17745        "yellow",
17746        "yellowgreen",
17747        "rebeccapurple"
17748      ],
17749      Cycle,
17750      History,
17751      Stack,
17752      EventEmitter,
17753      valid_color: function valid_color(color) {
17754        if (color.match(color_re)) {
17755          return true;
17756        } else {
17757          return $.inArray(color.toLowerCase(), $.terminal.color_names) !== -1;
17758        }
17759      },
17760      unclosed_strings: function unclosed_strings(string2) {
17761        return !!string2.match(unclosed_strings_re);
17762      },
17763      escape_regex: function escape_regex(str) {
17764        if (typeof str === "string") {
17765          var special = /([-\\^$[\]()+{}?*.|])/g;
17766          return str.replace(special, "\\$1");
17767        }
17768      },
17769      have_formatting: function have_formatting(str) {
17770        return typeof str === "string" && !!str.match(format_exist_re);
17771      },
17772      is_formatting: function is_formatting(str) {
17773        return typeof str === "string" && !!str.match(format_full_re);
17774      },
17775      is_extended_command: function is_extended_command(str) {
17776        return typeof str === "string" && str.match(format_exec_re) && !$.terminal.is_formatting(str);
17777      },
17778      each_extended_command: function(string2, fn2) {
17779        var parts = string2.split(format_exec_split_re);
17780        return $.map(parts, function(string2) {
17781          if ($.terminal.is_extended_command(string2)) {
17782            var command = string2.replace(/^\[\[|\]\]$/g, "");
17783            return fn2(command) || "";
17784          }
17785          return string2;
17786        }).join("");
17787      },
17788      format_split: function format_split(str) {
17789        return str.split(format_split_re).filter(Boolean);
17790      },
17791      tracking_replace: function tracking_replace(string2, rex, replacement, position) {
17792        if (!(rex instanceof RegExp)) {
17793          throw new Error("tracking_replace: Second argument need to be RegExp");
17794        }
17795        function substring(string2, start, end) {
17796          return string2.slice(start, end);
17797        }
17798        function length(string2) {
17799          return $.terminal.strip(string2).length;
17800        }
17801        var new_string = "";
17802        var match;
17803        var index = 0;
17804        var rep_string;
17805        var new_position = position;
17806        var start;
17807        rex.lastIndex = 0;
17808        while (match = rex.exec(string2)) {
17809          if (rex.global) {
17810            var last_index = length(substring(string2, 0, rex.lastIndex));
17811            start = last_index - length(match[0]);
17812          } else {
17813            start = match.index;
17814            last_index = start + length(match[0]);
17815          }
17816          if (index < start) {
17817            new_string += substring(string2, index, start);
17818          }
17819          index = last_index;
17820          if (typeof replacement === "function") {
17821            rep_string = replacement.apply(null, match);
17822          } else {
17823            rep_string = replacement.replace(/\$(\$|\d)/g, function(m2, c0) {
17824              if (c0 === "$") {
17825                return "$";
17826              }
17827              return match[c0];
17828            });
17829          }
17830          new_string += rep_string;
17831          if (start < position) {
17832            var rep_len = length(rep_string);
17833            rep_len += count_selfclosing_formatting(rep_string);
17834            if (last_index < position) {
17835              new_position = Math.max(0, new_position + rep_len - length(match[0]));
17836            } else {
17837              new_position += rep_len - (position - start);
17838            }
17839          }
17840          if (!rex.global) {
17841            break;
17842          }
17843        }
17844        if (index < length(string2)) {
17845          new_string += substring(string2, index);
17846        }
17847        if (string2 === new_string) {
17848          return [string2, position];
17849        }
17850        return [new_string, new_position];
17851      },
17852      iterate_formatting: function iterate_formatting(string2, callback) {
17853        function is_any_space(str) {
17854          return str === " " || str === "\t" || str === `
17855`;
17856        }
17857        function is_space(i) {
17858          if (!have_entities) {
17859            return is_any_space(string2[i - 1]);
17860          }
17861          return string2.slice(i - 6, i) === "&nbsp;" || is_any_space(string2[i - 1]);
17862        }
17863        function match_entity(index) {
17864          if (!have_entities) {
17865            return null;
17866          }
17867          return string2.slice(index).match(entity_re);
17868        }
17869        function is_open_formatting(i) {
17870          return string2[i] === "[" && string2[i + 1] === "[";
17871        }
17872        function is_escape_bracket(i) {
17873          return string2[i - 1] !== "\\" && string2[i] === "\\" && string2[i + 1] === "]";
17874        }
17875        function is_bracket(i) {
17876          return string2[i] === "]" || string2[i] === "[";
17877        }
17878        function is_text(i) {
17879          return not_formatting && !opening && (string2[i] !== "]" && !closing_formatting || !have_formatting) || in_text && !formatting;
17880        }
17881        var get_next_character2 = make_next_char_fun(string2);
17882        function next_iteration() {
17883          var char = get_next_character2(substring);
17884          if (char.length > 1 && $.terminal.length(substring) > 1) {
17885            return char.length - 1;
17886          }
17887          return 0;
17888        }
17889        function is_next_space() {
17890          return is_space(i) && (not_formatting || opening) && (space === -1 && prev_space !== i || space !== -1);
17891        }
17892        var last = false;
17893        function is_last() {
17894          if (i === string2.length - 1 && !last) {
17895            last = true;
17896          } else {
17897            last = formatting && !!substring.match(/^.]$/);
17898          }
17899          return last;
17900        }
17901        var have_formatting = $.terminal.have_formatting(string2);
17902        var have_entities = entity_re.test(string2);
17903        var formatting = "";
17904        var in_text = false;
17905        var count = 0;
17906        var match;
17907        var space = -1;
17908        var space_count = -1;
17909        var prev_space;
17910        var length = 0;
17911        var offset = 0;
17912        var re_ent = /(&[^;]+);$/;
17913        for (var i = 0;i < string2.length; i++) {
17914          var substring = string2.slice(i);
17915          var closing_formatting = false;
17916          match = substring.match(format_start_re);
17917          if (match) {
17918            formatting = match[1];
17919            in_text = false;
17920          } else if (formatting) {
17921            if (string2[i] === "]") {
17922              closing_formatting = in_text;
17923              if (in_text) {
17924                formatting = "";
17925                in_text = false;
17926              } else {
17927                in_text = true;
17928              }
17929            }
17930          } else {
17931            in_text = true;
17932          }
17933          var not_formatting = formatting && in_text || !formatting;
17934          var opening = is_open_formatting(i);
17935          if (is_next_space()) {
17936            space = i;
17937            space_count = count;
17938          }
17939          var braket = is_bracket(i);
17940          offset = 0;
17941          if (not_formatting) {
17942            if (string2[i] === "&") {
17943              match = match_entity(i);
17944              if (match) {
17945                i += match[1].length - 2;
17946                continue;
17947              }
17948              ++count;
17949              ++length;
17950            } else if (is_escape_bracket(i)) {
17951              ++count;
17952              ++length;
17953              offset = 1;
17954              i += 1;
17955            } else if (!braket || !have_formatting || in_text && !formatting) {
17956              ++count;
17957              ++length;
17958            }
17959          }
17960          if (is_text(i)) {
17961            if (strlen(string2[i]) === 2) {
17962              length++;
17963            }
17964            var char = get_next_character2(substring);
17965            var size = char.length;
17966            if (char === ";") {
17967              match = string2.slice(0, i + 1).match(re_ent);
17968              if (match) {
17969                offset = match[1].length;
17970                size = offset + 1;
17971              }
17972            }
17973            var data = {
17974              last: is_last(),
17975              count,
17976              index: i - offset,
17977              formatting,
17978              length,
17979              text: in_text,
17980              size,
17981              space,
17982              space_count
17983            };
17984            var ret2 = callback(data);
17985            if (ret2 === false) {
17986              break;
17987            } else if (ret2) {
17988              if (ret2.count !== undefined) {
17989                count = ret2.count;
17990              }
17991              if (ret2.length !== undefined) {
17992                length = ret2.length;
17993              }
17994              if (ret2.space !== undefined) {
17995                prev_space = space;
17996                space = ret2.space;
17997              }
17998              if (ret2.index !== undefined) {
17999                i = ret2.index;
18000                continue;
18001              }
18002            }
18003          } else if (i === string2.length - 1 && !last) {
18004            callback({
18005              last: true,
18006              count: count + 1,
18007              index: i,
18008              formatting,
18009              length: 0,
18010              text: in_text,
18011              space
18012            });
18013          }
18014          if (in_text) {
18015            i += next_iteration();
18016          }
18017        }
18018      },
18019      partition: function partition(string2, options2) {
18020        var settings2 = $.extend({
18021          wrap: true
18022        }, options2);
18023        if (!$.terminal.have_formatting(string2)) {
18024          var chars = $.terminal.split_characters(string2);
18025          return chars.map(wrap);
18026        }
18027        var result = [];
18028        function wrap(string2) {
18029          if (string2.match(/\\$/)) {
18030            string2 += "\\";
18031          }
18032          return "[[;;]" + string2 + "]";
18033        }
18034        function formatting(string2) {
18035          if ($.terminal.is_formatting(string2)) {
18036            if (string2.match(/\\]$/)) {
18037              string2 = string2.replace(/\\]/g, "\\\\]");
18038            }
18039          } else if (settings2.wrap) {
18040            string2 = wrap(string2);
18041          }
18042          return string2;
18043        }
18044        $.terminal.iterate_formatting(string2, function callback(data) {
18045          if (data.text) {
18046            var text2 = [];
18047            if (data.formatting) {
18048              text2.push(data.formatting);
18049            }
18050            text2.push(string2.substring(data.index, data.index + data.size));
18051            if (data.formatting) {
18052              text2.push("]");
18053            }
18054            result.push(formatting(text2.join("")));
18055          }
18056        });
18057        return result;
18058      },
18059      substring: function substring(string2, start_index, end_index) {
18060        var chars = $.terminal.split_characters(string2);
18061        if (!chars.slice(start_index, end_index).length) {
18062          return "";
18063        }
18064        if (!$.terminal.have_formatting(string2)) {
18065          return chars.slice(start_index, end_index).join("");
18066        }
18067        var start = 0;
18068        var end;
18069        var start_formatting = "";
18070        var end_formatting = "";
18071        var prev_index;
18072        var offset = 1;
18073        $.terminal.iterate_formatting(string2, function callback(data) {
18074          if (start_index && data.count === start_index + 1) {
18075            start = data.index;
18076            if (data.formatting) {
18077              start_formatting = data.formatting;
18078            }
18079          }
18080          if (end_index && data.count === end_index) {
18081            end_formatting = data.formatting;
18082            prev_index = data.index;
18083            offset = data.size;
18084          }
18085          if (data.count === end_index + 1) {
18086            end = data.index;
18087            if (data.formatting) {
18088              end = prev_index + offset;
18089            }
18090          }
18091        });
18092        if (start_index && !start) {
18093          return "";
18094        }
18095        if (end === undefined) {
18096          end = string2.length;
18097        }
18098        string2 = start_formatting + string2.slice(start, end);
18099        if (end_formatting) {
18100          string2 = string2.replace(/(\[\[[^\]]+)?\]$/, "");
18101          string2 += "]";
18102        }
18103        return string2;
18104      },
18105      normalize: function normalize(str) {
18106        str = str.replace(format_re, function callback(_, format, text2) {
18107          if (format.match(self_closing_re) && text2 === "") {
18108            return "[[" + format + "] ]";
18109          }
18110          if (text2 === "") {
18111            return "";
18112          }
18113          function safe2(str) {
18114            return str.replace(/\\\]/g, "&#93;").replace(/\n/g, "\\n").replace(/&nbsp;/g, " ");
18115          }
18116          format = safe2(format);
18117          var semicolons = format.match(/;/g).length;
18118          if (semicolons >= 4) {
18119            var args2 = format.split(/;/);
18120            var start = args2.slice(0, 4).join(";");
18121            var arg = args2.slice(4).join(";");
18122            return "[[" + start + ";" + (arg || text2) + "]" + text2 + "]";
18123          } else if (semicolons === 2) {
18124            semicolons = ";;";
18125          } else if (semicolons === 3) {
18126            semicolons = ";";
18127          }
18128          format += semicolons + safe2(text2);
18129          return "[[" + format + "]" + text2 + "]";
18130        });
18131        return $.terminal.amp(str);
18132      },
18133      split_equal: function split_equal(str, length, options2) {
18134        if (typeof options2 === "boolean") {
18135          options2 = {
18136            keepWords: options2
18137          };
18138        }
18139        var settings2 = $.extend({
18140          trim: false,
18141          keepWords: false
18142        }, options2);
18143        var prev_format = "";
18144        var result = [];
18145        var array = $.terminal.normalize(str).split(/\n/g);
18146        var have_formatting = $.terminal.have_formatting(str);
18147        for (var i = 0, len = array.length;i < len; ++i) {
18148          if (array[i] === "") {
18149            result.push("");
18150            continue;
18151          }
18152          var line = array[i];
18153          var get_next_character2 = make_next_char_fun(line);
18154          var first_index = 0;
18155          var output;
18156          var line_length = line.length;
18157          var last_bracket = /\[\[[^\]]+\](?:[^\][]|\\\])+\]$/.test(line);
18158          var leading_spaces = /^(&nbsp;|\s)/.test(line);
18159          if (!have_formatting && line_length < length) {
18160            result.push(line);
18161            continue;
18162          }
18163          $.terminal.iterate_formatting(line, function callback(data) {
18164            var chr, substring;
18165            if (data.length >= length || data.last || data.length === length - 1 && strlen(line[data.index + 1]) === 2) {
18166              var can_break = false;
18167              if (settings2.keepWords && data.space !== -1) {
18168                var stripped = text(line).substring(data.space_count);
18169                stripped = stripped.slice(0, length).replace(/\s+$/, "");
18170                var text_len = strlen(stripped);
18171                if (space_re.test(stripped) || text_len < length) {
18172                  can_break = true;
18173                }
18174              }
18175              var after_index = data.index + data.size;
18176              if (last_bracket) {
18177                after_index += 1;
18178              }
18179              var new_index;
18180              if (settings2.keepWords && data.space !== -1 && after_index !== line_length && can_break) {
18181                output = line.slice(first_index, data.space);
18182                new_index = data.space - 1;
18183              } else {
18184                substring = line.slice(data.index);
18185                chr = get_next_character2(substring);
18186                output = line.slice(first_index, data.index) + chr;
18187                if (data.last && last_bracket && chr !== "]") {
18188                  output += "]";
18189                }
18190                new_index = data.index + chr.length - 1;
18191              }
18192              if (settings2.trim || settings2.keepWords) {
18193                output = output.replace(/(&nbsp;|\s)+$/g, "");
18194              }
18195              if (!leading_spaces && !prev_format) {
18196                output = output.replace(/^(&nbsp;|\s)+/g, "");
18197              }
18198              first_index = (new_index || data.index) + 1;
18199              if (prev_format) {
18200                var closed_formatting = /^[^\]]*\]/.test(output);
18201                output = prev_format + output;
18202                if (closed_formatting) {
18203                  prev_format = "";
18204                }
18205              }
18206              var matched = output.match(format_re);
18207              if (matched) {
18208                var last = matched[matched.length - 1];
18209                if (last[last.length - 1] !== "]") {
18210                  prev_format = last.match(format_begin_re)[1];
18211                  output += "]";
18212                } else if (format_end_re.test(output)) {
18213                  output = output.replace(format_end_re, "");
18214                  prev_format = last.match(format_begin_re)[1];
18215                }
18216              }
18217              result.push(output);
18218              return { index: new_index, length: 0, space: -1 };
18219            }
18220          });
18221        }
18222        return result;
18223      },
18224      amp,
18225      encode: function encode(str, options2) {
18226        var settings2 = $.extend({
18227          tabs: 4,
18228          before: ""
18229        }, options2);
18230        return safe(str).replace(/ /g, "&nbsp;").split(`
18231`).map(function(line) {
18232          var splitted = line.split(/((?:\[\[[^\]]+\])?\t(?:\])?)/);
18233          splitted = splitted.filter(Boolean);
18234          return splitted.map(function(str, i) {
18235            if (str.match(/\t/)) {
18236              return str.replace(/\t([^\t]*)$/, function(_, end) {
18237                if (i !== 0 && splitted[i - 1].match(/\t\]?$/)) {
18238                  var sp = new Array(settings2.tabs + 1).join("&nbsp;");
18239                  return sp + end;
18240                } else {
18241                  var before = splitted.slice(i - 1, i).join("");
18242                  if (settings2.before && i <= 1) {
18243                    before = settings2.before + before;
18244                  }
18245                  var len = $.terminal.length(before);
18246                  var chars = settings2.tabs - len % settings2.tabs;
18247                  if (chars === 0) {
18248                    chars = 4;
18249                  }
18250                  return new Array(chars + 1).join("&nbsp;") + end;
18251                }
18252              });
18253            }
18254            return str;
18255          }).join("");
18256        }).join(`
18257`);
18258      },
18259      nested_formatting: function nested_formatting(string2) {
18260        if (!$.terminal.have_formatting(string2)) {
18261          return string2;
18262        }
18263        var stack = [];
18264        var re = /((?:\[\[(?:[^\][]|\\\])+\])?(?:[^\][]|\\\])*\]?)/;
18265        var format_re2 = /\[\[([^\][]+)\][\s\S]*/;
18266        var format_split_re2 = /^\[\[([^;]*);([^;]*);([^\]]*)\]/;
18267        var class_i = 3;
18268        var attrs_i = 5;
18269        function unique(value, index, self2) {
18270          return self2.indexOf(value) === index;
18271        }
18272        function update_style(new_style, old_style) {
18273          new_style = parse_style(new_style);
18274          if (!old_style) {
18275            return new_style;
18276          }
18277          return $.extend(old_style, new_style);
18278        }
18279        function parse_style(string2) {
18280          var style = {};
18281          string2.split(/\s*;\s*/).forEach(function(string2) {
18282            var parts = string2.split(":").map(function(string2) {
18283              return string2.trim();
18284            });
18285            var prop = parts[0];
18286            var value = parts[1];
18287            style[prop] = value;
18288          });
18289          return style;
18290        }
18291        function stringify_formatting(input) {
18292          var result = input.slice();
18293          if (input[attrs_i]) {
18294            result[attrs_i] = stringify_attrs(input[attrs_i]);
18295          }
18296          if (input[class_i]) {
18297            result[class_i] = stringify_class(input[class_i]);
18298          }
18299          result[0] = stringify_styles(input[0]);
18300          return result.join(";");
18301        }
18302        function stringify_styles(input) {
18303          var ignore = input.filter(function(s) {
18304            return s[0] === "-";
18305          }).map(function(s) {
18306            return s[1];
18307          });
18308          return input.filter(function(s) {
18309            return ignore.indexOf(s) === -1 && ignore.indexOf(s[1]) === -1;
18310          }).join("");
18311        }
18312        function stringify_attrs(attrs) {
18313          return JSON.stringify(attrs, function(key, value) {
18314            if (key === "style") {
18315              return stringify_style(value);
18316            }
18317            return value;
18318          });
18319        }
18320        function stringify_class(klass) {
18321          return klass.filter(unique).join(" ");
18322        }
18323        function stringify_style(style) {
18324          return Object.keys(style).map(function(prop) {
18325            return prop + ":" + style[prop];
18326          }).join(";");
18327        }
18328        function get_inherit_style(stack) {
18329          function update_attrs(value) {
18330            if (!output[attrs_i]) {
18331              output[attrs_i] = {};
18332            }
18333            try {
18334              var new_attrs = JSON.parse(value);
18335              if (new_attrs.style) {
18336                var new_style = new_attrs.style;
18337                var old_style = output[attrs_i].style;
18338                new_attrs.style = update_style(new_style, old_style);
18339                output[attrs_i] = $.extend(new_attrs, output[attrs_i], {
18340                  style: update_style(new_style, old_style)
18341                });
18342              } else {
18343                output[attrs_i] = $.extend(new_attrs, output[attrs_i]);
18344              }
18345            } catch (e) {
18346              warn("Invalid JSON " + value);
18347            }
18348          }
18349          var output = [[], "", ""];
18350          if (!stack.length) {
18351            return output;
18352          }
18353          for (var i = stack.length;i--; ) {
18354            var formatting = $.terminal.parse_formatting(stack[i]);
18355            if (formatting.length > 5) {
18356              var last = formatting.slice(5).join(";");
18357              formatting = formatting.slice(0, 5).concat(last);
18358            }
18359            var style = formatting[0].split(/(-?[@!gbiusor])/g).filter(Boolean);
18360            style.forEach(function(s) {
18361              if (output[0].indexOf(s) === -1) {
18362                output[0].push(s);
18363              }
18364            });
18365            for (var j = 1;j < formatting.length; ++j) {
18366              var value = formatting[j].trim();
18367              if (value) {
18368                if (j === class_i) {
18369                  if (!output[class_i]) {
18370                    output[class_i] = [];
18371                  }
18372                  var classes = value.split(/\s+/);
18373                  output[class_i] = output[class_i].concat(classes);
18374                } else if (j === attrs_i) {
18375                  update_attrs(value);
18376                } else if (!output[j]) {
18377                  output[j] = value;
18378                }
18379              }
18380            }
18381          }
18382          return stringify_formatting(output);
18383        }
18384        return string2.split(re).filter(Boolean).map(function(string2) {
18385          var style;
18386          if (string2.match(/^\[\[/) && !$.terminal.is_extended_command(string2)) {
18387            var formatting = string2.replace(format_re2, "$1");
18388            var is_formatting = $.terminal.is_formatting(string2);
18389            string2 = string2.replace(format_split_re2, "");
18390            stack.push(formatting);
18391            if ($.terminal.nested_formatting.__inherit__) {
18392              style = get_inherit_style(stack);
18393            } else {
18394              style = formatting;
18395            }
18396            if (!is_formatting) {
18397              string2 += "]";
18398            } else {
18399              stack.pop();
18400            }
18401            string2 = "[[" + style + "]" + string2;
18402          } else {
18403            var pop = false;
18404            if (string2.match(/\]/)) {
18405              pop = true;
18406            }
18407            if (stack.length) {
18408              if ($.terminal.nested_formatting.__inherit__) {
18409                style = get_inherit_style(stack);
18410              } else {
18411                style = stack[stack.length - 1];
18412              }
18413              string2 = "[[" + style + "]" + string2;
18414            }
18415            if (pop) {
18416              stack.pop();
18417            } else if (stack.length) {
18418              string2 += "]";
18419            }
18420          }
18421          return string2;
18422        }).join("");
18423      },
18424      using_xml_formatter: function using_xml_formatter() {
18425        if (!("xml_formatter" in $.terminal)) {
18426          return false;
18427        }
18428        var formatters = $.terminal.defaults.formatters;
18429        return formatters.includes($.terminal.xml_formatter);
18430      },
18431      escape_formatting: function escape_formatting(string2) {
18432        var result = $.terminal.escape_brackets(string2);
18433        if ($.terminal.using_xml_formatter()) {
18434          result = safe(result);
18435        }
18436        return result;
18437      },
18438      apply_formatters: function apply_formatters(string2, settings2) {
18439        if (string2 === "") {
18440          if (settings2 && typeof settings2.position === "number") {
18441            return ["", settings2.position];
18442          } else {
18443            return "";
18444          }
18445        }
18446        function test_lengths(formatter, index, ret2, string2) {
18447          if (!formatter.__no_warn__ && $.terminal.length(ret2) !== $.terminal.length(string2)) {
18448            warn("Your formatter[" + index + "] change length of the string, " + "you should use [regex, replacement] formatter or function " + " that return [replacement, position] instead");
18449          }
18450        }
18451        function should_format(options2) {
18452          if (!settings2 || !options2) {
18453            return true;
18454          }
18455          var props = ["echo", "command", "prompt"];
18456          var have_any = props.some(function(name) {
18457            return options2[name] === true;
18458          });
18459          if (!have_any) {
18460            return true;
18461          }
18462          for (var i = props.length;i--; ) {
18463            var prop = props[i];
18464            if (options2[prop] === true && settings2[prop] === true) {
18465              return true;
18466            }
18467          }
18468          return false;
18469        }
18470        settings2 = settings2 || {};
18471        var formatters = settings2.formatters || $.terminal.defaults.formatters;
18472        var i = 0;
18473        function apply_function_formatter(formatter, input) {
18474          var options2 = $.extend({}, settings2, {
18475            position: input[1]
18476          });
18477          var ret2 = formatter(input[0], options2);
18478          if (typeof ret2 === "string") {
18479            test_lengths(formatter, i - 1, ret2, input[0]);
18480            return [ret2, options2.position];
18481          } else if (is_array(ret2) && ret2.length === 2) {
18482            return ret2;
18483          } else {
18484            return input;
18485          }
18486        }
18487        var input;
18488        if (typeof settings2.position === "number") {
18489          input = [string2, settings2.position];
18490        } else {
18491          input = [string2, 0];
18492        }
18493        try {
18494          var result = formatters.reduce(function(input, formatter) {
18495            i++;
18496            if (typeof formatter === "function" && formatter.__meta__) {
18497              return apply_function_formatter(formatter, input);
18498            } else {
18499              var length = 0;
18500              var found_position = false;
18501              var splitted = $.terminal.format_split(input[0]);
18502              var partials = splitted.map(function(string2) {
18503                var position;
18504                var this_len = text(string2).length;
18505                if (input[1] < length + this_len && !found_position) {
18506                  position = input[1] - length;
18507                  found_position = true;
18508                } else if (found_position) {
18509                  position = -1;
18510                } else {
18511                  position = input[1];
18512                }
18513                var length_before = length;
18514                var result;
18515                length += this_len;
18516                if ($.terminal.is_formatting(string2)) {
18517                  if (found_position) {
18518                    return [string2, position];
18519                  }
18520                  return [string2, -1];
18521                } else {
18522                  if (is_array(formatter)) {
18523                    var options2 = formatter[2] || {};
18524                    result = [string2, position < 0 ? 0 : position];
18525                    if (result[0].match(formatter[0]) && should_format(formatter[2])) {
18526                      if (options2.loop) {
18527                        while (result[0].match(formatter[0])) {
18528                          result = $.terminal.tracking_replace(result[0], formatter[0], formatter[1], result[1]);
18529                        }
18530                      } else {
18531                        result = $.terminal.tracking_replace(result[0], formatter[0], formatter[1], result[1]);
18532                      }
18533                    }
18534                    if (position < 0) {
18535                      return [result[0], -1];
18536                    }
18537                  } else if (typeof formatter === "function") {
18538                    result = apply_function_formatter(formatter, [
18539                      string2,
18540                      position
18541                    ]);
18542                  }
18543                  if (typeof result !== "undefined") {
18544                    if (result[1] !== -1) {
18545                      result[1] += length_before;
18546                    }
18547                    var after_len = text(result[0]).length;
18548                    if (after_len !== this_len) {}
18549                    return result;
18550                  }
18551                  return [string2, -1];
18552                }
18553              });
18554              var position_partial = partials.filter(function(partial) {
18555                return partial[1] !== -1;
18556              })[0];
18557              var string2 = partials.map(function(partial) {
18558                return partial[0];
18559              }).join("");
18560              var position;
18561              if (typeof position_partial === "undefined") {
18562                position = input[1];
18563              } else {
18564                position = position_partial[1];
18565              }
18566              var max = text(string2).length;
18567              max += count_selfclosing_formatting(string2);
18568              if (position > max) {
18569                position = max;
18570              }
18571              if (string2 === input[0]) {
18572                return input;
18573              }
18574              var before = $.terminal.strip(input[0]);
18575              var after = $.terminal.strip(string2);
18576              if (before === after) {
18577                return [string2, input[1]];
18578              }
18579              return [string2, position];
18580            }
18581          }, input);
18582          if (typeof settings2.position === "number") {
18583            var codepoint_len = $.terminal.strip(result[0]).length;
18584            if ($.terminal.length(result[0]) < codepoint_len) {
18585              var position = result[1];
18586              position = normalize_position(result[0], position);
18587              var max = $.terminal.length(result[0]);
18588              if (position > max) {
18589                position = max;
18590              }
18591              result[1] = position;
18592            }
18593            return result;
18594          } else {
18595            return result[0];
18596          }
18597        } catch (e) {
18598          var msg = "Error in formatter [" + (i - 1) + "]";
18599          formatters.splice(i - 1);
18600          throw new $.terminal.Exception("formatting", msg, e.stack);
18601        }
18602      },
18603      escape_brackets: function escape_brackets(string2) {
18604        return string2.replace(/\[/g, "&#91;").replace(/\]/g, "&#93;").replace(/\\/g, "&#92;");
18605      },
18606      unescape_brackets: function unescape_brackets(string2) {
18607        return string2.replace(/&#91;/g, "[").replace(/&#93;/g, "]").replace(/&#92;/g, "\\");
18608      },
18609      length: function length(string2, raw) {
18610        if (!string2) {
18611          return 0;
18612        }
18613        return $.terminal.split_characters(raw ? string2 : text(string2)).length;
18614      },
18615      split_characters: function split_characters(string2) {
18616        if (is_simple_text(string2)) {
18617          return string2.split("");
18618        }
18619        var result = [];
18620        var get_next_character2 = make_next_char_fun(string2);
18621        while (string2.length) {
18622          var chr = get_next_character2(string2);
18623          string2 = string2.slice(chr.length);
18624          result.push(chr);
18625        }
18626        return result;
18627      },
18628      columns: function columns(array, cols, space) {
18629        array = array.map(function(value) {
18630          if (typeof value !== "string") {
18631            return String(value);
18632          }
18633          return value;
18634        });
18635        var no_formatting = array.map(function(value) {
18636          return $.terminal.strip(value);
18637        });
18638        var lengths = no_formatting.map(function(string2) {
18639          return strlen(string2);
18640        });
18641        if (typeof space === "undefined") {
18642          space = 4;
18643        }
18644        var length = Math.max.apply(null, lengths) + space;
18645        var column_limit = Math.floor(cols / length) - 1;
18646        if (column_limit < 1) {
18647          return array.join(`
18648`);
18649        }
18650        var lines = [];
18651        for (var i = 0, len = array.length;i < len; i += column_limit) {
18652          var line = array.slice(i, i + column_limit);
18653          var last = line.pop();
18654          lines.push(line.reduce(function(acc, string2) {
18655            var stripped = $.terminal.strip(string2);
18656            var pad = new Array(length - stripped.length + 1).join(" ");
18657            acc.push(string2 + pad);
18658            return acc;
18659          }, []).join("") + last);
18660        }
18661        return lines.join(`
18662`);
18663      },
18664      strip: function strip(str) {
18665        if (!$.terminal.have_formatting(str)) {
18666          return str;
18667        }
18668        return $.terminal.format_split(str).map(function(str) {
18669          if ($.terminal.is_formatting(str)) {
18670            str = str.replace(format_parts_re, "$6");
18671            return str.replace(/\\([[\]])/g, function(whole, bracket) {
18672              return bracket;
18673            });
18674          }
18675          return str;
18676        }).join("");
18677      },
18678      active: function active() {
18679        return terminals.front();
18680      },
18681      last_id: function last_id() {
18682        var len = terminals.length();
18683        return len - 1;
18684      },
18685      parse_argument: function parse_argument(arg, strict) {
18686        function parse_string(string2) {
18687          return string2.split(string_re).map(function(string2) {
18688            if (string2.match(/^['"`]/)) {
18689              if (string2 === '""' || string2 === "''" || string2 === "``") {
18690                return "";
18691              }
18692              var quote = string2[0];
18693              var re = new RegExp("(\\\\\\\\(?:\\\\\\\\)*)" + quote, "g");
18694              string2 = string2.replace(re, "$1").replace(/^[`'"]|[`'"]$/g, "");
18695              if (quote === "'") {
18696                string2 = string2.replace(/"/g, "\\\"");
18697              }
18698            }
18699            string2 = '"' + string2 + '"';
18700            return JSON.parse(string2);
18701          }).join("");
18702        }
18703        if (strict === false) {
18704          if (arg[0] === "'" && arg[arg.length - 1] === "'") {
18705            return arg.replace(/^'|'$/g, "");
18706          } else if (arg[0] === "`" && arg[arg.length - 1] === "`") {
18707            return arg.replace(/^`|`$/g, "");
18708          } else if (arg[0] === '"' && arg[arg.length - 1] === '"') {
18709            return arg.replace(/^"|"$/g, "").replace(/\\([" ])/g, "$1");
18710          } else if (arg.match(/\/.*\/[gimy]*$/)) {
18711            return arg;
18712          } else if (arg.match(/['"`]]/)) {
18713            return parse_string(arg);
18714          } else {
18715            return arg.replace(/\\ /g, " ");
18716          }
18717        }
18718        if (arg === "true") {
18719          return true;
18720        } else if (arg === "false") {
18721          return false;
18722        }
18723        var regex = arg.match(re_re);
18724        if (regex) {
18725          return new RegExp(regex[1], regex[2]);
18726        } else if (arg.match(/['"`]/)) {
18727          return parse_string(arg);
18728        } else if (arg.match(/^-?[0-9]+n?$/)) {
18729          if (arg.match(/n$/)) {
18730            return BigInt(arg.replace(/n$/, ""));
18731          }
18732          return parseInt(arg, 10);
18733        } else if (arg.match(float_re)) {
18734          return parseFloat(arg);
18735        } else {
18736          return arg.replace(/\\(['"() ])/g, "$1");
18737        }
18738      },
18739      parse_arguments: function parse_arguments(string2) {
18740        return $.map(string2.match(command_re) || [], $.terminal.parse_argument);
18741      },
18742      split_arguments: function split_arguments(string2) {
18743        return $.map(string2.match(command_re) || [], function(arg) {
18744          return $.terminal.parse_argument(arg, false);
18745        });
18746      },
18747      parse_command: function parse_command(string2) {
18748        return process_command(string2, $.terminal.parse_argument);
18749      },
18750      split_command: function split_command(string2) {
18751        return process_command(string2, function(arg) {
18752          return $.terminal.parse_argument(arg, false);
18753        });
18754      },
18755      parse_options: function parse_options(arg, options2) {
18756        var settings2 = $.extend({}, {
18757          boolean: []
18758        }, options2);
18759        if (typeof arg === "string") {
18760          return parse_options($.terminal.split_arguments(arg), options2);
18761        }
18762        var result = {
18763          _: []
18764        };
18765        function token(value) {
18766          this.value = value;
18767        }
18768        var rest = arg.reduce(function(acc, arg) {
18769          var str = typeof arg === "string" ? arg : "";
18770          if (str.match(/^--?[^-]/) && acc instanceof token) {
18771            result[acc.value] = true;
18772          }
18773          if (str.match(/^--[^-]/)) {
18774            var name = str.replace(/^--/, "");
18775            if (settings2.boolean.indexOf(name) === -1) {
18776              return new token(name);
18777            } else {
18778              result[name] = true;
18779            }
18780          } else if (str.match(/^-[^-]/)) {
18781            var single = str.replace(/^-/, "").split("");
18782            if (settings2.boolean.indexOf(single.slice(-1)[0]) === -1) {
18783              var last = single.pop();
18784            }
18785            single.forEach(function(single) {
18786              result[single] = true;
18787            });
18788            if (last) {
18789              return new token(last);
18790            }
18791          } else if (acc instanceof token) {
18792            result[acc.value] = arg;
18793          } else if (arg) {
18794            result._.push(arg);
18795          }
18796          return null;
18797        }, null);
18798        if (rest instanceof token) {
18799          result[rest.value] = true;
18800        }
18801        return result;
18802      },
18803      parse_formatting: function(string2) {
18804        var formatting = $.terminal.unescape_brackets(string2).split(";");
18805        var text_part = 4;
18806        if (formatting.length >= 5) {
18807          var escaped = $.terminal.escape_brackets(formatting[text_part]);
18808          formatting[text_part] = escaped;
18809        }
18810        return formatting;
18811      },
18812      extended_command: function extended_command(term, string, options) {
18813        var settings = $.extend({
18814          invokeMethods: false
18815        }, options);
18816        var deferred = new $.Deferred;
18817        try {
18818          change_hash = false;
18819          var m = string.match(extended_command_re);
18820          if (m) {
18821            if (!settings.invokeMethods) {
18822              warn("To invoke terminal or cmd methods you need to enable " + "invokeMethods option");
18823              deferred.reject();
18824            } else {
18825              string = m[1];
18826              var obj = m[2] === "terminal" ? term : term.cmd();
18827              var fn = m[3];
18828              try {
18829                var args = eval("[" + m[4] + "]");
18830                if (!obj[fn]) {
18831                  term.error("Unknow function " + fn);
18832                } else {
18833                  var ret = obj[fn].apply(term, args);
18834                  if (ret && ret.then) {
18835                    return ret;
18836                  }
18837                }
18838                deferred.resolve();
18839              } catch (e) {
18840                term.error("Invalid invocation in " + $.terminal.escape_brackets(string));
18841                deferred.reject();
18842              }
18843            }
18844          } else {
18845            return term.exec(string, true).done(function() {
18846              change_hash = true;
18847            });
18848          }
18849        } catch (e) {
18850          deferred.reject();
18851        }
18852        return deferred.promise();
18853      },
18854      iterator: function(string2) {
18855        function formatting(string2) {
18856          if ($.terminal.is_formatting(string2)) {
18857            if (string2.match(/\]\\\]/)) {
18858              string2 = string2.replace(/\]\\\]/g, "]\\\\]");
18859            }
18860          }
18861          return string2;
18862        }
18863        if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
18864          var len = $.terminal.length(string2);
18865          var i = 0;
18866          var obj2 = {};
18867          obj2[Symbol.iterator] = function() {
18868            return {
18869              next: function() {
18870                if (i < len) {
18871                  var text2 = $.terminal.substring(string2, i, i + 1);
18872                  i++;
18873                  return {
18874                    value: formatting(text2)
18875                  };
18876                } else {
18877                  return {
18878                    done: true
18879                  };
18880                }
18881              }
18882            };
18883          };
18884          return obj2;
18885        }
18886      },
18887      formatter: new function() {
18888        try {
18889          this[Symbol.split] = function(string2) {
18890            return $.terminal.format_split(string2);
18891          };
18892          this[Symbol.match] = function(string2) {
18893            return string2.match(format_re);
18894          };
18895          this[Symbol.replace] = function(string2, replacer) {
18896            return string2.replace(format_parts_re, replacer);
18897          };
18898          this[Symbol.search] = function(string2) {
18899            return string2.search(format_re);
18900          };
18901        } catch (e) {}
18902      },
18903      process_formatting: function(string2) {
18904        return $.terminal.format_split(string2).map(function(string2) {
18905          if ($.terminal.is_formatting(string2)) {
18906            var parts = string2.match(new RegExp(format_parts_re, "i"));
18907            var text2 = parts.pop();
18908            for (var i = 1;i <= 2; ++i) {
18909              if (!$.terminal.valid_color(parts[i])) {
18910                parts[i] = "";
18911              }
18912            }
18913            return parts.slice(1, 4).concat(text2);
18914          } else {
18915            return ["", "", "", string2];
18916          }
18917        });
18918      },
18919      new_formatter: function(formatter) {
18920        $.terminal.defaults.formatters.unshift(formatter);
18921      },
18922      remove_formatter: function(formatter) {
18923        remove($.terminal.defaults.formatters, function(item) {
18924          return item === formatter;
18925        });
18926      }
18927    };
18928    (function() {
18929      function clean_data(data, text2) {
18930        if (data === "") {
18931          return text2;
18932        } else {
18933          return data.replace(/&#93;/g, "]").replace(/>/g, "&gt;").replace(/</g, "&lt;").replace(/"/g, "&quot;");
18934        }
18935      }
18936      function is_path(url) {
18937        return url.match(/^\.{1,2}\//) || url.match(/^\//) || !(url.match(/\//) || url.match(/^[^:]+:/));
18938      }
18939      function with_url_validation(fn2, settings2) {
18940        return function(url) {
18941          if (settings2.anyLinks) {
18942            return true;
18943          }
18944          var test = fn2(url);
18945          if (!test) {
18946            warn("Invalid URL " + url + " only http(s), blob, ftp, and " + "paths are allowed!");
18947          }
18948          return test;
18949        };
18950      }
18951      var href_re = /^(((?:blob:)?https?|file|ftp):\/\/|\.{0,2}\/)/;
18952      var src_re = /^(https?:|file:|blob:|data:)/;
18953      $.terminal.format = function format(str, options2) {
18954        var settings2 = $.extend({}, {
18955          linksNoReferrer: false,
18956          linksNoFollow: false,
18957          allowedAttributes: [],
18958          charWidth: undefined,
18959          escape: true,
18960          anyLinks: false
18961        }, options2 || {});
18962        var valid_href = with_url_validation(function(url) {
18963          return url.match(href_re) || is_path(url);
18964        }, settings2);
18965        var valid_src = with_url_validation(function(url) {
18966          return url.match(src_re) || is_path(url);
18967        }, settings2);
18968        function filter_attr_names(names) {
18969          if (names.length && settings2.allowedAttributes.length) {
18970            return names.filter(function(name) {
18971              if (name === "data-text") {
18972                return false;
18973              }
18974              var allowed = false;
18975              var filters = settings2.allowedAttributes;
18976              for (var i = 0;i < filters.length; ++i) {
18977                if (filters[i] instanceof RegExp) {
18978                  if (filters[i].test(name)) {
18979                    allowed = true;
18980                    break;
18981                  }
18982                } else if (filters[i] === name) {
18983                  allowed = true;
18984                  break;
18985                }
18986              }
18987              return allowed;
18988            });
18989          }
18990          return [];
18991        }
18992        function attrs_to_string(style, attrs, valid_attrs) {
18993          if (attrs) {
18994            if (valid_attrs.length) {
18995              var style_attrs;
18996              var result = valid_attrs.map(function(name) {
18997                if (attrs[name] === null) {
18998                  return "";
18999                }
19000                if (attrs[name] === true) {
19001                  return name;
19002                }
19003                var value = escape_html_attr(attrs[name]);
19004                if (name === "style") {
19005                  if (style) {
19006                    value = value ? style + ";" + value : style;
19007                  }
19008                  style_attrs = true;
19009                }
19010                return name + '="' + value + '"';
19011              }).filter(Boolean);
19012              if (!result.length) {
19013                return "";
19014              }
19015              if (!style_attrs && style) {
19016                result.push('style="' + style + '"');
19017              }
19018              return result.join(" ");
19019            }
19020          }
19021          if (!style) {
19022            return "";
19023          }
19024          return 'style="' + style + '"';
19025        }
19026        function rel_attr() {
19027          var rel = ["noopener"];
19028          if (settings2.linksNoReferrer) {
19029            rel.unshift("noreferrer");
19030          }
19031          if (settings2.linksNoFollow) {
19032            rel.unshift("nofollow");
19033          }
19034          return rel;
19035        }
19036        var default_rel = rel_attr().join(" ");
19037        function pre_process_link(data, attrs, valid_attrs) {
19038          if (data.match(email_re)) {
19039            return '<a href="mailto:' + data + '"';
19040          } else {
19041            var result = ["<a"];
19042            if (data && valid_href(data)) {
19043              result.push('href="' + data + '"');
19044            }
19045            if (attrs) {
19046              if (valid_attrs.includes("target") && attrs.target === undefined) {
19047                attrs.target = "_blank";
19048              }
19049              if (valid_attrs.includes("rel") && attrs.rel === undefined) {
19050                attrs.rel = default_rel;
19051              }
19052            } else {
19053              result.push('rel="' + default_rel + '"');
19054              result.push('target="_blank"');
19055            }
19056            return result.join(" ");
19057          }
19058        }
19059        function pre_process_image(data, text2) {
19060          var result = "<img";
19061          if (valid_src(data)) {
19062            result += ' src="' + data + '"';
19063            if (text2) {
19064              result += ' alt="' + text2 + '"';
19065            }
19066          }
19067          return result;
19068        }
19069        function find_semicolon(text2) {
19070          var index = 0;
19071          var inside_entity = false;
19072          while (index < text2.length) {
19073            if (text2[index] === "&") {
19074              inside_entity = true;
19075            } else if (text2[index] === ";" && !inside_entity) {
19076              return index;
19077            } else if (text2[index] === ";") {
19078              inside_entity = false;
19079            }
19080            index++;
19081          }
19082          return -1;
19083        }
19084        function format(s, style, color, background, _class, data_text, text2) {
19085          var attrs;
19086          var valid_attrs = [];
19087          if (data_text.match(/;/)) {
19088            try {
19089              var semicolon = find_semicolon(data_text);
19090              if (semicolon !== -1) {
19091                var json = data_text.substring(semicolon + 1);
19092                json = json.replace(/&nbsp;/g, " ").replace(/&lt;/g, "<").replace(/&gt;/g, ">");
19093                if (json.match(/^\s*\{[^}]*\}\s*$/)) {
19094                  attrs = JSON.parse(json);
19095                  valid_attrs = filter_attr_names(Object.keys(attrs));
19096                  data_text = data_text.substring(0, semicolon);
19097                }
19098              }
19099            } catch (e) {}
19100          }
19101          if (text2 === "" && !style.match(/@/)) {
19102            return "";
19103          }
19104          text2 = safe(text2);
19105          text2 = text2.replace(/\\\]/g, "&#93;");
19106          if (settings2.escape) {
19107            text2 = text2.replace(/\\\\/g, "\\");
19108          }
19109          var styles = {};
19110          if (style.indexOf("b") !== -1) {
19111            styles["font-weight"] = "bold";
19112          }
19113          var text_decoration = [];
19114          if (style.indexOf("u") !== -1) {
19115            text_decoration.push("underline");
19116          }
19117          if (style.indexOf("s") !== -1) {
19118            text_decoration.push("line-through");
19119          }
19120          if (style.indexOf("o") !== -1) {
19121            text_decoration.push("overline");
19122          }
19123          if (text_decoration.length) {
19124            styles["text-decoration"] = text_decoration.join(" ");
19125          }
19126          if (style.indexOf("i") !== -1) {
19127            styles["font-style"] = "italic";
19128          }
19129          if (style.indexOf("r") !== -1) {
19130            if (_class.trim()) {
19131              _class += " " + "terminal-inverted";
19132            } else {
19133              _class = "terminal-inverted";
19134            }
19135          }
19136          if ($.terminal.valid_color(color)) {
19137            $.extend(styles, {
19138              color,
19139              "--color": color,
19140              "--original-color": color
19141            });
19142            if (style.indexOf("!") !== -1) {
19143              styles["--link-color"] = color;
19144            }
19145            if (style.indexOf("g") !== -1) {
19146              styles["text-shadow"] = "0 0 5px " + color;
19147            }
19148          }
19149          if ($.terminal.valid_color(background)) {
19150            $.extend(styles, {
19151              "background-color": background,
19152              "--background": background
19153            });
19154          }
19155          var data = clean_data(data_text, text2);
19156          var extra = extra_css(text2, settings2);
19157          if (extra) {
19158            text2 = wide_characters(text2, settings2);
19159            $.extend(styles, extra);
19160          }
19161          var result;
19162          var style_str = style_to_string(styles);
19163          if (style.indexOf("!") !== -1) {
19164            result = pre_process_link(data, attrs, valid_attrs);
19165          } else if (style.indexOf("@") !== -1) {
19166            result = pre_process_image(data, text2);
19167          } else {
19168            result = "<span";
19169          }
19170          var output_attrs = attrs_to_string(style_str, attrs, valid_attrs);
19171          if (output_attrs) {
19172            result += " " + output_attrs;
19173          }
19174          if (_class !== "") {
19175            result += ' class="' + _class + '"';
19176          }
19177          if (style.indexOf("!") !== -1) {
19178            result += " data-text>" + text2 + "</a>";
19179          } else if (style.indexOf("@") !== -1) {
19180            result += " data-text/>";
19181          } else {
19182            result += ' data-text="' + data + '">' + "<span>" + text2 + "</span></span>";
19183          }
19184          return result;
19185        }
19186        if (typeof str === "string") {
19187          var splitted = $.terminal.format_split(str);
19188          str = $.map(splitted, function(text2) {
19189            if (text2 === "") {
19190              return text2;
19191            } else if ($.terminal.is_formatting(text2)) {
19192              text2 = text2.replace(/\[\[[^\]]+\]/, function(text2) {
19193                return text2.replace(/&nbsp;/g, " ");
19194              });
19195              return text2.replace(format_parts_re, format);
19196            } else {
19197              text2 = safe(text2);
19198              text2 = text2.replace(/\\\]/, "&#93;");
19199              var data = clean_data(text2);
19200              var extra = extra_css(text2, settings2);
19201              var prefix;
19202              if (extra) {
19203                text2 = wide_characters(text2, settings2);
19204                prefix = '<span style="' + style_to_string(extra) + '"';
19205              } else {
19206                prefix = "<span";
19207              }
19208              return prefix + ' data-text="' + data + '">' + text2 + "</span>";
19209            }
19210          }).join("");
19211          return str.replace(/<span><br\s*\/?><\/span>/gi, "<br/>");
19212        } else {
19213          return "";
19214        }
19215      };
19216    })();
19217    $.terminal.Exception = function Terminal_Exception(type, message, stack) {
19218      if (arguments.length === 1) {
19219        this.message = arguments[0];
19220        this.type = "TERMINAL";
19221      } else {
19222        this.type = type;
19223        this.message = message;
19224        if (stack) {
19225          this.stack = stack;
19226        }
19227      }
19228    };
19229    $.terminal.Exception.prototype = new Error;
19230    $.terminal.Exception.prototype.toString = function() {
19231      return this.message + `
19232` + this.stack;
19233    };
19234    $.fn.visible = function() {
19235      return this.css("visibility", "visible");
19236    };
19237    $.fn.hidden = function() {
19238      return this.css("visibility", "hidden");
19239    };
19240    var warnings = [];
19241    function warn(msg) {
19242      msg = "[jQuery Terminal] " + msg;
19243      if (warnings.indexOf(msg) === -1) {
19244        warnings.push(msg);
19245        if (console) {
19246          if (console.warn) {
19247            console.warn(msg);
19248          } else if (console.log) {
19249            console.log(msg);
19250          }
19251        } else {
19252          setTimeout(function() {
19253            throw new Error("WARN: " + msg);
19254          }, 0);
19255        }
19256      }
19257    }
19258    var ids = {};
19259    $.jrpc = function(url, method, params, success, error) {
19260      var deferred2 = new $.Deferred;
19261      var options2;
19262      if ($.isPlainObject(url)) {
19263        options2 = url;
19264      } else {
19265        options2 = {
19266          url,
19267          method,
19268          params,
19269          success,
19270          error
19271        };
19272      }
19273      function validJSONRPC(response) {
19274        return typeof response.id === "number" && (typeof response.result !== "undefined" || typeof response.error !== "undefined");
19275      }
19276      ids[options2.url] = ids[options2.url] || 0;
19277      var request = {
19278        jsonrpc: "2.0",
19279        method: options2.method,
19280        params: options2.params,
19281        id: ++ids[options2.url]
19282      };
19283      function finalize(json, response, status, jqXHR) {
19284        if (validJSONRPC(json) || options2.method === "system.describe") {
19285          if (options2.success) {
19286            options2.success(json, status, jqXHR);
19287          }
19288          deferred2.resolve(json);
19289        } else {
19290          if (options2.error) {
19291            options2.error(jqXHR, "Invalid JSON-RPC");
19292          }
19293          deferred2.reject({ message: "Invalid JSON-RPC", response });
19294        }
19295      }
19296      $.ajax({
19297        url: options2.url,
19298        beforeSend: function beforeSend(jxhr, settings2) {
19299          if (is_function(options2.request)) {
19300            options2.request(jxhr, request);
19301          }
19302          settings2.data = JSON.stringify(request);
19303        },
19304        success: function success(response, status, jqXHR) {
19305          var content_type = jqXHR.getResponseHeader("Content-Type");
19306          if (!content_type.match(/(application|text)\/json/)) {
19307            warn("Response Content-Type is neither application/json" + " nor text/json");
19308          }
19309          var json;
19310          try {
19311            json = JSON.parse(response);
19312          } catch (e) {
19313            if (options2.error) {
19314              options2.error(jqXHR, "Invalid JSON", e);
19315            } else {
19316              throw new $.terminal.Exception("JSON", "Invalid JSON", e.stack);
19317            }
19318            deferred2.reject({ message: "Invalid JSON", response });
19319            return;
19320          }
19321          if (is_function(options2.response)) {
19322            options2.response(jqXHR, json);
19323          }
19324          if (is_function(options2.intercept)) {
19325            var ret2 = options2.intercept(request, json);
19326            if (ret2) {
19327              return unpromise(ret2, function(json) {
19328                var response = JSON.stringify(json);
19329                finalize(json, response, status, jqXHR);
19330              });
19331            }
19332          }
19333          finalize(json, response, status, jqXHR);
19334        },
19335        error: options2.error,
19336        contentType: "application/json",
19337        dataType: "text",
19338        async: true,
19339        cache: false,
19340        type: "POST"
19341      });
19342      return deferred2.promise();
19343    };
19344    $.rpc = function(url, method, params) {
19345      var deferred2 = new $.Deferred;
19346      function success(res) {
19347        if (res.error) {
19348          deferred2.reject(res.error);
19349        } else {
19350          deferred2.resolve(res.result);
19351        }
19352      }
19353      function error(jqXHR, status, message) {
19354        deferred2.reject({ message });
19355      }
19356      $.jrpc(url, method, params, success, error);
19357      return deferred2.promise();
19358    };
19359    function terminal_ready(term2) {
19360      return !!(term2.closest("body").length && term2.is(":visible") && term2.find(".cmd-prompt").length);
19361    }
19362    function format_stack_trace(stack) {
19363      stack = $.terminal.escape_brackets(stack);
19364      return stack.split(/\n/g).map(function(trace) {
19365        return "[[;;;terminal-error]" + trace.replace(url_re, function(url) {
19366          return "]" + url + "[[;;;terminal-error]";
19367        }) + "]";
19368      }).join(`
19369`);
19370    }
19371    function get_char_size(term2) {
19372      var result;
19373      if (terminal_ready(term2)) {
19374        var $prompt = term2.find(".cmd-prompt").clone().css({
19375          visiblity: "hidden",
19376          position: "absolute"
19377        });
19378        $prompt.appendTo(term2.find(".cmd")).html("&nbsp;").wrap('<div class="cmd-wrapper"/>');
19379        result = {
19380          width: $prompt.width(),
19381          height: $prompt.height()
19382        };
19383        $prompt.parent().remove();
19384      } else {
19385        var temp = $('<div class="terminal terminal-temp"><div class="terminal-' + 'wrapper"><div class="terminal-output"><div><div class="te' + 'rminal-line" style="float: left"><span>&nbsp;</span></div' + '></div></div><div class="terminal-pixel"></div></div>').appendTo("body");
19386        temp.addClass(term2.attr("class")).attr("id", term2.attr("id"));
19387        var style = term2.attr("style");
19388        if (style) {
19389          style = style.split(/\s*;\s*/).filter(function(s) {
19390            return !s.match(/display\s*:\s*none/i);
19391          }).join(";");
19392          temp.attr("style", style);
19393        }
19394        var node = temp.find(".terminal-line");
19395        result = {
19396          width: node.width(),
19397          height: node.height()
19398        };
19399        temp.remove();
19400      }
19401      return result;
19402    }
19403    function aproximation(number) {
19404      if (number - Math.floor(number) > 0.9) {
19405        return Math.ceil(number);
19406      }
19407      return Math.floor(number);
19408    }
19409    function get_num_chars(terminal, char_size) {
19410      var width = terminal.find(".terminal-fill").width();
19411      var result = Math.floor(width / char_size.width);
19412      return result || 1000;
19413    }
19414    function get_num_rows(terminal, char_size) {
19415      var filler = terminal.find(".terminal-fill");
19416      var height = filler.height();
19417      return aproximation(height / char_size.height);
19418    }
19419    function all(array, fn2) {
19420      var same = array.filter(function(item) {
19421        return item[fn2]() === item;
19422      });
19423      return same.length === array.length;
19424    }
19425    function string_case(string2) {
19426      var array = string2.split("");
19427      if (all(array, "toLowerCase")) {
19428        return "lower";
19429      } else if (all(array, "toUpperCase")) {
19430        return "upper";
19431      } else {
19432        return "mixed";
19433      }
19434    }
19435    function same_case(string2) {
19436      return string_case(string2) !== "mixed";
19437    }
19438    function is_function(object) {
19439      return get_type(object) === "function";
19440    }
19441    function is_string(object) {
19442      return get_type(object) === "string";
19443    }
19444    function is_object(object) {
19445      return object && typeof object === "object";
19446    }
19447    function is_promise(object) {
19448      return is_object(object) && is_function(object.then || object.done);
19449    }
19450    function is_big_int(object) {
19451      return typeof object === "bigint";
19452    }
19453    function is_deferred(object) {
19454      return is_promise(object) && is_function(object.promise);
19455    }
19456    if (!Array.isArray) {
19457      Array.isArray = function(arg) {
19458        return Object.prototype.toString.call(arg) === "[object Array]";
19459      };
19460    }
19461    function is_array(object) {
19462      return Array.isArray(object);
19463    }
19464    function have_custom_font(term2) {
19465      var custom_font = $(term2).css("--font");
19466      if (!custom_font) {
19467        return false;
19468      }
19469      var fonts = Array.from(document.fonts.keys());
19470      var font = fonts.find(function(face) {
19471        return face.family === custom_font;
19472      });
19473      return !!font;
19474    }
19475    function get_type(object) {
19476      if (typeof object === "function") {
19477        return "function";
19478      }
19479      if (object === null) {
19480        return object + "";
19481      }
19482      if (Array.isArray(object)) {
19483        return "array";
19484      }
19485      if (object instanceof String) {
19486        return "string";
19487      }
19488      if (typeof object === "object") {
19489        return "object";
19490      }
19491      return typeof object;
19492    }
19493    var version_set = !$.terminal.version.match(/^\{\{/);
19494    var copyright = "Copyright (c) 2010-2025 Jakub T. Jankiewicz " + "<https://jcubic.pl/me>";
19495    var version_string = version_set ? " v. " + $.terminal.version : " ";
19496    var reg = new RegExp(" {" + version_string.length + "}$");
19497    function small_string(name) {
19498      return "(c) 2010-2025 [[!;;;;https://jcubic.pl/me]" + name + "]";
19499    }
19500    var signatures = [
19501      ["jQuery Terminal", small_string("jcubic")],
19502      [
19503        "      __ ____ ________",
19504        "     / // _  /__  ___/__ ___ ______",
19505        " __ / // // /  / // _  // _//     /",
19506        "/  / // // /  / // ___// / / / / /",
19507        "\\___//____ \\ /_//____//_/ /_/ /_/",
19508        "          \\/                    ".replace(reg, " ") + version_string,
19509        small_string("Jakub T. Jankiewicz")
19510      ],
19511      [
19512        "      _______                 ________                        __",
19513        "     / / _  /_ ____________ _/__  ___/______________  _____  / /",
19514        " __ / / // / // / _  / _/ // / / / _  / _/     / /  \\/ / _ \\/ /",
19515        "/  / / // / // / ___/ // // / / / ___/ // / / / / /\\  / // / /__",
19516        "\\___/____ \\\\__/____/_/ \\__ / /_/____/_//_/_/_/_/_/  \\/\\__\\_\\___/",
19517        "         \\/          /____/                                   ".replace(reg, " ") + version_string,
19518        copyright
19519      ],
19520      [
19521        "      __ _____                     ________                            " + "  __",
19522        "     / // _  /__ __ _____ ___ __ _/__  ___/__ ___ ______ __ __  __ ___ " + " / /",
19523        " __ / // // // // // _  // _// // / / // _  // _//     // //  \\/ // _ " + "\\/ /",
19524        "/  / // // // // // ___// / / // / / // ___// / / / / // // /\\  // // " + "/ /__",
19525        "\\___//____ \\\\___//____//_/ _\\_  / /_//____//_/ /_/ /_//_//_/ /_/ \\" + "__\\_\\___/",
19526        ("          \\/              /____/                                     " + "     ").replace(reg, "") + version_string,
19527        copyright
19528      ]
19529    ];
19530    $.terminal.nested_formatting.__meta__ = true;
19531    $.terminal.nested_formatting.__inherit__ = true;
19532    $.terminal.nested_formatting.__no_warn__ = true;
19533    $.terminal.defaults = {
19534      prompt: "> ",
19535      history: true,
19536      exit: true,
19537      clear: true,
19538      enabled: true,
19539      maskChar: "*",
19540      wrap: true,
19541      checkArity: true,
19542      raw: false,
19543      tabindex: 1,
19544      invokeMethods: false,
19545      exceptionHandler: null,
19546      pauseEvents: true,
19547      softPause: false,
19548      mousewheel: null,
19549      touchscroll: null,
19550      memory: false,
19551      cancelableAjax: true,
19552      processArguments: true,
19553      execAnimation: false,
19554      execAnimationDelay: 100,
19555      execHistory: false,
19556      linksNoReferrer: false,
19557      externalPause: true,
19558      useCache: true,
19559      anyLinks: false,
19560      linksNoFollow: false,
19561      processRPCResponse: null,
19562      completionEscape: true,
19563      mobileDelete: is_mobile,
19564      convertLinks: true,
19565      errorOnAbort: true,
19566      extra: {},
19567      tabs: 4,
19568      historySize: 60,
19569      scrollObject: null,
19570      historyState: false,
19571      importHistory: false,
19572      historyFilter: null,
19573      echoCommand: true,
19574      scrollOnEcho: true,
19575      login: null,
19576      outputLimit: -1,
19577      formatters: [$.terminal.nested_formatting],
19578      unixFormatting: {
19579        escapeBrackets: false,
19580        ansiParser: {},
19581        ansiArt: false
19582      },
19583      onAjaxError: null,
19584      pasteImage: true,
19585      scrollBottomOffset: 20,
19586      wordAutocomplete: true,
19587      caseSensitiveAutocomplete: true,
19588      caseSensitiveSearch: true,
19589      clickTimeout: 200,
19590      holdTimeout: 400,
19591      holdRepeatTimeout: 200,
19592      repeatTimeoutKeys: [],
19593      mobileIgnoreAutoSpace: [",", ".", ")"],
19594      request: $.noop,
19595      response: $.noop,
19596      describe: "procs",
19597      onRPCError: null,
19598      keymap: null,
19599      doubleTab: null,
19600      doubleTabEchoCommand: false,
19601      completion: false,
19602      onInit: $.noop,
19603      onClear: $.noop,
19604      onBlur: $.noop,
19605      onFocus: $.noop,
19606      onTerminalChange: $.noop,
19607      onExit: $.noop,
19608      onPush: $.noop,
19609      onPop: $.noop,
19610      keypress: $.noop,
19611      keydown: $.noop,
19612      renderHandler: null,
19613      onAfterRedraw: $.noop,
19614      onEchoCommand: $.noop,
19615      onPaste: $.noop,
19616      onFlush: $.noop,
19617      onBeforeCommand: null,
19618      onAfterCommand: null,
19619      onBeforeEcho: null,
19620      onAfterEcho: null,
19621      onBeforeLogin: null,
19622      onAfterLogout: null,
19623      onBeforeLogout: null,
19624      onCommandChange: null,
19625      onPositionChange: null,
19626      allowedAttributes: ["title", "target", "rel", /^aria-/, "id", /^data-/],
19627      strings: {
19628        comletionParameters: "From version 1.0.0 completion function need to" + " have two arguments",
19629        wrongPasswordTryAgain: "Wrong username or password try again!",
19630        wrongPassword: "Wrong username or password!",
19631        ajaxAbortError: "Error while aborting ajax call!",
19632        wrongArity: "Wrong number of arguments. Function '%s' expects %s got" + " %s!",
19633        commandNotFound: "Command '%s' Not Found!",
19634        oneRPCWithIgnore: "You can use only one rpc with describe == false " + "or rpc without system.describe",
19635        oneInterpreterFunction: "You can't use more than one function (rpc " + "without system.describe or with option describe == false count" + "s as one)",
19636        loginFunctionMissing: "You didn't specify a login function",
19637        noTokenError: "Access denied (no token)",
19638        serverResponse: "Server responded",
19639        wrongGreetings: "Wrong value of greetings parameter",
19640        notWhileLogin: "You can't call `%s' function while in login",
19641        loginIsNotAFunction: "Authenticate must be a function",
19642        canExitError: "You can't exit from main interpreter",
19643        invalidCompletion: "Invalid completion",
19644        invalidSelector: "Sorry, but terminal said that you use invalid " + "selector!",
19645        invalidTerminalId: "Invalid Terminal ID",
19646        login: "login",
19647        password: "password",
19648        recursiveLoop: "Recursive loop in echo detected, skip",
19649        notAString: "%s function: argument is not a string",
19650        redrawError: "Internal error, wrong position in cmd redraw",
19651        invalidStrings: "Command %s have unclosed strings",
19652        invalidMask: "Invalid mask used only string or boolean allowed",
19653        defunctTerminal: "You can't call method '%s' on terminal that was destroyed",
19654        abortError: "Abort with CTRL+D",
19655        timeoutError: "Signal timed out",
19656        invalidId: "terminal with this `id` aready exists! You need to destr" + "oy old terminal before you can create terminal with the same `id`"
19657      }
19658    };
19659    var requests = [];
19660    var abort_controllers = [];
19661    var terminals = new Cycle;
19662    var save_state = [];
19663    var hash_commands;
19664    var change_hash = false;
19665    var fire_hash_change = true;
19666    var first_instance = true;
19667    $.fn.terminal = function(init_interpreter, options2) {
19668      function StorageHelper(memory) {
19669        if (memory) {
19670          this.storage = {};
19671        }
19672        this.set = function(key, value) {
19673          if (memory) {
19674            this.storage[key] = value;
19675          } else {
19676            $.Storage.set(key, value);
19677          }
19678        };
19679        this.get = function(key) {
19680          if (memory) {
19681            return this.storage[key];
19682          } else {
19683            return $.Storage.get(key);
19684          }
19685        };
19686        this.remove = function(key) {
19687          if (memory) {
19688            delete this.storage[key];
19689          } else {
19690            $.Storage.remove(key);
19691          }
19692        };
19693      }
19694      function get_processed_command(command) {
19695        if ($.terminal.unclosed_strings(command)) {
19696          var string2 = $.terminal.escape_brackets(command);
19697          var message = sprintf(strings().invalidStrings, "`" + string2 + "`");
19698          throw new $.terminal.Exception(message);
19699        } else if (is_function(settings2.processArguments)) {
19700          return process_command(command, settings2.processArguments);
19701        } else if (settings2.processArguments) {
19702          return $.terminal.parse_command(command);
19703        } else {
19704          return $.terminal.split_command(command);
19705        }
19706      }
19707      var recursive_render = false;
19708      function preprocess_value(value, options2) {
19709        options2 = options2 || {};
19710        if ($.terminal.Animation && value instanceof $.terminal.Animation) {
19711          value.start(self2);
19712          return false;
19713        }
19714        if (is_function(settings2.renderHandler)) {
19715          if (recursive_render) {
19716            return value;
19717          }
19718          return unpromise(value, function(value) {
19719            try {
19720              recursive_render = true;
19721              var ret2 = settings2.renderHandler.call(self2, value, options2, self2);
19722              if (ret2 === false) {
19723                return false;
19724              }
19725              var was_promise = is_promise(ret2);
19726              if (was_promise) {
19727                return always(ret2, function() {
19728                  recursive_render = false;
19729                });
19730              }
19731              if (typeof ret2 === "string" || is_node(ret2)) {
19732                return ret2;
19733              } else {
19734                return value;
19735              }
19736            } catch (e) {
19737              return [
19738                "[[;red;]" + e.message + "]",
19739                format_stack_trace(e.stack)
19740              ].join(`
19741`);
19742            } finally {
19743              if (!was_promise) {
19744                recursive_render = false;
19745              }
19746            }
19747          });
19748        }
19749        return value;
19750      }
19751      function prepare_render(value, options2) {
19752        if (is_node(value)) {
19753          var settings2 = $.extend({}, options2, {
19754            raw: true,
19755            finalize: function(div) {
19756              div.find(".terminal-render-item").replaceWith(value);
19757              if (options2 && is_function(options2.finalize)) {
19758                options2.finalize(div, self2);
19759              }
19760            }
19761          });
19762          return ['<div class="terminal-render-item"/>', settings2];
19763        }
19764      }
19765      function render(value, options2) {
19766        var ret2 = prepare_render(value, options2);
19767        if (ret2) {
19768          self2.echo.apply(self2, ret2);
19769          return true;
19770        }
19771      }
19772      function get_node(index) {
19773        return output.find("[data-index=" + index + "]");
19774      }
19775      function is_node(object) {
19776        return object instanceof $.fn.init || object instanceof Element;
19777      }
19778      function display_object(object) {
19779        object = preprocess_value(object);
19780        if (object === false) {
19781          return;
19782        }
19783        if (render(object)) {
19784          return;
19785        }
19786        if (is_string(object)) {
19787          self2.echo(object);
19788        } else if (is_array(object)) {
19789          self2.echo($.map(object, function(object) {
19790            return JSON.stringify(object);
19791          }).join(" "));
19792        } else if (typeof object === "object") {
19793          self2.echo(JSON.stringify(object));
19794        } else {
19795          self2.echo(object);
19796        }
19797      }
19798      function print_line(url_spec, cols) {
19799        var re = /(.*):([0-9]+):([0-9]+)$/;
19800        var m2 = url_spec.match(re);
19801        if (m2) {
19802          self2.pause(settings2.softPause);
19803          $.get(m2[1], function(response) {
19804            var file = m2[1];
19805            var code = response.split(`
19806`);
19807            var n = +m2[2] - 1;
19808            var start = n > 2 ? n - 2 : 0;
19809            var lines = code.slice(start, n + 3).map(function(line, i) {
19810              var prefix = "[" + (n + i - 1) + "]: ";
19811              var limit = cols - prefix.length - 4;
19812              if (line.length > limit) {
19813                line = line.substring(0, limit) + "...";
19814              }
19815              if (n > 2 ? i === 2 : i === n) {
19816                line = "[[;#f00;]" + $.terminal.escape_brackets(line) + "]";
19817              }
19818              return prefix + line;
19819            }).filter(Boolean).join(`
19820`);
19821            if (lines.length) {
19822              self2.echo("[[b;white;]" + file + "]");
19823              self2.echo(lines).resume();
19824            }
19825          }, "text");
19826        }
19827      }
19828      function display_json_rpc_error(error) {
19829        if (is_function(settings2.onRPCError)) {
19830          settings2.onRPCError.call(self2, error);
19831        } else {
19832          self2.error("&#91;RPC&#93; " + error.message);
19833          if (error.error && error.error.message) {
19834            error = error.error;
19835            var msg = "\t" + error.message;
19836            if (error.file) {
19837              msg += ' in file "' + error.file.replace(/.*\//, "") + '"';
19838            }
19839            if (error.at) {
19840              msg += " at line " + error.at;
19841            }
19842            self2.error(msg);
19843          }
19844        }
19845      }
19846      function make_basic_json_rpc(url, auth) {
19847        var rpc_interceptor;
19848        if (settings2.rpc) {
19849          rpc_interceptor = function() {
19850            return settings2.rpc.apply(self2, arguments);
19851          };
19852        }
19853        var interpreter = function(method, params) {
19854          self2.pause(settings2.softPause);
19855          $.jrpc({
19856            url,
19857            method,
19858            params,
19859            request: function(jxhr, request) {
19860              try {
19861                settings2.request.call(self2, jxhr, request, self2);
19862              } catch (e) {
19863                display_exception(e, "USER");
19864              }
19865            },
19866            intercept: rpc_interceptor,
19867            response: function(jxhr, response) {
19868              try {
19869                settings2.response.call(self2, jxhr, response, self2);
19870              } catch (e) {
19871                display_exception(e, "USER");
19872              }
19873            },
19874            success: function success(json) {
19875              if (json.error) {
19876                display_json_rpc_error(json.error);
19877              } else if (is_function(settings2.processRPCResponse)) {
19878                settings2.processRPCResponse.call(self2, json.result, self2);
19879              } else if (json.result !== null) {
19880                display_object(json.result);
19881              }
19882              self2.resume();
19883            },
19884            error: ajax_error
19885          });
19886        };
19887        return function(command, terminal) {
19888          if (command === "") {
19889            return;
19890          }
19891          try {
19892            command = get_processed_command(command);
19893          } catch (e) {
19894            display_exception(e, "TERMINAL (get_processed_command)");
19895            return;
19896          }
19897          if (!auth || command.name === "help") {
19898            interpreter(command.name, command.args);
19899          } else {
19900            var token = terminal.token(true);
19901            if (token) {
19902              interpreter(command.name, [token].concat(command.args));
19903            } else {
19904              terminal.error("&#91;AUTH&#93; " + strings().noTokenError);
19905            }
19906          }
19907        };
19908      }
19909      function make_object_interpreter(object, arity, login, fallback) {
19910        return function(user_command, terminal) {
19911          if (user_command === "") {
19912            return;
19913          }
19914          var command;
19915          try {
19916            command = get_processed_command(user_command);
19917          } catch (e) {
19918            if (is_function(settings2.exception)) {
19919              settings2.exception(e, self2);
19920            } else {
19921              self2.error("Error: " + (e.message || e));
19922            }
19923            return;
19924          }
19925          var val = object[command.name];
19926          var type = get_type(val);
19927          if (type === "function") {
19928            if (arity && val.length !== command.args.length) {
19929              self2.error("&#91;Arity&#93; " + sprintf(strings().wrongArity, command.name, val.length, command.args.length));
19930            } else {
19931              return val.apply(self2, command.args);
19932            }
19933          } else if (type === "object" || type === "string") {
19934            var commands = [];
19935            if (type === "object") {
19936              commands = Object.keys(val);
19937              val = make_object_interpreter(val, arity, login);
19938            }
19939            terminal.push(val, {
19940              prompt: command.name + "> ",
19941              name: command.name,
19942              completion: type === "object" ? commands : undefined
19943            });
19944          } else if (is_function(fallback)) {
19945            return fallback(user_command, self2);
19946          } else if (is_function(settings2.onCommandNotFound)) {
19947            settings2.onCommandNotFound.call(self2, user_command, self2);
19948          } else {
19949            terminal.error(sprintf(strings().commandNotFound, command.name));
19950          }
19951        };
19952      }
19953      function ajax_error(xhr, status, error) {
19954        self2.resume();
19955        if (is_function(settings2.onAjaxError)) {
19956          settings2.onAjaxError.call(self2, xhr, status, error);
19957        } else if (status !== "abort") {
19958          self2.error("&#91;AJAX&#93; " + status + " - " + strings().serverResponse + `:
19959` + $.terminal.escape_brackets(xhr.responseText));
19960        }
19961      }
19962      function make_json_rpc_object(url, auth, success) {
19963        function jrpc_success(json) {
19964          if (json.error) {
19965            display_json_rpc_error(json.error);
19966          } else if (is_function(settings2.processRPCResponse)) {
19967            settings2.processRPCResponse.call(self2, json.result, self2);
19968          } else {
19969            display_object(json.result);
19970          }
19971          self2.resume();
19972        }
19973        function jrpc_request(jxhr, request) {
19974          try {
19975            settings2.request.call(self2, jxhr, request, self2);
19976          } catch (e) {
19977            display_exception(e, "USER");
19978          }
19979        }
19980        function jrpc_response(jxhr, response) {
19981          try {
19982            settings2.response.call(self2, jxhr, response, self2);
19983          } catch (e) {
19984            display_exception(e, "USER");
19985          }
19986        }
19987        function response(response) {
19988          var procs = response;
19989          if (settings2.describe !== false && settings2.describe !== "") {
19990            settings2.describe.split(".").forEach(function(field) {
19991              procs = procs[field];
19992            });
19993          }
19994          if (procs && procs.length) {
19995            var interpreter_object = {};
19996            $.each(procs, function(_, proc) {
19997              if ($.isPlainObject(proc) && typeof proc.name === "string") {
19998                interpreter_object[proc.name] = function() {
19999                  var append = auth && proc.name !== "help";
20000                  var args2 = Array.prototype.slice.call(arguments);
20001                  var args_len = args2.length + (append ? 1 : 0);
20002                  if (settings2.checkArity && proc.params && proc.params.length !== args_len) {
20003                    self2.error("&#91;Arity&#93; " + sprintf(strings().wrongArity, proc.name, proc.params.length, args_len));
20004                  } else {
20005                    self2.pause(settings2.softPause);
20006                    if (append) {
20007                      var token = self2.token(true);
20008                      if (token) {
20009                        args2 = [token].concat(args2);
20010                      } else {
20011                        self2.error("&#91;AUTH&#93; " + strings().noTokenError);
20012                      }
20013                    }
20014                    $.jrpc({
20015                      url,
20016                      method: proc.name,
20017                      params: args2,
20018                      request: jrpc_request,
20019                      response: jrpc_response,
20020                      success: jrpc_success,
20021                      error: ajax_error
20022                    });
20023                  }
20024                };
20025              }
20026            });
20027            var login = typeof auth === "string" ? auth : "login";
20028            interpreter_object.help = interpreter_object.help || function(fn2) {
20029              if (typeof fn2 === "undefined") {
20030                var names = procs.map(function(proc) {
20031                  return proc.name;
20032                }).join(", ") + ", help";
20033                self2.echo("Available commands: " + names);
20034              } else {
20035                var found = false;
20036                $.each(procs, function(_, proc) {
20037                  if (proc.name === fn2) {
20038                    found = true;
20039                    var msg = "";
20040                    msg += "[[bu;;]" + proc.name + "]";
20041                    if (proc.params) {
20042                      var params = proc.params;
20043                      if (auth && proc.name !== login) {
20044                        params = params.slice(1);
20045                      }
20046                      msg += " " + params.join(" ");
20047                    }
20048                    if (proc.help) {
20049                      msg += `
20050` + proc.help;
20051                    }
20052                    self2.echo(msg);
20053                    return false;
20054                  }
20055                });
20056                if (!found) {
20057                  if (fn2 === "help") {
20058                    self2.echo(`[[bu;;]help] [method]
20059display help ` + "for the method or list of methods if not" + " specified");
20060                  } else {
20061                    var msg = "Method `" + fn2 + "' not found ";
20062                    self2.error(msg);
20063                  }
20064                }
20065              }
20066            };
20067            success(interpreter_object);
20068          } else {
20069            success(null);
20070          }
20071        }
20072        return $.jrpc({
20073          url,
20074          method: "system.describe",
20075          params: [],
20076          success: response,
20077          request: jrpc_request,
20078          response: jrpc_response,
20079          error: function error() {
20080            success(null);
20081          }
20082        });
20083      }
20084      function make_interpreter(user_intrp, login, finalize) {
20085        finalize = finalize || $.noop;
20086        var type = get_type(user_intrp);
20087        var object;
20088        var result = {};
20089        var rpc_count = 0;
20090        var fn_interpreter;
20091        if (type === "array") {
20092          object = {};
20093          (function recur(interpreters, success) {
20094            if (interpreters.length) {
20095              var first = interpreters[0];
20096              var rest = interpreters.slice(1);
20097              var type = get_type(first);
20098              if (type === "string") {
20099                if (settings2.describe === false) {
20100                  if (++rpc_count === 1) {
20101                    fn_interpreter = make_basic_json_rpc(first, login);
20102                  } else {
20103                    self2.error(strings().oneRPCWithIgnore);
20104                  }
20105                  recur(rest, success);
20106                } else {
20107                  self2.pause(settings2.softPause);
20108                  make_json_rpc_object(first, login, function(new_obj) {
20109                    if (new_obj) {
20110                      $.extend(object, new_obj);
20111                    } else if (++rpc_count === 1) {
20112                      fn_interpreter = make_basic_json_rpc(first, login);
20113                    } else {
20114                      self2.error(strings().oneRPCWithIgnore);
20115                    }
20116                    self2.resume();
20117                    recur(rest, success);
20118                  });
20119                }
20120              } else if (type === "function") {
20121                if (fn_interpreter) {
20122                  self2.error(strings().oneInterpreterFunction);
20123                } else {
20124                  fn_interpreter = first;
20125                }
20126                recur(rest, success);
20127              } else if (type === "object") {
20128                $.extend(object, first);
20129                recur(rest, success);
20130              }
20131            } else {
20132              success();
20133            }
20134          })(user_intrp, function() {
20135            finalize({
20136              interpreter: make_object_interpreter(object, false, login, fn_interpreter && fn_interpreter.bind(self2)),
20137              completion: Object.keys(object)
20138            });
20139          });
20140        } else if (type === "string") {
20141          if (settings2.describe === false) {
20142            object = {
20143              interpreter: make_basic_json_rpc(user_intrp, login)
20144            };
20145            if (Array.isArray(settings2.completion)) {
20146              object.completion = settings2.completion;
20147            }
20148            finalize(object);
20149          } else {
20150            self2.pause(settings2.softPause);
20151            make_json_rpc_object(user_intrp, login, function(object) {
20152              if (object) {
20153                result.interpreter = make_object_interpreter(object, false, login);
20154                result.completion = Object.keys(object);
20155              } else {
20156                result.interpreter = make_basic_json_rpc(user_intrp, login);
20157              }
20158              finalize(result);
20159              self2.resume();
20160            });
20161          }
20162        } else if (type === "object") {
20163          finalize({
20164            interpreter: make_object_interpreter(user_intrp, settings2.checkArity, login),
20165            completion: Object.keys(user_intrp)
20166          });
20167        } else {
20168          if (type === "undefined") {
20169            user_intrp = $.noop;
20170          } else if (type !== "function") {
20171            var msg = type + " is invalid interpreter value";
20172            throw new $.terminal.Exception(msg);
20173          }
20174          finalize({
20175            interpreter: user_intrp,
20176            completion: settings2.completion
20177          });
20178        }
20179      }
20180      function make_json_rpc_login(url, login) {
20181        var method = get_type(login) === "boolean" ? "login" : login;
20182        return function(user, passwd, callback) {
20183          self2.pause(settings2.softPause);
20184          $.jrpc({
20185            url,
20186            method,
20187            params: [user, passwd],
20188            request: function(jxhr, request) {
20189              try {
20190                settings2.request.call(self2, jxhr, request, self2);
20191              } catch (e) {
20192                display_exception(e, "USER");
20193              }
20194            },
20195            response: function(jxhr, response) {
20196              try {
20197                settings2.response.call(self2, jxhr, response, self2);
20198              } catch (e) {
20199                display_exception(e, "USER");
20200              }
20201            },
20202            success: function success(response) {
20203              if (!response.error && response.result) {
20204                callback(response.result);
20205              } else {
20206                callback(null);
20207              }
20208              self2.resume();
20209            },
20210            error: ajax_error
20211          });
20212        };
20213      }
20214      function display_exception(e, label, silent) {
20215        if (is_function(settings2.exceptionHandler)) {
20216          settings2.exceptionHandler.call(self2, e, label);
20217        } else {
20218          self2.exception(e, label);
20219          if (!silent) {
20220            setTimeout(function() {
20221              throw e;
20222            }, 0);
20223          }
20224        }
20225      }
20226      function links(string2) {
20227        function format(_, style, color, background, _class, data, text2) {
20228          function formatting(s, text2) {
20229            return "[[" + [
20230              style + (s || ""),
20231              color,
20232              background,
20233              _class,
20234              text2 || data
20235            ].join(";") + "]";
20236          }
20237          function escaped(_) {
20238            return "]" + formatting("!", _) + _ + "]" + formatting();
20239          }
20240          if (!style.match(/!/)) {
20241            var m2 = text2.match(email_full_re) || text2.match(url_full_re);
20242            if (m2) {
20243              return formatting("!", m2[1]) + text2 + "]";
20244            } else if (text2.match(email_re) || text2.match(url_nf_re)) {
20245              var output = text2.replace(email_re, escaped).replace(url_nf_re, escaped);
20246              return formatting("", data) + output + "]";
20247            }
20248          }
20249          return _;
20250        }
20251        function linkify(string2) {
20252          return string2.replace(email_re, "[[!;;]$1]").replace(url_nf_re, "[[!;;]$1]");
20253        }
20254        if (!$.terminal.have_formatting(string2)) {
20255          return linkify(string2);
20256        }
20257        return $.terminal.format_split(string2).map(function(str) {
20258          if ($.terminal.is_formatting(str)) {
20259            return str.replace(format_parts_re, format);
20260          } else {
20261            return linkify(str);
20262          }
20263        }).join("");
20264      }
20265      function should_wrap(string2, options2) {
20266        return (strlen(text(string2)) > options2.cols || string2.match(/\n/)) && (settings2.wrap === true && options2.wrap === undefined || settings2.wrap === false && options2.wrap === true);
20267      }
20268      var line_cache;
20269      if ("Map" in root) {
20270        line_cache = new Map;
20271      }
20272      function process_extended_commands(string2, line, line_settings) {
20273        if (line_settings.exec || line.options.clear_exec) {
20274          return $.terminal.each_extended_command(string2, function(command) {
20275            if (line_settings.exec) {
20276              line.options.exec = false;
20277              line.options.clear_exec = true;
20278              var trim = command.trim();
20279              if (prev_exec_cmd && prev_exec_cmd === trim) {
20280                prev_exec_cmd = "";
20281                self2.error(strings().recursiveLoop);
20282              } else {
20283                prev_exec_cmd = trim;
20284                $.terminal.extended_command(self2, command, {
20285                  invokeMethods: line_settings.invokeMethods
20286                }).then(function() {
20287                  prev_exec_cmd = "";
20288                });
20289              }
20290            }
20291          });
20292        }
20293        return string2;
20294      }
20295      function process_line(line, safe_throw) {
20296        try {
20297          var use_cache = !is_function(line.value);
20298          var line_settings = $.extend({
20299            exec: true,
20300            raw: false,
20301            finalize: $.noop,
20302            useCache: use_cache,
20303            invokeMethods: false,
20304            formatters: true,
20305            convertLinks: settings2.convertLinks
20306          }, line.options || {});
20307          var string2 = stringify_value(line.value);
20308          if (string2 && is_function(string2.then)) {
20309            return string2.then(function(string2) {
20310              process_line($.extend(line, {
20311                value: string2,
20312                options: line_settings
20313              }));
20314            });
20315          }
20316          if (string2 !== "") {
20317            if (!line_settings.raw) {
20318              if (settings2.useCache && line_settings.useCache) {
20319                var key = string2;
20320                if (line_cache && line_cache.has(key)) {
20321                  var data = line_cache.get(key);
20322                  buffer.append(data.input, line.index, line_settings, data.raw);
20323                  return true;
20324                }
20325              }
20326              if (line_settings.formatters) {
20327                try {
20328                  string2 = $.terminal.apply_formatters(string2, $.extend(settings2, { echo: true }));
20329                } catch (e) {
20330                  display_exception(e, "FORMATTING");
20331                }
20332              }
20333              string2 = process_extended_commands(string2, line, line_settings);
20334              if (string2 === "") {
20335                return;
20336              }
20337              if (line_settings.convertLinks) {
20338                string2 = links(string2);
20339              }
20340              var raw_string = string2;
20341              string2 = crlf($.terminal.normalize(string2));
20342              string2 = $.terminal.encode(string2, {
20343                tabs: settings2.tabs
20344              });
20345              var array;
20346              var raw_array;
20347              var cols = line_settings.cols = self2.cols();
20348              if (should_wrap(string2, line_settings)) {
20349                array = $.terminal.split_equal(string2, cols, {
20350                  keepWords: line_settings.keepWords,
20351                  trim: true
20352                });
20353                raw_array = $.terminal.split_equal(raw_string, cols, {
20354                  keepWords: line_settings.keepWords,
20355                  trim: true
20356                });
20357              } else if (string2.match(/\n/)) {
20358                array = string2.split(/\n/);
20359                raw_array = string2.split(/\n/);
20360              }
20361            }
20362          } else {
20363            raw_string = "";
20364          }
20365          var arg = array || string2;
20366          var raw = raw_array || raw_string;
20367          if (line_cache && key && use_cache) {
20368            line_cache.set(key, { input: arg, raw });
20369          }
20370          buffer.append(arg, line.index, line_settings, raw);
20371        } catch (e) {
20372          if (safe_throw) {
20373            throw e;
20374          }
20375          buffer.clear();
20376          if (is_function(settings2.exceptionHandler)) {
20377            settings2.exceptionHandler.call(self2, e, "TERMINAL");
20378          } else {
20379            alert_exception("[Internal Exception(process_line)]", e);
20380          }
20381        }
20382        return true;
20383      }
20384      function redraw(options2) {
20385        options2 = $.extend({}, {
20386          update: false,
20387          scroll: true
20388        }, options2 || {});
20389        if (!options2.update) {
20390          command_line.resize(num_chars);
20391          var detached_output = output.empty().detach();
20392        }
20393        try {
20394          buffer.clear();
20395          unpromise(lines.render(self2.rows(), function(lines_to_show) {
20396            return lines_to_show.map(process_line);
20397          }), function() {
20398            self2.flush(options2);
20399            if (!options2.update) {
20400              command_line.before(detached_output);
20401            }
20402            fire_event("onAfterRedraw");
20403          });
20404        } catch (e) {
20405          if (is_function(settings2.exceptionHandler)) {
20406            settings2.exceptionHandler.call(self2, e, "TERMINAL (redraw)");
20407          } else {
20408            alert_exception("[redraw]", e);
20409          }
20410        }
20411      }
20412      function limit_lines() {
20413        var $lines = output.find("> div > div");
20414        if (settings2.outputLimit >= 0) {
20415          var limit;
20416          if (settings2.outputLimit === 0) {
20417            limit = self2.rows();
20418          } else {
20419            limit = settings2.outputLimit;
20420          }
20421          if ($lines.length + 1 > limit) {
20422            var max = $lines.length - limit + 1;
20423            var for_remove = $lines.slice(0, max);
20424            var parents = for_remove.parent();
20425            for_remove.remove();
20426            parents.each(function() {
20427              var $self = $(this);
20428              if ($self.is(":empty")) {
20429                lines.unmount($self);
20430                $self.remove();
20431              }
20432            });
20433            lines.limit_snapshot(max);
20434            return max;
20435          }
20436        }
20437        return $lines.length;
20438      }
20439      function show_greetings() {
20440        if (settings2.greetings === undefined) {
20441          self2.echo(self2.signature, { finalize: a11y_hide, formatters: false });
20442        } else if (settings2.greetings) {
20443          if (is_string(settings2.greetings)) {
20444            self2.echo(settings2.greetings);
20445          } else if (is_function(settings2.greetings)) {
20446            self2.echo(function() {
20447              try {
20448                var defer = new $.Deferred;
20449                var ret2 = settings2.greetings.call(self2, defer.resolve);
20450                if (ret2) {
20451                  defer.resolve(ret2);
20452                }
20453                return defer.promise();
20454              } catch (e) {
20455                settings2.greetings = null;
20456                display_exception(e, "greetings");
20457              }
20458            });
20459          } else {
20460            self2.error(strings().wrongGreetings);
20461          }
20462        }
20463      }
20464      function mask_command(command) {
20465        var mask = command_line.mask();
20466        switch (typeof mask) {
20467          case "string":
20468            return command.replace(/./g, mask);
20469          case "boolean":
20470            if (mask) {
20471              return command.replace(/./g, settings2.maskChar);
20472            } else {
20473              return $.terminal.escape_formatting(command);
20474            }
20475        }
20476        throw new $.terminal.Exception(strings().invalidMask);
20477      }
20478      function echo_command(command) {
20479        if (typeof command === "undefined") {
20480          command = self2.get_command();
20481        }
20482        var prompt = command_line.prompt(true);
20483        command = mask_command(command);
20484        var options2 = {
20485          exec: false,
20486          formatters: false,
20487          convertLinks: false,
20488          finalize: function finalize(div) {
20489            a11y_hide(div.addClass("terminal-command"));
20490            fire_event("onEchoCommand", [div, command]);
20491          }
20492        };
20493        command = $.terminal.apply_formatters(command, { command: true });
20494        self2.echo(prompt + command, options2);
20495      }
20496      function have_scrollbar() {
20497        return filler.outerWidth() !== self2.outerWidth();
20498      }
20499      function restore_state(spec) {
20500        var terminal = terminals.get()[spec[0]];
20501        if (!terminal) {
20502          throw new $.terminal.Exception(strings().invalidTerminalId);
20503        }
20504        var command_idx = spec[1];
20505        if (save_state[command_idx]) {
20506          terminal.import_view(save_state[command_idx]);
20507        } else {
20508          change_hash = false;
20509          var command = spec[2];
20510          if (command) {
20511            terminal.exec(command).done(function() {
20512              change_hash = true;
20513              save_state[command_idx] = terminal.export_view();
20514            });
20515          }
20516        }
20517      }
20518      var signals = ["AbortError", "TimeoutError"];
20519      function make_label_error(label) {
20520        return function(err) {
20521          if (signals.includes(err.name) && !settings2.errorOnAbort) {
20522            return;
20523          }
20524          self2.error("[" + label + "] " + (err.message || err)).resume();
20525        };
20526      }
20527      function maybe_update_hash() {
20528        if (change_hash) {
20529          fire_hash_change = false;
20530          location.hash = "#" + JSON.stringify(hash_commands);
20531          setTimeout(function() {
20532            fire_hash_change = true;
20533          }, 100);
20534        }
20535      }
20536      var first_command = true;
20537      var resume_callbacks = [];
20538      function commands(command, silent, exec) {
20539        function init_state() {
20540          if (settings2.historyState || settings2.execHash && exec) {
20541            if (!save_state.length) {
20542              self2.save_state();
20543            } else {
20544              self2.save_state(null);
20545            }
20546          }
20547        }
20548        function before_async_exec() {
20549          if (!exec) {
20550            change_hash = true;
20551            if (settings2.historyState) {
20552              self2.save_state(command, false);
20553            }
20554            change_hash = saved_change_hash;
20555          }
20556        }
20557        function after_exec() {
20558          deferred2.resolve();
20559          fire_event("onAfterCommand", [command]);
20560        }
20561        function show(result, promise) {
20562          if (typeof result !== "undefined" && result !== self2) {
20563            display_object(result);
20564          }
20565          after_exec();
20566          if (promise) {
20567            self2.resume();
20568          }
20569        }
20570        function is_animation_promise(ret2) {
20571          return is_function(ret2.done || ret2.then) && animating;
20572        }
20573        var command_error = make_label_error("Command");
20574        function invoke_error(err) {
20575          command_error(err);
20576          abort_controllers = [];
20577        }
20578        function invoke() {
20579          var result = interpreter.interpreter.call(self2, command, self2);
20580          before_async_exec();
20581          if (result) {
20582            if (!force_awake) {
20583              if (is_animation_promise(result)) {
20584                paused = true;
20585              } else if (is_promise(result)) {
20586                self2.pause(settings2.softPause);
20587              }
20588            }
20589            force_awake = false;
20590            if (is_function(result.done || result.then)) {
20591              return unpromise(result, function(value) {
20592                show(value, true);
20593                abort_controllers = [];
20594              }, invoke_error);
20595            } else {
20596              return $.when(result).done(show).catch(invoke_error);
20597            }
20598          } else {
20599            if (exec) {
20600              command_line.refresh();
20601            }
20602            if (paused) {
20603              resume_callbacks.push(function() {
20604                after_exec();
20605              });
20606            } else {
20607              after_exec();
20608            }
20609            if (exec) {
20610              return deferred2.promise();
20611            }
20612          }
20613        }
20614        if (first_command) {
20615          first_command = false;
20616          init_state();
20617        }
20618        try {
20619          if (fire_event("onBeforeCommand", [command]) === false) {
20620            return;
20621          }
20622          if (exec) {
20623            prev_exec_cmd = command.trim();
20624            prev_command = $.terminal.split_command(prev_exec_cmd);
20625          } else {
20626            prev_command = $.terminal.split_command(command);
20627          }
20628          if (!ghost()) {
20629            if (exec && (is_function(settings2.historyFilter) && settings2.historyFilter(command) || command.match(settings2.historyFilter))) {
20630              command_line.history().append(command);
20631            }
20632          }
20633          var interpreter = interpreters.top();
20634          if (!silent && settings2.echoCommand) {
20635            echo_command(command);
20636          }
20637          var deferred2 = new $.Deferred;
20638          var saved_change_hash = change_hash;
20639          if (command.match(/^\s*login\s*$/) && self2.token(true)) {
20640            before_async_exec();
20641            if (self2.level() > 1) {
20642              self2.logout(true);
20643            } else {
20644              self2.logout();
20645            }
20646            after_exec();
20647          } else if (settings2.exit && command.match(/^\s*exit\s*$/) && !in_login) {
20648            before_async_exec();
20649            var level = self2.level();
20650            if (level === 1 && self2.get_token() || level > 1) {
20651              if (self2.get_token(true)) {
20652                self2.set_token(undefined, true);
20653              }
20654              self2.pop();
20655            }
20656            after_exec();
20657          } else if (settings2.clear && command.match(/^\s*clear\s*$/) && !in_login) {
20658            before_async_exec();
20659            self2.clear();
20660            after_exec();
20661          } else {
20662            return invoke();
20663          }
20664          return deferred2.promise();
20665        } catch (e) {
20666          display_exception(e, "USER", exec);
20667          self2.resume();
20668          if (exec) {
20669            throw e;
20670          }
20671        }
20672      }
20673      function global_logout() {
20674        if (fire_event("onBeforeLogout", [], true) === false) {
20675          return;
20676        }
20677        clear_loging_storage();
20678        fire_event("onAfterlogout", [], true);
20679        self2.login(global_login_fn, true, start);
20680      }
20681      function clear_loging_storage() {
20682        var name = self2.prefix_name(true) + "_";
20683        storage.remove(name + "token");
20684        storage.remove(name + "login");
20685      }
20686      function maybe_append_name(interpreter_name) {
20687        var storage_key = self2.prefix_name() + "_interpreters";
20688        var names = storage.get(storage_key);
20689        if (names) {
20690          names = JSON.parse(names);
20691        } else {
20692          names = [];
20693        }
20694        if ($.inArray(interpreter_name, names) === -1) {
20695          names.push(interpreter_name);
20696          storage.set(storage_key, JSON.stringify(names));
20697        }
20698      }
20699      function prepare_top_interpreter(silent) {
20700        var interpreter = interpreters.top();
20701        var name = self2.prefix_name(true);
20702        if (!ghost()) {
20703          maybe_append_name(name);
20704        }
20705        var login = self2.login_name(true);
20706        command_line.name(name + (login ? "_" + login : ""));
20707        var prompt = interpreter.prompt;
20708        if (is_function(prompt)) {
20709          prompt = context_callback_proxy(prompt);
20710        }
20711        var is_dynamic_prompt = is_function(interpreter.prompt);
20712        if (is_dynamic_prompt || prompt !== command_line.prompt()) {
20713          if (is_dynamic_prompt) {
20714            command_line.prompt("");
20715          }
20716          command_line.prompt(interpreter.prompt);
20717        }
20718        if (typeof interpreter.history !== "undefined") {
20719          self2.history().toggle(interpreter.history);
20720        }
20721        if ($.isPlainObject(interpreter.keymap)) {
20722          command_line.keymap(null).keymap($.extend({}, terminal_init_keymap, $.omap(interpreter.keymap, function(name, fun) {
20723            return function() {
20724              var args2 = [].slice.call(arguments);
20725              try {
20726                return fun.apply(self2, args2);
20727              } catch (e) {
20728                display_exception(e, "USER KEYMAP");
20729              }
20730            };
20731          })));
20732        }
20733        command_line.set("");
20734        if (!silent && is_function(interpreter.onStart)) {
20735          interpreter.onStart.call(self2, self2);
20736        }
20737      }
20738      function fire_event(name, args2, skip_local) {
20739        args2 = (args2 || []).concat([self2]);
20740        var top = interpreters && interpreters.top();
20741        if (top && is_function(top[name]) && !skip_local) {
20742          try {
20743            return top[name].apply(self2, args2);
20744          } catch (e) {
20745            delete top[name];
20746            display_exception(e, name);
20747          }
20748        } else if (is_function(settings2[name])) {
20749          try {
20750            return settings2[name].apply(self2, args2);
20751          } catch (e) {
20752            settings2[name] = null;
20753            display_exception(e, name);
20754          }
20755        }
20756      }
20757      var scroll_to_view = function() {
20758        function scroll_to_view(visible) {
20759          if (!visible) {
20760            try {
20761              self2.scroll_to(self2.find(".cmd-cursor-line"));
20762              return true;
20763            } catch (e) {
20764              return true;
20765            }
20766          }
20767        }
20768        if (typeof global !== "undefined" && typeof global.it === "function") {
20769          return scroll_to_view;
20770        }
20771        return debounce(scroll_to_view, 100, {
20772          leading: true,
20773          trailing: false
20774        });
20775      }();
20776      function make_cursor_visible() {
20777        var cursor = self2.find(".cmd-cursor-line");
20778        return cursor.is_fully_in_viewport(self2).then(scroll_to_view);
20779      }
20780      function replace_hash(state) {
20781        if (typeof history !== "undefined" && history.replaceState) {
20782          var new_hash = "#" + JSON.stringify(state);
20783          var url = location.href.replace(/#.*$/, new_hash);
20784          history.replaceState(null, "", url);
20785        }
20786      }
20787      function hashchange() {
20788        if (fire_hash_change && settings2.execHash) {
20789          try {
20790            if (location.hash) {
20791              var hash = location.hash.replace(/^#/, "");
20792              hash_commands = JSON.parse(decodeURIComponent(hash));
20793            } else {
20794              hash_commands = [];
20795            }
20796            if (hash_commands.length) {
20797              restore_state(hash_commands[hash_commands.length - 1]);
20798            } else if (save_state[0]) {
20799              self2.import_view(save_state[0]);
20800            }
20801          } catch (e) {
20802            display_exception(e, "TERMINAL");
20803          }
20804        }
20805      }
20806      function start() {
20807        prepare_top_interpreter();
20808        init_queue.resolve();
20809        show_greetings();
20810      }
20811      function initialize() {
20812        if (lines.length) {
20813          if (echo_delay.length) {
20814            $.when.apply($, echo_delay);
20815          }
20816        }
20817        function next() {
20818          onPause = $.noop;
20819          if (!was_paused && self2.enabled()) {
20820            self2.resume(true);
20821          }
20822        }
20823        var was_paused = false;
20824        if (is_function(settings2.onInit)) {
20825          onPause = function() {
20826            was_paused = true;
20827          };
20828          var ret2;
20829          try {
20830            ret2 = settings2.onInit.call(self2, self2);
20831          } catch (e) {
20832            display_exception(e, "OnInit");
20833          } finally {
20834            if (!is_promise(ret2)) {
20835              next();
20836            } else {
20837              ret2.then(next).catch(function(e) {
20838                display_exception(e, "OnInit");
20839                next();
20840              });
20841            }
20842          }
20843        }
20844        if (first_instance) {
20845          first_instance = false;
20846          $(window).on("hashchange", hashchange);
20847        }
20848      }
20849      function ghost() {
20850        return in_login || command_line.mask() !== false;
20851      }
20852      function user_key_down(e) {
20853        var result, top = interpreters.top();
20854        if (is_function(top.keydown)) {
20855          result = top.keydown.call(self2, e, self2);
20856          if (result !== undefined) {
20857            return result;
20858          }
20859        } else if (is_function(settings2.keydown)) {
20860          result = settings2.keydown.call(self2, e, self2);
20861          if (result !== undefined) {
20862            return result;
20863          }
20864        }
20865      }
20866      var keymap = {
20867        "CTRL+D": function(e, original) {
20868          if (!in_login) {
20869            if (command_line.get() === "") {
20870              if (interpreters.size() > 1 || is_function(global_login_fn)) {
20871                self2.pop("");
20872              } else {
20873                self2.resume();
20874              }
20875            } else {
20876              original();
20877            }
20878          }
20879          return false;
20880        },
20881        "CTRL+C": function() {
20882          with_selection(function(html) {
20883            if (html === "") {
20884              var command = self2.get_command();
20885              var position = self2.get_position();
20886              command = command.slice(0, position) + "^C" + command.slice(position + 2);
20887              echo_command(command);
20888              self2.set_command("");
20889            } else {
20890              var clip = self2.find("textarea");
20891              text_to_clipboard(clip, process_selected_html(html));
20892            }
20893          });
20894          return false;
20895        },
20896        "CTRL+L": function() {
20897          self2.clear();
20898          return false;
20899        },
20900        TAB: function(e, orignal) {
20901          var top = interpreters.top(), completion, caseSensitive;
20902          if (typeof top.caseSensitiveAutocomplete !== "undefined") {
20903            caseSensitive = top.caseSensitiveAutocomplete;
20904          } else {
20905            caseSensitive = settings2.caseSensitiveAutocomplete;
20906          }
20907          if (settings2.completion && get_type(settings2.completion) !== "boolean" && top.completion === undefined) {
20908            completion = settings2.completion;
20909          } else {
20910            completion = top.completion;
20911          }
20912          if (completion === "settings") {
20913            completion = settings2.completion;
20914          }
20915          function resolve(commands) {
20916            commands = commands.slice();
20917            if (!self2.before_cursor(false).match(/\s/)) {
20918              if (settings2.clear && $.inArray("clear", commands) === -1) {
20919                commands.push("clear");
20920              }
20921              if (settings2.exit && $.inArray("exit", commands) === -1) {
20922                commands.push("exit");
20923              }
20924            }
20925            self2.complete(commands, {
20926              echo: true,
20927              word: settings2.wordAutocomplete,
20928              escape: settings2.completionEscape,
20929              caseSensitive,
20930              echoCommand: settings2.doubleTabEchoCommand,
20931              doubleTab: settings2.doubleTab
20932            });
20933          }
20934          if (completion) {
20935            switch (get_type(completion)) {
20936              case "function":
20937                var string2 = self2.before_cursor(settings2.wordAutocomplete);
20938                if (completion.length === 3) {
20939                  var error = new Error(strings().comletionParameters);
20940                  display_exception(error, "USER");
20941                  return false;
20942                }
20943                var result = completion.call(self2, string2, resolve);
20944                unpromise(result, resolve, make_label_error("Completion"));
20945                break;
20946              case "array":
20947                resolve(completion);
20948                break;
20949              default:
20950                throw new $.terminal.Exception(strings().invalidCompletion);
20951            }
20952          } else {
20953            orignal();
20954          }
20955          return false;
20956        },
20957        "CTRL+V": function(e, original) {
20958          original(e);
20959          self2.oneTime(200, function() {
20960            self2.scroll_to_bottom();
20961          });
20962          return true;
20963        },
20964        "CTRL+TAB": function() {
20965          if (terminals.length() > 1) {
20966            self2.focus(false);
20967            return false;
20968          }
20969        },
20970        PAGEDOWN: function() {
20971          self2.scroll(self2.height());
20972        },
20973        PAGEUP: function() {
20974          self2.scroll(-self2.height());
20975        }
20976      };
20977      function key_down(e) {
20978        var result, i;
20979        if (animating) {
20980          return false;
20981        }
20982        if (self2.enabled()) {
20983          if (!self2.paused()) {
20984            result = user_key_down(e);
20985            if (result !== undefined) {
20986              return result;
20987            }
20988            if (e.which !== 9) {
20989              tab_count = 0;
20990            }
20991          } else {
20992            if (!settings2.pauseEvents) {
20993              result = user_key_down(e);
20994              if (result !== undefined) {
20995                return result;
20996              }
20997            }
20998            if (e.which === 68 && e.ctrlKey) {
20999              if (settings2.pauseEvents) {
21000                result = user_key_down(e);
21001                if (result !== undefined) {
21002                  return result;
21003                }
21004              }
21005              self2.abort();
21006              if (requests.length) {
21007                for (i = requests.length;i--; ) {
21008                  var r = requests[i];
21009                  if (r.readyState !== 4) {
21010                    try {
21011                      r.abort();
21012                    } catch (error) {
21013                      if (is_function(settings2.exceptionHandler)) {
21014                        settings2.exceptionHandler.call(self2, e, "AJAX ABORT");
21015                      } else {
21016                        self2.error(strings().ajaxAbortError);
21017                      }
21018                    }
21019                  }
21020                }
21021                requests = [];
21022              }
21023              self2.resume();
21024            }
21025            return true;
21026          }
21027        }
21028      }
21029      function key_press(e) {
21030        var top = interpreters.top();
21031        if (enabled && (!paused || !settings2.pauseEvents)) {
21032          if (is_function(top.keypress)) {
21033            return top.keypress.call(self2, e, self2);
21034          } else if (is_function(settings2.keypress)) {
21035            return settings2.keypress.call(self2, e, self2);
21036          }
21037        }
21038      }
21039      function typed(finish_typing_fn, optimized) {
21040        return function typing_animation(message, options2) {
21041          var formatted = $.terminal.apply_formatters(message, {
21042            animation: true
21043          });
21044          formatted = $.terminal.normalize(formatted);
21045          var keepWords = false;
21046          if (options2 && typeof options2.keepWords !== "undefined") {
21047            keepWords = options2.keepWords;
21048          }
21049          if (optimized) {
21050            var formatted_lines = $.terminal.split_equal(formatted, self2.cols(), {
21051              keepWords
21052            });
21053          }
21054          var was_animating = animating;
21055          animating = true;
21056          var prompt = self2.get_prompt();
21057          var char_i = 0;
21058          var len = $.terminal.length(formatted);
21059          if (len > 0) {
21060            var new_prompt = "";
21061            if (options2.prompt) {
21062              new_prompt = $.terminal.apply_formatters(options2.prompt, {
21063                prompt: true
21064              });
21065            } else {
21066              self2.set_prompt("");
21067            }
21068            var bottom = self2.is_bottom();
21069            var line = 0;
21070            if (optimized) {
21071              var anim_lines = formatted_lines.map(function(formatted) {
21072                return {
21073                  formatted,
21074                  chars: $.terminal.partition(formatted, { wrap: false }),
21075                  len: $.terminal.length(formatted)
21076                };
21077              });
21078            } else {
21079              var chars = $.terminal.partition(formatted, { wrap: false });
21080            }
21081            var stop;
21082            var interval = setInterval(function() {
21083              var formatted_line, input_chars, input_len;
21084              if (!skip) {
21085                if (optimized) {
21086                  formatted_line = anim_lines[line].formatted;
21087                  input_chars = anim_lines[line].chars;
21088                  input_len = anim_lines[line].len;
21089                } else {
21090                  formatted_line = formatted;
21091                  input_chars = chars;
21092                  input_len = len;
21093                }
21094                if (input_len === 0) {
21095                  command_line.prompt("");
21096                } else {
21097                  var chr = input_chars[char_i];
21098                  if (options2.mask) {
21099                    var mask = command_line.mask();
21100                    if (typeof mask === "string") {
21101                      chr = mask;
21102                    } else if (mask) {
21103                      chr = settings2.maskChar;
21104                    }
21105                  }
21106                  new_prompt += chr;
21107                  command_line.prompt(new_prompt, { formatters: false });
21108                  if (bottom && (chr === `
21109` || !self2.is_bottom())) {
21110                    self2.scroll_to_bottom();
21111                  }
21112                  char_i++;
21113                }
21114                if (char_i === input_len && optimized) {
21115                  var index = self2.last_index();
21116                  if (line === anim_lines.length - 1) {
21117                    self2.set_prompt(prompt);
21118                  } else {
21119                    self2.set_prompt("");
21120                  }
21121                  var is_partial = !!output.find(".partial").length;
21122                  self2.echo(formatted_line, $.extend({}, options2, {
21123                    formatters: false,
21124                    finalize: null,
21125                    typing: false
21126                  }));
21127                  anim_lines[line].index = index + 1;
21128                  new_prompt = "";
21129                  ++line;
21130                  char_i = 0;
21131                }
21132              } else {
21133                self2.skip_stop();
21134                var chr_rest = $.terminal.substring(formatted, char_i, len);
21135                new_prompt += chr_rest;
21136                command_line.prompt(new_prompt, { formatters: false });
21137                stop = true;
21138              }
21139              if (!stop) {
21140                if (optimized) {
21141                  stop = line === anim_lines.length;
21142                } else {
21143                  stop = char_i === len;
21144                }
21145              }
21146              if (stop) {
21147                clearInterval(interval);
21148                if (is_partial || options2.newline === false) {
21149                  var idx = self2.last_index();
21150                  var node = output.find('[data-index="' + idx + '"]');
21151                  options2.finalize(node);
21152                } else {
21153                  if (optimized) {
21154                    anim_lines.forEach(function(line) {
21155                      if (typeof line.index !== "undefined") {
21156                        self2.remove_line(line.index);
21157                      }
21158                    });
21159                  }
21160                  finish_typing_fn(message, prompt, options2);
21161                }
21162                if (!was_animating) {
21163                  animating = false;
21164                }
21165              }
21166            }, options2.delay);
21167          }
21168        };
21169      }
21170      var typed_prompt = typed(function(message, _, options2) {
21171        self2.set_prompt(message);
21172        options2.finalize();
21173      }, true);
21174      var typed_insert = function() {
21175        var helper = typed(function(message, prompt, options2) {
21176          self2.set_prompt(prompt);
21177          self2.insert(message);
21178          options2.finalize();
21179        });
21180        return function(prompt, command, options2) {
21181          return helper(command, $.extend({}, options2, {
21182            prompt: prompt + self2.get_command()
21183          }));
21184        };
21185      }();
21186      var typed_message = typed(function(message, prompt, options2) {
21187        self2.set_prompt(prompt);
21188        self2.echo(message, $.extend({}, options2, { typing: false }));
21189      }, true);
21190      var typed_enter = function() {
21191        var helper = typed(function(message, prompt, options2) {
21192          self2.set_prompt(prompt);
21193          with_prompt(prompt, function(prompt) {
21194            var command = mask_command(message);
21195            prompt = $.terminal.apply_formatters(prompt, { prompt: true });
21196            command = $.terminal.apply_formatters(command, { command: true });
21197            var output = prompt + command;
21198            options2 = $.extend({}, options2, {
21199              typing: false,
21200              formatters: false,
21201              convertLinks: false
21202            });
21203            self2.echo(output, options2);
21204          }, self2);
21205        });
21206        return function(prompt, message, options2) {
21207          return helper(message, $.extend({}, options2, {
21208            prompt,
21209            mask: true
21210          }));
21211        };
21212      }();
21213      function with_typing(kind, else_fn, finalize_fn) {
21214        return function with_typing_fn(string2, options2) {
21215          var d = new $.Deferred;
21216          when_ready(function ready() {
21217            var locals = $.extend({
21218              typing: false,
21219              delay: settings2.execAnimationDelay
21220            }, options2);
21221            if (locals.typing) {
21222              if (typeof string2 !== "string") {
21223                return d.reject(kind + ": Typing animation require string");
21224              }
21225              if (typeof locals.delay !== "number" || isNaN(locals.delay)) {
21226                return d.reject(kind + ": Invalid argument, delay need to" + " be a number");
21227              }
21228              var p = self2.typing(kind, locals.delay, string2, locals);
21229              p.then(function() {
21230                d.resolve();
21231              });
21232            } else {
21233              else_fn(string2, locals);
21234            }
21235            if (is_function(finalize_fn)) {
21236              finalize_fn(string2, locals);
21237            }
21238          });
21239          if (options2 && options2.typing) {
21240            return d.promise();
21241          }
21242          return self2;
21243        };
21244      }
21245      function validate_login(user, token_or_password, callback) {
21246        var ret2 = fire_event("onBeforeLogin", [user, token_or_password]);
21247        return unpromise(defined(ret2), callback, "validate_login");
21248      }
21249      function authentication(auth_callback, infinite, success, error) {
21250        if (settings2.history) {
21251          command_line.history().disable();
21252        }
21253        var level = self2.level();
21254        clear_token();
21255        function pop_user_pass() {
21256          while (self2.level() > level) {
21257            self2.pop(undefined, true);
21258          }
21259          if (settings2.history) {
21260            command_line.history().enable();
21261          }
21262        }
21263        function set_token(user, token) {
21264          var name = self2.prefix_name(true) + "_";
21265          storage.set(name + "token", token);
21266          storage.set(name + "login", user);
21267        }
21268        function clear_token() {
21269          var name = self2.prefix_name(true) + "_";
21270          storage.remove(name + "token");
21271          storage.remove(name + "login");
21272        }
21273        function login_callback(user, token, silent) {
21274          cmd_ready(function ready() {
21275            var next;
21276            if (token) {
21277              pop_user_pass();
21278              set_token(user, token);
21279              in_login = false;
21280              fire_event("onAfterLogin", [user, token]);
21281              next = success;
21282            } else {
21283              if (infinite) {
21284                if (!silent) {
21285                  self2.error(strings().wrongPasswordTryAgain);
21286                }
21287                self2.pop(undefined, true).set_mask(false);
21288              } else {
21289                in_login = false;
21290                if (!silent) {
21291                  self2.error(strings().wrongPassword);
21292                }
21293                self2.pop(undefined, true).pop(undefined, true);
21294              }
21295              next = error;
21296            }
21297            if (self2.paused()) {
21298              self2.resume();
21299            }
21300            if (is_function(next)) {
21301              next();
21302            }
21303            self2.off("terminal.autologin");
21304          });
21305        }
21306        self2.on("terminal.autologin", function(event, user, token, silent) {
21307          validate_login(user, token, function(valid) {
21308            if (valid !== false) {
21309              login_callback(user, token, silent);
21310            }
21311          });
21312        });
21313        self2.push(function(user) {
21314          self2.set_mask(settings2.maskChar).push(function(pass) {
21315            try {
21316              validate_login(user, pass, function(valid) {
21317                if (valid === false) {
21318                  pop_user_pass();
21319                  return;
21320                }
21321                self2.pause();
21322                try {
21323                  var args2 = [user, pass, function(token, silent) {
21324                    login_callback(user, token, silent);
21325                  }];
21326                  var ret2 = auth_callback.apply(self2, args2);
21327                  unpromise(ret2, function(token) {
21328                    login_callback(user, token);
21329                  }, function(err) {
21330                    self2.pop(undefined, true).pop(undefined, true);
21331                    self2.error(err.message);
21332                    if (is_function(error)) {
21333                      error();
21334                    }
21335                    if (self2.paused()) {
21336                      self2.resume();
21337                    }
21338                    self2.off("terminal.autologin");
21339                  });
21340                } catch (e) {
21341                  display_exception(e, "AUTH");
21342                }
21343              });
21344            } catch (e) {
21345              display_exception(e, "AUTH");
21346            }
21347          }, {
21348            prompt: strings().password + ": ",
21349            name: "password"
21350          });
21351        }, {
21352          prompt: strings().login + ": ",
21353          name: "login"
21354        });
21355      }
21356      function ready(queue) {
21357        return function(fun) {
21358          queue.add(fun);
21359        };
21360      }
21361      function strings() {
21362        return $.extend({}, $.terminal.defaults.strings, settings2 && settings2.strings || {});
21363      }
21364      function get_prop_number(style, prop) {
21365        return parseInt(style.getPropertyValue(prop), 10) || 0;
21366      }
21367      function get_scrollbar_width() {
21368        var width = filler.outerWidth();
21369        return container_width - width;
21370      }
21371      function get_padding() {
21372        var style = window.getComputedStyle(filler[0]);
21373        function padding(name) {
21374          return get_prop_number(style, "padding-" + name);
21375        }
21376        var left = padding("left");
21377        var right = padding("right");
21378        var top = padding("top");
21379        var bottom = padding("bottom");
21380        return {
21381          top,
21382          left,
21383          right,
21384          bottom
21385        };
21386      }
21387      var self2 = this;
21388      if (this.length > 1) {
21389        return this.each(function() {
21390          $.fn.terminal.call($(this), init_interpreter, $.extend({ name: self2.selector }, options2));
21391        });
21392      }
21393      var body_terminal;
21394      if (self2.is("body,html")) {
21395        if (self2.hasClass("full-screen-terminal")) {
21396          var data = self2.find("> .terminal").data("terminal");
21397          if (data) {
21398            return data;
21399          }
21400        }
21401        body_terminal = self2;
21402        self2 = $("<div/>").appendTo("body");
21403        $("body").addClass("full-screen-terminal");
21404      } else if (self2.data("terminal")) {
21405        return self2.data("terminal");
21406      }
21407      var public_api = $.omap({
21408        id: function() {
21409          return terminal_id;
21410        },
21411        clear: function() {
21412          if (fire_event("onClear") !== false) {
21413            buffer.clear();
21414            lines.clear(function(i) {
21415              return get_node(i);
21416            });
21417            output[0].innerHTML = "";
21418            self2.prop({ scrollTop: 0 });
21419          }
21420          return self2;
21421        },
21422        output_ready: function() {
21423          return event_hub.wait_for("async_echo_ready");
21424        },
21425        export_view: function() {
21426          var user_export = fire_event("onExport");
21427          user_export = user_export || {};
21428          return $.extend({}, {
21429            focus: enabled,
21430            mask: command_line.mask(),
21431            prompt: self2.get_prompt(),
21432            command: self2.get_command(),
21433            position: command_line.position(),
21434            lines: clone(lines.data()),
21435            interpreters: interpreters.clone(),
21436            history: command_line.history().data
21437          }, user_export);
21438        },
21439        import_view: function(view) {
21440          if (in_login) {
21441            throw new Error(sprintf(strings().notWhileLogin, "import_view"));
21442          }
21443          fire_event("onImport", [view]);
21444          when_ready(function ready() {
21445            var bottom = self2.is_bottom();
21446            self2.set_prompt(view.prompt);
21447            self2.set_command(view.command);
21448            command_line.position(view.position);
21449            command_line.mask(view.mask);
21450            if (view.focus) {
21451              self2.focus();
21452            }
21453            lines.import(clone(view.lines));
21454            if (view.interpreters instanceof Stack) {
21455              interpreters = view.interpreters;
21456            }
21457            if (settings2.importHistory) {
21458              command_line.history().set(view.history);
21459            }
21460            redraw();
21461            if (bottom) {
21462              self2.scroll_to_bottom();
21463            }
21464          });
21465          return self2;
21466        },
21467        save_state: function(command, ignore_hash, index) {
21468          if (typeof index !== "undefined") {
21469            save_state[index] = self2.export_view();
21470          } else {
21471            save_state.push(self2.export_view());
21472          }
21473          if (!Array.isArray(hash_commands)) {
21474            hash_commands = [];
21475          }
21476          if (command !== undefined && !ignore_hash) {
21477            var state = [
21478              terminal_id,
21479              save_state.length - 1,
21480              command
21481            ];
21482            hash_commands.push(state);
21483            maybe_update_hash();
21484          }
21485          return self2;
21486        },
21487        exec: function(command, silent, options2) {
21488          function invoke(silent) {
21489            if (exec_settings.history) {
21490              command_line.history().append(command);
21491            }
21492            var ret2 = commands(command, silent, true);
21493            unpromise(ret2, function() {
21494              prev_command = null;
21495              d.resolve();
21496            }, function() {
21497              prev_command = null;
21498              d.reject();
21499            });
21500          }
21501          if (silent && typeof silent === "object") {
21502            options2 = silent;
21503            silent = null;
21504          }
21505          var exec_settings = $.extend({
21506            deferred: null,
21507            silent: false,
21508            history: false,
21509            typing: false,
21510            delay: settings2.execAnimationDelay
21511          }, options2);
21512          if (silent === null) {
21513            silent = exec_settings.silent;
21514          }
21515          if (!is_deferred(exec_settings.deferred)) {
21516            exec_settings.deferred = new $.Deferred;
21517          }
21518          var d = exec_settings.deferred;
21519          cmd_ready(function ready() {
21520            if (Array.isArray(command)) {
21521              (function recur() {
21522                var cmd = command.shift();
21523                if (cmd) {
21524                  self2.exec(cmd, silent, options2).done(recur);
21525                } else {
21526                  d.resolve();
21527                }
21528              })();
21529            } else if (paused) {
21530              delayed_commands.push([command, silent, exec_settings]);
21531            } else if (exec_settings.typing && !silent) {
21532              var delay = exec_settings.delay;
21533              paused = true;
21534              var ret2 = self2.typing("enter", delay, command, {
21535                delay
21536              });
21537              ret2.then(function() {
21538                paused = false;
21539                invoke(true);
21540              });
21541              d.then(function() {
21542                paused = false;
21543              });
21544            } else {
21545              invoke(silent);
21546            }
21547          });
21548          return d.promise();
21549        },
21550        autologin: function(user, token, silent) {
21551          self2.trigger("terminal.autologin", [user, token, silent]);
21552          return self2;
21553        },
21554        login: function(auth_callback, infinite, success, error) {
21555          logins.push([].slice.call(arguments));
21556          if (in_login) {
21557            throw new Error(sprintf(strings().notWhileLogin, "login"));
21558          }
21559          if (!is_function(auth_callback)) {
21560            throw new Error(strings().loginIsNotAFunction);
21561          }
21562          in_login = true;
21563          if (self2.token() && self2.level() === 1 && !autologin) {
21564            in_login = false;
21565            self2.logout(true);
21566          } else {
21567            var token = self2.token(true);
21568            var login = self2.login_name(true);
21569            if (token && login) {
21570              in_login = false;
21571              self2.pause();
21572              validate_login(login, token, function(valid) {
21573                if (valid !== false) {
21574                  if (is_function(success)) {
21575                    success();
21576                  } else {
21577                    self2.resume();
21578                  }
21579                } else {
21580                  self2.resume();
21581                  authentication(auth_callback, infinite, success, error);
21582                }
21583              });
21584            } else {
21585              authentication(auth_callback, infinite, success, error);
21586            }
21587          }
21588          return self2;
21589        },
21590        settings: function() {
21591          return settings2;
21592        },
21593        before_cursor: function(word) {
21594          var pos = command_line.position();
21595          var command = command_line.get().slice(0, pos);
21596          var cmd_strings = command.split(/\s/);
21597          var string2;
21598          if (word) {
21599            if (cmd_strings.length === 1) {
21600              string2 = cmd_strings[0];
21601            } else {
21602              var m2 = command.match(/(\\?")/g);
21603              var double_quotes = m2 ? m2.filter(function(chr) {
21604                return !chr.match(/^\\/);
21605              }).length : 0;
21606              m2 = command.match(/'/g);
21607              var single_quote = m2 ? m2.length : 0;
21608              if (single_quote % 2 === 1) {
21609                string2 = command.match(/('[^']*)$/)[0];
21610              } else if (double_quotes % 2 === 1) {
21611                string2 = command.match(/("(?:[^"]|\\")*)$/)[0];
21612              } else {
21613                string2 = cmd_strings[cmd_strings.length - 1];
21614                for (i = cmd_strings.length - 1;i > 0; i--) {
21615                  var prev_string = cmd_strings[i - 1];
21616                  if (prev_string[prev_string.length - 1] === "\\") {
21617                    string2 = cmd_strings[i - 1] + " " + string2;
21618                  } else {
21619                    break;
21620                  }
21621                }
21622              }
21623            }
21624          } else {
21625            string2 = command;
21626          }
21627          return string2;
21628        },
21629        complete: function(commands, options2) {
21630          options2 = $.extend({
21631            word: true,
21632            echo: false,
21633            escape: true,
21634            echoCommand: false,
21635            caseSensitive: true,
21636            doubleTab: null
21637          }, options2 || {});
21638          var sensitive = options2.caseSensitive;
21639          var string2 = self2.before_cursor(options2.word).replace(/\\"/g, '"');
21640          var quote = false;
21641          if (options2.word) {
21642            if (string2.match(/^"/)) {
21643              quote = '"';
21644            } else if (string2.match(/^'/)) {
21645              quote = "'";
21646            }
21647            if (quote) {
21648              string2 = string2.replace(/^["']/, "");
21649            }
21650          }
21651          if (tab_count % 2 === 0) {
21652            command = self2.before_cursor(options2.word);
21653          } else {
21654            var test = self2.before_cursor(options2.word);
21655            if (test !== command) {
21656              return;
21657            }
21658          }
21659          var safe2 = $.terminal.escape_regex(string2);
21660          if (options2.escape) {
21661            safe2 = safe2.replace(/(\\+)(["'() ])/g, function(_, slash, chr) {
21662              if (chr.match(/[()]/)) {
21663                return slash + "\\?\\" + chr;
21664              } else {
21665                return slash + "?" + chr;
21666              }
21667            });
21668          }
21669          function escape2(string2) {
21670            if (quote === '"') {
21671              string2 = string2.replace(/"/g, "\\\"");
21672            }
21673            if (!quote && options2.escape) {
21674              string2 = string2.replace(/(["'() ])/g, "\\$1");
21675            }
21676            return string2;
21677          }
21678          function matched_strings() {
21679            var matched = [];
21680            for (var i = commands.length;i--; ) {
21681              if (commands[i].match(/\n/) && options2.word) {
21682                warn("If you use commands with newlines you " + "should use word option for complete or" + " wordAutocomplete terminal option");
21683              }
21684              if (regex.test(commands[i])) {
21685                var match = escape2(commands[i]);
21686                if (!sensitive && same_case(match)) {
21687                  if (string2.toLowerCase() === string2) {
21688                    match = match.toLowerCase();
21689                  } else if (string2.toUpperCase() === string2) {
21690                    match = match.toUpperCase();
21691                  }
21692                }
21693                matched.push(match);
21694              }
21695            }
21696            return matched;
21697          }
21698          var flags = sensitive ? "" : "i";
21699          var regex = new RegExp("^" + safe2, flags);
21700          var matched = matched_strings();
21701          function replace(input, replacement) {
21702            var text2 = self2.get_command();
21703            var pos = self2.get_position();
21704            var re = new RegExp("^" + input, "i");
21705            var pre = text2.slice(0, pos);
21706            var post = text2.slice(pos);
21707            var to_insert = replacement.replace(re, "") + (quote || "");
21708            self2.set_command(pre + to_insert + post);
21709            self2.set_position((pre + to_insert).length);
21710          }
21711          if (matched.length === 1) {
21712            if (options2.escape) {
21713              replace(safe2, matched[0]);
21714            } else {
21715              self2.insert(matched[0].replace(regex, "") + (quote || ""));
21716            }
21717            command = self2.before_cursor(options2.word);
21718            return true;
21719          } else if (matched.length > 1) {
21720            if (++tab_count >= 2) {
21721              tab_count = 0;
21722              if (options2.echo) {
21723                if (is_function(options2.doubleTab)) {
21724                  if (options2.echoCommand) {
21725                    echo_command();
21726                  }
21727                  var ret2 = options2.doubleTab.call(self2, string2, matched, echo_command);
21728                  if (typeof ret2 === "undefined") {
21729                    return true;
21730                  } else {
21731                    return ret2;
21732                  }
21733                } else if (options2.doubleTab !== false) {
21734                  echo_command();
21735                  var text2 = matched.slice().reverse().join("\t\t");
21736                  self2.echo($.terminal.escape_brackets(text2), {
21737                    keepWords: true,
21738                    formatters: false
21739                  });
21740                }
21741                return true;
21742              }
21743            } else {
21744              var common = common_string(escape2(string2), matched, sensitive);
21745              if (common) {
21746                replace(safe2, common);
21747                command = self2.before_cursor(options2.word);
21748                return true;
21749              }
21750            }
21751          }
21752        },
21753        commands: function() {
21754          return interpreters.top().interpreter;
21755        },
21756        set_interpreter: function(user_intrp, login) {
21757          var defer = $.Deferred();
21758          function overwrite_interpreter() {
21759            self2.pause(settings2.softPause);
21760            make_interpreter(user_intrp, login, function(result) {
21761              self2.resume();
21762              var top = interpreters.top();
21763              $.extend(top, result);
21764              prepare_top_interpreter(true);
21765              defer.resolve();
21766            });
21767          }
21768          if (is_function(login)) {
21769            self2.login(login, true, overwrite_interpreter);
21770          } else if (get_type(user_intrp) === "string" && login) {
21771            self2.login(make_json_rpc_login(user_intrp, login), true, overwrite_interpreter);
21772          } else {
21773            overwrite_interpreter();
21774          }
21775          return defer.promise();
21776        },
21777        greetings: function() {
21778          show_greetings();
21779          return self2;
21780        },
21781        paused: function() {
21782          return paused;
21783        },
21784        pause: function(visible) {
21785          cmd_ready(function ready() {
21786            onPause();
21787            paused = true;
21788            command_line.disable(visible || is_android);
21789            if (!visible) {
21790              command_line.find(".cmd-prompt").hidden();
21791            }
21792            fire_event("onPause");
21793          });
21794          return self2;
21795        },
21796        resume: function(silent) {
21797          cmd_ready(function ready() {
21798            paused = false;
21799            if (enabled && terminals.front() === self2) {
21800              command_line.enable(silent);
21801            }
21802            command_line.find(".cmd-prompt").visible();
21803            var original = delayed_commands;
21804            delayed_commands = [];
21805            for (var i = 0;i < original.length; ++i) {
21806              self2.exec.apply(self2, original[i]);
21807            }
21808            self2.trigger("resume");
21809            var fn2 = resume_callbacks.shift();
21810            if (fn2) {
21811              fn2();
21812            }
21813            if (fire_event("onResume") !== false) {
21814              self2.scroll_to_bottom();
21815            }
21816          });
21817          return self2;
21818        },
21819        signal: function() {
21820          var controller = new AbortController;
21821          abort_controllers.push(controller);
21822          return controller.signal;
21823        },
21824        timeout: function(time) {
21825          var controller = new AbortController;
21826          var err = new Error(strings().timeoutError);
21827          err.name = "TimeoutError";
21828          abort_controllers.push(controller);
21829          var signal = controller.signal;
21830          setTimeout(function() {
21831            if (!signal.aborted) {
21832              controller.abort(err);
21833            }
21834          }, time);
21835          return signal;
21836        },
21837        abort: function(message) {
21838          if (abort_controllers.length) {
21839            var err = new Error(message || strings().abortError);
21840            err.name = "AbortError";
21841            for (var i = abort_controllers.length;i--; ) {
21842              var controller = abort_controllers[i];
21843              if (!controller.signal.aborted) {
21844                controller.abort(err);
21845              }
21846            }
21847            abort_controllers = [];
21848          }
21849          return self2;
21850        },
21851        skip: function() {
21852          skip = true;
21853          return self2;
21854        },
21855        skip_stop: function() {
21856          skip = false;
21857          return self2;
21858        },
21859        animating: function() {
21860          return animating;
21861        },
21862        cols: function() {
21863          if (settings2.numChars) {
21864            return settings2.numChars;
21865          }
21866          if (!num_chars || num_chars === 1000) {
21867            num_chars = get_num_chars(self2, char_size);
21868          }
21869          return num_chars;
21870        },
21871        rows: function() {
21872          if (settings2.numRows) {
21873            return settings2.numRows;
21874          }
21875          if (!num_rows) {
21876            num_rows = get_num_rows(self2, char_size);
21877          }
21878          return num_rows;
21879        },
21880        history: function() {
21881          return command_line.history();
21882        },
21883        geometry: function() {
21884          var padding = get_padding();
21885          var height = old_height + padding.top + padding.bottom;
21886          return {
21887            terminal: {
21888              padding: {
21889                left: padding.left,
21890                right: padding.right,
21891                top: padding.top,
21892                bottom: padding.bottom
21893              },
21894              content: {
21895                width: old_width + padding.left + padding.right,
21896                height
21897              },
21898              width: container_width,
21899              height
21900            },
21901            density: pixel_density,
21902            char: char_size,
21903            cols: this.cols(),
21904            rows: this.rows()
21905          };
21906        },
21907        history_state: function(toggle) {
21908          function run() {
21909            settings2.historyState = true;
21910            if (!save_state.length) {
21911              self2.save_state();
21912            } else if (terminals.length() > 1) {
21913              self2.save_state(null);
21914            }
21915          }
21916          if (toggle) {
21917            if (typeof window.setImmediate === "undefined") {
21918              setTimeout(run, 0);
21919            } else {
21920              setImmediate(run);
21921            }
21922          } else {
21923            settings2.historyState = false;
21924          }
21925          return self2;
21926        },
21927        clear_history_state: function() {
21928          hash_commands = [];
21929          save_state = [];
21930          return self2;
21931        },
21932        next: function() {
21933          if (terminals.length() === 1) {
21934            return self2;
21935          } else {
21936            terminals.front().disable();
21937            var next = terminals.rotate().enable();
21938            var x = next.offset().top - 50;
21939            $("html,body").animate({ scrollTop: x }, 500);
21940            try {
21941              trigger_terminal_change(next);
21942            } catch (e) {
21943              display_exception(e, "onTerminalChange");
21944            }
21945            return next;
21946          }
21947        },
21948        focus: function(toggle, silent) {
21949          cmd_ready(function ready() {
21950            if (terminals.length() === 1) {
21951              if (toggle === false) {
21952                self2.disable(silent);
21953              } else {
21954                self2.enable(silent);
21955              }
21956            } else if (toggle === false) {
21957              self2.next();
21958            } else {
21959              var front = terminals.front();
21960              if (front !== self2) {
21961                terminals.forEach(function(terminal) {
21962                  if (terminal !== self2 && terminal.enabled()) {
21963                    terminal.disable(silent);
21964                  }
21965                });
21966                if (!silent) {
21967                  try {
21968                    trigger_terminal_change(self2);
21969                  } catch (e) {
21970                    display_exception(e, "onTerminalChange");
21971                  }
21972                }
21973              }
21974              terminals.active(self2);
21975              self2.enable(silent);
21976            }
21977          });
21978          return self2;
21979        },
21980        blur: function(silent) {
21981          return this.focus(false, silent);
21982        },
21983        freeze: function(freeze) {
21984          when_ready(function ready() {
21985            if (freeze) {
21986              self2.disable();
21987              frozen = true;
21988            } else {
21989              frozen = false;
21990              self2.enable();
21991            }
21992          });
21993          return self2;
21994        },
21995        frozen: function() {
21996          return frozen;
21997        },
21998        enable: function(silent) {
21999          if (!enabled && !frozen) {
22000            if (num_chars === undefined) {
22001              self2.resize();
22002            }
22003            cmd_ready(function ready() {
22004              var ret2;
22005              if (!silent && !enabled) {
22006                fire_event("onFocus");
22007              }
22008              if (!silent && ret2 === undefined || silent) {
22009                enabled = true;
22010                if (!self2.paused()) {
22011                  command_line.enable(true);
22012                }
22013              }
22014            });
22015          }
22016          return self2;
22017        },
22018        clear_cache: "Map" in root ? function() {
22019          buffer.clear_cache();
22020          line_cache.clear();
22021          command_line.clear_cache();
22022          return self2;
22023        } : function() {
22024          return self2;
22025        },
22026        disable: function(silent) {
22027          cmd_ready(function ready() {
22028            var ret2;
22029            if (!silent && enabled) {
22030              ret2 = fire_event("onBlur");
22031            }
22032            if (!silent && ret2 === undefined || silent) {
22033              enabled = false;
22034              command_line.disable();
22035            }
22036          });
22037          return self2;
22038        },
22039        enabled: function() {
22040          return enabled;
22041        },
22042        signature: function() {
22043          var cols = self2.cols();
22044          for (var i = signatures.length;i--; ) {
22045            var lengths = signatures[i].map(function(line) {
22046              return $.terminal.length(line);
22047            });
22048            if (Math.max.apply(null, lengths) <= cols) {
22049              return signatures[i].join(`
22050`).replace(/\s+$/m, "") + `
22051`;
22052            }
22053          }
22054          return "";
22055        },
22056        lines: function() {
22057          return output_line_count;
22058        },
22059        version: function() {
22060          return $.terminal.version;
22061        },
22062        cmd: function() {
22063          return command_line;
22064        },
22065        get_command: function() {
22066          return command_line.get();
22067        },
22068        enter: with_typing("enter", echo_command),
22069        set_command: function(command, silent) {
22070          when_ready(function ready() {
22071            if (typeof command !== "string") {
22072              command = JSON.stringify(command);
22073            }
22074            command_line.set(command, undefined, silent);
22075          });
22076          return self2;
22077        },
22078        set_position: function(position, relative) {
22079          when_ready(function ready() {
22080            command_line.position(position, relative);
22081          });
22082          return self2;
22083        },
22084        get_position: function() {
22085          return command_line.position();
22086        },
22087        insert: function(string2, options2) {
22088          if (typeof string2 === "string") {
22089            var locals;
22090            var defaults = {
22091              stay: false,
22092              typing: false,
22093              delay: 100
22094            };
22095            if (!is_object(options2)) {
22096              options2 = {
22097                stay: options2
22098              };
22099            }
22100            locals = $.extend(defaults, options2);
22101            var d = new $.Deferred;
22102            when_ready(function ready() {
22103              function done() {
22104                if (settings2.scrollOnEcho || bottom) {
22105                  self2.scroll_to_bottom();
22106                }
22107              }
22108              var bottom = self2.is_bottom();
22109              if (locals.typing) {
22110                var delay = locals.delay;
22111                var p = self2.typing("insert", delay, string2, settings2);
22112                p.then(function() {
22113                  done();
22114                  d.resolve();
22115                });
22116              } else {
22117                command_line.insert(string2, settings2.stay);
22118                done();
22119              }
22120            });
22121            if (locals.typing) {
22122              return d.promise();
22123            }
22124            return self2;
22125          } else {
22126            throw new Error(sprintf(strings().notAString, "insert"));
22127          }
22128        },
22129        set_prompt: with_typing("prompt", function(prompt) {
22130          if (is_function(prompt)) {
22131            command_line.prompt(function(callback) {
22132              return prompt.call(self2, callback, self2);
22133            });
22134          } else {
22135            command_line.prompt(prompt);
22136          }
22137        }, function(prompt) {
22138          interpreters.top().prompt = prompt;
22139        }),
22140        get_prompt: function() {
22141          return interpreters.top().prompt;
22142        },
22143        set_mask: function(mask) {
22144          when_ready(function ready() {
22145            command_line.mask(mask === true ? settings2.maskChar : mask);
22146          });
22147          return self2;
22148        },
22149        get_mask: function() {
22150          return command_line.mask();
22151        },
22152        get_output: function(raw) {
22153          if (raw) {
22154            return lines.data();
22155          } else {
22156            return lines.get_snapshot();
22157          }
22158        },
22159        resize: function(width, height) {
22160          if (!self2.is(":visible")) {
22161            self2.stopTime("resize");
22162            self2.oneTime(500, "resize", function() {
22163              self2.resize(width, height);
22164            });
22165          } else {
22166            if (width && height) {
22167              self2.width(width);
22168              self2.height(height);
22169            }
22170            width = self2.width();
22171            height = self2.height();
22172            if (typeof settings2.numChars !== "undefined" || typeof settings2.numRows !== "undefined") {
22173              if (typeof settings2.numChars !== "undefined") {
22174                command_line.resize(settings2.numChars);
22175                self2.refresh();
22176              }
22177              fire_event("onResize");
22178              return;
22179            }
22180            var new_num_chars = get_num_chars(self2, char_size);
22181            var new_num_rows = get_num_rows(self2, char_size);
22182            if (new_num_chars !== num_chars || new_num_rows !== num_rows) {
22183              self2.clear_cache();
22184              var changed = new_num_chars !== num_chars;
22185              num_chars = new_num_chars;
22186              num_rows = new_num_rows;
22187              if (changed) {
22188                command_line.resize(num_chars);
22189                self2.refresh();
22190              }
22191              fire_event("onResize");
22192            }
22193          }
22194          return self2;
22195        },
22196        refresh: function() {
22197          if (char_size.width !== 0) {
22198            css(self2[0], {
22199              "--char-width": char_size.width,
22200              "--pixel-density": pixel_density
22201            });
22202          }
22203          self2.clear_cache();
22204          if (command) {
22205            command_line.resize();
22206          }
22207          redraw({
22208            scroll: false,
22209            update: true
22210          });
22211          return self2;
22212        },
22213        flush: function(options2) {
22214          options2 = $.extend({}, {
22215            update: false,
22216            scroll: true
22217          }, options2 || {});
22218          when_ready(function ready() {
22219            try {
22220              if (buffer.is_empty()) {
22221                return self2;
22222              }
22223              var bottom = self2.is_bottom();
22224              var scroll = settings2.scrollOnEcho && options2.scroll || bottom;
22225              var wrapper;
22226              var first = true;
22227              var appending_to_partial = false;
22228              var partial = $();
22229              var snapshot;
22230              var finalizations = [];
22231              if (!options2.update) {
22232                partial = self2.find(".partial");
22233                snapshot = lines.get_partial();
22234                buffer.sort();
22235              }
22236              buffer.flush(function(data) {
22237                if (!data) {
22238                  if (!partial.length) {
22239                    wrapper = $("<div/>");
22240                    snapshot = [];
22241                  } else if (first) {
22242                    first = false;
22243                    appending_to_partial = true;
22244                    wrapper = partial;
22245                  }
22246                } else if (is_function(data.finalize)) {
22247                  if (options2.update && data.raw === true && data.newline) {
22248                    return;
22249                  }
22250                  if (scroll) {
22251                    wrapper.find("img").on("load", function() {
22252                      self2.scroll_to_bottom();
22253                    });
22254                  }
22255                  if (options2.update) {
22256                    lines.update_snapshot(data.index, snapshot);
22257                    var node = get_node(data.index);
22258                    if (node.html() !== wrapper.html()) {
22259                      node.replaceWith(wrapper);
22260                    }
22261                  } else {
22262                    wrapper.appendTo(output);
22263                    if (!partial.length) {
22264                      lines.make_snapshot(snapshot);
22265                    }
22266                  }
22267                  wrapper.attr("data-index", data.index);
22268                  appending_to_partial = !data.newline;
22269                  wrapper.toggleClass("partial", appending_to_partial);
22270                  finalizations.push({
22271                    node: wrapper,
22272                    finalize: data.finalize
22273                  });
22274                  if (appending_to_partial) {
22275                    partial = wrapper;
22276                  } else if (data.newline && partial.length) {
22277                    wrapper = $("<div/>");
22278                    partial = $();
22279                  }
22280                } else {
22281                  var line = data.line;
22282                  var div;
22283                  if (typeof data.raw === "string") {
22284                    if (appending_to_partial) {
22285                      snapshot[snapshot.length - 1] += data.raw;
22286                    } else {
22287                      snapshot.push(data.raw);
22288                    }
22289                  }
22290                  if (appending_to_partial) {
22291                    div = wrapper.children().last().append(line);
22292                    appending_to_partial = false;
22293                  } else {
22294                    div = $("<div/>").html(line);
22295                    if (data.newline) {
22296                      div.addClass("cmd-end-line");
22297                    }
22298                    wrapper.append(div);
22299                  }
22300                  div.css("width", "100%");
22301                }
22302              });
22303              partial = self2.find(".partial");
22304              var len = $.terminal.length(snapshot[snapshot.length - 1]);
22305              len %= self2.cols();
22306              finalizations.forEach(function(data) {
22307                data.finalize(data.node);
22308              });
22309              var last_row;
22310              if (partial.length === 0) {
22311                css(command_line[0], {
22312                  "--prompt-offset": "",
22313                  top: ""
22314                });
22315                command_line.__set_prompt_margin(0);
22316                last_row = self2.find(".terminal-output div:last-child" + " div:last-child");
22317                if (last_row.css("display") === "inline-block") {
22318                  last_row.css({
22319                    width: "100%",
22320                    display: ""
22321                  });
22322                }
22323              } else if (snapshot.length) {
22324                last_row = partial.children().last();
22325                var last_row_rect = last_row[0].getBoundingClientRect();
22326                var size = is_ch_unit_supported ? len + "ch" : len + "px";
22327                css(command_line[0], {
22328                  top: -last_row_rect.height / pixel_density + "px",
22329                  "--prompt-offset": size
22330                });
22331                command_line.__set_prompt_margin(len);
22332              }
22333              output_line_count = limit_lines();
22334              fire_event("onFlush");
22335              self2.stopTime("flush").oneTime(10, "flush", function() {
22336                var cmd_cursor = self2.find(".cmd-cursor");
22337                var offset = self2.find(".cmd").offset();
22338                var self_offset = self2.offset();
22339                var top = output.height();
22340                var height = command_line.height();
22341                css(self2[0], {
22342                  "--terminal-height": self2.height(),
22343                  "--terminal-x": offset.left - self_offset.left,
22344                  "--terminal-y": offset.top - self_offset.top,
22345                  "--terminal-scroll": scroller.prop("scrollTop"),
22346                  "--cmd-top": top,
22347                  "--cmd-height": height
22348                });
22349                if (enabled && !is_mobile && !options2.update) {
22350                  cmd_cursor.hide();
22351                  setTimeout(function() {
22352                    cmd_cursor.show();
22353                  });
22354                }
22355              });
22356              wrapper.on_load({
22357                done: function() {
22358                  if (scroll) {
22359                    self2.scroll_to_bottom();
22360                  }
22361                }
22362              });
22363            } catch (e1) {
22364              if (is_function(settings2.exceptionHandler)) {
22365                try {
22366                  settings2.exceptionHandler.call(self2, e1, "TERMINAL (Flush)");
22367                } catch (e2) {
22368                  settings2.exceptionHandler = $.noop;
22369                  alert_exception("[exceptionHandler]", e2);
22370                }
22371              } else {
22372                alert_exception("[Flush]", e1);
22373              }
22374            } finally {
22375              buffer.clear();
22376            }
22377          });
22378          return self2;
22379        },
22380        update: function(line, value, options2) {
22381          when_ready(function ready() {
22382            if (line < 0) {
22383              line = lines.length() + line;
22384            }
22385            if (!lines.valid_index(line)) {
22386              self2.error("Invalid line number " + line);
22387            } else if (value === null) {
22388              lines.update(line, null);
22389              get_node(line).remove();
22390            } else {
22391              value = preprocess_value(value, {
22392                update: true,
22393                line
22394              });
22395              if (value === false) {
22396                return self2;
22397              }
22398              unpromise(value, function(value) {
22399                var ret2 = prepare_render(value, options2);
22400                if (ret2) {
22401                  value = ret2[0];
22402                  options2 = ret2[1];
22403                }
22404                options2 = lines.update(line, value, options2);
22405                var next = process_line({
22406                  value,
22407                  index: line,
22408                  options: options2
22409                });
22410                unpromise(next, function() {
22411                  self2.flush({
22412                    scroll: false,
22413                    update: true
22414                  });
22415                });
22416              });
22417            }
22418          });
22419          return self2;
22420        },
22421        remove_line: function(line) {
22422          return self2.update(line, null);
22423        },
22424        last_index: function() {
22425          return lines.length() - 1;
22426        },
22427        echo: function(arg, options2, deferred2) {
22428          var arg_defined = arguments.length > 0;
22429          var d = deferred2 || new $.Deferred;
22430          function cont(value) {
22431            echo_promise = false;
22432            var original = echo_delay;
22433            echo_delay = [];
22434            for (var i = 0;i < original.length; ++i) {
22435              self2.echo.apply(self2, original[i]);
22436            }
22437            if (value) {
22438              async_echo = async_echo.filter(function(promise) {
22439                return promise !== value;
22440              });
22441              if (!async_echo.length) {
22442                event_hub.emit("async_echo_ready");
22443              }
22444            }
22445          }
22446          function error(e, value) {
22447            cont(value);
22448            display_exception(e, "ECHO", true);
22449          }
22450          function echo(arg) {
22451            try {
22452              var locals = $.extend({
22453                flush: true,
22454                exec: true,
22455                raw: settings2.raw,
22456                finalize: $.noop,
22457                unmount: $.noop,
22458                delay: settings2.execAnimationDelay,
22459                ansi: false,
22460                typing: false,
22461                externalPause: true,
22462                keepWords: false,
22463                invokeMethods: settings2.invokeMethods,
22464                onClear: null,
22465                formatters: true,
22466                allowedAttributes: settings2.allowedAttributes,
22467                newline: true
22468              }, options2 || {});
22469              var should_pause = settings2.externalPause && locals.externalPause;
22470              (function(finalize) {
22471                if (is_node(arg)) {
22472                  return;
22473                }
22474                locals.finalize = function(node) {
22475                  if (locals.raw) {
22476                    node.addClass("raw");
22477                  }
22478                  if (locals.ansi) {
22479                    node.addClass("ansi");
22480                  }
22481                  try {
22482                    if (is_function(finalize)) {
22483                      finalize.call(self2, node);
22484                    }
22485                    node.on_load({
22486                      error: function(element) {
22487                        element.replaceWith(use_broken_image);
22488                        if (should_pause) {
22489                          self2.resume();
22490                        }
22491                      },
22492                      done: function(has_elements) {
22493                        if (has_elements && should_pause) {
22494                          self2.resume();
22495                        }
22496                      },
22497                      load: function(has_elements) {
22498                        if (has_elements && should_pause) {
22499                          self2.pause();
22500                        }
22501                      }
22502                    });
22503                  } catch (e) {
22504                    display_exception(e, "USER:echo(finalize)");
22505                    finalize = null;
22506                  }
22507                };
22508              })(locals.finalize);
22509              if (locals.flush) {
22510                if (!buffer.empty()) {
22511                  self2.flush();
22512                }
22513              }
22514              if (fire_event("onBeforeEcho", [arg]) === false) {
22515                return;
22516              }
22517              if (locals.typing) {
22518                if (typeof arg !== "string") {
22519                  return d.reject("echo: Typing animation require string" + " or promise that resolve to string");
22520                }
22521                if (typeof locals.delay !== "number" || isNaN(locals.delay)) {
22522                  return d.reject("echo: Invalid argument, delay need to" + " be a number");
22523                }
22524                var p = self2.typing("echo", locals.delay, arg, locals);
22525                p.then(function() {
22526                  d.resolve();
22527                });
22528                return;
22529              }
22530              var value;
22531              if (typeof arg === "function") {
22532                value = arg.bind(self2);
22533              } else if (typeof arg === "undefined") {
22534                if (arg_defined) {
22535                  return self2;
22536                } else {
22537                  value = "";
22538                }
22539              } else {
22540                var ret2 = preprocess_value(arg);
22541                if (ret2 === false) {
22542                  return self2;
22543                }
22544                value = ret2;
22545              }
22546              if (is_promise(value)) {
22547                echo_promise = true;
22548              }
22549              unpromise(value, function(value) {
22550                if (typeof value === "undefined" || is_promise(ret2) && value === false) {
22551                  return;
22552                }
22553                if (render(value, locals)) {
22554                  return;
22555                }
22556                var index = lines.length();
22557                var last_newline = lines.has_newline();
22558                if (!last_newline) {
22559                  index--;
22560                }
22561                if (!locals.newline && value[value.length - 1] === `
22562`) {
22563                  value = value.slice(0, -1);
22564                  locals.newline = true;
22565                }
22566                var next = process_line({
22567                  value,
22568                  options: locals,
22569                  index
22570                }, true);
22571                if (is_promise(next)) {
22572                  echo_promise = true;
22573                  async_echo.push(next);
22574                }
22575                unpromise(next, function() {
22576                  lines.push([value, locals]);
22577                  var have_partial = self2.find(".partial").length;
22578                  var contination_run = locals.flush && have_partial;
22579                  if (locals.flush) {
22580                    self2.flush();
22581                    if (have_partial) {
22582                      self2.oneTime(1, "echo", function() {
22583                        var line = lines.last_line();
22584                        if (line) {
22585                          self2.update(-1, line[0], line[1]);
22586                        }
22587                        cont(next);
22588                      });
22589                    }
22590                    fire_event("onAfterEcho", [arg]);
22591                  }
22592                  if (!contination_run) {
22593                    cont(next);
22594                  }
22595                }, function(e) {
22596                  error(e, next);
22597                });
22598              }, error);
22599            } catch (e) {
22600              if (is_function(settings2.exceptionHandler)) {
22601                settings2.exceptionHandler.call(self2, e, "TERMINAL (echo)");
22602              } else {
22603                alert_exception("[Terminal.echo]", e);
22604              }
22605            }
22606          }
22607          var is_animation = options2 && options2.typing;
22608          if (echo_promise && !recursive_render) {
22609            var args2 = [arg, options2];
22610            if (is_animation) {
22611              args2.push(d);
22612            }
22613            echo_delay.push(args2);
22614          } else {
22615            echo(arg);
22616          }
22617          if (is_animation) {
22618            return d.promise();
22619          }
22620          return self2;
22621        },
22622        animation: function(callback) {
22623          if (is_function(callback)) {
22624            animating = true;
22625            var prompt = self2.get_prompt();
22626            self2.set_prompt("");
22627            return unpromise(callback(), function() {
22628              self2.set_prompt(prompt);
22629              animating = false;
22630            });
22631          }
22632          return $.when();
22633        },
22634        delay: function(time) {
22635          var d = new $.Deferred;
22636          setTimeout(function() {
22637            d.resolve();
22638          }, time);
22639          return d.promise();
22640        },
22641        typing: function(type, delay, string2, options2) {
22642          var d = new $.Deferred;
22643          var settings2;
22644          var finish2;
22645          if (typeof options2 === "object") {
22646            finish2 = options2.finalize || $.noop;
22647            settings2 = $.extend({}, options2, {
22648              delay,
22649              finalize: done
22650            });
22651          } else {
22652            finish2 = options2 || $.noop;
22653            settings2 = {
22654              delay,
22655              finalize: done
22656            };
22657          }
22658          function done() {
22659            d.resolve();
22660            if (is_function(finish2)) {
22661              finish2.apply(self2, arguments);
22662            }
22663          }
22664          var animations = ["prompt", "echo", "enter", "insert"];
22665          function valid_animation() {
22666            return animations.indexOf(type) >= 0;
22667          }
22668          when_ready(function ready() {
22669            if (valid_animation()) {
22670              if (type === "prompt") {
22671                typed_prompt(string2, settings2);
22672              } else if (type === "echo") {
22673                typed_message(string2, settings2);
22674              } else if (type === "enter") {
22675                with_prompt(self2.get_prompt(), function(prompt) {
22676                  typed_enter(prompt, string2, settings2);
22677                }, self2);
22678              } else if (type === "insert") {
22679                with_prompt(self2.get_prompt(), function(prompt) {
22680                  typed_insert(prompt, string2, settings2);
22681                }, self2);
22682              }
22683            } else {
22684              d.reject("Invalid type only `echo` and `prompt` are supported");
22685            }
22686          });
22687          return d.promise();
22688        },
22689        error: function(message, options2) {
22690          options2 = $.extend({}, options2, { raw: false, formatters: false });
22691          function format(string2) {
22692            if (typeof string2 !== "string") {
22693              string2 = String(string2);
22694            }
22695            var str = $.terminal.escape_brackets(string2).replace(/\\$/, "&#92;").replace(url_re, "]$1[[;;;terminal-error]");
22696            return "[[;;;terminal-error]" + str + "]";
22697          }
22698          if (typeof message === "function") {
22699            return self2.echo(function() {
22700              return format(message.call(self2));
22701            }, options2);
22702          }
22703          if (message && message.then) {
22704            message.then(function(string2) {
22705              self2.echo(format(string2));
22706            }).catch(make_label_error("Echo Error"));
22707            return self2;
22708          }
22709          return self2.echo(format(message), options2);
22710        },
22711        exception: function(e, label) {
22712          var message = exception_message(e);
22713          if (label) {
22714            message = "&#91;" + label + "&#93;: " + message;
22715          }
22716          if (message) {
22717            self2.error(message, {
22718              finalize: function(div) {
22719                div.addClass("terminal-exception terminal-message");
22720              },
22721              keepWords: true
22722            });
22723          }
22724          if (typeof e.fileName === "string") {
22725            var was_pased = self2.paused();
22726            if (!was_pased) {
22727              self2.pause(settings2.softPause);
22728            }
22729            $.get(e.fileName, function(file) {
22730              var num = e.lineNumber - 1;
22731              var line = file.split(`
22732`)[num];
22733              if (line) {
22734                self2.error("[" + e.lineNumber + "]: " + line);
22735              }
22736              if (!was_pased) {
22737                self2.resume();
22738              }
22739            }, "text");
22740          }
22741          if (e.stack) {
22742            self2.echo(format_stack_trace(e.stack), {
22743              finalize: function(div) {
22744                div.addClass("terminal-exception terminal-stack-trace");
22745              },
22746              formatters: false
22747            });
22748          }
22749          return self2;
22750        },
22751        scroll: function(amount) {
22752          var pos;
22753          amount = Math.round(amount);
22754          if (self2.prop) {
22755            if (amount > scroller.prop("scrollTop") && amount > 0) {
22756              scroller.prop("scrollTop", 0);
22757            }
22758            pos = scroller.prop("scrollTop");
22759            scroller.scrollTop(pos + amount);
22760          } else {
22761            if (amount > scroller.attr("scrollTop") && amount > 0) {
22762              scroller.attr("scrollTop", 0);
22763            }
22764            pos = scroller.attr("scrollTop");
22765            scroller.scrollTop(pos + amount);
22766          }
22767          return self2;
22768        },
22769        logout: function(local) {
22770          if (in_login) {
22771            throw new Error(sprintf(strings().notWhileLogin, "logout"));
22772          }
22773          when_ready(function ready() {
22774            if (local) {
22775              var login = logins.pop();
22776              self2.set_token(undefined, true);
22777              self2.login.apply(self2, login);
22778            } else if (interpreters.size() === 1 && self2.token()) {
22779              self2.logout(true);
22780            } else {
22781              while (interpreters.size() > 1) {
22782                if (self2.token()) {
22783                  self2.logout(true).pop().pop();
22784                } else {
22785                  self2.pop();
22786                }
22787              }
22788            }
22789          });
22790          return self2;
22791        },
22792        token: function(local) {
22793          return storage.get(self2.prefix_name(local) + "_token");
22794        },
22795        set_token: function(token, local) {
22796          var name = self2.prefix_name(local) + "_token";
22797          if (typeof token === "undefined") {
22798            storage.remove(name);
22799          } else {
22800            storage.set(name, token);
22801          }
22802          return self2;
22803        },
22804        get_token: function(local) {
22805          return self2.token(local);
22806        },
22807        login_name: function(local) {
22808          return storage.get(self2.prefix_name(local) + "_login");
22809        },
22810        name: function() {
22811          return interpreters.top().name;
22812        },
22813        prefix_name: function(local, max_size) {
22814          var name = (settings2.name ? settings2.name + "_" : "") + terminal_id;
22815          if (local && interpreters.size() > 1) {
22816            var local_name = interpreters.map(function(intrp) {
22817              return intrp.name || "";
22818            }).slice(1, max_size).join("_");
22819            if (local_name) {
22820              name += "_" + local_name;
22821            }
22822          }
22823          return name;
22824        },
22825        read: function(message, success, cancel) {
22826          var options2;
22827          if (typeof arguments[1] === "object") {
22828            options2 = $.extend({
22829              typing: false,
22830              delay: settings2.execAnimationDelay,
22831              success: $.noop,
22832              cancel: $.noop
22833            }, arguments[1]);
22834          } else {
22835            options2 = {
22836              typing: false,
22837              success: success || $.noop,
22838              cancel: cancel || $.noop
22839            };
22840          }
22841          if (!options2.signal) {
22842            options2.signal = self2.signal();
22843          }
22844          if (options2.typing) {
22845            var prompt = self2.get_prompt();
22846            options2.typing = false;
22847            return self2.typing("prompt", options2.delay, message).then(function() {
22848              return self2.set_prompt(prompt).read(message, options2);
22849            });
22850          }
22851          force_awake = true;
22852          var defer = jQuery.Deferred();
22853          if (options2.signal.aborted) {
22854            defer.reject();
22855            return defer.promise();
22856          }
22857          self2.push(function(string2) {
22858            defer.resolve(string2);
22859            if (is_function(options2.success)) {
22860              options2.success(string2);
22861            }
22862            exit();
22863          }, {
22864            name: "read",
22865            history: false,
22866            prompt: message || "",
22867            onStart: function() {
22868              options2.signal.addEventListener("abort", abort_handler);
22869            },
22870            keymap: {
22871              "CTRL+D": function() {
22872                self2.abort();
22873                return false;
22874              }
22875            }
22876          });
22877          function reject(value) {
22878            defer.reject(value);
22879            if (is_function(options2.cancel)) {
22880              options2.cancel();
22881            }
22882          }
22883          function exit() {
22884            self2.pop();
22885            if (settings2.history) {
22886              command_line.history().enable();
22887            }
22888          }
22889          function abort_handler() {
22890            exit();
22891            reject(options2.signal.reason);
22892          }
22893          if (settings2.history) {
22894            command_line.history().disable();
22895          }
22896          if (is_function(options2.onReady)) {
22897            options2.onReady.call(self2);
22898          }
22899          return defer.promise();
22900        },
22901        push: function(interpreter, options2) {
22902          cmd_ready(function ready() {
22903            options2 = options2 || {};
22904            var defaults = {
22905              infiniteLogin: false
22906            };
22907            var push_settings = $.extend({}, defaults, options2);
22908            if (!push_settings.name && prev_command) {
22909              push_settings.name = prev_command.name;
22910            }
22911            if (push_settings.prompt === undefined) {
22912              push_settings.prompt = (push_settings.name || ">") + " ";
22913            }
22914            var top = interpreters.top();
22915            if (top) {
22916              top.mask = command_line.mask();
22917            }
22918            var was_paused = paused;
22919            function init() {
22920              fire_event("onPush", [top, interpreters.top()]);
22921              prepare_top_interpreter();
22922            }
22923            make_interpreter(interpreter, options2.login, function(ret2) {
22924              interpreters.push($.extend({}, ret2, push_settings));
22925              if (push_settings.completion === true) {
22926                if (Array.isArray(ret2.completion)) {
22927                  interpreters.top().completion = ret2.completion;
22928                } else if (!ret2.completion) {
22929                  interpreters.top().completion = false;
22930                }
22931              }
22932              if (push_settings.login) {
22933                var error;
22934                var type = get_type(push_settings.login);
22935                if (type === "function") {
22936                  error = push_settings.infiniteLogin ? $.noop : self2.pop;
22937                  self2.login(push_settings.login, push_settings.infiniteLogin, init, error);
22938                } else if (get_type(interpreter) === "string" && type === "string" || type === "boolean") {
22939                  error = push_settings.infiniteLogin ? $.noop : self2.pop;
22940                  self2.login(make_json_rpc_login(interpreter, push_settings.login), push_settings.infiniteLogin, init, error);
22941                }
22942              } else {
22943                init();
22944              }
22945              if (!was_paused && self2.enabled()) {
22946                self2.resume();
22947              }
22948            });
22949          });
22950          return self2;
22951        },
22952        pop: function(string2, silent) {
22953          if (string2 !== undefined) {
22954            echo_command(string2);
22955          }
22956          var token = self2.token(true);
22957          var top;
22958          if (interpreters.size() === 1) {
22959            top = interpreters.top();
22960            if (settings2.login) {
22961              if (!silent) {
22962                fire_event("onPop", [top, null]);
22963              }
22964              global_logout();
22965              fire_event("onExit");
22966            } else {
22967              self2.error(strings().canExitError);
22968            }
22969          } else {
22970            if (token) {
22971              clear_loging_storage();
22972            }
22973            var current = interpreters.pop();
22974            top = interpreters.top();
22975            prepare_top_interpreter();
22976            self2.set_mask(top.mask);
22977            if (!silent) {
22978              fire_event("onPop", [current, top]);
22979            }
22980            if (in_login && self2.get_prompt() !== strings().login + ": ") {
22981              in_login = false;
22982            }
22983            if (is_function(current.onExit)) {
22984              try {
22985                current.onExit.call(self2, self2);
22986              } catch (e) {
22987                current.onExit = $.noop;
22988                display_exception(e, "onExit");
22989              }
22990            }
22991          }
22992          return self2;
22993        },
22994        option: function(object_or_name, value) {
22995          if (typeof value === "undefined") {
22996            if (typeof object_or_name === "string") {
22997              return settings2[object_or_name];
22998            } else if (typeof object_or_name === "object") {
22999              $.each(object_or_name, function(key, value) {
23000                settings2[key] = value;
23001              });
23002            }
23003          } else {
23004            settings2[object_or_name] = value;
23005            if (object_or_name.match(/^num(Chars|Rows)$/)) {
23006              redraw();
23007            }
23008          }
23009          return self2;
23010        },
23011        invoke_key: function(shortcut) {
23012          command_line.invoke_key(shortcut);
23013          return self2;
23014        },
23015        keymap: function(keymap, fn2) {
23016          if (arguments.length === 0) {
23017            return command_line.keymap();
23018          }
23019          if (typeof fn2 === "undefined") {
23020            if (typeof keymap === "string") {
23021              return command_line.keymap(keymap);
23022            } else if ($.isPlainObject(keymap)) {
23023              keymap = $.extend({}, terminal_init_keymap, $.omap(keymap || {}, function(key, fn2) {
23024                if (!terminal_init_keymap[key]) {
23025                  return fn2.bind(self2);
23026                }
23027                return function(e, original) {
23028                  return fn2.call(self2, e, function() {
23029                    return terminal_init_keymap[key](e, original);
23030                  });
23031                };
23032              }));
23033              command_line.keymap(null).keymap(keymap);
23034            }
23035          } else if (typeof fn2 === "function") {
23036            var key = keymap;
23037            if (!terminal_init_keymap[key]) {
23038              command_line.keymap(key, fn2.bind(self2));
23039            } else {
23040              command_line.keymap(key, function(e, original) {
23041                return fn2.call(self2, e, function() {
23042                  return terminal_init_keymap[key](e, original);
23043                });
23044              });
23045            }
23046          }
23047        },
23048        level: function() {
23049          return interpreters.size();
23050        },
23051        reset: function() {
23052          when_ready(function ready() {
23053            self2.clear();
23054            while (interpreters.size() > 1) {
23055              interpreters.pop();
23056            }
23057            prepare_top_interpreter();
23058            show_greetings();
23059            initialize();
23060          });
23061          return self2;
23062        },
23063        purge: function() {
23064          when_ready(function ready() {
23065            var prefix = self2.prefix_name() + "_";
23066            var names = storage.get(prefix + "interpreters");
23067            if (names) {
23068              $.each(JSON.parse(names), function(_, name) {
23069                storage.remove(name + "_commands");
23070                storage.remove(name + "_token");
23071                storage.remove(name + "_login");
23072              });
23073            }
23074            command_line.purge();
23075            storage.remove(prefix + "interpreters");
23076          });
23077          return self2;
23078        },
23079        destroy: function() {
23080          when_ready(function ready() {
23081            command_line.destroy().remove();
23082            self2.resizer("unbind");
23083            self2.touch_scroll("unbind");
23084            font_resizer.resizer("unbind").remove();
23085            pixel_resizer.resizer("unbind").remove();
23086            $(document).unbind(".terminal_" + self2.id());
23087            $(window).unbind(".terminal_" + self2.id());
23088            self2.unbind("click mousedown mouseup");
23089            self2.removeData("terminal").removeClass("terminal").unbind(".terminal");
23090            if (settings2.width) {
23091              self2.css("width", "");
23092            }
23093            if (settings2.height) {
23094              self2.css("height", "");
23095            }
23096            $(window).off("blur", blur_terminal).off("focus", focus_terminal);
23097            self2.find(".terminal-fill, .terminal-font, .terminal-font-forcer").remove();
23098            self2.stopTime();
23099            terminals.remove(terminal_id);
23100            if (visibility_observer) {
23101              if (visibility_observer.unobserve) {
23102                visibility_observer.unobserve(self2[0]);
23103              } else {
23104                clearInterval(visibility_observer);
23105              }
23106            }
23107            var scroll_marker = self2.find(".terminal-scroll-marker");
23108            if (is_bottom_observer) {
23109              is_bottom_observer.unobserve(scroll_marker[0]);
23110            }
23111            scroll_marker.remove();
23112            if (mutation_observer) {
23113              mutation_observer.disconnect();
23114            }
23115            if (!terminals.length()) {
23116              $(window).off("hashchange");
23117            }
23118            if (is_mobile) {
23119              self2.off([
23120                "touchstart.terminal",
23121                "touchmove.terminal",
23122                "touchend.terminal"
23123              ].join(" "));
23124            }
23125            output.remove();
23126            scroller.remove();
23127            if (body_terminal) {
23128              var $body = $(body_terminal);
23129              if ($body.attr("class") === "full-screen-terminal") {
23130                $body.removeAttr("class");
23131              } else {
23132                $body.removeClass("full-screen-terminal");
23133              }
23134              self2.remove();
23135            }
23136            defunct = true;
23137          });
23138          return self2;
23139        },
23140        scroll_to: function(elem) {
23141          var scroll = scroller.scrollTop() - self2.offset().top + $(elem).offset().top;
23142          scroller.scrollTop(scroll);
23143          return self2;
23144        },
23145        scroll_to_bottom: function() {
23146          var scrollHeight;
23147          if (self2.prop) {
23148            scrollHeight = scroller.prop("scrollHeight");
23149          } else {
23150            scrollHeight = scroller.attr("scrollHeight");
23151          }
23152          scroller.scrollTop(scrollHeight);
23153          return self2;
23154        },
23155        is_bottom: function() {
23156          if (settings2.scrollBottomOffset === -1) {
23157            return false;
23158          } else if (typeof is_bottom_detected === "boolean") {
23159            return is_bottom_detected;
23160          } else {
23161            var scroll_height, scroll_top, height;
23162            scroll_height = scroller[0].scrollHeight;
23163            scroll_top = scroller[0].scrollTop;
23164            height = scroller[0].offsetHeight;
23165            var limit = scroll_height - settings2.scrollBottomOffset;
23166            return scroll_top + height > limit;
23167          }
23168        },
23169        duplicate: function() {
23170          var copy = $(self2);
23171          return $.extend(copy, public_api);
23172        },
23173        get_output_buffer: function(options2) {
23174          var settings2 = $.extend({
23175            html: false
23176          }, options2);
23177          var result = [];
23178          var append = false;
23179          buffer.forEach(function(data) {
23180            if (data) {
23181              if (is_function(data.finalize)) {
23182                append = !data.newline;
23183              } else {
23184                var output;
23185                if (settings2.html) {
23186                  output = data.line;
23187                } else {
23188                  output = data.raw;
23189                }
23190                if (append) {
23191                  var last = result.length - 1;
23192                  result[last] += output;
23193                } else {
23194                  result.push(output);
23195                }
23196              }
23197            }
23198          });
23199          if (settings2.html) {
23200            return result.map(function(line) {
23201              return "<div>" + line + "</div>";
23202            }).join(`
23203`);
23204          }
23205          return result.join(`
23206`);
23207        },
23208        clear_buffer: function() {
23209          buffer.clear();
23210          return self2;
23211        }
23212      }, function(name, fun) {
23213        return function() {
23214          if (defunct) {
23215            if (!settings2.exceptionHandler) {
23216              throw new $.terminal.Exception(strings().defunctTerminal);
23217            }
23218          }
23219          try {
23220            return fun.apply(self2, [].slice.apply(arguments));
23221          } catch (e) {
23222            if (name !== "exec" && name !== "resume") {
23223              display_exception(e, e.type || "TERMINAL", true);
23224            }
23225            if (!settings2.exceptionHandler) {
23226              throw e;
23227            }
23228          }
23229        };
23230      });
23231      $.extend(self2, public_api);
23232      if (self2.length === 0) {
23233        var msg = sprintf(strings().invalidSelector);
23234        throw new $.terminal.Exception(msg);
23235      }
23236      self2.data("terminal", self2);
23237      var echo_delay = [];
23238      var echo_promise = false;
23239      var prev_command;
23240      var prev_exec_cmd;
23241      var tab_count = 0;
23242      var output;
23243      var have_custom_id = !!(options2 && typeof options2.id === "number");
23244      var terminal_id = have_custom_id ? options2.id : terminals.length();
23245      var force_awake = false;
23246      var num_chars;
23247      var output_line_count = 0;
23248      var num_rows;
23249      var command;
23250      var logins = new Stack;
23251      var command_queue = new DelayQueue;
23252      var animating = false;
23253      var skip = false;
23254      var init_queue = new DelayQueue;
23255      var when_ready = ready(init_queue);
23256      var cmd_ready = ready(command_queue);
23257      var async_echo = [];
23258      var event_hub = new EventEmitter;
23259      var is_bottom_detected;
23260      var is_bottom_observer;
23261      var in_login = false;
23262      var onPause = $.noop;
23263      var old_width, old_height, old_pixel_density, container_width;
23264      var delayed_commands = [];
23265      var settings2 = $.extend({}, $.terminal.defaults, {
23266        name: self2.selector,
23267        exit: !!(options2 && options2.login || !options2)
23268      }, options2 || {});
23269      if (typeof settings2.width === "number") {
23270        self2.width(settings2.width);
23271      }
23272      if (typeof settings2.height === "number") {
23273        self2.height(settings2.height);
23274      }
23275      delete settings2.formatters;
23276      var defunct = false;
23277      var buffer = new FormatBuffer(function(options2) {
23278        return {
23279          linksNoReferrer: settings2.linksNoReferrer,
23280          linksNoFollow: settings2.linksNoFollow,
23281          anyLinks: settings2.anyLinks,
23282          charWidth: char_size.width,
23283          useCache: settings2.useCache,
23284          escape: false,
23285          allowedAttributes: options2.allowedAttributes || []
23286        };
23287      });
23288      var lines = new OutputLines(function() {
23289        return settings2;
23290      });
23291      var storage = new StorageHelper(settings2.memory);
23292      var enabled = settings2.enabled;
23293      var frozen = false;
23294      var paused = false;
23295      var autologin = true;
23296      var interpreters;
23297      var command_line;
23298      var old_enabled;
23299      var visibility_observer;
23300      var mutation_observer;
23301      if (settings2.ignoreSystemDescribe === true) {
23302        settings2.describe = false;
23303      }
23304      $(document).bind("ajaxSend.terminal_" + self2.id(), function(e, xhr) {
23305        requests.push(xhr);
23306      });
23307      var scroller = $('<div class="terminal-scroller"/>').appendTo(self2);
23308      var wrapper = $('<div class="terminal-wrapper"/>').appendTo(scroller);
23309      $(broken_image).hide().appendTo(wrapper);
23310      var font_resizer = $('<div class="terminal-font">&nbsp;</div>').appendTo(self2);
23311      var pixel_resizer = $('<div class="terminal-pixel"/>').appendTo(self2);
23312      var filler = $('<div class="terminal-fill"/>').appendTo(scroller);
23313      output = $("<div>").addClass("terminal-output").attr("role", "log").appendTo(wrapper);
23314      self2.addClass("terminal");
23315      var pixel_density = get_pixel_size();
23316      var char_size = get_char_size(self2);
23317      css(self2[0], {
23318        "--char-width": char_size.width,
23319        "--char-height": char_size.height,
23320        "--terminal-scrollbar": get_scrollbar_width()
23321      });
23322      var need_char_size_recalculate = !terminal_ready(self2);
23323      if (settings2.login && fire_event("onBeforeLogin") === false) {
23324        autologin = false;
23325      }
23326      var base_interpreter;
23327      if (typeof init_interpreter === "string") {
23328        base_interpreter = init_interpreter;
23329      } else if (is_array(init_interpreter)) {
23330        for (var i = 0, len = init_interpreter.length;i < len; ++i) {
23331          if (typeof init_interpreter[i] === "string") {
23332            base_interpreter = init_interpreter[i];
23333            break;
23334          }
23335        }
23336      }
23337      var global_login_fn;
23338      if (is_function(settings2.login)) {
23339        global_login_fn = settings2.login;
23340      } else if (base_interpreter && (typeof settings2.login === "string" || settings2.login === true)) {
23341        global_login_fn = make_json_rpc_login(base_interpreter, settings2.login);
23342      }
23343      if (have_custom_id) {
23344        if (!terminals.set(settings2.id, self2)) {
23345          warn(strings().invalidId);
23346        }
23347      } else {
23348        terminals.append(self2);
23349      }
23350      function focus_terminal() {
23351        if (old_enabled) {
23352          self2.focus();
23353          self2.scroll_to_bottom();
23354        }
23355      }
23356      function get_pixel_size() {
23357        var rect = pixel_resizer[0].getBoundingClientRect();
23358        return rect.width || 1;
23359      }
23360      function blur_terminal() {
23361        old_enabled = enabled;
23362        self2.disable().find(".cmd textarea").trigger("blur", [true]);
23363      }
23364      function stringify_value(value) {
23365        if (is_function(value)) {
23366          value = value();
23367        }
23368        if (value && is_function(value.then)) {
23369          return value.then(stringify_value);
23370        }
23371        if (get_type(value) !== "string") {
23372          if (is_function(settings2.parseObject)) {
23373            var ret2 = settings2.parseObject(value);
23374            if (get_type(ret2) === "string") {
23375              value = ret2;
23376            }
23377          } else if (is_array(value)) {
23378            value = $.terminal.columns(value, self2.cols(), settings2.tabs);
23379          } else {
23380            var need_suffix = is_big_int(value);
23381            value = String(value);
23382            if (need_suffix) {
23383              value += "n";
23384            }
23385          }
23386        }
23387        return value;
23388      }
23389      function context_callback_proxy(fn2) {
23390        if (fn2.proxy) {
23391          return fn2;
23392        }
23393        var wrapper = function(callback) {
23394          return fn2.call(self2, callback, self2);
23395        };
23396        wrapper.proxy = true;
23397        return wrapper;
23398      }
23399      function paste_event(e) {
23400        e = e.originalEvent;
23401        function is_type(item, type) {
23402          return item.type.indexOf(type) !== -1;
23403        }
23404        function echo_image(image) {
23405          self2.echo('<img src="' + image + '"/>', { raw: true });
23406        }
23407        function data_uri(blob) {
23408          var URL2 = window.URL || window.webkitURL;
23409          return URL2.createObjectURL(blob);
23410        }
23411        function echo(object, ignoreEvents) {
23412          if (!ignoreEvents) {
23413            var event = {
23414              target: self2
23415            };
23416            if (typeof object === "string") {
23417              event.text = object;
23418            } else if (object instanceof Blob) {
23419              event.image = data_uri(object);
23420            }
23421            var ret2 = fire_event("onPaste", [event]);
23422            if (ret2) {
23423              if (is_function(ret2.then || ret2.done)) {
23424                return (ret2.then || ret2.done).call(ret2, function(ret2) {
23425                  echo(ret2, true);
23426                });
23427              } else {
23428                echo(ret2, true);
23429              }
23430            } else if (ret2 !== false) {
23431              echo(event.image || event.text, true);
23432            }
23433          } else if (object instanceof Blob) {
23434            echo_image(data_uri(object));
23435          } else if (typeof object === "string") {
23436            if (object.match(/^(data:|blob:)/)) {
23437              echo_image(object);
23438            } else {
23439              self2.insert(object);
23440            }
23441          }
23442        }
23443        if (e.clipboardData) {
23444          if (self2.enabled()) {
23445            var items = e.clipboardData.items;
23446            if (items) {
23447              for (var i = 0;i < items.length; i++) {
23448                if (is_type(items[i], "image") && settings2.pasteImage) {
23449                  var blob = items[i].getAsFile();
23450                  echo(blob);
23451                } else if (is_type(items[i], "text/plain")) {
23452                  items[i].getAsString(function(text2) {
23453                    echo(text2.replace(/\r/g, ""));
23454                  });
23455                }
23456              }
23457            } else if (e.clipboardData.getData) {
23458              var text2 = e.clipboardData.getData("text/plain");
23459              echo(text2.replace(/\r/g, ""));
23460            }
23461            return false;
23462          }
23463        }
23464      }
23465      $(document).on("paste.terminal_" + self2.id(), paste_event);
23466      var terminal_init_keymap = $.extend({}, keymap, $.omap(settings2.keymap || {}, function(key, fn2) {
23467        if (!keymap[key]) {
23468          return fn2.bind(self2);
23469        }
23470        return function(e, original) {
23471          return fn2.call(self2, e, function() {
23472            return keymap[key](e, original);
23473          });
23474        };
23475      }));
23476      make_interpreter(init_interpreter, settings2.login, function(interpreter) {
23477        if (settings2.completion && typeof settings2.completion !== "boolean" || !settings2.completion) {
23478          interpreter.completion = "settings";
23479        }
23480        var prompt = settings2.prompt;
23481        if (is_function(prompt)) {
23482          prompt = context_callback_proxy(prompt);
23483        }
23484        interpreters = new Stack($.extend({}, settings2.extra, {
23485          name: settings2.name,
23486          prompt,
23487          keypress: settings2.keypress,
23488          keydown: settings2.keydown,
23489          resize: settings2.onResize,
23490          greetings: settings2.greetings,
23491          mousewheel: settings2.mousewheel,
23492          history: settings2.history,
23493          keymap: terminal_init_keymap
23494        }, interpreter));
23495        command_line = $("<div/>").appendTo(wrapper).cmd({
23496          tabindex: settings2.tabindex,
23497          mobileDelete: settings2.mobileDelete,
23498          mobileIgnoreAutoSpace: settings2.mobileIgnoreAutoSpace,
23499          prompt: global_login_fn ? false : prompt,
23500          history: settings2.memory ? "memory" : settings2.history,
23501          historyFilter: settings2.historyFilter,
23502          historySize: settings2.historySize,
23503          caseSensitiveSearch: settings2.caseSensitiveSearch,
23504          onPaste: settings2.onPaste,
23505          width: "100%",
23506          enabled: false,
23507          charWidth: char_size.width,
23508          keydown: key_down,
23509          keymap: terminal_init_keymap,
23510          clickTimeout: settings2.clickTimeout,
23511          holdTimeout: settings2.holdTimeout,
23512          holdRepeatTimeout: settings2.holdRepeatTimeout,
23513          repeatTimeoutKeys: settings2.repeatTimeoutKeys,
23514          allowedAttributes: settings2.allowedAttributes,
23515          keypress: key_press,
23516          tabs: settings2.tabs,
23517          onPositionChange: function() {
23518            var args2 = [].slice.call(arguments);
23519            make_cursor_visible();
23520            fire_event("onPositionChange", args2);
23521          },
23522          onCommandChange: function(command) {
23523            if (old_width !== filler.width()) {
23524              self2.resizer();
23525            }
23526            fire_event("onCommandChange", [command]);
23527            make_cursor_visible();
23528          },
23529          commands
23530        });
23531        function disable(e) {
23532          if (is_mobile) {
23533            return;
23534          }
23535          e = e.originalEvent;
23536          if (e && e.isTrusted) {
23537            var node = document.elementFromPoint(e.clientX, e.clientY);
23538            if (!$(node).closest(".terminal").length && self2.enabled()) {
23539              self2.disable();
23540            }
23541          }
23542        }
23543        self2.oneTime(100, function() {
23544          $(document).bind("click.terminal_" + self2.id(), disable).bind("contextmenu.terminal_" + self2.id(), disable);
23545        });
23546        var $win = $(window);
23547        document.addEventListener("resume", function() {
23548          self2.disable();
23549        });
23550        if (is_mobile) {
23551          (function() {
23552            self2.addClass("terminal-mobile");
23553            var start;
23554            var move;
23555            var enabled;
23556            var SENSITIVITY = 3;
23557            var clip = command_line.clip();
23558            var HOLD_TIME = 200;
23559            var timer;
23560            clip.$node.off("touchstart.cmd");
23561            self2.on("touchstart.terminal", function(e) {
23562              e = e.originalEvent;
23563              window.touch_event = e;
23564              if (e.target.tagName.toLowerCase() === "a") {
23565                return;
23566              }
23567              if (!frozen && e.touches.length === 1) {
23568                enabled = self2.enabled();
23569                var point = e.touches[0];
23570                start = {
23571                  x: point.clientX,
23572                  y: point.clientY
23573                };
23574                timer = setTimeout(function() {
23575                  start = null;
23576                }, HOLD_TIME);
23577              }
23578            }).on("touchmove.terminal", function(e) {
23579              if (e.touches.length === 1 && start) {
23580                var point = e.touches[0];
23581                var diff_x = Math.abs(point.clientX - start.x);
23582                var diff_y = Math.abs(point.clientY - start.y);
23583                if (diff_x > SENSITIVITY || diff_y > SENSITIVITY) {
23584                  move = true;
23585                }
23586              }
23587            }).on("touchend.terminal", function() {
23588              if (start) {
23589                clearTimeout(timer);
23590                if (!move) {
23591                  if (!enabled) {
23592                    clip.focus();
23593                    self2.focus();
23594                    setTimeout(function() {
23595                      self2.scroll_to_bottom();
23596                    }, 100);
23597                  } else {
23598                    clip.blur();
23599                    self2.disable();
23600                  }
23601                }
23602              }
23603              move = false;
23604              start = null;
23605            });
23606          })();
23607          if ("visualViewport" in window) {
23608            on_height_change(function(height) {
23609              css(document.documentElement, {
23610                "--terminal-force-height": height + "px"
23611              });
23612            });
23613          }
23614        } else {
23615          $win.on("focus.terminal_" + self2.id(), focus_terminal).on("blur.terminal_" + self2.id(), blur_terminal);
23616          var was_ctx_event;
23617          (function() {
23618            var count = 0;
23619            var $target;
23620            var name = "click_" + self2.id();
23621            var textarea = self2.find(".cmd textarea");
23622            function click() {
23623              if ($target.is(".terminal") || $target.is(".terminal-scroller") || $target.is(".terminal-wrapper")) {
23624                var len = self2.get_command().length;
23625                self2.set_position(len);
23626              } else if ($target.closest(".cmd-prompt").length) {
23627                self2.set_position(0);
23628              }
23629              if (!textarea.is(":focus")) {
23630                textarea.focus();
23631              }
23632              reset();
23633            }
23634            function reset() {
23635              count = 0;
23636              $target = null;
23637            }
23638            var ignore_elements = ".terminal-output textarea," + ".terminal-output input";
23639            self2.mousedown(function(e) {
23640              if (!scrollbar_event(e, filler, pixel_density)) {
23641                $target = $(e.target);
23642              }
23643            }).mouseup(function() {
23644              if (was_ctx_event) {
23645                was_ctx_event = false;
23646                return;
23647              }
23648              if ($target && $target.closest(ignore_elements).length) {
23649                if (enabled) {
23650                  self2.disable();
23651                }
23652              } else if (get_selected_html() === "" && $target) {
23653                if (++count === 1) {
23654                  if (!frozen) {
23655                    if (!enabled) {
23656                      self2.focus();
23657                      self2.scroll_to_bottom();
23658                    } else {
23659                      var timeout = settings2.clickTimeout;
23660                      self2.oneTime(timeout, name, click);
23661                      return;
23662                    }
23663                  }
23664                } else {
23665                  self2.stopTime(name);
23666                }
23667              }
23668              reset();
23669            }).dblclick(function() {
23670              reset();
23671              self2.stopTime(name);
23672            });
23673          })();
23674          (function() {
23675            var $clip = command_line.clip().$node;
23676            function is_context_event(e) {
23677              return e.type === "mousedown" && e.buttons === 2 || e.type === "contextmenu";
23678            }
23679            var event_name;
23680            if ("oncontextmenu" in window) {
23681              event_name = "contextmenu.terminal";
23682            } else {
23683              event_name = "mousedown.terminal";
23684            }
23685            self2.on(event_name, function(e) {
23686              was_ctx_event = get_selected_html() === "" && is_context_event(e) && !e.ctrlKey;
23687              if (was_ctx_event) {
23688                var $target = $(e.target);
23689                if ($target.is("img,value,audio,object,canvas,a")) {
23690                  return;
23691                }
23692                if (!self2.enabled()) {
23693                  self2.enable();
23694                }
23695                var cmd_offset = command_line.offset();
23696                var cmd_rect = command_line[0].getBoundingClientRect();
23697                var self_offset = self2.offset();
23698                var top_limit = self_offset.top - cmd_offset.top;
23699                var top = Math.max(e.pageY - cmd_offset.top - 20, top_limit);
23700                var left = e.pageX - cmd_offset.left - 20;
23701                var height = 4 * 14;
23702                var width = 5 * 14;
23703                var rect = self2[0].getBoundingClientRect();
23704                var content_width = filler.outerWidth() * pixel_density;
23705                var diff_h = top + cmd_rect.top + height;
23706                diff_h = diff_h - rect.height - rect.top;
23707                var diff_w = left + cmd_rect.left + width;
23708                diff_w = diff_w - content_width - rect.left;
23709                if (diff_h > 0) {
23710                  height -= Math.ceil(diff_h);
23711                }
23712                if (diff_w > 0) {
23713                  width -= Math.ceil(diff_w);
23714                }
23715                $clip.attr("style", [
23716                  style_prop("left", left, true),
23717                  style_prop("top", top, true),
23718                  style_prop("width", width, true),
23719                  style_prop("height", height, true)
23720                ].join(";"));
23721                if (!$clip.is(":focus")) {
23722                  $clip.focus();
23723                }
23724                self2.stopTime("textarea");
23725                self2.oneTime(100, "textarea", function() {
23726                  var props = {
23727                    left: "",
23728                    top: "",
23729                    width: "",
23730                    height: ""
23731                  };
23732                  if (!is_css_variables_supported) {
23733                    var in_line = self2.find(".cmd .cmd-cursor-line").prevUntil(".cmd-prompt").length;
23734                    props.top = in_line * 14 + "px";
23735                  }
23736                  $clip.css(props);
23737                });
23738                self2.stopTime("selection");
23739                self2.everyTime(20, "selection", function() {
23740                  if ($clip[0].selection !== $clip[0].value) {
23741                    if (get_textarea_selection($clip[0])) {
23742                      clear_textarea_selection($clip[0]);
23743                      select(self2.find(".terminal-output")[0], self2.find(".cmd div:last-of-type")[0]);
23744                      self2.stopTime("selection");
23745                    }
23746                  }
23747                });
23748              }
23749            });
23750          })();
23751          self2.on("scroll", function() {
23752            var $textarea = self2.find("textarea");
23753            var rect = self2[0].getBoundingClientRect();
23754            var height = self2[0].scrollHeight;
23755            var scrollTop = scroller.scrollTop();
23756            var diff = height - (scrollTop + rect.height);
23757            if (diff === 0) {
23758              $textarea.css("top", "");
23759            } else {
23760              $textarea.css("top", -diff);
23761            }
23762          });
23763        }
23764        self2.on("click", "a", function(e) {
23765          var $this = $(this);
23766          if ($this.closest(".terminal-exception").length) {
23767            var href = $this.attr("href");
23768            if (href.match(/:[0-9]+$/)) {
23769              e.preventDefault();
23770              print_line(href, self2.cols());
23771            }
23772          }
23773          if (enabled) {
23774            self2.find(".cmd textarea").focus();
23775          }
23776        });
23777        function calculate_char_size() {
23778          var width = char_size.width;
23779          var height = char_size.height;
23780          char_size = get_char_size(self2);
23781          var css_vars = {};
23782          if (width !== char_size.width) {
23783            command_line.option("charWidth", char_size.width).refresh();
23784            css_vars["--char-width"] = char_size.width;
23785          }
23786          if (height !== char_size.height) {
23787            css_vars["--char-height"] = char_size.height;
23788          }
23789          if (Object.keys(css_vars).length) {
23790            css(self2[0], css_vars);
23791          }
23792        }
23793        resize();
23794        function resize() {
23795          if (self2.is(":visible")) {
23796            var width = filler.width();
23797            var height = filler.height();
23798            pixel_density = get_pixel_size();
23799            if (old_pixel_density !== pixel_density) {
23800              css(self2[0], {
23801                "--pixel-density": pixel_density
23802              });
23803            }
23804            if (need_char_size_recalculate) {
23805              need_char_size_recalculate = !terminal_ready(self2);
23806              if (!need_char_size_recalculate) {
23807                char_size = get_char_size(self2);
23808                calculate_char_size();
23809              }
23810            }
23811            if (old_height !== height || old_width !== width || pixel_density !== old_pixel_density) {
23812              self2.resize();
23813            }
23814            old_height = height;
23815            old_width = width;
23816            container_width = self2.width();
23817            old_pixel_density = pixel_density;
23818          }
23819        }
23820        function create_resizers() {
23821          var options2 = {
23822            prefix: "terminal-"
23823          };
23824          self2.resizer("unbind").resizer(resize, options2);
23825          font_resizer.resizer("unbind").resizer(function() {
23826            calculate_char_size();
23827            self2.resize();
23828          }, options2);
23829          pixel_resizer.resizer("unbind").resizer(function() {
23830            pixel_density = get_pixel_size();
23831            self2.refresh();
23832          }, options2);
23833          $('<div class="terminal-font-forcer terminal-hidden">x<div>').appendTo(self2);
23834        }
23835        function bottom_detect(intersections) {
23836          is_bottom_detected = intersections[0].intersectionRatio >= 0.9;
23837        }
23838        function create_bottom_detect() {
23839          if (window.IntersectionObserver) {
23840            var top = $('<div class="terminal-scroll-marker"/>').appendTo(scroller);
23841            var marker = top;
23842            if (settings2.scrollBottomOffset !== -1) {
23843              var style = style_prop("height", settings2.scrollBottomOffset);
23844              marker = $('<div style="' + style + '"/>').appendTo(top);
23845            }
23846            is_bottom_observer = new IntersectionObserver(bottom_detect, {
23847              root: scroller[0],
23848              rootMargin: "0px",
23849              threshold: 1
23850            });
23851            is_bottom_observer.observe(marker[0]);
23852          }
23853        }
23854        create_bottom_detect();
23855        if (self2.is(":visible")) {
23856          create_resizers();
23857        }
23858        function observe_visibility() {
23859          if (visibility_observer) {
23860            if (visibility_observer.unobserve) {
23861              visibility_observer.unobserve(self2[0]);
23862            } else {
23863              clearInterval(visibility_observer);
23864            }
23865          }
23866          var was_enabled = self2.enabled();
23867          var visible = self2.is(":visible");
23868          if (was_enabled && !visible) {
23869            self2.disable();
23870          }
23871          if (visible) {
23872            create_resizers();
23873          } else {
23874            wrapper.css("visibility", "hidden");
23875          }
23876          function visibility_checker() {
23877            if (self2.is(":visible") && !visible) {
23878              visible = true;
23879              create_resizers();
23880              calculate_char_size();
23881              resize();
23882              if (was_enabled) {
23883                self2.enable();
23884              }
23885              wrapper.css("visibility", "");
23886            } else if (visible && !self2.is(":visible")) {
23887              visible = false;
23888              was_enabled = $.terminal.active() === self2 && self2.enabled();
23889              self2.disable();
23890              wrapper.css("visibility", "hidden");
23891            }
23892          }
23893          if (window.IntersectionObserver && self2.css("position") !== "fixed") {
23894            visibility_observer = new IntersectionObserver(visibility_checker, {
23895              root: null
23896            });
23897            visibility_observer.observe(self2[0]);
23898          } else {
23899            visibility_observer = setInterval(visibility_checker, 100);
23900          }
23901        }
23902        var in_dom = !!self2.closest("body").length;
23903        var MutationObsrv = window.MutationObserver || window.WebKitMutationObserver;
23904        if (MutationObsrv) {
23905          mutation_observer = new MutationObsrv(function() {
23906            if (self2.closest("body").length) {
23907              if (!in_dom) {
23908                self2.scroll_to_bottom();
23909                observe_visibility();
23910                resize();
23911              }
23912              in_dom = true;
23913            } else if (in_dom) {
23914              in_dom = false;
23915            }
23916          });
23917          mutation_observer.observe(document.body, { childList: true });
23918        }
23919        if (in_dom) {
23920          observe_visibility();
23921        }
23922        function fonts_ready() {
23923          if (!defunct) {
23924            if (have_custom_font(self2)) {
23925              calculate_char_size();
23926              self2.resize();
23927            }
23928            command_queue.resolve();
23929          }
23930        }
23931        if (document.fonts && document.fonts.ready) {
23932          if (document.fonts.status === "loaded") {
23933            fonts_ready();
23934          } else {
23935            document.fonts.ready.then(fonts_ready);
23936          }
23937        } else {
23938          command_queue.resolve();
23939        }
23940        if (enabled && self2.is(":visible") && !is_mobile) {
23941          self2.focus(undefined, true);
23942        } else {
23943          self2.disable();
23944        }
23945        if (is_function(global_login_fn)) {
23946          self2.login(global_login_fn, true, start);
23947          init_queue.resolve();
23948          initialize();
23949        } else {
23950          start();
23951          initialize();
23952        }
23953        function exec_spec(spec, options2) {
23954          var terminal = terminals.get()[spec[0]];
23955          var defer = $.Deferred();
23956          if (terminal && terminal_id === terminal.id()) {
23957            if (!spec[2]) {
23958              defer.resolve();
23959              return defer.promise();
23960            } else if (paused) {
23961              resume_callbacks.push(function() {
23962                return terminal.exec(spec[2], options2).done(function() {
23963                  terminal.save_state(spec[2], true, spec[1]);
23964                  defer.resolve();
23965                });
23966              });
23967              return defer.promise();
23968            } else {
23969              return terminal.exec(spec[2], options2).done(function() {
23970                terminal.save_state(spec[2], true, spec[1]);
23971              });
23972            }
23973          }
23974        }
23975        if (settings2.execHash) {
23976          if (location.hash) {
23977            setTimeout(function() {
23978              try {
23979                var hash = location.hash.replace(/^#/, "");
23980                hash_commands = JSON.parse(decodeURIComponent(hash));
23981                if (!hash.match(/\[/)) {
23982                  replace_hash(hash_commands);
23983                }
23984                var i = 0;
23985                var options2 = {
23986                  typing: settings2.execAnimation,
23987                  history: settings2.execHistory,
23988                  delay: settings2.execAnimationDelay
23989                };
23990                (function recur() {
23991                  var spec = hash_commands[i++];
23992                  if (spec) {
23993                    exec_spec(spec, options2).done(recur);
23994                  } else {
23995                    change_hash = true;
23996                  }
23997                })();
23998              } catch (e) {}
23999            });
24000          } else {
24001            change_hash = true;
24002          }
24003        } else {
24004          change_hash = true;
24005        }
24006        (function() {
24007          var shift = false;
24008          $(document).bind("keydown.terminal_" + self2.id(), function(e) {
24009            if (e.shiftKey) {
24010              shift = true;
24011            }
24012          }).bind("keyup.terminal_" + self2.id(), function(e) {
24013            if (e.shiftKey || e.which === 16) {
24014              shift = false;
24015            }
24016          });
24017          function mousewheel(event, delta) {
24018            if (!shift) {
24019              var interpreter = interpreters.top();
24020              var ret2;
24021              if (is_function(interpreter.mousewheel)) {
24022                ret2 = interpreter.mousewheel(event, delta, self2);
24023              } else if (is_function(settings2.mousewheel)) {
24024                ret2 = settings2.mousewheel(event, delta, self2);
24025              }
24026              if (ret2 === true) {
24027                return;
24028              }
24029              if ((have_scrollbar() || ret2 === false) && !event.ctrlKey) {
24030                event.stopPropagation();
24031                event.preventDefault();
24032              }
24033              if (ret2 === false) {
24034                return false;
24035              }
24036              if (delta > 0) {
24037                self2.scroll(-40);
24038              } else {
24039                self2.scroll(40);
24040              }
24041            }
24042          }
24043          if ($.event.special.mousewheel) {
24044            scroller.on("mousewheel", mousewheel);
24045          } else {
24046            var event;
24047            var div = document.createElement("div");
24048            if ("onwheel" in div) {
24049              event = "wheel";
24050            } else if (document.onmousewheel !== undefined) {
24051              event = "mousewheel";
24052            } else {
24053              event = "DOMMouseScroll";
24054            }
24055            div = null;
24056            self2.on(event, function(e) {
24057              var delta;
24058              if (event === "mousewheel") {
24059                delta = -1 / 40 * e.originalEvent.wheelDelta;
24060              } else {
24061                delta = e.originalEvent.deltaY || e.originalEvent.detail;
24062              }
24063              mousewheel(e, -delta);
24064            });
24065          }
24066          scroller.touch_scroll(function(event) {
24067            var delta = event.current.clientY - event.previous.clientY;
24068            var ret2;
24069            var interpreter = interpreters.top();
24070            if (is_function(interpreter.touchscroll)) {
24071              ret2 = interpreter.touchscroll(event, delta, self2);
24072            } else if (is_function(settings2.touchscroll)) {
24073              ret2 = settings2.touchscroll(event, delta, self2);
24074            }
24075            css(self2[0], {
24076              "--terminal-scroll": scroller.prop("scrollTop")
24077            });
24078            if (ret2 === true) {
24079              return;
24080            }
24081            return false;
24082          });
24083        })();
24084      });
24085      return self2;
24086    };
24087  });
24088});
24089

24090// vendor/bundle/ruby/3.4.0/bundler/gems/humantheme-94cd7d067f0d/app/assets/javascripts/jquery-init.js
24091var import_jquery = __toESM(require_jquery());
24092window.jQuery = import_jquery.default;
24093window.$ = import_jquery.default;
24094

24095// vendor/bundle/ruby/3.4.0/bundler/gems/humantheme-94cd7d067f0d/app/assets/javascripts/humantheme.js
24096var import_bootstrap = __toESM(require_bootstrap());
24097var import_vanilla_lazyload = __toESM(require_lazyload_min());
24098

vendor: 12,998 bytes, lines 24099-24463

24099// node_modules/intersection-observer/intersection-observer.js
24100(function() {
24101  if (typeof window !== "object") {
24102    return;
24103  }
24104  if ("IntersectionObserver" in window && "IntersectionObserverEntry" in window && "intersectionRatio" in window.IntersectionObserverEntry.prototype) {
24105    if (!("isIntersecting" in window.IntersectionObserverEntry.prototype)) {
24106      Object.defineProperty(window.IntersectionObserverEntry.prototype, "isIntersecting", {
24107        get: function() {
24108          return this.intersectionRatio > 0;
24109        }
24110      });
24111    }
24112    return;
24113  }
24114  var document2 = window.document;
24115  var registry = [];
24116  function IntersectionObserverEntry(entry) {
24117    this.time = entry.time;
24118    this.target = entry.target;
24119    this.rootBounds = entry.rootBounds;
24120    this.boundingClientRect = entry.boundingClientRect;
24121    this.intersectionRect = entry.intersectionRect || getEmptyRect();
24122    this.isIntersecting = !!entry.intersectionRect;
24123    var targetRect = this.boundingClientRect;
24124    var targetArea = targetRect.width * targetRect.height;
24125    var intersectionRect = this.intersectionRect;
24126    var intersectionArea = intersectionRect.width * intersectionRect.height;
24127    if (targetArea) {
24128      this.intersectionRatio = Number((intersectionArea / targetArea).toFixed(4));
24129    } else {
24130      this.intersectionRatio = this.isIntersecting ? 1 : 0;
24131    }
24132  }
24133  function IntersectionObserver2(callback, opt_options) {
24134    var options2 = opt_options || {};
24135    if (typeof callback != "function") {
24136      throw new Error("callback must be a function");
24137    }
24138    if (options2.root && options2.root.nodeType != 1) {
24139      throw new Error("root must be an Element");
24140    }
24141    this._checkForIntersections = throttle(this._checkForIntersections.bind(this), this.THROTTLE_TIMEOUT);
24142    this._callback = callback;
24143    this._observationTargets = [];
24144    this._queuedEntries = [];
24145    this._rootMarginValues = this._parseRootMargin(options2.rootMargin);
24146    this.thresholds = this._initThresholds(options2.threshold);
24147    this.root = options2.root || null;
24148    this.rootMargin = this._rootMarginValues.map(function(margin) {
24149      return margin.value + margin.unit;
24150    }).join(" ");
24151  }
24152  IntersectionObserver2.prototype.THROTTLE_TIMEOUT = 100;
24153  IntersectionObserver2.prototype.POLL_INTERVAL = null;
24154  IntersectionObserver2.prototype.USE_MUTATION_OBSERVER = true;
24155  IntersectionObserver2.prototype.observe = function(target) {
24156    var isTargetAlreadyObserved = this._observationTargets.some(function(item) {
24157      return item.element == target;
24158    });
24159    if (isTargetAlreadyObserved) {
24160      return;
24161    }
24162    if (!(target && target.nodeType == 1)) {
24163      throw new Error("target must be an Element");
24164    }
24165    this._registerInstance();
24166    this._observationTargets.push({ element: target, entry: null });
24167    this._monitorIntersections();
24168    this._checkForIntersections();
24169  };
24170  IntersectionObserver2.prototype.unobserve = function(target) {
24171    this._observationTargets = this._observationTargets.filter(function(item) {
24172      return item.element != target;
24173    });
24174    if (!this._observationTargets.length) {
24175      this._unmonitorIntersections();
24176      this._unregisterInstance();
24177    }
24178  };
24179  IntersectionObserver2.prototype.disconnect = function() {
24180    this._observationTargets = [];
24181    this._unmonitorIntersections();
24182    this._unregisterInstance();
24183  };
24184  IntersectionObserver2.prototype.takeRecords = function() {
24185    var records = this._queuedEntries.slice();
24186    this._queuedEntries = [];
24187    return records;
24188  };
24189  IntersectionObserver2.prototype._initThresholds = function(opt_threshold) {
24190    var threshold = opt_threshold || [0];
24191    if (!Array.isArray(threshold))
24192      threshold = [threshold];
24193    return threshold.sort().filter(function(t, i, a) {
24194      if (typeof t != "number" || isNaN(t) || t < 0 || t > 1) {
24195        throw new Error("threshold must be a number between 0 and 1 inclusively");
24196      }
24197      return t !== a[i - 1];
24198    });
24199  };
24200  IntersectionObserver2.prototype._parseRootMargin = function(opt_rootMargin) {
24201    var marginString = opt_rootMargin || "0px";
24202    var margins = marginString.split(/\s+/).map(function(margin) {
24203      var parts = /^(-?\d*\.?\d+)(px|%)$/.exec(margin);
24204      if (!parts) {
24205        throw new Error("rootMargin must be specified in pixels or percent");
24206      }
24207      return { value: parseFloat(parts[1]), unit: parts[2] };
24208    });
24209    margins[1] = margins[1] || margins[0];
24210    margins[2] = margins[2] || margins[0];
24211    margins[3] = margins[3] || margins[1];
24212    return margins;
24213  };
24214  IntersectionObserver2.prototype._monitorIntersections = function() {
24215    if (!this._monitoringIntersections) {
24216      this._monitoringIntersections = true;
24217      if (this.POLL_INTERVAL) {
24218        this._monitoringInterval = setInterval(this._checkForIntersections, this.POLL_INTERVAL);
24219      } else {
24220        addEvent(window, "resize", this._checkForIntersections, true);
24221        addEvent(document2, "scroll", this._checkForIntersections, true);
24222        if (this.USE_MUTATION_OBSERVER && "MutationObserver" in window) {
24223          this._domObserver = new MutationObserver(this._checkForIntersections);
24224          this._domObserver.observe(document2, {
24225            attributes: true,
24226            childList: true,
24227            characterData: true,
24228            subtree: true
24229          });
24230        }
24231      }
24232    }
24233  };
24234  IntersectionObserver2.prototype._unmonitorIntersections = function() {
24235    if (this._monitoringIntersections) {
24236      this._monitoringIntersections = false;
24237      clearInterval(this._monitoringInterval);
24238      this._monitoringInterval = null;
24239      removeEvent(window, "resize", this._checkForIntersections, true);
24240      removeEvent(document2, "scroll", this._checkForIntersections, true);
24241      if (this._domObserver) {
24242        this._domObserver.disconnect();
24243        this._domObserver = null;
24244      }
24245    }
24246  };
24247  IntersectionObserver2.prototype._checkForIntersections = function() {
24248    var rootIsInDom = this._rootIsInDom();
24249    var rootRect = rootIsInDom ? this._getRootRect() : getEmptyRect();
24250    this._observationTargets.forEach(function(item) {
24251      var target = item.element;
24252      var targetRect = getBoundingClientRect(target);
24253      var rootContainsTarget = this._rootContainsTarget(target);
24254      var oldEntry = item.entry;
24255      var intersectionRect = rootIsInDom && rootContainsTarget && this._computeTargetAndRootIntersection(target, rootRect);
24256      var newEntry = item.entry = new IntersectionObserverEntry({
24257        time: now(),
24258        target,
24259        boundingClientRect: targetRect,
24260        rootBounds: rootRect,
24261        intersectionRect
24262      });
24263      if (!oldEntry) {
24264        this._queuedEntries.push(newEntry);
24265      } else if (rootIsInDom && rootContainsTarget) {
24266        if (this._hasCrossedThreshold(oldEntry, newEntry)) {
24267          this._queuedEntries.push(newEntry);
24268        }
24269      } else {
24270        if (oldEntry && oldEntry.isIntersecting) {
24271          this._queuedEntries.push(newEntry);
24272        }
24273      }
24274    }, this);
24275    if (this._queuedEntries.length) {
24276      this._callback(this.takeRecords(), this);
24277    }
24278  };
24279  IntersectionObserver2.prototype._computeTargetAndRootIntersection = function(target, rootRect) {
24280    if (window.getComputedStyle(target).display == "none")
24281      return;
24282    var targetRect = getBoundingClientRect(target);
24283    var intersectionRect = targetRect;
24284    var parent = getParentNode(target);
24285    var atRoot = false;
24286    while (!atRoot) {
24287      var parentRect = null;
24288      var parentComputedStyle = parent.nodeType == 1 ? window.getComputedStyle(parent) : {};
24289      if (parentComputedStyle.display == "none")
24290        return;
24291      if (parent == this.root || parent == document2) {
24292        atRoot = true;
24293        parentRect = rootRect;
24294      } else {
24295        if (parent != document2.body && parent != document2.documentElement && parentComputedStyle.overflow != "visible") {
24296          parentRect = getBoundingClientRect(parent);
24297        }
24298      }
24299      if (parentRect) {
24300        intersectionRect = computeRectIntersection(parentRect, intersectionRect);
24301        if (!intersectionRect)
24302          break;
24303      }
24304      parent = getParentNode(parent);
24305    }
24306    return intersectionRect;
24307  };
24308  IntersectionObserver2.prototype._getRootRect = function() {
24309    var rootRect;
24310    if (this.root) {
24311      rootRect = getBoundingClientRect(this.root);
24312    } else {
24313      var html = document2.documentElement;
24314      var body = document2.body;
24315      rootRect = {
24316        top: 0,
24317        left: 0,
24318        right: html.clientWidth || body.clientWidth,
24319        width: html.clientWidth || body.clientWidth,
24320        bottom: html.clientHeight || body.clientHeight,
24321        height: html.clientHeight || body.clientHeight
24322      };
24323    }
24324    return this._expandRectByRootMargin(rootRect);
24325  };
24326  IntersectionObserver2.prototype._expandRectByRootMargin = function(rect) {
24327    var margins = this._rootMarginValues.map(function(margin, i) {
24328      return margin.unit == "px" ? margin.value : margin.value * (i % 2 ? rect.width : rect.height) / 100;
24329    });
24330    var newRect = {
24331      top: rect.top - margins[0],
24332      right: rect.right + margins[1],
24333      bottom: rect.bottom + margins[2],
24334      left: rect.left - margins[3]
24335    };
24336    newRect.width = newRect.right - newRect.left;
24337    newRect.height = newRect.bottom - newRect.top;
24338    return newRect;
24339  };
24340  IntersectionObserver2.prototype._hasCrossedThreshold = function(oldEntry, newEntry) {
24341    var oldRatio = oldEntry && oldEntry.isIntersecting ? oldEntry.intersectionRatio || 0 : -1;
24342    var newRatio = newEntry.isIntersecting ? newEntry.intersectionRatio || 0 : -1;
24343    if (oldRatio === newRatio)
24344      return;
24345    for (var i = 0;i < this.thresholds.length; i++) {
24346      var threshold = this.thresholds[i];
24347      if (threshold == oldRatio || threshold == newRatio || threshold < oldRatio !== threshold < newRatio) {
24348        return true;
24349      }
24350    }
24351  };
24352  IntersectionObserver2.prototype._rootIsInDom = function() {
24353    return !this.root || containsDeep(document2, this.root);
24354  };
24355  IntersectionObserver2.prototype._rootContainsTarget = function(target) {
24356    return containsDeep(this.root || document2, target);
24357  };
24358  IntersectionObserver2.prototype._registerInstance = function() {
24359    if (registry.indexOf(this) < 0) {
24360      registry.push(this);
24361    }
24362  };
24363  IntersectionObserver2.prototype._unregisterInstance = function() {
24364    var index = registry.indexOf(this);
24365    if (index != -1)
24366      registry.splice(index, 1);
24367  };
24368  function now() {
24369    return window.performance && performance.now && performance.now();
24370  }
24371  function throttle(fn2, timeout) {
24372    var timer = null;
24373    return function() {
24374      if (!timer) {
24375        timer = setTimeout(function() {
24376          fn2();
24377          timer = null;
24378        }, timeout);
24379      }
24380    };
24381  }
24382  function addEvent(node, event, fn2, opt_useCapture) {
24383    if (typeof node.addEventListener == "function") {
24384      node.addEventListener(event, fn2, opt_useCapture || false);
24385    } else if (typeof node.attachEvent == "function") {
24386      node.attachEvent("on" + event, fn2);
24387    }
24388  }
24389  function removeEvent(node, event, fn2, opt_useCapture) {
24390    if (typeof node.removeEventListener == "function") {
24391      node.removeEventListener(event, fn2, opt_useCapture || false);
24392    } else if (typeof node.detatchEvent == "function") {
24393      node.detatchEvent("on" + event, fn2);
24394    }
24395  }
24396  function computeRectIntersection(rect1, rect2) {
24397    var top = Math.max(rect1.top, rect2.top);
24398    var bottom = Math.min(rect1.bottom, rect2.bottom);
24399    var left = Math.max(rect1.left, rect2.left);
24400    var right = Math.min(rect1.right, rect2.right);
24401    var width = right - left;
24402    var height = bottom - top;
24403    return width >= 0 && height >= 0 && {
24404      top,
24405      bottom,
24406      left,
24407      right,
24408      width,
24409      height
24410    };
24411  }
24412  function getBoundingClientRect(el) {
24413    var rect;
24414    try {
24415      rect = el.getBoundingClientRect();
24416    } catch (err) {}
24417    if (!rect)
24418      return getEmptyRect();
24419    if (!(rect.width && rect.height)) {
24420      rect = {
24421        top: rect.top,
24422        right: rect.right,
24423        bottom: rect.bottom,
24424        left: rect.left,
24425        width: rect.right - rect.left,
24426        height: rect.bottom - rect.top
24427      };
24428    }
24429    return rect;
24430  }
24431  function getEmptyRect() {
24432    return {
24433      top: 0,
24434      bottom: 0,
24435      left: 0,
24436      right: 0,
24437      width: 0,
24438      height: 0
24439    };
24440  }
24441  function containsDeep(parent, child) {
24442    var node = child;
24443    while (node) {
24444      if (node == parent)
24445        return true;
24446      node = getParentNode(node);
24447    }
24448    return false;
24449  }
24450  function getParentNode(node) {
24451    var parent = node.parentNode;
24452    if (parent && parent.nodeType == 11 && parent.host) {
24453      return parent.host;
24454    }
24455    if (parent && parent.assignedSlot) {
24456      return parent.assignedSlot.parentNode;
24457    }
24458    return parent;
24459  }
24460  window.IntersectionObserver = IntersectionObserver2;
24461  window.IntersectionObserverEntry = IntersectionObserverEntry;
24462})();
24463

24464// vendor/bundle/ruby/3.4.0/bundler/gems/humantheme-94cd7d067f0d/app/assets/javascripts/humantheme/google_analytics_pageview.js
24465$(document).on("turbo:load", function() {
24466  if (typeof ga === "function") {
24467    ga("set", "location", window.location.href.split("#")[0]);
24468    ga("send", "pageview");
24469  }
24470});
24471

24472// vendor/bundle/ruby/3.4.0/bundler/gems/humantheme-94cd7d067f0d/app/assets/javascripts/humantheme/topbar.js
24473var ready = function() {
24474  let toggleMenu = document.getElementsByClassName("toggle-menu")[0];
24475  toggleMenu.addEventListener("click", function(e) {
24476    e.preventDefault();
24477    document.getElementsByClassName("main-nav")[0].classList.toggle("show");
24478  });
24479};
24480$(document).on("turbo:load", ready);
24481

24482// vendor/bundle/ruby/3.4.0/bundler/gems/humantheme-94cd7d067f0d/app/assets/javascripts/humantheme.js
24483var lazyLoadInstance = new import_vanilla_lazyload.default({
24484  elements_selector: ".lazy"
24485});
24486window.lazyLoadInstance = lazyLoadInstance;
24487document.addEventListener("turbo:load", function() {
24488  lazyLoadInstance.update();
24489});
24490

vendor: 167,853 bytes, lines 24491-29711

24491// node_modules/@hotwired/turbo/dist/turbo.es2017-esm.js
24492var exports_turbo_es2017_esm = {};
24493__export(exports_turbo_es2017_esm, {
24494  FetchEnctype: () => FetchEnctype,
24495  FetchMethod: () => FetchMethod,
24496  FetchRequest: () => FetchRequest,
24497  FetchResponse: () => FetchResponse,
24498  FrameElement: () => FrameElement,
24499  FrameLoadingStyle: () => FrameLoadingStyle,
24500  FrameRenderer: () => FrameRenderer,
24501  PageRenderer: () => PageRenderer,
24502  PageSnapshot: () => PageSnapshot,
24503  StreamActions: () => StreamActions,
24504  StreamElement: () => StreamElement,
24505  StreamSourceElement: () => StreamSourceElement,
24506  cache: () => cache,
24507  config: () => config,
24508  connectStreamSource: () => connectStreamSource,
24509  disconnectStreamSource: () => disconnectStreamSource,
24510  fetch: () => fetchWithTurboHeaders,
24511  fetchEnctypeFromString: () => fetchEnctypeFromString,
24512  fetchMethodFromString: () => fetchMethodFromString,
24513  isSafe: () => isSafe,
24514  morphBodyElements: () => morphBodyElements,
24515  morphChildren: () => morphChildren,
24516  morphElements: () => morphElements,
24517  morphTurboFrameElements: () => morphTurboFrameElements,
24518  navigator: () => navigator2,
24519  registerAdapter: () => registerAdapter,
24520  renderStreamMessage: () => renderStreamMessage,
24521  session: () => session,
24522  setConfirmMethod: () => setConfirmMethod,
24523  setFormMode: () => setFormMode,
24524  setProgressBarDelay: () => setProgressBarDelay,
24525  start: () => start,
24526  visit: () => visit
24527});
24528/*!
24529Turbo 8.0.21
24530Copyright Â© 2026 37signals LLC
24531 */
24532var FrameLoadingStyle = {
24533  eager: "eager",
24534  lazy: "lazy"
24535};
24536
24537class FrameElement extends HTMLElement {
24538  static delegateConstructor = undefined;
24539  loaded = Promise.resolve();
24540  static get observedAttributes() {
24541    return ["disabled", "loading", "src"];
24542  }
24543  constructor() {
24544    super();
24545    this.delegate = new FrameElement.delegateConstructor(this);
24546  }
24547  connectedCallback() {
24548    this.delegate.connect();
24549  }
24550  disconnectedCallback() {
24551    this.delegate.disconnect();
24552  }
24553  reload() {
24554    return this.delegate.sourceURLReloaded();
24555  }
24556  attributeChangedCallback(name) {
24557    if (name == "loading") {
24558      this.delegate.loadingStyleChanged();
24559    } else if (name == "src") {
24560      this.delegate.sourceURLChanged();
24561    } else if (name == "disabled") {
24562      this.delegate.disabledChanged();
24563    }
24564  }
24565  get src() {
24566    return this.getAttribute("src");
24567  }
24568  set src(value) {
24569    if (value) {
24570      this.setAttribute("src", value);
24571    } else {
24572      this.removeAttribute("src");
24573    }
24574  }
24575  get refresh() {
24576    return this.getAttribute("refresh");
24577  }
24578  set refresh(value) {
24579    if (value) {
24580      this.setAttribute("refresh", value);
24581    } else {
24582      this.removeAttribute("refresh");
24583    }
24584  }
24585  get shouldReloadWithMorph() {
24586    return this.src && this.refresh === "morph";
24587  }
24588  get loading() {
24589    return frameLoadingStyleFromString(this.getAttribute("loading") || "");
24590  }
24591  set loading(value) {
24592    if (value) {
24593      this.setAttribute("loading", value);
24594    } else {
24595      this.removeAttribute("loading");
24596    }
24597  }
24598  get disabled() {
24599    return this.hasAttribute("disabled");
24600  }
24601  set disabled(value) {
24602    if (value) {
24603      this.setAttribute("disabled", "");
24604    } else {
24605      this.removeAttribute("disabled");
24606    }
24607  }
24608  get autoscroll() {
24609    return this.hasAttribute("autoscroll");
24610  }
24611  set autoscroll(value) {
24612    if (value) {
24613      this.setAttribute("autoscroll", "");
24614    } else {
24615      this.removeAttribute("autoscroll");
24616    }
24617  }
24618  get complete() {
24619    return !this.delegate.isLoading;
24620  }
24621  get isActive() {
24622    return this.ownerDocument === document && !this.isPreview;
24623  }
24624  get isPreview() {
24625    return this.ownerDocument?.documentElement?.hasAttribute("data-turbo-preview");
24626  }
24627}
24628function frameLoadingStyleFromString(style) {
24629  switch (style.toLowerCase()) {
24630    case "lazy":
24631      return FrameLoadingStyle.lazy;
24632    default:
24633      return FrameLoadingStyle.eager;
24634  }
24635}
24636var drive = {
24637  enabled: true,
24638  progressBarDelay: 500,
24639  unvisitableExtensions: new Set([
24640    ".7z",
24641    ".aac",
24642    ".apk",
24643    ".avi",
24644    ".bmp",
24645    ".bz2",
24646    ".css",
24647    ".csv",
24648    ".deb",
24649    ".dmg",
24650    ".doc",
24651    ".docx",
24652    ".exe",
24653    ".gif",
24654    ".gz",
24655    ".heic",
24656    ".heif",
24657    ".ico",
24658    ".iso",
24659    ".jpeg",
24660    ".jpg",
24661    ".js",
24662    ".json",
24663    ".m4a",
24664    ".mkv",
24665    ".mov",
24666    ".mp3",
24667    ".mp4",
24668    ".mpeg",
24669    ".mpg",
24670    ".msi",
24671    ".ogg",
24672    ".ogv",
24673    ".pdf",
24674    ".pkg",
24675    ".png",
24676    ".ppt",
24677    ".pptx",
24678    ".rar",
24679    ".rtf",
24680    ".svg",
24681    ".tar",
24682    ".tif",
24683    ".tiff",
24684    ".txt",
24685    ".wav",
24686    ".webm",
24687    ".webp",
24688    ".wma",
24689    ".wmv",
24690    ".xls",
24691    ".xlsx",
24692    ".xml",
24693    ".zip"
24694  ])
24695};
24696function activateScriptElement(element) {
24697  if (element.getAttribute("data-turbo-eval") == "false") {
24698    return element;
24699  } else {
24700    const createdScriptElement = document.createElement("script");
24701    const cspNonce = getCspNonce();
24702    if (cspNonce) {
24703      createdScriptElement.nonce = cspNonce;
24704    }
24705    createdScriptElement.textContent = element.textContent;
24706    createdScriptElement.async = false;
24707    copyElementAttributes(createdScriptElement, element);
24708    return createdScriptElement;
24709  }
24710}
24711function copyElementAttributes(destinationElement, sourceElement) {
24712  for (const { name, value } of sourceElement.attributes) {
24713    destinationElement.setAttribute(name, value);
24714  }
24715}
24716function createDocumentFragment(html) {
24717  const template = document.createElement("template");
24718  template.innerHTML = html;
24719  return template.content;
24720}
24721function dispatch(eventName, { target, cancelable, detail } = {}) {
24722  const event = new CustomEvent(eventName, {
24723    cancelable,
24724    bubbles: true,
24725    composed: true,
24726    detail
24727  });
24728  if (target && target.isConnected) {
24729    target.dispatchEvent(event);
24730  } else {
24731    document.documentElement.dispatchEvent(event);
24732  }
24733  return event;
24734}
24735function cancelEvent(event) {
24736  event.preventDefault();
24737  event.stopImmediatePropagation();
24738}
24739function nextRepaint() {
24740  if (document.visibilityState === "hidden") {
24741    return nextEventLoopTick();
24742  } else {
24743    return nextAnimationFrame();
24744  }
24745}
24746function nextAnimationFrame() {
24747  return new Promise((resolve) => requestAnimationFrame(() => resolve()));
24748}
24749function nextEventLoopTick() {
24750  return new Promise((resolve) => setTimeout(() => resolve(), 0));
24751}
24752function parseHTMLDocument(html = "") {
24753  return new DOMParser().parseFromString(html, "text/html");
24754}
24755function unindent(strings, ...values) {
24756  const lines = interpolate(strings, values).replace(/^\n/, "").split(`
24757`);
24758  const match = lines[0].match(/^\s+/);
24759  const indent = match ? match[0].length : 0;
24760  return lines.map((line) => line.slice(indent)).join(`
24761`);
24762}
24763function interpolate(strings, values) {
24764  return strings.reduce((result, string2, i) => {
24765    const value = values[i] == undefined ? "" : values[i];
24766    return result + string2 + value;
24767  }, "");
24768}
24769function uuid() {
24770  return Array.from({ length: 36 }).map((_, i) => {
24771    if (i == 8 || i == 13 || i == 18 || i == 23) {
24772      return "-";
24773    } else if (i == 14) {
24774      return "4";
24775    } else if (i == 19) {
24776      return (Math.floor(Math.random() * 4) + 8).toString(16);
24777    } else {
24778      return Math.floor(Math.random() * 16).toString(16);
24779    }
24780  }).join("");
24781}
24782function getAttribute(attributeName, ...elements) {
24783  for (const value of elements.map((element) => element?.getAttribute(attributeName))) {
24784    if (typeof value == "string")
24785      return value;
24786  }
24787  return null;
24788}
24789function hasAttribute(attributeName, ...elements) {
24790  return elements.some((element) => element && element.hasAttribute(attributeName));
24791}
24792function markAsBusy(...elements) {
24793  for (const element of elements) {
24794    if (element.localName == "turbo-frame") {
24795      element.setAttribute("busy", "");
24796    }
24797    element.setAttribute("aria-busy", "true");
24798  }
24799}
24800function clearBusyState(...elements) {
24801  for (const element of elements) {
24802    if (element.localName == "turbo-frame") {
24803      element.removeAttribute("busy");
24804    }
24805    element.removeAttribute("aria-busy");
24806  }
24807}
24808function waitForLoad(element, timeoutInMilliseconds = 2000) {
24809  return new Promise((resolve) => {
24810    const onComplete = () => {
24811      element.removeEventListener("error", onComplete);
24812      element.removeEventListener("load", onComplete);
24813      resolve();
24814    };
24815    element.addEventListener("load", onComplete, { once: true });
24816    element.addEventListener("error", onComplete, { once: true });
24817    setTimeout(resolve, timeoutInMilliseconds);
24818  });
24819}
24820function getHistoryMethodForAction(action) {
24821  switch (action) {
24822    case "replace":
24823      return history.replaceState;
24824    case "advance":
24825    case "restore":
24826      return history.pushState;
24827  }
24828}
24829function isAction(action) {
24830  return action == "advance" || action == "replace" || action == "restore";
24831}
24832function getVisitAction(...elements) {
24833  const action = getAttribute("data-turbo-action", ...elements);
24834  return isAction(action) ? action : null;
24835}
24836function getMetaElement(name) {
24837  return document.querySelector(`meta[name="${name}"]`);
24838}
24839function getMetaContent(name) {
24840  const element = getMetaElement(name);
24841  return element && element.content;
24842}
24843function getCspNonce() {
24844  const element = getMetaElement("csp-nonce");
24845  if (element) {
24846    const { nonce, content } = element;
24847    return nonce == "" ? content : nonce;
24848  }
24849}
24850function setMetaContent(name, content) {
24851  let element = getMetaElement(name);
24852  if (!element) {
24853    element = document.createElement("meta");
24854    element.setAttribute("name", name);
24855    document.head.appendChild(element);
24856  }
24857  element.setAttribute("content", content);
24858  return element;
24859}
24860function findClosestRecursively(element, selector) {
24861  if (element instanceof Element) {
24862    return element.closest(selector) || findClosestRecursively(element.assignedSlot || element.getRootNode()?.host, selector);
24863  }
24864}
24865function elementIsFocusable(element) {
24866  const inertDisabledOrHidden = "[inert], :disabled, [hidden], details:not([open]), dialog:not([open])";
24867  return !!element && element.closest(inertDisabledOrHidden) == null && typeof element.focus == "function";
24868}
24869function queryAutofocusableElement(elementOrDocumentFragment) {
24870  return Array.from(elementOrDocumentFragment.querySelectorAll("[autofocus]")).find(elementIsFocusable);
24871}
24872async function around(callback, reader) {
24873  const before = reader();
24874  callback();
24875  await nextAnimationFrame();
24876  const after = reader();
24877  return [before, after];
24878}
24879function doesNotTargetIFrame(name) {
24880  if (name === "_blank") {
24881    return false;
24882  } else if (name) {
24883    for (const element of document.getElementsByName(name)) {
24884      if (element instanceof HTMLIFrameElement)
24885        return false;
24886    }
24887    return true;
24888  } else {
24889    return true;
24890  }
24891}
24892function findLinkFromClickTarget(target) {
24893  const link = findClosestRecursively(target, "a[href], a[xlink\\:href]");
24894  if (!link)
24895    return null;
24896  if (link.href.startsWith("#"))
24897    return null;
24898  if (link.hasAttribute("download"))
24899    return null;
24900  const linkTarget = link.getAttribute("target");
24901  if (linkTarget && linkTarget !== "_self")
24902    return null;
24903  return link;
24904}
24905function debounce2(fn2, delay) {
24906  let timeoutId = null;
24907  return (...args2) => {
24908    const callback = () => fn2.apply(this, args2);
24909    clearTimeout(timeoutId);
24910    timeoutId = setTimeout(callback, delay);
24911  };
24912}
24913var submitter = {
24914  "aria-disabled": {
24915    beforeSubmit: (submitter) => {
24916      submitter.setAttribute("aria-disabled", "true");
24917      submitter.addEventListener("click", cancelEvent);
24918    },
24919    afterSubmit: (submitter) => {
24920      submitter.removeAttribute("aria-disabled");
24921      submitter.removeEventListener("click", cancelEvent);
24922    }
24923  },
24924  disabled: {
24925    beforeSubmit: (submitter) => submitter.disabled = true,
24926    afterSubmit: (submitter) => submitter.disabled = false
24927  }
24928};
24929
24930class Config {
24931  #submitter = null;
24932  constructor(config2) {
24933    Object.assign(this, config2);
24934  }
24935  get submitter() {
24936    return this.#submitter;
24937  }
24938  set submitter(value) {
24939    this.#submitter = submitter[value] || value;
24940  }
24941}
24942var forms = new Config({
24943  mode: "on",
24944  submitter: "disabled"
24945});
24946var config = {
24947  drive,
24948  forms
24949};
24950function expandURL(locatable) {
24951  return new URL(locatable.toString(), document.baseURI);
24952}
24953function getAnchor(url) {
24954  let anchorMatch;
24955  if (url.hash) {
24956    return url.hash.slice(1);
24957  } else if (anchorMatch = url.href.match(/#(.*)$/)) {
24958    return anchorMatch[1];
24959  }
24960}
24961function getAction$1(form, submitter) {
24962  const action = submitter?.getAttribute("formaction") || form.getAttribute("action") || form.action;
24963  return expandURL(action);
24964}
24965function getExtension(url) {
24966  return (getLastPathComponent(url).match(/\.[^.]*$/) || [])[0] || "";
24967}
24968function isPrefixedBy(baseURL, url) {
24969  const prefix = addTrailingSlash(url.origin + url.pathname);
24970  return addTrailingSlash(baseURL.href) === prefix || baseURL.href.startsWith(prefix);
24971}
24972function locationIsVisitable(location2, rootLocation) {
24973  return isPrefixedBy(location2, rootLocation) && !config.drive.unvisitableExtensions.has(getExtension(location2));
24974}
24975function getLocationForLink(link) {
24976  return expandURL(link.getAttribute("href") || "");
24977}
24978function getRequestURL(url) {
24979  const anchor = getAnchor(url);
24980  return anchor != null ? url.href.slice(0, -(anchor.length + 1)) : url.href;
24981}
24982function toCacheKey(url) {
24983  return getRequestURL(url);
24984}
24985function urlsAreEqual(left, right) {
24986  return expandURL(left).href == expandURL(right).href;
24987}
24988function getPathComponents(url) {
24989  return url.pathname.split("/").slice(1);
24990}
24991function getLastPathComponent(url) {
24992  return getPathComponents(url).slice(-1)[0];
24993}
24994function addTrailingSlash(value) {
24995  return value.endsWith("/") ? value : value + "/";
24996}
24997
24998class FetchResponse {
24999  constructor(response) {
25000    this.response = response;
25001  }
25002  get succeeded() {
25003    return this.response.ok;
25004  }
25005  get failed() {
25006    return !this.succeeded;
25007  }
25008  get clientError() {
25009    return this.statusCode >= 400 && this.statusCode <= 499;
25010  }
25011  get serverError() {
25012    return this.statusCode >= 500 && this.statusCode <= 599;
25013  }
25014  get redirected() {
25015    return this.response.redirected;
25016  }
25017  get location() {
25018    return expandURL(this.response.url);
25019  }
25020  get isHTML() {
25021    return this.contentType && this.contentType.match(/^(?:text\/([^\s;,]+\b)?html|application\/xhtml\+xml)\b/);
25022  }
25023  get statusCode() {
25024    return this.response.status;
25025  }
25026  get contentType() {
25027    return this.header("Content-Type");
25028  }
25029  get responseText() {
25030    return this.response.clone().text();
25031  }
25032  get responseHTML() {
25033    if (this.isHTML) {
25034      return this.response.clone().text();
25035    } else {
25036      return Promise.resolve(undefined);
25037    }
25038  }
25039  header(name) {
25040    return this.response.headers.get(name);
25041  }
25042}
25043
25044class LimitedSet extends Set {
25045  constructor(maxSize) {
25046    super();
25047    this.maxSize = maxSize;
25048  }
25049  add(value) {
25050    if (this.size >= this.maxSize) {
25051      const iterator = this.values();
25052      const oldestValue = iterator.next().value;
25053      this.delete(oldestValue);
25054    }
25055    super.add(value);
25056  }
25057}
25058var recentRequests = new LimitedSet(20);
25059function fetchWithTurboHeaders(url, options2 = {}) {
25060  const modifiedHeaders = new Headers(options2.headers || {});
25061  const requestUID = uuid();
25062  recentRequests.add(requestUID);
25063  modifiedHeaders.append("X-Turbo-Request-Id", requestUID);
25064  return window.fetch(url, {
25065    ...options2,
25066    headers: modifiedHeaders
25067  });
25068}
25069function fetchMethodFromString(method) {
25070  switch (method.toLowerCase()) {
25071    case "get":
25072      return FetchMethod.get;
25073    case "post":
25074      return FetchMethod.post;
25075    case "put":
25076      return FetchMethod.put;
25077    case "patch":
25078      return FetchMethod.patch;
25079    case "delete":
25080      return FetchMethod.delete;
25081  }
25082}
25083var FetchMethod = {
25084  get: "get",
25085  post: "post",
25086  put: "put",
25087  patch: "patch",
25088  delete: "delete"
25089};
25090function fetchEnctypeFromString(encoding) {
25091  switch (encoding.toLowerCase()) {
25092    case FetchEnctype.multipart:
25093      return FetchEnctype.multipart;
25094    case FetchEnctype.plain:
25095      return FetchEnctype.plain;
25096    default:
25097      return FetchEnctype.urlEncoded;
25098  }
25099}
25100var FetchEnctype = {
25101  urlEncoded: "application/x-www-form-urlencoded",
25102  multipart: "multipart/form-data",
25103  plain: "text/plain"
25104};
25105
25106class FetchRequest {
25107  abortController = new AbortController;
25108  #resolveRequestPromise = (_value) => {};
25109  constructor(delegate, method, location2, requestBody = new URLSearchParams, target = null, enctype = FetchEnctype.urlEncoded) {
25110    const [url, body] = buildResourceAndBody(expandURL(location2), method, requestBody, enctype);
25111    this.delegate = delegate;
25112    this.url = url;
25113    this.target = target;
25114    this.fetchOptions = {
25115      credentials: "same-origin",
25116      redirect: "follow",
25117      method: method.toUpperCase(),
25118      headers: { ...this.defaultHeaders },
25119      body,
25120      signal: this.abortSignal,
25121      referrer: this.delegate.referrer?.href
25122    };
25123    this.enctype = enctype;
25124  }
25125  get method() {
25126    return this.fetchOptions.method;
25127  }
25128  set method(value) {
25129    const fetchBody = this.isSafe ? this.url.searchParams : this.fetchOptions.body || new FormData;
25130    const fetchMethod = fetchMethodFromString(value) || FetchMethod.get;
25131    this.url.search = "";
25132    const [url, body] = buildResourceAndBody(this.url, fetchMethod, fetchBody, this.enctype);
25133    this.url = url;
25134    this.fetchOptions.body = body;
25135    this.fetchOptions.method = fetchMethod.toUpperCase();
25136  }
25137  get headers() {
25138    return this.fetchOptions.headers;
25139  }
25140  set headers(value) {
25141    this.fetchOptions.headers = value;
25142  }
25143  get body() {
25144    if (this.isSafe) {
25145      return this.url.searchParams;
25146    } else {
25147      return this.fetchOptions.body;
25148    }
25149  }
25150  set body(value) {
25151    this.fetchOptions.body = value;
25152  }
25153  get location() {
25154    return this.url;
25155  }
25156  get params() {
25157    return this.url.searchParams;
25158  }
25159  get entries() {
25160    return this.body ? Array.from(this.body.entries()) : [];
25161  }
25162  cancel() {
25163    this.abortController.abort();
25164  }
25165  async perform() {
25166    const { fetchOptions } = this;
25167    this.delegate.prepareRequest(this);
25168    const event = await this.#allowRequestToBeIntercepted(fetchOptions);
25169    try {
25170      this.delegate.requestStarted(this);
25171      if (event.detail.fetchRequest) {
25172        this.response = event.detail.fetchRequest.response;
25173      } else {
25174        this.response = fetchWithTurboHeaders(this.url.href, fetchOptions);
25175      }
25176      const response = await this.response;
25177      return await this.receive(response);
25178    } catch (error) {
25179      if (error.name !== "AbortError") {
25180        if (this.#willDelegateErrorHandling(error)) {
25181          this.delegate.requestErrored(this, error);
25182        }
25183        throw error;
25184      }
25185    } finally {
25186      this.delegate.requestFinished(this);
25187    }
25188  }
25189  async receive(response) {
25190    const fetchResponse = new FetchResponse(response);
25191    const event = dispatch("turbo:before-fetch-response", {
25192      cancelable: true,
25193      detail: { fetchResponse },
25194      target: this.target
25195    });
25196    if (event.defaultPrevented) {
25197      this.delegate.requestPreventedHandlingResponse(this, fetchResponse);
25198    } else if (fetchResponse.succeeded) {
25199      this.delegate.requestSucceededWithResponse(this, fetchResponse);
25200    } else {
25201      this.delegate.requestFailedWithResponse(this, fetchResponse);
25202    }
25203    return fetchResponse;
25204  }
25205  get defaultHeaders() {
25206    return {
25207      Accept: "text/html, application/xhtml+xml"
25208    };
25209  }
25210  get isSafe() {
25211    return isSafe(this.method);
25212  }
25213  get abortSignal() {
25214    return this.abortController.signal;
25215  }
25216  acceptResponseType(mimeType) {
25217    this.headers["Accept"] = [mimeType, this.headers["Accept"]].join(", ");
25218  }
25219  async#allowRequestToBeIntercepted(fetchOptions) {
25220    const requestInterception = new Promise((resolve) => this.#resolveRequestPromise = resolve);
25221    const event = dispatch("turbo:before-fetch-request", {
25222      cancelable: true,
25223      detail: {
25224        fetchOptions,
25225        url: this.url,
25226        resume: this.#resolveRequestPromise
25227      },
25228      target: this.target
25229    });
25230    this.url = event.detail.url;
25231    if (event.defaultPrevented)
25232      await requestInterception;
25233    return event;
25234  }
25235  #willDelegateErrorHandling(error) {
25236    const event = dispatch("turbo:fetch-request-error", {
25237      target: this.target,
25238      cancelable: true,
25239      detail: { request: this, error }
25240    });
25241    return !event.defaultPrevented;
25242  }
25243}
25244function isSafe(fetchMethod) {
25245  return fetchMethodFromString(fetchMethod) == FetchMethod.get;
25246}
25247function buildResourceAndBody(resource, method, requestBody, enctype) {
25248  const searchParams = Array.from(requestBody).length > 0 ? new URLSearchParams(entriesExcludingFiles(requestBody)) : resource.searchParams;
25249  if (isSafe(method)) {
25250    return [mergeIntoURLSearchParams(resource, searchParams), null];
25251  } else if (enctype == FetchEnctype.urlEncoded) {
25252    return [resource, searchParams];
25253  } else {
25254    return [resource, requestBody];
25255  }
25256}
25257function entriesExcludingFiles(requestBody) {
25258  const entries = [];
25259  for (const [name, value] of requestBody) {
25260    if (value instanceof File)
25261      continue;
25262    else
25263      entries.push([name, value]);
25264  }
25265  return entries;
25266}
25267function mergeIntoURLSearchParams(url, requestBody) {
25268  const searchParams = new URLSearchParams(entriesExcludingFiles(requestBody));
25269  url.search = searchParams.toString();
25270  return url;
25271}
25272
25273class AppearanceObserver {
25274  started = false;
25275  constructor(delegate, element) {
25276    this.delegate = delegate;
25277    this.element = element;
25278    this.intersectionObserver = new IntersectionObserver(this.intersect);
25279  }
25280  start() {
25281    if (!this.started) {
25282      this.started = true;
25283      this.intersectionObserver.observe(this.element);
25284    }
25285  }
25286  stop() {
25287    if (this.started) {
25288      this.started = false;
25289      this.intersectionObserver.unobserve(this.element);
25290    }
25291  }
25292  intersect = (entries) => {
25293    const lastEntry = entries.slice(-1)[0];
25294    if (lastEntry?.isIntersecting) {
25295      this.delegate.elementAppearedInViewport(this.element);
25296    }
25297  };
25298}
25299
25300class StreamMessage {
25301  static contentType = "text/vnd.turbo-stream.html";
25302  static wrap(message) {
25303    if (typeof message == "string") {
25304      return new this(createDocumentFragment(message));
25305    } else {
25306      return message;
25307    }
25308  }
25309  constructor(fragment) {
25310    this.fragment = importStreamElements(fragment);
25311  }
25312}
25313function importStreamElements(fragment) {
25314  for (const element of fragment.querySelectorAll("turbo-stream")) {
25315    const streamElement = document.importNode(element, true);
25316    for (const inertScriptElement of streamElement.templateElement.content.querySelectorAll("script")) {
25317      inertScriptElement.replaceWith(activateScriptElement(inertScriptElement));
25318    }
25319    element.replaceWith(streamElement);
25320  }
25321  return fragment;
25322}
25323var identity = (key) => key;
25324
25325class LRUCache {
25326  keys = [];
25327  entries = {};
25328  #toCacheKey;
25329  constructor(size, toCacheKey = identity) {
25330    this.size = size;
25331    this.#toCacheKey = toCacheKey;
25332  }
25333  has(key) {
25334    return this.#toCacheKey(key) in this.entries;
25335  }
25336  get(key) {
25337    if (this.has(key)) {
25338      const entry = this.read(key);
25339      this.touch(key);
25340      return entry;
25341    }
25342  }
25343  put(key, entry) {
25344    this.write(key, entry);
25345    this.touch(key);
25346    return entry;
25347  }
25348  clear() {
25349    for (const key of Object.keys(this.entries)) {
25350      this.evict(key);
25351    }
25352  }
25353  read(key) {
25354    return this.entries[this.#toCacheKey(key)];
25355  }
25356  write(key, entry) {
25357    this.entries[this.#toCacheKey(key)] = entry;
25358  }
25359  touch(key) {
25360    key = this.#toCacheKey(key);
25361    const index = this.keys.indexOf(key);
25362    if (index > -1)
25363      this.keys.splice(index, 1);
25364    this.keys.unshift(key);
25365    this.trim();
25366  }
25367  trim() {
25368    for (const key of this.keys.splice(this.size)) {
25369      this.evict(key);
25370    }
25371  }
25372  evict(key) {
25373    delete this.entries[key];
25374  }
25375}
25376var PREFETCH_DELAY = 100;
25377
25378class PrefetchCache extends LRUCache {
25379  #prefetchTimeout = null;
25380  #maxAges = {};
25381  constructor(size = 1, prefetchDelay = PREFETCH_DELAY) {
25382    super(size, toCacheKey);
25383    this.prefetchDelay = prefetchDelay;
25384  }
25385  putLater(url, request, ttl) {
25386    this.#prefetchTimeout = setTimeout(() => {
25387      request.perform();
25388      this.put(url, request, ttl);
25389      this.#prefetchTimeout = null;
25390    }, this.prefetchDelay);
25391  }
25392  put(url, request, ttl = cacheTtl) {
25393    super.put(url, request);
25394    this.#maxAges[toCacheKey(url)] = new Date(new Date().getTime() + ttl);
25395  }
25396  clear() {
25397    super.clear();
25398    if (this.#prefetchTimeout)
25399      clearTimeout(this.#prefetchTimeout);
25400  }
25401  evict(key) {
25402    super.evict(key);
25403    delete this.#maxAges[key];
25404  }
25405  has(key) {
25406    if (super.has(key)) {
25407      const maxAge = this.#maxAges[toCacheKey(key)];
25408      return maxAge && maxAge > Date.now();
25409    } else {
25410      return false;
25411    }
25412  }
25413}
25414var cacheTtl = 10 * 1000;
25415var prefetchCache = new PrefetchCache;
25416var FormSubmissionState = {
25417  initialized: "initialized",
25418  requesting: "requesting",
25419  waiting: "waiting",
25420  receiving: "receiving",
25421  stopping: "stopping",
25422  stopped: "stopped"
25423};
25424
25425class FormSubmission {
25426  state = FormSubmissionState.initialized;
25427  static confirmMethod(message) {
25428    return Promise.resolve(confirm(message));
25429  }
25430  constructor(delegate, formElement, submitter, mustRedirect = false) {
25431    const method = getMethod(formElement, submitter);
25432    const action = getAction(getFormAction(formElement, submitter), method);
25433    const body = buildFormData(formElement, submitter);
25434    const enctype = getEnctype(formElement, submitter);
25435    this.delegate = delegate;
25436    this.formElement = formElement;
25437    this.submitter = submitter;
25438    this.fetchRequest = new FetchRequest(this, method, action, body, formElement, enctype);
25439    this.mustRedirect = mustRedirect;
25440  }
25441  get method() {
25442    return this.fetchRequest.method;
25443  }
25444  set method(value) {
25445    this.fetchRequest.method = value;
25446  }
25447  get action() {
25448    return this.fetchRequest.url.toString();
25449  }
25450  set action(value) {
25451    this.fetchRequest.url = expandURL(value);
25452  }
25453  get body() {
25454    return this.fetchRequest.body;
25455  }
25456  get enctype() {
25457    return this.fetchRequest.enctype;
25458  }
25459  get isSafe() {
25460    return this.fetchRequest.isSafe;
25461  }
25462  get location() {
25463    return this.fetchRequest.url;
25464  }
25465  async start() {
25466    const { initialized, requesting } = FormSubmissionState;
25467    const confirmationMessage = getAttribute("data-turbo-confirm", this.submitter, this.formElement);
25468    if (typeof confirmationMessage === "string") {
25469      const confirmMethod = typeof config.forms.confirm === "function" ? config.forms.confirm : FormSubmission.confirmMethod;
25470      const answer = await confirmMethod(confirmationMessage, this.formElement, this.submitter);
25471      if (!answer) {
25472        return;
25473      }
25474    }
25475    if (this.state == initialized) {
25476      this.state = requesting;
25477      return this.fetchRequest.perform();
25478    }
25479  }
25480  stop() {
25481    const { stopping, stopped } = FormSubmissionState;
25482    if (this.state != stopping && this.state != stopped) {
25483      this.state = stopping;
25484      this.fetchRequest.cancel();
25485      return true;
25486    }
25487  }
25488  prepareRequest(request) {
25489    if (!request.isSafe) {
25490      const token = getCookieValue(getMetaContent("csrf-param")) || getMetaContent("csrf-token");
25491      if (token) {
25492        request.headers["X-CSRF-Token"] = token;
25493      }
25494    }
25495    if (this.requestAcceptsTurboStreamResponse(request)) {
25496      request.acceptResponseType(StreamMessage.contentType);
25497    }
25498  }
25499  requestStarted(_request) {
25500    this.state = FormSubmissionState.waiting;
25501    if (this.submitter)
25502      config.forms.submitter.beforeSubmit(this.submitter);
25503    this.setSubmitsWith();
25504    markAsBusy(this.formElement);
25505    dispatch("turbo:submit-start", {
25506      target: this.formElement,
25507      detail: { formSubmission: this }
25508    });
25509    this.delegate.formSubmissionStarted(this);
25510  }
25511  requestPreventedHandlingResponse(request, response) {
25512    prefetchCache.clear();
25513    this.result = { success: response.succeeded, fetchResponse: response };
25514  }
25515  requestSucceededWithResponse(request, response) {
25516    if (response.clientError || response.serverError) {
25517      this.delegate.formSubmissionFailedWithResponse(this, response);
25518      return;
25519    }
25520    prefetchCache.clear();
25521    if (this.requestMustRedirect(request) && responseSucceededWithoutRedirect(response)) {
25522      const error = new Error("Form responses must redirect to another location");
25523      this.delegate.formSubmissionErrored(this, error);
25524    } else {
25525      this.state = FormSubmissionState.receiving;
25526      this.result = { success: true, fetchResponse: response };
25527      this.delegate.formSubmissionSucceededWithResponse(this, response);
25528    }
25529  }
25530  requestFailedWithResponse(request, response) {
25531    this.result = { success: false, fetchResponse: response };
25532    this.delegate.formSubmissionFailedWithResponse(this, response);
25533  }
25534  requestErrored(request, error) {
25535    this.result = { success: false, error };
25536    this.delegate.formSubmissionErrored(this, error);
25537  }
25538  requestFinished(_request) {
25539    this.state = FormSubmissionState.stopped;
25540    if (this.submitter)
25541      config.forms.submitter.afterSubmit(this.submitter);
25542    this.resetSubmitterText();
25543    clearBusyState(this.formElement);
25544    dispatch("turbo:submit-end", {
25545      target: this.formElement,
25546      detail: { formSubmission: this, ...this.result }
25547    });
25548    this.delegate.formSubmissionFinished(this);
25549  }
25550  setSubmitsWith() {
25551    if (!this.submitter || !this.submitsWith)
25552      return;
25553    if (this.submitter.matches("button")) {
25554      this.originalSubmitText = this.submitter.innerHTML;
25555      this.submitter.innerHTML = this.submitsWith;
25556    } else if (this.submitter.matches("input")) {
25557      const input = this.submitter;
25558      this.originalSubmitText = input.value;
25559      input.value = this.submitsWith;
25560    }
25561  }
25562  resetSubmitterText() {
25563    if (!this.submitter || !this.originalSubmitText)
25564      return;
25565    if (this.submitter.matches("button")) {
25566      this.submitter.innerHTML = this.originalSubmitText;
25567    } else if (this.submitter.matches("input")) {
25568      const input = this.submitter;
25569      input.value = this.originalSubmitText;
25570    }
25571  }
25572  requestMustRedirect(request) {
25573    return !request.isSafe && this.mustRedirect;
25574  }
25575  requestAcceptsTurboStreamResponse(request) {
25576    return !request.isSafe || hasAttribute("data-turbo-stream", this.submitter, this.formElement);
25577  }
25578  get submitsWith() {
25579    return this.submitter?.getAttribute("data-turbo-submits-with");
25580  }
25581}
25582function buildFormData(formElement, submitter) {
25583  const formData = new FormData(formElement);
25584  const name = submitter?.getAttribute("name");
25585  const value = submitter?.getAttribute("value");
25586  if (name) {
25587    formData.append(name, value || "");
25588  }
25589  return formData;
25590}
25591function getCookieValue(cookieName) {
25592  if (cookieName != null) {
25593    const cookies = document.cookie ? document.cookie.split("; ") : [];
25594    const cookie = cookies.find((cookie) => cookie.startsWith(cookieName));
25595    if (cookie) {
25596      const value = cookie.split("=").slice(1).join("=");
25597      return value ? decodeURIComponent(value) : undefined;
25598    }
25599  }
25600}
25601function responseSucceededWithoutRedirect(response) {
25602  return response.statusCode == 200 && !response.redirected;
25603}
25604function getFormAction(formElement, submitter) {
25605  const formElementAction = typeof formElement.action === "string" ? formElement.action : null;
25606  if (submitter?.hasAttribute("formaction")) {
25607    return submitter.getAttribute("formaction") || "";
25608  } else {
25609    return formElement.getAttribute("action") || formElementAction || "";
25610  }
25611}
25612function getAction(formAction, fetchMethod) {
25613  const action = expandURL(formAction);
25614  if (isSafe(fetchMethod)) {
25615    action.search = "";
25616  }
25617  return action;
25618}
25619function getMethod(formElement, submitter) {
25620  const method = submitter?.getAttribute("formmethod") || formElement.getAttribute("method") || "";
25621  return fetchMethodFromString(method.toLowerCase()) || FetchMethod.get;
25622}
25623function getEnctype(formElement, submitter) {
25624  return fetchEnctypeFromString(submitter?.getAttribute("formenctype") || formElement.enctype);
25625}
25626
25627class Snapshot {
25628  constructor(element) {
25629    this.element = element;
25630  }
25631  get activeElement() {
25632    return this.element.ownerDocument.activeElement;
25633  }
25634  get children() {
25635    return [...this.element.children];
25636  }
25637  hasAnchor(anchor) {
25638    return this.getElementForAnchor(anchor) != null;
25639  }
25640  getElementForAnchor(anchor) {
25641    return anchor ? this.element.querySelector(`[id='${anchor}'], a[name='${anchor}']`) : null;
25642  }
25643  get isConnected() {
25644    return this.element.isConnected;
25645  }
25646  get firstAutofocusableElement() {
25647    return queryAutofocusableElement(this.element);
25648  }
25649  get permanentElements() {
25650    return queryPermanentElementsAll(this.element);
25651  }
25652  getPermanentElementById(id) {
25653    return getPermanentElementById(this.element, id);
25654  }
25655  getPermanentElementMapForSnapshot(snapshot) {
25656    const permanentElementMap = {};
25657    for (const currentPermanentElement of this.permanentElements) {
25658      const { id } = currentPermanentElement;
25659      const newPermanentElement = snapshot.getPermanentElementById(id);
25660      if (newPermanentElement) {
25661        permanentElementMap[id] = [currentPermanentElement, newPermanentElement];
25662      }
25663    }
25664    return permanentElementMap;
25665  }
25666}
25667function getPermanentElementById(node, id) {
25668  return node.querySelector(`#${id}[data-turbo-permanent]`);
25669}
25670function queryPermanentElementsAll(node) {
25671  return node.querySelectorAll("[id][data-turbo-permanent]");
25672}
25673
25674class FormSubmitObserver {
25675  started = false;
25676  constructor(delegate, eventTarget) {
25677    this.delegate = delegate;
25678    this.eventTarget = eventTarget;
25679  }
25680  start() {
25681    if (!this.started) {
25682      this.eventTarget.addEventListener("submit", this.submitCaptured, true);
25683      this.started = true;
25684    }
25685  }
25686  stop() {
25687    if (this.started) {
25688      this.eventTarget.removeEventListener("submit", this.submitCaptured, true);
25689      this.started = false;
25690    }
25691  }
25692  submitCaptured = () => {
25693    this.eventTarget.removeEventListener("submit", this.submitBubbled, false);
25694    this.eventTarget.addEventListener("submit", this.submitBubbled, false);
25695  };
25696  submitBubbled = (event) => {
25697    if (!event.defaultPrevented) {
25698      const form = event.target instanceof HTMLFormElement ? event.target : undefined;
25699      const submitter = event.submitter || undefined;
25700      if (form && submissionDoesNotDismissDialog(form, submitter) && submissionDoesNotTargetIFrame(form, submitter) && this.delegate.willSubmitForm(form, submitter)) {
25701        event.preventDefault();
25702        event.stopImmediatePropagation();
25703        this.delegate.formSubmitted(form, submitter);
25704      }
25705    }
25706  };
25707}
25708function submissionDoesNotDismissDialog(form, submitter) {
25709  const method = submitter?.getAttribute("formmethod") || form.getAttribute("method");
25710  return method != "dialog";
25711}
25712function submissionDoesNotTargetIFrame(form, submitter) {
25713  const target = submitter?.getAttribute("formtarget") || form.getAttribute("target");
25714  return doesNotTargetIFrame(target);
25715}
25716
25717class View {
25718  #resolveRenderPromise = (_value) => {};
25719  #resolveInterceptionPromise = (_value) => {};
25720  constructor(delegate, element) {
25721    this.delegate = delegate;
25722    this.element = element;
25723  }
25724  scrollToAnchor(anchor) {
25725    const element = this.snapshot.getElementForAnchor(anchor);
25726    if (element) {
25727      this.focusElement(element);
25728      this.scrollToElement(element);
25729    } else {
25730      this.scrollToPosition({ x: 0, y: 0 });
25731    }
25732  }
25733  scrollToAnchorFromLocation(location2) {
25734    this.scrollToAnchor(getAnchor(location2));
25735  }
25736  scrollToElement(element) {
25737    element.scrollIntoView();
25738  }
25739  focusElement(element) {
25740    if (element instanceof HTMLElement) {
25741      if (element.hasAttribute("tabindex")) {
25742        element.focus();
25743      } else {
25744        element.setAttribute("tabindex", "-1");
25745        element.focus();
25746        element.removeAttribute("tabindex");
25747      }
25748    }
25749  }
25750  scrollToPosition({ x, y }) {
25751    this.scrollRoot.scrollTo(x, y);
25752  }
25753  scrollToTop() {
25754    this.scrollToPosition({ x: 0, y: 0 });
25755  }
25756  get scrollRoot() {
25757    return window;
25758  }
25759  async render(renderer) {
25760    const { isPreview, shouldRender, willRender, newSnapshot: snapshot } = renderer;
25761    const shouldInvalidate = willRender;
25762    if (shouldRender) {
25763      try {
25764        this.renderPromise = new Promise((resolve) => this.#resolveRenderPromise = resolve);
25765        this.renderer = renderer;
25766        await this.prepareToRenderSnapshot(renderer);
25767        const renderInterception = new Promise((resolve) => this.#resolveInterceptionPromise = resolve);
25768        const options2 = { resume: this.#resolveInterceptionPromise, render: this.renderer.renderElement, renderMethod: this.renderer.renderMethod };
25769        const immediateRender = this.delegate.allowsImmediateRender(snapshot, options2);
25770        if (!immediateRender)
25771          await renderInterception;
25772        await this.renderSnapshot(renderer);
25773        this.delegate.viewRenderedSnapshot(snapshot, isPreview, this.renderer.renderMethod);
25774        this.delegate.preloadOnLoadLinksForView(this.element);
25775        this.finishRenderingSnapshot(renderer);
25776      } finally {
25777        delete this.renderer;
25778        this.#resolveRenderPromise(undefined);
25779        delete this.renderPromise;
25780      }
25781    } else if (shouldInvalidate) {
25782      this.invalidate(renderer.reloadReason);
25783    }
25784  }
25785  invalidate(reason) {
25786    this.delegate.viewInvalidated(reason);
25787  }
25788  async prepareToRenderSnapshot(renderer) {
25789    this.markAsPreview(renderer.isPreview);
25790    await renderer.prepareToRender();
25791  }
25792  markAsPreview(isPreview) {
25793    if (isPreview) {
25794      this.element.setAttribute("data-turbo-preview", "");
25795    } else {
25796      this.element.removeAttribute("data-turbo-preview");
25797    }
25798  }
25799  markVisitDirection(direction) {
25800    this.element.setAttribute("data-turbo-visit-direction", direction);
25801  }
25802  unmarkVisitDirection() {
25803    this.element.removeAttribute("data-turbo-visit-direction");
25804  }
25805  async renderSnapshot(renderer) {
25806    await renderer.render();
25807  }
25808  finishRenderingSnapshot(renderer) {
25809    renderer.finishRendering();
25810  }
25811}
25812
25813class FrameView extends View {
25814  missing() {
25815    this.element.innerHTML = `<strong class="turbo-frame-error">Content missing</strong>`;
25816  }
25817  get snapshot() {
25818    return new Snapshot(this.element);
25819  }
25820}
25821
25822class LinkInterceptor {
25823  constructor(delegate, element) {
25824    this.delegate = delegate;
25825    this.element = element;
25826  }
25827  start() {
25828    this.element.addEventListener("click", this.clickBubbled);
25829    document.addEventListener("turbo:click", this.linkClicked);
25830    document.addEventListener("turbo:before-visit", this.willVisit);
25831  }
25832  stop() {
25833    this.element.removeEventListener("click", this.clickBubbled);
25834    document.removeEventListener("turbo:click", this.linkClicked);
25835    document.removeEventListener("turbo:before-visit", this.willVisit);
25836  }
25837  clickBubbled = (event) => {
25838    if (this.clickEventIsSignificant(event)) {
25839      this.clickEvent = event;
25840    } else {
25841      delete this.clickEvent;
25842    }
25843  };
25844  linkClicked = (event) => {
25845    if (this.clickEvent && this.clickEventIsSignificant(event)) {
25846      if (this.delegate.shouldInterceptLinkClick(event.target, event.detail.url, event.detail.originalEvent)) {
25847        this.clickEvent.preventDefault();
25848        event.preventDefault();
25849        this.delegate.linkClickIntercepted(event.target, event.detail.url, event.detail.originalEvent);
25850      }
25851    }
25852    delete this.clickEvent;
25853  };
25854  willVisit = (_event) => {
25855    delete this.clickEvent;
25856  };
25857  clickEventIsSignificant(event) {
25858    const target = event.composed ? event.target?.parentElement : event.target;
25859    const element = findLinkFromClickTarget(target) || target;
25860    return element instanceof Element && element.closest("turbo-frame, html") == this.element;
25861  }
25862}
25863
25864class LinkClickObserver {
25865  started = false;
25866  constructor(delegate, eventTarget) {
25867    this.delegate = delegate;
25868    this.eventTarget = eventTarget;
25869  }
25870  start() {
25871    if (!this.started) {
25872      this.eventTarget.addEventListener("click", this.clickCaptured, true);
25873      this.started = true;
25874    }
25875  }
25876  stop() {
25877    if (this.started) {
25878      this.eventTarget.removeEventListener("click", this.clickCaptured, true);
25879      this.started = false;
25880    }
25881  }
25882  clickCaptured = () => {
25883    this.eventTarget.removeEventListener("click", this.clickBubbled, false);
25884    this.eventTarget.addEventListener("click", this.clickBubbled, false);
25885  };
25886  clickBubbled = (event) => {
25887    if (event instanceof MouseEvent && this.clickEventIsSignificant(event)) {
25888      const target = event.composedPath && event.composedPath()[0] || event.target;
25889      const link = findLinkFromClickTarget(target);
25890      if (link && doesNotTargetIFrame(link.target)) {
25891        const location2 = getLocationForLink(link);
25892        if (this.delegate.willFollowLinkToLocation(link, location2, event)) {
25893          event.preventDefault();
25894          this.delegate.followedLinkToLocation(link, location2);
25895        }
25896      }
25897    }
25898  };
25899  clickEventIsSignificant(event) {
25900    return !(event.target && event.target.isContentEditable || event.defaultPrevented || event.which > 1 || event.altKey || event.ctrlKey || event.metaKey || event.shiftKey);
25901  }
25902}
25903
25904class FormLinkClickObserver {
25905  constructor(delegate, element) {
25906    this.delegate = delegate;
25907    this.linkInterceptor = new LinkClickObserver(this, element);
25908  }
25909  start() {
25910    this.linkInterceptor.start();
25911  }
25912  stop() {
25913    this.linkInterceptor.stop();
25914  }
25915  canPrefetchRequestToLocation(link, location2) {
25916    return false;
25917  }
25918  prefetchAndCacheRequestToLocation(link, location2) {
25919    return;
25920  }
25921  willFollowLinkToLocation(link, location2, originalEvent) {
25922    return this.delegate.willSubmitFormLinkToLocation(link, location2, originalEvent) && (link.hasAttribute("data-turbo-method") || link.hasAttribute("data-turbo-stream"));
25923  }
25924  followedLinkToLocation(link, location2) {
25925    const form = document.createElement("form");
25926    const type = "hidden";
25927    for (const [name, value] of location2.searchParams) {
25928      form.append(Object.assign(document.createElement("input"), { type, name, value }));
25929    }
25930    const action = Object.assign(location2, { search: "" });
25931    form.setAttribute("data-turbo", "true");
25932    form.setAttribute("action", action.href);
25933    form.setAttribute("hidden", "");
25934    const method = link.getAttribute("data-turbo-method");
25935    if (method)
25936      form.setAttribute("method", method);
25937    const turboFrame = link.getAttribute("data-turbo-frame");
25938    if (turboFrame)
25939      form.setAttribute("data-turbo-frame", turboFrame);
25940    const turboAction = getVisitAction(link);
25941    if (turboAction)
25942      form.setAttribute("data-turbo-action", turboAction);
25943    const turboConfirm = link.getAttribute("data-turbo-confirm");
25944    if (turboConfirm)
25945      form.setAttribute("data-turbo-confirm", turboConfirm);
25946    const turboStream = link.hasAttribute("data-turbo-stream");
25947    if (turboStream)
25948      form.setAttribute("data-turbo-stream", "");
25949    this.delegate.submittedFormLinkToLocation(link, location2, form);
25950    document.body.appendChild(form);
25951    form.addEventListener("turbo:submit-end", () => form.remove(), { once: true });
25952    requestAnimationFrame(() => form.requestSubmit());
25953  }
25954}
25955
25956class Bardo {
25957  static async preservingPermanentElements(delegate, permanentElementMap, callback) {
25958    const bardo = new this(delegate, permanentElementMap);
25959    bardo.enter();
25960    await callback();
25961    bardo.leave();
25962  }
25963  constructor(delegate, permanentElementMap) {
25964    this.delegate = delegate;
25965    this.permanentElementMap = permanentElementMap;
25966  }
25967  enter() {
25968    for (const id in this.permanentElementMap) {
25969      const [currentPermanentElement, newPermanentElement] = this.permanentElementMap[id];
25970      this.delegate.enteringBardo(currentPermanentElement, newPermanentElement);
25971      this.replaceNewPermanentElementWithPlaceholder(newPermanentElement);
25972    }
25973  }
25974  leave() {
25975    for (const id in this.permanentElementMap) {
25976      const [currentPermanentElement] = this.permanentElementMap[id];
25977      this.replaceCurrentPermanentElementWithClone(currentPermanentElement);
25978      this.replacePlaceholderWithPermanentElement(currentPermanentElement);
25979      this.delegate.leavingBardo(currentPermanentElement);
25980    }
25981  }
25982  replaceNewPermanentElementWithPlaceholder(permanentElement) {
25983    const placeholder = createPlaceholderForPermanentElement(permanentElement);
25984    permanentElement.replaceWith(placeholder);
25985  }
25986  replaceCurrentPermanentElementWithClone(permanentElement) {
25987    const clone2 = permanentElement.cloneNode(true);
25988    permanentElement.replaceWith(clone2);
25989  }
25990  replacePlaceholderWithPermanentElement(permanentElement) {
25991    const placeholder = this.getPlaceholderById(permanentElement.id);
25992    placeholder?.replaceWith(permanentElement);
25993  }
25994  getPlaceholderById(id) {
25995    return this.placeholders.find((element) => element.content == id);
25996  }
25997  get placeholders() {
25998    return [...document.querySelectorAll("meta[name=turbo-permanent-placeholder][content]")];
25999  }
26000}
26001function createPlaceholderForPermanentElement(permanentElement) {
26002  const element = document.createElement("meta");
26003  element.setAttribute("name", "turbo-permanent-placeholder");
26004  element.setAttribute("content", permanentElement.id);
26005  return element;
26006}
26007
26008class Renderer {
26009  #activeElement = null;
26010  static renderElement(currentElement, newElement) {}
26011  constructor(currentSnapshot, newSnapshot, isPreview, willRender = true) {
26012    this.currentSnapshot = currentSnapshot;
26013    this.newSnapshot = newSnapshot;
26014    this.isPreview = isPreview;
26015    this.willRender = willRender;
26016    this.renderElement = this.constructor.renderElement;
26017    this.promise = new Promise((resolve, reject) => this.resolvingFunctions = { resolve, reject });
26018  }
26019  get shouldRender() {
26020    return true;
26021  }
26022  get shouldAutofocus() {
26023    return true;
26024  }
26025  get reloadReason() {
26026    return;
26027  }
26028  prepareToRender() {
26029    return;
26030  }
26031  render() {}
26032  finishRendering() {
26033    if (this.resolvingFunctions) {
26034      this.resolvingFunctions.resolve();
26035      delete this.resolvingFunctions;
26036    }
26037  }
26038  async preservingPermanentElements(callback) {
26039    await Bardo.preservingPermanentElements(this, this.permanentElementMap, callback);
26040  }
26041  focusFirstAutofocusableElement() {
26042    if (this.shouldAutofocus) {
26043      const element = this.connectedSnapshot.firstAutofocusableElement;
26044      if (element) {
26045        element.focus();
26046      }
26047    }
26048  }
26049  enteringBardo(currentPermanentElement) {
26050    if (this.#activeElement)
26051      return;
26052    if (currentPermanentElement.contains(this.currentSnapshot.activeElement)) {
26053      this.#activeElement = this.currentSnapshot.activeElement;
26054    }
26055  }
26056  leavingBardo(currentPermanentElement) {
26057    if (currentPermanentElement.contains(this.#activeElement) && this.#activeElement instanceof HTMLElement) {
26058      this.#activeElement.focus();
26059      this.#activeElement = null;
26060    }
26061  }
26062  get connectedSnapshot() {
26063    return this.newSnapshot.isConnected ? this.newSnapshot : this.currentSnapshot;
26064  }
26065  get currentElement() {
26066    return this.currentSnapshot.element;
26067  }
26068  get newElement() {
26069    return this.newSnapshot.element;
26070  }
26071  get permanentElementMap() {
26072    return this.currentSnapshot.getPermanentElementMapForSnapshot(this.newSnapshot);
26073  }
26074  get renderMethod() {
26075    return "replace";
26076  }
26077}
26078
26079class FrameRenderer extends Renderer {
26080  static renderElement(currentElement, newElement) {
26081    const destinationRange = document.createRange();
26082    destinationRange.selectNodeContents(currentElement);
26083    destinationRange.deleteContents();
26084    const frameElement = newElement;
26085    const sourceRange = frameElement.ownerDocument?.createRange();
26086    if (sourceRange) {
26087      sourceRange.selectNodeContents(frameElement);
26088      currentElement.appendChild(sourceRange.extractContents());
26089    }
26090  }
26091  constructor(delegate, currentSnapshot, newSnapshot, renderElement, isPreview, willRender = true) {
26092    super(currentSnapshot, newSnapshot, renderElement, isPreview, willRender);
26093    this.delegate = delegate;
26094  }
26095  get shouldRender() {
26096    return true;
26097  }
26098  async render() {
26099    await nextRepaint();
26100    this.preservingPermanentElements(() => {
26101      this.loadFrameElement();
26102    });
26103    this.scrollFrameIntoView();
26104    await nextRepaint();
26105    this.focusFirstAutofocusableElement();
26106    await nextRepaint();
26107    this.activateScriptElements();
26108  }
26109  loadFrameElement() {
26110    this.delegate.willRenderFrame(this.currentElement, this.newElement);
26111    this.renderElement(this.currentElement, this.newElement);
26112  }
26113  scrollFrameIntoView() {
26114    if (this.currentElement.autoscroll || this.newElement.autoscroll) {
26115      const element = this.currentElement.firstElementChild;
26116      const block = readScrollLogicalPosition(this.currentElement.getAttribute("data-autoscroll-block"), "end");
26117      const behavior = readScrollBehavior(this.currentElement.getAttribute("data-autoscroll-behavior"), "auto");
26118      if (element) {
26119        element.scrollIntoView({ block, behavior });
26120        return true;
26121      }
26122    }
26123    return false;
26124  }
26125  activateScriptElements() {
26126    for (const inertScriptElement of this.newScriptElements) {
26127      const activatedScriptElement = activateScriptElement(inertScriptElement);
26128      inertScriptElement.replaceWith(activatedScriptElement);
26129    }
26130  }
26131  get newScriptElements() {
26132    return this.currentElement.querySelectorAll("script");
26133  }
26134}
26135function readScrollLogicalPosition(value, defaultValue) {
26136  if (value == "end" || value == "start" || value == "center" || value == "nearest") {
26137    return value;
26138  } else {
26139    return defaultValue;
26140  }
26141}
26142function readScrollBehavior(value, defaultValue) {
26143  if (value == "auto" || value == "smooth") {
26144    return value;
26145  } else {
26146    return defaultValue;
26147  }
26148}
26149var Idiomorph = function() {
26150  const noOp = () => {};
26151  const defaults = {
26152    morphStyle: "outerHTML",
26153    callbacks: {
26154      beforeNodeAdded: noOp,
26155      afterNodeAdded: noOp,
26156      beforeNodeMorphed: noOp,
26157      afterNodeMorphed: noOp,
26158      beforeNodeRemoved: noOp,
26159      afterNodeRemoved: noOp,
26160      beforeAttributeUpdated: noOp
26161    },
26162    head: {
26163      style: "merge",
26164      shouldPreserve: (elt) => elt.getAttribute("im-preserve") === "true",
26165      shouldReAppend: (elt) => elt.getAttribute("im-re-append") === "true",
26166      shouldRemove: noOp,
26167      afterHeadMorphed: noOp
26168    },
26169    restoreFocus: true
26170  };
26171  function morph(oldNode, newContent, config2 = {}) {
26172    oldNode = normalizeElement(oldNode);
26173    const newNode = normalizeParent(newContent);
26174    const ctx = createMorphContext(oldNode, newNode, config2);
26175    const morphedNodes = saveAndRestoreFocus(ctx, () => {
26176      return withHeadBlocking(ctx, oldNode, newNode, (ctx) => {
26177        if (ctx.morphStyle === "innerHTML") {
26178          morphChildren2(ctx, oldNode, newNode);
26179          return Array.from(oldNode.childNodes);
26180        } else {
26181          return morphOuterHTML(ctx, oldNode, newNode);
26182        }
26183      });
26184    });
26185    ctx.pantry.remove();
26186    return morphedNodes;
26187  }
26188  function morphOuterHTML(ctx, oldNode, newNode) {
26189    const oldParent = normalizeParent(oldNode);
26190    morphChildren2(ctx, oldParent, newNode, oldNode, oldNode.nextSibling);
26191    return Array.from(oldParent.childNodes);
26192  }
26193  function saveAndRestoreFocus(ctx, fn2) {
26194    if (!ctx.config.restoreFocus)
26195      return fn2();
26196    let activeElement = document.activeElement;
26197    if (!(activeElement instanceof HTMLInputElement || activeElement instanceof HTMLTextAreaElement)) {
26198      return fn2();
26199    }
26200    const { id: activeElementId, selectionStart, selectionEnd } = activeElement;
26201    const results = fn2();
26202    if (activeElementId && activeElementId !== document.activeElement?.getAttribute("id")) {
26203      activeElement = ctx.target.querySelector(`[id="${activeElementId}"]`);
26204      activeElement?.focus();
26205    }
26206    if (activeElement && !activeElement.selectionEnd && selectionEnd) {
26207      activeElement.setSelectionRange(selectionStart, selectionEnd);
26208    }
26209    return results;
26210  }
26211  const morphChildren2 = function() {
26212    function morphChildren2(ctx, oldParent, newParent, insertionPoint = null, endPoint = null) {
26213      if (oldParent instanceof HTMLTemplateElement && newParent instanceof HTMLTemplateElement) {
26214        oldParent = oldParent.content;
26215        newParent = newParent.content;
26216      }
26217      insertionPoint ||= oldParent.firstChild;
26218      for (const newChild of newParent.childNodes) {
26219        if (insertionPoint && insertionPoint != endPoint) {
26220          const bestMatch = findBestMatch(ctx, newChild, insertionPoint, endPoint);
26221          if (bestMatch) {
26222            if (bestMatch !== insertionPoint) {
26223              removeNodesBetween(ctx, insertionPoint, bestMatch);
26224            }
26225            morphNode(bestMatch, newChild, ctx);
26226            insertionPoint = bestMatch.nextSibling;
26227            continue;
26228          }
26229        }
26230        if (newChild instanceof Element) {
26231          const newChildId = newChild.getAttribute("id");
26232          if (ctx.persistentIds.has(newChildId)) {
26233            const movedChild = moveBeforeById(oldParent, newChildId, insertionPoint, ctx);
26234            morphNode(movedChild, newChild, ctx);
26235            insertionPoint = movedChild.nextSibling;
26236            continue;
26237          }
26238        }
26239        const insertedNode = createNode(oldParent, newChild, insertionPoint, ctx);
26240        if (insertedNode) {
26241          insertionPoint = insertedNode.nextSibling;
26242        }
26243      }
26244      while (insertionPoint && insertionPoint != endPoint) {
26245        const tempNode = insertionPoint;
26246        insertionPoint = insertionPoint.nextSibling;
26247        removeNode(ctx, tempNode);
26248      }
26249    }
26250    function createNode(oldParent, newChild, insertionPoint, ctx) {
26251      if (ctx.callbacks.beforeNodeAdded(newChild) === false)
26252        return null;
26253      if (ctx.idMap.has(newChild)) {
26254        const newEmptyChild = document.createElement(newChild.tagName);
26255        oldParent.insertBefore(newEmptyChild, insertionPoint);
26256        morphNode(newEmptyChild, newChild, ctx);
26257        ctx.callbacks.afterNodeAdded(newEmptyChild);
26258        return newEmptyChild;
26259      } else {
26260        const newClonedChild = document.importNode(newChild, true);
26261        oldParent.insertBefore(newClonedChild, insertionPoint);
26262        ctx.callbacks.afterNodeAdded(newClonedChild);
26263        return newClonedChild;
26264      }
26265    }
26266    const findBestMatch = function() {
26267      function findBestMatch(ctx, node, startPoint, endPoint) {
26268        let softMatch = null;
26269        let nextSibling = node.nextSibling;
26270        let siblingSoftMatchCount = 0;
26271        let cursor = startPoint;
26272        while (cursor && cursor != endPoint) {
26273          if (isSoftMatch(cursor, node)) {
26274            if (isIdSetMatch(ctx, cursor, node)) {
26275              return cursor;
26276            }
26277            if (softMatch === null) {
26278              if (!ctx.idMap.has(cursor)) {
26279                softMatch = cursor;
26280              }
26281            }
26282          }
26283          if (softMatch === null && nextSibling && isSoftMatch(cursor, nextSibling)) {
26284            siblingSoftMatchCount++;
26285            nextSibling = nextSibling.nextSibling;
26286            if (siblingSoftMatchCount >= 2) {
26287              softMatch = undefined;
26288            }
26289          }
26290          if (ctx.activeElementAndParents.includes(cursor))
26291            break;
26292          cursor = cursor.nextSibling;
26293        }
26294        return softMatch || null;
26295      }
26296      function isIdSetMatch(ctx, oldNode, newNode) {
26297        let oldSet = ctx.idMap.get(oldNode);
26298        let newSet = ctx.idMap.get(newNode);
26299        if (!newSet || !oldSet)
26300          return false;
26301        for (const id of oldSet) {
26302          if (newSet.has(id)) {
26303            return true;
26304          }
26305        }
26306        return false;
26307      }
26308      function isSoftMatch(oldNode, newNode) {
26309        const oldElt = oldNode;
26310        const newElt = newNode;
26311        return oldElt.nodeType === newElt.nodeType && oldElt.tagName === newElt.tagName && (!oldElt.getAttribute?.("id") || oldElt.getAttribute?.("id") === newElt.getAttribute?.("id"));
26312      }
26313      return findBestMatch;
26314    }();
26315    function removeNode(ctx, node) {
26316      if (ctx.idMap.has(node)) {
26317        moveBefore(ctx.pantry, node, null);
26318      } else {
26319        if (ctx.callbacks.beforeNodeRemoved(node) === false)
26320          return;
26321        node.parentNode?.removeChild(node);
26322        ctx.callbacks.afterNodeRemoved(node);
26323      }
26324    }
26325    function removeNodesBetween(ctx, startInclusive, endExclusive) {
26326      let cursor = startInclusive;
26327      while (cursor && cursor !== endExclusive) {
26328        let tempNode = cursor;
26329        cursor = cursor.nextSibling;
26330        removeNode(ctx, tempNode);
26331      }
26332      return cursor;
26333    }
26334    function moveBeforeById(parentNode, id, after, ctx) {
26335      const target = ctx.target.getAttribute?.("id") === id && ctx.target || ctx.target.querySelector(`[id="${id}"]`) || ctx.pantry.querySelector(`[id="${id}"]`);
26336      removeElementFromAncestorsIdMaps(target, ctx);
26337      moveBefore(parentNode, target, after);
26338      return target;
26339    }
26340    function removeElementFromAncestorsIdMaps(element, ctx) {
26341      const id = element.getAttribute("id");
26342      while (element = element.parentNode) {
26343        let idSet = ctx.idMap.get(element);
26344        if (idSet) {
26345          idSet.delete(id);
26346          if (!idSet.size) {
26347            ctx.idMap.delete(element);
26348          }
26349        }
26350      }
26351    }
26352    function moveBefore(parentNode, element, after) {
26353      if (parentNode.moveBefore) {
26354        try {
26355          parentNode.moveBefore(element, after);
26356        } catch (e) {
26357          parentNode.insertBefore(element, after);
26358        }
26359      } else {
26360        parentNode.insertBefore(element, after);
26361      }
26362    }
26363    return morphChildren2;
26364  }();
26365  const morphNode = function() {
26366    function morphNode(oldNode, newContent, ctx) {
26367      if (ctx.ignoreActive && oldNode === document.activeElement) {
26368        return null;
26369      }
26370      if (ctx.callbacks.beforeNodeMorphed(oldNode, newContent) === false) {
26371        return oldNode;
26372      }
26373      if (oldNode instanceof HTMLHeadElement && ctx.head.ignore)
26374        ;
26375      else if (oldNode instanceof HTMLHeadElement && ctx.head.style !== "morph") {
26376        handleHeadElement(oldNode, newContent, ctx);
26377      } else {
26378        morphAttributes(oldNode, newContent, ctx);
26379        if (!ignoreValueOfActiveElement(oldNode, ctx)) {
26380          morphChildren2(ctx, oldNode, newContent);
26381        }
26382      }
26383      ctx.callbacks.afterNodeMorphed(oldNode, newContent);
26384      return oldNode;
26385    }
26386    function morphAttributes(oldNode, newNode, ctx) {
26387      let type = newNode.nodeType;
26388      if (type === 1) {
26389        const oldElt = oldNode;
26390        const newElt = newNode;
26391        const oldAttributes = oldElt.attributes;
26392        const newAttributes = newElt.attributes;
26393        for (const newAttribute of newAttributes) {
26394          if (ignoreAttribute(newAttribute.name, oldElt, "update", ctx)) {
26395            continue;
26396          }
26397          if (oldElt.getAttribute(newAttribute.name) !== newAttribute.value) {
26398            oldElt.setAttribute(newAttribute.name, newAttribute.value);
26399          }
26400        }
26401        for (let i = oldAttributes.length - 1;0 <= i; i--) {
26402          const oldAttribute = oldAttributes[i];
26403          if (!oldAttribute)
26404            continue;
26405          if (!newElt.hasAttribute(oldAttribute.name)) {
26406            if (ignoreAttribute(oldAttribute.name, oldElt, "remove", ctx)) {
26407              continue;
26408            }
26409            oldElt.removeAttribute(oldAttribute.name);
26410          }
26411        }
26412        if (!ignoreValueOfActiveElement(oldElt, ctx)) {
26413          syncInputValue(oldElt, newElt, ctx);
26414        }
26415      }
26416      if (type === 8 || type === 3) {
26417        if (oldNode.nodeValue !== newNode.nodeValue) {
26418          oldNode.nodeValue = newNode.nodeValue;
26419        }
26420      }
26421    }
26422    function syncInputValue(oldElement, newElement, ctx) {
26423      if (oldElement instanceof HTMLInputElement && newElement instanceof HTMLInputElement && newElement.type !== "file") {
26424        let newValue = newElement.value;
26425        let oldValue = oldElement.value;
26426        syncBooleanAttribute(oldElement, newElement, "checked", ctx);
26427        syncBooleanAttribute(oldElement, newElement, "disabled", ctx);
26428        if (!newElement.hasAttribute("value")) {
26429          if (!ignoreAttribute("value", oldElement, "remove", ctx)) {
26430            oldElement.value = "";
26431            oldElement.removeAttribute("value");
26432          }
26433        } else if (oldValue !== newValue) {
26434          if (!ignoreAttribute("value", oldElement, "update", ctx)) {
26435            oldElement.setAttribute("value", newValue);
26436            oldElement.value = newValue;
26437          }
26438        }
26439      } else if (oldElement instanceof HTMLOptionElement && newElement instanceof HTMLOptionElement) {
26440        syncBooleanAttribute(oldElement, newElement, "selected", ctx);
26441      } else if (oldElement instanceof HTMLTextAreaElement && newElement instanceof HTMLTextAreaElement) {
26442        let newValue = newElement.value;
26443        let oldValue = oldElement.value;
26444        if (ignoreAttribute("value", oldElement, "update", ctx)) {
26445          return;
26446        }
26447        if (newValue !== oldValue) {
26448          oldElement.value = newValue;
26449        }
26450        if (oldElement.firstChild && oldElement.firstChild.nodeValue !== newValue) {
26451          oldElement.firstChild.nodeValue = newValue;
26452        }
26453      }
26454    }
26455    function syncBooleanAttribute(oldElement, newElement, attributeName, ctx) {
26456      const newLiveValue = newElement[attributeName], oldLiveValue = oldElement[attributeName];
26457      if (newLiveValue !== oldLiveValue) {
26458        const ignoreUpdate = ignoreAttribute(attributeName, oldElement, "update", ctx);
26459        if (!ignoreUpdate) {
26460          oldElement[attributeName] = newElement[attributeName];
26461        }
26462        if (newLiveValue) {
26463          if (!ignoreUpdate) {
26464            oldElement.setAttribute(attributeName, "");
26465          }
26466        } else {
26467          if (!ignoreAttribute(attributeName, oldElement, "remove", ctx)) {
26468            oldElement.removeAttribute(attributeName);
26469          }
26470        }
26471      }
26472    }
26473    function ignoreAttribute(attr, element, updateType, ctx) {
26474      if (attr === "value" && ctx.ignoreActiveValue && element === document.activeElement) {
26475        return true;
26476      }
26477      return ctx.callbacks.beforeAttributeUpdated(attr, element, updateType) === false;
26478    }
26479    function ignoreValueOfActiveElement(possibleActiveElement, ctx) {
26480      return !!ctx.ignoreActiveValue && possibleActiveElement === document.activeElement && possibleActiveElement !== document.body;
26481    }
26482    return morphNode;
26483  }();
26484  function withHeadBlocking(ctx, oldNode, newNode, callback) {
26485    if (ctx.head.block) {
26486      const oldHead = oldNode.querySelector("head");
26487      const newHead = newNode.querySelector("head");
26488      if (oldHead && newHead) {
26489        const promises = handleHeadElement(oldHead, newHead, ctx);
26490        return Promise.all(promises).then(() => {
26491          const newCtx = Object.assign(ctx, {
26492            head: {
26493              block: false,
26494              ignore: true
26495            }
26496          });
26497          return callback(newCtx);
26498        });
26499      }
26500    }
26501    return callback(ctx);
26502  }
26503  function handleHeadElement(oldHead, newHead, ctx) {
26504    let added = [];
26505    let removed = [];
26506    let preserved = [];
26507    let nodesToAppend = [];
26508    let srcToNewHeadNodes = new Map;
26509    for (const newHeadChild of newHead.children) {
26510      srcToNewHeadNodes.set(newHeadChild.outerHTML, newHeadChild);
26511    }
26512    for (const currentHeadElt of oldHead.children) {
26513      let inNewContent = srcToNewHeadNodes.has(currentHeadElt.outerHTML);
26514      let isReAppended = ctx.head.shouldReAppend(currentHeadElt);
26515      let isPreserved = ctx.head.shouldPreserve(currentHeadElt);
26516      if (inNewContent || isPreserved) {
26517        if (isReAppended) {
26518          removed.push(currentHeadElt);
26519        } else {
26520          srcToNewHeadNodes.delete(currentHeadElt.outerHTML);
26521          preserved.push(currentHeadElt);
26522        }
26523      } else {
26524        if (ctx.head.style === "append") {
26525          if (isReAppended) {
26526            removed.push(currentHeadElt);
26527            nodesToAppend.push(currentHeadElt);
26528          }
26529        } else {
26530          if (ctx.head.shouldRemove(currentHeadElt) !== false) {
26531            removed.push(currentHeadElt);
26532          }
26533        }
26534      }
26535    }
26536    nodesToAppend.push(...srcToNewHeadNodes.values());
26537    let promises = [];
26538    for (const newNode of nodesToAppend) {
26539      let newElt = document.createRange().createContextualFragment(newNode.outerHTML).firstChild;
26540      if (ctx.callbacks.beforeNodeAdded(newElt) !== false) {
26541        if ("href" in newElt && newElt.href || "src" in newElt && newElt.src) {
26542          let resolve;
26543          let promise = new Promise(function(_resolve) {
26544            resolve = _resolve;
26545          });
26546          newElt.addEventListener("load", function() {
26547            resolve();
26548          });
26549          promises.push(promise);
26550        }
26551        oldHead.appendChild(newElt);
26552        ctx.callbacks.afterNodeAdded(newElt);
26553        added.push(newElt);
26554      }
26555    }
26556    for (const removedElement of removed) {
26557      if (ctx.callbacks.beforeNodeRemoved(removedElement) !== false) {
26558        oldHead.removeChild(removedElement);
26559        ctx.callbacks.afterNodeRemoved(removedElement);
26560      }
26561    }
26562    ctx.head.afterHeadMorphed(oldHead, {
26563      added,
26564      kept: preserved,
26565      removed
26566    });
26567    return promises;
26568  }
26569  const createMorphContext = function() {
26570    function createMorphContext(oldNode, newContent, config2) {
26571      const { persistentIds, idMap } = createIdMaps(oldNode, newContent);
26572      const mergedConfig = mergeDefaults(config2);
26573      const morphStyle = mergedConfig.morphStyle || "outerHTML";
26574      if (!["innerHTML", "outerHTML"].includes(morphStyle)) {
26575        throw `Do not understand how to morph style ${morphStyle}`;
26576      }
26577      return {
26578        target: oldNode,
26579        newContent,
26580        config: mergedConfig,
26581        morphStyle,
26582        ignoreActive: mergedConfig.ignoreActive,
26583        ignoreActiveValue: mergedConfig.ignoreActiveValue,
26584        restoreFocus: mergedConfig.restoreFocus,
26585        idMap,
26586        persistentIds,
26587        pantry: createPantry(),
26588        activeElementAndParents: createActiveElementAndParents(oldNode),
26589        callbacks: mergedConfig.callbacks,
26590        head: mergedConfig.head
26591      };
26592    }
26593    function mergeDefaults(config2) {
26594      let finalConfig = Object.assign({}, defaults);
26595      Object.assign(finalConfig, config2);
26596      finalConfig.callbacks = Object.assign({}, defaults.callbacks, config2.callbacks);
26597      finalConfig.head = Object.assign({}, defaults.head, config2.head);
26598      return finalConfig;
26599    }
26600    function createPantry() {
26601      const pantry = document.createElement("div");
26602      pantry.hidden = true;
26603      document.body.insertAdjacentElement("afterend", pantry);
26604      return pantry;
26605    }
26606    function createActiveElementAndParents(oldNode) {
26607      let activeElementAndParents = [];
26608      let elt = document.activeElement;
26609      if (elt?.tagName !== "BODY" && oldNode.contains(elt)) {
26610        while (elt) {
26611          activeElementAndParents.push(elt);
26612          if (elt === oldNode)
26613            break;
26614          elt = elt.parentElement;
26615        }
26616      }
26617      return activeElementAndParents;
26618    }
26619    function findIdElements(root2) {
26620      let elements = Array.from(root2.querySelectorAll("[id]"));
26621      if (root2.getAttribute?.("id")) {
26622        elements.push(root2);
26623      }
26624      return elements;
26625    }
26626    function populateIdMapWithTree(idMap, persistentIds, root2, elements) {
26627      for (const elt of elements) {
26628        const id = elt.getAttribute("id");
26629        if (persistentIds.has(id)) {
26630          let current = elt;
26631          while (current) {
26632            let idSet = idMap.get(current);
26633            if (idSet == null) {
26634              idSet = new Set;
26635              idMap.set(current, idSet);
26636            }
26637            idSet.add(id);
26638            if (current === root2)
26639              break;
26640            current = current.parentElement;
26641          }
26642        }
26643      }
26644    }
26645    function createIdMaps(oldContent, newContent) {
26646      const oldIdElements = findIdElements(oldContent);
26647      const newIdElements = findIdElements(newContent);
26648      const persistentIds = createPersistentIds(oldIdElements, newIdElements);
26649      let idMap = new Map;
26650      populateIdMapWithTree(idMap, persistentIds, oldContent, oldIdElements);
26651      const newRoot = newContent.__idiomorphRoot || newContent;
26652      populateIdMapWithTree(idMap, persistentIds, newRoot, newIdElements);
26653      return { persistentIds, idMap };
26654    }
26655    function createPersistentIds(oldIdElements, newIdElements) {
26656      let duplicateIds = new Set;
26657      let oldIdTagNameMap = new Map;
26658      for (const { id, tagName } of oldIdElements) {
26659        if (oldIdTagNameMap.has(id)) {
26660          duplicateIds.add(id);
26661        } else {
26662          oldIdTagNameMap.set(id, tagName);
26663        }
26664      }
26665      let persistentIds = new Set;
26666      for (const { id, tagName } of newIdElements) {
26667        if (persistentIds.has(id)) {
26668          duplicateIds.add(id);
26669        } else if (oldIdTagNameMap.get(id) === tagName) {
26670          persistentIds.add(id);
26671        }
26672      }
26673      for (const id of duplicateIds) {
26674        persistentIds.delete(id);
26675      }
26676      return persistentIds;
26677    }
26678    return createMorphContext;
26679  }();
26680  const { normalizeElement, normalizeParent } = function() {
26681    const generatedByIdiomorph = new WeakSet;
26682    function normalizeElement(content) {
26683      if (content instanceof Document) {
26684        return content.documentElement;
26685      } else {
26686        return content;
26687      }
26688    }
26689    function normalizeParent(newContent) {
26690      if (newContent == null) {
26691        return document.createElement("div");
26692      } else if (typeof newContent === "string") {
26693        return normalizeParent(parseContent(newContent));
26694      } else if (generatedByIdiomorph.has(newContent)) {
26695        return newContent;
26696      } else if (newContent instanceof Node) {
26697        if (newContent.parentNode) {
26698          return new SlicedParentNode(newContent);
26699        } else {
26700          const dummyParent = document.createElement("div");
26701          dummyParent.append(newContent);
26702          return dummyParent;
26703        }
26704      } else {
26705        const dummyParent = document.createElement("div");
26706        for (const elt of [...newContent]) {
26707          dummyParent.append(elt);
26708        }
26709        return dummyParent;
26710      }
26711    }
26712
26713    class SlicedParentNode {
26714      constructor(node) {
26715        this.originalNode = node;
26716        this.realParentNode = node.parentNode;
26717        this.previousSibling = node.previousSibling;
26718        this.nextSibling = node.nextSibling;
26719      }
26720      get childNodes() {
26721        const nodes = [];
26722        let cursor = this.previousSibling ? this.previousSibling.nextSibling : this.realParentNode.firstChild;
26723        while (cursor && cursor != this.nextSibling) {
26724          nodes.push(cursor);
26725          cursor = cursor.nextSibling;
26726        }
26727        return nodes;
26728      }
26729      querySelectorAll(selector) {
26730        return this.childNodes.reduce((results, node) => {
26731          if (node instanceof Element) {
26732            if (node.matches(selector))
26733              results.push(node);
26734            const nodeList = node.querySelectorAll(selector);
26735            for (let i = 0;i < nodeList.length; i++) {
26736              results.push(nodeList[i]);
26737            }
26738          }
26739          return results;
26740        }, []);
26741      }
26742      insertBefore(node, referenceNode) {
26743        return this.realParentNode.insertBefore(node, referenceNode);
26744      }
26745      moveBefore(node, referenceNode) {
26746        return this.realParentNode.moveBefore(node, referenceNode);
26747      }
26748      get __idiomorphRoot() {
26749        return this.originalNode;
26750      }
26751    }
26752    function parseContent(newContent) {
26753      let parser = new DOMParser;
26754      let contentWithSvgsRemoved = newContent.replace(/<svg(\s[^>]*>|>)([\s\S]*?)<\/svg>/gim, "");
26755      if (contentWithSvgsRemoved.match(/<\/html>/) || contentWithSvgsRemoved.match(/<\/head>/) || contentWithSvgsRemoved.match(/<\/body>/)) {
26756        let content = parser.parseFromString(newContent, "text/html");
26757        if (contentWithSvgsRemoved.match(/<\/html>/)) {
26758          generatedByIdiomorph.add(content);
26759          return content;
26760        } else {
26761          let htmlElement = content.firstChild;
26762          if (htmlElement) {
26763            generatedByIdiomorph.add(htmlElement);
26764          }
26765          return htmlElement;
26766        }
26767      } else {
26768        let responseDoc = parser.parseFromString("<body><template>" + newContent + "</template></body>", "text/html");
26769        let content = responseDoc.body.querySelector("template").content;
26770        generatedByIdiomorph.add(content);
26771        return content;
26772      }
26773    }
26774    return { normalizeElement, normalizeParent };
26775  }();
26776  return {
26777    morph,
26778    defaults
26779  };
26780}();
26781function morphElements(currentElement, newElement, { callbacks, ...options2 } = {}) {
26782  Idiomorph.morph(currentElement, newElement, {
26783    ...options2,
26784    callbacks: new DefaultIdiomorphCallbacks(callbacks)
26785  });
26786}
26787function morphChildren(currentElement, newElement, options2 = {}) {
26788  morphElements(currentElement, newElement.childNodes, {
26789    ...options2,
26790    morphStyle: "innerHTML"
26791  });
26792}
26793function shouldRefreshFrameWithMorphing(currentFrame, newFrame) {
26794  return currentFrame instanceof FrameElement && currentFrame.shouldReloadWithMorph && (!newFrame || areFramesCompatibleForRefreshing(currentFrame, newFrame)) && !currentFrame.closest("[data-turbo-permanent]");
26795}
26796function areFramesCompatibleForRefreshing(currentFrame, newFrame) {
26797  return newFrame instanceof Element && newFrame.nodeName === "TURBO-FRAME" && currentFrame.id === newFrame.id && (!newFrame.getAttribute("src") || urlsAreEqual(currentFrame.src, newFrame.getAttribute("src")));
26798}
26799function closestFrameReloadableWithMorphing(node) {
26800  return node.parentElement.closest("turbo-frame[src][refresh=morph]");
26801}
26802
26803class DefaultIdiomorphCallbacks {
26804  #beforeNodeMorphed;
26805  constructor({ beforeNodeMorphed } = {}) {
26806    this.#beforeNodeMorphed = beforeNodeMorphed || (() => true);
26807  }
26808  beforeNodeAdded = (node) => {
26809    return !(node.id && node.hasAttribute("data-turbo-permanent") && document.getElementById(node.id));
26810  };
26811  beforeNodeMorphed = (currentElement, newElement) => {
26812    if (currentElement instanceof Element) {
26813      if (!currentElement.hasAttribute("data-turbo-permanent") && this.#beforeNodeMorphed(currentElement, newElement)) {
26814        const event = dispatch("turbo:before-morph-element", {
26815          cancelable: true,
26816          target: currentElement,
26817          detail: { currentElement, newElement }
26818        });
26819        return !event.defaultPrevented;
26820      } else {
26821        return false;
26822      }
26823    }
26824  };
26825  beforeAttributeUpdated = (attributeName, target, mutationType) => {
26826    const event = dispatch("turbo:before-morph-attribute", {
26827      cancelable: true,
26828      target,
26829      detail: { attributeName, mutationType }
26830    });
26831    return !event.defaultPrevented;
26832  };
26833  beforeNodeRemoved = (node) => {
26834    return this.beforeNodeMorphed(node);
26835  };
26836  afterNodeMorphed = (currentElement, newElement) => {
26837    if (currentElement instanceof Element) {
26838      dispatch("turbo:morph-element", {
26839        target: currentElement,
26840        detail: { currentElement, newElement }
26841      });
26842    }
26843  };
26844}
26845
26846class MorphingFrameRenderer extends FrameRenderer {
26847  static renderElement(currentElement, newElement) {
26848    dispatch("turbo:before-frame-morph", {
26849      target: currentElement,
26850      detail: { currentElement, newElement }
26851    });
26852    morphChildren(currentElement, newElement, {
26853      callbacks: {
26854        beforeNodeMorphed: (node, newNode) => {
26855          if (shouldRefreshFrameWithMorphing(node, newNode) && closestFrameReloadableWithMorphing(node) === currentElement) {
26856            node.reload();
26857            return false;
26858          }
26859          return true;
26860        }
26861      }
26862    });
26863  }
26864  async preservingPermanentElements(callback) {
26865    return await callback();
26866  }
26867}
26868
26869class ProgressBar {
26870  static animationDuration = 300;
26871  static get defaultCSS() {
26872    return unindent`
26873      .turbo-progress-bar {
26874        position: fixed;
26875        display: block;
26876        top: 0;
26877        left: 0;
26878        height: 3px;
26879        background: #0076ff;
26880        z-index: 2147483647;
26881        transition:
26882          width ${ProgressBar.animationDuration}ms ease-out,
26883          opacity ${ProgressBar.animationDuration / 2}ms ${ProgressBar.animationDuration / 2}ms ease-in;
26884        transform: translate3d(0, 0, 0);
26885      }
26886    `;
26887  }
26888  hiding = false;
26889  value = 0;
26890  visible = false;
26891  constructor() {
26892    this.stylesheetElement = this.createStylesheetElement();
26893    this.progressElement = this.createProgressElement();
26894    this.installStylesheetElement();
26895    this.setValue(0);
26896  }
26897  show() {
26898    if (!this.visible) {
26899      this.visible = true;
26900      this.installProgressElement();
26901      this.startTrickling();
26902    }
26903  }
26904  hide() {
26905    if (this.visible && !this.hiding) {
26906      this.hiding = true;
26907      this.fadeProgressElement(() => {
26908        this.uninstallProgressElement();
26909        this.stopTrickling();
26910        this.visible = false;
26911        this.hiding = false;
26912      });
26913    }
26914  }
26915  setValue(value) {
26916    this.value = value;
26917    this.refresh();
26918  }
26919  installStylesheetElement() {
26920    document.head.insertBefore(this.stylesheetElement, document.head.firstChild);
26921  }
26922  installProgressElement() {
26923    this.progressElement.style.width = "0";
26924    this.progressElement.style.opacity = "1";
26925    document.documentElement.insertBefore(this.progressElement, document.body);
26926    this.refresh();
26927  }
26928  fadeProgressElement(callback) {
26929    this.progressElement.style.opacity = "0";
26930    setTimeout(callback, ProgressBar.animationDuration * 1.5);
26931  }
26932  uninstallProgressElement() {
26933    if (this.progressElement.parentNode) {
26934      document.documentElement.removeChild(this.progressElement);
26935    }
26936  }
26937  startTrickling() {
26938    if (!this.trickleInterval) {
26939      this.trickleInterval = window.setInterval(this.trickle, ProgressBar.animationDuration);
26940    }
26941  }
26942  stopTrickling() {
26943    window.clearInterval(this.trickleInterval);
26944    delete this.trickleInterval;
26945  }
26946  trickle = () => {
26947    this.setValue(this.value + Math.random() / 100);
26948  };
26949  refresh() {
26950    requestAnimationFrame(() => {
26951      this.progressElement.style.width = `${10 + this.value * 90}%`;
26952    });
26953  }
26954  createStylesheetElement() {
26955    const element = document.createElement("style");
26956    element.type = "text/css";
26957    element.textContent = ProgressBar.defaultCSS;
26958    const cspNonce = getCspNonce();
26959    if (cspNonce) {
26960      element.nonce = cspNonce;
26961    }
26962    return element;
26963  }
26964  createProgressElement() {
26965    const element = document.createElement("div");
26966    element.className = "turbo-progress-bar";
26967    return element;
26968  }
26969}
26970
26971class HeadSnapshot extends Snapshot {
26972  detailsByOuterHTML = this.children.filter((element) => !elementIsNoscript(element)).map((element) => elementWithoutNonce(element)).reduce((result, element) => {
26973    const { outerHTML } = element;
26974    const details = outerHTML in result ? result[outerHTML] : {
26975      type: elementType(element),
26976      tracked: elementIsTracked(element),
26977      elements: []
26978    };
26979    return {
26980      ...result,
26981      [outerHTML]: {
26982        ...details,
26983        elements: [...details.elements, element]
26984      }
26985    };
26986  }, {});
26987  get trackedElementSignature() {
26988    return Object.keys(this.detailsByOuterHTML).filter((outerHTML) => this.detailsByOuterHTML[outerHTML].tracked).join("");
26989  }
26990  getScriptElementsNotInSnapshot(snapshot) {
26991    return this.getElementsMatchingTypeNotInSnapshot("script", snapshot);
26992  }
26993  getStylesheetElementsNotInSnapshot(snapshot) {
26994    return this.getElementsMatchingTypeNotInSnapshot("stylesheet", snapshot);
26995  }
26996  getElementsMatchingTypeNotInSnapshot(matchedType, snapshot) {
26997    return Object.keys(this.detailsByOuterHTML).filter((outerHTML) => !(outerHTML in snapshot.detailsByOuterHTML)).map((outerHTML) => this.detailsByOuterHTML[outerHTML]).filter(({ type }) => type == matchedType).map(({ elements: [element] }) => element);
26998  }
26999  get provisionalElements() {
27000    return Object.keys(this.detailsByOuterHTML).reduce((result, outerHTML) => {
27001      const { type, tracked, elements } = this.detailsByOuterHTML[outerHTML];
27002      if (type == null && !tracked) {
27003        return [...result, ...elements];
27004      } else if (elements.length > 1) {
27005        return [...result, ...elements.slice(1)];
27006      } else {
27007        return result;
27008      }
27009    }, []);
27010  }
27011  getMetaValue(name) {
27012    const element = this.findMetaElementByName(name);
27013    return element ? element.getAttribute("content") : null;
27014  }
27015  findMetaElementByName(name) {
27016    return Object.keys(this.detailsByOuterHTML).reduce((result, outerHTML) => {
27017      const {
27018        elements: [element]
27019      } = this.detailsByOuterHTML[outerHTML];
27020      return elementIsMetaElementWithName(element, name) ? element : result;
27021    }, undefined | undefined);
27022  }
27023}
27024function elementType(element) {
27025  if (elementIsScript(element)) {
27026    return "script";
27027  } else if (elementIsStylesheet(element)) {
27028    return "stylesheet";
27029  }
27030}
27031function elementIsTracked(element) {
27032  return element.getAttribute("data-turbo-track") == "reload";
27033}
27034function elementIsScript(element) {
27035  const tagName = element.localName;
27036  return tagName == "script";
27037}
27038function elementIsNoscript(element) {
27039  const tagName = element.localName;
27040  return tagName == "noscript";
27041}
27042function elementIsStylesheet(element) {
27043  const tagName = element.localName;
27044  return tagName == "style" || tagName == "link" && element.getAttribute("rel") == "stylesheet";
27045}
27046function elementIsMetaElementWithName(element, name) {
27047  const tagName = element.localName;
27048  return tagName == "meta" && element.getAttribute("name") == name;
27049}
27050function elementWithoutNonce(element) {
27051  if (element.hasAttribute("nonce")) {
27052    element.setAttribute("nonce", "");
27053  }
27054  return element;
27055}
27056
27057class PageSnapshot extends Snapshot {
27058  static fromHTMLString(html = "") {
27059    return this.fromDocument(parseHTMLDocument(html));
27060  }
27061  static fromElement(element) {
27062    return this.fromDocument(element.ownerDocument);
27063  }
27064  static fromDocument({ documentElement, body, head }) {
27065    return new this(documentElement, body, new HeadSnapshot(head));
27066  }
27067  constructor(documentElement, body, headSnapshot) {
27068    super(body);
27069    this.documentElement = documentElement;
27070    this.headSnapshot = headSnapshot;
27071  }
27072  clone() {
27073    const clonedElement = this.element.cloneNode(true);
27074    const selectElements = this.element.querySelectorAll("select");
27075    const clonedSelectElements = clonedElement.querySelectorAll("select");
27076    for (const [index, source] of selectElements.entries()) {
27077      const clone2 = clonedSelectElements[index];
27078      for (const option of clone2.selectedOptions)
27079        option.selected = false;
27080      for (const option of source.selectedOptions)
27081        clone2.options[option.index].selected = true;
27082    }
27083    for (const clonedPasswordInput of clonedElement.querySelectorAll('input[type="password"]')) {
27084      clonedPasswordInput.value = "";
27085    }
27086    for (const clonedNoscriptElement of clonedElement.querySelectorAll("noscript")) {
27087      clonedNoscriptElement.remove();
27088    }
27089    return new PageSnapshot(this.documentElement, clonedElement, this.headSnapshot);
27090  }
27091  get lang() {
27092    return this.documentElement.getAttribute("lang");
27093  }
27094  get dir() {
27095    return this.documentElement.getAttribute("dir");
27096  }
27097  get headElement() {
27098    return this.headSnapshot.element;
27099  }
27100  get rootLocation() {
27101    const root2 = this.getSetting("root") ?? "/";
27102    return expandURL(root2);
27103  }
27104  get cacheControlValue() {
27105    return this.getSetting("cache-control");
27106  }
27107  get isPreviewable() {
27108    return this.cacheControlValue != "no-preview";
27109  }
27110  get isCacheable() {
27111    return this.cacheControlValue != "no-cache";
27112  }
27113  get isVisitable() {
27114    return this.getSetting("visit-control") != "reload";
27115  }
27116  get prefersViewTransitions() {
27117    const viewTransitionEnabled = this.getSetting("view-transition") === "true" || this.headSnapshot.getMetaValue("view-transition") === "same-origin";
27118    return viewTransitionEnabled && !window.matchMedia("(prefers-reduced-motion: reduce)").matches;
27119  }
27120  get refreshMethod() {
27121    return this.getSetting("refresh-method");
27122  }
27123  get refreshScroll() {
27124    return this.getSetting("refresh-scroll");
27125  }
27126  getSetting(name) {
27127    return this.headSnapshot.getMetaValue(`turbo-${name}`);
27128  }
27129}
27130
27131class ViewTransitioner {
27132  #viewTransitionStarted = false;
27133  #lastOperation = Promise.resolve();
27134  renderChange(useViewTransition, render) {
27135    if (useViewTransition && this.viewTransitionsAvailable && !this.#viewTransitionStarted) {
27136      this.#viewTransitionStarted = true;
27137      this.#lastOperation = this.#lastOperation.then(async () => {
27138        await document.startViewTransition(render).finished;
27139      });
27140    } else {
27141      this.#lastOperation = this.#lastOperation.then(render);
27142    }
27143    return this.#lastOperation;
27144  }
27145  get viewTransitionsAvailable() {
27146    return document.startViewTransition;
27147  }
27148}
27149var defaultOptions = {
27150  action: "advance",
27151  historyChanged: false,
27152  visitCachedSnapshot: () => {},
27153  willRender: true,
27154  updateHistory: true,
27155  shouldCacheSnapshot: true,
27156  acceptsStreamResponse: false,
27157  refresh: {}
27158};
27159var TimingMetric = {
27160  visitStart: "visitStart",
27161  requestStart: "requestStart",
27162  requestEnd: "requestEnd",
27163  visitEnd: "visitEnd"
27164};
27165var VisitState = {
27166  initialized: "initialized",
27167  started: "started",
27168  canceled: "canceled",
27169  failed: "failed",
27170  completed: "completed"
27171};
27172var SystemStatusCode = {
27173  networkFailure: 0,
27174  timeoutFailure: -1,
27175  contentTypeMismatch: -2
27176};
27177var Direction = {
27178  advance: "forward",
27179  restore: "back",
27180  replace: "none"
27181};
27182
27183class Visit {
27184  identifier = uuid();
27185  timingMetrics = {};
27186  followedRedirect = false;
27187  historyChanged = false;
27188  scrolled = false;
27189  shouldCacheSnapshot = true;
27190  acceptsStreamResponse = false;
27191  snapshotCached = false;
27192  state = VisitState.initialized;
27193  viewTransitioner = new ViewTransitioner;
27194  constructor(delegate, location2, restorationIdentifier, options2 = {}) {
27195    this.delegate = delegate;
27196    this.location = location2;
27197    this.restorationIdentifier = restorationIdentifier || uuid();
27198    const {
27199      action,
27200      historyChanged,
27201      referrer,
27202      snapshot,
27203      snapshotHTML,
27204      response,
27205      visitCachedSnapshot,
27206      willRender,
27207      updateHistory,
27208      shouldCacheSnapshot,
27209      acceptsStreamResponse,
27210      direction,
27211      refresh
27212    } = {
27213      ...defaultOptions,
27214      ...options2
27215    };
27216    this.action = action;
27217    this.historyChanged = historyChanged;
27218    this.referrer = referrer;
27219    this.snapshot = snapshot;
27220    this.snapshotHTML = snapshotHTML;
27221    this.response = response;
27222    this.isPageRefresh = this.view.isPageRefresh(this);
27223    this.visitCachedSnapshot = visitCachedSnapshot;
27224    this.willRender = willRender;
27225    this.updateHistory = updateHistory;
27226    this.scrolled = !willRender;
27227    this.shouldCacheSnapshot = shouldCacheSnapshot;
27228    this.acceptsStreamResponse = acceptsStreamResponse;
27229    this.direction = direction || Direction[action];
27230    this.refresh = refresh;
27231  }
27232  get adapter() {
27233    return this.delegate.adapter;
27234  }
27235  get view() {
27236    return this.delegate.view;
27237  }
27238  get history() {
27239    return this.delegate.history;
27240  }
27241  get restorationData() {
27242    return this.history.getRestorationDataForIdentifier(this.restorationIdentifier);
27243  }
27244  start() {
27245    if (this.state == VisitState.initialized) {
27246      this.recordTimingMetric(TimingMetric.visitStart);
27247      this.state = VisitState.started;
27248      this.adapter.visitStarted(this);
27249      this.delegate.visitStarted(this);
27250    }
27251  }
27252  cancel() {
27253    if (this.state == VisitState.started) {
27254      if (this.request) {
27255        this.request.cancel();
27256      }
27257      this.cancelRender();
27258      this.state = VisitState.canceled;
27259    }
27260  }
27261  complete() {
27262    if (this.state == VisitState.started) {
27263      this.recordTimingMetric(TimingMetric.visitEnd);
27264      this.adapter.visitCompleted(this);
27265      this.state = VisitState.completed;
27266      this.followRedirect();
27267      if (!this.followedRedirect) {
27268        this.delegate.visitCompleted(this);
27269      }
27270    }
27271  }
27272  fail() {
27273    if (this.state == VisitState.started) {
27274      this.state = VisitState.failed;
27275      this.adapter.visitFailed(this);
27276      this.delegate.visitCompleted(this);
27277    }
27278  }
27279  changeHistory() {
27280    if (!this.historyChanged && this.updateHistory) {
27281      const actionForHistory = this.location.href === this.referrer?.href ? "replace" : this.action;
27282      const method = getHistoryMethodForAction(actionForHistory);
27283      this.history.update(method, this.location, this.restorationIdentifier);
27284      this.historyChanged = true;
27285    }
27286  }
27287  issueRequest() {
27288    if (this.hasPreloadedResponse()) {
27289      this.simulateRequest();
27290    } else if (this.shouldIssueRequest() && !this.request) {
27291      this.request = new FetchRequest(this, FetchMethod.get, this.location);
27292      this.request.perform();
27293    }
27294  }
27295  simulateRequest() {
27296    if (this.response) {
27297      this.startRequest();
27298      this.recordResponse();
27299      this.finishRequest();
27300    }
27301  }
27302  startRequest() {
27303    this.recordTimingMetric(TimingMetric.requestStart);
27304    this.adapter.visitRequestStarted(this);
27305  }
27306  recordResponse(response = this.response) {
27307    this.response = response;
27308    if (response) {
27309      const { statusCode } = response;
27310      if (isSuccessful(statusCode)) {
27311        this.adapter.visitRequestCompleted(this);
27312      } else {
27313        this.adapter.visitRequestFailedWithStatusCode(this, statusCode);
27314      }
27315    }
27316  }
27317  finishRequest() {
27318    this.recordTimingMetric(TimingMetric.requestEnd);
27319    this.adapter.visitRequestFinished(this);
27320  }
27321  loadResponse() {
27322    if (this.response) {
27323      const { statusCode, responseHTML } = this.response;
27324      this.render(async () => {
27325        if (this.shouldCacheSnapshot)
27326          this.cacheSnapshot();
27327        if (this.view.renderPromise)
27328          await this.view.renderPromise;
27329        if (isSuccessful(statusCode) && responseHTML != null) {
27330          const snapshot = PageSnapshot.fromHTMLString(responseHTML);
27331          await this.renderPageSnapshot(snapshot, false);
27332          this.adapter.visitRendered(this);
27333          this.complete();
27334        } else {
27335          await this.view.renderError(PageSnapshot.fromHTMLString(responseHTML), this);
27336          this.adapter.visitRendered(this);
27337          this.fail();
27338        }
27339      });
27340    }
27341  }
27342  getCachedSnapshot() {
27343    const snapshot = this.view.getCachedSnapshotForLocation(this.location) || this.getPreloadedSnapshot();
27344    if (snapshot && (!getAnchor(this.location) || snapshot.hasAnchor(getAnchor(this.location)))) {
27345      if (this.action == "restore" || snapshot.isPreviewable) {
27346        return snapshot;
27347      }
27348    }
27349  }
27350  getPreloadedSnapshot() {
27351    if (this.snapshotHTML) {
27352      return PageSnapshot.fromHTMLString(this.snapshotHTML);
27353    }
27354  }
27355  hasCachedSnapshot() {
27356    return this.getCachedSnapshot() != null;
27357  }
27358  loadCachedSnapshot() {
27359    const snapshot = this.getCachedSnapshot();
27360    if (snapshot) {
27361      const isPreview = this.shouldIssueRequest();
27362      this.render(async () => {
27363        this.cacheSnapshot();
27364        if (this.isPageRefresh) {
27365          this.adapter.visitRendered(this);
27366        } else {
27367          if (this.view.renderPromise)
27368            await this.view.renderPromise;
27369          await this.renderPageSnapshot(snapshot, isPreview);
27370          this.adapter.visitRendered(this);
27371          if (!isPreview) {
27372            this.complete();
27373          }
27374        }
27375      });
27376    }
27377  }
27378  followRedirect() {
27379    if (this.redirectedToLocation && !this.followedRedirect && this.response?.redirected) {
27380      this.adapter.visitProposedToLocation(this.redirectedToLocation, {
27381        action: "replace",
27382        response: this.response,
27383        shouldCacheSnapshot: false,
27384        willRender: false
27385      });
27386      this.followedRedirect = true;
27387    }
27388  }
27389  prepareRequest(request) {
27390    if (this.acceptsStreamResponse) {
27391      request.acceptResponseType(StreamMessage.contentType);
27392    }
27393  }
27394  requestStarted() {
27395    this.startRequest();
27396  }
27397  requestPreventedHandlingResponse(_request, _response) {}
27398  async requestSucceededWithResponse(request, response) {
27399    const responseHTML = await response.responseHTML;
27400    const { redirected, statusCode } = response;
27401    if (responseHTML == undefined) {
27402      this.recordResponse({
27403        statusCode: SystemStatusCode.contentTypeMismatch,
27404        redirected
27405      });
27406    } else {
27407      this.redirectedToLocation = response.redirected ? response.location : undefined;
27408      this.recordResponse({ statusCode, responseHTML, redirected });
27409    }
27410  }
27411  async requestFailedWithResponse(request, response) {
27412    const responseHTML = await response.responseHTML;
27413    const { redirected, statusCode } = response;
27414    if (responseHTML == undefined) {
27415      this.recordResponse({
27416        statusCode: SystemStatusCode.contentTypeMismatch,
27417        redirected
27418      });
27419    } else {
27420      this.recordResponse({ statusCode, responseHTML, redirected });
27421    }
27422  }
27423  requestErrored(_request, _error) {
27424    this.recordResponse({
27425      statusCode: SystemStatusCode.networkFailure,
27426      redirected: false
27427    });
27428  }
27429  requestFinished() {
27430    this.finishRequest();
27431  }
27432  performScroll() {
27433    if (!this.scrolled && !this.view.forceReloaded && !this.view.shouldPreserveScrollPosition(this)) {
27434      if (this.action == "restore") {
27435        this.scrollToRestoredPosition() || this.scrollToAnchor() || this.view.scrollToTop();
27436      } else {
27437        this.scrollToAnchor() || this.view.scrollToTop();
27438      }
27439      this.scrolled = true;
27440    }
27441  }
27442  scrollToRestoredPosition() {
27443    const { scrollPosition } = this.restorationData;
27444    if (scrollPosition) {
27445      this.view.scrollToPosition(scrollPosition);
27446      return true;
27447    }
27448  }
27449  scrollToAnchor() {
27450    const anchor = getAnchor(this.location);
27451    if (anchor != null) {
27452      this.view.scrollToAnchor(anchor);
27453      return true;
27454    }
27455  }
27456  recordTimingMetric(metric) {
27457    this.timingMetrics[metric] = new Date().getTime();
27458  }
27459  getTimingMetrics() {
27460    return { ...this.timingMetrics };
27461  }
27462  hasPreloadedResponse() {
27463    return typeof this.response == "object";
27464  }
27465  shouldIssueRequest() {
27466    if (this.action == "restore") {
27467      return !this.hasCachedSnapshot();
27468    } else {
27469      return this.willRender;
27470    }
27471  }
27472  cacheSnapshot() {
27473    if (!this.snapshotCached) {
27474      this.view.cacheSnapshot(this.snapshot).then((snapshot) => snapshot && this.visitCachedSnapshot(snapshot));
27475      this.snapshotCached = true;
27476    }
27477  }
27478  async render(callback) {
27479    this.cancelRender();
27480    await new Promise((resolve) => {
27481      this.frame = document.visibilityState === "hidden" ? setTimeout(() => resolve(), 0) : requestAnimationFrame(() => resolve());
27482    });
27483    await callback();
27484    delete this.frame;
27485  }
27486  async renderPageSnapshot(snapshot, isPreview) {
27487    await this.viewTransitioner.renderChange(this.view.shouldTransitionTo(snapshot), async () => {
27488      await this.view.renderPage(snapshot, isPreview, this.willRender, this);
27489      this.performScroll();
27490    });
27491  }
27492  cancelRender() {
27493    if (this.frame) {
27494      cancelAnimationFrame(this.frame);
27495      delete this.frame;
27496    }
27497  }
27498}
27499function isSuccessful(statusCode) {
27500  return statusCode >= 200 && statusCode < 300;
27501}
27502
27503class BrowserAdapter {
27504  progressBar = new ProgressBar;
27505  constructor(session2) {
27506    this.session = session2;
27507  }
27508  visitProposedToLocation(location2, options2) {
27509    if (locationIsVisitable(location2, this.navigator.rootLocation)) {
27510      this.navigator.startVisit(location2, options2?.restorationIdentifier || uuid(), options2);
27511    } else {
27512      window.location.href = location2.toString();
27513    }
27514  }
27515  visitStarted(visit2) {
27516    this.location = visit2.location;
27517    this.redirectedToLocation = null;
27518    visit2.loadCachedSnapshot();
27519    visit2.issueRequest();
27520  }
27521  visitRequestStarted(visit2) {
27522    this.progressBar.setValue(0);
27523    if (visit2.hasCachedSnapshot() || visit2.action != "restore") {
27524      this.showVisitProgressBarAfterDelay();
27525    } else {
27526      this.showProgressBar();
27527    }
27528  }
27529  visitRequestCompleted(visit2) {
27530    visit2.loadResponse();
27531    if (visit2.response.redirected) {
27532      this.redirectedToLocation = visit2.redirectedToLocation;
27533    }
27534  }
27535  visitRequestFailedWithStatusCode(visit2, statusCode) {
27536    switch (statusCode) {
27537      case SystemStatusCode.networkFailure:
27538      case SystemStatusCode.timeoutFailure:
27539      case SystemStatusCode.contentTypeMismatch:
27540        return this.reload({
27541          reason: "request_failed",
27542          context: {
27543            statusCode
27544          }
27545        });
27546      default:
27547        return visit2.loadResponse();
27548    }
27549  }
27550  visitRequestFinished(_visit) {}
27551  visitCompleted(_visit) {
27552    this.progressBar.setValue(1);
27553    this.hideVisitProgressBar();
27554  }
27555  pageInvalidated(reason) {
27556    this.reload(reason);
27557  }
27558  visitFailed(_visit) {
27559    this.progressBar.setValue(1);
27560    this.hideVisitProgressBar();
27561  }
27562  visitRendered(_visit) {}
27563  linkPrefetchingIsEnabledForLocation(location2) {
27564    return true;
27565  }
27566  formSubmissionStarted(_formSubmission) {
27567    this.progressBar.setValue(0);
27568    this.showFormProgressBarAfterDelay();
27569  }
27570  formSubmissionFinished(_formSubmission) {
27571    this.progressBar.setValue(1);
27572    this.hideFormProgressBar();
27573  }
27574  showVisitProgressBarAfterDelay() {
27575    this.visitProgressBarTimeout = window.setTimeout(this.showProgressBar, this.session.progressBarDelay);
27576  }
27577  hideVisitProgressBar() {
27578    this.progressBar.hide();
27579    if (this.visitProgressBarTimeout != null) {
27580      window.clearTimeout(this.visitProgressBarTimeout);
27581      delete this.visitProgressBarTimeout;
27582    }
27583  }
27584  showFormProgressBarAfterDelay() {
27585    if (this.formProgressBarTimeout == null) {
27586      this.formProgressBarTimeout = window.setTimeout(this.showProgressBar, this.session.progressBarDelay);
27587    }
27588  }
27589  hideFormProgressBar() {
27590    this.progressBar.hide();
27591    if (this.formProgressBarTimeout != null) {
27592      window.clearTimeout(this.formProgressBarTimeout);
27593      delete this.formProgressBarTimeout;
27594    }
27595  }
27596  showProgressBar = () => {
27597    this.progressBar.show();
27598  };
27599  reload(reason) {
27600    dispatch("turbo:reload", { detail: reason });
27601    window.location.href = (this.redirectedToLocation || this.location)?.toString() || window.location.href;
27602  }
27603  get navigator() {
27604    return this.session.navigator;
27605  }
27606}
27607
27608class CacheObserver {
27609  selector = "[data-turbo-temporary]";
27610  started = false;
27611  start() {
27612    if (!this.started) {
27613      this.started = true;
27614      addEventListener("turbo:before-cache", this.removeTemporaryElements, false);
27615    }
27616  }
27617  stop() {
27618    if (this.started) {
27619      this.started = false;
27620      removeEventListener("turbo:before-cache", this.removeTemporaryElements, false);
27621    }
27622  }
27623  removeTemporaryElements = (_event) => {
27624    for (const element of this.temporaryElements) {
27625      element.remove();
27626    }
27627  };
27628  get temporaryElements() {
27629    return [...document.querySelectorAll(this.selector)];
27630  }
27631}
27632
27633class FrameRedirector {
27634  constructor(session2, element) {
27635    this.session = session2;
27636    this.element = element;
27637    this.linkInterceptor = new LinkInterceptor(this, element);
27638    this.formSubmitObserver = new FormSubmitObserver(this, element);
27639  }
27640  start() {
27641    this.linkInterceptor.start();
27642    this.formSubmitObserver.start();
27643  }
27644  stop() {
27645    this.linkInterceptor.stop();
27646    this.formSubmitObserver.stop();
27647  }
27648  shouldInterceptLinkClick(element, _location, _event) {
27649    return this.#shouldRedirect(element);
27650  }
27651  linkClickIntercepted(element, url, event) {
27652    const frame = this.#findFrameElement(element);
27653    if (frame) {
27654      frame.delegate.linkClickIntercepted(element, url, event);
27655    }
27656  }
27657  willSubmitForm(element, submitter) {
27658    return element.closest("turbo-frame") == null && this.#shouldSubmit(element, submitter) && this.#shouldRedirect(element, submitter);
27659  }
27660  formSubmitted(element, submitter) {
27661    const frame = this.#findFrameElement(element, submitter);
27662    if (frame) {
27663      frame.delegate.formSubmitted(element, submitter);
27664    }
27665  }
27666  #shouldSubmit(form, submitter) {
27667    const action = getAction$1(form, submitter);
27668    const meta = this.element.ownerDocument.querySelector(`meta[name="turbo-root"]`);
27669    const rootLocation = expandURL(meta?.content ?? "/");
27670    return this.#shouldRedirect(form, submitter) && locationIsVisitable(action, rootLocation);
27671  }
27672  #shouldRedirect(element, submitter) {
27673    const isNavigatable = element instanceof HTMLFormElement ? this.session.submissionIsNavigatable(element, submitter) : this.session.elementIsNavigatable(element);
27674    if (isNavigatable) {
27675      const frame = this.#findFrameElement(element, submitter);
27676      return frame ? frame != element.closest("turbo-frame") : false;
27677    } else {
27678      return false;
27679    }
27680  }
27681  #findFrameElement(element, submitter) {
27682    const id = submitter?.getAttribute("data-turbo-frame") || element.getAttribute("data-turbo-frame");
27683    if (id && id != "_top") {
27684      const frame = this.element.querySelector(`#${id}:not([disabled])`);
27685      if (frame instanceof FrameElement) {
27686        return frame;
27687      }
27688    }
27689  }
27690}
27691
27692class History2 {
27693  location;
27694  restorationIdentifier = uuid();
27695  restorationData = {};
27696  started = false;
27697  currentIndex = 0;
27698  constructor(delegate) {
27699    this.delegate = delegate;
27700  }
27701  start() {
27702    if (!this.started) {
27703      addEventListener("popstate", this.onPopState, false);
27704      this.currentIndex = history.state?.turbo?.restorationIndex || 0;
27705      this.started = true;
27706      this.replace(new URL(window.location.href));
27707    }
27708  }
27709  stop() {
27710    if (this.started) {
27711      removeEventListener("popstate", this.onPopState, false);
27712      this.started = false;
27713    }
27714  }
27715  push(location2, restorationIdentifier) {
27716    this.update(history.pushState, location2, restorationIdentifier);
27717  }
27718  replace(location2, restorationIdentifier) {
27719    this.update(history.replaceState, location2, restorationIdentifier);
27720  }
27721  update(method, location2, restorationIdentifier = uuid()) {
27722    if (method === history.pushState)
27723      ++this.currentIndex;
27724    const state = { turbo: { restorationIdentifier, restorationIndex: this.currentIndex } };
27725    method.call(history, state, "", location2.href);
27726    this.location = location2;
27727    this.restorationIdentifier = restorationIdentifier;
27728  }
27729  getRestorationDataForIdentifier(restorationIdentifier) {
27730    return this.restorationData[restorationIdentifier] || {};
27731  }
27732  updateRestorationData(additionalData) {
27733    const { restorationIdentifier } = this;
27734    const restorationData = this.restorationData[restorationIdentifier];
27735    this.restorationData[restorationIdentifier] = {
27736      ...restorationData,
27737      ...additionalData
27738    };
27739  }
27740  assumeControlOfScrollRestoration() {
27741    if (!this.previousScrollRestoration) {
27742      this.previousScrollRestoration = history.scrollRestoration ?? "auto";
27743      history.scrollRestoration = "manual";
27744    }
27745  }
27746  relinquishControlOfScrollRestoration() {
27747    if (this.previousScrollRestoration) {
27748      history.scrollRestoration = this.previousScrollRestoration;
27749      delete this.previousScrollRestoration;
27750    }
27751  }
27752  onPopState = (event) => {
27753    const { turbo } = event.state || {};
27754    this.location = new URL(window.location.href);
27755    if (turbo) {
27756      const { restorationIdentifier, restorationIndex } = turbo;
27757      this.restorationIdentifier = restorationIdentifier;
27758      const direction = restorationIndex > this.currentIndex ? "forward" : "back";
27759      this.delegate.historyPoppedToLocationWithRestorationIdentifierAndDirection(this.location, restorationIdentifier, direction);
27760      this.currentIndex = restorationIndex;
27761    } else {
27762      this.currentIndex++;
27763      this.delegate.historyPoppedWithEmptyState(this.location);
27764    }
27765  };
27766}
27767class LinkPrefetchObserver {
27768  started = false;
27769  #prefetchedLink = null;
27770  constructor(delegate, eventTarget) {
27771    this.delegate = delegate;
27772    this.eventTarget = eventTarget;
27773  }
27774  start() {
27775    if (this.started)
27776      return;
27777    if (this.eventTarget.readyState === "loading") {
27778      this.eventTarget.addEventListener("DOMContentLoaded", this.#enable, { once: true });
27779    } else {
27780      this.#enable();
27781    }
27782  }
27783  stop() {
27784    if (!this.started)
27785      return;
27786    this.eventTarget.removeEventListener("mouseenter", this.#tryToPrefetchRequest, {
27787      capture: true,
27788      passive: true
27789    });
27790    this.eventTarget.removeEventListener("mouseleave", this.#cancelRequestIfObsolete, {
27791      capture: true,
27792      passive: true
27793    });
27794    this.eventTarget.removeEventListener("turbo:before-fetch-request", this.#tryToUsePrefetchedRequest, true);
27795    this.started = false;
27796  }
27797  #enable = () => {
27798    this.eventTarget.addEventListener("mouseenter", this.#tryToPrefetchRequest, {
27799      capture: true,
27800      passive: true
27801    });
27802    this.eventTarget.addEventListener("mouseleave", this.#cancelRequestIfObsolete, {
27803      capture: true,
27804      passive: true
27805    });
27806    this.eventTarget.addEventListener("turbo:before-fetch-request", this.#tryToUsePrefetchedRequest, true);
27807    this.started = true;
27808  };
27809  #tryToPrefetchRequest = (event) => {
27810    if (getMetaContent("turbo-prefetch") === "false")
27811      return;
27812    const target = event.target;
27813    const isLink = target.matches && target.matches("a[href]:not([target^=_]):not([download])");
27814    if (isLink && this.#isPrefetchable(target)) {
27815      const link = target;
27816      const location2 = getLocationForLink(link);
27817      if (this.delegate.canPrefetchRequestToLocation(link, location2)) {
27818        this.#prefetchedLink = link;
27819        const fetchRequest = new FetchRequest(this, FetchMethod.get, location2, new URLSearchParams, target);
27820        fetchRequest.fetchOptions.priority = "low";
27821        prefetchCache.putLater(location2, fetchRequest, this.#cacheTtl);
27822      }
27823    }
27824  };
27825  #cancelRequestIfObsolete = (event) => {
27826    if (event.target === this.#prefetchedLink)
27827      this.#cancelPrefetchRequest();
27828  };
27829  #cancelPrefetchRequest = () => {
27830    prefetchCache.clear();
27831    this.#prefetchedLink = null;
27832  };
27833  #tryToUsePrefetchedRequest = (event) => {
27834    if (event.target.tagName !== "FORM" && event.detail.fetchOptions.method === "GET") {
27835      const cached = prefetchCache.get(event.detail.url);
27836      if (cached) {
27837        event.detail.fetchRequest = cached;
27838      }
27839      prefetchCache.clear();
27840    }
27841  };
27842  prepareRequest(request) {
27843    const link = request.target;
27844    request.headers["X-Sec-Purpose"] = "prefetch";
27845    const turboFrame = link.closest("turbo-frame");
27846    const turboFrameTarget = link.getAttribute("data-turbo-frame") || turboFrame?.getAttribute("target") || turboFrame?.id;
27847    if (turboFrameTarget && turboFrameTarget !== "_top") {
27848      request.headers["Turbo-Frame"] = turboFrameTarget;
27849    }
27850  }
27851  requestSucceededWithResponse() {}
27852  requestStarted(fetchRequest) {}
27853  requestErrored(fetchRequest) {}
27854  requestFinished(fetchRequest) {}
27855  requestPreventedHandlingResponse(fetchRequest, fetchResponse) {}
27856  requestFailedWithResponse(fetchRequest, fetchResponse) {}
27857  get #cacheTtl() {
27858    return Number(getMetaContent("turbo-prefetch-cache-time")) || cacheTtl;
27859  }
27860  #isPrefetchable(link) {
27861    const href = link.getAttribute("href");
27862    if (!href)
27863      return false;
27864    if (unfetchableLink(link))
27865      return false;
27866    if (linkToTheSamePage(link))
27867      return false;
27868    if (linkOptsOut(link))
27869      return false;
27870    if (nonSafeLink(link))
27871      return false;
27872    if (eventPrevented(link))
27873      return false;
27874    return true;
27875  }
27876}
27877var unfetchableLink = (link) => {
27878  return link.origin !== document.location.origin || !["http:", "https:"].includes(link.protocol) || link.hasAttribute("target");
27879};
27880var linkToTheSamePage = (link) => {
27881  return link.pathname + link.search === document.location.pathname + document.location.search || link.href.startsWith("#");
27882};
27883var linkOptsOut = (link) => {
27884  if (link.getAttribute("data-turbo-prefetch") === "false")
27885    return true;
27886  if (link.getAttribute("data-turbo") === "false")
27887    return true;
27888  const turboPrefetchParent = findClosestRecursively(link, "[data-turbo-prefetch]");
27889  if (turboPrefetchParent && turboPrefetchParent.getAttribute("data-turbo-prefetch") === "false")
27890    return true;
27891  return false;
27892};
27893var nonSafeLink = (link) => {
27894  const turboMethod = link.getAttribute("data-turbo-method");
27895  if (turboMethod && turboMethod.toLowerCase() !== "get")
27896    return true;
27897  if (isUJS(link))
27898    return true;
27899  if (link.hasAttribute("data-turbo-confirm"))
27900    return true;
27901  if (link.hasAttribute("data-turbo-stream"))
27902    return true;
27903  return false;
27904};
27905var isUJS = (link) => {
27906  return link.hasAttribute("data-remote") || link.hasAttribute("data-behavior") || link.hasAttribute("data-confirm") || link.hasAttribute("data-method");
27907};
27908var eventPrevented = (link) => {
27909  const event = dispatch("turbo:before-prefetch", { target: link, cancelable: true });
27910  return event.defaultPrevented;
27911};
27912
27913class Navigator {
27914  constructor(delegate) {
27915    this.delegate = delegate;
27916  }
27917  proposeVisit(location2, options2 = {}) {
27918    if (this.delegate.allowsVisitingLocationWithAction(location2, options2.action)) {
27919      this.delegate.visitProposedToLocation(location2, options2);
27920    }
27921  }
27922  startVisit(locatable, restorationIdentifier, options2 = {}) {
27923    this.stop();
27924    this.currentVisit = new Visit(this, expandURL(locatable), restorationIdentifier, {
27925      referrer: this.location,
27926      ...options2
27927    });
27928    this.currentVisit.start();
27929  }
27930  submitForm(form, submitter) {
27931    this.stop();
27932    this.formSubmission = new FormSubmission(this, form, submitter, true);
27933    this.formSubmission.start();
27934  }
27935  stop() {
27936    if (this.formSubmission) {
27937      this.formSubmission.stop();
27938      delete this.formSubmission;
27939    }
27940    if (this.currentVisit) {
27941      this.currentVisit.cancel();
27942      delete this.currentVisit;
27943    }
27944  }
27945  get adapter() {
27946    return this.delegate.adapter;
27947  }
27948  get view() {
27949    return this.delegate.view;
27950  }
27951  get rootLocation() {
27952    return this.view.snapshot.rootLocation;
27953  }
27954  get history() {
27955    return this.delegate.history;
27956  }
27957  formSubmissionStarted(formSubmission) {
27958    if (typeof this.adapter.formSubmissionStarted === "function") {
27959      this.adapter.formSubmissionStarted(formSubmission);
27960    }
27961  }
27962  async formSubmissionSucceededWithResponse(formSubmission, fetchResponse) {
27963    if (formSubmission == this.formSubmission) {
27964      const responseHTML = await fetchResponse.responseHTML;
27965      if (responseHTML) {
27966        const shouldCacheSnapshot = formSubmission.isSafe;
27967        if (!shouldCacheSnapshot) {
27968          this.view.clearSnapshotCache();
27969        }
27970        const { statusCode, redirected } = fetchResponse;
27971        const action = this.#getActionForFormSubmission(formSubmission, fetchResponse);
27972        const visitOptions = {
27973          action,
27974          shouldCacheSnapshot,
27975          response: { statusCode, responseHTML, redirected }
27976        };
27977        this.proposeVisit(fetchResponse.location, visitOptions);
27978      }
27979    }
27980  }
27981  async formSubmissionFailedWithResponse(formSubmission, fetchResponse) {
27982    const responseHTML = await fetchResponse.responseHTML;
27983    if (responseHTML) {
27984      const snapshot = PageSnapshot.fromHTMLString(responseHTML);
27985      if (fetchResponse.serverError) {
27986        await this.view.renderError(snapshot, this.currentVisit);
27987      } else {
27988        await this.view.renderPage(snapshot, false, true, this.currentVisit);
27989      }
27990      if (snapshot.refreshScroll !== "preserve") {
27991        this.view.scrollToTop();
27992      }
27993      this.view.clearSnapshotCache();
27994    }
27995  }
27996  formSubmissionErrored(formSubmission, error) {
27997    console.error(error);
27998  }
27999  formSubmissionFinished(formSubmission) {
28000    if (typeof this.adapter.formSubmissionFinished === "function") {
28001      this.adapter.formSubmissionFinished(formSubmission);
28002    }
28003  }
28004  linkPrefetchingIsEnabledForLocation(location2) {
28005    if (typeof this.adapter.linkPrefetchingIsEnabledForLocation === "function") {
28006      return this.adapter.linkPrefetchingIsEnabledForLocation(location2);
28007    }
28008    return true;
28009  }
28010  visitStarted(visit2) {
28011    this.delegate.visitStarted(visit2);
28012  }
28013  visitCompleted(visit2) {
28014    this.delegate.visitCompleted(visit2);
28015    delete this.currentVisit;
28016  }
28017  locationWithActionIsSamePage(location2, action) {
28018    return false;
28019  }
28020  get location() {
28021    return this.history.location;
28022  }
28023  get restorationIdentifier() {
28024    return this.history.restorationIdentifier;
28025  }
28026  #getActionForFormSubmission(formSubmission, fetchResponse) {
28027    const { submitter, formElement } = formSubmission;
28028    return getVisitAction(submitter, formElement) || this.#getDefaultAction(fetchResponse);
28029  }
28030  #getDefaultAction(fetchResponse) {
28031    const sameLocationRedirect = fetchResponse.redirected && fetchResponse.location.href === this.location?.href;
28032    return sameLocationRedirect ? "replace" : "advance";
28033  }
28034}
28035var PageStage = {
28036  initial: 0,
28037  loading: 1,
28038  interactive: 2,
28039  complete: 3
28040};
28041
28042class PageObserver {
28043  stage = PageStage.initial;
28044  started = false;
28045  constructor(delegate) {
28046    this.delegate = delegate;
28047  }
28048  start() {
28049    if (!this.started) {
28050      if (this.stage == PageStage.initial) {
28051        this.stage = PageStage.loading;
28052      }
28053      document.addEventListener("readystatechange", this.interpretReadyState, false);
28054      addEventListener("pagehide", this.pageWillUnload, false);
28055      this.started = true;
28056    }
28057  }
28058  stop() {
28059    if (this.started) {
28060      document.removeEventListener("readystatechange", this.interpretReadyState, false);
28061      removeEventListener("pagehide", this.pageWillUnload, false);
28062      this.started = false;
28063    }
28064  }
28065  interpretReadyState = () => {
28066    const { readyState } = this;
28067    if (readyState == "interactive") {
28068      this.pageIsInteractive();
28069    } else if (readyState == "complete") {
28070      this.pageIsComplete();
28071    }
28072  };
28073  pageIsInteractive() {
28074    if (this.stage == PageStage.loading) {
28075      this.stage = PageStage.interactive;
28076      this.delegate.pageBecameInteractive();
28077    }
28078  }
28079  pageIsComplete() {
28080    this.pageIsInteractive();
28081    if (this.stage == PageStage.interactive) {
28082      this.stage = PageStage.complete;
28083      this.delegate.pageLoaded();
28084    }
28085  }
28086  pageWillUnload = () => {
28087    this.delegate.pageWillUnload();
28088  };
28089  get readyState() {
28090    return document.readyState;
28091  }
28092}
28093
28094class ScrollObserver {
28095  started = false;
28096  constructor(delegate) {
28097    this.delegate = delegate;
28098  }
28099  start() {
28100    if (!this.started) {
28101      addEventListener("scroll", this.onScroll, false);
28102      this.onScroll();
28103      this.started = true;
28104    }
28105  }
28106  stop() {
28107    if (this.started) {
28108      removeEventListener("scroll", this.onScroll, false);
28109      this.started = false;
28110    }
28111  }
28112  onScroll = () => {
28113    this.updatePosition({ x: window.pageXOffset, y: window.pageYOffset });
28114  };
28115  updatePosition(position) {
28116    this.delegate.scrollPositionChanged(position);
28117  }
28118}
28119
28120class StreamMessageRenderer {
28121  render({ fragment }) {
28122    Bardo.preservingPermanentElements(this, getPermanentElementMapForFragment(fragment), () => {
28123      withAutofocusFromFragment(fragment, () => {
28124        withPreservedFocus(() => {
28125          document.documentElement.appendChild(fragment);
28126        });
28127      });
28128    });
28129  }
28130  enteringBardo(currentPermanentElement, newPermanentElement) {
28131    newPermanentElement.replaceWith(currentPermanentElement.cloneNode(true));
28132  }
28133  leavingBardo() {}
28134}
28135function getPermanentElementMapForFragment(fragment) {
28136  const permanentElementsInDocument = queryPermanentElementsAll(document.documentElement);
28137  const permanentElementMap = {};
28138  for (const permanentElementInDocument of permanentElementsInDocument) {
28139    const { id } = permanentElementInDocument;
28140    for (const streamElement of fragment.querySelectorAll("turbo-stream")) {
28141      const elementInStream = getPermanentElementById(streamElement.templateElement.content, id);
28142      if (elementInStream) {
28143        permanentElementMap[id] = [permanentElementInDocument, elementInStream];
28144      }
28145    }
28146  }
28147  return permanentElementMap;
28148}
28149async function withAutofocusFromFragment(fragment, callback) {
28150  const generatedID = `turbo-stream-autofocus-${uuid()}`;
28151  const turboStreams = fragment.querySelectorAll("turbo-stream");
28152  const elementWithAutofocus = firstAutofocusableElementInStreams(turboStreams);
28153  let willAutofocusId = null;
28154  if (elementWithAutofocus) {
28155    if (elementWithAutofocus.id) {
28156      willAutofocusId = elementWithAutofocus.id;
28157    } else {
28158      willAutofocusId = generatedID;
28159    }
28160    elementWithAutofocus.id = willAutofocusId;
28161  }
28162  callback();
28163  await nextRepaint();
28164  const hasNoActiveElement = document.activeElement == null || document.activeElement == document.body;
28165  if (hasNoActiveElement && willAutofocusId) {
28166    const elementToAutofocus = document.getElementById(willAutofocusId);
28167    if (elementIsFocusable(elementToAutofocus)) {
28168      elementToAutofocus.focus();
28169    }
28170    if (elementToAutofocus && elementToAutofocus.id == generatedID) {
28171      elementToAutofocus.removeAttribute("id");
28172    }
28173  }
28174}
28175async function withPreservedFocus(callback) {
28176  const [activeElementBeforeRender, activeElementAfterRender] = await around(callback, () => document.activeElement);
28177  const restoreFocusTo = activeElementBeforeRender && activeElementBeforeRender.id;
28178  if (restoreFocusTo) {
28179    const elementToFocus = document.getElementById(restoreFocusTo);
28180    if (elementIsFocusable(elementToFocus) && elementToFocus != activeElementAfterRender) {
28181      elementToFocus.focus();
28182    }
28183  }
28184}
28185function firstAutofocusableElementInStreams(nodeListOfStreamElements) {
28186  for (const streamElement of nodeListOfStreamElements) {
28187    const elementWithAutofocus = queryAutofocusableElement(streamElement.templateElement.content);
28188    if (elementWithAutofocus)
28189      return elementWithAutofocus;
28190  }
28191  return null;
28192}
28193
28194class StreamObserver {
28195  sources = new Set;
28196  #started = false;
28197  constructor(delegate) {
28198    this.delegate = delegate;
28199  }
28200  start() {
28201    if (!this.#started) {
28202      this.#started = true;
28203      addEventListener("turbo:before-fetch-response", this.inspectFetchResponse, false);
28204    }
28205  }
28206  stop() {
28207    if (this.#started) {
28208      this.#started = false;
28209      removeEventListener("turbo:before-fetch-response", this.inspectFetchResponse, false);
28210    }
28211  }
28212  connectStreamSource(source) {
28213    if (!this.streamSourceIsConnected(source)) {
28214      this.sources.add(source);
28215      source.addEventListener("message", this.receiveMessageEvent, false);
28216    }
28217  }
28218  disconnectStreamSource(source) {
28219    if (this.streamSourceIsConnected(source)) {
28220      this.sources.delete(source);
28221      source.removeEventListener("message", this.receiveMessageEvent, false);
28222    }
28223  }
28224  streamSourceIsConnected(source) {
28225    return this.sources.has(source);
28226  }
28227  inspectFetchResponse = (event) => {
28228    const response = fetchResponseFromEvent(event);
28229    if (response && fetchResponseIsStream(response)) {
28230      event.preventDefault();
28231      this.receiveMessageResponse(response);
28232    }
28233  };
28234  receiveMessageEvent = (event) => {
28235    if (this.#started && typeof event.data == "string") {
28236      this.receiveMessageHTML(event.data);
28237    }
28238  };
28239  async receiveMessageResponse(response) {
28240    const html = await response.responseHTML;
28241    if (html) {
28242      this.receiveMessageHTML(html);
28243    }
28244  }
28245  receiveMessageHTML(html) {
28246    this.delegate.receivedMessageFromStream(StreamMessage.wrap(html));
28247  }
28248}
28249function fetchResponseFromEvent(event) {
28250  const fetchResponse = event.detail?.fetchResponse;
28251  if (fetchResponse instanceof FetchResponse) {
28252    return fetchResponse;
28253  }
28254}
28255function fetchResponseIsStream(response) {
28256  const contentType = response.contentType ?? "";
28257  return contentType.startsWith(StreamMessage.contentType);
28258}
28259
28260class ErrorRenderer extends Renderer {
28261  static renderElement(currentElement, newElement) {
28262    const { documentElement, body } = document;
28263    documentElement.replaceChild(newElement, body);
28264  }
28265  async render() {
28266    this.replaceHeadAndBody();
28267    this.activateScriptElements();
28268  }
28269  replaceHeadAndBody() {
28270    const { documentElement, head } = document;
28271    documentElement.replaceChild(this.newHead, head);
28272    this.renderElement(this.currentElement, this.newElement);
28273  }
28274  activateScriptElements() {
28275    for (const replaceableElement of this.scriptElements) {
28276      const parentNode = replaceableElement.parentNode;
28277      if (parentNode) {
28278        const element = activateScriptElement(replaceableElement);
28279        parentNode.replaceChild(element, replaceableElement);
28280      }
28281    }
28282  }
28283  get newHead() {
28284    return this.newSnapshot.headSnapshot.element;
28285  }
28286  get scriptElements() {
28287    return document.documentElement.querySelectorAll("script");
28288  }
28289}
28290
28291class PageRenderer extends Renderer {
28292  static renderElement(currentElement, newElement) {
28293    if (document.body && newElement instanceof HTMLBodyElement) {
28294      document.body.replaceWith(newElement);
28295    } else {
28296      document.documentElement.appendChild(newElement);
28297    }
28298  }
28299  get shouldRender() {
28300    return this.newSnapshot.isVisitable && this.trackedElementsAreIdentical;
28301  }
28302  get reloadReason() {
28303    if (!this.newSnapshot.isVisitable) {
28304      return {
28305        reason: "turbo_visit_control_is_reload"
28306      };
28307    }
28308    if (!this.trackedElementsAreIdentical) {
28309      return {
28310        reason: "tracked_element_mismatch"
28311      };
28312    }
28313  }
28314  async prepareToRender() {
28315    this.#setLanguage();
28316    await this.mergeHead();
28317  }
28318  async render() {
28319    if (this.willRender) {
28320      await this.replaceBody();
28321    }
28322  }
28323  finishRendering() {
28324    super.finishRendering();
28325    if (!this.isPreview) {
28326      this.focusFirstAutofocusableElement();
28327    }
28328  }
28329  get currentHeadSnapshot() {
28330    return this.currentSnapshot.headSnapshot;
28331  }
28332  get newHeadSnapshot() {
28333    return this.newSnapshot.headSnapshot;
28334  }
28335  get newElement() {
28336    return this.newSnapshot.element;
28337  }
28338  #setLanguage() {
28339    const { documentElement } = this.currentSnapshot;
28340    const { dir, lang } = this.newSnapshot;
28341    if (lang) {
28342      documentElement.setAttribute("lang", lang);
28343    } else {
28344      documentElement.removeAttribute("lang");
28345    }
28346    if (dir) {
28347      documentElement.setAttribute("dir", dir);
28348    } else {
28349      documentElement.removeAttribute("dir");
28350    }
28351  }
28352  async mergeHead() {
28353    const mergedHeadElements = this.mergeProvisionalElements();
28354    const newStylesheetElements = this.copyNewHeadStylesheetElements();
28355    this.copyNewHeadScriptElements();
28356    await mergedHeadElements;
28357    await newStylesheetElements;
28358    if (this.willRender) {
28359      this.removeUnusedDynamicStylesheetElements();
28360    }
28361  }
28362  async replaceBody() {
28363    await this.preservingPermanentElements(async () => {
28364      this.activateNewBody();
28365      await this.assignNewBody();
28366    });
28367  }
28368  get trackedElementsAreIdentical() {
28369    return this.currentHeadSnapshot.trackedElementSignature == this.newHeadSnapshot.trackedElementSignature;
28370  }
28371  async copyNewHeadStylesheetElements() {
28372    const loadingElements = [];
28373    for (const element of this.newHeadStylesheetElements) {
28374      loadingElements.push(waitForLoad(element));
28375      document.head.appendChild(element);
28376    }
28377    await Promise.all(loadingElements);
28378  }
28379  copyNewHeadScriptElements() {
28380    for (const element of this.newHeadScriptElements) {
28381      document.head.appendChild(activateScriptElement(element));
28382    }
28383  }
28384  removeUnusedDynamicStylesheetElements() {
28385    for (const element of this.unusedDynamicStylesheetElements) {
28386      document.head.removeChild(element);
28387    }
28388  }
28389  async mergeProvisionalElements() {
28390    const newHeadElements = [...this.newHeadProvisionalElements];
28391    for (const element of this.currentHeadProvisionalElements) {
28392      if (!this.isCurrentElementInElementList(element, newHeadElements)) {
28393        document.head.removeChild(element);
28394      }
28395    }
28396    for (const element of newHeadElements) {
28397      document.head.appendChild(element);
28398    }
28399  }
28400  isCurrentElementInElementList(element, elementList) {
28401    for (const [index, newElement] of elementList.entries()) {
28402      if (element.tagName == "TITLE") {
28403        if (newElement.tagName != "TITLE") {
28404          continue;
28405        }
28406        if (element.innerHTML == newElement.innerHTML) {
28407          elementList.splice(index, 1);
28408          return true;
28409        }
28410      }
28411      if (newElement.isEqualNode(element)) {
28412        elementList.splice(index, 1);
28413        return true;
28414      }
28415    }
28416    return false;
28417  }
28418  removeCurrentHeadProvisionalElements() {
28419    for (const element of this.currentHeadProvisionalElements) {
28420      document.head.removeChild(element);
28421    }
28422  }
28423  copyNewHeadProvisionalElements() {
28424    for (const element of this.newHeadProvisionalElements) {
28425      document.head.appendChild(element);
28426    }
28427  }
28428  activateNewBody() {
28429    document.adoptNode(this.newElement);
28430    this.removeNoscriptElements();
28431    this.activateNewBodyScriptElements();
28432  }
28433  removeNoscriptElements() {
28434    for (const noscriptElement of this.newElement.querySelectorAll("noscript")) {
28435      noscriptElement.remove();
28436    }
28437  }
28438  activateNewBodyScriptElements() {
28439    for (const inertScriptElement of this.newBodyScriptElements) {
28440      const activatedScriptElement = activateScriptElement(inertScriptElement);
28441      inertScriptElement.replaceWith(activatedScriptElement);
28442    }
28443  }
28444  async assignNewBody() {
28445    await this.renderElement(this.currentElement, this.newElement);
28446  }
28447  get unusedDynamicStylesheetElements() {
28448    return this.oldHeadStylesheetElements.filter((element) => {
28449      return element.getAttribute("data-turbo-track") === "dynamic";
28450    });
28451  }
28452  get oldHeadStylesheetElements() {
28453    return this.currentHeadSnapshot.getStylesheetElementsNotInSnapshot(this.newHeadSnapshot);
28454  }
28455  get newHeadStylesheetElements() {
28456    return this.newHeadSnapshot.getStylesheetElementsNotInSnapshot(this.currentHeadSnapshot);
28457  }
28458  get newHeadScriptElements() {
28459    return this.newHeadSnapshot.getScriptElementsNotInSnapshot(this.currentHeadSnapshot);
28460  }
28461  get currentHeadProvisionalElements() {
28462    return this.currentHeadSnapshot.provisionalElements;
28463  }
28464  get newHeadProvisionalElements() {
28465    return this.newHeadSnapshot.provisionalElements;
28466  }
28467  get newBodyScriptElements() {
28468    return this.newElement.querySelectorAll("script");
28469  }
28470}
28471
28472class MorphingPageRenderer extends PageRenderer {
28473  static renderElement(currentElement, newElement) {
28474    morphElements(currentElement, newElement, {
28475      callbacks: {
28476        beforeNodeMorphed: (node, newNode) => {
28477          if (shouldRefreshFrameWithMorphing(node, newNode) && !closestFrameReloadableWithMorphing(node)) {
28478            node.reload();
28479            return false;
28480          }
28481          return true;
28482        }
28483      }
28484    });
28485    dispatch("turbo:morph", { detail: { currentElement, newElement } });
28486  }
28487  async preservingPermanentElements(callback) {
28488    return await callback();
28489  }
28490  get renderMethod() {
28491    return "morph";
28492  }
28493  get shouldAutofocus() {
28494    return false;
28495  }
28496}
28497
28498class SnapshotCache extends LRUCache {
28499  constructor(size) {
28500    super(size, toCacheKey);
28501  }
28502  get snapshots() {
28503    return this.entries;
28504  }
28505}
28506
28507class PageView extends View {
28508  snapshotCache = new SnapshotCache(10);
28509  lastRenderedLocation = new URL(location.href);
28510  forceReloaded = false;
28511  shouldTransitionTo(newSnapshot) {
28512    return this.snapshot.prefersViewTransitions && newSnapshot.prefersViewTransitions;
28513  }
28514  renderPage(snapshot, isPreview = false, willRender = true, visit2) {
28515    const shouldMorphPage = this.isPageRefresh(visit2) && (visit2?.refresh?.method || this.snapshot.refreshMethod) === "morph";
28516    const rendererClass = shouldMorphPage ? MorphingPageRenderer : PageRenderer;
28517    const renderer = new rendererClass(this.snapshot, snapshot, isPreview, willRender);
28518    if (!renderer.shouldRender) {
28519      this.forceReloaded = true;
28520    } else {
28521      visit2?.changeHistory();
28522    }
28523    return this.render(renderer);
28524  }
28525  renderError(snapshot, visit2) {
28526    visit2?.changeHistory();
28527    const renderer = new ErrorRenderer(this.snapshot, snapshot, false);
28528    return this.render(renderer);
28529  }
28530  clearSnapshotCache() {
28531    this.snapshotCache.clear();
28532  }
28533  async cacheSnapshot(snapshot = this.snapshot) {
28534    if (snapshot.isCacheable) {
28535      this.delegate.viewWillCacheSnapshot();
28536      const { lastRenderedLocation: location2 } = this;
28537      await nextEventLoopTick();
28538      const cachedSnapshot = snapshot.clone();
28539      this.snapshotCache.put(location2, cachedSnapshot);
28540      return cachedSnapshot;
28541    }
28542  }
28543  getCachedSnapshotForLocation(location2) {
28544    return this.snapshotCache.get(location2);
28545  }
28546  isPageRefresh(visit2) {
28547    return !visit2 || this.lastRenderedLocation.pathname === visit2.location.pathname && visit2.action === "replace";
28548  }
28549  shouldPreserveScrollPosition(visit2) {
28550    return this.isPageRefresh(visit2) && (visit2?.refresh?.scroll || this.snapshot.refreshScroll) === "preserve";
28551  }
28552  get snapshot() {
28553    return PageSnapshot.fromElement(this.element);
28554  }
28555}
28556
28557class Preloader {
28558  selector = "a[data-turbo-preload]";
28559  constructor(delegate, snapshotCache) {
28560    this.delegate = delegate;
28561    this.snapshotCache = snapshotCache;
28562  }
28563  start() {
28564    if (document.readyState === "loading") {
28565      document.addEventListener("DOMContentLoaded", this.#preloadAll);
28566    } else {
28567      this.preloadOnLoadLinksForView(document.body);
28568    }
28569  }
28570  stop() {
28571    document.removeEventListener("DOMContentLoaded", this.#preloadAll);
28572  }
28573  preloadOnLoadLinksForView(element) {
28574    for (const link of element.querySelectorAll(this.selector)) {
28575      if (this.delegate.shouldPreloadLink(link)) {
28576        this.preloadURL(link);
28577      }
28578    }
28579  }
28580  async preloadURL(link) {
28581    const location2 = new URL(link.href);
28582    if (this.snapshotCache.has(location2)) {
28583      return;
28584    }
28585    const fetchRequest = new FetchRequest(this, FetchMethod.get, location2, new URLSearchParams, link);
28586    await fetchRequest.perform();
28587  }
28588  prepareRequest(fetchRequest) {
28589    fetchRequest.headers["X-Sec-Purpose"] = "prefetch";
28590  }
28591  async requestSucceededWithResponse(fetchRequest, fetchResponse) {
28592    try {
28593      const responseHTML = await fetchResponse.responseHTML;
28594      const snapshot = PageSnapshot.fromHTMLString(responseHTML);
28595      this.snapshotCache.put(fetchRequest.url, snapshot);
28596    } catch (_) {}
28597  }
28598  requestStarted(fetchRequest) {}
28599  requestErrored(fetchRequest) {}
28600  requestFinished(fetchRequest) {}
28601  requestPreventedHandlingResponse(fetchRequest, fetchResponse) {}
28602  requestFailedWithResponse(fetchRequest, fetchResponse) {}
28603  #preloadAll = () => {
28604    this.preloadOnLoadLinksForView(document.body);
28605  };
28606}
28607
28608class Cache {
28609  constructor(session2) {
28610    this.session = session2;
28611  }
28612  clear() {
28613    this.session.clearCache();
28614  }
28615  resetCacheControl() {
28616    this.#setCacheControl("");
28617  }
28618  exemptPageFromCache() {
28619    this.#setCacheControl("no-cache");
28620  }
28621  exemptPageFromPreview() {
28622    this.#setCacheControl("no-preview");
28623  }
28624  #setCacheControl(value) {
28625    setMetaContent("turbo-cache-control", value);
28626  }
28627}
28628
28629class Session {
28630  navigator = new Navigator(this);
28631  history = new History2(this);
28632  view = new PageView(this, document.documentElement);
28633  adapter = new BrowserAdapter(this);
28634  pageObserver = new PageObserver(this);
28635  cacheObserver = new CacheObserver;
28636  linkPrefetchObserver = new LinkPrefetchObserver(this, document);
28637  linkClickObserver = new LinkClickObserver(this, window);
28638  formSubmitObserver = new FormSubmitObserver(this, document);
28639  scrollObserver = new ScrollObserver(this);
28640  streamObserver = new StreamObserver(this);
28641  formLinkClickObserver = new FormLinkClickObserver(this, document.documentElement);
28642  frameRedirector = new FrameRedirector(this, document.documentElement);
28643  streamMessageRenderer = new StreamMessageRenderer;
28644  cache = new Cache(this);
28645  enabled = true;
28646  started = false;
28647  #pageRefreshDebouncePeriod = 150;
28648  constructor(recentRequests) {
28649    this.recentRequests = recentRequests;
28650    this.preloader = new Preloader(this, this.view.snapshotCache);
28651    this.debouncedRefresh = this.refresh;
28652    this.pageRefreshDebouncePeriod = this.pageRefreshDebouncePeriod;
28653  }
28654  start() {
28655    if (!this.started) {
28656      this.pageObserver.start();
28657      this.cacheObserver.start();
28658      this.linkPrefetchObserver.start();
28659      this.formLinkClickObserver.start();
28660      this.linkClickObserver.start();
28661      this.formSubmitObserver.start();
28662      this.scrollObserver.start();
28663      this.streamObserver.start();
28664      this.frameRedirector.start();
28665      this.history.start();
28666      this.preloader.start();
28667      this.started = true;
28668      this.enabled = true;
28669    }
28670  }
28671  disable() {
28672    this.enabled = false;
28673  }
28674  stop() {
28675    if (this.started) {
28676      this.pageObserver.stop();
28677      this.cacheObserver.stop();
28678      this.linkPrefetchObserver.stop();
28679      this.formLinkClickObserver.stop();
28680      this.linkClickObserver.stop();
28681      this.formSubmitObserver.stop();
28682      this.scrollObserver.stop();
28683      this.streamObserver.stop();
28684      this.frameRedirector.stop();
28685      this.history.stop();
28686      this.preloader.stop();
28687      this.started = false;
28688    }
28689  }
28690  registerAdapter(adapter) {
28691    this.adapter = adapter;
28692  }
28693  visit(location2, options2 = {}) {
28694    const frameElement = options2.frame ? document.getElementById(options2.frame) : null;
28695    if (frameElement instanceof FrameElement) {
28696      const action = options2.action || getVisitAction(frameElement);
28697      frameElement.delegate.proposeVisitIfNavigatedWithAction(frameElement, action);
28698      frameElement.src = location2.toString();
28699    } else {
28700      this.navigator.proposeVisit(expandURL(location2), options2);
28701    }
28702  }
28703  refresh(url, options2 = {}) {
28704    options2 = typeof options2 === "string" ? { requestId: options2 } : options2;
28705    const { method, requestId, scroll } = options2;
28706    const isRecentRequest = requestId && this.recentRequests.has(requestId);
28707    const isCurrentUrl = url === document.baseURI;
28708    if (!isRecentRequest && !this.navigator.currentVisit && isCurrentUrl) {
28709      this.visit(url, { action: "replace", shouldCacheSnapshot: false, refresh: { method, scroll } });
28710    }
28711  }
28712  connectStreamSource(source) {
28713    this.streamObserver.connectStreamSource(source);
28714  }
28715  disconnectStreamSource(source) {
28716    this.streamObserver.disconnectStreamSource(source);
28717  }
28718  renderStreamMessage(message) {
28719    this.streamMessageRenderer.render(StreamMessage.wrap(message));
28720  }
28721  clearCache() {
28722    this.view.clearSnapshotCache();
28723  }
28724  setProgressBarDelay(delay) {
28725    console.warn("Please replace `session.setProgressBarDelay(delay)` with `session.progressBarDelay = delay`. The function is deprecated and will be removed in a future version of Turbo.`");
28726    this.progressBarDelay = delay;
28727  }
28728  set progressBarDelay(delay) {
28729    config.drive.progressBarDelay = delay;
28730  }
28731  get progressBarDelay() {
28732    return config.drive.progressBarDelay;
28733  }
28734  set drive(value) {
28735    config.drive.enabled = value;
28736  }
28737  get drive() {
28738    return config.drive.enabled;
28739  }
28740  set formMode(value) {
28741    config.forms.mode = value;
28742  }
28743  get formMode() {
28744    return config.forms.mode;
28745  }
28746  get location() {
28747    return this.history.location;
28748  }
28749  get restorationIdentifier() {
28750    return this.history.restorationIdentifier;
28751  }
28752  get pageRefreshDebouncePeriod() {
28753    return this.#pageRefreshDebouncePeriod;
28754  }
28755  set pageRefreshDebouncePeriod(value) {
28756    this.refresh = debounce2(this.debouncedRefresh.bind(this), value);
28757    this.#pageRefreshDebouncePeriod = value;
28758  }
28759  shouldPreloadLink(element) {
28760    const isUnsafe = element.hasAttribute("data-turbo-method");
28761    const isStream = element.hasAttribute("data-turbo-stream");
28762    const frameTarget = element.getAttribute("data-turbo-frame");
28763    const frame = frameTarget == "_top" ? null : document.getElementById(frameTarget) || findClosestRecursively(element, "turbo-frame:not([disabled])");
28764    if (isUnsafe || isStream || frame instanceof FrameElement) {
28765      return false;
28766    } else {
28767      const location2 = new URL(element.href);
28768      return this.elementIsNavigatable(element) && locationIsVisitable(location2, this.snapshot.rootLocation);
28769    }
28770  }
28771  historyPoppedToLocationWithRestorationIdentifierAndDirection(location2, restorationIdentifier, direction) {
28772    if (this.enabled) {
28773      this.navigator.startVisit(location2, restorationIdentifier, {
28774        action: "restore",
28775        historyChanged: true,
28776        direction
28777      });
28778    } else {
28779      this.adapter.pageInvalidated({
28780        reason: "turbo_disabled"
28781      });
28782    }
28783  }
28784  historyPoppedWithEmptyState(location2) {
28785    this.history.replace(location2);
28786    this.view.lastRenderedLocation = location2;
28787    this.view.cacheSnapshot();
28788  }
28789  scrollPositionChanged(position) {
28790    this.history.updateRestorationData({ scrollPosition: position });
28791  }
28792  willSubmitFormLinkToLocation(link, location2) {
28793    return this.elementIsNavigatable(link) && locationIsVisitable(location2, this.snapshot.rootLocation);
28794  }
28795  submittedFormLinkToLocation() {}
28796  canPrefetchRequestToLocation(link, location2) {
28797    return this.elementIsNavigatable(link) && locationIsVisitable(location2, this.snapshot.rootLocation) && this.navigator.linkPrefetchingIsEnabledForLocation(location2);
28798  }
28799  willFollowLinkToLocation(link, location2, event) {
28800    return this.elementIsNavigatable(link) && locationIsVisitable(location2, this.snapshot.rootLocation) && this.applicationAllowsFollowingLinkToLocation(link, location2, event);
28801  }
28802  followedLinkToLocation(link, location2) {
28803    const action = this.getActionForLink(link);
28804    const acceptsStreamResponse = link.hasAttribute("data-turbo-stream");
28805    this.visit(location2.href, { action, acceptsStreamResponse });
28806  }
28807  allowsVisitingLocationWithAction(location2, action) {
28808    return this.applicationAllowsVisitingLocation(location2);
28809  }
28810  visitProposedToLocation(location2, options2) {
28811    extendURLWithDeprecatedProperties(location2);
28812    this.adapter.visitProposedToLocation(location2, options2);
28813  }
28814  visitStarted(visit2) {
28815    if (!visit2.acceptsStreamResponse) {
28816      markAsBusy(document.documentElement);
28817      this.view.markVisitDirection(visit2.direction);
28818    }
28819    extendURLWithDeprecatedProperties(visit2.location);
28820    this.notifyApplicationAfterVisitingLocation(visit2.location, visit2.action);
28821  }
28822  visitCompleted(visit2) {
28823    this.view.unmarkVisitDirection();
28824    clearBusyState(document.documentElement);
28825    this.notifyApplicationAfterPageLoad(visit2.getTimingMetrics());
28826  }
28827  willSubmitForm(form, submitter) {
28828    const action = getAction$1(form, submitter);
28829    return this.submissionIsNavigatable(form, submitter) && locationIsVisitable(expandURL(action), this.snapshot.rootLocation);
28830  }
28831  formSubmitted(form, submitter) {
28832    this.navigator.submitForm(form, submitter);
28833  }
28834  pageBecameInteractive() {
28835    this.view.lastRenderedLocation = this.location;
28836    this.notifyApplicationAfterPageLoad();
28837  }
28838  pageLoaded() {
28839    this.history.assumeControlOfScrollRestoration();
28840  }
28841  pageWillUnload() {
28842    this.history.relinquishControlOfScrollRestoration();
28843  }
28844  receivedMessageFromStream(message) {
28845    this.renderStreamMessage(message);
28846  }
28847  viewWillCacheSnapshot() {
28848    this.notifyApplicationBeforeCachingSnapshot();
28849  }
28850  allowsImmediateRender({ element }, options2) {
28851    const event = this.notifyApplicationBeforeRender(element, options2);
28852    const {
28853      defaultPrevented,
28854      detail: { render }
28855    } = event;
28856    if (this.view.renderer && render) {
28857      this.view.renderer.renderElement = render;
28858    }
28859    return !defaultPrevented;
28860  }
28861  viewRenderedSnapshot(_snapshot, _isPreview, renderMethod) {
28862    this.view.lastRenderedLocation = this.history.location;
28863    this.notifyApplicationAfterRender(renderMethod);
28864  }
28865  preloadOnLoadLinksForView(element) {
28866    this.preloader.preloadOnLoadLinksForView(element);
28867  }
28868  viewInvalidated(reason) {
28869    this.adapter.pageInvalidated(reason);
28870  }
28871  frameLoaded(frame) {
28872    this.notifyApplicationAfterFrameLoad(frame);
28873  }
28874  frameRendered(fetchResponse, frame) {
28875    this.notifyApplicationAfterFrameRender(fetchResponse, frame);
28876  }
28877  applicationAllowsFollowingLinkToLocation(link, location2, ev) {
28878    const event = this.notifyApplicationAfterClickingLinkToLocation(link, location2, ev);
28879    return !event.defaultPrevented;
28880  }
28881  applicationAllowsVisitingLocation(location2) {
28882    const event = this.notifyApplicationBeforeVisitingLocation(location2);
28883    return !event.defaultPrevented;
28884  }
28885  notifyApplicationAfterClickingLinkToLocation(link, location2, event) {
28886    return dispatch("turbo:click", {
28887      target: link,
28888      detail: { url: location2.href, originalEvent: event },
28889      cancelable: true
28890    });
28891  }
28892  notifyApplicationBeforeVisitingLocation(location2) {
28893    return dispatch("turbo:before-visit", {
28894      detail: { url: location2.href },
28895      cancelable: true
28896    });
28897  }
28898  notifyApplicationAfterVisitingLocation(location2, action) {
28899    return dispatch("turbo:visit", { detail: { url: location2.href, action } });
28900  }
28901  notifyApplicationBeforeCachingSnapshot() {
28902    return dispatch("turbo:before-cache");
28903  }
28904  notifyApplicationBeforeRender(newBody, options2) {
28905    return dispatch("turbo:before-render", {
28906      detail: { newBody, ...options2 },
28907      cancelable: true
28908    });
28909  }
28910  notifyApplicationAfterRender(renderMethod) {
28911    return dispatch("turbo:render", { detail: { renderMethod } });
28912  }
28913  notifyApplicationAfterPageLoad(timing = {}) {
28914    return dispatch("turbo:load", {
28915      detail: { url: this.location.href, timing }
28916    });
28917  }
28918  notifyApplicationAfterFrameLoad(frame) {
28919    return dispatch("turbo:frame-load", { target: frame });
28920  }
28921  notifyApplicationAfterFrameRender(fetchResponse, frame) {
28922    return dispatch("turbo:frame-render", {
28923      detail: { fetchResponse },
28924      target: frame,
28925      cancelable: true
28926    });
28927  }
28928  submissionIsNavigatable(form, submitter) {
28929    if (config.forms.mode == "off") {
28930      return false;
28931    } else {
28932      const submitterIsNavigatable = submitter ? this.elementIsNavigatable(submitter) : true;
28933      if (config.forms.mode == "optin") {
28934        return submitterIsNavigatable && form.closest('[data-turbo="true"]') != null;
28935      } else {
28936        return submitterIsNavigatable && this.elementIsNavigatable(form);
28937      }
28938    }
28939  }
28940  elementIsNavigatable(element) {
28941    const container = findClosestRecursively(element, "[data-turbo]");
28942    const withinFrame = findClosestRecursively(element, "turbo-frame");
28943    if (config.drive.enabled || withinFrame) {
28944      if (container) {
28945        return container.getAttribute("data-turbo") != "false";
28946      } else {
28947        return true;
28948      }
28949    } else {
28950      if (container) {
28951        return container.getAttribute("data-turbo") == "true";
28952      } else {
28953        return false;
28954      }
28955    }
28956  }
28957  getActionForLink(link) {
28958    return getVisitAction(link) || "advance";
28959  }
28960  get snapshot() {
28961    return this.view.snapshot;
28962  }
28963}
28964function extendURLWithDeprecatedProperties(url) {
28965  Object.defineProperties(url, deprecatedLocationPropertyDescriptors);
28966}
28967var deprecatedLocationPropertyDescriptors = {
28968  absoluteURL: {
28969    get() {
28970      return this.toString();
28971    }
28972  }
28973};
28974var session = new Session(recentRequests);
28975var { cache, navigator: navigator2 } = session;
28976function start() {
28977  session.start();
28978}
28979function registerAdapter(adapter) {
28980  session.registerAdapter(adapter);
28981}
28982function visit(location2, options2) {
28983  session.visit(location2, options2);
28984}
28985function connectStreamSource(source) {
28986  session.connectStreamSource(source);
28987}
28988function disconnectStreamSource(source) {
28989  session.disconnectStreamSource(source);
28990}
28991function renderStreamMessage(message) {
28992  session.renderStreamMessage(message);
28993}
28994function setProgressBarDelay(delay) {
28995  console.warn("Please replace `Turbo.setProgressBarDelay(delay)` with `Turbo.config.drive.progressBarDelay = delay`. The top-level function is deprecated and will be removed in a future version of Turbo.`");
28996  config.drive.progressBarDelay = delay;
28997}
28998function setConfirmMethod(confirmMethod) {
28999  console.warn("Please replace `Turbo.setConfirmMethod(confirmMethod)` with `Turbo.config.forms.confirm = confirmMethod`. The top-level function is deprecated and will be removed in a future version of Turbo.`");
29000  config.forms.confirm = confirmMethod;
29001}
29002function setFormMode(mode) {
29003  console.warn("Please replace `Turbo.setFormMode(mode)` with `Turbo.config.forms.mode = mode`. The top-level function is deprecated and will be removed in a future version of Turbo.`");
29004  config.forms.mode = mode;
29005}
29006function morphBodyElements(currentBody, newBody) {
29007  MorphingPageRenderer.renderElement(currentBody, newBody);
29008}
29009function morphTurboFrameElements(currentFrame, newFrame) {
29010  MorphingFrameRenderer.renderElement(currentFrame, newFrame);
29011}
29012var Turbo2 = /* @__PURE__ */ Object.freeze({
29013  __proto__: null,
29014  navigator: navigator2,
29015  session,
29016  cache,
29017  PageRenderer,
29018  PageSnapshot,
29019  FrameRenderer,
29020  fetch: fetchWithTurboHeaders,
29021  config,
29022  start,
29023  registerAdapter,
29024  visit,
29025  connectStreamSource,
29026  disconnectStreamSource,
29027  renderStreamMessage,
29028  setProgressBarDelay,
29029  setConfirmMethod,
29030  setFormMode,
29031  morphBodyElements,
29032  morphTurboFrameElements,
29033  morphChildren,
29034  morphElements
29035});
29036
29037class TurboFrameMissingError extends Error {
29038}
29039
29040class FrameController {
29041  fetchResponseLoaded = (_fetchResponse) => Promise.resolve();
29042  #currentFetchRequest = null;
29043  #resolveVisitPromise = () => {};
29044  #connected = false;
29045  #hasBeenLoaded = false;
29046  #ignoredAttributes = new Set;
29047  #shouldMorphFrame = false;
29048  action = null;
29049  constructor(element) {
29050    this.element = element;
29051    this.view = new FrameView(this, this.element);
29052    this.appearanceObserver = new AppearanceObserver(this, this.element);
29053    this.formLinkClickObserver = new FormLinkClickObserver(this, this.element);
29054    this.linkInterceptor = new LinkInterceptor(this, this.element);
29055    this.restorationIdentifier = uuid();
29056    this.formSubmitObserver = new FormSubmitObserver(this, this.element);
29057  }
29058  connect() {
29059    if (!this.#connected) {
29060      this.#connected = true;
29061      if (this.loadingStyle == FrameLoadingStyle.lazy) {
29062        this.appearanceObserver.start();
29063      } else {
29064        this.#loadSourceURL();
29065      }
29066      this.formLinkClickObserver.start();
29067      this.linkInterceptor.start();
29068      this.formSubmitObserver.start();
29069    }
29070  }
29071  disconnect() {
29072    if (this.#connected) {
29073      this.#connected = false;
29074      this.appearanceObserver.stop();
29075      this.formLinkClickObserver.stop();
29076      this.linkInterceptor.stop();
29077      this.formSubmitObserver.stop();
29078      if (!this.element.hasAttribute("recurse")) {
29079        this.#currentFetchRequest?.cancel();
29080      }
29081    }
29082  }
29083  disabledChanged() {
29084    if (this.disabled) {
29085      this.#currentFetchRequest?.cancel();
29086    } else if (this.loadingStyle == FrameLoadingStyle.eager) {
29087      this.#loadSourceURL();
29088    }
29089  }
29090  sourceURLChanged() {
29091    if (this.#isIgnoringChangesTo("src"))
29092      return;
29093    if (!this.sourceURL) {
29094      this.#currentFetchRequest?.cancel();
29095    }
29096    if (this.element.isConnected) {
29097      this.complete = false;
29098    }
29099    if (this.loadingStyle == FrameLoadingStyle.eager || this.#hasBeenLoaded) {
29100      this.#loadSourceURL();
29101    }
29102  }
29103  sourceURLReloaded() {
29104    const { refresh, src } = this.element;
29105    this.#shouldMorphFrame = src && refresh === "morph";
29106    this.element.removeAttribute("complete");
29107    this.element.src = null;
29108    this.element.src = src;
29109    return this.element.loaded;
29110  }
29111  loadingStyleChanged() {
29112    if (this.loadingStyle == FrameLoadingStyle.lazy) {
29113      this.appearanceObserver.start();
29114    } else {
29115      this.appearanceObserver.stop();
29116      this.#loadSourceURL();
29117    }
29118  }
29119  async#loadSourceURL() {
29120    if (this.enabled && this.isActive && !this.complete && this.sourceURL) {
29121      this.element.loaded = this.#visit(expandURL(this.sourceURL));
29122      this.appearanceObserver.stop();
29123      await this.element.loaded;
29124      this.#hasBeenLoaded = true;
29125    }
29126  }
29127  async loadResponse(fetchResponse) {
29128    if (fetchResponse.redirected || fetchResponse.succeeded && fetchResponse.isHTML) {
29129      this.sourceURL = fetchResponse.response.url;
29130    }
29131    try {
29132      const html = await fetchResponse.responseHTML;
29133      if (html) {
29134        const document2 = parseHTMLDocument(html);
29135        const pageSnapshot = PageSnapshot.fromDocument(document2);
29136        if (pageSnapshot.isVisitable) {
29137          await this.#loadFrameResponse(fetchResponse, document2);
29138        } else {
29139          await this.#handleUnvisitableFrameResponse(fetchResponse);
29140        }
29141      }
29142    } finally {
29143      this.#shouldMorphFrame = false;
29144      this.fetchResponseLoaded = () => Promise.resolve();
29145    }
29146  }
29147  elementAppearedInViewport(element) {
29148    this.proposeVisitIfNavigatedWithAction(element, getVisitAction(element));
29149    this.#loadSourceURL();
29150  }
29151  willSubmitFormLinkToLocation(link) {
29152    return this.#shouldInterceptNavigation(link);
29153  }
29154  submittedFormLinkToLocation(link, _location, form) {
29155    const frame = this.#findFrameElement(link);
29156    if (frame)
29157      form.setAttribute("data-turbo-frame", frame.id);
29158  }
29159  shouldInterceptLinkClick(element, _location, _event) {
29160    return this.#shouldInterceptNavigation(element);
29161  }
29162  linkClickIntercepted(element, location2) {
29163    this.#navigateFrame(element, location2);
29164  }
29165  willSubmitForm(element, submitter) {
29166    return element.closest("turbo-frame") == this.element && this.#shouldInterceptNavigation(element, submitter);
29167  }
29168  formSubmitted(element, submitter) {
29169    if (this.formSubmission) {
29170      this.formSubmission.stop();
29171    }
29172    this.formSubmission = new FormSubmission(this, element, submitter);
29173    const { fetchRequest } = this.formSubmission;
29174    const frame = this.#findFrameElement(element, submitter);
29175    this.prepareRequest(fetchRequest, frame);
29176    this.formSubmission.start();
29177  }
29178  prepareRequest(request, frame = this) {
29179    request.headers["Turbo-Frame"] = frame.id;
29180    if (this.currentNavigationElement?.hasAttribute("data-turbo-stream")) {
29181      request.acceptResponseType(StreamMessage.contentType);
29182    }
29183  }
29184  requestStarted(_request) {
29185    markAsBusy(this.element);
29186  }
29187  requestPreventedHandlingResponse(_request, _response) {
29188    this.#resolveVisitPromise();
29189  }
29190  async requestSucceededWithResponse(request, response) {
29191    await this.loadResponse(response);
29192    this.#resolveVisitPromise();
29193  }
29194  async requestFailedWithResponse(request, response) {
29195    await this.loadResponse(response);
29196    this.#resolveVisitPromise();
29197  }
29198  requestErrored(request, error) {
29199    console.error(error);
29200    this.#resolveVisitPromise();
29201  }
29202  requestFinished(_request) {
29203    clearBusyState(this.element);
29204  }
29205  formSubmissionStarted({ formElement }) {
29206    markAsBusy(formElement, this.#findFrameElement(formElement));
29207  }
29208  formSubmissionSucceededWithResponse(formSubmission, response) {
29209    const frame = this.#findFrameElement(formSubmission.formElement, formSubmission.submitter);
29210    frame.delegate.proposeVisitIfNavigatedWithAction(frame, getVisitAction(formSubmission.submitter, formSubmission.formElement, frame));
29211    frame.delegate.loadResponse(response);
29212    if (!formSubmission.isSafe) {
29213      session.clearCache();
29214    }
29215  }
29216  formSubmissionFailedWithResponse(formSubmission, fetchResponse) {
29217    this.element.delegate.loadResponse(fetchResponse);
29218    session.clearCache();
29219  }
29220  formSubmissionErrored(formSubmission, error) {
29221    console.error(error);
29222  }
29223  formSubmissionFinished({ formElement }) {
29224    clearBusyState(formElement, this.#findFrameElement(formElement));
29225  }
29226  allowsImmediateRender({ element: newFrame }, options2) {
29227    const event = dispatch("turbo:before-frame-render", {
29228      target: this.element,
29229      detail: { newFrame, ...options2 },
29230      cancelable: true
29231    });
29232    const {
29233      defaultPrevented,
29234      detail: { render }
29235    } = event;
29236    if (this.view.renderer && render) {
29237      this.view.renderer.renderElement = render;
29238    }
29239    return !defaultPrevented;
29240  }
29241  viewRenderedSnapshot(_snapshot, _isPreview, _renderMethod) {}
29242  preloadOnLoadLinksForView(element) {
29243    session.preloadOnLoadLinksForView(element);
29244  }
29245  viewInvalidated() {}
29246  willRenderFrame(currentElement, _newElement) {
29247    this.previousFrameElement = currentElement.cloneNode(true);
29248  }
29249  visitCachedSnapshot = ({ element }) => {
29250    const frame = element.querySelector("#" + this.element.id);
29251    if (frame && this.previousFrameElement) {
29252      frame.replaceChildren(...this.previousFrameElement.children);
29253    }
29254    delete this.previousFrameElement;
29255  };
29256  async#loadFrameResponse(fetchResponse, document2) {
29257    const newFrameElement = await this.extractForeignFrameElement(document2.body);
29258    const rendererClass = this.#shouldMorphFrame ? MorphingFrameRenderer : FrameRenderer;
29259    if (newFrameElement) {
29260      const snapshot = new Snapshot(newFrameElement);
29261      const renderer = new rendererClass(this, this.view.snapshot, snapshot, false, false);
29262      if (this.view.renderPromise)
29263        await this.view.renderPromise;
29264      this.changeHistory();
29265      await this.view.render(renderer);
29266      this.complete = true;
29267      session.frameRendered(fetchResponse, this.element);
29268      session.frameLoaded(this.element);
29269      await this.fetchResponseLoaded(fetchResponse);
29270    } else if (this.#willHandleFrameMissingFromResponse(fetchResponse)) {
29271      this.#handleFrameMissingFromResponse(fetchResponse);
29272    }
29273  }
29274  async#visit(url) {
29275    const request = new FetchRequest(this, FetchMethod.get, url, new URLSearchParams, this.element);
29276    this.#currentFetchRequest?.cancel();
29277    this.#currentFetchRequest = request;
29278    return new Promise((resolve) => {
29279      this.#resolveVisitPromise = () => {
29280        this.#resolveVisitPromise = () => {};
29281        this.#currentFetchRequest = null;
29282        resolve();
29283      };
29284      request.perform();
29285    });
29286  }
29287  #navigateFrame(element, url, submitter) {
29288    const frame = this.#findFrameElement(element, submitter);
29289    frame.delegate.proposeVisitIfNavigatedWithAction(frame, getVisitAction(submitter, element, frame));
29290    this.#withCurrentNavigationElement(element, () => {
29291      frame.src = url;
29292    });
29293  }
29294  proposeVisitIfNavigatedWithAction(frame, action = null) {
29295    this.action = action;
29296    if (this.action) {
29297      const pageSnapshot = PageSnapshot.fromElement(frame).clone();
29298      const { visitCachedSnapshot } = frame.delegate;
29299      frame.delegate.fetchResponseLoaded = async (fetchResponse) => {
29300        if (frame.src) {
29301          const { statusCode, redirected } = fetchResponse;
29302          const responseHTML = await fetchResponse.responseHTML;
29303          const response = { statusCode, redirected, responseHTML };
29304          const options2 = {
29305            response,
29306            visitCachedSnapshot,
29307            willRender: false,
29308            updateHistory: false,
29309            restorationIdentifier: this.restorationIdentifier,
29310            snapshot: pageSnapshot
29311          };
29312          if (this.action)
29313            options2.action = this.action;
29314          session.visit(frame.src, options2);
29315        }
29316      };
29317    }
29318  }
29319  changeHistory() {
29320    if (this.action) {
29321      const method = getHistoryMethodForAction(this.action);
29322      session.history.update(method, expandURL(this.element.src || ""), this.restorationIdentifier);
29323    }
29324  }
29325  async#handleUnvisitableFrameResponse(fetchResponse) {
29326    console.warn(`The response (${fetchResponse.statusCode}) from <turbo-frame id="${this.element.id}"> is performing a full page visit due to turbo-visit-control.`);
29327    await this.#visitResponse(fetchResponse.response);
29328  }
29329  #willHandleFrameMissingFromResponse(fetchResponse) {
29330    this.element.setAttribute("complete", "");
29331    const response = fetchResponse.response;
29332    const visit2 = async (url, options2) => {
29333      if (url instanceof Response) {
29334        this.#visitResponse(url);
29335      } else {
29336        session.visit(url, options2);
29337      }
29338    };
29339    const event = dispatch("turbo:frame-missing", {
29340      target: this.element,
29341      detail: { response, visit: visit2 },
29342      cancelable: true
29343    });
29344    return !event.defaultPrevented;
29345  }
29346  #handleFrameMissingFromResponse(fetchResponse) {
29347    this.view.missing();
29348    this.#throwFrameMissingError(fetchResponse);
29349  }
29350  #throwFrameMissingError(fetchResponse) {
29351    const message = `The response (${fetchResponse.statusCode}) did not contain the expected <turbo-frame id="${this.element.id}"> and will be ignored. To perform a full page visit instead, set turbo-visit-control to reload.`;
29352    throw new TurboFrameMissingError(message);
29353  }
29354  async#visitResponse(response) {
29355    const wrapped = new FetchResponse(response);
29356    const responseHTML = await wrapped.responseHTML;
29357    const { location: location2, redirected, statusCode } = wrapped;
29358    return session.visit(location2, { response: { redirected, statusCode, responseHTML } });
29359  }
29360  #findFrameElement(element, submitter) {
29361    const id = getAttribute("data-turbo-frame", submitter, element) || this.element.getAttribute("target");
29362    const target = this.#getFrameElementById(id);
29363    return target instanceof FrameElement ? target : this.element;
29364  }
29365  async extractForeignFrameElement(container) {
29366    let element;
29367    const id = CSS.escape(this.id);
29368    try {
29369      element = activateElement(container.querySelector(`turbo-frame#${id}`), this.sourceURL);
29370      if (element) {
29371        return element;
29372      }
29373      element = activateElement(container.querySelector(`turbo-frame[src][recurse~=${id}]`), this.sourceURL);
29374      if (element) {
29375        await element.loaded;
29376        return await this.extractForeignFrameElement(element);
29377      }
29378    } catch (error) {
29379      console.error(error);
29380      return new FrameElement;
29381    }
29382    return null;
29383  }
29384  #formActionIsVisitable(form, submitter) {
29385    const action = getAction$1(form, submitter);
29386    return locationIsVisitable(expandURL(action), this.rootLocation);
29387  }
29388  #shouldInterceptNavigation(element, submitter) {
29389    const id = getAttribute("data-turbo-frame", submitter, element) || this.element.getAttribute("target");
29390    if (element instanceof HTMLFormElement && !this.#formActionIsVisitable(element, submitter)) {
29391      return false;
29392    }
29393    if (!this.enabled || id == "_top") {
29394      return false;
29395    }
29396    if (id) {
29397      const frameElement = this.#getFrameElementById(id);
29398      if (frameElement) {
29399        return !frameElement.disabled;
29400      } else if (id == "_parent") {
29401        return false;
29402      }
29403    }
29404    if (!session.elementIsNavigatable(element)) {
29405      return false;
29406    }
29407    if (submitter && !session.elementIsNavigatable(submitter)) {
29408      return false;
29409    }
29410    return true;
29411  }
29412  get id() {
29413    return this.element.id;
29414  }
29415  get disabled() {
29416    return this.element.disabled;
29417  }
29418  get enabled() {
29419    return !this.disabled;
29420  }
29421  get sourceURL() {
29422    if (this.element.src) {
29423      return this.element.src;
29424    }
29425  }
29426  set sourceURL(sourceURL) {
29427    this.#ignoringChangesToAttribute("src", () => {
29428      this.element.src = sourceURL ?? null;
29429    });
29430  }
29431  get loadingStyle() {
29432    return this.element.loading;
29433  }
29434  get isLoading() {
29435    return this.formSubmission !== undefined || this.#resolveVisitPromise() !== undefined;
29436  }
29437  get complete() {
29438    return this.element.hasAttribute("complete");
29439  }
29440  set complete(value) {
29441    if (value) {
29442      this.element.setAttribute("complete", "");
29443    } else {
29444      this.element.removeAttribute("complete");
29445    }
29446  }
29447  get isActive() {
29448    return this.element.isActive && this.#connected;
29449  }
29450  get rootLocation() {
29451    const meta = this.element.ownerDocument.querySelector(`meta[name="turbo-root"]`);
29452    const root2 = meta?.content ?? "/";
29453    return expandURL(root2);
29454  }
29455  #isIgnoringChangesTo(attributeName) {
29456    return this.#ignoredAttributes.has(attributeName);
29457  }
29458  #ignoringChangesToAttribute(attributeName, callback) {
29459    this.#ignoredAttributes.add(attributeName);
29460    callback();
29461    this.#ignoredAttributes.delete(attributeName);
29462  }
29463  #withCurrentNavigationElement(element, callback) {
29464    this.currentNavigationElement = element;
29465    callback();
29466    delete this.currentNavigationElement;
29467  }
29468  #getFrameElementById(id) {
29469    if (id != null) {
29470      const element = id === "_parent" ? this.element.parentElement.closest("turbo-frame") : document.getElementById(id);
29471      if (element instanceof FrameElement) {
29472        return element;
29473      }
29474    }
29475  }
29476}
29477function activateElement(element, currentURL) {
29478  if (element) {
29479    const src = element.getAttribute("src");
29480    if (src != null && currentURL != null && urlsAreEqual(src, currentURL)) {
29481      throw new Error(`Matching <turbo-frame id="${element.id}"> element has a source URL which references itself`);
29482    }
29483    if (element.ownerDocument !== document) {
29484      element = document.importNode(element, true);
29485    }
29486    if (element instanceof FrameElement) {
29487      element.connectedCallback();
29488      element.disconnectedCallback();
29489      return element;
29490    }
29491  }
29492}
29493var StreamActions = {
29494  after() {
29495    this.removeDuplicateTargetSiblings();
29496    this.targetElements.forEach((e) => e.parentElement?.insertBefore(this.templateContent, e.nextSibling));
29497  },
29498  append() {
29499    this.removeDuplicateTargetChildren();
29500    this.targetElements.forEach((e) => e.append(this.templateContent));
29501  },
29502  before() {
29503    this.removeDuplicateTargetSiblings();
29504    this.targetElements.forEach((e) => e.parentElement?.insertBefore(this.templateContent, e));
29505  },
29506  prepend() {
29507    this.removeDuplicateTargetChildren();
29508    this.targetElements.forEach((e) => e.prepend(this.templateContent));
29509  },
29510  remove() {
29511    this.targetElements.forEach((e) => e.remove());
29512  },
29513  replace() {
29514    const method = this.getAttribute("method");
29515    this.targetElements.forEach((targetElement) => {
29516      if (method === "morph") {
29517        morphElements(targetElement, this.templateContent);
29518      } else {
29519        targetElement.replaceWith(this.templateContent);
29520      }
29521    });
29522  },
29523  update() {
29524    const method = this.getAttribute("method");
29525    this.targetElements.forEach((targetElement) => {
29526      if (method === "morph") {
29527        morphChildren(targetElement, this.templateContent);
29528      } else {
29529        targetElement.innerHTML = "";
29530        targetElement.append(this.templateContent);
29531      }
29532    });
29533  },
29534  refresh() {
29535    const method = this.getAttribute("method");
29536    const requestId = this.requestId;
29537    const scroll = this.getAttribute("scroll");
29538    session.refresh(this.baseURI, { method, requestId, scroll });
29539  }
29540};
29541
29542class StreamElement extends HTMLElement {
29543  static async renderElement(newElement) {
29544    await newElement.performAction();
29545  }
29546  async connectedCallback() {
29547    try {
29548      await this.render();
29549    } catch (error) {
29550      console.error(error);
29551    } finally {
29552      this.disconnect();
29553    }
29554  }
29555  async render() {
29556    return this.renderPromise ??= (async () => {
29557      const event = this.beforeRenderEvent;
29558      if (this.dispatchEvent(event)) {
29559        await nextRepaint();
29560        await event.detail.render(this);
29561      }
29562    })();
29563  }
29564  disconnect() {
29565    try {
29566      this.remove();
29567    } catch {}
29568  }
29569  removeDuplicateTargetChildren() {
29570    this.duplicateChildren.forEach((c) => c.remove());
29571  }
29572  get duplicateChildren() {
29573    const existingChildren = this.targetElements.flatMap((e) => [...e.children]).filter((c) => !!c.getAttribute("id"));
29574    const newChildrenIds = [...this.templateContent?.children || []].filter((c) => !!c.getAttribute("id")).map((c) => c.getAttribute("id"));
29575    return existingChildren.filter((c) => newChildrenIds.includes(c.getAttribute("id")));
29576  }
29577  removeDuplicateTargetSiblings() {
29578    this.duplicateSiblings.forEach((c) => c.remove());
29579  }
29580  get duplicateSiblings() {
29581    const existingChildren = this.targetElements.flatMap((e) => [...e.parentElement.children]).filter((c) => !!c.id);
29582    const newChildrenIds = [...this.templateContent?.children || []].filter((c) => !!c.id).map((c) => c.id);
29583    return existingChildren.filter((c) => newChildrenIds.includes(c.id));
29584  }
29585  get performAction() {
29586    if (this.action) {
29587      const actionFunction = StreamActions[this.action];
29588      if (actionFunction) {
29589        return actionFunction;
29590      }
29591      this.#raise("unknown action");
29592    }
29593    this.#raise("action attribute is missing");
29594  }
29595  get targetElements() {
29596    if (this.target) {
29597      return this.targetElementsById;
29598    } else if (this.targets) {
29599      return this.targetElementsByQuery;
29600    } else {
29601      this.#raise("target or targets attribute is missing");
29602    }
29603  }
29604  get templateContent() {
29605    return this.templateElement.content.cloneNode(true);
29606  }
29607  get templateElement() {
29608    if (this.firstElementChild === null) {
29609      const template = this.ownerDocument.createElement("template");
29610      this.appendChild(template);
29611      return template;
29612    } else if (this.firstElementChild instanceof HTMLTemplateElement) {
29613      return this.firstElementChild;
29614    }
29615    this.#raise("first child element must be a <template> element");
29616  }
29617  get action() {
29618    return this.getAttribute("action");
29619  }
29620  get target() {
29621    return this.getAttribute("target");
29622  }
29623  get targets() {
29624    return this.getAttribute("targets");
29625  }
29626  get requestId() {
29627    return this.getAttribute("request-id");
29628  }
29629  #raise(message) {
29630    throw new Error(`${this.description}: ${message}`);
29631  }
29632  get description() {
29633    return (this.outerHTML.match(/<[^>]+>/) ?? [])[0] ?? "<turbo-stream>";
29634  }
29635  get beforeRenderEvent() {
29636    return new CustomEvent("turbo:before-stream-render", {
29637      bubbles: true,
29638      cancelable: true,
29639      detail: { newStream: this, render: StreamElement.renderElement }
29640    });
29641  }
29642  get targetElementsById() {
29643    const element = this.ownerDocument?.getElementById(this.target);
29644    if (element !== null) {
29645      return [element];
29646    } else {
29647      return [];
29648    }
29649  }
29650  get targetElementsByQuery() {
29651    const elements = this.ownerDocument?.querySelectorAll(this.targets);
29652    if (elements.length !== 0) {
29653      return Array.prototype.slice.call(elements);
29654    } else {
29655      return [];
29656    }
29657  }
29658}
29659
29660class StreamSourceElement extends HTMLElement {
29661  streamSource = null;
29662  connectedCallback() {
29663    this.streamSource = this.src.match(/^ws{1,2}:/) ? new WebSocket(this.src) : new EventSource(this.src);
29664    connectStreamSource(this.streamSource);
29665  }
29666  disconnectedCallback() {
29667    if (this.streamSource) {
29668      this.streamSource.close();
29669      disconnectStreamSource(this.streamSource);
29670    }
29671  }
29672  get src() {
29673    return this.getAttribute("src") || "";
29674  }
29675}
29676FrameElement.delegateConstructor = FrameController;
29677if (customElements.get("turbo-frame") === undefined) {
29678  customElements.define("turbo-frame", FrameElement);
29679}
29680if (customElements.get("turbo-stream") === undefined) {
29681  customElements.define("turbo-stream", StreamElement);
29682}
29683if (customElements.get("turbo-stream-source") === undefined) {
29684  customElements.define("turbo-stream-source", StreamSourceElement);
29685}
29686(() => {
29687  const scriptElement = document.currentScript;
29688  if (!scriptElement)
29689    return;
29690  if (scriptElement.hasAttribute("data-turbo-suppress-warning"))
29691    return;
29692  let element = scriptElement.parentElement;
29693  while (element) {
29694    if (element == document.body) {
29695      return console.warn(unindent`
29696        You are loading Turbo from a <script> element inside the <body> element. This is probably not what you meant to do!
29697
29698        Load your applicationâs JavaScript bundle inside the <head> element instead. <script> elements in <body> are evaluated with each page change.
29699
29700        For more information, see: https://turbo.hotwired.dev/handbook/building#working-with-script-elements
29701
29702        ââ
29703        Suppress this warning by adding a "data-turbo-suppress-warning" attribute to: %s
29704      `, scriptElement.outerHTML);
29705    }
29706    element = element.parentElement;
29707  }
29708})();
29709window.Turbo = { ...Turbo2, StreamActions };
29710start();
29711

vendor: 515 bytes, lines 29712-29728

29712// node_modules/@hotwired/turbo-rails/app/javascript/turbo/cable.js
29713var consumer;
29714async function getConsumer() {
29715  return consumer || setConsumer(createConsumer2().then(setConsumer));
29716}
29717function setConsumer(newConsumer) {
29718  return consumer = newConsumer;
29719}
29720async function createConsumer2() {
29721  await Promise.resolve().then(() => init_src());
29722  return createConsumer();
29723}
29724async function subscribeTo(channel, mixin) {
29725  const { subscriptions } = await getConsumer();
29726  return subscriptions.create(channel, mixin);
29727}
29728

vendor: 529 bytes, lines 29729-29745

29729// node_modules/@hotwired/turbo-rails/app/javascript/turbo/snakeize.js
29730function walk(obj2) {
29731  if (!obj2 || typeof obj2 !== "object")
29732    return obj2;
29733  if (obj2 instanceof Date || obj2 instanceof RegExp)
29734    return obj2;
29735  if (Array.isArray(obj2))
29736    return obj2.map(walk);
29737  return Object.keys(obj2).reduce(function(acc, key) {
29738    var camel = key[0].toLowerCase() + key.slice(1).replace(/([A-Z]+)/g, function(m2, x) {
29739      return "_" + x.toLowerCase();
29740    });
29741    acc[camel] = walk(obj2[key]);
29742    return acc;
29743  }, {});
29744}
29745

vendor: 1,473 bytes, lines 29746-29788

29746// node_modules/@hotwired/turbo-rails/app/javascript/turbo/cable_stream_source_element.js
29747class TurboCableStreamSourceElement extends HTMLElement {
29748  static observedAttributes = ["channel", "signed-stream-name"];
29749  async connectedCallback() {
29750    connectStreamSource(this);
29751    this.subscription = await subscribeTo(this.channel, {
29752      received: this.dispatchMessageEvent.bind(this),
29753      connected: this.subscriptionConnected.bind(this),
29754      disconnected: this.subscriptionDisconnected.bind(this)
29755    });
29756  }
29757  disconnectedCallback() {
29758    disconnectStreamSource(this);
29759    if (this.subscription)
29760      this.subscription.unsubscribe();
29761    this.subscriptionDisconnected();
29762  }
29763  attributeChangedCallback() {
29764    if (this.subscription) {
29765      this.disconnectedCallback();
29766      this.connectedCallback();
29767    }
29768  }
29769  dispatchMessageEvent(data) {
29770    const event = new MessageEvent("message", { data });
29771    return this.dispatchEvent(event);
29772  }
29773  subscriptionConnected() {
29774    this.setAttribute("connected", "");
29775  }
29776  subscriptionDisconnected() {
29777    this.removeAttribute("connected");
29778  }
29779  get channel() {
29780    const channel = this.getAttribute("channel");
29781    const signed_stream_name = this.getAttribute("signed-stream-name");
29782    return { channel, signed_stream_name, ...walk({ ...this.dataset }) };
29783  }
29784}
29785if (customElements.get("turbo-cable-stream-source") === undefined) {
29786  customElements.define("turbo-cable-stream-source", TurboCableStreamSourceElement);
29787}
29788

vendor: 1,587 bytes, lines 29789-29835

29789// node_modules/@hotwired/turbo-rails/app/javascript/turbo/fetch_requests.js
29790function encodeMethodIntoRequestBody(event) {
29791  if (event.target instanceof HTMLFormElement) {
29792    const { target: form, detail: { fetchOptions } } = event;
29793    form.addEventListener("turbo:submit-start", ({ detail: { formSubmission: { submitter } } }) => {
29794      const body = isBodyInit(fetchOptions.body) ? fetchOptions.body : new URLSearchParams;
29795      const method = determineFetchMethod(submitter, body, form);
29796      if (!/get/i.test(method)) {
29797        if (/post/i.test(method)) {
29798          body.delete("_method");
29799        } else {
29800          body.set("_method", method);
29801        }
29802        fetchOptions.method = "post";
29803      }
29804    }, { once: true });
29805  }
29806}
29807function determineFetchMethod(submitter, body, form) {
29808  const formMethod = determineFormMethod(submitter);
29809  const overrideMethod = body.get("_method");
29810  const method = form.getAttribute("method") || "get";
29811  if (typeof formMethod == "string") {
29812    return formMethod;
29813  } else if (typeof overrideMethod == "string") {
29814    return overrideMethod;
29815  } else {
29816    return method;
29817  }
29818}
29819function determineFormMethod(submitter) {
29820  if (submitter instanceof HTMLButtonElement || submitter instanceof HTMLInputElement) {
29821    if (submitter.name === "_method") {
29822      return submitter.value;
29823    } else if (submitter.hasAttribute("formmethod")) {
29824      return submitter.formMethod;
29825    } else {
29826      return null;
29827    }
29828  } else {
29829    return null;
29830  }
29831}
29832function isBodyInit(body) {
29833  return body instanceof FormData || body instanceof URLSearchParams;
29834}
29835

vendor: 187 bytes, lines 29836-29839

29836// node_modules/@hotwired/turbo-rails/app/javascript/turbo/index.js
29837window.Turbo = exports_turbo_es2017_esm;
29838addEventListener("turbo:before-fetch-request", encodeMethodIntoRequestBody);
29839

vendor: 78,789 bytes, lines 29840-32308

29840// node_modules/@hotwired/stimulus/dist/stimulus.js
29841class EventListener {
29842  constructor(eventTarget, eventName, eventOptions) {
29843    this.eventTarget = eventTarget;
29844    this.eventName = eventName;
29845    this.eventOptions = eventOptions;
29846    this.unorderedBindings = new Set;
29847  }
29848  connect() {
29849    this.eventTarget.addEventListener(this.eventName, this, this.eventOptions);
29850  }
29851  disconnect() {
29852    this.eventTarget.removeEventListener(this.eventName, this, this.eventOptions);
29853  }
29854  bindingConnected(binding) {
29855    this.unorderedBindings.add(binding);
29856  }
29857  bindingDisconnected(binding) {
29858    this.unorderedBindings.delete(binding);
29859  }
29860  handleEvent(event) {
29861    const extendedEvent = extendEvent(event);
29862    for (const binding of this.bindings) {
29863      if (extendedEvent.immediatePropagationStopped) {
29864        break;
29865      } else {
29866        binding.handleEvent(extendedEvent);
29867      }
29868    }
29869  }
29870  hasBindings() {
29871    return this.unorderedBindings.size > 0;
29872  }
29873  get bindings() {
29874    return Array.from(this.unorderedBindings).sort((left, right) => {
29875      const leftIndex = left.index, rightIndex = right.index;
29876      return leftIndex < rightIndex ? -1 : leftIndex > rightIndex ? 1 : 0;
29877    });
29878  }
29879}
29880function extendEvent(event) {
29881  if ("immediatePropagationStopped" in event) {
29882    return event;
29883  } else {
29884    const { stopImmediatePropagation } = event;
29885    return Object.assign(event, {
29886      immediatePropagationStopped: false,
29887      stopImmediatePropagation() {
29888        this.immediatePropagationStopped = true;
29889        stopImmediatePropagation.call(this);
29890      }
29891    });
29892  }
29893}
29894
29895class Dispatcher {
29896  constructor(application) {
29897    this.application = application;
29898    this.eventListenerMaps = new Map;
29899    this.started = false;
29900  }
29901  start() {
29902    if (!this.started) {
29903      this.started = true;
29904      this.eventListeners.forEach((eventListener) => eventListener.connect());
29905    }
29906  }
29907  stop() {
29908    if (this.started) {
29909      this.started = false;
29910      this.eventListeners.forEach((eventListener) => eventListener.disconnect());
29911    }
29912  }
29913  get eventListeners() {
29914    return Array.from(this.eventListenerMaps.values()).reduce((listeners, map) => listeners.concat(Array.from(map.values())), []);
29915  }
29916  bindingConnected(binding) {
29917    this.fetchEventListenerForBinding(binding).bindingConnected(binding);
29918  }
29919  bindingDisconnected(binding, clearEventListeners = false) {
29920    this.fetchEventListenerForBinding(binding).bindingDisconnected(binding);
29921    if (clearEventListeners)
29922      this.clearEventListenersForBinding(binding);
29923  }
29924  handleError(error, message, detail = {}) {
29925    this.application.handleError(error, `Error ${message}`, detail);
29926  }
29927  clearEventListenersForBinding(binding) {
29928    const eventListener = this.fetchEventListenerForBinding(binding);
29929    if (!eventListener.hasBindings()) {
29930      eventListener.disconnect();
29931      this.removeMappedEventListenerFor(binding);
29932    }
29933  }
29934  removeMappedEventListenerFor(binding) {
29935    const { eventTarget, eventName, eventOptions } = binding;
29936    const eventListenerMap = this.fetchEventListenerMapForEventTarget(eventTarget);
29937    const cacheKey = this.cacheKey(eventName, eventOptions);
29938    eventListenerMap.delete(cacheKey);
29939    if (eventListenerMap.size == 0)
29940      this.eventListenerMaps.delete(eventTarget);
29941  }
29942  fetchEventListenerForBinding(binding) {
29943    const { eventTarget, eventName, eventOptions } = binding;
29944    return this.fetchEventListener(eventTarget, eventName, eventOptions);
29945  }
29946  fetchEventListener(eventTarget, eventName, eventOptions) {
29947    const eventListenerMap = this.fetchEventListenerMapForEventTarget(eventTarget);
29948    const cacheKey = this.cacheKey(eventName, eventOptions);
29949    let eventListener = eventListenerMap.get(cacheKey);
29950    if (!eventListener) {
29951      eventListener = this.createEventListener(eventTarget, eventName, eventOptions);
29952      eventListenerMap.set(cacheKey, eventListener);
29953    }
29954    return eventListener;
29955  }
29956  createEventListener(eventTarget, eventName, eventOptions) {
29957    const eventListener = new EventListener(eventTarget, eventName, eventOptions);
29958    if (this.started) {
29959      eventListener.connect();
29960    }
29961    return eventListener;
29962  }
29963  fetchEventListenerMapForEventTarget(eventTarget) {
29964    let eventListenerMap = this.eventListenerMaps.get(eventTarget);
29965    if (!eventListenerMap) {
29966      eventListenerMap = new Map;
29967      this.eventListenerMaps.set(eventTarget, eventListenerMap);
29968    }
29969    return eventListenerMap;
29970  }
29971  cacheKey(eventName, eventOptions) {
29972    const parts = [eventName];
29973    Object.keys(eventOptions).sort().forEach((key) => {
29974      parts.push(`${eventOptions[key] ? "" : "!"}${key}`);
29975    });
29976    return parts.join(":");
29977  }
29978}
29979var defaultActionDescriptorFilters = {
29980  stop({ event, value }) {
29981    if (value)
29982      event.stopPropagation();
29983    return true;
29984  },
29985  prevent({ event, value }) {
29986    if (value)
29987      event.preventDefault();
29988    return true;
29989  },
29990  self({ event, value, element }) {
29991    if (value) {
29992      return element === event.target;
29993    } else {
29994      return true;
29995    }
29996  }
29997};
29998var descriptorPattern = /^(?:(?:([^.]+?)\+)?(.+?)(?:\.(.+?))?(?:@(window|document))?->)?(.+?)(?:#([^:]+?))(?::(.+))?$/;
29999function parseActionDescriptorString(descriptorString) {
30000  const source = descriptorString.trim();
30001  const matches = source.match(descriptorPattern) || [];
30002  let eventName = matches[2];
30003  let keyFilter = matches[3];
30004  if (keyFilter && !["keydown", "keyup", "keypress"].includes(eventName)) {
30005    eventName += `.${keyFilter}`;
30006    keyFilter = "";
30007  }
30008  return {
30009    eventTarget: parseEventTarget(matches[4]),
30010    eventName,
30011    eventOptions: matches[7] ? parseEventOptions(matches[7]) : {},
30012    identifier: matches[5],
30013    methodName: matches[6],
30014    keyFilter: matches[1] || keyFilter
30015  };
30016}
30017function parseEventTarget(eventTargetName) {
30018  if (eventTargetName == "window") {
30019    return window;
30020  } else if (eventTargetName == "document") {
30021    return document;
30022  }
30023}
30024function parseEventOptions(eventOptions) {
30025  return eventOptions.split(":").reduce((options2, token) => Object.assign(options2, { [token.replace(/^!/, "")]: !/^!/.test(token) }), {});
30026}
30027function stringifyEventTarget(eventTarget) {
30028  if (eventTarget == window) {
30029    return "window";
30030  } else if (eventTarget == document) {
30031    return "document";
30032  }
30033}
30034function camelize(value) {
30035  return value.replace(/(?:[_-])([a-z0-9])/g, (_, char) => char.toUpperCase());
30036}
30037function namespaceCamelize(value) {
30038  return camelize(value.replace(/--/g, "-").replace(/__/g, "_"));
30039}
30040function capitalize(value) {
30041  return value.charAt(0).toUpperCase() + value.slice(1);
30042}
30043function dasherize(value) {
30044  return value.replace(/([A-Z])/g, (_, char) => `-${char.toLowerCase()}`);
30045}
30046function tokenize(value) {
30047  return value.match(/[^\s]+/g) || [];
30048}
30049function isSomething(object) {
30050  return object !== null && object !== undefined;
30051}
30052function hasProperty(object, property) {
30053  return Object.prototype.hasOwnProperty.call(object, property);
30054}
30055var allModifiers = ["meta", "ctrl", "alt", "shift"];
30056
30057class Action {
30058  constructor(element, index, descriptor, schema) {
30059    this.element = element;
30060    this.index = index;
30061    this.eventTarget = descriptor.eventTarget || element;
30062    this.eventName = descriptor.eventName || getDefaultEventNameForElement(element) || error("missing event name");
30063    this.eventOptions = descriptor.eventOptions || {};
30064    this.identifier = descriptor.identifier || error("missing identifier");
30065    this.methodName = descriptor.methodName || error("missing method name");
30066    this.keyFilter = descriptor.keyFilter || "";
30067    this.schema = schema;
30068  }
30069  static forToken(token, schema) {
30070    return new this(token.element, token.index, parseActionDescriptorString(token.content), schema);
30071  }
30072  toString() {
30073    const eventFilter = this.keyFilter ? `.${this.keyFilter}` : "";
30074    const eventTarget = this.eventTargetName ? `@${this.eventTargetName}` : "";
30075    return `${this.eventName}${eventFilter}${eventTarget}->${this.identifier}#${this.methodName}`;
30076  }
30077  shouldIgnoreKeyboardEvent(event) {
30078    if (!this.keyFilter) {
30079      return false;
30080    }
30081    const filters = this.keyFilter.split("+");
30082    if (this.keyFilterDissatisfied(event, filters)) {
30083      return true;
30084    }
30085    const standardFilter = filters.filter((key) => !allModifiers.includes(key))[0];
30086    if (!standardFilter) {
30087      return false;
30088    }
30089    if (!hasProperty(this.keyMappings, standardFilter)) {
30090      error(`contains unknown key filter: ${this.keyFilter}`);
30091    }
30092    return this.keyMappings[standardFilter].toLowerCase() !== event.key.toLowerCase();
30093  }
30094  shouldIgnoreMouseEvent(event) {
30095    if (!this.keyFilter) {
30096      return false;
30097    }
30098    const filters = [this.keyFilter];
30099    if (this.keyFilterDissatisfied(event, filters)) {
30100      return true;
30101    }
30102    return false;
30103  }
30104  get params() {
30105    const params = {};
30106    const pattern = new RegExp(`^data-${this.identifier}-(.+)-param$`, "i");
30107    for (const { name, value } of Array.from(this.element.attributes)) {
30108      const match = name.match(pattern);
30109      const key = match && match[1];
30110      if (key) {
30111        params[camelize(key)] = typecast(value);
30112      }
30113    }
30114    return params;
30115  }
30116  get eventTargetName() {
30117    return stringifyEventTarget(this.eventTarget);
30118  }
30119  get keyMappings() {
30120    return this.schema.keyMappings;
30121  }
30122  keyFilterDissatisfied(event, filters) {
30123    const [meta, ctrl, alt, shift] = allModifiers.map((modifier) => filters.includes(modifier));
30124    return event.metaKey !== meta || event.ctrlKey !== ctrl || event.altKey !== alt || event.shiftKey !== shift;
30125  }
30126}
30127var defaultEventNames = {
30128  a: () => "click",
30129  button: () => "click",
30130  form: () => "submit",
30131  details: () => "toggle",
30132  input: (e) => e.getAttribute("type") == "submit" ? "click" : "input",
30133  select: () => "change",
30134  textarea: () => "input"
30135};
30136function getDefaultEventNameForElement(element) {
30137  const tagName = element.tagName.toLowerCase();
30138  if (tagName in defaultEventNames) {
30139    return defaultEventNames[tagName](element);
30140  }
30141}
30142function error(message) {
30143  throw new Error(message);
30144}
30145function typecast(value) {
30146  try {
30147    return JSON.parse(value);
30148  } catch (o_O) {
30149    return value;
30150  }
30151}
30152
30153class Binding {
30154  constructor(context, action) {
30155    this.context = context;
30156    this.action = action;
30157  }
30158  get index() {
30159    return this.action.index;
30160  }
30161  get eventTarget() {
30162    return this.action.eventTarget;
30163  }
30164  get eventOptions() {
30165    return this.action.eventOptions;
30166  }
30167  get identifier() {
30168    return this.context.identifier;
30169  }
30170  handleEvent(event) {
30171    const actionEvent = this.prepareActionEvent(event);
30172    if (this.willBeInvokedByEvent(event) && this.applyEventModifiers(actionEvent)) {
30173      this.invokeWithEvent(actionEvent);
30174    }
30175  }
30176  get eventName() {
30177    return this.action.eventName;
30178  }
30179  get method() {
30180    const method = this.controller[this.methodName];
30181    if (typeof method == "function") {
30182      return method;
30183    }
30184    throw new Error(`Action "${this.action}" references undefined method "${this.methodName}"`);
30185  }
30186  applyEventModifiers(event) {
30187    const { element } = this.action;
30188    const { actionDescriptorFilters } = this.context.application;
30189    const { controller } = this.context;
30190    let passes = true;
30191    for (const [name, value] of Object.entries(this.eventOptions)) {
30192      if (name in actionDescriptorFilters) {
30193        const filter = actionDescriptorFilters[name];
30194        passes = passes && filter({ name, value, event, element, controller });
30195      } else {
30196        continue;
30197      }
30198    }
30199    return passes;
30200  }
30201  prepareActionEvent(event) {
30202    return Object.assign(event, { params: this.action.params });
30203  }
30204  invokeWithEvent(event) {
30205    const { target, currentTarget } = event;
30206    try {
30207      this.method.call(this.controller, event);
30208      this.context.logDebugActivity(this.methodName, { event, target, currentTarget, action: this.methodName });
30209    } catch (error) {
30210      const { identifier, controller, element, index } = this;
30211      const detail = { identifier, controller, element, index, event };
30212      this.context.handleError(error, `invoking action "${this.action}"`, detail);
30213    }
30214  }
30215  willBeInvokedByEvent(event) {
30216    const eventTarget = event.target;
30217    if (event instanceof KeyboardEvent && this.action.shouldIgnoreKeyboardEvent(event)) {
30218      return false;
30219    }
30220    if (event instanceof MouseEvent && this.action.shouldIgnoreMouseEvent(event)) {
30221      return false;
30222    }
30223    if (this.element === eventTarget) {
30224      return true;
30225    } else if (eventTarget instanceof Element && this.element.contains(eventTarget)) {
30226      return this.scope.containsElement(eventTarget);
30227    } else {
30228      return this.scope.containsElement(this.action.element);
30229    }
30230  }
30231  get controller() {
30232    return this.context.controller;
30233  }
30234  get methodName() {
30235    return this.action.methodName;
30236  }
30237  get element() {
30238    return this.scope.element;
30239  }
30240  get scope() {
30241    return this.context.scope;
30242  }
30243}
30244
30245class ElementObserver {
30246  constructor(element, delegate) {
30247    this.mutationObserverInit = { attributes: true, childList: true, subtree: true };
30248    this.element = element;
30249    this.started = false;
30250    this.delegate = delegate;
30251    this.elements = new Set;
30252    this.mutationObserver = new MutationObserver((mutations) => this.processMutations(mutations));
30253  }
30254  start() {
30255    if (!this.started) {
30256      this.started = true;
30257      this.mutationObserver.observe(this.element, this.mutationObserverInit);
30258      this.refresh();
30259    }
30260  }
30261  pause(callback) {
30262    if (this.started) {
30263      this.mutationObserver.disconnect();
30264      this.started = false;
30265    }
30266    callback();
30267    if (!this.started) {
30268      this.mutationObserver.observe(this.element, this.mutationObserverInit);
30269      this.started = true;
30270    }
30271  }
30272  stop() {
30273    if (this.started) {
30274      this.mutationObserver.takeRecords();
30275      this.mutationObserver.disconnect();
30276      this.started = false;
30277    }
30278  }
30279  refresh() {
30280    if (this.started) {
30281      const matches = new Set(this.matchElementsInTree());
30282      for (const element of Array.from(this.elements)) {
30283        if (!matches.has(element)) {
30284          this.removeElement(element);
30285        }
30286      }
30287      for (const element of Array.from(matches)) {
30288        this.addElement(element);
30289      }
30290    }
30291  }
30292  processMutations(mutations) {
30293    if (this.started) {
30294      for (const mutation of mutations) {
30295        this.processMutation(mutation);
30296      }
30297    }
30298  }
30299  processMutation(mutation) {
30300    if (mutation.type == "attributes") {
30301      this.processAttributeChange(mutation.target, mutation.attributeName);
30302    } else if (mutation.type == "childList") {
30303      this.processRemovedNodes(mutation.removedNodes);
30304      this.processAddedNodes(mutation.addedNodes);
30305    }
30306  }
30307  processAttributeChange(element, attributeName) {
30308    if (this.elements.has(element)) {
30309      if (this.delegate.elementAttributeChanged && this.matchElement(element)) {
30310        this.delegate.elementAttributeChanged(element, attributeName);
30311      } else {
30312        this.removeElement(element);
30313      }
30314    } else if (this.matchElement(element)) {
30315      this.addElement(element);
30316    }
30317  }
30318  processRemovedNodes(nodes) {
30319    for (const node of Array.from(nodes)) {
30320      const element = this.elementFromNode(node);
30321      if (element) {
30322        this.processTree(element, this.removeElement);
30323      }
30324    }
30325  }
30326  processAddedNodes(nodes) {
30327    for (const node of Array.from(nodes)) {
30328      const element = this.elementFromNode(node);
30329      if (element && this.elementIsActive(element)) {
30330        this.processTree(element, this.addElement);
30331      }
30332    }
30333  }
30334  matchElement(element) {
30335    return this.delegate.matchElement(element);
30336  }
30337  matchElementsInTree(tree = this.element) {
30338    return this.delegate.matchElementsInTree(tree);
30339  }
30340  processTree(tree, processor) {
30341    for (const element of this.matchElementsInTree(tree)) {
30342      processor.call(this, element);
30343    }
30344  }
30345  elementFromNode(node) {
30346    if (node.nodeType == Node.ELEMENT_NODE) {
30347      return node;
30348    }
30349  }
30350  elementIsActive(element) {
30351    if (element.isConnected != this.element.isConnected) {
30352      return false;
30353    } else {
30354      return this.element.contains(element);
30355    }
30356  }
30357  addElement(element) {
30358    if (!this.elements.has(element)) {
30359      if (this.elementIsActive(element)) {
30360        this.elements.add(element);
30361        if (this.delegate.elementMatched) {
30362          this.delegate.elementMatched(element);
30363        }
30364      }
30365    }
30366  }
30367  removeElement(element) {
30368    if (this.elements.has(element)) {
30369      this.elements.delete(element);
30370      if (this.delegate.elementUnmatched) {
30371        this.delegate.elementUnmatched(element);
30372      }
30373    }
30374  }
30375}
30376
30377class AttributeObserver {
30378  constructor(element, attributeName, delegate) {
30379    this.attributeName = attributeName;
30380    this.delegate = delegate;
30381    this.elementObserver = new ElementObserver(element, this);
30382  }
30383  get element() {
30384    return this.elementObserver.element;
30385  }
30386  get selector() {
30387    return `[${this.attributeName}]`;
30388  }
30389  start() {
30390    this.elementObserver.start();
30391  }
30392  pause(callback) {
30393    this.elementObserver.pause(callback);
30394  }
30395  stop() {
30396    this.elementObserver.stop();
30397  }
30398  refresh() {
30399    this.elementObserver.refresh();
30400  }
30401  get started() {
30402    return this.elementObserver.started;
30403  }
30404  matchElement(element) {
30405    return element.hasAttribute(this.attributeName);
30406  }
30407  matchElementsInTree(tree) {
30408    const match = this.matchElement(tree) ? [tree] : [];
30409    const matches = Array.from(tree.querySelectorAll(this.selector));
30410    return match.concat(matches);
30411  }
30412  elementMatched(element) {
30413    if (this.delegate.elementMatchedAttribute) {
30414      this.delegate.elementMatchedAttribute(element, this.attributeName);
30415    }
30416  }
30417  elementUnmatched(element) {
30418    if (this.delegate.elementUnmatchedAttribute) {
30419      this.delegate.elementUnmatchedAttribute(element, this.attributeName);
30420    }
30421  }
30422  elementAttributeChanged(element, attributeName) {
30423    if (this.delegate.elementAttributeValueChanged && this.attributeName == attributeName) {
30424      this.delegate.elementAttributeValueChanged(element, attributeName);
30425    }
30426  }
30427}
30428function add(map, key, value) {
30429  fetch2(map, key).add(value);
30430}
30431function del(map, key, value) {
30432  fetch2(map, key).delete(value);
30433  prune(map, key);
30434}
30435function fetch2(map, key) {
30436  let values = map.get(key);
30437  if (!values) {
30438    values = new Set;
30439    map.set(key, values);
30440  }
30441  return values;
30442}
30443function prune(map, key) {
30444  const values = map.get(key);
30445  if (values != null && values.size == 0) {
30446    map.delete(key);
30447  }
30448}
30449
30450class Multimap {
30451  constructor() {
30452    this.valuesByKey = new Map;
30453  }
30454  get keys() {
30455    return Array.from(this.valuesByKey.keys());
30456  }
30457  get values() {
30458    const sets = Array.from(this.valuesByKey.values());
30459    return sets.reduce((values, set) => values.concat(Array.from(set)), []);
30460  }
30461  get size() {
30462    const sets = Array.from(this.valuesByKey.values());
30463    return sets.reduce((size, set) => size + set.size, 0);
30464  }
30465  add(key, value) {
30466    add(this.valuesByKey, key, value);
30467  }
30468  delete(key, value) {
30469    del(this.valuesByKey, key, value);
30470  }
30471  has(key, value) {
30472    const values = this.valuesByKey.get(key);
30473    return values != null && values.has(value);
30474  }
30475  hasKey(key) {
30476    return this.valuesByKey.has(key);
30477  }
30478  hasValue(value) {
30479    const sets = Array.from(this.valuesByKey.values());
30480    return sets.some((set) => set.has(value));
30481  }
30482  getValuesForKey(key) {
30483    const values = this.valuesByKey.get(key);
30484    return values ? Array.from(values) : [];
30485  }
30486  getKeysForValue(value) {
30487    return Array.from(this.valuesByKey).filter(([_key, values]) => values.has(value)).map(([key, _values]) => key);
30488  }
30489}
30490class SelectorObserver {
30491  constructor(element, selector, delegate, details) {
30492    this._selector = selector;
30493    this.details = details;
30494    this.elementObserver = new ElementObserver(element, this);
30495    this.delegate = delegate;
30496    this.matchesByElement = new Multimap;
30497  }
30498  get started() {
30499    return this.elementObserver.started;
30500  }
30501  get selector() {
30502    return this._selector;
30503  }
30504  set selector(selector) {
30505    this._selector = selector;
30506    this.refresh();
30507  }
30508  start() {
30509    this.elementObserver.start();
30510  }
30511  pause(callback) {
30512    this.elementObserver.pause(callback);
30513  }
30514  stop() {
30515    this.elementObserver.stop();
30516  }
30517  refresh() {
30518    this.elementObserver.refresh();
30519  }
30520  get element() {
30521    return this.elementObserver.element;
30522  }
30523  matchElement(element) {
30524    const { selector } = this;
30525    if (selector) {
30526      const matches = element.matches(selector);
30527      if (this.delegate.selectorMatchElement) {
30528        return matches && this.delegate.selectorMatchElement(element, this.details);
30529      }
30530      return matches;
30531    } else {
30532      return false;
30533    }
30534  }
30535  matchElementsInTree(tree) {
30536    const { selector } = this;
30537    if (selector) {
30538      const match = this.matchElement(tree) ? [tree] : [];
30539      const matches = Array.from(tree.querySelectorAll(selector)).filter((match) => this.matchElement(match));
30540      return match.concat(matches);
30541    } else {
30542      return [];
30543    }
30544  }
30545  elementMatched(element) {
30546    const { selector } = this;
30547    if (selector) {
30548      this.selectorMatched(element, selector);
30549    }
30550  }
30551  elementUnmatched(element) {
30552    const selectors = this.matchesByElement.getKeysForValue(element);
30553    for (const selector of selectors) {
30554      this.selectorUnmatched(element, selector);
30555    }
30556  }
30557  elementAttributeChanged(element, _attributeName) {
30558    const { selector } = this;
30559    if (selector) {
30560      const matches = this.matchElement(element);
30561      const matchedBefore = this.matchesByElement.has(selector, element);
30562      if (matches && !matchedBefore) {
30563        this.selectorMatched(element, selector);
30564      } else if (!matches && matchedBefore) {
30565        this.selectorUnmatched(element, selector);
30566      }
30567    }
30568  }
30569  selectorMatched(element, selector) {
30570    this.delegate.selectorMatched(element, selector, this.details);
30571    this.matchesByElement.add(selector, element);
30572  }
30573  selectorUnmatched(element, selector) {
30574    this.delegate.selectorUnmatched(element, selector, this.details);
30575    this.matchesByElement.delete(selector, element);
30576  }
30577}
30578
30579class StringMapObserver {
30580  constructor(element, delegate) {
30581    this.element = element;
30582    this.delegate = delegate;
30583    this.started = false;
30584    this.stringMap = new Map;
30585    this.mutationObserver = new MutationObserver((mutations) => this.processMutations(mutations));
30586  }
30587  start() {
30588    if (!this.started) {
30589      this.started = true;
30590      this.mutationObserver.observe(this.element, { attributes: true, attributeOldValue: true });
30591      this.refresh();
30592    }
30593  }
30594  stop() {
30595    if (this.started) {
30596      this.mutationObserver.takeRecords();
30597      this.mutationObserver.disconnect();
30598      this.started = false;
30599    }
30600  }
30601  refresh() {
30602    if (this.started) {
30603      for (const attributeName of this.knownAttributeNames) {
30604        this.refreshAttribute(attributeName, null);
30605      }
30606    }
30607  }
30608  processMutations(mutations) {
30609    if (this.started) {
30610      for (const mutation of mutations) {
30611        this.processMutation(mutation);
30612      }
30613    }
30614  }
30615  processMutation(mutation) {
30616    const attributeName = mutation.attributeName;
30617    if (attributeName) {
30618      this.refreshAttribute(attributeName, mutation.oldValue);
30619    }
30620  }
30621  refreshAttribute(attributeName, oldValue) {
30622    const key = this.delegate.getStringMapKeyForAttribute(attributeName);
30623    if (key != null) {
30624      if (!this.stringMap.has(attributeName)) {
30625        this.stringMapKeyAdded(key, attributeName);
30626      }
30627      const value = this.element.getAttribute(attributeName);
30628      if (this.stringMap.get(attributeName) != value) {
30629        this.stringMapValueChanged(value, key, oldValue);
30630      }
30631      if (value == null) {
30632        const oldValue = this.stringMap.get(attributeName);
30633        this.stringMap.delete(attributeName);
30634        if (oldValue)
30635          this.stringMapKeyRemoved(key, attributeName, oldValue);
30636      } else {
30637        this.stringMap.set(attributeName, value);
30638      }
30639    }
30640  }
30641  stringMapKeyAdded(key, attributeName) {
30642    if (this.delegate.stringMapKeyAdded) {
30643      this.delegate.stringMapKeyAdded(key, attributeName);
30644    }
30645  }
30646  stringMapValueChanged(value, key, oldValue) {
30647    if (this.delegate.stringMapValueChanged) {
30648      this.delegate.stringMapValueChanged(value, key, oldValue);
30649    }
30650  }
30651  stringMapKeyRemoved(key, attributeName, oldValue) {
30652    if (this.delegate.stringMapKeyRemoved) {
30653      this.delegate.stringMapKeyRemoved(key, attributeName, oldValue);
30654    }
30655  }
30656  get knownAttributeNames() {
30657    return Array.from(new Set(this.currentAttributeNames.concat(this.recordedAttributeNames)));
30658  }
30659  get currentAttributeNames() {
30660    return Array.from(this.element.attributes).map((attribute) => attribute.name);
30661  }
30662  get recordedAttributeNames() {
30663    return Array.from(this.stringMap.keys());
30664  }
30665}
30666
30667class TokenListObserver {
30668  constructor(element, attributeName, delegate) {
30669    this.attributeObserver = new AttributeObserver(element, attributeName, this);
30670    this.delegate = delegate;
30671    this.tokensByElement = new Multimap;
30672  }
30673  get started() {
30674    return this.attributeObserver.started;
30675  }
30676  start() {
30677    this.attributeObserver.start();
30678  }
30679  pause(callback) {
30680    this.attributeObserver.pause(callback);
30681  }
30682  stop() {
30683    this.attributeObserver.stop();
30684  }
30685  refresh() {
30686    this.attributeObserver.refresh();
30687  }
30688  get element() {
30689    return this.attributeObserver.element;
30690  }
30691  get attributeName() {
30692    return this.attributeObserver.attributeName;
30693  }
30694  elementMatchedAttribute(element) {
30695    this.tokensMatched(this.readTokensForElement(element));
30696  }
30697  elementAttributeValueChanged(element) {
30698    const [unmatchedTokens, matchedTokens] = this.refreshTokensForElement(element);
30699    this.tokensUnmatched(unmatchedTokens);
30700    this.tokensMatched(matchedTokens);
30701  }
30702  elementUnmatchedAttribute(element) {
30703    this.tokensUnmatched(this.tokensByElement.getValuesForKey(element));
30704  }
30705  tokensMatched(tokens) {
30706    tokens.forEach((token) => this.tokenMatched(token));
30707  }
30708  tokensUnmatched(tokens) {
30709    tokens.forEach((token) => this.tokenUnmatched(token));
30710  }
30711  tokenMatched(token) {
30712    this.delegate.tokenMatched(token);
30713    this.tokensByElement.add(token.element, token);
30714  }
30715  tokenUnmatched(token) {
30716    this.delegate.tokenUnmatched(token);
30717    this.tokensByElement.delete(token.element, token);
30718  }
30719  refreshTokensForElement(element) {
30720    const previousTokens = this.tokensByElement.getValuesForKey(element);
30721    const currentTokens = this.readTokensForElement(element);
30722    const firstDifferingIndex = zip(previousTokens, currentTokens).findIndex(([previousToken, currentToken]) => !tokensAreEqual(previousToken, currentToken));
30723    if (firstDifferingIndex == -1) {
30724      return [[], []];
30725    } else {
30726      return [previousTokens.slice(firstDifferingIndex), currentTokens.slice(firstDifferingIndex)];
30727    }
30728  }
30729  readTokensForElement(element) {
30730    const attributeName = this.attributeName;
30731    const tokenString = element.getAttribute(attributeName) || "";
30732    return parseTokenString(tokenString, element, attributeName);
30733  }
30734}
30735function parseTokenString(tokenString, element, attributeName) {
30736  return tokenString.trim().split(/\s+/).filter((content) => content.length).map((content, index) => ({ element, attributeName, content, index }));
30737}
30738function zip(left, right) {
30739  const length = Math.max(left.length, right.length);
30740  return Array.from({ length }, (_, index) => [left[index], right[index]]);
30741}
30742function tokensAreEqual(left, right) {
30743  return left && right && left.index == right.index && left.content == right.content;
30744}
30745
30746class ValueListObserver {
30747  constructor(element, attributeName, delegate) {
30748    this.tokenListObserver = new TokenListObserver(element, attributeName, this);
30749    this.delegate = delegate;
30750    this.parseResultsByToken = new WeakMap;
30751    this.valuesByTokenByElement = new WeakMap;
30752  }
30753  get started() {
30754    return this.tokenListObserver.started;
30755  }
30756  start() {
30757    this.tokenListObserver.start();
30758  }
30759  stop() {
30760    this.tokenListObserver.stop();
30761  }
30762  refresh() {
30763    this.tokenListObserver.refresh();
30764  }
30765  get element() {
30766    return this.tokenListObserver.element;
30767  }
30768  get attributeName() {
30769    return this.tokenListObserver.attributeName;
30770  }
30771  tokenMatched(token) {
30772    const { element } = token;
30773    const { value } = this.fetchParseResultForToken(token);
30774    if (value) {
30775      this.fetchValuesByTokenForElement(element).set(token, value);
30776      this.delegate.elementMatchedValue(element, value);
30777    }
30778  }
30779  tokenUnmatched(token) {
30780    const { element } = token;
30781    const { value } = this.fetchParseResultForToken(token);
30782    if (value) {
30783      this.fetchValuesByTokenForElement(element).delete(token);
30784      this.delegate.elementUnmatchedValue(element, value);
30785    }
30786  }
30787  fetchParseResultForToken(token) {
30788    let parseResult = this.parseResultsByToken.get(token);
30789    if (!parseResult) {
30790      parseResult = this.parseToken(token);
30791      this.parseResultsByToken.set(token, parseResult);
30792    }
30793    return parseResult;
30794  }
30795  fetchValuesByTokenForElement(element) {
30796    let valuesByToken = this.valuesByTokenByElement.get(element);
30797    if (!valuesByToken) {
30798      valuesByToken = new Map;
30799      this.valuesByTokenByElement.set(element, valuesByToken);
30800    }
30801    return valuesByToken;
30802  }
30803  parseToken(token) {
30804    try {
30805      const value = this.delegate.parseValueForToken(token);
30806      return { value };
30807    } catch (error) {
30808      return { error };
30809    }
30810  }
30811}
30812
30813class BindingObserver {
30814  constructor(context, delegate) {
30815    this.context = context;
30816    this.delegate = delegate;
30817    this.bindingsByAction = new Map;
30818  }
30819  start() {
30820    if (!this.valueListObserver) {
30821      this.valueListObserver = new ValueListObserver(this.element, this.actionAttribute, this);
30822      this.valueListObserver.start();
30823    }
30824  }
30825  stop() {
30826    if (this.valueListObserver) {
30827      this.valueListObserver.stop();
30828      delete this.valueListObserver;
30829      this.disconnectAllActions();
30830    }
30831  }
30832  get element() {
30833    return this.context.element;
30834  }
30835  get identifier() {
30836    return this.context.identifier;
30837  }
30838  get actionAttribute() {
30839    return this.schema.actionAttribute;
30840  }
30841  get schema() {
30842    return this.context.schema;
30843  }
30844  get bindings() {
30845    return Array.from(this.bindingsByAction.values());
30846  }
30847  connectAction(action) {
30848    const binding = new Binding(this.context, action);
30849    this.bindingsByAction.set(action, binding);
30850    this.delegate.bindingConnected(binding);
30851  }
30852  disconnectAction(action) {
30853    const binding = this.bindingsByAction.get(action);
30854    if (binding) {
30855      this.bindingsByAction.delete(action);
30856      this.delegate.bindingDisconnected(binding);
30857    }
30858  }
30859  disconnectAllActions() {
30860    this.bindings.forEach((binding) => this.delegate.bindingDisconnected(binding, true));
30861    this.bindingsByAction.clear();
30862  }
30863  parseValueForToken(token) {
30864    const action = Action.forToken(token, this.schema);
30865    if (action.identifier == this.identifier) {
30866      return action;
30867    }
30868  }
30869  elementMatchedValue(element, action) {
30870    this.connectAction(action);
30871  }
30872  elementUnmatchedValue(element, action) {
30873    this.disconnectAction(action);
30874  }
30875}
30876
30877class ValueObserver {
30878  constructor(context, receiver) {
30879    this.context = context;
30880    this.receiver = receiver;
30881    this.stringMapObserver = new StringMapObserver(this.element, this);
30882    this.valueDescriptorMap = this.controller.valueDescriptorMap;
30883  }
30884  start() {
30885    this.stringMapObserver.start();
30886    this.invokeChangedCallbacksForDefaultValues();
30887  }
30888  stop() {
30889    this.stringMapObserver.stop();
30890  }
30891  get element() {
30892    return this.context.element;
30893  }
30894  get controller() {
30895    return this.context.controller;
30896  }
30897  getStringMapKeyForAttribute(attributeName) {
30898    if (attributeName in this.valueDescriptorMap) {
30899      return this.valueDescriptorMap[attributeName].name;
30900    }
30901  }
30902  stringMapKeyAdded(key, attributeName) {
30903    const descriptor = this.valueDescriptorMap[attributeName];
30904    if (!this.hasValue(key)) {
30905      this.invokeChangedCallback(key, descriptor.writer(this.receiver[key]), descriptor.writer(descriptor.defaultValue));
30906    }
30907  }
30908  stringMapValueChanged(value, name, oldValue) {
30909    const descriptor = this.valueDescriptorNameMap[name];
30910    if (value === null)
30911      return;
30912    if (oldValue === null) {
30913      oldValue = descriptor.writer(descriptor.defaultValue);
30914    }
30915    this.invokeChangedCallback(name, value, oldValue);
30916  }
30917  stringMapKeyRemoved(key, attributeName, oldValue) {
30918    const descriptor = this.valueDescriptorNameMap[key];
30919    if (this.hasValue(key)) {
30920      this.invokeChangedCallback(key, descriptor.writer(this.receiver[key]), oldValue);
30921    } else {
30922      this.invokeChangedCallback(key, descriptor.writer(descriptor.defaultValue), oldValue);
30923    }
30924  }
30925  invokeChangedCallbacksForDefaultValues() {
30926    for (const { key, name, defaultValue, writer } of this.valueDescriptors) {
30927      if (defaultValue != null && !this.controller.data.has(key)) {
30928        this.invokeChangedCallback(name, writer(defaultValue), undefined);
30929      }
30930    }
30931  }
30932  invokeChangedCallback(name, rawValue, rawOldValue) {
30933    const changedMethodName = `${name}Changed`;
30934    const changedMethod = this.receiver[changedMethodName];
30935    if (typeof changedMethod == "function") {
30936      const descriptor = this.valueDescriptorNameMap[name];
30937      try {
30938        const value = descriptor.reader(rawValue);
30939        let oldValue = rawOldValue;
30940        if (rawOldValue) {
30941          oldValue = descriptor.reader(rawOldValue);
30942        }
30943        changedMethod.call(this.receiver, value, oldValue);
30944      } catch (error) {
30945        if (error instanceof TypeError) {
30946          error.message = `Stimulus Value "${this.context.identifier}.${descriptor.name}" - ${error.message}`;
30947        }
30948        throw error;
30949      }
30950    }
30951  }
30952  get valueDescriptors() {
30953    const { valueDescriptorMap } = this;
30954    return Object.keys(valueDescriptorMap).map((key) => valueDescriptorMap[key]);
30955  }
30956  get valueDescriptorNameMap() {
30957    const descriptors = {};
30958    Object.keys(this.valueDescriptorMap).forEach((key) => {
30959      const descriptor = this.valueDescriptorMap[key];
30960      descriptors[descriptor.name] = descriptor;
30961    });
30962    return descriptors;
30963  }
30964  hasValue(attributeName) {
30965    const descriptor = this.valueDescriptorNameMap[attributeName];
30966    const hasMethodName = `has${capitalize(descriptor.name)}`;
30967    return this.receiver[hasMethodName];
30968  }
30969}
30970
30971class TargetObserver {
30972  constructor(context, delegate) {
30973    this.context = context;
30974    this.delegate = delegate;
30975    this.targetsByName = new Multimap;
30976  }
30977  start() {
30978    if (!this.tokenListObserver) {
30979      this.tokenListObserver = new TokenListObserver(this.element, this.attributeName, this);
30980      this.tokenListObserver.start();
30981    }
30982  }
30983  stop() {
30984    if (this.tokenListObserver) {
30985      this.disconnectAllTargets();
30986      this.tokenListObserver.stop();
30987      delete this.tokenListObserver;
30988    }
30989  }
30990  tokenMatched({ element, content: name }) {
30991    if (this.scope.containsElement(element)) {
30992      this.connectTarget(element, name);
30993    }
30994  }
30995  tokenUnmatched({ element, content: name }) {
30996    this.disconnectTarget(element, name);
30997  }
30998  connectTarget(element, name) {
30999    var _a;
31000    if (!this.targetsByName.has(name, element)) {
31001      this.targetsByName.add(name, element);
31002      (_a = this.tokenListObserver) === null || _a === undefined || _a.pause(() => this.delegate.targetConnected(element, name));
31003    }
31004  }
31005  disconnectTarget(element, name) {
31006    var _a;
31007    if (this.targetsByName.has(name, element)) {
31008      this.targetsByName.delete(name, element);
31009      (_a = this.tokenListObserver) === null || _a === undefined || _a.pause(() => this.delegate.targetDisconnected(element, name));
31010    }
31011  }
31012  disconnectAllTargets() {
31013    for (const name of this.targetsByName.keys) {
31014      for (const element of this.targetsByName.getValuesForKey(name)) {
31015        this.disconnectTarget(element, name);
31016      }
31017    }
31018  }
31019  get attributeName() {
31020    return `data-${this.context.identifier}-target`;
31021  }
31022  get element() {
31023    return this.context.element;
31024  }
31025  get scope() {
31026    return this.context.scope;
31027  }
31028}
31029function readInheritableStaticArrayValues(constructor, propertyName) {
31030  const ancestors = getAncestorsForConstructor(constructor);
31031  return Array.from(ancestors.reduce((values, constructor) => {
31032    getOwnStaticArrayValues(constructor, propertyName).forEach((name) => values.add(name));
31033    return values;
31034  }, new Set));
31035}
31036function readInheritableStaticObjectPairs(constructor, propertyName) {
31037  const ancestors = getAncestorsForConstructor(constructor);
31038  return ancestors.reduce((pairs, constructor) => {
31039    pairs.push(...getOwnStaticObjectPairs(constructor, propertyName));
31040    return pairs;
31041  }, []);
31042}
31043function getAncestorsForConstructor(constructor) {
31044  const ancestors = [];
31045  while (constructor) {
31046    ancestors.push(constructor);
31047    constructor = Object.getPrototypeOf(constructor);
31048  }
31049  return ancestors.reverse();
31050}
31051function getOwnStaticArrayValues(constructor, propertyName) {
31052  const definition = constructor[propertyName];
31053  return Array.isArray(definition) ? definition : [];
31054}
31055function getOwnStaticObjectPairs(constructor, propertyName) {
31056  const definition = constructor[propertyName];
31057  return definition ? Object.keys(definition).map((key) => [key, definition[key]]) : [];
31058}
31059
31060class OutletObserver {
31061  constructor(context, delegate) {
31062    this.started = false;
31063    this.context = context;
31064    this.delegate = delegate;
31065    this.outletsByName = new Multimap;
31066    this.outletElementsByName = new Multimap;
31067    this.selectorObserverMap = new Map;
31068    this.attributeObserverMap = new Map;
31069  }
31070  start() {
31071    if (!this.started) {
31072      this.outletDefinitions.forEach((outletName) => {
31073        this.setupSelectorObserverForOutlet(outletName);
31074        this.setupAttributeObserverForOutlet(outletName);
31075      });
31076      this.started = true;
31077      this.dependentContexts.forEach((context) => context.refresh());
31078    }
31079  }
31080  refresh() {
31081    this.selectorObserverMap.forEach((observer) => observer.refresh());
31082    this.attributeObserverMap.forEach((observer) => observer.refresh());
31083  }
31084  stop() {
31085    if (this.started) {
31086      this.started = false;
31087      this.disconnectAllOutlets();
31088      this.stopSelectorObservers();
31089      this.stopAttributeObservers();
31090    }
31091  }
31092  stopSelectorObservers() {
31093    if (this.selectorObserverMap.size > 0) {
31094      this.selectorObserverMap.forEach((observer) => observer.stop());
31095      this.selectorObserverMap.clear();
31096    }
31097  }
31098  stopAttributeObservers() {
31099    if (this.attributeObserverMap.size > 0) {
31100      this.attributeObserverMap.forEach((observer) => observer.stop());
31101      this.attributeObserverMap.clear();
31102    }
31103  }
31104  selectorMatched(element, _selector, { outletName }) {
31105    const outlet = this.getOutlet(element, outletName);
31106    if (outlet) {
31107      this.connectOutlet(outlet, element, outletName);
31108    }
31109  }
31110  selectorUnmatched(element, _selector, { outletName }) {
31111    const outlet = this.getOutletFromMap(element, outletName);
31112    if (outlet) {
31113      this.disconnectOutlet(outlet, element, outletName);
31114    }
31115  }
31116  selectorMatchElement(element, { outletName }) {
31117    const selector = this.selector(outletName);
31118    const hasOutlet = this.hasOutlet(element, outletName);
31119    const hasOutletController = element.matches(`[${this.schema.controllerAttribute}~=${outletName}]`);
31120    if (selector) {
31121      return hasOutlet && hasOutletController && element.matches(selector);
31122    } else {
31123      return false;
31124    }
31125  }
31126  elementMatchedAttribute(_element, attributeName) {
31127    const outletName = this.getOutletNameFromOutletAttributeName(attributeName);
31128    if (outletName) {
31129      this.updateSelectorObserverForOutlet(outletName);
31130    }
31131  }
31132  elementAttributeValueChanged(_element, attributeName) {
31133    const outletName = this.getOutletNameFromOutletAttributeName(attributeName);
31134    if (outletName) {
31135      this.updateSelectorObserverForOutlet(outletName);
31136    }
31137  }
31138  elementUnmatchedAttribute(_element, attributeName) {
31139    const outletName = this.getOutletNameFromOutletAttributeName(attributeName);
31140    if (outletName) {
31141      this.updateSelectorObserverForOutlet(outletName);
31142    }
31143  }
31144  connectOutlet(outlet, element, outletName) {
31145    var _a;
31146    if (!this.outletElementsByName.has(outletName, element)) {
31147      this.outletsByName.add(outletName, outlet);
31148      this.outletElementsByName.add(outletName, element);
31149      (_a = this.selectorObserverMap.get(outletName)) === null || _a === undefined || _a.pause(() => this.delegate.outletConnected(outlet, element, outletName));
31150    }
31151  }
31152  disconnectOutlet(outlet, element, outletName) {
31153    var _a;
31154    if (this.outletElementsByName.has(outletName, element)) {
31155      this.outletsByName.delete(outletName, outlet);
31156      this.outletElementsByName.delete(outletName, element);
31157      (_a = this.selectorObserverMap.get(outletName)) === null || _a === undefined || _a.pause(() => this.delegate.outletDisconnected(outlet, element, outletName));
31158    }
31159  }
31160  disconnectAllOutlets() {
31161    for (const outletName of this.outletElementsByName.keys) {
31162      for (const element of this.outletElementsByName.getValuesForKey(outletName)) {
31163        for (const outlet of this.outletsByName.getValuesForKey(outletName)) {
31164          this.disconnectOutlet(outlet, element, outletName);
31165        }
31166      }
31167    }
31168  }
31169  updateSelectorObserverForOutlet(outletName) {
31170    const observer = this.selectorObserverMap.get(outletName);
31171    if (observer) {
31172      observer.selector = this.selector(outletName);
31173    }
31174  }
31175  setupSelectorObserverForOutlet(outletName) {
31176    const selector = this.selector(outletName);
31177    const selectorObserver = new SelectorObserver(document.body, selector, this, { outletName });
31178    this.selectorObserverMap.set(outletName, selectorObserver);
31179    selectorObserver.start();
31180  }
31181  setupAttributeObserverForOutlet(outletName) {
31182    const attributeName = this.attributeNameForOutletName(outletName);
31183    const attributeObserver = new AttributeObserver(this.scope.element, attributeName, this);
31184    this.attributeObserverMap.set(outletName, attributeObserver);
31185    attributeObserver.start();
31186  }
31187  selector(outletName) {
31188    return this.scope.outlets.getSelectorForOutletName(outletName);
31189  }
31190  attributeNameForOutletName(outletName) {
31191    return this.scope.schema.outletAttributeForScope(this.identifier, outletName);
31192  }
31193  getOutletNameFromOutletAttributeName(attributeName) {
31194    return this.outletDefinitions.find((outletName) => this.attributeNameForOutletName(outletName) === attributeName);
31195  }
31196  get outletDependencies() {
31197    const dependencies = new Multimap;
31198    this.router.modules.forEach((module2) => {
31199      const constructor = module2.definition.controllerConstructor;
31200      const outlets = readInheritableStaticArrayValues(constructor, "outlets");
31201      outlets.forEach((outlet) => dependencies.add(outlet, module2.identifier));
31202    });
31203    return dependencies;
31204  }
31205  get outletDefinitions() {
31206    return this.outletDependencies.getKeysForValue(this.identifier);
31207  }
31208  get dependentControllerIdentifiers() {
31209    return this.outletDependencies.getValuesForKey(this.identifier);
31210  }
31211  get dependentContexts() {
31212    const identifiers = this.dependentControllerIdentifiers;
31213    return this.router.contexts.filter((context) => identifiers.includes(context.identifier));
31214  }
31215  hasOutlet(element, outletName) {
31216    return !!this.getOutlet(element, outletName) || !!this.getOutletFromMap(element, outletName);
31217  }
31218  getOutlet(element, outletName) {
31219    return this.application.getControllerForElementAndIdentifier(element, outletName);
31220  }
31221  getOutletFromMap(element, outletName) {
31222    return this.outletsByName.getValuesForKey(outletName).find((outlet) => outlet.element === element);
31223  }
31224  get scope() {
31225    return this.context.scope;
31226  }
31227  get schema() {
31228    return this.context.schema;
31229  }
31230  get identifier() {
31231    return this.context.identifier;
31232  }
31233  get application() {
31234    return this.context.application;
31235  }
31236  get router() {
31237    return this.application.router;
31238  }
31239}
31240
31241class Context {
31242  constructor(module2, scope) {
31243    this.logDebugActivity = (functionName, detail = {}) => {
31244      const { identifier, controller, element } = this;
31245      detail = Object.assign({ identifier, controller, element }, detail);
31246      this.application.logDebugActivity(this.identifier, functionName, detail);
31247    };
31248    this.module = module2;
31249    this.scope = scope;
31250    this.controller = new module2.controllerConstructor(this);
31251    this.bindingObserver = new BindingObserver(this, this.dispatcher);
31252    this.valueObserver = new ValueObserver(this, this.controller);
31253    this.targetObserver = new TargetObserver(this, this);
31254    this.outletObserver = new OutletObserver(this, this);
31255    try {
31256      this.controller.initialize();
31257      this.logDebugActivity("initialize");
31258    } catch (error) {
31259      this.handleError(error, "initializing controller");
31260    }
31261  }
31262  connect() {
31263    this.bindingObserver.start();
31264    this.valueObserver.start();
31265    this.targetObserver.start();
31266    this.outletObserver.start();
31267    try {
31268      this.controller.connect();
31269      this.logDebugActivity("connect");
31270    } catch (error) {
31271      this.handleError(error, "connecting controller");
31272    }
31273  }
31274  refresh() {
31275    this.outletObserver.refresh();
31276  }
31277  disconnect() {
31278    try {
31279      this.controller.disconnect();
31280      this.logDebugActivity("disconnect");
31281    } catch (error) {
31282      this.handleError(error, "disconnecting controller");
31283    }
31284    this.outletObserver.stop();
31285    this.targetObserver.stop();
31286    this.valueObserver.stop();
31287    this.bindingObserver.stop();
31288  }
31289  get application() {
31290    return this.module.application;
31291  }
31292  get identifier() {
31293    return this.module.identifier;
31294  }
31295  get schema() {
31296    return this.application.schema;
31297  }
31298  get dispatcher() {
31299    return this.application.dispatcher;
31300  }
31301  get element() {
31302    return this.scope.element;
31303  }
31304  get parentElement() {
31305    return this.element.parentElement;
31306  }
31307  handleError(error, message, detail = {}) {
31308    const { identifier, controller, element } = this;
31309    detail = Object.assign({ identifier, controller, element }, detail);
31310    this.application.handleError(error, `Error ${message}`, detail);
31311  }
31312  targetConnected(element, name) {
31313    this.invokeControllerMethod(`${name}TargetConnected`, element);
31314  }
31315  targetDisconnected(element, name) {
31316    this.invokeControllerMethod(`${name}TargetDisconnected`, element);
31317  }
31318  outletConnected(outlet, element, name) {
31319    this.invokeControllerMethod(`${namespaceCamelize(name)}OutletConnected`, outlet, element);
31320  }
31321  outletDisconnected(outlet, element, name) {
31322    this.invokeControllerMethod(`${namespaceCamelize(name)}OutletDisconnected`, outlet, element);
31323  }
31324  invokeControllerMethod(methodName, ...args2) {
31325    const controller = this.controller;
31326    if (typeof controller[methodName] == "function") {
31327      controller[methodName](...args2);
31328    }
31329  }
31330}
31331function bless(constructor) {
31332  return shadow(constructor, getBlessedProperties(constructor));
31333}
31334function shadow(constructor, properties) {
31335  const shadowConstructor = extend2(constructor);
31336  const shadowProperties = getShadowProperties(constructor.prototype, properties);
31337  Object.defineProperties(shadowConstructor.prototype, shadowProperties);
31338  return shadowConstructor;
31339}
31340function getBlessedProperties(constructor) {
31341  const blessings = readInheritableStaticArrayValues(constructor, "blessings");
31342  return blessings.reduce((blessedProperties, blessing) => {
31343    const properties = blessing(constructor);
31344    for (const key in properties) {
31345      const descriptor = blessedProperties[key] || {};
31346      blessedProperties[key] = Object.assign(descriptor, properties[key]);
31347    }
31348    return blessedProperties;
31349  }, {});
31350}
31351function getShadowProperties(prototype, properties) {
31352  return getOwnKeys(properties).reduce((shadowProperties, key) => {
31353    const descriptor = getShadowedDescriptor(prototype, properties, key);
31354    if (descriptor) {
31355      Object.assign(shadowProperties, { [key]: descriptor });
31356    }
31357    return shadowProperties;
31358  }, {});
31359}
31360function getShadowedDescriptor(prototype, properties, key) {
31361  const shadowingDescriptor = Object.getOwnPropertyDescriptor(prototype, key);
31362  const shadowedByValue = shadowingDescriptor && "value" in shadowingDescriptor;
31363  if (!shadowedByValue) {
31364    const descriptor = Object.getOwnPropertyDescriptor(properties, key).value;
31365    if (shadowingDescriptor) {
31366      descriptor.get = shadowingDescriptor.get || descriptor.get;
31367      descriptor.set = shadowingDescriptor.set || descriptor.set;
31368    }
31369    return descriptor;
31370  }
31371}
31372var getOwnKeys = (() => {
31373  if (typeof Object.getOwnPropertySymbols == "function") {
31374    return (object) => [...Object.getOwnPropertyNames(object), ...Object.getOwnPropertySymbols(object)];
31375  } else {
31376    return Object.getOwnPropertyNames;
31377  }
31378})();
31379var extend2 = (() => {
31380  function extendWithReflect(constructor) {
31381    function extended() {
31382      return Reflect.construct(constructor, arguments, new.target);
31383    }
31384    extended.prototype = Object.create(constructor.prototype, {
31385      constructor: { value: extended }
31386    });
31387    Reflect.setPrototypeOf(extended, constructor);
31388    return extended;
31389  }
31390  function testReflectExtension() {
31391    const a = function() {
31392      this.a.call(this);
31393    };
31394    const b = extendWithReflect(a);
31395    b.prototype.a = function() {};
31396    return new b;
31397  }
31398  try {
31399    testReflectExtension();
31400    return extendWithReflect;
31401  } catch (error) {
31402    return (constructor) => class extended extends constructor {
31403    };
31404  }
31405})();
31406function blessDefinition(definition) {
31407  return {
31408    identifier: definition.identifier,
31409    controllerConstructor: bless(definition.controllerConstructor)
31410  };
31411}
31412
31413class Module {
31414  constructor(application, definition) {
31415    this.application = application;
31416    this.definition = blessDefinition(definition);
31417    this.contextsByScope = new WeakMap;
31418    this.connectedContexts = new Set;
31419  }
31420  get identifier() {
31421    return this.definition.identifier;
31422  }
31423  get controllerConstructor() {
31424    return this.definition.controllerConstructor;
31425  }
31426  get contexts() {
31427    return Array.from(this.connectedContexts);
31428  }
31429  connectContextForScope(scope) {
31430    const context = this.fetchContextForScope(scope);
31431    this.connectedContexts.add(context);
31432    context.connect();
31433  }
31434  disconnectContextForScope(scope) {
31435    const context = this.contextsByScope.get(scope);
31436    if (context) {
31437      this.connectedContexts.delete(context);
31438      context.disconnect();
31439    }
31440  }
31441  fetchContextForScope(scope) {
31442    let context = this.contextsByScope.get(scope);
31443    if (!context) {
31444      context = new Context(this, scope);
31445      this.contextsByScope.set(scope, context);
31446    }
31447    return context;
31448  }
31449}
31450
31451class ClassMap {
31452  constructor(scope) {
31453    this.scope = scope;
31454  }
31455  has(name) {
31456    return this.data.has(this.getDataKey(name));
31457  }
31458  get(name) {
31459    return this.getAll(name)[0];
31460  }
31461  getAll(name) {
31462    const tokenString = this.data.get(this.getDataKey(name)) || "";
31463    return tokenize(tokenString);
31464  }
31465  getAttributeName(name) {
31466    return this.data.getAttributeNameForKey(this.getDataKey(name));
31467  }
31468  getDataKey(name) {
31469    return `${name}-class`;
31470  }
31471  get data() {
31472    return this.scope.data;
31473  }
31474}
31475
31476class DataMap {
31477  constructor(scope) {
31478    this.scope = scope;
31479  }
31480  get element() {
31481    return this.scope.element;
31482  }
31483  get identifier() {
31484    return this.scope.identifier;
31485  }
31486  get(key) {
31487    const name = this.getAttributeNameForKey(key);
31488    return this.element.getAttribute(name);
31489  }
31490  set(key, value) {
31491    const name = this.getAttributeNameForKey(key);
31492    this.element.setAttribute(name, value);
31493    return this.get(key);
31494  }
31495  has(key) {
31496    const name = this.getAttributeNameForKey(key);
31497    return this.element.hasAttribute(name);
31498  }
31499  delete(key) {
31500    if (this.has(key)) {
31501      const name = this.getAttributeNameForKey(key);
31502      this.element.removeAttribute(name);
31503      return true;
31504    } else {
31505      return false;
31506    }
31507  }
31508  getAttributeNameForKey(key) {
31509    return `data-${this.identifier}-${dasherize(key)}`;
31510  }
31511}
31512
31513class Guide {
31514  constructor(logger) {
31515    this.warnedKeysByObject = new WeakMap;
31516    this.logger = logger;
31517  }
31518  warn(object, key, message) {
31519    let warnedKeys = this.warnedKeysByObject.get(object);
31520    if (!warnedKeys) {
31521      warnedKeys = new Set;
31522      this.warnedKeysByObject.set(object, warnedKeys);
31523    }
31524    if (!warnedKeys.has(key)) {
31525      warnedKeys.add(key);
31526      this.logger.warn(message, object);
31527    }
31528  }
31529}
31530function attributeValueContainsToken(attributeName, token) {
31531  return `[${attributeName}~="${token}"]`;
31532}
31533
31534class TargetSet {
31535  constructor(scope) {
31536    this.scope = scope;
31537  }
31538  get element() {
31539    return this.scope.element;
31540  }
31541  get identifier() {
31542    return this.scope.identifier;
31543  }
31544  get schema() {
31545    return this.scope.schema;
31546  }
31547  has(targetName) {
31548    return this.find(targetName) != null;
31549  }
31550  find(...targetNames) {
31551    return targetNames.reduce((target, targetName) => target || this.findTarget(targetName) || this.findLegacyTarget(targetName), undefined);
31552  }
31553  findAll(...targetNames) {
31554    return targetNames.reduce((targets, targetName) => [
31555      ...targets,
31556      ...this.findAllTargets(targetName),
31557      ...this.findAllLegacyTargets(targetName)
31558    ], []);
31559  }
31560  findTarget(targetName) {
31561    const selector = this.getSelectorForTargetName(targetName);
31562    return this.scope.findElement(selector);
31563  }
31564  findAllTargets(targetName) {
31565    const selector = this.getSelectorForTargetName(targetName);
31566    return this.scope.findAllElements(selector);
31567  }
31568  getSelectorForTargetName(targetName) {
31569    const attributeName = this.schema.targetAttributeForScope(this.identifier);
31570    return attributeValueContainsToken(attributeName, targetName);
31571  }
31572  findLegacyTarget(targetName) {
31573    const selector = this.getLegacySelectorForTargetName(targetName);
31574    return this.deprecate(this.scope.findElement(selector), targetName);
31575  }
31576  findAllLegacyTargets(targetName) {
31577    const selector = this.getLegacySelectorForTargetName(targetName);
31578    return this.scope.findAllElements(selector).map((element) => this.deprecate(element, targetName));
31579  }
31580  getLegacySelectorForTargetName(targetName) {
31581    const targetDescriptor = `${this.identifier}.${targetName}`;
31582    return attributeValueContainsToken(this.schema.targetAttribute, targetDescriptor);
31583  }
31584  deprecate(element, targetName) {
31585    if (element) {
31586      const { identifier } = this;
31587      const attributeName = this.schema.targetAttribute;
31588      const revisedAttributeName = this.schema.targetAttributeForScope(identifier);
31589      this.guide.warn(element, `target:${targetName}`, `Please replace ${attributeName}="${identifier}.${targetName}" with ${revisedAttributeName}="${targetName}". ` + `The ${attributeName} attribute is deprecated and will be removed in a future version of Stimulus.`);
31590    }
31591    return element;
31592  }
31593  get guide() {
31594    return this.scope.guide;
31595  }
31596}
31597
31598class OutletSet {
31599  constructor(scope, controllerElement) {
31600    this.scope = scope;
31601    this.controllerElement = controllerElement;
31602  }
31603  get element() {
31604    return this.scope.element;
31605  }
31606  get identifier() {
31607    return this.scope.identifier;
31608  }
31609  get schema() {
31610    return this.scope.schema;
31611  }
31612  has(outletName) {
31613    return this.find(outletName) != null;
31614  }
31615  find(...outletNames) {
31616    return outletNames.reduce((outlet, outletName) => outlet || this.findOutlet(outletName), undefined);
31617  }
31618  findAll(...outletNames) {
31619    return outletNames.reduce((outlets, outletName) => [...outlets, ...this.findAllOutlets(outletName)], []);
31620  }
31621  getSelectorForOutletName(outletName) {
31622    const attributeName = this.schema.outletAttributeForScope(this.identifier, outletName);
31623    return this.controllerElement.getAttribute(attributeName);
31624  }
31625  findOutlet(outletName) {
31626    const selector = this.getSelectorForOutletName(outletName);
31627    if (selector)
31628      return this.findElement(selector, outletName);
31629  }
31630  findAllOutlets(outletName) {
31631    const selector = this.getSelectorForOutletName(outletName);
31632    return selector ? this.findAllElements(selector, outletName) : [];
31633  }
31634  findElement(selector, outletName) {
31635    const elements = this.scope.queryElements(selector);
31636    return elements.filter((element) => this.matchesElement(element, selector, outletName))[0];
31637  }
31638  findAllElements(selector, outletName) {
31639    const elements = this.scope.queryElements(selector);
31640    return elements.filter((element) => this.matchesElement(element, selector, outletName));
31641  }
31642  matchesElement(element, selector, outletName) {
31643    const controllerAttribute = element.getAttribute(this.scope.schema.controllerAttribute) || "";
31644    return element.matches(selector) && controllerAttribute.split(" ").includes(outletName);
31645  }
31646}
31647
31648class Scope {
31649  constructor(schema, element, identifier, logger) {
31650    this.targets = new TargetSet(this);
31651    this.classes = new ClassMap(this);
31652    this.data = new DataMap(this);
31653    this.containsElement = (element) => {
31654      return element.closest(this.controllerSelector) === this.element;
31655    };
31656    this.schema = schema;
31657    this.element = element;
31658    this.identifier = identifier;
31659    this.guide = new Guide(logger);
31660    this.outlets = new OutletSet(this.documentScope, element);
31661  }
31662  findElement(selector) {
31663    return this.element.matches(selector) ? this.element : this.queryElements(selector).find(this.containsElement);
31664  }
31665  findAllElements(selector) {
31666    return [
31667      ...this.element.matches(selector) ? [this.element] : [],
31668      ...this.queryElements(selector).filter(this.containsElement)
31669    ];
31670  }
31671  queryElements(selector) {
31672    return Array.from(this.element.querySelectorAll(selector));
31673  }
31674  get controllerSelector() {
31675    return attributeValueContainsToken(this.schema.controllerAttribute, this.identifier);
31676  }
31677  get isDocumentScope() {
31678    return this.element === document.documentElement;
31679  }
31680  get documentScope() {
31681    return this.isDocumentScope ? this : new Scope(this.schema, document.documentElement, this.identifier, this.guide.logger);
31682  }
31683}
31684
31685class ScopeObserver {
31686  constructor(element, schema, delegate) {
31687    this.element = element;
31688    this.schema = schema;
31689    this.delegate = delegate;
31690    this.valueListObserver = new ValueListObserver(this.element, this.controllerAttribute, this);
31691    this.scopesByIdentifierByElement = new WeakMap;
31692    this.scopeReferenceCounts = new WeakMap;
31693  }
31694  start() {
31695    this.valueListObserver.start();
31696  }
31697  stop() {
31698    this.valueListObserver.stop();
31699  }
31700  get controllerAttribute() {
31701    return this.schema.controllerAttribute;
31702  }
31703  parseValueForToken(token) {
31704    const { element, content: identifier } = token;
31705    return this.parseValueForElementAndIdentifier(element, identifier);
31706  }
31707  parseValueForElementAndIdentifier(element, identifier) {
31708    const scopesByIdentifier = this.fetchScopesByIdentifierForElement(element);
31709    let scope = scopesByIdentifier.get(identifier);
31710    if (!scope) {
31711      scope = this.delegate.createScopeForElementAndIdentifier(element, identifier);
31712      scopesByIdentifier.set(identifier, scope);
31713    }
31714    return scope;
31715  }
31716  elementMatchedValue(element, value) {
31717    const referenceCount = (this.scopeReferenceCounts.get(value) || 0) + 1;
31718    this.scopeReferenceCounts.set(value, referenceCount);
31719    if (referenceCount == 1) {
31720      this.delegate.scopeConnected(value);
31721    }
31722  }
31723  elementUnmatchedValue(element, value) {
31724    const referenceCount = this.scopeReferenceCounts.get(value);
31725    if (referenceCount) {
31726      this.scopeReferenceCounts.set(value, referenceCount - 1);
31727      if (referenceCount == 1) {
31728        this.delegate.scopeDisconnected(value);
31729      }
31730    }
31731  }
31732  fetchScopesByIdentifierForElement(element) {
31733    let scopesByIdentifier = this.scopesByIdentifierByElement.get(element);
31734    if (!scopesByIdentifier) {
31735      scopesByIdentifier = new Map;
31736      this.scopesByIdentifierByElement.set(element, scopesByIdentifier);
31737    }
31738    return scopesByIdentifier;
31739  }
31740}
31741
31742class Router {
31743  constructor(application) {
31744    this.application = application;
31745    this.scopeObserver = new ScopeObserver(this.element, this.schema, this);
31746    this.scopesByIdentifier = new Multimap;
31747    this.modulesByIdentifier = new Map;
31748  }
31749  get element() {
31750    return this.application.element;
31751  }
31752  get schema() {
31753    return this.application.schema;
31754  }
31755  get logger() {
31756    return this.application.logger;
31757  }
31758  get controllerAttribute() {
31759    return this.schema.controllerAttribute;
31760  }
31761  get modules() {
31762    return Array.from(this.modulesByIdentifier.values());
31763  }
31764  get contexts() {
31765    return this.modules.reduce((contexts, module2) => contexts.concat(module2.contexts), []);
31766  }
31767  start() {
31768    this.scopeObserver.start();
31769  }
31770  stop() {
31771    this.scopeObserver.stop();
31772  }
31773  loadDefinition(definition) {
31774    this.unloadIdentifier(definition.identifier);
31775    const module2 = new Module(this.application, definition);
31776    this.connectModule(module2);
31777    const afterLoad = definition.controllerConstructor.afterLoad;
31778    if (afterLoad) {
31779      afterLoad.call(definition.controllerConstructor, definition.identifier, this.application);
31780    }
31781  }
31782  unloadIdentifier(identifier) {
31783    const module2 = this.modulesByIdentifier.get(identifier);
31784    if (module2) {
31785      this.disconnectModule(module2);
31786    }
31787  }
31788  getContextForElementAndIdentifier(element, identifier) {
31789    const module2 = this.modulesByIdentifier.get(identifier);
31790    if (module2) {
31791      return module2.contexts.find((context) => context.element == element);
31792    }
31793  }
31794  proposeToConnectScopeForElementAndIdentifier(element, identifier) {
31795    const scope = this.scopeObserver.parseValueForElementAndIdentifier(element, identifier);
31796    if (scope) {
31797      this.scopeObserver.elementMatchedValue(scope.element, scope);
31798    } else {
31799      console.error(`Couldn't find or create scope for identifier: "${identifier}" and element:`, element);
31800    }
31801  }
31802  handleError(error, message, detail) {
31803    this.application.handleError(error, message, detail);
31804  }
31805  createScopeForElementAndIdentifier(element, identifier) {
31806    return new Scope(this.schema, element, identifier, this.logger);
31807  }
31808  scopeConnected(scope) {
31809    this.scopesByIdentifier.add(scope.identifier, scope);
31810    const module2 = this.modulesByIdentifier.get(scope.identifier);
31811    if (module2) {
31812      module2.connectContextForScope(scope);
31813    }
31814  }
31815  scopeDisconnected(scope) {
31816    this.scopesByIdentifier.delete(scope.identifier, scope);
31817    const module2 = this.modulesByIdentifier.get(scope.identifier);
31818    if (module2) {
31819      module2.disconnectContextForScope(scope);
31820    }
31821  }
31822  connectModule(module2) {
31823    this.modulesByIdentifier.set(module2.identifier, module2);
31824    const scopes = this.scopesByIdentifier.getValuesForKey(module2.identifier);
31825    scopes.forEach((scope) => module2.connectContextForScope(scope));
31826  }
31827  disconnectModule(module2) {
31828    this.modulesByIdentifier.delete(module2.identifier);
31829    const scopes = this.scopesByIdentifier.getValuesForKey(module2.identifier);
31830    scopes.forEach((scope) => module2.disconnectContextForScope(scope));
31831  }
31832}
31833var defaultSchema = {
31834  controllerAttribute: "data-controller",
31835  actionAttribute: "data-action",
31836  targetAttribute: "data-target",
31837  targetAttributeForScope: (identifier) => `data-${identifier}-target`,
31838  outletAttributeForScope: (identifier, outlet) => `data-${identifier}-${outlet}-outlet`,
31839  keyMappings: Object.assign(Object.assign({ enter: "Enter", tab: "Tab", esc: "Escape", space: " ", up: "ArrowUp", down: "ArrowDown", left: "ArrowLeft", right: "ArrowRight", home: "Home", end: "End", page_up: "PageUp", page_down: "PageDown" }, objectFromEntries("abcdefghijklmnopqrstuvwxyz".split("").map((c) => [c, c]))), objectFromEntries("0123456789".split("").map((n) => [n, n])))
31840};
31841function objectFromEntries(array) {
31842  return array.reduce((memo, [k, v]) => Object.assign(Object.assign({}, memo), { [k]: v }), {});
31843}
31844
31845class Application {
31846  constructor(element = document.documentElement, schema = defaultSchema) {
31847    this.logger = console;
31848    this.debug = false;
31849    this.logDebugActivity = (identifier, functionName, detail = {}) => {
31850      if (this.debug) {
31851        this.logFormattedMessage(identifier, functionName, detail);
31852      }
31853    };
31854    this.element = element;
31855    this.schema = schema;
31856    this.dispatcher = new Dispatcher(this);
31857    this.router = new Router(this);
31858    this.actionDescriptorFilters = Object.assign({}, defaultActionDescriptorFilters);
31859  }
31860  static start(element, schema) {
31861    const application = new this(element, schema);
31862    application.start();
31863    return application;
31864  }
31865  async start() {
31866    await domReady();
31867    this.logDebugActivity("application", "starting");
31868    this.dispatcher.start();
31869    this.router.start();
31870    this.logDebugActivity("application", "start");
31871  }
31872  stop() {
31873    this.logDebugActivity("application", "stopping");
31874    this.dispatcher.stop();
31875    this.router.stop();
31876    this.logDebugActivity("application", "stop");
31877  }
31878  register(identifier, controllerConstructor) {
31879    this.load({ identifier, controllerConstructor });
31880  }
31881  registerActionOption(name, filter) {
31882    this.actionDescriptorFilters[name] = filter;
31883  }
31884  load(head, ...rest) {
31885    const definitions = Array.isArray(head) ? head : [head, ...rest];
31886    definitions.forEach((definition) => {
31887      if (definition.controllerConstructor.shouldLoad) {
31888        this.router.loadDefinition(definition);
31889      }
31890    });
31891  }
31892  unload(head, ...rest) {
31893    const identifiers = Array.isArray(head) ? head : [head, ...rest];
31894    identifiers.forEach((identifier) => this.router.unloadIdentifier(identifier));
31895  }
31896  get controllers() {
31897    return this.router.contexts.map((context) => context.controller);
31898  }
31899  getControllerForElementAndIdentifier(element, identifier) {
31900    const context = this.router.getContextForElementAndIdentifier(element, identifier);
31901    return context ? context.controller : null;
31902  }
31903  handleError(error, message, detail) {
31904    var _a;
31905    this.logger.error(`%s
31906
31907%o
31908
31909%o`, message, error, detail);
31910    (_a = window.onerror) === null || _a === undefined || _a.call(window, message, "", 0, 0, error);
31911  }
31912  logFormattedMessage(identifier, functionName, detail = {}) {
31913    detail = Object.assign({ application: this }, detail);
31914    this.logger.groupCollapsed(`${identifier} #${functionName}`);
31915    this.logger.log("details:", Object.assign({}, detail));
31916    this.logger.groupEnd();
31917  }
31918}
31919function domReady() {
31920  return new Promise((resolve) => {
31921    if (document.readyState == "loading") {
31922      document.addEventListener("DOMContentLoaded", () => resolve());
31923    } else {
31924      resolve();
31925    }
31926  });
31927}
31928function ClassPropertiesBlessing(constructor) {
31929  const classes = readInheritableStaticArrayValues(constructor, "classes");
31930  return classes.reduce((properties, classDefinition) => {
31931    return Object.assign(properties, propertiesForClassDefinition(classDefinition));
31932  }, {});
31933}
31934function propertiesForClassDefinition(key) {
31935  return {
31936    [`${key}Class`]: {
31937      get() {
31938        const { classes } = this;
31939        if (classes.has(key)) {
31940          return classes.get(key);
31941        } else {
31942          const attribute = classes.getAttributeName(key);
31943          throw new Error(`Missing attribute "${attribute}"`);
31944        }
31945      }
31946    },
31947    [`${key}Classes`]: {
31948      get() {
31949        return this.classes.getAll(key);
31950      }
31951    },
31952    [`has${capitalize(key)}Class`]: {
31953      get() {
31954        return this.classes.has(key);
31955      }
31956    }
31957  };
31958}
31959function OutletPropertiesBlessing(constructor) {
31960  const outlets = readInheritableStaticArrayValues(constructor, "outlets");
31961  return outlets.reduce((properties, outletDefinition) => {
31962    return Object.assign(properties, propertiesForOutletDefinition(outletDefinition));
31963  }, {});
31964}
31965function getOutletController(controller, element, identifier) {
31966  return controller.application.getControllerForElementAndIdentifier(element, identifier);
31967}
31968function getControllerAndEnsureConnectedScope(controller, element, outletName) {
31969  let outletController = getOutletController(controller, element, outletName);
31970  if (outletController)
31971    return outletController;
31972  controller.application.router.proposeToConnectScopeForElementAndIdentifier(element, outletName);
31973  outletController = getOutletController(controller, element, outletName);
31974  if (outletController)
31975    return outletController;
31976}
31977function propertiesForOutletDefinition(name) {
31978  const camelizedName = namespaceCamelize(name);
31979  return {
31980    [`${camelizedName}Outlet`]: {
31981      get() {
31982        const outletElement = this.outlets.find(name);
31983        const selector = this.outlets.getSelectorForOutletName(name);
31984        if (outletElement) {
31985          const outletController = getControllerAndEnsureConnectedScope(this, outletElement, name);
31986          if (outletController)
31987            return outletController;
31988          throw new Error(`The provided outlet element is missing an outlet controller "${name}" instance for host controller "${this.identifier}"`);
31989        }
31990        throw new Error(`Missing outlet element "${name}" for host controller "${this.identifier}". Stimulus couldn't find a matching outlet element using selector "${selector}".`);
31991      }
31992    },
31993    [`${camelizedName}Outlets`]: {
31994      get() {
31995        const outlets = this.outlets.findAll(name);
31996        if (outlets.length > 0) {
31997          return outlets.map((outletElement) => {
31998            const outletController = getControllerAndEnsureConnectedScope(this, outletElement, name);
31999            if (outletController)
32000              return outletController;
32001            console.warn(`The provided outlet element is missing an outlet controller "${name}" instance for host controller "${this.identifier}"`, outletElement);
32002          }).filter((controller) => controller);
32003        }
32004        return [];
32005      }
32006    },
32007    [`${camelizedName}OutletElement`]: {
32008      get() {
32009        const outletElement = this.outlets.find(name);
32010        const selector = this.outlets.getSelectorForOutletName(name);
32011        if (outletElement) {
32012          return outletElement;
32013        } else {
32014          throw new Error(`Missing outlet element "${name}" for host controller "${this.identifier}". Stimulus couldn't find a matching outlet element using selector "${selector}".`);
32015        }
32016      }
32017    },
32018    [`${camelizedName}OutletElements`]: {
32019      get() {
32020        return this.outlets.findAll(name);
32021      }
32022    },
32023    [`has${capitalize(camelizedName)}Outlet`]: {
32024      get() {
32025        return this.outlets.has(name);
32026      }
32027    }
32028  };
32029}
32030function TargetPropertiesBlessing(constructor) {
32031  const targets = readInheritableStaticArrayValues(constructor, "targets");
32032  return targets.reduce((properties, targetDefinition) => {
32033    return Object.assign(properties, propertiesForTargetDefinition(targetDefinition));
32034  }, {});
32035}
32036function propertiesForTargetDefinition(name) {
32037  return {
32038    [`${name}Target`]: {
32039      get() {
32040        const target = this.targets.find(name);
32041        if (target) {
32042          return target;
32043        } else {
32044          throw new Error(`Missing target element "${name}" for "${this.identifier}" controller`);
32045        }
32046      }
32047    },
32048    [`${name}Targets`]: {
32049      get() {
32050        return this.targets.findAll(name);
32051      }
32052    },
32053    [`has${capitalize(name)}Target`]: {
32054      get() {
32055        return this.targets.has(name);
32056      }
32057    }
32058  };
32059}
32060function ValuePropertiesBlessing(constructor) {
32061  const valueDefinitionPairs = readInheritableStaticObjectPairs(constructor, "values");
32062  const propertyDescriptorMap = {
32063    valueDescriptorMap: {
32064      get() {
32065        return valueDefinitionPairs.reduce((result, valueDefinitionPair) => {
32066          const valueDescriptor = parseValueDefinitionPair(valueDefinitionPair, this.identifier);
32067          const attributeName = this.data.getAttributeNameForKey(valueDescriptor.key);
32068          return Object.assign(result, { [attributeName]: valueDescriptor });
32069        }, {});
32070      }
32071    }
32072  };
32073  return valueDefinitionPairs.reduce((properties, valueDefinitionPair) => {
32074    return Object.assign(properties, propertiesForValueDefinitionPair(valueDefinitionPair));
32075  }, propertyDescriptorMap);
32076}
32077function propertiesForValueDefinitionPair(valueDefinitionPair, controller) {
32078  const definition = parseValueDefinitionPair(valueDefinitionPair, controller);
32079  const { key, name, reader: read, writer: write } = definition;
32080  return {
32081    [name]: {
32082      get() {
32083        const value = this.data.get(key);
32084        if (value !== null) {
32085          return read(value);
32086        } else {
32087          return definition.defaultValue;
32088        }
32089      },
32090      set(value) {
32091        if (value === undefined) {
32092          this.data.delete(key);
32093        } else {
32094          this.data.set(key, write(value));
32095        }
32096      }
32097    },
32098    [`has${capitalize(name)}`]: {
32099      get() {
32100        return this.data.has(key) || definition.hasCustomDefaultValue;
32101      }
32102    }
32103  };
32104}
32105function parseValueDefinitionPair([token, typeDefinition], controller) {
32106  return valueDescriptorForTokenAndTypeDefinition({
32107    controller,
32108    token,
32109    typeDefinition
32110  });
32111}
32112function parseValueTypeConstant(constant) {
32113  switch (constant) {
32114    case Array:
32115      return "array";
32116    case Boolean:
32117      return "boolean";
32118    case Number:
32119      return "number";
32120    case Object:
32121      return "object";
32122    case String:
32123      return "string";
32124  }
32125}
32126function parseValueTypeDefault(defaultValue) {
32127  switch (typeof defaultValue) {
32128    case "boolean":
32129      return "boolean";
32130    case "number":
32131      return "number";
32132    case "string":
32133      return "string";
32134  }
32135  if (Array.isArray(defaultValue))
32136    return "array";
32137  if (Object.prototype.toString.call(defaultValue) === "[object Object]")
32138    return "object";
32139}
32140function parseValueTypeObject(payload) {
32141  const { controller, token, typeObject } = payload;
32142  const hasType = isSomething(typeObject.type);
32143  const hasDefault = isSomething(typeObject.default);
32144  const fullObject = hasType && hasDefault;
32145  const onlyType = hasType && !hasDefault;
32146  const onlyDefault = !hasType && hasDefault;
32147  const typeFromObject = parseValueTypeConstant(typeObject.type);
32148  const typeFromDefaultValue = parseValueTypeDefault(payload.typeObject.default);
32149  if (onlyType)
32150    return typeFromObject;
32151  if (onlyDefault)
32152    return typeFromDefaultValue;
32153  if (typeFromObject !== typeFromDefaultValue) {
32154    const propertyPath = controller ? `${controller}.${token}` : token;
32155    throw new Error(`The specified default value for the Stimulus Value "${propertyPath}" must match the defined type "${typeFromObject}". The provided default value of "${typeObject.default}" is of type "${typeFromDefaultValue}".`);
32156  }
32157  if (fullObject)
32158    return typeFromObject;
32159}
32160function parseValueTypeDefinition(payload) {
32161  const { controller, token, typeDefinition } = payload;
32162  const typeObject = { controller, token, typeObject: typeDefinition };
32163  const typeFromObject = parseValueTypeObject(typeObject);
32164  const typeFromDefaultValue = parseValueTypeDefault(typeDefinition);
32165  const typeFromConstant = parseValueTypeConstant(typeDefinition);
32166  const type = typeFromObject || typeFromDefaultValue || typeFromConstant;
32167  if (type)
32168    return type;
32169  const propertyPath = controller ? `${controller}.${typeDefinition}` : token;
32170  throw new Error(`Unknown value type "${propertyPath}" for "${token}" value`);
32171}
32172function defaultValueForDefinition(typeDefinition) {
32173  const constant = parseValueTypeConstant(typeDefinition);
32174  if (constant)
32175    return defaultValuesByType[constant];
32176  const hasDefault = hasProperty(typeDefinition, "default");
32177  const hasType = hasProperty(typeDefinition, "type");
32178  const typeObject = typeDefinition;
32179  if (hasDefault)
32180    return typeObject.default;
32181  if (hasType) {
32182    const { type } = typeObject;
32183    const constantFromType = parseValueTypeConstant(type);
32184    if (constantFromType)
32185      return defaultValuesByType[constantFromType];
32186  }
32187  return typeDefinition;
32188}
32189function valueDescriptorForTokenAndTypeDefinition(payload) {
32190  const { token, typeDefinition } = payload;
32191  const key = `${dasherize(token)}-value`;
32192  const type = parseValueTypeDefinition(payload);
32193  return {
32194    type,
32195    key,
32196    name: camelize(key),
32197    get defaultValue() {
32198      return defaultValueForDefinition(typeDefinition);
32199    },
32200    get hasCustomDefaultValue() {
32201      return parseValueTypeDefault(typeDefinition) !== undefined;
32202    },
32203    reader: readers[type],
32204    writer: writers[type] || writers.default
32205  };
32206}
32207var defaultValuesByType = {
32208  get array() {
32209    return [];
32210  },
32211  boolean: false,
32212  number: 0,
32213  get object() {
32214    return {};
32215  },
32216  string: ""
32217};
32218var readers = {
32219  array(value) {
32220    const array = JSON.parse(value);
32221    if (!Array.isArray(array)) {
32222      throw new TypeError(`expected value of type "array" but instead got value "${value}" of type "${parseValueTypeDefault(array)}"`);
32223    }
32224    return array;
32225  },
32226  boolean(value) {
32227    return !(value == "0" || String(value).toLowerCase() == "false");
32228  },
32229  number(value) {
32230    return Number(value.replace(/_/g, ""));
32231  },
32232  object(value) {
32233    const object = JSON.parse(value);
32234    if (object === null || typeof object != "object" || Array.isArray(object)) {
32235      throw new TypeError(`expected value of type "object" but instead got value "${value}" of type "${parseValueTypeDefault(object)}"`);
32236    }
32237    return object;
32238  },
32239  string(value) {
32240    return value;
32241  }
32242};
32243var writers = {
32244  default: writeString,
32245  array: writeJSON,
32246  object: writeJSON
32247};
32248function writeJSON(value) {
32249  return JSON.stringify(value);
32250}
32251function writeString(value) {
32252  return `${value}`;
32253}
32254
32255class Controller {
32256  constructor(context) {
32257    this.context = context;
32258  }
32259  static get shouldLoad() {
32260    return true;
32261  }
32262  static afterLoad(_identifier, _application) {
32263    return;
32264  }
32265  get application() {
32266    return this.context.application;
32267  }
32268  get scope() {
32269    return this.context.scope;
32270  }
32271  get element() {
32272    return this.scope.element;
32273  }
32274  get identifier() {
32275    return this.scope.identifier;
32276  }
32277  get targets() {
32278    return this.scope.targets;
32279  }
32280  get outlets() {
32281    return this.scope.outlets;
32282  }
32283  get classes() {
32284    return this.scope.classes;
32285  }
32286  get data() {
32287    return this.scope.data;
32288  }
32289  initialize() {}
32290  connect() {}
32291  disconnect() {}
32292  dispatch(eventName, { target = this.element, detail = {}, prefix = this.identifier, bubbles = true, cancelable = true } = {}) {
32293    const type = prefix ? `${prefix}:${eventName}` : eventName;
32294    const event = new CustomEvent(type, { detail, bubbles, cancelable });
32295    target.dispatchEvent(event);
32296    return event;
32297  }
32298}
32299Controller.blessings = [
32300  ClassPropertiesBlessing,
32301  TargetPropertiesBlessing,
32302  ValuePropertiesBlessing,
32303  OutletPropertiesBlessing
32304];
32305Controller.targets = [];
32306Controller.outlets = [];
32307Controller.values = {};
32308

32309// app/javascript/controllers/search_controller.js
32310class search_controller_default extends Controller {
32311  static targets = ["nextSessionOption"];
32312  submit() {
32313    this.element.requestSubmit();
32314  }
32315  toggleNextSession(event) {
32316    const checkbox = event.currentTarget;
32317    if (checkbox.checked) {
32318      this.nextSessionOptionTargets.forEach((label) => {
32319        const input = label.querySelector("input");
32320        if (input !== checkbox) {
32321          input.checked = false;
32322          label.style.display = "none";
32323        }
32324      });
32325    } else {
32326      this.nextSessionOptionTargets.forEach((label) => {
32327        label.style.display = "";
32328      });
32329    }
32330    this.submit();
32331  }
32332}
32333

32334// app/javascript/controllers/filter_toggle_controller.js
32335class filter_toggle_controller_default extends Controller {
32336  static targets = ["panel", "iconFilter", "iconClose", "toggle"];
32337  toggle() {
32338    const panel = this.panelTarget;
32339    const isHidden = panel.classList.contains("d-none");
32340    if (isHidden) {
32341      panel.classList.remove("d-none", "d-md-block");
32342      panel.classList.add("d-block");
32343      this.iconFilterTarget.classList.add("d-none");
32344      this.iconCloseTarget.classList.remove("d-none");
32345    } else {
32346      panel.classList.remove("d-block");
32347      panel.classList.add("d-none", "d-md-block");
32348      this.iconFilterTarget.classList.remove("d-none");
32349      this.iconCloseTarget.classList.add("d-none");
32350    }
32351    this.toggleTarget.setAttribute("aria-expanded", isHidden ? "true" : "false");
32352    const hiddenField = panel.querySelector('input[name="filters_open"]');
32353    if (hiddenField) {
32354      hiddenField.value = isHidden ? "1" : "";
32355    }
32356  }
32357}
32358

32359// app/javascript/controllers/index.js
32360var application = Application.start();
32361application.register("search", search_controller_default);
32362application.register("filter-toggle", filter_toggle_controller_default);
32363

32364// app/javascript/application.js
32365var import_smoothscroll_polyfill = __toESM(require_smoothscroll());
32366

32367// app/javascript/theme/home.js
32368var import_jquery2 = __toESM(require_jquery());
32369function isHome() {
32370  return import_jquery2.default(".home.show").length === 1;
32371}
32372var ready2 = function() {
32373  if (!isHome()) {
32374    return;
32375  } else {
32376    var head = document.getElementsByTagName("head")[0];
32377    var script = document.createElement("script");
32378    script.type = "text/javascript";
32379    script.src = "/terminal.js";
32380    script.defer = true;
32381    head.appendChild(script);
32382    script.onload = function() {
32383      animateOnScroll();
32384    };
32385  }
32386};
32387function animateOnScroll() {
32388  import_jquery2.default(window).scroll(function() {
32389    if (!isHome()) {
32390      return;
32391    }
32392    var scroll = import_jquery2.default(window).scrollTop();
32393    if (scroll >= 300) {
32394      import_jquery2.default(".header").addClass("is-full fix");
32395    }
32396    if (scroll < 300) {
32397      import_jquery2.default(".header").removeClass("is-full fix");
32398    }
32399    if (scroll >= 400) {
32400      import_jquery2.default("#home-speaker").addClass("show");
32401    }
32402    if (scroll >= 700) {
32403      import_jquery2.default(".culture-item").addClass("show");
32404    }
32405    if (scroll >= 1000) {
32406      import_jquery2.default("#home-terminal").addClass("show");
32407      if (typeof window.terminalInit === "function") {
32408        window.terminalInit();
32409      }
32410    }
32411  });
32412}
32413import_jquery2.default(document).on("turbo:load", ready2);
32414

32415// app/javascript/theme/behavior.js
32416var import_jquery3 = __toESM(require_jquery());
32417document.addEventListener("turbo:load", function() {
32418  var quoteShowned = false;
32419  import_jquery3.default(document).on("click", "#display-more-quotes", function(e) {
32420    e.preventDefault();
32421    var $this = import_jquery3.default(this);
32422    if (!quoteShowned) {
32423      import_jquery3.default("#quotes > .row, #quotes-m > .row").addClass("show");
32424      $this.text("Masquer les tÃ©moignages");
32425    } else {
32426      import_jquery3.default("#quotes > .row, #quotes-m > .row").removeClass("show").first().addClass("show");
32427      $this.text("Afficher les autres tÃ©moignages");
32428    }
32429    quoteShowned = !quoteShowned;
32430  });
32431  var trainerShowned = false;
32432  import_jquery3.default(document).on("click", "#display-more-trainers", function(e) {
32433    e.preventDefault();
32434    var $this = import_jquery3.default(this);
32435    if (!trainerShowned) {
32436      import_jquery3.default("#trainers > .trainer").addClass("show");
32437      $this.text("Masquer les formateurs");
32438    } else {
32439      import_jquery3.default("#trainers > .trainer.hide").removeClass("show");
32440      $this.text("Afficher les autres formateurs");
32441    }
32442    trainerShowned = !trainerShowned;
32443  });
32444});
32445

32446// app/javascript/theme/stickers.js
32447var import_jquery4 = __toESM(require_jquery());
32448var import_scrollmagic = __toESM(require_ScrollMagic());
32449

vendor: 118,139 bytes, lines 32450-35616

32450// node_modules/gsap/gsap-core.js
32451function _assertThisInitialized(self2) {
32452  if (self2 === undefined) {
32453    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
32454  }
32455  return self2;
32456}
32457function _inheritsLoose(subClass, superClass) {
32458  subClass.prototype = Object.create(superClass.prototype);
32459  subClass.prototype.constructor = subClass;
32460  subClass.__proto__ = superClass;
32461}
32462/*!
32463 * GSAP 3.14.2
32464 * https://gsap.com
32465 *
32466 * @license Copyright 2008-2025, GreenSock. All rights reserved.
32467 * Subject to the terms at https://gsap.com/standard-license
32468 * @author: Jack Doyle, [email protected]
32469*/
32470var _config = {
32471  autoSleep: 120,
32472  force3D: "auto",
32473  nullTargetWarn: 1,
32474  units: {
32475    lineHeight: ""
32476  }
32477};
32478var _defaults = {
32479  duration: 0.5,
32480  overwrite: false,
32481  delay: 0
32482};
32483var _suppressOverwrites;
32484var _reverting;
32485var _context;
32486var _bigNum = 1e8;
32487var _tinyNum = 1 / _bigNum;
32488var _2PI = Math.PI * 2;
32489var _HALF_PI = _2PI / 4;
32490var _gsID = 0;
32491var _sqrt = Math.sqrt;
32492var _cos = Math.cos;
32493var _sin = Math.sin;
32494var _isString = function _isString(value) {
32495  return typeof value === "string";
32496};
32497var _isFunction = function _isFunction(value) {
32498  return typeof value === "function";
32499};
32500var _isNumber = function _isNumber(value) {
32501  return typeof value === "number";
32502};
32503var _isUndefined = function _isUndefined(value) {
32504  return typeof value === "undefined";
32505};
32506var _isObject = function _isObject(value) {
32507  return typeof value === "object";
32508};
32509var _isNotFalse = function _isNotFalse(value) {
32510  return value !== false;
32511};
32512var _windowExists = function _windowExists() {
32513  return typeof window !== "undefined";
32514};
32515var _isFuncOrString = function _isFuncOrString(value) {
32516  return _isFunction(value) || _isString(value);
32517};
32518var _isTypedArray = typeof ArrayBuffer === "function" && ArrayBuffer.isView || function() {};
32519var _isArray = Array.isArray;
32520var _randomExp = /random\([^)]+\)/g;
32521var _commaDelimExp = /,\s*/g;
32522var _strictNumExp = /(?:-?\.?\d|\.)+/gi;
32523var _numExp = /[-+=.]*\d+[.e\-+]*\d*[e\-+]*\d*/g;
32524var _numWithUnitExp = /[-+=.]*\d+[.e-]*\d*[a-z%]*/g;
32525var _complexStringNumExp = /[-+=.]*\d+\.?\d*(?:e-|e\+)?\d*/gi;
32526var _relExp = /[+-]=-?[.\d]+/;
32527var _delimitedValueExp = /[^,'"\[\]\s]+/gi;
32528var _unitExp = /^[+\-=e\s\d]*\d+[.\d]*([a-z]*|%)\s*$/i;
32529var _globalTimeline;
32530var _win;
32531var _coreInitted;
32532var _doc;
32533var _globals = {};
32534var _installScope = {};
32535var _coreReady;
32536var _install = function _install(scope) {
32537  return (_installScope = _merge(scope, _globals)) && gsap;
32538};
32539var _missingPlugin = function _missingPlugin(property, value) {
32540  return console.warn("Invalid property", property, "set to", value, "Missing plugin? gsap.registerPlugin()");
32541};
32542var _warn = function _warn(message, suppress) {
32543  return !suppress && console.warn(message);
32544};
32545var _addGlobal = function _addGlobal(name, obj2) {
32546  return name && (_globals[name] = obj2) && _installScope && (_installScope[name] = obj2) || _globals;
32547};
32548var _emptyFunc = function _emptyFunc() {
32549  return 0;
32550};
32551var _startAtRevertConfig = {
32552  suppressEvents: true,
32553  isStart: true,
32554  kill: false
32555};
32556var _revertConfigNoKill = {
32557  suppressEvents: true,
32558  kill: false
32559};
32560var _revertConfig = {
32561  suppressEvents: true
32562};
32563var _reservedProps = {};
32564var _lazyTweens = [];
32565var _lazyLookup = {};
32566var _lastRenderedFrame;
32567var _plugins = {};
32568var _effects = {};
32569var _nextGCFrame = 30;
32570var _harnessPlugins = [];
32571var _callbackNames = "";
32572var _harness = function _harness(targets) {
32573  var target = targets[0], harnessPlugin, i;
32574  _isObject(target) || _isFunction(target) || (targets = [targets]);
32575  if (!(harnessPlugin = (target._gsap || {}).harness)) {
32576    i = _harnessPlugins.length;
32577    while (i-- && !_harnessPlugins[i].targetTest(target)) {}
32578    harnessPlugin = _harnessPlugins[i];
32579  }
32580  i = targets.length;
32581  while (i--) {
32582    targets[i] && (targets[i]._gsap || (targets[i]._gsap = new GSCache(targets[i], harnessPlugin))) || targets.splice(i, 1);
32583  }
32584  return targets;
32585};
32586var _getCache = function _getCache(target) {
32587  return target._gsap || _harness(toArray(target))[0]._gsap;
32588};
32589var _getProperty = function _getProperty(target, property, v) {
32590  return (v = target[property]) && _isFunction(v) ? target[property]() : _isUndefined(v) && target.getAttribute && target.getAttribute(property) || v;
32591};
32592var _forEachName = function _forEachName(names, func) {
32593  return (names = names.split(",")).forEach(func) || names;
32594};
32595var _round = function _round(value) {
32596  return Math.round(value * 1e5) / 1e5 || 0;
32597};
32598var _roundPrecise = function _roundPrecise(value) {
32599  return Math.round(value * 1e7) / 1e7 || 0;
32600};
32601var _parseRelative = function _parseRelative(start, value) {
32602  var operator = value.charAt(0), end = parseFloat(value.substr(2));
32603  start = parseFloat(start);
32604  return operator === "+" ? start + end : operator === "-" ? start - end : operator === "*" ? start * end : start / end;
32605};
32606var _arrayContainsAny = function _arrayContainsAny(toSearch, toFind) {
32607  var l = toFind.length, i = 0;
32608  for (;toSearch.indexOf(toFind[i]) < 0 && ++i < l; ) {}
32609  return i < l;
32610};
32611var _lazyRender = function _lazyRender() {
32612  var l = _lazyTweens.length, a = _lazyTweens.slice(0), i, tween;
32613  _lazyLookup = {};
32614  _lazyTweens.length = 0;
32615  for (i = 0;i < l; i++) {
32616    tween = a[i];
32617    tween && tween._lazy && (tween.render(tween._lazy[0], tween._lazy[1], true)._lazy = 0);
32618  }
32619};
32620var _isRevertWorthy = function _isRevertWorthy(animation) {
32621  return !!(animation._initted || animation._startAt || animation.add);
32622};
32623var _lazySafeRender = function _lazySafeRender(animation, time, suppressEvents, force) {
32624  _lazyTweens.length && !_reverting && _lazyRender();
32625  animation.render(time, suppressEvents, force || !!(_reverting && time < 0 && _isRevertWorthy(animation)));
32626  _lazyTweens.length && !_reverting && _lazyRender();
32627};
32628var _numericIfPossible = function _numericIfPossible(value) {
32629  var n = parseFloat(value);
32630  return (n || n === 0) && (value + "").match(_delimitedValueExp).length < 2 ? n : _isString(value) ? value.trim() : value;
32631};
32632var _passThrough = function _passThrough(p) {
32633  return p;
32634};
32635var _setDefaults = function _setDefaults(obj2, defaults) {
32636  for (var p in defaults) {
32637    p in obj2 || (obj2[p] = defaults[p]);
32638  }
32639  return obj2;
32640};
32641var _setKeyframeDefaults = function _setKeyframeDefaults(excludeDuration) {
32642  return function(obj2, defaults) {
32643    for (var p in defaults) {
32644      p in obj2 || p === "duration" && excludeDuration || p === "ease" || (obj2[p] = defaults[p]);
32645    }
32646  };
32647};
32648var _merge = function _merge(base, toMerge) {
32649  for (var p in toMerge) {
32650    base[p] = toMerge[p];
32651  }
32652  return base;
32653};
32654var _mergeDeep = function _mergeDeep(base, toMerge) {
32655  for (var p in toMerge) {
32656    p !== "__proto__" && p !== "constructor" && p !== "prototype" && (base[p] = _isObject(toMerge[p]) ? _mergeDeep(base[p] || (base[p] = {}), toMerge[p]) : toMerge[p]);
32657  }
32658  return base;
32659};
32660var _copyExcluding = function _copyExcluding(obj2, excluding) {
32661  var copy = {}, p;
32662  for (p in obj2) {
32663    p in excluding || (copy[p] = obj2[p]);
32664  }
32665  return copy;
32666};
32667var _inheritDefaults = function _inheritDefaults(vars) {
32668  var parent = vars.parent || _globalTimeline, func = vars.keyframes ? _setKeyframeDefaults(_isArray(vars.keyframes)) : _setDefaults;
32669  if (_isNotFalse(vars.inherit)) {
32670    while (parent) {
32671      func(vars, parent.vars.defaults);
32672      parent = parent.parent || parent._dp;
32673    }
32674  }
32675  return vars;
32676};
32677var _arraysMatch = function _arraysMatch(a1, a2) {
32678  var i = a1.length, match = i === a2.length;
32679  while (match && i-- && a1[i] === a2[i]) {}
32680  return i < 0;
32681};
32682var _addLinkedListItem = function _addLinkedListItem(parent, child, firstProp, lastProp, sortBy) {
32683  if (firstProp === undefined) {
32684    firstProp = "_first";
32685  }
32686  if (lastProp === undefined) {
32687    lastProp = "_last";
32688  }
32689  var prev = parent[lastProp], t;
32690  if (sortBy) {
32691    t = child[sortBy];
32692    while (prev && prev[sortBy] > t) {
32693      prev = prev._prev;
32694    }
32695  }
32696  if (prev) {
32697    child._next = prev._next;
32698    prev._next = child;
32699  } else {
32700    child._next = parent[firstProp];
32701    parent[firstProp] = child;
32702  }
32703  if (child._next) {
32704    child._next._prev = child;
32705  } else {
32706    parent[lastProp] = child;
32707  }
32708  child._prev = prev;
32709  child.parent = child._dp = parent;
32710  return child;
32711};
32712var _removeLinkedListItem = function _removeLinkedListItem(parent, child, firstProp, lastProp) {
32713  if (firstProp === undefined) {
32714    firstProp = "_first";
32715  }
32716  if (lastProp === undefined) {
32717    lastProp = "_last";
32718  }
32719  var { _prev: prev, _next: next } = child;
32720  if (prev) {
32721    prev._next = next;
32722  } else if (parent[firstProp] === child) {
32723    parent[firstProp] = next;
32724  }
32725  if (next) {
32726    next._prev = prev;
32727  } else if (parent[lastProp] === child) {
32728    parent[lastProp] = prev;
32729  }
32730  child._next = child._prev = child.parent = null;
32731};
32732var _removeFromParent = function _removeFromParent(child, onlyIfParentHasAutoRemove) {
32733  child.parent && (!onlyIfParentHasAutoRemove || child.parent.autoRemoveChildren) && child.parent.remove && child.parent.remove(child);
32734  child._act = 0;
32735};
32736var _uncache = function _uncache(animation, child) {
32737  if (animation && (!child || child._end > animation._dur || child._start < 0)) {
32738    var a = animation;
32739    while (a) {
32740      a._dirty = 1;
32741      a = a.parent;
32742    }
32743  }
32744  return animation;
32745};
32746var _recacheAncestors = function _recacheAncestors(animation) {
32747  var parent = animation.parent;
32748  while (parent && parent.parent) {
32749    parent._dirty = 1;
32750    parent.totalDuration();
32751    parent = parent.parent;
32752  }
32753  return animation;
32754};
32755var _rewindStartAt = function _rewindStartAt(tween, totalTime, suppressEvents, force) {
32756  return tween._startAt && (_reverting ? tween._startAt.revert(_revertConfigNoKill) : tween.vars.immediateRender && !tween.vars.autoRevert || tween._startAt.render(totalTime, true, force));
32757};
32758var _hasNoPausedAncestors = function _hasNoPausedAncestors(animation) {
32759  return !animation || animation._ts && _hasNoPausedAncestors(animation.parent);
32760};
32761var _elapsedCycleDuration = function _elapsedCycleDuration(animation) {
32762  return animation._repeat ? _animationCycle(animation._tTime, animation = animation.duration() + animation._rDelay) * animation : 0;
32763};
32764var _animationCycle = function _animationCycle(tTime, cycleDuration) {
32765  var whole = Math.floor(tTime = _roundPrecise(tTime / cycleDuration));
32766  return tTime && whole === tTime ? whole - 1 : whole;
32767};
32768var _parentToChildTotalTime = function _parentToChildTotalTime(parentTime, child) {
32769  return (parentTime - child._start) * child._ts + (child._ts >= 0 ? 0 : child._dirty ? child.totalDuration() : child._tDur);
32770};
32771var _setEnd = function _setEnd(animation) {
32772  return animation._end = _roundPrecise(animation._start + (animation._tDur / Math.abs(animation._ts || animation._rts || _tinyNum) || 0));
32773};
32774var _alignPlayhead = function _alignPlayhead(animation, totalTime) {
32775  var parent = animation._dp;
32776  if (parent && parent.smoothChildTiming && animation._ts) {
32777    animation._start = _roundPrecise(parent._time - (animation._ts > 0 ? totalTime / animation._ts : ((animation._dirty ? animation.totalDuration() : animation._tDur) - totalTime) / -animation._ts));
32778    _setEnd(animation);
32779    parent._dirty || _uncache(parent, animation);
32780  }
32781  return animation;
32782};
32783var _postAddChecks = function _postAddChecks(timeline, child) {
32784  var t;
32785  if (child._time || !child._dur && child._initted || child._start < timeline._time && (child._dur || !child.add)) {
32786    t = _parentToChildTotalTime(timeline.rawTime(), child);
32787    if (!child._dur || _clamp(0, child.totalDuration(), t) - child._tTime > _tinyNum) {
32788      child.render(t, true);
32789    }
32790  }
32791  if (_uncache(timeline, child)._dp && timeline._initted && timeline._time >= timeline._dur && timeline._ts) {
32792    if (timeline._dur < timeline.duration()) {
32793      t = timeline;
32794      while (t._dp) {
32795        t.rawTime() >= 0 && t.totalTime(t._tTime);
32796        t = t._dp;
32797      }
32798    }
32799    timeline._zTime = -_tinyNum;
32800  }
32801};
32802var _addToTimeline = function _addToTimeline(timeline, child, position, skipChecks) {
32803  child.parent && _removeFromParent(child);
32804  child._start = _roundPrecise((_isNumber(position) ? position : position || timeline !== _globalTimeline ? _parsePosition(timeline, position, child) : timeline._time) + child._delay);
32805  child._end = _roundPrecise(child._start + (child.totalDuration() / Math.abs(child.timeScale()) || 0));
32806  _addLinkedListItem(timeline, child, "_first", "_last", timeline._sort ? "_start" : 0);
32807  _isFromOrFromStart(child) || (timeline._recent = child);
32808  skipChecks || _postAddChecks(timeline, child);
32809  timeline._ts < 0 && _alignPlayhead(timeline, timeline._tTime);
32810  return timeline;
32811};
32812var _scrollTrigger = function _scrollTrigger(animation, trigger) {
32813  return (_globals.ScrollTrigger || _missingPlugin("scrollTrigger", trigger)) && _globals.ScrollTrigger.create(trigger, animation);
32814};
32815var _attemptInitTween = function _attemptInitTween(tween, time, force, suppressEvents, tTime) {
32816  _initTween(tween, time, tTime);
32817  if (!tween._initted) {
32818    return 1;
32819  }
32820  if (!force && tween._pt && !_reverting && (tween._dur && tween.vars.lazy !== false || !tween._dur && tween.vars.lazy) && _lastRenderedFrame !== _ticker.frame) {
32821    _lazyTweens.push(tween);
32822    tween._lazy = [tTime, suppressEvents];
32823    return 1;
32824  }
32825};
32826var _parentPlayheadIsBeforeStart = function _parentPlayheadIsBeforeStart(_ref) {
32827  var parent = _ref.parent;
32828  return parent && parent._ts && parent._initted && !parent._lock && (parent.rawTime() < 0 || _parentPlayheadIsBeforeStart(parent));
32829};
32830var _isFromOrFromStart = function _isFromOrFromStart(_ref2) {
32831  var data = _ref2.data;
32832  return data === "isFromStart" || data === "isStart";
32833};
32834var _renderZeroDurationTween = function _renderZeroDurationTween(tween, totalTime, suppressEvents, force) {
32835  var prevRatio = tween.ratio, ratio = totalTime < 0 || !totalTime && (!tween._start && _parentPlayheadIsBeforeStart(tween) && !(!tween._initted && _isFromOrFromStart(tween)) || (tween._ts < 0 || tween._dp._ts < 0) && !_isFromOrFromStart(tween)) ? 0 : 1, repeatDelay = tween._rDelay, tTime = 0, pt, iteration, prevIteration;
32836  if (repeatDelay && tween._repeat) {
32837    tTime = _clamp(0, tween._tDur, totalTime);
32838    iteration = _animationCycle(tTime, repeatDelay);
32839    tween._yoyo && iteration & 1 && (ratio = 1 - ratio);
32840    if (iteration !== _animationCycle(tween._tTime, repeatDelay)) {
32841      prevRatio = 1 - ratio;
32842      tween.vars.repeatRefresh && tween._initted && tween.invalidate();
32843    }
32844  }
32845  if (ratio !== prevRatio || _reverting || force || tween._zTime === _tinyNum || !totalTime && tween._zTime) {
32846    if (!tween._initted && _attemptInitTween(tween, totalTime, force, suppressEvents, tTime)) {
32847      return;
32848    }
32849    prevIteration = tween._zTime;
32850    tween._zTime = totalTime || (suppressEvents ? _tinyNum : 0);
32851    suppressEvents || (suppressEvents = totalTime && !prevIteration);
32852    tween.ratio = ratio;
32853    tween._from && (ratio = 1 - ratio);
32854    tween._time = 0;
32855    tween._tTime = tTime;
32856    pt = tween._pt;
32857    while (pt) {
32858      pt.r(ratio, pt.d);
32859      pt = pt._next;
32860    }
32861    totalTime < 0 && _rewindStartAt(tween, totalTime, suppressEvents, true);
32862    tween._onUpdate && !suppressEvents && _callback(tween, "onUpdate");
32863    tTime && tween._repeat && !suppressEvents && tween.parent && _callback(tween, "onRepeat");
32864    if ((totalTime >= tween._tDur || totalTime < 0) && tween.ratio === ratio) {
32865      ratio && _removeFromParent(tween, 1);
32866      if (!suppressEvents && !_reverting) {
32867        _callback(tween, ratio ? "onComplete" : "onReverseComplete", true);
32868        tween._prom && tween._prom();
32869      }
32870    }
32871  } else if (!tween._zTime) {
32872    tween._zTime = totalTime;
32873  }
32874};
32875var _findNextPauseTween = function _findNextPauseTween(animation, prevTime, time) {
32876  var child;
32877  if (time > prevTime) {
32878    child = animation._first;
32879    while (child && child._start <= time) {
32880      if (child.data === "isPause" && child._start > prevTime) {
32881        return child;
32882      }
32883      child = child._next;
32884    }
32885  } else {
32886    child = animation._last;
32887    while (child && child._start >= time) {
32888      if (child.data === "isPause" && child._start < prevTime) {
32889        return child;
32890      }
32891      child = child._prev;
32892    }
32893  }
32894};
32895var _setDuration = function _setDuration(animation, duration, skipUncache, leavePlayhead) {
32896  var repeat = animation._repeat, dur = _roundPrecise(duration) || 0, totalProgress = animation._tTime / animation._tDur;
32897  totalProgress && !leavePlayhead && (animation._time *= dur / animation._dur);
32898  animation._dur = dur;
32899  animation._tDur = !repeat ? dur : repeat < 0 ? 10000000000 : _roundPrecise(dur * (repeat + 1) + animation._rDelay * repeat);
32900  totalProgress > 0 && !leavePlayhead && _alignPlayhead(animation, animation._tTime = animation._tDur * totalProgress);
32901  animation.parent && _setEnd(animation);
32902  skipUncache || _uncache(animation.parent, animation);
32903  return animation;
32904};
32905var _onUpdateTotalDuration = function _onUpdateTotalDuration(animation) {
32906  return animation instanceof Timeline ? _uncache(animation) : _setDuration(animation, animation._dur);
32907};
32908var _zeroPosition = {
32909  _start: 0,
32910  endTime: _emptyFunc,
32911  totalDuration: _emptyFunc
32912};
32913var _parsePosition = function _parsePosition(animation, position, percentAnimation) {
32914  var labels = animation.labels, recent = animation._recent || _zeroPosition, clippedDuration = animation.duration() >= _bigNum ? recent.endTime(false) : animation._dur, i, offset, isPercent;
32915  if (_isString(position) && (isNaN(position) || (position in labels))) {
32916    offset = position.charAt(0);
32917    isPercent = position.substr(-1) === "%";
32918    i = position.indexOf("=");
32919    if (offset === "<" || offset === ">") {
32920      i >= 0 && (position = position.replace(/=/, ""));
32921      return (offset === "<" ? recent._start : recent.endTime(recent._repeat >= 0)) + (parseFloat(position.substr(1)) || 0) * (isPercent ? (i < 0 ? recent : percentAnimation).totalDuration() / 100 : 1);
32922    }
32923    if (i < 0) {
32924      position in labels || (labels[position] = clippedDuration);
32925      return labels[position];
32926    }
32927    offset = parseFloat(position.charAt(i - 1) + position.substr(i + 1));
32928    if (isPercent && percentAnimation) {
32929      offset = offset / 100 * (_isArray(percentAnimation) ? percentAnimation[0] : percentAnimation).totalDuration();
32930    }
32931    return i > 1 ? _parsePosition(animation, position.substr(0, i - 1), percentAnimation) + offset : clippedDuration + offset;
32932  }
32933  return position == null ? clippedDuration : +position;
32934};
32935var _createTweenType = function _createTweenType(type, params, timeline) {
32936  var isLegacy = _isNumber(params[1]), varsIndex = (isLegacy ? 2 : 1) + (type < 2 ? 0 : 1), vars = params[varsIndex], irVars, parent;
32937  isLegacy && (vars.duration = params[1]);
32938  vars.parent = timeline;
32939  if (type) {
32940    irVars = vars;
32941    parent = timeline;
32942    while (parent && !("immediateRender" in irVars)) {
32943      irVars = parent.vars.defaults || {};
32944      parent = _isNotFalse(parent.vars.inherit) && parent.parent;
32945    }
32946    vars.immediateRender = _isNotFalse(irVars.immediateRender);
32947    type < 2 ? vars.runBackwards = 1 : vars.startAt = params[varsIndex - 1];
32948  }
32949  return new Tween(params[0], vars, params[varsIndex + 1]);
32950};
32951var _conditionalReturn = function _conditionalReturn(value, func) {
32952  return value || value === 0 ? func(value) : func;
32953};
32954var _clamp = function _clamp(min, max, value) {
32955  return value < min ? min : value > max ? max : value;
32956};
32957var getUnit = function getUnit(value, v) {
32958  return !_isString(value) || !(v = _unitExp.exec(value)) ? "" : v[1];
32959};
32960var clamp = function clamp(min, max, value) {
32961  return _conditionalReturn(value, function(v) {
32962    return _clamp(min, max, v);
32963  });
32964};
32965var _slice = [].slice;
32966var _isArrayLike = function _isArrayLike(value, nonEmpty) {
32967  return value && _isObject(value) && "length" in value && (!nonEmpty && !value.length || (value.length - 1 in value) && _isObject(value[0])) && !value.nodeType && value !== _win;
32968};
32969var _flatten = function _flatten(ar, leaveStrings, accumulator) {
32970  if (accumulator === undefined) {
32971    accumulator = [];
32972  }
32973  return ar.forEach(function(value) {
32974    var _accumulator;
32975    return _isString(value) && !leaveStrings || _isArrayLike(value, 1) ? (_accumulator = accumulator).push.apply(_accumulator, toArray(value)) : accumulator.push(value);
32976  }) || accumulator;
32977};
32978var toArray = function toArray(value, scope, leaveStrings) {
32979  return _context && !scope && _context.selector ? _context.selector(value) : _isString(value) && !leaveStrings && (_coreInitted || !_wake()) ? _slice.call((scope || _doc).querySelectorAll(value), 0) : _isArray(value) ? _flatten(value, leaveStrings) : _isArrayLike(value) ? _slice.call(value, 0) : value ? [value] : [];
32980};
32981var selector = function selector(value) {
32982  value = toArray(value)[0] || _warn("Invalid scope") || {};
32983  return function(v) {
32984    var el = value.current || value.nativeElement || value;
32985    return toArray(v, el.querySelectorAll ? el : el === value ? _warn("Invalid scope") || _doc.createElement("div") : value);
32986  };
32987};
32988var shuffle = function shuffle(a) {
32989  return a.sort(function() {
32990    return 0.5 - Math.random();
32991  });
32992};
32993var distribute = function distribute(v) {
32994  if (_isFunction(v)) {
32995    return v;
32996  }
32997  var vars = _isObject(v) ? v : {
32998    each: v
32999  }, ease = _parseEase(vars.ease), from = vars.from || 0, base = parseFloat(vars.base) || 0, cache = {}, isDecimal = from > 0 && from < 1, ratios = isNaN(from) || isDecimal, axis = vars.axis, ratioX = from, ratioY = from;
33000  if (_isString(from)) {
33001    ratioX = ratioY = {
33002      center: 0.5,
33003      edges: 0.5,
33004      end: 1
33005    }[from] || 0;
33006  } else if (!isDecimal && ratios) {
33007    ratioX = from[0];
33008    ratioY = from[1];
33009  }
33010  return function(i, target, a) {
33011    var l = (a || vars).length, distances = cache[l], originX, originY, x, y, d, j, max, min, wrapAt;
33012    if (!distances) {
33013      wrapAt = vars.grid === "auto" ? 0 : (vars.grid || [1, _bigNum])[1];
33014      if (!wrapAt) {
33015        max = -_bigNum;
33016        while (max < (max = a[wrapAt++].getBoundingClientRect().left) && wrapAt < l) {}
33017        wrapAt < l && wrapAt--;
33018      }
33019      distances = cache[l] = [];
33020      originX = ratios ? Math.min(wrapAt, l) * ratioX - 0.5 : from % wrapAt;
33021      originY = wrapAt === _bigNum ? 0 : ratios ? l * ratioY / wrapAt - 0.5 : from / wrapAt | 0;
33022      max = 0;
33023      min = _bigNum;
33024      for (j = 0;j < l; j++) {
33025        x = j % wrapAt - originX;
33026        y = originY - (j / wrapAt | 0);
33027        distances[j] = d = !axis ? _sqrt(x * x + y * y) : Math.abs(axis === "y" ? y : x);
33028        d > max && (max = d);
33029        d < min && (min = d);
33030      }
33031      from === "random" && shuffle(distances);
33032      distances.max = max - min;
33033      distances.min = min;
33034      distances.v = l = (parseFloat(vars.amount) || parseFloat(vars.each) * (wrapAt > l ? l - 1 : !axis ? Math.max(wrapAt, l / wrapAt) : axis === "y" ? l / wrapAt : wrapAt) || 0) * (from === "edges" ? -1 : 1);
33035      distances.b = l < 0 ? base - l : base;
33036      distances.u = getUnit(vars.amount || vars.each) || 0;
33037      ease = ease && l < 0 ? _invertEase(ease) : ease;
33038    }
33039    l = (distances[i] - distances.min) / distances.max || 0;
33040    return _roundPrecise(distances.b + (ease ? ease(l) : l) * distances.v) + distances.u;
33041  };
33042};
33043var _roundModifier = function _roundModifier(v) {
33044  var p = Math.pow(10, ((v + "").split(".")[1] || "").length);
33045  return function(raw) {
33046    var n = _roundPrecise(Math.round(parseFloat(raw) / v) * v * p);
33047    return (n - n % 1) / p + (_isNumber(raw) ? 0 : getUnit(raw));
33048  };
33049};
33050var snap = function snap(snapTo, value) {
33051  var isArray = _isArray(snapTo), radius, is2D;
33052  if (!isArray && _isObject(snapTo)) {
33053    radius = isArray = snapTo.radius || _bigNum;
33054    if (snapTo.values) {
33055      snapTo = toArray(snapTo.values);
33056      if (is2D = !_isNumber(snapTo[0])) {
33057        radius *= radius;
33058      }
33059    } else {
33060      snapTo = _roundModifier(snapTo.increment);
33061    }
33062  }
33063  return _conditionalReturn(value, !isArray ? _roundModifier(snapTo) : _isFunction(snapTo) ? function(raw) {
33064    is2D = snapTo(raw);
33065    return Math.abs(is2D - raw) <= radius ? is2D : raw;
33066  } : function(raw) {
33067    var x = parseFloat(is2D ? raw.x : raw), y = parseFloat(is2D ? raw.y : 0), min = _bigNum, closest = 0, i = snapTo.length, dx, dy;
33068    while (i--) {
33069      if (is2D) {
33070        dx = snapTo[i].x - x;
33071        dy = snapTo[i].y - y;
33072        dx = dx * dx + dy * dy;
33073      } else {
33074        dx = Math.abs(snapTo[i] - x);
33075      }
33076      if (dx < min) {
33077        min = dx;
33078        closest = i;
33079      }
33080    }
33081    closest = !radius || min <= radius ? snapTo[closest] : raw;
33082    return is2D || closest === raw || _isNumber(raw) ? closest : closest + getUnit(raw);
33083  });
33084};
33085var random = function random(min, max, roundingIncrement, returnFunction) {
33086  return _conditionalReturn(_isArray(min) ? !max : roundingIncrement === true ? !!(roundingIncrement = 0) : !returnFunction, function() {
33087    return _isArray(min) ? min[~~(Math.random() * min.length)] : (roundingIncrement = roundingIncrement || 0.00001) && (returnFunction = roundingIncrement < 1 ? Math.pow(10, (roundingIncrement + "").length - 2) : 1) && Math.floor(Math.round((min - roundingIncrement / 2 + Math.random() * (max - min + roundingIncrement * 0.99)) / roundingIncrement) * roundingIncrement * returnFunction) / returnFunction;
33088  });
33089};
33090var pipe = function pipe() {
33091  for (var _len = arguments.length, functions = new Array(_len), _key = 0;_key < _len; _key++) {
33092    functions[_key] = arguments[_key];
33093  }
33094  return function(value) {
33095    return functions.reduce(function(v, f) {
33096      return f(v);
33097    }, value);
33098  };
33099};
33100var unitize = function unitize(func, unit) {
33101  return function(value) {
33102    return func(parseFloat(value)) + (unit || getUnit(value));
33103  };
33104};
33105var normalize = function normalize(min, max, value) {
33106  return mapRange(min, max, 0, 1, value);
33107};
33108var _wrapArray = function _wrapArray(a, wrapper, value) {
33109  return _conditionalReturn(value, function(index) {
33110    return a[~~wrapper(index)];
33111  });
33112};
33113var wrap = function wrap(min, max, value) {
33114  var range = max - min;
33115  return _isArray(min) ? _wrapArray(min, wrap(0, min.length), max) : _conditionalReturn(value, function(value) {
33116    return (range + (value - min) % range) % range + min;
33117  });
33118};
33119var wrapYoyo = function wrapYoyo(min, max, value) {
33120  var range = max - min, total = range * 2;
33121  return _isArray(min) ? _wrapArray(min, wrapYoyo(0, min.length - 1), max) : _conditionalReturn(value, function(value) {
33122    value = (total + (value - min) % total) % total || 0;
33123    return min + (value > range ? total - value : value);
33124  });
33125};
33126var _replaceRandom = function _replaceRandom(s) {
33127  return s.replace(_randomExp, function(match) {
33128    var arIndex = match.indexOf("[") + 1, values = match.substring(arIndex || 7, arIndex ? match.indexOf("]") : match.length - 1).split(_commaDelimExp);
33129    return random(arIndex ? values : +values[0], arIndex ? 0 : +values[1], +values[2] || 0.00001);
33130  });
33131};
33132var mapRange = function mapRange(inMin, inMax, outMin, outMax, value) {
33133  var inRange = inMax - inMin, outRange = outMax - outMin;
33134  return _conditionalReturn(value, function(value) {
33135    return outMin + ((value - inMin) / inRange * outRange || 0);
33136  });
33137};
33138var interpolate2 = function interpolate(start, end, progress, mutate) {
33139  var func = isNaN(start + end) ? 0 : function(p) {
33140    return (1 - p) * start + p * end;
33141  };
33142  if (!func) {
33143    var isString = _isString(start), master = {}, p, i, interpolators, l, il;
33144    progress === true && (mutate = 1) && (progress = null);
33145    if (isString) {
33146      start = {
33147        p: start
33148      };
33149      end = {
33150        p: end
33151      };
33152    } else if (_isArray(start) && !_isArray(end)) {
33153      interpolators = [];
33154      l = start.length;
33155      il = l - 2;
33156      for (i = 1;i < l; i++) {
33157        interpolators.push(interpolate(start[i - 1], start[i]));
33158      }
33159      l--;
33160      func = function func(p) {
33161        p *= l;
33162        var i = Math.min(il, ~~p);
33163        return interpolators[i](p - i);
33164      };
33165      progress = end;
33166    } else if (!mutate) {
33167      start = _merge(_isArray(start) ? [] : {}, start);
33168    }
33169    if (!interpolators) {
33170      for (p in end) {
33171        _addPropTween.call(master, start, p, "get", end[p]);
33172      }
33173      func = function func(p) {
33174        return _renderPropTweens(p, master) || (isString ? start.p : start);
33175      };
33176    }
33177  }
33178  return _conditionalReturn(progress, func);
33179};
33180var _getLabelInDirection = function _getLabelInDirection(timeline, fromTime, backward) {
33181  var labels = timeline.labels, min = _bigNum, p, distance, label;
33182  for (p in labels) {
33183    distance = labels[p] - fromTime;
33184    if (distance < 0 === !!backward && distance && min > (distance = Math.abs(distance))) {
33185      label = p;
33186      min = distance;
33187    }
33188  }
33189  return label;
33190};
33191var _callback = function _callback(animation, type, executeLazyFirst) {
33192  var v = animation.vars, callback = v[type], prevContext = _context, context = animation._ctx, params, scope, result;
33193  if (!callback) {
33194    return;
33195  }
33196  params = v[type + "Params"];
33197  scope = v.callbackScope || animation;
33198  executeLazyFirst && _lazyTweens.length && _lazyRender();
33199  context && (_context = context);
33200  result = params ? callback.apply(scope, params) : callback.call(scope);
33201  _context = prevContext;
33202  return result;
33203};
33204var _interrupt = function _interrupt(animation) {
33205  _removeFromParent(animation);
33206  animation.scrollTrigger && animation.scrollTrigger.kill(!!_reverting);
33207  animation.progress() < 1 && _callback(animation, "onInterrupt");
33208  return animation;
33209};
33210var _quickTween;
33211var _registerPluginQueue = [];
33212var _createPlugin = function _createPlugin(config) {
33213  if (!config)
33214    return;
33215  config = !config.name && config["default"] || config;
33216  if (_windowExists() || config.headless) {
33217    var name = config.name, isFunc = _isFunction(config), Plugin = name && !isFunc && config.init ? function() {
33218      this._props = [];
33219    } : config, instanceDefaults = {
33220      init: _emptyFunc,
33221      render: _renderPropTweens,
33222      add: _addPropTween,
33223      kill: _killPropTweensOf,
33224      modifier: _addPluginModifier,
33225      rawVars: 0
33226    }, statics = {
33227      targetTest: 0,
33228      get: 0,
33229      getSetter: _getSetter,
33230      aliases: {},
33231      register: 0
33232    };
33233    _wake();
33234    if (config !== Plugin) {
33235      if (_plugins[name]) {
33236        return;
33237      }
33238      _setDefaults(Plugin, _setDefaults(_copyExcluding(config, instanceDefaults), statics));
33239      _merge(Plugin.prototype, _merge(instanceDefaults, _copyExcluding(config, statics)));
33240      _plugins[Plugin.prop = name] = Plugin;
33241      if (config.targetTest) {
33242        _harnessPlugins.push(Plugin);
33243        _reservedProps[name] = 1;
33244      }
33245      name = (name === "css" ? "CSS" : name.charAt(0).toUpperCase() + name.substr(1)) + "Plugin";
33246    }
33247    _addGlobal(name, Plugin);
33248    config.register && config.register(gsap, Plugin, PropTween);
33249  } else {
33250    _registerPluginQueue.push(config);
33251  }
33252};
33253var _255 = 255;
33254var _colorLookup = {
33255  aqua: [0, _255, _255],
33256  lime: [0, _255, 0],
33257  silver: [192, 192, 192],
33258  black: [0, 0, 0],
33259  maroon: [128, 0, 0],
33260  teal: [0, 128, 128],
33261  blue: [0, 0, _255],
33262  navy: [0, 0, 128],
33263  white: [_255, _255, _255],
33264  olive: [128, 128, 0],
33265  yellow: [_255, _255, 0],
33266  orange: [_255, 165, 0],
33267  gray: [128, 128, 128],
33268  purple: [128, 0, 128],
33269  green: [0, 128, 0],
33270  red: [_255, 0, 0],
33271  pink: [_255, 192, 203],
33272  cyan: [0, _255, _255],
33273  transparent: [_255, _255, _255, 0]
33274};
33275var _hue = function _hue(h, m1, m2) {
33276  h += h < 0 ? 1 : h > 1 ? -1 : 0;
33277  return (h * 6 < 1 ? m1 + (m2 - m1) * h * 6 : h < 0.5 ? m2 : h * 3 < 2 ? m1 + (m2 - m1) * (2 / 3 - h) * 6 : m1) * _255 + 0.5 | 0;
33278};
33279var splitColor = function splitColor(v, toHSL, forceAlpha) {
33280  var a = !v ? _colorLookup.black : _isNumber(v) ? [v >> 16, v >> 8 & _255, v & _255] : 0, r, g, b, h, s, l, max, min, d, wasHSL;
33281  if (!a) {
33282    if (v.substr(-1) === ",") {
33283      v = v.substr(0, v.length - 1);
33284    }
33285    if (_colorLookup[v]) {
33286      a = _colorLookup[v];
33287    } else if (v.charAt(0) === "#") {
33288      if (v.length < 6) {
33289        r = v.charAt(1);
33290        g = v.charAt(2);
33291        b = v.charAt(3);
33292        v = "#" + r + r + g + g + b + b + (v.length === 5 ? v.charAt(4) + v.charAt(4) : "");
33293      }
33294      if (v.length === 9) {
33295        a = parseInt(v.substr(1, 6), 16);
33296        return [a >> 16, a >> 8 & _255, a & _255, parseInt(v.substr(7), 16) / 255];
33297      }
33298      v = parseInt(v.substr(1), 16);
33299      a = [v >> 16, v >> 8 & _255, v & _255];
33300    } else if (v.substr(0, 3) === "hsl") {
33301      a = wasHSL = v.match(_strictNumExp);
33302      if (!toHSL) {
33303        h = +a[0] % 360 / 360;
33304        s = +a[1] / 100;
33305        l = +a[2] / 100;
33306        g = l <= 0.5 ? l * (s + 1) : l + s - l * s;
33307        r = l * 2 - g;
33308        a.length > 3 && (a[3] *= 1);
33309        a[0] = _hue(h + 1 / 3, r, g);
33310        a[1] = _hue(h, r, g);
33311        a[2] = _hue(h - 1 / 3, r, g);
33312      } else if (~v.indexOf("=")) {
33313        a = v.match(_numExp);
33314        forceAlpha && a.length < 4 && (a[3] = 1);
33315        return a;
33316      }
33317    } else {
33318      a = v.match(_strictNumExp) || _colorLookup.transparent;
33319    }
33320    a = a.map(Number);
33321  }
33322  if (toHSL && !wasHSL) {
33323    r = a[0] / _255;
33324    g = a[1] / _255;
33325    b = a[2] / _255;
33326    max = Math.max(r, g, b);
33327    min = Math.min(r, g, b);
33328    l = (max + min) / 2;
33329    if (max === min) {
33330      h = s = 0;
33331    } else {
33332      d = max - min;
33333      s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
33334      h = max === r ? (g - b) / d + (g < b ? 6 : 0) : max === g ? (b - r) / d + 2 : (r - g) / d + 4;
33335      h *= 60;
33336    }
33337    a[0] = ~~(h + 0.5);
33338    a[1] = ~~(s * 100 + 0.5);
33339    a[2] = ~~(l * 100 + 0.5);
33340  }
33341  forceAlpha && a.length < 4 && (a[3] = 1);
33342  return a;
33343};
33344var _colorOrderData = function _colorOrderData(v) {
33345  var values = [], c = [], i = -1;
33346  v.split(_colorExp).forEach(function(v) {
33347    var a = v.match(_numWithUnitExp) || [];
33348    values.push.apply(values, a);
33349    c.push(i += a.length + 1);
33350  });
33351  values.c = c;
33352  return values;
33353};
33354var _formatColors = function _formatColors(s, toHSL, orderMatchData) {
33355  var result = "", colors = (s + result).match(_colorExp), type = toHSL ? "hsla(" : "rgba(", i = 0, c, shell, d, l;
33356  if (!colors) {
33357    return s;
33358  }
33359  colors = colors.map(function(color) {
33360    return (color = splitColor(color, toHSL, 1)) && type + (toHSL ? color[0] + "," + color[1] + "%," + color[2] + "%," + color[3] : color.join(",")) + ")";
33361  });
33362  if (orderMatchData) {
33363    d = _colorOrderData(s);
33364    c = orderMatchData.c;
33365    if (c.join(result) !== d.c.join(result)) {
33366      shell = s.replace(_colorExp, "1").split(_numWithUnitExp);
33367      l = shell.length - 1;
33368      for (;i < l; i++) {
33369        result += shell[i] + (~c.indexOf(i) ? colors.shift() || type + "0,0,0,0)" : (d.length ? d : colors.length ? colors : orderMatchData).shift());
33370      }
33371    }
33372  }
33373  if (!shell) {
33374    shell = s.split(_colorExp);
33375    l = shell.length - 1;
33376    for (;i < l; i++) {
33377      result += shell[i] + colors[i];
33378    }
33379  }
33380  return result + shell[l];
33381};
33382var _colorExp = function() {
33383  var s = "(?:\\b(?:(?:rgb|rgba|hsl|hsla)\\(.+?\\))|\\B#(?:[0-9a-f]{3,4}){1,2}\\b", p;
33384  for (p in _colorLookup) {
33385    s += "|" + p + "\\b";
33386  }
33387  return new RegExp(s + ")", "gi");
33388}();
33389var _hslExp = /hsl[a]?\(/;
33390var _colorStringFilter = function _colorStringFilter(a) {
33391  var combined = a.join(" "), toHSL;
33392  _colorExp.lastIndex = 0;
33393  if (_colorExp.test(combined)) {
33394    toHSL = _hslExp.test(combined);
33395    a[1] = _formatColors(a[1], toHSL);
33396    a[0] = _formatColors(a[0], toHSL, _colorOrderData(a[1]));
33397    return true;
33398  }
33399};
33400var _tickerActive;
33401var _ticker = function() {
33402  var _getTime = Date.now, _lagThreshold = 500, _adjustedLag = 33, _startTime = _getTime(), _lastUpdate = _startTime, _gap = 1000 / 240, _nextTime = _gap, _listeners = [], _id, _req, _raf, _self, _delta, _i, _tick = function _tick(v) {
33403    var elapsed = _getTime() - _lastUpdate, manual = v === true, overlap, dispatch, time, frame;
33404    (elapsed > _lagThreshold || elapsed < 0) && (_startTime += elapsed - _adjustedLag);
33405    _lastUpdate += elapsed;
33406    time = _lastUpdate - _startTime;
33407    overlap = time - _nextTime;
33408    if (overlap > 0 || manual) {
33409      frame = ++_self.frame;
33410      _delta = time - _self.time * 1000;
33411      _self.time = time = time / 1000;
33412      _nextTime += overlap + (overlap >= _gap ? 4 : _gap - overlap);
33413      dispatch = 1;
33414    }
33415    manual || (_id = _req(_tick));
33416    if (dispatch) {
33417      for (_i = 0;_i < _listeners.length; _i++) {
33418        _listeners[_i](time, _delta, frame, v);
33419      }
33420    }
33421  };
33422  _self = {
33423    time: 0,
33424    frame: 0,
33425    tick: function tick() {
33426      _tick(true);
33427    },
33428    deltaRatio: function deltaRatio(fps) {
33429      return _delta / (1000 / (fps || 60));
33430    },
33431    wake: function wake() {
33432      if (_coreReady) {
33433        if (!_coreInitted && _windowExists()) {
33434          _win = _coreInitted = window;
33435          _doc = _win.document || {};
33436          _globals.gsap = gsap;
33437          (_win.gsapVersions || (_win.gsapVersions = [])).push(gsap.version);
33438          _install(_installScope || _win.GreenSockGlobals || !_win.gsap && _win || {});
33439          _registerPluginQueue.forEach(_createPlugin);
33440        }
33441        _raf = typeof requestAnimationFrame !== "undefined" && requestAnimationFrame;
33442        _id && _self.sleep();
33443        _req = _raf || function(f) {
33444          return setTimeout(f, _nextTime - _self.time * 1000 + 1 | 0);
33445        };
33446        _tickerActive = 1;
33447        _tick(2);
33448      }
33449    },
33450    sleep: function sleep() {
33451      (_raf ? cancelAnimationFrame : clearTimeout)(_id);
33452      _tickerActive = 0;
33453      _req = _emptyFunc;
33454    },
33455    lagSmoothing: function lagSmoothing(threshold, adjustedLag) {
33456      _lagThreshold = threshold || Infinity;
33457      _adjustedLag = Math.min(adjustedLag || 33, _lagThreshold);
33458    },
33459    fps: function fps(_fps) {
33460      _gap = 1000 / (_fps || 240);
33461      _nextTime = _self.time * 1000 + _gap;
33462    },
33463    add: function add(callback, once, prioritize) {
33464      var func = once ? function(t, d, f, v) {
33465        callback(t, d, f, v);
33466        _self.remove(func);
33467      } : callback;
33468      _self.remove(callback);
33469      _listeners[prioritize ? "unshift" : "push"](func);
33470      _wake();
33471      return func;
33472    },
33473    remove: function remove2(callback, i) {
33474      ~(i = _listeners.indexOf(callback)) && _listeners.splice(i, 1) && _i >= i && _i--;
33475    },
33476    _listeners
33477  };
33478  return _self;
33479}();
33480var _wake = function _wake() {
33481  return !_tickerActive && _ticker.wake();
33482};
33483var _easeMap = {};
33484var _customEaseExp = /^[\d.\-M][\d.\-,\s]/;
33485var _quotesExp = /["']/g;
33486var _parseObjectInString = function _parseObjectInString(value) {
33487  var obj2 = {}, split = value.substr(1, value.length - 3).split(":"), key = split[0], i = 1, l = split.length, index, val, parsedVal;
33488  for (;i < l; i++) {
33489    val = split[i];
33490    index = i !== l - 1 ? val.lastIndexOf(",") : val.length;
33491    parsedVal = val.substr(0, index);
33492    obj2[key] = isNaN(parsedVal) ? parsedVal.replace(_quotesExp, "").trim() : +parsedVal;
33493    key = val.substr(index + 1).trim();
33494  }
33495  return obj2;
33496};
33497var _valueInParentheses = function _valueInParentheses(value) {
33498  var open = value.indexOf("(") + 1, close = value.indexOf(")"), nested = value.indexOf("(", open);
33499  return value.substring(open, ~nested && nested < close ? value.indexOf(")", close + 1) : close);
33500};
33501var _configEaseFromString = function _configEaseFromString(name) {
33502  var split = (name + "").split("("), ease = _easeMap[split[0]];
33503  return ease && split.length > 1 && ease.config ? ease.config.apply(null, ~name.indexOf("{") ? [_parseObjectInString(split[1])] : _valueInParentheses(name).split(",").map(_numericIfPossible)) : _easeMap._CE && _customEaseExp.test(name) ? _easeMap._CE("", name) : ease;
33504};
33505var _invertEase = function _invertEase(ease) {
33506  return function(p) {
33507    return 1 - ease(1 - p);
33508  };
33509};
33510var _propagateYoyoEase = function _propagateYoyoEase(timeline, isYoyo) {
33511  var child = timeline._first, ease;
33512  while (child) {
33513    if (child instanceof Timeline) {
33514      _propagateYoyoEase(child, isYoyo);
33515    } else if (child.vars.yoyoEase && (!child._yoyo || !child._repeat) && child._yoyo !== isYoyo) {
33516      if (child.timeline) {
33517        _propagateYoyoEase(child.timeline, isYoyo);
33518      } else {
33519        ease = child._ease;
33520        child._ease = child._yEase;
33521        child._yEase = ease;
33522        child._yoyo = isYoyo;
33523      }
33524    }
33525    child = child._next;
33526  }
33527};
33528var _parseEase = function _parseEase(ease, defaultEase) {
33529  return !ease ? defaultEase : (_isFunction(ease) ? ease : _easeMap[ease] || _configEaseFromString(ease)) || defaultEase;
33530};
33531var _insertEase = function _insertEase(names, easeIn, easeOut, easeInOut) {
33532  if (easeOut === undefined) {
33533    easeOut = function easeOut(p) {
33534      return 1 - easeIn(1 - p);
33535    };
33536  }
33537  if (easeInOut === undefined) {
33538    easeInOut = function easeInOut(p) {
33539      return p < 0.5 ? easeIn(p * 2) / 2 : 1 - easeIn((1 - p) * 2) / 2;
33540    };
33541  }
33542  var ease = {
33543    easeIn,
33544    easeOut,
33545    easeInOut
33546  }, lowercaseName;
33547  _forEachName(names, function(name) {
33548    _easeMap[name] = _globals[name] = ease;
33549    _easeMap[lowercaseName = name.toLowerCase()] = easeOut;
33550    for (var p in ease) {
33551      _easeMap[lowercaseName + (p === "easeIn" ? ".in" : p === "easeOut" ? ".out" : ".inOut")] = _easeMap[name + "." + p] = ease[p];
33552    }
33553  });
33554  return ease;
33555};
33556var _easeInOutFromOut = function _easeInOutFromOut(easeOut) {
33557  return function(p) {
33558    return p < 0.5 ? (1 - easeOut(1 - p * 2)) / 2 : 0.5 + easeOut((p - 0.5) * 2) / 2;
33559  };
33560};
33561var _configElastic = function _configElastic(type, amplitude, period) {
33562  var p1 = amplitude >= 1 ? amplitude : 1, p2 = (period || (type ? 0.3 : 0.45)) / (amplitude < 1 ? amplitude : 1), p3 = p2 / _2PI * (Math.asin(1 / p1) || 0), easeOut = function easeOut(p) {
33563    return p === 1 ? 1 : p1 * Math.pow(2, -10 * p) * _sin((p - p3) * p2) + 1;
33564  }, ease = type === "out" ? easeOut : type === "in" ? function(p) {
33565    return 1 - easeOut(1 - p);
33566  } : _easeInOutFromOut(easeOut);
33567  p2 = _2PI / p2;
33568  ease.config = function(amplitude, period) {
33569    return _configElastic(type, amplitude, period);
33570  };
33571  return ease;
33572};
33573var _configBack = function _configBack(type, overshoot) {
33574  if (overshoot === undefined) {
33575    overshoot = 1.70158;
33576  }
33577  var easeOut = function easeOut(p) {
33578    return p ? --p * p * ((overshoot + 1) * p + overshoot) + 1 : 0;
33579  }, ease = type === "out" ? easeOut : type === "in" ? function(p) {
33580    return 1 - easeOut(1 - p);
33581  } : _easeInOutFromOut(easeOut);
33582  ease.config = function(overshoot) {
33583    return _configBack(type, overshoot);
33584  };
33585  return ease;
33586};
33587_forEachName("Linear,Quad,Cubic,Quart,Quint,Strong", function(name, i) {
33588  var power = i < 5 ? i + 1 : i;
33589  _insertEase(name + ",Power" + (power - 1), i ? function(p) {
33590    return Math.pow(p, power);
33591  } : function(p) {
33592    return p;
33593  }, function(p) {
33594    return 1 - Math.pow(1 - p, power);
33595  }, function(p) {
33596    return p < 0.5 ? Math.pow(p * 2, power) / 2 : 1 - Math.pow((1 - p) * 2, power) / 2;
33597  });
33598});
33599_easeMap.Linear.easeNone = _easeMap.none = _easeMap.Linear.easeIn;
33600_insertEase("Elastic", _configElastic("in"), _configElastic("out"), _configElastic());
33601(function(n, c) {
33602  var n1 = 1 / c, n2 = 2 * n1, n3 = 2.5 * n1, easeOut = function easeOut(p) {
33603    return p < n1 ? n * p * p : p < n2 ? n * Math.pow(p - 1.5 / c, 2) + 0.75 : p < n3 ? n * (p -= 2.25 / c) * p + 0.9375 : n * Math.pow(p - 2.625 / c, 2) + 0.984375;
33604  };
33605  _insertEase("Bounce", function(p) {
33606    return 1 - easeOut(1 - p);
33607  }, easeOut);
33608})(7.5625, 2.75);
33609_insertEase("Expo", function(p) {
33610  return Math.pow(2, 10 * (p - 1)) * p + p * p * p * p * p * p * (1 - p);
33611});
33612_insertEase("Circ", function(p) {
33613  return -(_sqrt(1 - p * p) - 1);
33614});
33615_insertEase("Sine", function(p) {
33616  return p === 1 ? 1 : -_cos(p * _HALF_PI) + 1;
33617});
33618_insertEase("Back", _configBack("in"), _configBack("out"), _configBack());
33619_easeMap.SteppedEase = _easeMap.steps = _globals.SteppedEase = {
33620  config: function config(steps, immediateStart) {
33621    if (steps === undefined) {
33622      steps = 1;
33623    }
33624    var p1 = 1 / steps, p2 = steps + (immediateStart ? 0 : 1), p3 = immediateStart ? 1 : 0, max = 1 - _tinyNum;
33625    return function(p) {
33626      return ((p2 * _clamp(0, max, p) | 0) + p3) * p1;
33627    };
33628  }
33629};
33630_defaults.ease = _easeMap["quad.out"];
33631_forEachName("onComplete,onUpdate,onStart,onRepeat,onReverseComplete,onInterrupt", function(name) {
33632  return _callbackNames += name + "," + name + "Params,";
33633});
33634var GSCache = function GSCache(target, harness) {
33635  this.id = _gsID++;
33636  target._gsap = this;
33637  this.target = target;
33638  this.harness = harness;
33639  this.get = harness ? harness.get : _getProperty;
33640  this.set = harness ? harness.getSetter : _getSetter;
33641};
33642var Animation = /* @__PURE__ */ function() {
33643  function Animation(vars) {
33644    this.vars = vars;
33645    this._delay = +vars.delay || 0;
33646    if (this._repeat = vars.repeat === Infinity ? -2 : vars.repeat || 0) {
33647      this._rDelay = vars.repeatDelay || 0;
33648      this._yoyo = !!vars.yoyo || !!vars.yoyoEase;
33649    }
33650    this._ts = 1;
33651    _setDuration(this, +vars.duration, 1, 1);
33652    this.data = vars.data;
33653    if (_context) {
33654      this._ctx = _context;
33655      _context.data.push(this);
33656    }
33657    _tickerActive || _ticker.wake();
33658  }
33659  var _proto = Animation.prototype;
33660  _proto.delay = function delay(value) {
33661    if (value || value === 0) {
33662      this.parent && this.parent.smoothChildTiming && this.startTime(this._start + value - this._delay);
33663      this._delay = value;
33664      return this;
33665    }
33666    return this._delay;
33667  };
33668  _proto.duration = function duration(value) {
33669    return arguments.length ? this.totalDuration(this._repeat > 0 ? value + (value + this._rDelay) * this._repeat : value) : this.totalDuration() && this._dur;
33670  };
33671  _proto.totalDuration = function totalDuration(value) {
33672    if (!arguments.length) {
33673      return this._tDur;
33674    }
33675    this._dirty = 0;
33676    return _setDuration(this, this._repeat < 0 ? value : (value - this._repeat * this._rDelay) / (this._repeat + 1));
33677  };
33678  _proto.totalTime = function totalTime(_totalTime, suppressEvents) {
33679    _wake();
33680    if (!arguments.length) {
33681      return this._tTime;
33682    }
33683    var parent = this._dp;
33684    if (parent && parent.smoothChildTiming && this._ts) {
33685      _alignPlayhead(this, _totalTime);
33686      !parent._dp || parent.parent || _postAddChecks(parent, this);
33687      while (parent && parent.parent) {
33688        if (parent.parent._time !== parent._start + (parent._ts >= 0 ? parent._tTime / parent._ts : (parent.totalDuration() - parent._tTime) / -parent._ts)) {
33689          parent.totalTime(parent._tTime, true);
33690        }
33691        parent = parent.parent;
33692      }
33693      if (!this.parent && this._dp.autoRemoveChildren && (this._ts > 0 && _totalTime < this._tDur || this._ts < 0 && _totalTime > 0 || !this._tDur && !_totalTime)) {
33694        _addToTimeline(this._dp, this, this._start - this._delay);
33695      }
33696    }
33697    if (this._tTime !== _totalTime || !this._dur && !suppressEvents || this._initted && Math.abs(this._zTime) === _tinyNum || !this._initted && this._dur && _totalTime || !_totalTime && !this._initted && (this.add || this._ptLookup)) {
33698      this._ts || (this._pTime = _totalTime);
33699      _lazySafeRender(this, _totalTime, suppressEvents);
33700    }
33701    return this;
33702  };
33703  _proto.time = function time(value, suppressEvents) {
33704    return arguments.length ? this.totalTime(Math.min(this.totalDuration(), value + _elapsedCycleDuration(this)) % (this._dur + this._rDelay) || (value ? this._dur : 0), suppressEvents) : this._time;
33705  };
33706  _proto.totalProgress = function totalProgress(value, suppressEvents) {
33707    return arguments.length ? this.totalTime(this.totalDuration() * value, suppressEvents) : this.totalDuration() ? Math.min(1, this._tTime / this._tDur) : this.rawTime() >= 0 && this._initted ? 1 : 0;
33708  };
33709  _proto.progress = function progress(value, suppressEvents) {
33710    return arguments.length ? this.totalTime(this.duration() * (this._yoyo && !(this.iteration() & 1) ? 1 - value : value) + _elapsedCycleDuration(this), suppressEvents) : this.duration() ? Math.min(1, this._time / this._dur) : this.rawTime() > 0 ? 1 : 0;
33711  };
33712  _proto.iteration = function iteration(value, suppressEvents) {
33713    var cycleDuration = this.duration() + this._rDelay;
33714    return arguments.length ? this.totalTime(this._time + (value - 1) * cycleDuration, suppressEvents) : this._repeat ? _animationCycle(this._tTime, cycleDuration) + 1 : 1;
33715  };
33716  _proto.timeScale = function timeScale(value, suppressEvents) {
33717    if (!arguments.length) {
33718      return this._rts === -_tinyNum ? 0 : this._rts;
33719    }
33720    if (this._rts === value) {
33721      return this;
33722    }
33723    var tTime = this.parent && this._ts ? _parentToChildTotalTime(this.parent._time, this) : this._tTime;
33724    this._rts = +value || 0;
33725    this._ts = this._ps || value === -_tinyNum ? 0 : this._rts;
33726    this.totalTime(_clamp(-Math.abs(this._delay), this.totalDuration(), tTime), suppressEvents !== false);
33727    _setEnd(this);
33728    return _recacheAncestors(this);
33729  };
33730  _proto.paused = function paused(value) {
33731    if (!arguments.length) {
33732      return this._ps;
33733    }
33734    if (this._ps !== value) {
33735      this._ps = value;
33736      if (value) {
33737        this._pTime = this._tTime || Math.max(-this._delay, this.rawTime());
33738        this._ts = this._act = 0;
33739      } else {
33740        _wake();
33741        this._ts = this._rts;
33742        this.totalTime(this.parent && !this.parent.smoothChildTiming ? this.rawTime() : this._tTime || this._pTime, this.progress() === 1 && Math.abs(this._zTime) !== _tinyNum && (this._tTime -= _tinyNum));
33743      }
33744    }
33745    return this;
33746  };
33747  _proto.startTime = function startTime(value) {
33748    if (arguments.length) {
33749      this._start = _roundPrecise(value);
33750      var parent = this.parent || this._dp;
33751      parent && (parent._sort || !this.parent) && _addToTimeline(parent, this, this._start - this._delay);
33752      return this;
33753    }
33754    return this._start;
33755  };
33756  _proto.endTime = function endTime(includeRepeats) {
33757    return this._start + (_isNotFalse(includeRepeats) ? this.totalDuration() : this.duration()) / Math.abs(this._ts || 1);
33758  };
33759  _proto.rawTime = function rawTime(wrapRepeats) {
33760    var parent = this.parent || this._dp;
33761    return !parent ? this._tTime : wrapRepeats && (!this._ts || this._repeat && this._time && this.totalProgress() < 1) ? this._tTime % (this._dur + this._rDelay) : !this._ts ? this._tTime : _parentToChildTotalTime(parent.rawTime(wrapRepeats), this);
33762  };
33763  _proto.revert = function revert(config) {
33764    if (config === undefined) {
33765      config = _revertConfig;
33766    }
33767    var prevIsReverting = _reverting;
33768    _reverting = config;
33769    if (_isRevertWorthy(this)) {
33770      this.timeline && this.timeline.revert(config);
33771      this.totalTime(-0.01, config.suppressEvents);
33772    }
33773    this.data !== "nested" && config.kill !== false && this.kill();
33774    _reverting = prevIsReverting;
33775    return this;
33776  };
33777  _proto.globalTime = function globalTime(rawTime) {
33778    var animation = this, time = arguments.length ? rawTime : animation.rawTime();
33779    while (animation) {
33780      time = animation._start + time / (Math.abs(animation._ts) || 1);
33781      animation = animation._dp;
33782    }
33783    return !this.parent && this._sat ? this._sat.globalTime(rawTime) : time;
33784  };
33785  _proto.repeat = function repeat(value) {
33786    if (arguments.length) {
33787      this._repeat = value === Infinity ? -2 : value;
33788      return _onUpdateTotalDuration(this);
33789    }
33790    return this._repeat === -2 ? Infinity : this._repeat;
33791  };
33792  _proto.repeatDelay = function repeatDelay(value) {
33793    if (arguments.length) {
33794      var time = this._time;
33795      this._rDelay = value;
33796      _onUpdateTotalDuration(this);
33797      return time ? this.time(time) : this;
33798    }
33799    return this._rDelay;
33800  };
33801  _proto.yoyo = function yoyo(value) {
33802    if (arguments.length) {
33803      this._yoyo = value;
33804      return this;
33805    }
33806    return this._yoyo;
33807  };
33808  _proto.seek = function seek(position, suppressEvents) {
33809    return this.totalTime(_parsePosition(this, position), _isNotFalse(suppressEvents));
33810  };
33811  _proto.restart = function restart(includeDelay, suppressEvents) {
33812    this.play().totalTime(includeDelay ? -this._delay : 0, _isNotFalse(suppressEvents));
33813    this._dur || (this._zTime = -_tinyNum);
33814    return this;
33815  };
33816  _proto.play = function play(from, suppressEvents) {
33817    from != null && this.seek(from, suppressEvents);
33818    return this.reversed(false).paused(false);
33819  };
33820  _proto.reverse = function reverse(from, suppressEvents) {
33821    from != null && this.seek(from || this.totalDuration(), suppressEvents);
33822    return this.reversed(true).paused(false);
33823  };
33824  _proto.pause = function pause(atTime, suppressEvents) {
33825    atTime != null && this.seek(atTime, suppressEvents);
33826    return this.paused(true);
33827  };
33828  _proto.resume = function resume() {
33829    return this.paused(false);
33830  };
33831  _proto.reversed = function reversed(value) {
33832    if (arguments.length) {
33833      !!value !== this.reversed() && this.timeScale(-this._rts || (value ? -_tinyNum : 0));
33834      return this;
33835    }
33836    return this._rts < 0;
33837  };
33838  _proto.invalidate = function invalidate() {
33839    this._initted = this._act = 0;
33840    this._zTime = -_tinyNum;
33841    return this;
33842  };
33843  _proto.isActive = function isActive() {
33844    var parent = this.parent || this._dp, start = this._start, rawTime;
33845    return !!(!parent || this._ts && this._initted && parent.isActive() && (rawTime = parent.rawTime(true)) >= start && rawTime < this.endTime(true) - _tinyNum);
33846  };
33847  _proto.eventCallback = function eventCallback(type, callback, params) {
33848    var vars = this.vars;
33849    if (arguments.length > 1) {
33850      if (!callback) {
33851        delete vars[type];
33852      } else {
33853        vars[type] = callback;
33854        params && (vars[type + "Params"] = params);
33855        type === "onUpdate" && (this._onUpdate = callback);
33856      }
33857      return this;
33858    }
33859    return vars[type];
33860  };
33861  _proto.then = function then(onFulfilled) {
33862    var self2 = this, prevProm = self2._prom;
33863    return new Promise(function(resolve) {
33864      var f = _isFunction(onFulfilled) ? onFulfilled : _passThrough, _resolve = function _resolve() {
33865        var _then = self2.then;
33866        self2.then = null;
33867        prevProm && prevProm();
33868        _isFunction(f) && (f = f(self2)) && (f.then || f === self2) && (self2.then = _then);
33869        resolve(f);
33870        self2.then = _then;
33871      };
33872      if (self2._initted && self2.totalProgress() === 1 && self2._ts >= 0 || !self2._tTime && self2._ts < 0) {
33873        _resolve();
33874      } else {
33875        self2._prom = _resolve;
33876      }
33877    });
33878  };
33879  _proto.kill = function kill() {
33880    _interrupt(this);
33881  };
33882  return Animation;
33883}();
33884_setDefaults(Animation.prototype, {
33885  _time: 0,
33886  _start: 0,
33887  _end: 0,
33888  _tTime: 0,
33889  _tDur: 0,
33890  _dirty: 0,
33891  _repeat: 0,
33892  _yoyo: false,
33893  parent: null,
33894  _initted: false,
33895  _rDelay: 0,
33896  _ts: 1,
33897  _dp: 0,
33898  ratio: 0,
33899  _zTime: -_tinyNum,
33900  _prom: 0,
33901  _ps: false,
33902  _rts: 1
33903});
33904var Timeline = /* @__PURE__ */ function(_Animation) {
33905  _inheritsLoose(Timeline, _Animation);
33906  function Timeline(vars, position) {
33907    var _this;
33908    if (vars === undefined) {
33909      vars = {};
33910    }
33911    _this = _Animation.call(this, vars) || this;
33912    _this.labels = {};
33913    _this.smoothChildTiming = !!vars.smoothChildTiming;
33914    _this.autoRemoveChildren = !!vars.autoRemoveChildren;
33915    _this._sort = _isNotFalse(vars.sortChildren);
33916    _globalTimeline && _addToTimeline(vars.parent || _globalTimeline, _assertThisInitialized(_this), position);
33917    vars.reversed && _this.reverse();
33918    vars.paused && _this.paused(true);
33919    vars.scrollTrigger && _scrollTrigger(_assertThisInitialized(_this), vars.scrollTrigger);
33920    return _this;
33921  }
33922  var _proto2 = Timeline.prototype;
33923  _proto2.to = function to(targets, vars, position) {
33924    _createTweenType(0, arguments, this);
33925    return this;
33926  };
33927  _proto2.from = function from(targets, vars, position) {
33928    _createTweenType(1, arguments, this);
33929    return this;
33930  };
33931  _proto2.fromTo = function fromTo(targets, fromVars, toVars, position) {
33932    _createTweenType(2, arguments, this);
33933    return this;
33934  };
33935  _proto2.set = function set(targets, vars, position) {
33936    vars.duration = 0;
33937    vars.parent = this;
33938    _inheritDefaults(vars).repeatDelay || (vars.repeat = 0);
33939    vars.immediateRender = !!vars.immediateRender;
33940    new Tween(targets, vars, _parsePosition(this, position), 1);
33941    return this;
33942  };
33943  _proto2.call = function call(callback, params, position) {
33944    return _addToTimeline(this, Tween.delayedCall(0, callback, params), position);
33945  };
33946  _proto2.staggerTo = function staggerTo(targets, duration, vars, stagger, position, onCompleteAll, onCompleteAllParams) {
33947    vars.duration = duration;
33948    vars.stagger = vars.stagger || stagger;
33949    vars.onComplete = onCompleteAll;
33950    vars.onCompleteParams = onCompleteAllParams;
33951    vars.parent = this;
33952    new Tween(targets, vars, _parsePosition(this, position));
33953    return this;
33954  };
33955  _proto2.staggerFrom = function staggerFrom(targets, duration, vars, stagger, position, onCompleteAll, onCompleteAllParams) {
33956    vars.runBackwards = 1;
33957    _inheritDefaults(vars).immediateRender = _isNotFalse(vars.immediateRender);
33958    return this.staggerTo(targets, duration, vars, stagger, position, onCompleteAll, onCompleteAllParams);
33959  };
33960  _proto2.staggerFromTo = function staggerFromTo(targets, duration, fromVars, toVars, stagger, position, onCompleteAll, onCompleteAllParams) {
33961    toVars.startAt = fromVars;
33962    _inheritDefaults(toVars).immediateRender = _isNotFalse(toVars.immediateRender);
33963    return this.staggerTo(targets, duration, toVars, stagger, position, onCompleteAll, onCompleteAllParams);
33964  };
33965  _proto2.render = function render(totalTime, suppressEvents, force) {
33966    var prevTime = this._time, tDur = this._dirty ? this.totalDuration() : this._tDur, dur = this._dur, tTime = totalTime <= 0 ? 0 : _roundPrecise(totalTime), crossingStart = this._zTime < 0 !== totalTime < 0 && (this._initted || !dur), time, child, next, iteration, cycleDuration, prevPaused, pauseTween, timeScale, prevStart, prevIteration, yoyo, isYoyo;
33967    this !== _globalTimeline && tTime > tDur && totalTime >= 0 && (tTime = tDur);
33968    if (tTime !== this._tTime || force || crossingStart) {
33969      if (prevTime !== this._time && dur) {
33970        tTime += this._time - prevTime;
33971        totalTime += this._time - prevTime;
33972      }
33973      time = tTime;
33974      prevStart = this._start;
33975      timeScale = this._ts;
33976      prevPaused = !timeScale;
33977      if (crossingStart) {
33978        dur || (prevTime = this._zTime);
33979        (totalTime || !suppressEvents) && (this._zTime = totalTime);
33980      }
33981      if (this._repeat) {
33982        yoyo = this._yoyo;
33983        cycleDuration = dur + this._rDelay;
33984        if (this._repeat < -1 && totalTime < 0) {
33985          return this.totalTime(cycleDuration * 100 + totalTime, suppressEvents, force);
33986        }
33987        time = _roundPrecise(tTime % cycleDuration);
33988        if (tTime === tDur) {
33989          iteration = this._repeat;
33990          time = dur;
33991        } else {
33992          prevIteration = _roundPrecise(tTime / cycleDuration);
33993          iteration = ~~prevIteration;
33994          if (iteration && iteration === prevIteration) {
33995            time = dur;
33996            iteration--;
33997          }
33998          time > dur && (time = dur);
33999        }
34000        prevIteration = _animationCycle(this._tTime, cycleDuration);
34001        !prevTime && this._tTime && prevIteration !== iteration && this._tTime - prevIteration * cycleDuration - this._dur <= 0 && (prevIteration = iteration);
34002        if (yoyo && iteration & 1) {
34003          time = dur - time;
34004          isYoyo = 1;
34005        }
34006        if (iteration !== prevIteration && !this._lock) {
34007          var rewinding = yoyo && prevIteration & 1, doesWrap = rewinding === (yoyo && iteration & 1);
34008          iteration < prevIteration && (rewinding = !rewinding);
34009          prevTime = rewinding ? 0 : tTime % dur ? dur : tTime;
34010          this._lock = 1;
34011          this.render(prevTime || (isYoyo ? 0 : _roundPrecise(iteration * cycleDuration)), suppressEvents, !dur)._lock = 0;
34012          this._tTime = tTime;
34013          !suppressEvents && this.parent && _callback(this, "onRepeat");
34014          if (this.vars.repeatRefresh && !isYoyo) {
34015            this.invalidate()._lock = 1;
34016            prevIteration = iteration;
34017          }
34018          if (prevTime && prevTime !== this._time || prevPaused !== !this._ts || this.vars.onRepeat && !this.parent && !this._act) {
34019            return this;
34020          }
34021          dur = this._dur;
34022          tDur = this._tDur;
34023          if (doesWrap) {
34024            this._lock = 2;
34025            prevTime = rewinding ? dur : -0.0001;
34026            this.render(prevTime, true);
34027            this.vars.repeatRefresh && !isYoyo && this.invalidate();
34028          }
34029          this._lock = 0;
34030          if (!this._ts && !prevPaused) {
34031            return this;
34032          }
34033          _propagateYoyoEase(this, isYoyo);
34034        }
34035      }
34036      if (this._hasPause && !this._forcing && this._lock < 2) {
34037        pauseTween = _findNextPauseTween(this, _roundPrecise(prevTime), _roundPrecise(time));
34038        if (pauseTween) {
34039          tTime -= time - (time = pauseTween._start);
34040        }
34041      }
34042      this._tTime = tTime;
34043      this._time = time;
34044      this._act = !timeScale;
34045      if (!this._initted) {
34046        this._onUpdate = this.vars.onUpdate;
34047        this._initted = 1;
34048        this._zTime = totalTime;
34049        prevTime = 0;
34050      }
34051      if (!prevTime && tTime && dur && !suppressEvents && !prevIteration) {
34052        _callback(this, "onStart");
34053        if (this._tTime !== tTime) {
34054          return this;
34055        }
34056      }
34057      if (time >= prevTime && totalTime >= 0) {
34058        child = this._first;
34059        while (child) {
34060          next = child._next;
34061          if ((child._act || time >= child._start) && child._ts && pauseTween !== child) {
34062            if (child.parent !== this) {
34063              return this.render(totalTime, suppressEvents, force);
34064            }
34065            child.render(child._ts > 0 ? (time - child._start) * child._ts : (child._dirty ? child.totalDuration() : child._tDur) + (time - child._start) * child._ts, suppressEvents, force);
34066            if (time !== this._time || !this._ts && !prevPaused) {
34067              pauseTween = 0;
34068              next && (tTime += this._zTime = -_tinyNum);
34069              break;
34070            }
34071          }
34072          child = next;
34073        }
34074      } else {
34075        child = this._last;
34076        var adjustedTime = totalTime < 0 ? totalTime : time;
34077        while (child) {
34078          next = child._prev;
34079          if ((child._act || adjustedTime <= child._end) && child._ts && pauseTween !== child) {
34080            if (child.parent !== this) {
34081              return this.render(totalTime, suppressEvents, force);
34082            }
34083            child.render(child._ts > 0 ? (adjustedTime - child._start) * child._ts : (child._dirty ? child.totalDuration() : child._tDur) + (adjustedTime - child._start) * child._ts, suppressEvents, force || _reverting && _isRevertWorthy(child));
34084            if (time !== this._time || !this._ts && !prevPaused) {
34085              pauseTween = 0;
34086              next && (tTime += this._zTime = adjustedTime ? -_tinyNum : _tinyNum);
34087              break;
34088            }
34089          }
34090          child = next;
34091        }
34092      }
34093      if (pauseTween && !suppressEvents) {
34094        this.pause();
34095        pauseTween.render(time >= prevTime ? 0 : -_tinyNum)._zTime = time >= prevTime ? 1 : -1;
34096        if (this._ts) {
34097          this._start = prevStart;
34098          _setEnd(this);
34099          return this.render(totalTime, suppressEvents, force);
34100        }
34101      }
34102      this._onUpdate && !suppressEvents && _callback(this, "onUpdate", true);
34103      if (tTime === tDur && this._tTime >= this.totalDuration() || !tTime && prevTime) {
34104        if (prevStart === this._start || Math.abs(timeScale) !== Math.abs(this._ts)) {
34105          if (!this._lock) {
34106            (totalTime || !dur) && (tTime === tDur && this._ts > 0 || !tTime && this._ts < 0) && _removeFromParent(this, 1);
34107            if (!suppressEvents && !(totalTime < 0 && !prevTime) && (tTime || prevTime || !tDur)) {
34108              _callback(this, tTime === tDur && totalTime >= 0 ? "onComplete" : "onReverseComplete", true);
34109              this._prom && !(tTime < tDur && this.timeScale() > 0) && this._prom();
34110            }
34111          }
34112        }
34113      }
34114    }
34115    return this;
34116  };
34117  _proto2.add = function add(child, position) {
34118    var _this2 = this;
34119    _isNumber(position) || (position = _parsePosition(this, position, child));
34120    if (!(child instanceof Animation)) {
34121      if (_isArray(child)) {
34122        child.forEach(function(obj2) {
34123          return _this2.add(obj2, position);
34124        });
34125        return this;
34126      }
34127      if (_isString(child)) {
34128        return this.addLabel(child, position);
34129      }
34130      if (_isFunction(child)) {
34131        child = Tween.delayedCall(0, child);
34132      } else {
34133        return this;
34134      }
34135    }
34136    return this !== child ? _addToTimeline(this, child, position) : this;
34137  };
34138  _proto2.getChildren = function getChildren(nested, tweens, timelines, ignoreBeforeTime) {
34139    if (nested === undefined) {
34140      nested = true;
34141    }
34142    if (tweens === undefined) {
34143      tweens = true;
34144    }
34145    if (timelines === undefined) {
34146      timelines = true;
34147    }
34148    if (ignoreBeforeTime === undefined) {
34149      ignoreBeforeTime = -_bigNum;
34150    }
34151    var a = [], child = this._first;
34152    while (child) {
34153      if (child._start >= ignoreBeforeTime) {
34154        if (child instanceof Tween) {
34155          tweens && a.push(child);
34156        } else {
34157          timelines && a.push(child);
34158          nested && a.push.apply(a, child.getChildren(true, tweens, timelines));
34159        }
34160      }
34161      child = child._next;
34162    }
34163    return a;
34164  };
34165  _proto2.getById = function getById(id) {
34166    var animations = this.getChildren(1, 1, 1), i = animations.length;
34167    while (i--) {
34168      if (animations[i].vars.id === id) {
34169        return animations[i];
34170      }
34171    }
34172  };
34173  _proto2.remove = function remove2(child) {
34174    if (_isString(child)) {
34175      return this.removeLabel(child);
34176    }
34177    if (_isFunction(child)) {
34178      return this.killTweensOf(child);
34179    }
34180    child.parent === this && _removeLinkedListItem(this, child);
34181    if (child === this._recent) {
34182      this._recent = this._last;
34183    }
34184    return _uncache(this);
34185  };
34186  _proto2.totalTime = function totalTime(_totalTime2, suppressEvents) {
34187    if (!arguments.length) {
34188      return this._tTime;
34189    }
34190    this._forcing = 1;
34191    if (!this._dp && this._ts) {
34192      this._start = _roundPrecise(_ticker.time - (this._ts > 0 ? _totalTime2 / this._ts : (this.totalDuration() - _totalTime2) / -this._ts));
34193    }
34194    _Animation.prototype.totalTime.call(this, _totalTime2, suppressEvents);
34195    this._forcing = 0;
34196    return this;
34197  };
34198  _proto2.addLabel = function addLabel(label, position) {
34199    this.labels[label] = _parsePosition(this, position);
34200    return this;
34201  };
34202  _proto2.removeLabel = function removeLabel(label) {
34203    delete this.labels[label];
34204    return this;
34205  };
34206  _proto2.addPause = function addPause(position, callback, params) {
34207    var t = Tween.delayedCall(0, callback || _emptyFunc, params);
34208    t.data = "isPause";
34209    this._hasPause = 1;
34210    return _addToTimeline(this, t, _parsePosition(this, position));
34211  };
34212  _proto2.removePause = function removePause(position) {
34213    var child = this._first;
34214    position = _parsePosition(this, position);
34215    while (child) {
34216      if (child._start === position && child.data === "isPause") {
34217        _removeFromParent(child);
34218      }
34219      child = child._next;
34220    }
34221  };
34222  _proto2.killTweensOf = function killTweensOf(targets, props, onlyActive) {
34223    var tweens = this.getTweensOf(targets, onlyActive), i = tweens.length;
34224    while (i--) {
34225      _overwritingTween !== tweens[i] && tweens[i].kill(targets, props);
34226    }
34227    return this;
34228  };
34229  _proto2.getTweensOf = function getTweensOf(targets, onlyActive) {
34230    var a = [], parsedTargets = toArray(targets), child = this._first, isGlobalTime = _isNumber(onlyActive), children;
34231    while (child) {
34232      if (child instanceof Tween) {
34233        if (_arrayContainsAny(child._targets, parsedTargets) && (isGlobalTime ? (!_overwritingTween || child._initted && child._ts) && child.globalTime(0) <= onlyActive && child.globalTime(child.totalDuration()) > onlyActive : !onlyActive || child.isActive())) {
34234          a.push(child);
34235        }
34236      } else if ((children = child.getTweensOf(parsedTargets, onlyActive)).length) {
34237        a.push.apply(a, children);
34238      }
34239      child = child._next;
34240    }
34241    return a;
34242  };
34243  _proto2.tweenTo = function tweenTo(position, vars) {
34244    vars = vars || {};
34245    var tl = this, endTime = _parsePosition(tl, position), _vars = vars, { startAt, onStart: _onStart, onStartParams, immediateRender } = _vars, initted, tween = Tween.to(tl, _setDefaults({
34246      ease: vars.ease || "none",
34247      lazy: false,
34248      immediateRender: false,
34249      time: endTime,
34250      overwrite: "auto",
34251      duration: vars.duration || Math.abs((endTime - (startAt && "time" in startAt ? startAt.time : tl._time)) / tl.timeScale()) || _tinyNum,
34252      onStart: function onStart() {
34253        tl.pause();
34254        if (!initted) {
34255          var duration = vars.duration || Math.abs((endTime - (startAt && "time" in startAt ? startAt.time : tl._time)) / tl.timeScale());
34256          tween._dur !== duration && _setDuration(tween, duration, 0, 1).render(tween._time, true, true);
34257          initted = 1;
34258        }
34259        _onStart && _onStart.apply(tween, onStartParams || []);
34260      }
34261    }, vars));
34262    return immediateRender ? tween.render(0) : tween;
34263  };
34264  _proto2.tweenFromTo = function tweenFromTo(fromPosition, toPosition, vars) {
34265    return this.tweenTo(toPosition, _setDefaults({
34266      startAt: {
34267        time: _parsePosition(this, fromPosition)
34268      }
34269    }, vars));
34270  };
34271  _proto2.recent = function recent() {
34272    return this._recent;
34273  };
34274  _proto2.nextLabel = function nextLabel(afterTime) {
34275    if (afterTime === undefined) {
34276      afterTime = this._time;
34277    }
34278    return _getLabelInDirection(this, _parsePosition(this, afterTime));
34279  };
34280  _proto2.previousLabel = function previousLabel(beforeTime) {
34281    if (beforeTime === undefined) {
34282      beforeTime = this._time;
34283    }
34284    return _getLabelInDirection(this, _parsePosition(this, beforeTime), 1);
34285  };
34286  _proto2.currentLabel = function currentLabel(value) {
34287    return arguments.length ? this.seek(value, true) : this.previousLabel(this._time + _tinyNum);
34288  };
34289  _proto2.shiftChildren = function shiftChildren(amount, adjustLabels, ignoreBeforeTime) {
34290    if (ignoreBeforeTime === undefined) {
34291      ignoreBeforeTime = 0;
34292    }
34293    var child = this._first, labels = this.labels, p;
34294    amount = _roundPrecise(amount);
34295    while (child) {
34296      if (child._start >= ignoreBeforeTime) {
34297        child._start += amount;
34298        child._end += amount;
34299      }
34300      child = child._next;
34301    }
34302    if (adjustLabels) {
34303      for (p in labels) {
34304        if (labels[p] >= ignoreBeforeTime) {
34305          labels[p] += amount;
34306        }
34307      }
34308    }
34309    return _uncache(this);
34310  };
34311  _proto2.invalidate = function invalidate(soft) {
34312    var child = this._first;
34313    this._lock = 0;
34314    while (child) {
34315      child.invalidate(soft);
34316      child = child._next;
34317    }
34318    return _Animation.prototype.invalidate.call(this, soft);
34319  };
34320  _proto2.clear = function clear(includeLabels) {
34321    if (includeLabels === undefined) {
34322      includeLabels = true;
34323    }
34324    var child = this._first, next;
34325    while (child) {
34326      next = child._next;
34327      this.remove(child);
34328      child = next;
34329    }
34330    this._dp && (this._time = this._tTime = this._pTime = 0);
34331    includeLabels && (this.labels = {});
34332    return _uncache(this);
34333  };
34334  _proto2.totalDuration = function totalDuration(value) {
34335    var max = 0, self2 = this, child = self2._last, prevStart = _bigNum, prev, start, parent;
34336    if (arguments.length) {
34337      return self2.timeScale((self2._repeat < 0 ? self2.duration() : self2.totalDuration()) / (self2.reversed() ? -value : value));
34338    }
34339    if (self2._dirty) {
34340      parent = self2.parent;
34341      while (child) {
34342        prev = child._prev;
34343        child._dirty && child.totalDuration();
34344        start = child._start;
34345        if (start > prevStart && self2._sort && child._ts && !self2._lock) {
34346          self2._lock = 1;
34347          _addToTimeline(self2, child, start - child._delay, 1)._lock = 0;
34348        } else {
34349          prevStart = start;
34350        }
34351        if (start < 0 && child._ts) {
34352          max -= start;
34353          if (!parent && !self2._dp || parent && parent.smoothChildTiming) {
34354            self2._start += _roundPrecise(start / self2._ts);
34355            self2._time -= start;
34356            self2._tTime -= start;
34357          }
34358          self2.shiftChildren(-start, false, -Infinity);
34359          prevStart = 0;
34360        }
34361        child._end > max && child._ts && (max = child._end);
34362        child = prev;
34363      }
34364      _setDuration(self2, self2 === _globalTimeline && self2._time > max ? self2._time : max, 1, 1);
34365      self2._dirty = 0;
34366    }
34367    return self2._tDur;
34368  };
34369  Timeline.updateRoot = function updateRoot(time) {
34370    if (_globalTimeline._ts) {
34371      _lazySafeRender(_globalTimeline, _parentToChildTotalTime(time, _globalTimeline));
34372      _lastRenderedFrame = _ticker.frame;
34373    }
34374    if (_ticker.frame >= _nextGCFrame) {
34375      _nextGCFrame += _config.autoSleep || 120;
34376      var child = _globalTimeline._first;
34377      if (!child || !child._ts) {
34378        if (_config.autoSleep && _ticker._listeners.length < 2) {
34379          while (child && !child._ts) {
34380            child = child._next;
34381          }
34382          child || _ticker.sleep();
34383        }
34384      }
34385    }
34386  };
34387  return Timeline;
34388}(Animation);
34389_setDefaults(Timeline.prototype, {
34390  _lock: 0,
34391  _hasPause: 0,
34392  _forcing: 0
34393});
34394var _addComplexStringPropTween = function _addComplexStringPropTween(target, prop, start, end, setter, stringFilter, funcParam) {
34395  var pt = new PropTween(this._pt, target, prop, 0, 1, _renderComplexString, null, setter), index = 0, matchIndex = 0, result, startNums, color, endNum, chunk, startNum, hasRandom, a;
34396  pt.b = start;
34397  pt.e = end;
34398  start += "";
34399  end += "";
34400  if (hasRandom = ~end.indexOf("random(")) {
34401    end = _replaceRandom(end);
34402  }
34403  if (stringFilter) {
34404    a = [start, end];
34405    stringFilter(a, target, prop);
34406    start = a[0];
34407    end = a[1];
34408  }
34409  startNums = start.match(_complexStringNumExp) || [];
34410  while (result = _complexStringNumExp.exec(end)) {
34411    endNum = result[0];
34412    chunk = end.substring(index, result.index);
34413    if (color) {
34414      color = (color + 1) % 5;
34415    } else if (chunk.substr(-5) === "rgba(") {
34416      color = 1;
34417    }
34418    if (endNum !== startNums[matchIndex++]) {
34419      startNum = parseFloat(startNums[matchIndex - 1]) || 0;
34420      pt._pt = {
34421        _next: pt._pt,
34422        p: chunk || matchIndex === 1 ? chunk : ",",
34423        s: startNum,
34424        c: endNum.charAt(1) === "=" ? _parseRelative(startNum, endNum) - startNum : parseFloat(endNum) - startNum,
34425        m: color && color < 4 ? Math.round : 0
34426      };
34427      index = _complexStringNumExp.lastIndex;
34428    }
34429  }
34430  pt.c = index < end.length ? end.substring(index, end.length) : "";
34431  pt.fp = funcParam;
34432  if (_relExp.test(end) || hasRandom) {
34433    pt.e = 0;
34434  }
34435  this._pt = pt;
34436  return pt;
34437};
34438var _addPropTween = function _addPropTween(target, prop, start, end, index, targets, modifier, stringFilter, funcParam, optional) {
34439  _isFunction(end) && (end = end(index || 0, target, targets));
34440  var currentValue = target[prop], parsedStart = start !== "get" ? start : !_isFunction(currentValue) ? currentValue : funcParam ? target[prop.indexOf("set") || !_isFunction(target["get" + prop.substr(3)]) ? prop : "get" + prop.substr(3)](funcParam) : target[prop](), setter = !_isFunction(currentValue) ? _setterPlain : funcParam ? _setterFuncWithParam : _setterFunc, pt;
34441  if (_isString(end)) {
34442    if (~end.indexOf("random(")) {
34443      end = _replaceRandom(end);
34444    }
34445    if (end.charAt(1) === "=") {
34446      pt = _parseRelative(parsedStart, end) + (getUnit(parsedStart) || 0);
34447      if (pt || pt === 0) {
34448        end = pt;
34449      }
34450    }
34451  }
34452  if (!optional || parsedStart !== end || _forceAllPropTweens) {
34453    if (!isNaN(parsedStart * end) && end !== "") {
34454      pt = new PropTween(this._pt, target, prop, +parsedStart || 0, end - (parsedStart || 0), typeof currentValue === "boolean" ? _renderBoolean : _renderPlain, 0, setter);
34455      funcParam && (pt.fp = funcParam);
34456      modifier && pt.modifier(modifier, this, target);
34457      return this._pt = pt;
34458    }
34459    !currentValue && !(prop in target) && _missingPlugin(prop, end);
34460    return _addComplexStringPropTween.call(this, target, prop, parsedStart, end, setter, stringFilter || _config.stringFilter, funcParam);
34461  }
34462};
34463var _processVars = function _processVars(vars, index, target, targets, tween) {
34464  _isFunction(vars) && (vars = _parseFuncOrString(vars, tween, index, target, targets));
34465  if (!_isObject(vars) || vars.style && vars.nodeType || _isArray(vars) || _isTypedArray(vars)) {
34466    return _isString(vars) ? _parseFuncOrString(vars, tween, index, target, targets) : vars;
34467  }
34468  var copy = {}, p;
34469  for (p in vars) {
34470    copy[p] = _parseFuncOrString(vars[p], tween, index, target, targets);
34471  }
34472  return copy;
34473};
34474var _checkPlugin = function _checkPlugin(property, vars, tween, index, target, targets) {
34475  var plugin, pt, ptLookup, i;
34476  if (_plugins[property] && (plugin = new _plugins[property]).init(target, plugin.rawVars ? vars[property] : _processVars(vars[property], index, target, targets, tween), tween, index, targets) !== false) {
34477    tween._pt = pt = new PropTween(tween._pt, target, property, 0, 1, plugin.render, plugin, 0, plugin.priority);
34478    if (tween !== _quickTween) {
34479      ptLookup = tween._ptLookup[tween._targets.indexOf(target)];
34480      i = plugin._props.length;
34481      while (i--) {
34482        ptLookup[plugin._props[i]] = pt;
34483      }
34484    }
34485  }
34486  return plugin;
34487};
34488var _overwritingTween;
34489var _forceAllPropTweens;
34490var _initTween = function _initTween(tween, time, tTime) {
34491  var vars = tween.vars, { ease, startAt, immediateRender, lazy, onUpdate, runBackwards, yoyoEase, keyframes, autoRevert } = vars, { _dur: dur, _startAt: prevStartAt, _targets: targets, parent } = tween, fullTargets = parent && parent.data === "nested" ? parent.vars.targets : targets, autoOverwrite = tween._overwrite === "auto" && !_suppressOverwrites, tl = tween.timeline, cleanVars, i, p, pt, target, hasPriority, gsData, harness, plugin, ptLookup, index, harnessVars, overwritten;
34492  tl && (!keyframes || !ease) && (ease = "none");
34493  tween._ease = _parseEase(ease, _defaults.ease);
34494  tween._yEase = yoyoEase ? _invertEase(_parseEase(yoyoEase === true ? ease : yoyoEase, _defaults.ease)) : 0;
34495  if (yoyoEase && tween._yoyo && !tween._repeat) {
34496    yoyoEase = tween._yEase;
34497    tween._yEase = tween._ease;
34498    tween._ease = yoyoEase;
34499  }
34500  tween._from = !tl && !!vars.runBackwards;
34501  if (!tl || keyframes && !vars.stagger) {
34502    harness = targets[0] ? _getCache(targets[0]).harness : 0;
34503    harnessVars = harness && vars[harness.prop];
34504    cleanVars = _copyExcluding(vars, _reservedProps);
34505    if (prevStartAt) {
34506      prevStartAt._zTime < 0 && prevStartAt.progress(1);
34507      time < 0 && runBackwards && immediateRender && !autoRevert ? prevStartAt.render(-1, true) : prevStartAt.revert(runBackwards && dur ? _revertConfigNoKill : _startAtRevertConfig);
34508      prevStartAt._lazy = 0;
34509    }
34510    if (startAt) {
34511      _removeFromParent(tween._startAt = Tween.set(targets, _setDefaults({
34512        data: "isStart",
34513        overwrite: false,
34514        parent,
34515        immediateRender: true,
34516        lazy: !prevStartAt && _isNotFalse(lazy),
34517        startAt: null,
34518        delay: 0,
34519        onUpdate: onUpdate && function() {
34520          return _callback(tween, "onUpdate");
34521        },
34522        stagger: 0
34523      }, startAt)));
34524      tween._startAt._dp = 0;
34525      tween._startAt._sat = tween;
34526      time < 0 && (_reverting || !immediateRender && !autoRevert) && tween._startAt.revert(_revertConfigNoKill);
34527      if (immediateRender) {
34528        if (dur && time <= 0 && tTime <= 0) {
34529          time && (tween._zTime = time);
34530          return;
34531        }
34532      }
34533    } else if (runBackwards && dur) {
34534      if (!prevStartAt) {
34535        time && (immediateRender = false);
34536        p = _setDefaults({
34537          overwrite: false,
34538          data: "isFromStart",
34539          lazy: immediateRender && !prevStartAt && _isNotFalse(lazy),
34540          immediateRender,
34541          stagger: 0,
34542          parent
34543        }, cleanVars);
34544        harnessVars && (p[harness.prop] = harnessVars);
34545        _removeFromParent(tween._startAt = Tween.set(targets, p));
34546        tween._startAt._dp = 0;
34547        tween._startAt._sat = tween;
34548        time < 0 && (_reverting ? tween._startAt.revert(_revertConfigNoKill) : tween._startAt.render(-1, true));
34549        tween._zTime = time;
34550        if (!immediateRender) {
34551          _initTween(tween._startAt, _tinyNum, _tinyNum);
34552        } else if (!time) {
34553          return;
34554        }
34555      }
34556    }
34557    tween._pt = tween._ptCache = 0;
34558    lazy = dur && _isNotFalse(lazy) || lazy && !dur;
34559    for (i = 0;i < targets.length; i++) {
34560      target = targets[i];
34561      gsData = target._gsap || _harness(targets)[i]._gsap;
34562      tween._ptLookup[i] = ptLookup = {};
34563      _lazyLookup[gsData.id] && _lazyTweens.length && _lazyRender();
34564      index = fullTargets === targets ? i : fullTargets.indexOf(target);
34565      if (harness && (plugin = new harness).init(target, harnessVars || cleanVars, tween, index, fullTargets) !== false) {
34566        tween._pt = pt = new PropTween(tween._pt, target, plugin.name, 0, 1, plugin.render, plugin, 0, plugin.priority);
34567        plugin._props.forEach(function(name) {
34568          ptLookup[name] = pt;
34569        });
34570        plugin.priority && (hasPriority = 1);
34571      }
34572      if (!harness || harnessVars) {
34573        for (p in cleanVars) {
34574          if (_plugins[p] && (plugin = _checkPlugin(p, cleanVars, tween, index, target, fullTargets))) {
34575            plugin.priority && (hasPriority = 1);
34576          } else {
34577            ptLookup[p] = pt = _addPropTween.call(tween, target, p, "get", cleanVars[p], index, fullTargets, 0, vars.stringFilter);
34578          }
34579        }
34580      }
34581      tween._op && tween._op[i] && tween.kill(target, tween._op[i]);
34582      if (autoOverwrite && tween._pt) {
34583        _overwritingTween = tween;
34584        _globalTimeline.killTweensOf(target, ptLookup, tween.globalTime(time));
34585        overwritten = !tween.parent;
34586        _overwritingTween = 0;
34587      }
34588      tween._pt && lazy && (_lazyLookup[gsData.id] = 1);
34589    }
34590    hasPriority && _sortPropTweensByPriority(tween);
34591    tween._onInit && tween._onInit(tween);
34592  }
34593  tween._onUpdate = onUpdate;
34594  tween._initted = (!tween._op || tween._pt) && !overwritten;
34595  keyframes && time <= 0 && tl.render(_bigNum, true, true);
34596};
34597var _updatePropTweens = function _updatePropTweens(tween, property, value, start, startIsRelative, ratio, time, skipRecursion) {
34598  var ptCache = (tween._pt && tween._ptCache || (tween._ptCache = {}))[property], pt, rootPT, lookup, i;
34599  if (!ptCache) {
34600    ptCache = tween._ptCache[property] = [];
34601    lookup = tween._ptLookup;
34602    i = tween._targets.length;
34603    while (i--) {
34604      pt = lookup[i][property];
34605      if (pt && pt.d && pt.d._pt) {
34606        pt = pt.d._pt;
34607        while (pt && pt.p !== property && pt.fp !== property) {
34608          pt = pt._next;
34609        }
34610      }
34611      if (!pt) {
34612        _forceAllPropTweens = 1;
34613        tween.vars[property] = "+=0";
34614        _initTween(tween, time);
34615        _forceAllPropTweens = 0;
34616        return skipRecursion ? _warn(property + " not eligible for reset") : 1;
34617      }
34618      ptCache.push(pt);
34619    }
34620  }
34621  i = ptCache.length;
34622  while (i--) {
34623    rootPT = ptCache[i];
34624    pt = rootPT._pt || rootPT;
34625    pt.s = (start || start === 0) && !startIsRelative ? start : pt.s + (start || 0) + ratio * pt.c;
34626    pt.c = value - pt.s;
34627    rootPT.e && (rootPT.e = _round(value) + getUnit(rootPT.e));
34628    rootPT.b && (rootPT.b = pt.s + getUnit(rootPT.b));
34629  }
34630};
34631var _addAliasesToVars = function _addAliasesToVars(targets, vars) {
34632  var harness = targets[0] ? _getCache(targets[0]).harness : 0, propertyAliases = harness && harness.aliases, copy, p, i, aliases;
34633  if (!propertyAliases) {
34634    return vars;
34635  }
34636  copy = _merge({}, vars);
34637  for (p in propertyAliases) {
34638    if (p in copy) {
34639      aliases = propertyAliases[p].split(",");
34640      i = aliases.length;
34641      while (i--) {
34642        copy[aliases[i]] = copy[p];
34643      }
34644    }
34645  }
34646  return copy;
34647};
34648var _parseKeyframe = function _parseKeyframe(prop, obj2, allProps, easeEach) {
34649  var ease = obj2.ease || easeEach || "power1.inOut", p, a;
34650  if (_isArray(obj2)) {
34651    a = allProps[prop] || (allProps[prop] = []);
34652    obj2.forEach(function(value, i) {
34653      return a.push({
34654        t: i / (obj2.length - 1) * 100,
34655        v: value,
34656        e: ease
34657      });
34658    });
34659  } else {
34660    for (p in obj2) {
34661      a = allProps[p] || (allProps[p] = []);
34662      p === "ease" || a.push({
34663        t: parseFloat(prop),
34664        v: obj2[p],
34665        e: ease
34666      });
34667    }
34668  }
34669};
34670var _parseFuncOrString = function _parseFuncOrString(value, tween, i, target, targets) {
34671  return _isFunction(value) ? value.call(tween, i, target, targets) : _isString(value) && ~value.indexOf("random(") ? _replaceRandom(value) : value;
34672};
34673var _staggerTweenProps = _callbackNames + "repeat,repeatDelay,yoyo,repeatRefresh,yoyoEase,autoRevert";
34674var _staggerPropsToSkip = {};
34675_forEachName(_staggerTweenProps + ",id,stagger,delay,duration,paused,scrollTrigger", function(name) {
34676  return _staggerPropsToSkip[name] = 1;
34677});
34678var Tween = /* @__PURE__ */ function(_Animation2) {
34679  _inheritsLoose(Tween, _Animation2);
34680  function Tween(targets, vars, position, skipInherit) {
34681    var _this3;
34682    if (typeof vars === "number") {
34683      position.duration = vars;
34684      vars = position;
34685      position = null;
34686    }
34687    _this3 = _Animation2.call(this, skipInherit ? vars : _inheritDefaults(vars)) || this;
34688    var _this3$vars = _this3.vars, { duration, delay, immediateRender, stagger, overwrite, keyframes, defaults, scrollTrigger, yoyoEase } = _this3$vars, parent = vars.parent || _globalTimeline, parsedTargets = (_isArray(targets) || _isTypedArray(targets) ? _isNumber(targets[0]) : ("length" in vars)) ? [targets] : toArray(targets), tl, i, copy, l, p, curTarget, staggerFunc, staggerVarsToMerge;
34689    _this3._targets = parsedTargets.length ? _harness(parsedTargets) : _warn("GSAP target " + targets + " not found. https://gsap.com", !_config.nullTargetWarn) || [];
34690    _this3._ptLookup = [];
34691    _this3._overwrite = overwrite;
34692    if (keyframes || stagger || _isFuncOrString(duration) || _isFuncOrString(delay)) {
34693      vars = _this3.vars;
34694      tl = _this3.timeline = new Timeline({
34695        data: "nested",
34696        defaults: defaults || {},
34697        targets: parent && parent.data === "nested" ? parent.vars.targets : parsedTargets
34698      });
34699      tl.kill();
34700      tl.parent = tl._dp = _assertThisInitialized(_this3);
34701      tl._start = 0;
34702      if (stagger || _isFuncOrString(duration) || _isFuncOrString(delay)) {
34703        l = parsedTargets.length;
34704        staggerFunc = stagger && distribute(stagger);
34705        if (_isObject(stagger)) {
34706          for (p in stagger) {
34707            if (~_staggerTweenProps.indexOf(p)) {
34708              staggerVarsToMerge || (staggerVarsToMerge = {});
34709              staggerVarsToMerge[p] = stagger[p];
34710            }
34711          }
34712        }
34713        for (i = 0;i < l; i++) {
34714          copy = _copyExcluding(vars, _staggerPropsToSkip);
34715          copy.stagger = 0;
34716          yoyoEase && (copy.yoyoEase = yoyoEase);
34717          staggerVarsToMerge && _merge(copy, staggerVarsToMerge);
34718          curTarget = parsedTargets[i];
34719          copy.duration = +_parseFuncOrString(duration, _assertThisInitialized(_this3), i, curTarget, parsedTargets);
34720          copy.delay = (+_parseFuncOrString(delay, _assertThisInitialized(_this3), i, curTarget, parsedTargets) || 0) - _this3._delay;
34721          if (!stagger && l === 1 && copy.delay) {
34722            _this3._delay = delay = copy.delay;
34723            _this3._start += delay;
34724            copy.delay = 0;
34725          }
34726          tl.to(curTarget, copy, staggerFunc ? staggerFunc(i, curTarget, parsedTargets) : 0);
34727          tl._ease = _easeMap.none;
34728        }
34729        tl.duration() ? duration = delay = 0 : _this3.timeline = 0;
34730      } else if (keyframes) {
34731        _inheritDefaults(_setDefaults(tl.vars.defaults, {
34732          ease: "none"
34733        }));
34734        tl._ease = _parseEase(keyframes.ease || vars.ease || "none");
34735        var time = 0, a, kf, v;
34736        if (_isArray(keyframes)) {
34737          keyframes.forEach(function(frame) {
34738            return tl.to(parsedTargets, frame, ">");
34739          });
34740          tl.duration();
34741        } else {
34742          copy = {};
34743          for (p in keyframes) {
34744            p === "ease" || p === "easeEach" || _parseKeyframe(p, keyframes[p], copy, keyframes.easeEach);
34745          }
34746          for (p in copy) {
34747            a = copy[p].sort(function(a, b) {
34748              return a.t - b.t;
34749            });
34750            time = 0;
34751            for (i = 0;i < a.length; i++) {
34752              kf = a[i];
34753              v = {
34754                ease: kf.e,
34755                duration: (kf.t - (i ? a[i - 1].t : 0)) / 100 * duration
34756              };
34757              v[p] = kf.v;
34758              tl.to(parsedTargets, v, time);
34759              time += v.duration;
34760            }
34761          }
34762          tl.duration() < duration && tl.to({}, {
34763            duration: duration - tl.duration()
34764          });
34765        }
34766      }
34767      duration || _this3.duration(duration = tl.duration());
34768    } else {
34769      _this3.timeline = 0;
34770    }
34771    if (overwrite === true && !_suppressOverwrites) {
34772      _overwritingTween = _assertThisInitialized(_this3);
34773      _globalTimeline.killTweensOf(parsedTargets);
34774      _overwritingTween = 0;
34775    }
34776    _addToTimeline(parent, _assertThisInitialized(_this3), position);
34777    vars.reversed && _this3.reverse();
34778    vars.paused && _this3.paused(true);
34779    if (immediateRender || !duration && !keyframes && _this3._start === _roundPrecise(parent._time) && _isNotFalse(immediateRender) && _hasNoPausedAncestors(_assertThisInitialized(_this3)) && parent.data !== "nested") {
34780      _this3._tTime = -_tinyNum;
34781      _this3.render(Math.max(0, -delay) || 0);
34782    }
34783    scrollTrigger && _scrollTrigger(_assertThisInitialized(_this3), scrollTrigger);
34784    return _this3;
34785  }
34786  var _proto3 = Tween.prototype;
34787  _proto3.render = function render(totalTime, suppressEvents, force) {
34788    var prevTime = this._time, tDur = this._tDur, dur = this._dur, isNegative = totalTime < 0, tTime = totalTime > tDur - _tinyNum && !isNegative ? tDur : totalTime < _tinyNum ? 0 : totalTime, time, pt, iteration, cycleDuration, prevIteration, isYoyo, ratio, timeline, yoyoEase;
34789    if (!dur) {
34790      _renderZeroDurationTween(this, totalTime, suppressEvents, force);
34791    } else if (tTime !== this._tTime || !totalTime || force || !this._initted && this._tTime || this._startAt && this._zTime < 0 !== isNegative || this._lazy) {
34792      time = tTime;
34793      timeline = this.timeline;
34794      if (this._repeat) {
34795        cycleDuration = dur + this._rDelay;
34796        if (this._repeat < -1 && isNegative) {
34797          return this.totalTime(cycleDuration * 100 + totalTime, suppressEvents, force);
34798        }
34799        time = _roundPrecise(tTime % cycleDuration);
34800        if (tTime === tDur) {
34801          iteration = this._repeat;
34802          time = dur;
34803        } else {
34804          prevIteration = _roundPrecise(tTime / cycleDuration);
34805          iteration = ~~prevIteration;
34806          if (iteration && iteration === prevIteration) {
34807            time = dur;
34808            iteration--;
34809          } else if (time > dur) {
34810            time = dur;
34811          }
34812        }
34813        isYoyo = this._yoyo && iteration & 1;
34814        if (isYoyo) {
34815          yoyoEase = this._yEase;
34816          time = dur - time;
34817        }
34818        prevIteration = _animationCycle(this._tTime, cycleDuration);
34819        if (time === prevTime && !force && this._initted && iteration === prevIteration) {
34820          this._tTime = tTime;
34821          return this;
34822        }
34823        if (iteration !== prevIteration) {
34824          timeline && this._yEase && _propagateYoyoEase(timeline, isYoyo);
34825          if (this.vars.repeatRefresh && !isYoyo && !this._lock && time !== cycleDuration && this._initted) {
34826            this._lock = force = 1;
34827            this.render(_roundPrecise(cycleDuration * iteration), true).invalidate()._lock = 0;
34828          }
34829        }
34830      }
34831      if (!this._initted) {
34832        if (_attemptInitTween(this, isNegative ? totalTime : time, force, suppressEvents, tTime)) {
34833          this._tTime = 0;
34834          return this;
34835        }
34836        if (prevTime !== this._time && !(force && this.vars.repeatRefresh && iteration !== prevIteration)) {
34837          return this;
34838        }
34839        if (dur !== this._dur) {
34840          return this.render(totalTime, suppressEvents, force);
34841        }
34842      }
34843      this._tTime = tTime;
34844      this._time = time;
34845      if (!this._act && this._ts) {
34846        this._act = 1;
34847        this._lazy = 0;
34848      }
34849      this.ratio = ratio = (yoyoEase || this._ease)(time / dur);
34850      if (this._from) {
34851        this.ratio = ratio = 1 - ratio;
34852      }
34853      if (!prevTime && tTime && !suppressEvents && !prevIteration) {
34854        _callback(this, "onStart");
34855        if (this._tTime !== tTime) {
34856          return this;
34857        }
34858      }
34859      pt = this._pt;
34860      while (pt) {
34861        pt.r(ratio, pt.d);
34862        pt = pt._next;
34863      }
34864      timeline && timeline.render(totalTime < 0 ? totalTime : timeline._dur * timeline._ease(time / this._dur), suppressEvents, force) || this._startAt && (this._zTime = totalTime);
34865      if (this._onUpdate && !suppressEvents) {
34866        isNegative && _rewindStartAt(this, totalTime, suppressEvents, force);
34867        _callback(this, "onUpdate");
34868      }
34869      this._repeat && iteration !== prevIteration && this.vars.onRepeat && !suppressEvents && this.parent && _callback(this, "onRepeat");
34870      if ((tTime === this._tDur || !tTime) && this._tTime === tTime) {
34871        isNegative && !this._onUpdate && _rewindStartAt(this, totalTime, true, true);
34872        (totalTime || !dur) && (tTime === this._tDur && this._ts > 0 || !tTime && this._ts < 0) && _removeFromParent(this, 1);
34873        if (!suppressEvents && !(isNegative && !prevTime) && (tTime || prevTime || isYoyo)) {
34874          _callback(this, tTime === tDur ? "onComplete" : "onReverseComplete", true);
34875          this._prom && !(tTime < tDur && this.timeScale() > 0) && this._prom();
34876        }
34877      }
34878    }
34879    return this;
34880  };
34881  _proto3.targets = function targets() {
34882    return this._targets;
34883  };
34884  _proto3.invalidate = function invalidate(soft) {
34885    (!soft || !this.vars.runBackwards) && (this._startAt = 0);
34886    this._pt = this._op = this._onUpdate = this._lazy = this.ratio = 0;
34887    this._ptLookup = [];
34888    this.timeline && this.timeline.invalidate(soft);
34889    return _Animation2.prototype.invalidate.call(this, soft);
34890  };
34891  _proto3.resetTo = function resetTo(property, value, start, startIsRelative, skipRecursion) {
34892    _tickerActive || _ticker.wake();
34893    this._ts || this.play();
34894    var time = Math.min(this._dur, (this._dp._time - this._start) * this._ts), ratio;
34895    this._initted || _initTween(this, time);
34896    ratio = this._ease(time / this._dur);
34897    if (_updatePropTweens(this, property, value, start, startIsRelative, ratio, time, skipRecursion)) {
34898      return this.resetTo(property, value, start, startIsRelative, 1);
34899    }
34900    _alignPlayhead(this, 0);
34901    this.parent || _addLinkedListItem(this._dp, this, "_first", "_last", this._dp._sort ? "_start" : 0);
34902    return this.render(0);
34903  };
34904  _proto3.kill = function kill(targets, vars) {
34905    if (vars === undefined) {
34906      vars = "all";
34907    }
34908    if (!targets && (!vars || vars === "all")) {
34909      this._lazy = this._pt = 0;
34910      this.parent ? _interrupt(this) : this.scrollTrigger && this.scrollTrigger.kill(!!_reverting);
34911      return this;
34912    }
34913    if (this.timeline) {
34914      var tDur = this.timeline.totalDuration();
34915      this.timeline.killTweensOf(targets, vars, _overwritingTween && _overwritingTween.vars.overwrite !== true)._first || _interrupt(this);
34916      this.parent && tDur !== this.timeline.totalDuration() && _setDuration(this, this._dur * this.timeline._tDur / tDur, 0, 1);
34917      return this;
34918    }
34919    var parsedTargets = this._targets, killingTargets = targets ? toArray(targets) : parsedTargets, propTweenLookup = this._ptLookup, firstPT = this._pt, overwrittenProps, curLookup, curOverwriteProps, props, p, pt, i;
34920    if ((!vars || vars === "all") && _arraysMatch(parsedTargets, killingTargets)) {
34921      vars === "all" && (this._pt = 0);
34922      return _interrupt(this);
34923    }
34924    overwrittenProps = this._op = this._op || [];
34925    if (vars !== "all") {
34926      if (_isString(vars)) {
34927        p = {};
34928        _forEachName(vars, function(name) {
34929          return p[name] = 1;
34930        });
34931        vars = p;
34932      }
34933      vars = _addAliasesToVars(parsedTargets, vars);
34934    }
34935    i = parsedTargets.length;
34936    while (i--) {
34937      if (~killingTargets.indexOf(parsedTargets[i])) {
34938        curLookup = propTweenLookup[i];
34939        if (vars === "all") {
34940          overwrittenProps[i] = vars;
34941          props = curLookup;
34942          curOverwriteProps = {};
34943        } else {
34944          curOverwriteProps = overwrittenProps[i] = overwrittenProps[i] || {};
34945          props = vars;
34946        }
34947        for (p in props) {
34948          pt = curLookup && curLookup[p];
34949          if (pt) {
34950            if (!("kill" in pt.d) || pt.d.kill(p) === true) {
34951              _removeLinkedListItem(this, pt, "_pt");
34952            }
34953            delete curLookup[p];
34954          }
34955          if (curOverwriteProps !== "all") {
34956            curOverwriteProps[p] = 1;
34957          }
34958        }
34959      }
34960    }
34961    this._initted && !this._pt && firstPT && _interrupt(this);
34962    return this;
34963  };
34964  Tween.to = function to(targets, vars) {
34965    return new Tween(targets, vars, arguments[2]);
34966  };
34967  Tween.from = function from(targets, vars) {
34968    return _createTweenType(1, arguments);
34969  };
34970  Tween.delayedCall = function delayedCall(delay, callback, params, scope) {
34971    return new Tween(callback, 0, {
34972      immediateRender: false,
34973      lazy: false,
34974      overwrite: false,
34975      delay,
34976      onComplete: callback,
34977      onReverseComplete: callback,
34978      onCompleteParams: params,
34979      onReverseCompleteParams: params,
34980      callbackScope: scope
34981    });
34982  };
34983  Tween.fromTo = function fromTo(targets, fromVars, toVars) {
34984    return _createTweenType(2, arguments);
34985  };
34986  Tween.set = function set(targets, vars) {
34987    vars.duration = 0;
34988    vars.repeatDelay || (vars.repeat = 0);
34989    return new Tween(targets, vars);
34990  };
34991  Tween.killTweensOf = function killTweensOf(targets, props, onlyActive) {
34992    return _globalTimeline.killTweensOf(targets, props, onlyActive);
34993  };
34994  return Tween;
34995}(Animation);
34996_setDefaults(Tween.prototype, {
34997  _targets: [],
34998  _lazy: 0,
34999  _startAt: 0,
35000  _op: 0,
35001  _onInit: 0
35002});
35003_forEachName("staggerTo,staggerFrom,staggerFromTo", function(name) {
35004  Tween[name] = function() {
35005    var tl = new Timeline, params = _slice.call(arguments, 0);
35006    params.splice(name === "staggerFromTo" ? 5 : 4, 0, 0);
35007    return tl[name].apply(tl, params);
35008  };
35009});
35010var _setterPlain = function _setterPlain(target, property, value) {
35011  return target[property] = value;
35012};
35013var _setterFunc = function _setterFunc(target, property, value) {
35014  return target[property](value);
35015};
35016var _setterFuncWithParam = function _setterFuncWithParam(target, property, value, data) {
35017  return target[property](data.fp, value);
35018};
35019var _setterAttribute = function _setterAttribute(target, property, value) {
35020  return target.setAttribute(property, value);
35021};
35022var _getSetter = function _getSetter(target, property) {
35023  return _isFunction(target[property]) ? _setterFunc : _isUndefined(target[property]) && target.setAttribute ? _setterAttribute : _setterPlain;
35024};
35025var _renderPlain = function _renderPlain(ratio, data) {
35026  return data.set(data.t, data.p, Math.round((data.s + data.c * ratio) * 1e6) / 1e6, data);
35027};
35028var _renderBoolean = function _renderBoolean(ratio, data) {
35029  return data.set(data.t, data.p, !!(data.s + data.c * ratio), data);
35030};
35031var _renderComplexString = function _renderComplexString(ratio, data) {
35032  var pt = data._pt, s = "";
35033  if (!ratio && data.b) {
35034    s = data.b;
35035  } else if (ratio === 1 && data.e) {
35036    s = data.e;
35037  } else {
35038    while (pt) {
35039      s = pt.p + (pt.m ? pt.m(pt.s + pt.c * ratio) : Math.round((pt.s + pt.c * ratio) * 1e4) / 1e4) + s;
35040      pt = pt._next;
35041    }
35042    s += data.c;
35043  }
35044  data.set(data.t, data.p, s, data);
35045};
35046var _renderPropTweens = function _renderPropTweens(ratio, data) {
35047  var pt = data._pt;
35048  while (pt) {
35049    pt.r(ratio, pt.d);
35050    pt = pt._next;
35051  }
35052};
35053var _addPluginModifier = function _addPluginModifier(modifier, tween, target, property) {
35054  var pt = this._pt, next;
35055  while (pt) {
35056    next = pt._next;
35057    pt.p === property && pt.modifier(modifier, tween, target);
35058    pt = next;
35059  }
35060};
35061var _killPropTweensOf = function _killPropTweensOf(property) {
35062  var pt = this._pt, hasNonDependentRemaining, next;
35063  while (pt) {
35064    next = pt._next;
35065    if (pt.p === property && !pt.op || pt.op === property) {
35066      _removeLinkedListItem(this, pt, "_pt");
35067    } else if (!pt.dep) {
35068      hasNonDependentRemaining = 1;
35069    }
35070    pt = next;
35071  }
35072  return !hasNonDependentRemaining;
35073};
35074var _setterWithModifier = function _setterWithModifier(target, property, value, data) {
35075  data.mSet(target, property, data.m.call(data.tween, value, data.mt), data);
35076};
35077var _sortPropTweensByPriority = function _sortPropTweensByPriority(parent) {
35078  var pt = parent._pt, next, pt2, first, last;
35079  while (pt) {
35080    next = pt._next;
35081    pt2 = first;
35082    while (pt2 && pt2.pr > pt.pr) {
35083      pt2 = pt2._next;
35084    }
35085    if (pt._prev = pt2 ? pt2._prev : last) {
35086      pt._prev._next = pt;
35087    } else {
35088      first = pt;
35089    }
35090    if (pt._next = pt2) {
35091      pt2._prev = pt;
35092    } else {
35093      last = pt;
35094    }
35095    pt = next;
35096  }
35097  parent._pt = first;
35098};
35099var PropTween = /* @__PURE__ */ function() {
35100  function PropTween(next, target, prop, start, change, renderer, data, setter, priority) {
35101    this.t = target;
35102    this.s = start;
35103    this.c = change;
35104    this.p = prop;
35105    this.r = renderer || _renderPlain;
35106    this.d = data || this;
35107    this.set = setter || _setterPlain;
35108    this.pr = priority || 0;
35109    this._next = next;
35110    if (next) {
35111      next._prev = this;
35112    }
35113  }
35114  var _proto4 = PropTween.prototype;
35115  _proto4.modifier = function modifier(func, tween, target) {
35116    this.mSet = this.mSet || this.set;
35117    this.set = _setterWithModifier;
35118    this.m = func;
35119    this.mt = target;
35120    this.tween = tween;
35121  };
35122  return PropTween;
35123}();
35124_forEachName(_callbackNames + "parent,duration,ease,delay,overwrite,runBackwards,startAt,yoyo,immediateRender,repeat,repeatDelay,data,paused,reversed,lazy,callbackScope,stringFilter,id,yoyoEase,stagger,inherit,repeatRefresh,keyframes,autoRevert,scrollTrigger", function(name) {
35125  return _reservedProps[name] = 1;
35126});
35127_globals.TweenMax = _globals.TweenLite = Tween;
35128_globals.TimelineLite = _globals.TimelineMax = Timeline;
35129_globalTimeline = new Timeline({
35130  sortChildren: false,
35131  defaults: _defaults,
35132  autoRemoveChildren: true,
35133  id: "root",
35134  smoothChildTiming: true
35135});
35136_config.stringFilter = _colorStringFilter;
35137var _media = [];
35138var _listeners = {};
35139var _emptyArray = [];
35140var _lastMediaTime = 0;
35141var _contextID = 0;
35142var _dispatch = function _dispatch(type) {
35143  return (_listeners[type] || _emptyArray).map(function(f) {
35144    return f();
35145  });
35146};
35147var _onMediaChange = function _onMediaChange() {
35148  var time = Date.now(), matches = [];
35149  if (time - _lastMediaTime > 2) {
35150    _dispatch("matchMediaInit");
35151    _media.forEach(function(c) {
35152      var { queries, conditions } = c, match, p, anyMatch, toggled;
35153      for (p in queries) {
35154        match = _win.matchMedia(queries[p]).matches;
35155        match && (anyMatch = 1);
35156        if (match !== conditions[p]) {
35157          conditions[p] = match;
35158          toggled = 1;
35159        }
35160      }
35161      if (toggled) {
35162        c.revert();
35163        anyMatch && matches.push(c);
35164      }
35165    });
35166    _dispatch("matchMediaRevert");
35167    matches.forEach(function(c) {
35168      return c.onMatch(c, function(func) {
35169        return c.add(null, func);
35170      });
35171    });
35172    _lastMediaTime = time;
35173    _dispatch("matchMedia");
35174  }
35175};
35176var Context2 = /* @__PURE__ */ function() {
35177  function Context(func, scope) {
35178    this.selector = scope && selector(scope);
35179    this.data = [];
35180    this._r = [];
35181    this.isReverted = false;
35182    this.id = _contextID++;
35183    func && this.add(func);
35184  }
35185  var _proto5 = Context.prototype;
35186  _proto5.add = function add(name, func, scope) {
35187    if (_isFunction(name)) {
35188      scope = func;
35189      func = name;
35190      name = _isFunction;
35191    }
35192    var self2 = this, f = function f() {
35193      var prev = _context, prevSelector = self2.selector, result;
35194      prev && prev !== self2 && prev.data.push(self2);
35195      scope && (self2.selector = selector(scope));
35196      _context = self2;
35197      result = func.apply(self2, arguments);
35198      _isFunction(result) && self2._r.push(result);
35199      _context = prev;
35200      self2.selector = prevSelector;
35201      self2.isReverted = false;
35202      return result;
35203    };
35204    self2.last = f;
35205    return name === _isFunction ? f(self2, function(func) {
35206      return self2.add(null, func);
35207    }) : name ? self2[name] = f : f;
35208  };
35209  _proto5.ignore = function ignore(func) {
35210    var prev = _context;
35211    _context = null;
35212    func(this);
35213    _context = prev;
35214  };
35215  _proto5.getTweens = function getTweens() {
35216    var a = [];
35217    this.data.forEach(function(e) {
35218      return e instanceof Context ? a.push.apply(a, e.getTweens()) : e instanceof Tween && !(e.parent && e.parent.data === "nested") && a.push(e);
35219    });
35220    return a;
35221  };
35222  _proto5.clear = function clear() {
35223    this._r.length = this.data.length = 0;
35224  };
35225  _proto5.kill = function kill(revert, matchMedia) {
35226    var _this4 = this;
35227    if (revert) {
35228      (function() {
35229        var tweens = _this4.getTweens(), i = _this4.data.length, t;
35230        while (i--) {
35231          t = _this4.data[i];
35232          if (t.data === "isFlip") {
35233            t.revert();
35234            t.getChildren(true, true, false).forEach(function(tween) {
35235              return tweens.splice(tweens.indexOf(tween), 1);
35236            });
35237          }
35238        }
35239        tweens.map(function(t) {
35240          return {
35241            g: t._dur || t._delay || t._sat && !t._sat.vars.immediateRender ? t.globalTime(0) : -Infinity,
35242            t
35243          };
35244        }).sort(function(a, b) {
35245          return b.g - a.g || -Infinity;
35246        }).forEach(function(o) {
35247          return o.t.revert(revert);
35248        });
35249        i = _this4.data.length;
35250        while (i--) {
35251          t = _this4.data[i];
35252          if (t instanceof Timeline) {
35253            if (t.data !== "nested") {
35254              t.scrollTrigger && t.scrollTrigger.revert();
35255              t.kill();
35256            }
35257          } else {
35258            !(t instanceof Tween) && t.revert && t.revert(revert);
35259          }
35260        }
35261        _this4._r.forEach(function(f) {
35262          return f(revert, _this4);
35263        });
35264        _this4.isReverted = true;
35265      })();
35266    } else {
35267      this.data.forEach(function(e) {
35268        return e.kill && e.kill();
35269      });
35270    }
35271    this.clear();
35272    if (matchMedia) {
35273      var i = _media.length;
35274      while (i--) {
35275        _media[i].id === this.id && _media.splice(i, 1);
35276      }
35277    }
35278  };
35279  _proto5.revert = function revert(config) {
35280    this.kill(config || {});
35281  };
35282  return Context;
35283}();
35284var MatchMedia = /* @__PURE__ */ function() {
35285  function MatchMedia(scope) {
35286    this.contexts = [];
35287    this.scope = scope;
35288    _context && _context.data.push(this);
35289  }
35290  var _proto6 = MatchMedia.prototype;
35291  _proto6.add = function add(conditions, func, scope) {
35292    _isObject(conditions) || (conditions = {
35293      matches: conditions
35294    });
35295    var context = new Context2(0, scope || this.scope), cond = context.conditions = {}, mq, p, active;
35296    _context && !context.selector && (context.selector = _context.selector);
35297    this.contexts.push(context);
35298    func = context.add("onMatch", func);
35299    context.queries = conditions;
35300    for (p in conditions) {
35301      if (p === "all") {
35302        active = 1;
35303      } else {
35304        mq = _win.matchMedia(conditions[p]);
35305        if (mq) {
35306          _media.indexOf(context) < 0 && _media.push(context);
35307          (cond[p] = mq.matches) && (active = 1);
35308          mq.addListener ? mq.addListener(_onMediaChange) : mq.addEventListener("change", _onMediaChange);
35309        }
35310      }
35311    }
35312    active && func(context, function(f) {
35313      return context.add(null, f);
35314    });
35315    return this;
35316  };
35317  _proto6.revert = function revert(config) {
35318    this.kill(config || {});
35319  };
35320  _proto6.kill = function kill(revert) {
35321    this.contexts.forEach(function(c) {
35322      return c.kill(revert, true);
35323    });
35324  };
35325  return MatchMedia;
35326}();
35327var _gsap = {
35328  registerPlugin: function registerPlugin() {
35329    for (var _len2 = arguments.length, args2 = new Array(_len2), _key2 = 0;_key2 < _len2; _key2++) {
35330      args2[_key2] = arguments[_key2];
35331    }
35332    args2.forEach(function(config) {
35333      return _createPlugin(config);
35334    });
35335  },
35336  timeline: function timeline(vars) {
35337    return new Timeline(vars);
35338  },
35339  getTweensOf: function getTweensOf(targets, onlyActive) {
35340    return _globalTimeline.getTweensOf(targets, onlyActive);
35341  },
35342  getProperty: function getProperty(target, property, unit, uncache) {
35343    _isString(target) && (target = toArray(target)[0]);
35344    var getter = _getCache(target || {}).get, format = unit ? _passThrough : _numericIfPossible;
35345    unit === "native" && (unit = "");
35346    return !target ? target : !property ? function(property, unit, uncache) {
35347      return format((_plugins[property] && _plugins[property].get || getter)(target, property, unit, uncache));
35348    } : format((_plugins[property] && _plugins[property].get || getter)(target, property, unit, uncache));
35349  },
35350  quickSetter: function quickSetter(target, property, unit) {
35351    target = toArray(target);
35352    if (target.length > 1) {
35353      var setters = target.map(function(t) {
35354        return gsap.quickSetter(t, property, unit);
35355      }), l = setters.length;
35356      return function(value) {
35357        var i = l;
35358        while (i--) {
35359          setters[i](value);
35360        }
35361      };
35362    }
35363    target = target[0] || {};
35364    var Plugin = _plugins[property], cache = _getCache(target), p = cache.harness && (cache.harness.aliases || {})[property] || property, setter = Plugin ? function(value) {
35365      var p = new Plugin;
35366      _quickTween._pt = 0;
35367      p.init(target, unit ? value + unit : value, _quickTween, 0, [target]);
35368      p.render(1, p);
35369      _quickTween._pt && _renderPropTweens(1, _quickTween);
35370    } : cache.set(target, p);
35371    return Plugin ? setter : function(value) {
35372      return setter(target, p, unit ? value + unit : value, cache, 1);
35373    };
35374  },
35375  quickTo: function quickTo(target, property, vars) {
35376    var _setDefaults2;
35377    var tween = gsap.to(target, _setDefaults((_setDefaults2 = {}, _setDefaults2[property] = "+=0.1", _setDefaults2.paused = true, _setDefaults2.stagger = 0, _setDefaults2), vars || {})), func = function func(value, start, startIsRelative) {
35378      return tween.resetTo(property, value, start, startIsRelative);
35379    };
35380    func.tween = tween;
35381    return func;
35382  },
35383  isTweening: function isTweening(targets) {
35384    return _globalTimeline.getTweensOf(targets, true).length > 0;
35385  },
35386  defaults: function defaults(value) {
35387    value && value.ease && (value.ease = _parseEase(value.ease, _defaults.ease));
35388    return _mergeDeep(_defaults, value || {});
35389  },
35390  config: function config(value) {
35391    return _mergeDeep(_config, value || {});
35392  },
35393  registerEffect: function registerEffect(_ref3) {
35394    var { name, effect, plugins, defaults, extendTimeline } = _ref3;
35395    (plugins || "").split(",").forEach(function(pluginName) {
35396      return pluginName && !_plugins[pluginName] && !_globals[pluginName] && _warn(name + " effect requires " + pluginName + " plugin.");
35397    });
35398    _effects[name] = function(targets, vars, tl) {
35399      return effect(toArray(targets), _setDefaults(vars || {}, defaults), tl);
35400    };
35401    if (extendTimeline) {
35402      Timeline.prototype[name] = function(targets, vars, position) {
35403        return this.add(_effects[name](targets, _isObject(vars) ? vars : (position = vars) && {}, this), position);
35404      };
35405    }
35406  },
35407  registerEase: function registerEase(name, ease) {
35408    _easeMap[name] = _parseEase(ease);
35409  },
35410  parseEase: function parseEase(ease, defaultEase) {
35411    return arguments.length ? _parseEase(ease, defaultEase) : _easeMap;
35412  },
35413  getById: function getById(id) {
35414    return _globalTimeline.getById(id);
35415  },
35416  exportRoot: function exportRoot(vars, includeDelayedCalls) {
35417    if (vars === undefined) {
35418      vars = {};
35419    }
35420    var tl = new Timeline(vars), child, next;
35421    tl.smoothChildTiming = _isNotFalse(vars.smoothChildTiming);
35422    _globalTimeline.remove(tl);
35423    tl._dp = 0;
35424    tl._time = tl._tTime = _globalTimeline._time;
35425    child = _globalTimeline._first;
35426    while (child) {
35427      next = child._next;
35428      if (includeDelayedCalls || !(!child._dur && child instanceof Tween && child.vars.onComplete === child._targets[0])) {
35429        _addToTimeline(tl, child, child._start - child._delay);
35430      }
35431      child = next;
35432    }
35433    _addToTimeline(_globalTimeline, tl, 0);
35434    return tl;
35435  },
35436  context: function context(func, scope) {
35437    return func ? new Context2(func, scope) : _context;
35438  },
35439  matchMedia: function matchMedia(scope) {
35440    return new MatchMedia(scope);
35441  },
35442  matchMediaRefresh: function matchMediaRefresh() {
35443    return _media.forEach(function(c) {
35444      var cond = c.conditions, found, p;
35445      for (p in cond) {
35446        if (cond[p]) {
35447          cond[p] = false;
35448          found = 1;
35449        }
35450      }
35451      found && c.revert();
35452    }) || _onMediaChange();
35453  },
35454  addEventListener: function addEventListener2(type, callback) {
35455    var a = _listeners[type] || (_listeners[type] = []);
35456    ~a.indexOf(callback) || a.push(callback);
35457  },
35458  removeEventListener: function removeEventListener2(type, callback) {
35459    var a = _listeners[type], i = a && a.indexOf(callback);
35460    i >= 0 && a.splice(i, 1);
35461  },
35462  utils: {
35463    wrap,
35464    wrapYoyo,
35465    distribute,
35466    random,
35467    snap,
35468    normalize,
35469    getUnit,
35470    clamp,
35471    splitColor,
35472    toArray,
35473    selector,
35474    mapRange,
35475    pipe,
35476    unitize,
35477    interpolate: interpolate2,
35478    shuffle
35479  },
35480  install: _install,
35481  effects: _effects,
35482  ticker: _ticker,
35483  updateRoot: Timeline.updateRoot,
35484  plugins: _plugins,
35485  globalTimeline: _globalTimeline,
35486  core: {
35487    PropTween,
35488    globals: _addGlobal,
35489    Tween,
35490    Timeline,
35491    Animation,
35492    getCache: _getCache,
35493    _removeLinkedListItem,
35494    reverting: function reverting() {
35495      return _reverting;
35496    },
35497    context: function context(toAdd) {
35498      if (toAdd && _context) {
35499        _context.data.push(toAdd);
35500        toAdd._ctx = _context;
35501      }
35502      return _context;
35503    },
35504    suppressOverwrites: function suppressOverwrites(value) {
35505      return _suppressOverwrites = value;
35506    }
35507  }
35508};
35509_forEachName("to,from,fromTo,delayedCall,set,killTweensOf", function(name) {
35510  return _gsap[name] = Tween[name];
35511});
35512_ticker.add(Timeline.updateRoot);
35513_quickTween = _gsap.to({}, {
35514  duration: 0
35515});
35516var _getPluginPropTween = function _getPluginPropTween(plugin, prop) {
35517  var pt = plugin._pt;
35518  while (pt && pt.p !== prop && pt.op !== prop && pt.fp !== prop) {
35519    pt = pt._next;
35520  }
35521  return pt;
35522};
35523var _addModifiers = function _addModifiers(tween, modifiers) {
35524  var targets = tween._targets, p, i, pt;
35525  for (p in modifiers) {
35526    i = targets.length;
35527    while (i--) {
35528      pt = tween._ptLookup[i][p];
35529      if (pt && (pt = pt.d)) {
35530        if (pt._pt) {
35531          pt = _getPluginPropTween(pt, p);
35532        }
35533        pt && pt.modifier && pt.modifier(modifiers[p], tween, targets[i], p);
35534      }
35535    }
35536  }
35537};
35538var _buildModifierPlugin = function _buildModifierPlugin(name, modifier) {
35539  return {
35540    name,
35541    headless: 1,
35542    rawVars: 1,
35543    init: function init(target, vars, tween) {
35544      tween._onInit = function(tween) {
35545        var temp, p;
35546        if (_isString(vars)) {
35547          temp = {};
35548          _forEachName(vars, function(name) {
35549            return temp[name] = 1;
35550          });
35551          vars = temp;
35552        }
35553        if (modifier) {
35554          temp = {};
35555          for (p in vars) {
35556            temp[p] = modifier(vars[p]);
35557          }
35558          vars = temp;
35559        }
35560        _addModifiers(tween, vars);
35561      };
35562    }
35563  };
35564};
35565var gsap = _gsap.registerPlugin({
35566  name: "attr",
35567  init: function init(target, vars, tween, index, targets) {
35568    var p, pt, v;
35569    this.tween = tween;
35570    for (p in vars) {
35571      v = target.getAttribute(p) || "";
35572      pt = this.add(target, "setAttribute", (v || 0) + "", vars[p], index, targets, 0, 0, p);
35573      pt.op = p;
35574      pt.b = v;
35575      this._props.push(p);
35576    }
35577  },
35578  render: function render(ratio, data) {
35579    var pt = data._pt;
35580    while (pt) {
35581      _reverting ? pt.set(pt.t, pt.p, pt.b, pt) : pt.r(ratio, pt.d);
35582      pt = pt._next;
35583    }
35584  }
35585}, {
35586  name: "endArray",
35587  headless: 1,
35588  init: function init(target, value) {
35589    var i = value.length;
35590    while (i--) {
35591      this.add(target, i, target[i] || 0, value[i], 0, 0, 0, 0, 0, 1);
35592    }
35593  }
35594}, _buildModifierPlugin("roundProps", _roundModifier), _buildModifierPlugin("modifiers"), _buildModifierPlugin("snap", snap)) || _gsap;
35595Tween.version = Timeline.version = gsap.version = "3.14.2";
35596_coreReady = 1;
35597_windowExists() && _wake();
35598var Power0 = _easeMap.Power0;
35599var Power1 = _easeMap.Power1;
35600var Power2 = _easeMap.Power2;
35601var Power3 = _easeMap.Power3;
35602var Power4 = _easeMap.Power4;
35603var Linear = _easeMap.Linear;
35604var Quad = _easeMap.Quad;
35605var Cubic = _easeMap.Cubic;
35606var Quart = _easeMap.Quart;
35607var Quint = _easeMap.Quint;
35608var Strong = _easeMap.Strong;
35609var Elastic = _easeMap.Elastic;
35610var Back = _easeMap.Back;
35611var SteppedEase = _easeMap.SteppedEase;
35612var Bounce = _easeMap.Bounce;
35613var Sine = _easeMap.Sine;
35614var Expo = _easeMap.Expo;
35615var Circ = _easeMap.Circ;
35616

vendor: 45,645 bytes, lines 35617-36675

35617// node_modules/gsap/CSSPlugin.js
35618/*!
35619 * CSSPlugin 3.14.2
35620 * https://gsap.com
35621 *
35622 * Copyright 2008-2025, GreenSock. All rights reserved.
35623 * Subject to the terms at https://gsap.com/standard-license
35624 * @author: Jack Doyle, [email protected]
35625*/
35626var _win2;
35627var _doc2;
35628var _docElement;
35629var _pluginInitted;
35630var _tempDiv;
35631var _tempDivStyler;
35632var _recentSetterPlugin;
35633var _reverting2;
35634var _windowExists2 = function _windowExists() {
35635  return typeof window !== "undefined";
35636};
35637var _transformProps = {};
35638var _RAD2DEG = 180 / Math.PI;
35639var _DEG2RAD = Math.PI / 180;
35640var _atan2 = Math.atan2;
35641var _bigNum2 = 1e8;
35642var _capsExp = /([A-Z])/g;
35643var _horizontalExp = /(left|right|width|margin|padding|x)/i;
35644var _complexExp = /[\s,\(]\S/;
35645var _propertyAliases = {
35646  autoAlpha: "opacity,visibility",
35647  scale: "scaleX,scaleY",
35648  alpha: "opacity"
35649};
35650var _renderCSSProp = function _renderCSSProp(ratio, data) {
35651  return data.set(data.t, data.p, Math.round((data.s + data.c * ratio) * 1e4) / 1e4 + data.u, data);
35652};
35653var _renderPropWithEnd = function _renderPropWithEnd(ratio, data) {
35654  return data.set(data.t, data.p, ratio === 1 ? data.e : Math.round((data.s + data.c * ratio) * 1e4) / 1e4 + data.u, data);
35655};
35656var _renderCSSPropWithBeginning = function _renderCSSPropWithBeginning(ratio, data) {
35657  return data.set(data.t, data.p, ratio ? Math.round((data.s + data.c * ratio) * 1e4) / 1e4 + data.u : data.b, data);
35658};
35659var _renderCSSPropWithBeginningAndEnd = function _renderCSSPropWithBeginningAndEnd(ratio, data) {
35660  return data.set(data.t, data.p, ratio === 1 ? data.e : ratio ? Math.round((data.s + data.c * ratio) * 1e4) / 1e4 + data.u : data.b, data);
35661};
35662var _renderRoundedCSSProp = function _renderRoundedCSSProp(ratio, data) {
35663  var value = data.s + data.c * ratio;
35664  data.set(data.t, data.p, ~~(value + (value < 0 ? -0.5 : 0.5)) + data.u, data);
35665};
35666var _renderNonTweeningValue = function _renderNonTweeningValue(ratio, data) {
35667  return data.set(data.t, data.p, ratio ? data.e : data.b, data);
35668};
35669var _renderNonTweeningValueOnlyAtEnd = function _renderNonTweeningValueOnlyAtEnd(ratio, data) {
35670  return data.set(data.t, data.p, ratio !== 1 ? data.b : data.e, data);
35671};
35672var _setterCSSStyle = function _setterCSSStyle(target, property, value) {
35673  return target.style[property] = value;
35674};
35675var _setterCSSProp = function _setterCSSProp(target, property, value) {
35676  return target.style.setProperty(property, value);
35677};
35678var _setterTransform = function _setterTransform(target, property, value) {
35679  return target._gsap[property] = value;
35680};
35681var _setterScale = function _setterScale(target, property, value) {
35682  return target._gsap.scaleX = target._gsap.scaleY = value;
35683};
35684var _setterScaleWithRender = function _setterScaleWithRender(target, property, value, data, ratio) {
35685  var cache = target._gsap;
35686  cache.scaleX = cache.scaleY = value;
35687  cache.renderTransform(ratio, cache);
35688};
35689var _setterTransformWithRender = function _setterTransformWithRender(target, property, value, data, ratio) {
35690  var cache = target._gsap;
35691  cache[property] = value;
35692  cache.renderTransform(ratio, cache);
35693};
35694var _transformProp = "transform";
35695var _transformOriginProp = _transformProp + "Origin";
35696var _saveStyle = function _saveStyle(property, isNotCSS) {
35697  var _this = this;
35698  var target = this.target, { style, _gsap: cache } = target;
35699  if (property in _transformProps && style) {
35700    this.tfm = this.tfm || {};
35701    if (property !== "transform") {
35702      property = _propertyAliases[property] || property;
35703      ~property.indexOf(",") ? property.split(",").forEach(function(a) {
35704        return _this.tfm[a] = _get(target, a);
35705      }) : this.tfm[property] = cache.x ? cache[property] : _get(target, property);
35706      property === _transformOriginProp && (this.tfm.zOrigin = cache.zOrigin);
35707    } else {
35708      return _propertyAliases.transform.split(",").forEach(function(p) {
35709        return _saveStyle.call(_this, p, isNotCSS);
35710      });
35711    }
35712    if (this.props.indexOf(_transformProp) >= 0) {
35713      return;
35714    }
35715    if (cache.svg) {
35716      this.svgo = target.getAttribute("data-svg-origin");
35717      this.props.push(_transformOriginProp, isNotCSS, "");
35718    }
35719    property = _transformProp;
35720  }
35721  (style || isNotCSS) && this.props.push(property, isNotCSS, style[property]);
35722};
35723var _removeIndependentTransforms = function _removeIndependentTransforms(style) {
35724  if (style.translate) {
35725    style.removeProperty("translate");
35726    style.removeProperty("scale");
35727    style.removeProperty("rotate");
35728  }
35729};
35730var _revertStyle = function _revertStyle() {
35731  var props = this.props, target = this.target, { style, _gsap: cache } = target, i, p;
35732  for (i = 0;i < props.length; i += 3) {
35733    if (!props[i + 1]) {
35734      props[i + 2] ? style[props[i]] = props[i + 2] : style.removeProperty(props[i].substr(0, 2) === "--" ? props[i] : props[i].replace(_capsExp, "-$1").toLowerCase());
35735    } else if (props[i + 1] === 2) {
35736      target[props[i]](props[i + 2]);
35737    } else {
35738      target[props[i]] = props[i + 2];
35739    }
35740  }
35741  if (this.tfm) {
35742    for (p in this.tfm) {
35743      cache[p] = this.tfm[p];
35744    }
35745    if (cache.svg) {
35746      cache.renderTransform();
35747      target.setAttribute("data-svg-origin", this.svgo || "");
35748    }
35749    i = _reverting2();
35750    if ((!i || !i.isStart) && !style[_transformProp]) {
35751      _removeIndependentTransforms(style);
35752      if (cache.zOrigin && style[_transformOriginProp]) {
35753        style[_transformOriginProp] += " " + cache.zOrigin + "px";
35754        cache.zOrigin = 0;
35755        cache.renderTransform();
35756      }
35757      cache.uncache = 1;
35758    }
35759  }
35760};
35761var _getStyleSaver = function _getStyleSaver(target, properties) {
35762  var saver = {
35763    target,
35764    props: [],
35765    revert: _revertStyle,
35766    save: _saveStyle
35767  };
35768  target._gsap || gsap.core.getCache(target);
35769  properties && target.style && target.nodeType && properties.split(",").forEach(function(p) {
35770    return saver.save(p);
35771  });
35772  return saver;
35773};
35774var _supports3D;
35775var _createElement = function _createElement(type, ns) {
35776  var e = _doc2.createElementNS ? _doc2.createElementNS((ns || "http://www.w3.org/1999/xhtml").replace(/^https/, "http"), type) : _doc2.createElement(type);
35777  return e && e.style ? e : _doc2.createElement(type);
35778};
35779var _getComputedProperty = function _getComputedProperty(target, property, skipPrefixFallback) {
35780  var cs = getComputedStyle(target);
35781  return cs[property] || cs.getPropertyValue(property.replace(_capsExp, "-$1").toLowerCase()) || cs.getPropertyValue(property) || !skipPrefixFallback && _getComputedProperty(target, _checkPropPrefix(property) || property, 1) || "";
35782};
35783var _prefixes = "O,Moz,ms,Ms,Webkit".split(",");
35784var _checkPropPrefix = function _checkPropPrefix(property, element, preferPrefix) {
35785  var e = element || _tempDiv, s = e.style, i = 5;
35786  if (property in s && !preferPrefix) {
35787    return property;
35788  }
35789  property = property.charAt(0).toUpperCase() + property.substr(1);
35790  while (i-- && !(_prefixes[i] + property in s)) {}
35791  return i < 0 ? null : (i === 3 ? "ms" : i >= 0 ? _prefixes[i] : "") + property;
35792};
35793var _initCore = function _initCore() {
35794  if (_windowExists2() && window.document) {
35795    _win2 = window;
35796    _doc2 = _win2.document;
35797    _docElement = _doc2.documentElement;
35798    _tempDiv = _createElement("div") || {
35799      style: {}
35800    };
35801    _tempDivStyler = _createElement("div");
35802    _transformProp = _checkPropPrefix(_transformProp);
35803    _transformOriginProp = _transformProp + "Origin";
35804    _tempDiv.style.cssText = "border-width:0;line-height:0;position:absolute;padding:0";
35805    _supports3D = !!_checkPropPrefix("perspective");
35806    _reverting2 = gsap.core.reverting;
35807    _pluginInitted = 1;
35808  }
35809};
35810var _getReparentedCloneBBox = function _getReparentedCloneBBox(target) {
35811  var owner = target.ownerSVGElement, svg = _createElement("svg", owner && owner.getAttribute("xmlns") || "http://www.w3.org/2000/svg"), clone2 = target.cloneNode(true), bbox;
35812  clone2.style.display = "block";
35813  svg.appendChild(clone2);
35814  _docElement.appendChild(svg);
35815  try {
35816    bbox = clone2.getBBox();
35817  } catch (e) {}
35818  svg.removeChild(clone2);
35819  _docElement.removeChild(svg);
35820  return bbox;
35821};
35822var _getAttributeFallbacks = function _getAttributeFallbacks(target, attributesArray) {
35823  var i = attributesArray.length;
35824  while (i--) {
35825    if (target.hasAttribute(attributesArray[i])) {
35826      return target.getAttribute(attributesArray[i]);
35827    }
35828  }
35829};
35830var _getBBox = function _getBBox(target) {
35831  var bounds, cloned;
35832  try {
35833    bounds = target.getBBox();
35834  } catch (error) {
35835    bounds = _getReparentedCloneBBox(target);
35836    cloned = 1;
35837  }
35838  bounds && (bounds.width || bounds.height) || cloned || (bounds = _getReparentedCloneBBox(target));
35839  return bounds && !bounds.width && !bounds.x && !bounds.y ? {
35840    x: +_getAttributeFallbacks(target, ["x", "cx", "x1"]) || 0,
35841    y: +_getAttributeFallbacks(target, ["y", "cy", "y1"]) || 0,
35842    width: 0,
35843    height: 0
35844  } : bounds;
35845};
35846var _isSVG = function _isSVG(e) {
35847  return !!(e.getCTM && (!e.parentNode || e.ownerSVGElement) && _getBBox(e));
35848};
35849var _removeProperty = function _removeProperty(target, property) {
35850  if (property) {
35851    var style = target.style, first2Chars;
35852    if (property in _transformProps && property !== _transformOriginProp) {
35853      property = _transformProp;
35854    }
35855    if (style.removeProperty) {
35856      first2Chars = property.substr(0, 2);
35857      if (first2Chars === "ms" || property.substr(0, 6) === "webkit") {
35858        property = "-" + property;
35859      }
35860      style.removeProperty(first2Chars === "--" ? property : property.replace(_capsExp, "-$1").toLowerCase());
35861    } else {
35862      style.removeAttribute(property);
35863    }
35864  }
35865};
35866var _addNonTweeningPT = function _addNonTweeningPT(plugin, target, property, beginning, end, onlySetAtEnd) {
35867  var pt = new PropTween(plugin._pt, target, property, 0, 1, onlySetAtEnd ? _renderNonTweeningValueOnlyAtEnd : _renderNonTweeningValue);
35868  plugin._pt = pt;
35869  pt.b = beginning;
35870  pt.e = end;
35871  plugin._props.push(property);
35872  return pt;
35873};
35874var _nonConvertibleUnits = {
35875  deg: 1,
35876  rad: 1,
35877  turn: 1
35878};
35879var _nonStandardLayouts = {
35880  grid: 1,
35881  flex: 1
35882};
35883var _convertToUnit = function _convertToUnit(target, property, value, unit) {
35884  var curValue = parseFloat(value) || 0, curUnit = (value + "").trim().substr((curValue + "").length) || "px", style = _tempDiv.style, horizontal = _horizontalExp.test(property), isRootSVG = target.tagName.toLowerCase() === "svg", measureProperty = (isRootSVG ? "client" : "offset") + (horizontal ? "Width" : "Height"), amount = 100, toPixels = unit === "px", toPercent = unit === "%", px, parent, cache, isSVG;
35885  if (unit === curUnit || !curValue || _nonConvertibleUnits[unit] || _nonConvertibleUnits[curUnit]) {
35886    return curValue;
35887  }
35888  curUnit !== "px" && !toPixels && (curValue = _convertToUnit(target, property, value, "px"));
35889  isSVG = target.getCTM && _isSVG(target);
35890  if ((toPercent || curUnit === "%") && (_transformProps[property] || ~property.indexOf("adius"))) {
35891    px = isSVG ? target.getBBox()[horizontal ? "width" : "height"] : target[measureProperty];
35892    return _round(toPercent ? curValue / px * amount : curValue / 100 * px);
35893  }
35894  style[horizontal ? "width" : "height"] = amount + (toPixels ? curUnit : unit);
35895  parent = unit !== "rem" && ~property.indexOf("adius") || unit === "em" && target.appendChild && !isRootSVG ? target : target.parentNode;
35896  if (isSVG) {
35897    parent = (target.ownerSVGElement || {}).parentNode;
35898  }
35899  if (!parent || parent === _doc2 || !parent.appendChild) {
35900    parent = _doc2.body;
35901  }
35902  cache = parent._gsap;
35903  if (cache && toPercent && cache.width && horizontal && cache.time === _ticker.time && !cache.uncache) {
35904    return _round(curValue / cache.width * amount);
35905  } else {
35906    if (toPercent && (property === "height" || property === "width")) {
35907      var v = target.style[property];
35908      target.style[property] = amount + unit;
35909      px = target[measureProperty];
35910      v ? target.style[property] = v : _removeProperty(target, property);
35911    } else {
35912      (toPercent || curUnit === "%") && !_nonStandardLayouts[_getComputedProperty(parent, "display")] && (style.position = _getComputedProperty(target, "position"));
35913      parent === target && (style.position = "static");
35914      parent.appendChild(_tempDiv);
35915      px = _tempDiv[measureProperty];
35916      parent.removeChild(_tempDiv);
35917      style.position = "absolute";
35918    }
35919    if (horizontal && toPercent) {
35920      cache = _getCache(parent);
35921      cache.time = _ticker.time;
35922      cache.width = parent[measureProperty];
35923    }
35924  }
35925  return _round(toPixels ? px * curValue / amount : px && curValue ? amount / px * curValue : 0);
35926};
35927var _get = function _get(target, property, unit, uncache) {
35928  var value;
35929  _pluginInitted || _initCore();
35930  if (property in _propertyAliases && property !== "transform") {
35931    property = _propertyAliases[property];
35932    if (~property.indexOf(",")) {
35933      property = property.split(",")[0];
35934    }
35935  }
35936  if (_transformProps[property] && property !== "transform") {
35937    value = _parseTransform(target, uncache);
35938    value = property !== "transformOrigin" ? value[property] : value.svg ? value.origin : _firstTwoOnly(_getComputedProperty(target, _transformOriginProp)) + " " + value.zOrigin + "px";
35939  } else {
35940    value = target.style[property];
35941    if (!value || value === "auto" || uncache || ~(value + "").indexOf("calc(")) {
35942      value = _specialProps[property] && _specialProps[property](target, property, unit) || _getComputedProperty(target, property) || _getProperty(target, property) || (property === "opacity" ? 1 : 0);
35943    }
35944  }
35945  return unit && !~(value + "").trim().indexOf(" ") ? _convertToUnit(target, property, value, unit) + unit : value;
35946};
35947var _tweenComplexCSSString = function _tweenComplexCSSString(target, prop, start, end) {
35948  if (!start || start === "none") {
35949    var p = _checkPropPrefix(prop, target, 1), s = p && _getComputedProperty(target, p, 1);
35950    if (s && s !== start) {
35951      prop = p;
35952      start = s;
35953    } else if (prop === "borderColor") {
35954      start = _getComputedProperty(target, "borderTopColor");
35955    }
35956  }
35957  var pt = new PropTween(this._pt, target.style, prop, 0, 1, _renderComplexString), index = 0, matchIndex = 0, a, result, startValues, startNum, color, startValue, endValue, endNum, chunk, endUnit, startUnit, endValues;
35958  pt.b = start;
35959  pt.e = end;
35960  start += "";
35961  end += "";
35962  if (end.substring(0, 6) === "var(--") {
35963    end = _getComputedProperty(target, end.substring(4, end.indexOf(")")));
35964  }
35965  if (end === "auto") {
35966    startValue = target.style[prop];
35967    target.style[prop] = end;
35968    end = _getComputedProperty(target, prop) || end;
35969    startValue ? target.style[prop] = startValue : _removeProperty(target, prop);
35970  }
35971  a = [start, end];
35972  _colorStringFilter(a);
35973  start = a[0];
35974  end = a[1];
35975  startValues = start.match(_numWithUnitExp) || [];
35976  endValues = end.match(_numWithUnitExp) || [];
35977  if (endValues.length) {
35978    while (result = _numWithUnitExp.exec(end)) {
35979      endValue = result[0];
35980      chunk = end.substring(index, result.index);
35981      if (color) {
35982        color = (color + 1) % 5;
35983      } else if (chunk.substr(-5) === "rgba(" || chunk.substr(-5) === "hsla(") {
35984        color = 1;
35985      }
35986      if (endValue !== (startValue = startValues[matchIndex++] || "")) {
35987        startNum = parseFloat(startValue) || 0;
35988        startUnit = startValue.substr((startNum + "").length);
35989        endValue.charAt(1) === "=" && (endValue = _parseRelative(startNum, endValue) + startUnit);
35990        endNum = parseFloat(endValue);
35991        endUnit = endValue.substr((endNum + "").length);
35992        index = _numWithUnitExp.lastIndex - endUnit.length;
35993        if (!endUnit) {
35994          endUnit = endUnit || _config.units[prop] || startUnit;
35995          if (index === end.length) {
35996            end += endUnit;
35997            pt.e += endUnit;
35998          }
35999        }
36000        if (startUnit !== endUnit) {
36001          startNum = _convertToUnit(target, prop, startValue, endUnit) || 0;
36002        }
36003        pt._pt = {
36004          _next: pt._pt,
36005          p: chunk || matchIndex === 1 ? chunk : ",",
36006          s: startNum,
36007          c: endNum - startNum,
36008          m: color && color < 4 || prop === "zIndex" ? Math.round : 0
36009        };
36010      }
36011    }
36012    pt.c = index < end.length ? end.substring(index, end.length) : "";
36013  } else {
36014    pt.r = prop === "display" && end === "none" ? _renderNonTweeningValueOnlyAtEnd : _renderNonTweeningValue;
36015  }
36016  _relExp.test(end) && (pt.e = 0);
36017  this._pt = pt;
36018  return pt;
36019};
36020var _keywordToPercent = {
36021  top: "0%",
36022  bottom: "100%",
36023  left: "0%",
36024  right: "100%",
36025  center: "50%"
36026};
36027var _convertKeywordsToPercentages = function _convertKeywordsToPercentages(value) {
36028  var split = value.split(" "), x = split[0], y = split[1] || "50%";
36029  if (x === "top" || x === "bottom" || y === "left" || y === "right") {
36030    value = x;
36031    x = y;
36032    y = value;
36033  }
36034  split[0] = _keywordToPercent[x] || x;
36035  split[1] = _keywordToPercent[y] || y;
36036  return split.join(" ");
36037};
36038var _renderClearProps = function _renderClearProps(ratio, data) {
36039  if (data.tween && data.tween._time === data.tween._dur) {
36040    var target = data.t, style = target.style, props = data.u, cache = target._gsap, prop, clearTransforms, i;
36041    if (props === "all" || props === true) {
36042      style.cssText = "";
36043      clearTransforms = 1;
36044    } else {
36045      props = props.split(",");
36046      i = props.length;
36047      while (--i > -1) {
36048        prop = props[i];
36049        if (_transformProps[prop]) {
36050          clearTransforms = 1;
36051          prop = prop === "transformOrigin" ? _transformOriginProp : _transformProp;
36052        }
36053        _removeProperty(target, prop);
36054      }
36055    }
36056    if (clearTransforms) {
36057      _removeProperty(target, _transformProp);
36058      if (cache) {
36059        cache.svg && target.removeAttribute("transform");
36060        style.scale = style.rotate = style.translate = "none";
36061        _parseTransform(target, 1);
36062        cache.uncache = 1;
36063        _removeIndependentTransforms(style);
36064      }
36065    }
36066  }
36067};
36068var _specialProps = {
36069  clearProps: function clearProps(plugin, target, property, endValue, tween) {
36070    if (tween.data !== "isFromStart") {
36071      var pt = plugin._pt = new PropTween(plugin._pt, target, property, 0, 0, _renderClearProps);
36072      pt.u = endValue;
36073      pt.pr = -10;
36074      pt.tween = tween;
36075      plugin._props.push(property);
36076      return 1;
36077    }
36078  }
36079};
36080var _identity2DMatrix = [1, 0, 0, 1, 0, 0];
36081var _rotationalProperties = {};
36082var _isNullTransform = function _isNullTransform(value) {
36083  return value === "matrix(1, 0, 0, 1, 0, 0)" || value === "none" || !value;
36084};
36085var _getComputedTransformMatrixAsArray = function _getComputedTransformMatrixAsArray(target) {
36086  var matrixString = _getComputedProperty(target, _transformProp);
36087  return _isNullTransform(matrixString) ? _identity2DMatrix : matrixString.substr(7).match(_numExp).map(_round);
36088};
36089var _getMatrix = function _getMatrix(target, force2D) {
36090  var cache = target._gsap || _getCache(target), style = target.style, matrix = _getComputedTransformMatrixAsArray(target), parent, nextSibling, temp, addedToDOM;
36091  if (cache.svg && target.getAttribute("transform")) {
36092    temp = target.transform.baseVal.consolidate().matrix;
36093    matrix = [temp.a, temp.b, temp.c, temp.d, temp.e, temp.f];
36094    return matrix.join(",") === "1,0,0,1,0,0" ? _identity2DMatrix : matrix;
36095  } else if (matrix === _identity2DMatrix && !target.offsetParent && target !== _docElement && !cache.svg) {
36096    temp = style.display;
36097    style.display = "block";
36098    parent = target.parentNode;
36099    if (!parent || !target.offsetParent && !target.getBoundingClientRect().width) {
36100      addedToDOM = 1;
36101      nextSibling = target.nextElementSibling;
36102      _docElement.appendChild(target);
36103    }
36104    matrix = _getComputedTransformMatrixAsArray(target);
36105    temp ? style.display = temp : _removeProperty(target, "display");
36106    if (addedToDOM) {
36107      nextSibling ? parent.insertBefore(target, nextSibling) : parent ? parent.appendChild(target) : _docElement.removeChild(target);
36108    }
36109  }
36110  return force2D && matrix.length > 6 ? [matrix[0], matrix[1], matrix[4], matrix[5], matrix[12], matrix[13]] : matrix;
36111};
36112var _applySVGOrigin = function _applySVGOrigin(target, origin, originIsAbsolute, smooth, matrixArray, pluginToAddPropTweensTo) {
36113  var cache = target._gsap, matrix = matrixArray || _getMatrix(target, true), xOriginOld = cache.xOrigin || 0, yOriginOld = cache.yOrigin || 0, xOffsetOld = cache.xOffset || 0, yOffsetOld = cache.yOffset || 0, a = matrix[0], b = matrix[1], c = matrix[2], d = matrix[3], tx = matrix[4], ty = matrix[5], originSplit = origin.split(" "), xOrigin = parseFloat(originSplit[0]) || 0, yOrigin = parseFloat(originSplit[1]) || 0, bounds, determinant, x, y;
36114  if (!originIsAbsolute) {
36115    bounds = _getBBox(target);
36116    xOrigin = bounds.x + (~originSplit[0].indexOf("%") ? xOrigin / 100 * bounds.width : xOrigin);
36117    yOrigin = bounds.y + (~(originSplit[1] || originSplit[0]).indexOf("%") ? yOrigin / 100 * bounds.height : yOrigin);
36118  } else if (matrix !== _identity2DMatrix && (determinant = a * d - b * c)) {
36119    x = xOrigin * (d / determinant) + yOrigin * (-c / determinant) + (c * ty - d * tx) / determinant;
36120    y = xOrigin * (-b / determinant) + yOrigin * (a / determinant) - (a * ty - b * tx) / determinant;
36121    xOrigin = x;
36122    yOrigin = y;
36123  }
36124  if (smooth || smooth !== false && cache.smooth) {
36125    tx = xOrigin - xOriginOld;
36126    ty = yOrigin - yOriginOld;
36127    cache.xOffset = xOffsetOld + (tx * a + ty * c) - tx;
36128    cache.yOffset = yOffsetOld + (tx * b + ty * d) - ty;
36129  } else {
36130    cache.xOffset = cache.yOffset = 0;
36131  }
36132  cache.xOrigin = xOrigin;
36133  cache.yOrigin = yOrigin;
36134  cache.smooth = !!smooth;
36135  cache.origin = origin;
36136  cache.originIsAbsolute = !!originIsAbsolute;
36137  target.style[_transformOriginProp] = "0px 0px";
36138  if (pluginToAddPropTweensTo) {
36139    _addNonTweeningPT(pluginToAddPropTweensTo, cache, "xOrigin", xOriginOld, xOrigin);
36140    _addNonTweeningPT(pluginToAddPropTweensTo, cache, "yOrigin", yOriginOld, yOrigin);
36141    _addNonTweeningPT(pluginToAddPropTweensTo, cache, "xOffset", xOffsetOld, cache.xOffset);
36142    _addNonTweeningPT(pluginToAddPropTweensTo, cache, "yOffset", yOffsetOld, cache.yOffset);
36143  }
36144  target.setAttribute("data-svg-origin", xOrigin + " " + yOrigin);
36145};
36146var _parseTransform = function _parseTransform(target, uncache) {
36147  var cache = target._gsap || new GSCache(target);
36148  if ("x" in cache && !uncache && !cache.uncache) {
36149    return cache;
36150  }
36151  var style = target.style, invertedScaleX = cache.scaleX < 0, px = "px", deg = "deg", cs = getComputedStyle(target), origin = _getComputedProperty(target, _transformOriginProp) || "0", x, y, z, scaleX, scaleY, rotation, rotationX, rotationY, skewX, skewY, perspective, xOrigin, yOrigin, matrix, angle, cos, sin, a, b, c, d, a12, a22, t1, t2, t3, a13, a23, a33, a42, a43, a32;
36152  x = y = z = rotation = rotationX = rotationY = skewX = skewY = perspective = 0;
36153  scaleX = scaleY = 1;
36154  cache.svg = !!(target.getCTM && _isSVG(target));
36155  if (cs.translate) {
36156    if (cs.translate !== "none" || cs.scale !== "none" || cs.rotate !== "none") {
36157      style[_transformProp] = (cs.translate !== "none" ? "translate3d(" + (cs.translate + " 0 0").split(" ").slice(0, 3).join(", ") + ") " : "") + (cs.rotate !== "none" ? "rotate(" + cs.rotate + ") " : "") + (cs.scale !== "none" ? "scale(" + cs.scale.split(" ").join(",") + ") " : "") + (cs[_transformProp] !== "none" ? cs[_transformProp] : "");
36158    }
36159    style.scale = style.rotate = style.translate = "none";
36160  }
36161  matrix = _getMatrix(target, cache.svg);
36162  if (cache.svg) {
36163    if (cache.uncache) {
36164      t2 = target.getBBox();
36165      origin = cache.xOrigin - t2.x + "px " + (cache.yOrigin - t2.y) + "px";
36166      t1 = "";
36167    } else {
36168      t1 = !uncache && target.getAttribute("data-svg-origin");
36169    }
36170    _applySVGOrigin(target, t1 || origin, !!t1 || cache.originIsAbsolute, cache.smooth !== false, matrix);
36171  }
36172  xOrigin = cache.xOrigin || 0;
36173  yOrigin = cache.yOrigin || 0;
36174  if (matrix !== _identity2DMatrix) {
36175    a = matrix[0];
36176    b = matrix[1];
36177    c = matrix[2];
36178    d = matrix[3];
36179    x = a12 = matrix[4];
36180    y = a22 = matrix[5];
36181    if (matrix.length === 6) {
36182      scaleX = Math.sqrt(a * a + b * b);
36183      scaleY = Math.sqrt(d * d + c * c);
36184      rotation = a || b ? _atan2(b, a) * _RAD2DEG : 0;
36185      skewX = c || d ? _atan2(c, d) * _RAD2DEG + rotation : 0;
36186      skewX && (scaleY *= Math.abs(Math.cos(skewX * _DEG2RAD)));
36187      if (cache.svg) {
36188        x -= xOrigin - (xOrigin * a + yOrigin * c);
36189        y -= yOrigin - (xOrigin * b + yOrigin * d);
36190      }
36191    } else {
36192      a32 = matrix[6];
36193      a42 = matrix[7];
36194      a13 = matrix[8];
36195      a23 = matrix[9];
36196      a33 = matrix[10];
36197      a43 = matrix[11];
36198      x = matrix[12];
36199      y = matrix[13];
36200      z = matrix[14];
36201      angle = _atan2(a32, a33);
36202      rotationX = angle * _RAD2DEG;
36203      if (angle) {
36204        cos = Math.cos(-angle);
36205        sin = Math.sin(-angle);
36206        t1 = a12 * cos + a13 * sin;
36207        t2 = a22 * cos + a23 * sin;
36208        t3 = a32 * cos + a33 * sin;
36209        a13 = a12 * -sin + a13 * cos;
36210        a23 = a22 * -sin + a23 * cos;
36211        a33 = a32 * -sin + a33 * cos;
36212        a43 = a42 * -sin + a43 * cos;
36213        a12 = t1;
36214        a22 = t2;
36215        a32 = t3;
36216      }
36217      angle = _atan2(-c, a33);
36218      rotationY = angle * _RAD2DEG;
36219      if (angle) {
36220        cos = Math.cos(-angle);
36221        sin = Math.sin(-angle);
36222        t1 = a * cos - a13 * sin;
36223        t2 = b * cos - a23 * sin;
36224        t3 = c * cos - a33 * sin;
36225        a43 = d * sin + a43 * cos;
36226        a = t1;
36227        b = t2;
36228        c = t3;
36229      }
36230      angle = _atan2(b, a);
36231      rotation = angle * _RAD2DEG;
36232      if (angle) {
36233        cos = Math.cos(angle);
36234        sin = Math.sin(angle);
36235        t1 = a * cos + b * sin;
36236        t2 = a12 * cos + a22 * sin;
36237        b = b * cos - a * sin;
36238        a22 = a22 * cos - a12 * sin;
36239        a = t1;
36240        a12 = t2;
36241      }
36242      if (rotationX && Math.abs(rotationX) + Math.abs(rotation) > 359.9) {
36243        rotationX = rotation = 0;
36244        rotationY = 180 - rotationY;
36245      }
36246      scaleX = _round(Math.sqrt(a * a + b * b + c * c));
36247      scaleY = _round(Math.sqrt(a22 * a22 + a32 * a32));
36248      angle = _atan2(a12, a22);
36249      skewX = Math.abs(angle) > 0.0002 ? angle * _RAD2DEG : 0;
36250      perspective = a43 ? 1 / (a43 < 0 ? -a43 : a43) : 0;
36251    }
36252    if (cache.svg) {
36253      t1 = target.getAttribute("transform");
36254      cache.forceCSS = target.setAttribute("transform", "") || !_isNullTransform(_getComputedProperty(target, _transformProp));
36255      t1 && target.setAttribute("transform", t1);
36256    }
36257  }
36258  if (Math.abs(skewX) > 90 && Math.abs(skewX) < 270) {
36259    if (invertedScaleX) {
36260      scaleX *= -1;
36261      skewX += rotation <= 0 ? 180 : -180;
36262      rotation += rotation <= 0 ? 180 : -180;
36263    } else {
36264      scaleY *= -1;
36265      skewX += skewX <= 0 ? 180 : -180;
36266    }
36267  }
36268  uncache = uncache || cache.uncache;
36269  cache.x = x - ((cache.xPercent = x && (!uncache && cache.xPercent || (Math.round(target.offsetWidth / 2) === Math.round(-x) ? -50 : 0))) ? target.offsetWidth * cache.xPercent / 100 : 0) + px;
36270  cache.y = y - ((cache.yPercent = y && (!uncache && cache.yPercent || (Math.round(target.offsetHeight / 2) === Math.round(-y) ? -50 : 0))) ? target.offsetHeight * cache.yPercent / 100 : 0) + px;
36271  cache.z = z + px;
36272  cache.scaleX = _round(scaleX);
36273  cache.scaleY = _round(scaleY);
36274  cache.rotation = _round(rotation) + deg;
36275  cache.rotationX = _round(rotationX) + deg;
36276  cache.rotationY = _round(rotationY) + deg;
36277  cache.skewX = skewX + deg;
36278  cache.skewY = skewY + deg;
36279  cache.transformPerspective = perspective + px;
36280  if (cache.zOrigin = parseFloat(origin.split(" ")[2]) || !uncache && cache.zOrigin || 0) {
36281    style[_transformOriginProp] = _firstTwoOnly(origin);
36282  }
36283  cache.xOffset = cache.yOffset = 0;
36284  cache.force3D = _config.force3D;
36285  cache.renderTransform = cache.svg ? _renderSVGTransforms : _supports3D ? _renderCSSTransforms : _renderNon3DTransforms;
36286  cache.uncache = 0;
36287  return cache;
36288};
36289var _firstTwoOnly = function _firstTwoOnly(value) {
36290  return (value = value.split(" "))[0] + " " + value[1];
36291};
36292var _addPxTranslate = function _addPxTranslate(target, start, value) {
36293  var unit = getUnit(start);
36294  return _round(parseFloat(start) + parseFloat(_convertToUnit(target, "x", value + "px", unit))) + unit;
36295};
36296var _renderNon3DTransforms = function _renderNon3DTransforms(ratio, cache) {
36297  cache.z = "0px";
36298  cache.rotationY = cache.rotationX = "0deg";
36299  cache.force3D = 0;
36300  _renderCSSTransforms(ratio, cache);
36301};
36302var _zeroDeg = "0deg";
36303var _zeroPx = "0px";
36304var _endParenthesis = ") ";
36305var _renderCSSTransforms = function _renderCSSTransforms(ratio, cache) {
36306  var _ref = cache || this, { xPercent, yPercent, x, y, z, rotation, rotationY, rotationX, skewX, skewY, scaleX, scaleY, transformPerspective, force3D, target, zOrigin } = _ref, transforms = "", use3D = force3D === "auto" && ratio && ratio !== 1 || force3D === true;
36307  if (zOrigin && (rotationX !== _zeroDeg || rotationY !== _zeroDeg)) {
36308    var angle = parseFloat(rotationY) * _DEG2RAD, a13 = Math.sin(angle), a33 = Math.cos(angle), cos;
36309    angle = parseFloat(rotationX) * _DEG2RAD;
36310    cos = Math.cos(angle);
36311    x = _addPxTranslate(target, x, a13 * cos * -zOrigin);
36312    y = _addPxTranslate(target, y, -Math.sin(angle) * -zOrigin);
36313    z = _addPxTranslate(target, z, a33 * cos * -zOrigin + zOrigin);
36314  }
36315  if (transformPerspective !== _zeroPx) {
36316    transforms += "perspective(" + transformPerspective + _endParenthesis;
36317  }
36318  if (xPercent || yPercent) {
36319    transforms += "translate(" + xPercent + "%, " + yPercent + "%) ";
36320  }
36321  if (use3D || x !== _zeroPx || y !== _zeroPx || z !== _zeroPx) {
36322    transforms += z !== _zeroPx || use3D ? "translate3d(" + x + ", " + y + ", " + z + ") " : "translate(" + x + ", " + y + _endParenthesis;
36323  }
36324  if (rotation !== _zeroDeg) {
36325    transforms += "rotate(" + rotation + _endParenthesis;
36326  }
36327  if (rotationY !== _zeroDeg) {
36328    transforms += "rotateY(" + rotationY + _endParenthesis;
36329  }
36330  if (rotationX !== _zeroDeg) {
36331    transforms += "rotateX(" + rotationX + _endParenthesis;
36332  }
36333  if (skewX !== _zeroDeg || skewY !== _zeroDeg) {
36334    transforms += "skew(" + skewX + ", " + skewY + _endParenthesis;
36335  }
36336  if (scaleX !== 1 || scaleY !== 1) {
36337    transforms += "scale(" + scaleX + ", " + scaleY + _endParenthesis;
36338  }
36339  target.style[_transformProp] = transforms || "translate(0, 0)";
36340};
36341var _renderSVGTransforms = function _renderSVGTransforms(ratio, cache) {
36342  var _ref2 = cache || this, { xPercent, yPercent, x, y, rotation, skewX, skewY, scaleX, scaleY, target, xOrigin, yOrigin, xOffset, yOffset, forceCSS } = _ref2, tx = parseFloat(x), ty = parseFloat(y), a11, a21, a12, a22, temp;
36343  rotation = parseFloat(rotation);
36344  skewX = parseFloat(skewX);
36345  skewY = parseFloat(skewY);
36346  if (skewY) {
36347    skewY = parseFloat(skewY);
36348    skewX += skewY;
36349    rotation += skewY;
36350  }
36351  if (rotation || skewX) {
36352    rotation *= _DEG2RAD;
36353    skewX *= _DEG2RAD;
36354    a11 = Math.cos(rotation) * scaleX;
36355    a21 = Math.sin(rotation) * scaleX;
36356    a12 = Math.sin(rotation - skewX) * -scaleY;
36357    a22 = Math.cos(rotation - skewX) * scaleY;
36358    if (skewX) {
36359      skewY *= _DEG2RAD;
36360      temp = Math.tan(skewX - skewY);
36361      temp = Math.sqrt(1 + temp * temp);
36362      a12 *= temp;
36363      a22 *= temp;
36364      if (skewY) {
36365        temp = Math.tan(skewY);
36366        temp = Math.sqrt(1 + temp * temp);
36367        a11 *= temp;
36368        a21 *= temp;
36369      }
36370    }
36371    a11 = _round(a11);
36372    a21 = _round(a21);
36373    a12 = _round(a12);
36374    a22 = _round(a22);
36375  } else {
36376    a11 = scaleX;
36377    a22 = scaleY;
36378    a21 = a12 = 0;
36379  }
36380  if (tx && !~(x + "").indexOf("px") || ty && !~(y + "").indexOf("px")) {
36381    tx = _convertToUnit(target, "x", x, "px");
36382    ty = _convertToUnit(target, "y", y, "px");
36383  }
36384  if (xOrigin || yOrigin || xOffset || yOffset) {
36385    tx = _round(tx + xOrigin - (xOrigin * a11 + yOrigin * a12) + xOffset);
36386    ty = _round(ty + yOrigin - (xOrigin * a21 + yOrigin * a22) + yOffset);
36387  }
36388  if (xPercent || yPercent) {
36389    temp = target.getBBox();
36390    tx = _round(tx + xPercent / 100 * temp.width);
36391    ty = _round(ty + yPercent / 100 * temp.height);
36392  }
36393  temp = "matrix(" + a11 + "," + a21 + "," + a12 + "," + a22 + "," + tx + "," + ty + ")";
36394  target.setAttribute("transform", temp);
36395  forceCSS && (target.style[_transformProp] = temp);
36396};
36397var _addRotationalPropTween = function _addRotationalPropTween(plugin, target, property, startNum, endValue) {
36398  var cap = 360, isString = _isString(endValue), endNum = parseFloat(endValue) * (isString && ~endValue.indexOf("rad") ? _RAD2DEG : 1), change = endNum - startNum, finalValue = startNum + change + "deg", direction, pt;
36399  if (isString) {
36400    direction = endValue.split("_")[1];
36401    if (direction === "short") {
36402      change %= cap;
36403      if (change !== change % (cap / 2)) {
36404        change += change < 0 ? cap : -cap;
36405      }
36406    }
36407    if (direction === "cw" && change < 0) {
36408      change = (change + cap * _bigNum2) % cap - ~~(change / cap) * cap;
36409    } else if (direction === "ccw" && change > 0) {
36410      change = (change - cap * _bigNum2) % cap - ~~(change / cap) * cap;
36411    }
36412  }
36413  plugin._pt = pt = new PropTween(plugin._pt, target, property, startNum, change, _renderPropWithEnd);
36414  pt.e = finalValue;
36415  pt.u = "deg";
36416  plugin._props.push(property);
36417  return pt;
36418};
36419var _assign = function _assign(target, source) {
36420  for (var p in source) {
36421    target[p] = source[p];
36422  }
36423  return target;
36424};
36425var _addRawTransformPTs = function _addRawTransformPTs(plugin, transforms, target) {
36426  var startCache = _assign({}, target._gsap), exclude = "perspective,force3D,transformOrigin,svgOrigin", style = target.style, endCache, p, startValue, endValue, startNum, endNum, startUnit, endUnit;
36427  if (startCache.svg) {
36428    startValue = target.getAttribute("transform");
36429    target.setAttribute("transform", "");
36430    style[_transformProp] = transforms;
36431    endCache = _parseTransform(target, 1);
36432    _removeProperty(target, _transformProp);
36433    target.setAttribute("transform", startValue);
36434  } else {
36435    startValue = getComputedStyle(target)[_transformProp];
36436    style[_transformProp] = transforms;
36437    endCache = _parseTransform(target, 1);
36438    style[_transformProp] = startValue;
36439  }
36440  for (p in _transformProps) {
36441    startValue = startCache[p];
36442    endValue = endCache[p];
36443    if (startValue !== endValue && exclude.indexOf(p) < 0) {
36444      startUnit = getUnit(startValue);
36445      endUnit = getUnit(endValue);
36446      startNum = startUnit !== endUnit ? _convertToUnit(target, p, startValue, endUnit) : parseFloat(startValue);
36447      endNum = parseFloat(endValue);
36448      plugin._pt = new PropTween(plugin._pt, endCache, p, startNum, endNum - startNum, _renderCSSProp);
36449      plugin._pt.u = endUnit || 0;
36450      plugin._props.push(p);
36451    }
36452  }
36453  _assign(endCache, startCache);
36454};
36455_forEachName("padding,margin,Width,Radius", function(name, index) {
36456  var t = "Top", r = "Right", b = "Bottom", l = "Left", props = (index < 3 ? [t, r, b, l] : [t + l, t + r, b + r, b + l]).map(function(side) {
36457    return index < 2 ? name + side : "border" + side + name;
36458  });
36459  _specialProps[index > 1 ? "border" + name : name] = function(plugin, target, property, endValue, tween) {
36460    var a, vars;
36461    if (arguments.length < 4) {
36462      a = props.map(function(prop) {
36463        return _get(plugin, prop, property);
36464      });
36465      vars = a.join(" ");
36466      return vars.split(a[0]).length === 5 ? a[0] : vars;
36467    }
36468    a = (endValue + "").split(" ");
36469    vars = {};
36470    props.forEach(function(prop, i) {
36471      return vars[prop] = a[i] = a[i] || a[(i - 1) / 2 | 0];
36472    });
36473    plugin.init(target, vars, tween);
36474  };
36475});
36476var CSSPlugin = {
36477  name: "css",
36478  register: _initCore,
36479  targetTest: function targetTest(target) {
36480    return target.style && target.nodeType;
36481  },
36482  init: function init(target, vars, tween, index, targets) {
36483    var props = this._props, style = target.style, startAt = tween.vars.startAt, startValue, endValue, endNum, startNum, type, specialProp, p, startUnit, endUnit, relative, isTransformRelated, transformPropTween, cache, smooth, hasPriority, inlineProps, finalTransformValue;
36484    _pluginInitted || _initCore();
36485    this.styles = this.styles || _getStyleSaver(target);
36486    inlineProps = this.styles.props;
36487    this.tween = tween;
36488    for (p in vars) {
36489      if (p === "autoRound") {
36490        continue;
36491      }
36492      endValue = vars[p];
36493      if (_plugins[p] && _checkPlugin(p, vars, tween, index, target, targets)) {
36494        continue;
36495      }
36496      type = typeof endValue;
36497      specialProp = _specialProps[p];
36498      if (type === "function") {
36499        endValue = endValue.call(tween, index, target, targets);
36500        type = typeof endValue;
36501      }
36502      if (type === "string" && ~endValue.indexOf("random(")) {
36503        endValue = _replaceRandom(endValue);
36504      }
36505      if (specialProp) {
36506        specialProp(this, target, p, endValue, tween) && (hasPriority = 1);
36507      } else if (p.substr(0, 2) === "--") {
36508        startValue = (getComputedStyle(target).getPropertyValue(p) + "").trim();
36509        endValue += "";
36510        _colorExp.lastIndex = 0;
36511        if (!_colorExp.test(startValue)) {
36512          startUnit = getUnit(startValue);
36513          endUnit = getUnit(endValue);
36514          endUnit ? startUnit !== endUnit && (startValue = _convertToUnit(target, p, startValue, endUnit) + endUnit) : startUnit && (endValue += startUnit);
36515        }
36516        this.add(style, "setProperty", startValue, endValue, index, targets, 0, 0, p);
36517        props.push(p);
36518        inlineProps.push(p, 0, style[p]);
36519      } else if (type !== "undefined") {
36520        if (startAt && p in startAt) {
36521          startValue = typeof startAt[p] === "function" ? startAt[p].call(tween, index, target, targets) : startAt[p];
36522          _isString(startValue) && ~startValue.indexOf("random(") && (startValue = _replaceRandom(startValue));
36523          getUnit(startValue + "") || startValue === "auto" || (startValue += _config.units[p] || getUnit(_get(target, p)) || "");
36524          (startValue + "").charAt(1) === "=" && (startValue = _get(target, p));
36525        } else {
36526          startValue = _get(target, p);
36527        }
36528        startNum = parseFloat(startValue);
36529        relative = type === "string" && endValue.charAt(1) === "=" && endValue.substr(0, 2);
36530        relative && (endValue = endValue.substr(2));
36531        endNum = parseFloat(endValue);
36532        if (p in _propertyAliases) {
36533          if (p === "autoAlpha") {
36534            if (startNum === 1 && _get(target, "visibility") === "hidden" && endNum) {
36535              startNum = 0;
36536            }
36537            inlineProps.push("visibility", 0, style.visibility);
36538            _addNonTweeningPT(this, style, "visibility", startNum ? "inherit" : "hidden", endNum ? "inherit" : "hidden", !endNum);
36539          }
36540          if (p !== "scale" && p !== "transform") {
36541            p = _propertyAliases[p];
36542            ~p.indexOf(",") && (p = p.split(",")[0]);
36543          }
36544        }
36545        isTransformRelated = p in _transformProps;
36546        if (isTransformRelated) {
36547          this.styles.save(p);
36548          finalTransformValue = endValue;
36549          if (type === "string" && endValue.substring(0, 6) === "var(--") {
36550            endValue = _getComputedProperty(target, endValue.substring(4, endValue.indexOf(")")));
36551            if (endValue.substring(0, 5) === "calc(") {
36552              var origPerspective = target.style.perspective;
36553              target.style.perspective = endValue;
36554              endValue = _getComputedProperty(target, "perspective");
36555              origPerspective ? target.style.perspective = origPerspective : _removeProperty(target, "perspective");
36556            }
36557            endNum = parseFloat(endValue);
36558          }
36559          if (!transformPropTween) {
36560            cache = target._gsap;
36561            cache.renderTransform && !vars.parseTransform || _parseTransform(target, vars.parseTransform);
36562            smooth = vars.smoothOrigin !== false && cache.smooth;
36563            transformPropTween = this._pt = new PropTween(this._pt, style, _transformProp, 0, 1, cache.renderTransform, cache, 0, -1);
36564            transformPropTween.dep = 1;
36565          }
36566          if (p === "scale") {
36567            this._pt = new PropTween(this._pt, cache, "scaleY", cache.scaleY, (relative ? _parseRelative(cache.scaleY, relative + endNum) : endNum) - cache.scaleY || 0, _renderCSSProp);
36568            this._pt.u = 0;
36569            props.push("scaleY", p);
36570            p += "X";
36571          } else if (p === "transformOrigin") {
36572            inlineProps.push(_transformOriginProp, 0, style[_transformOriginProp]);
36573            endValue = _convertKeywordsToPercentages(endValue);
36574            if (cache.svg) {
36575              _applySVGOrigin(target, endValue, 0, smooth, 0, this);
36576            } else {
36577              endUnit = parseFloat(endValue.split(" ")[2]) || 0;
36578              endUnit !== cache.zOrigin && _addNonTweeningPT(this, cache, "zOrigin", cache.zOrigin, endUnit);
36579              _addNonTweeningPT(this, style, p, _firstTwoOnly(startValue), _firstTwoOnly(endValue));
36580            }
36581            continue;
36582          } else if (p === "svgOrigin") {
36583            _applySVGOrigin(target, endValue, 1, smooth, 0, this);
36584            continue;
36585          } else if (p in _rotationalProperties) {
36586            _addRotationalPropTween(this, cache, p, startNum, relative ? _parseRelative(startNum, relative + endValue) : endValue);
36587            continue;
36588          } else if (p === "smoothOrigin") {
36589            _addNonTweeningPT(this, cache, "smooth", cache.smooth, endValue);
36590            continue;
36591          } else if (p === "force3D") {
36592            cache[p] = endValue;
36593            continue;
36594          } else if (p === "transform") {
36595            _addRawTransformPTs(this, endValue, target);
36596            continue;
36597          }
36598        } else if (!(p in style)) {
36599          p = _checkPropPrefix(p) || p;
36600        }
36601        if (isTransformRelated || (endNum || endNum === 0) && (startNum || startNum === 0) && !_complexExp.test(endValue) && p in style) {
36602          startUnit = (startValue + "").substr((startNum + "").length);
36603          endNum || (endNum = 0);
36604          endUnit = getUnit(endValue) || (p in _config.units ? _config.units[p] : startUnit);
36605          startUnit !== endUnit && (startNum = _convertToUnit(target, p, startValue, endUnit));
36606          this._pt = new PropTween(this._pt, isTransformRelated ? cache : style, p, startNum, (relative ? _parseRelative(startNum, relative + endNum) : endNum) - startNum, !isTransformRelated && (endUnit === "px" || p === "zIndex") && vars.autoRound !== false ? _renderRoundedCSSProp : _renderCSSProp);
36607          this._pt.u = endUnit || 0;
36608          if (isTransformRelated && finalTransformValue !== endValue) {
36609            this._pt.b = startValue;
36610            this._pt.e = finalTransformValue;
36611            this._pt.r = _renderCSSPropWithBeginningAndEnd;
36612          } else if (startUnit !== endUnit && endUnit !== "%") {
36613            this._pt.b = startValue;
36614            this._pt.r = _renderCSSPropWithBeginning;
36615          }
36616        } else if (!(p in style)) {
36617          if (p in target) {
36618            this.add(target, p, startValue || target[p], relative ? relative + endValue : endValue, index, targets);
36619          } else if (p !== "parseTransform") {
36620            _missingPlugin(p, endValue);
36621            continue;
36622          }
36623        } else {
36624          _tweenComplexCSSString.call(this, target, p, startValue, relative ? relative + endValue : endValue);
36625        }
36626        isTransformRelated || (p in style ? inlineProps.push(p, 0, style[p]) : typeof target[p] === "function" ? inlineProps.push(p, 2, target[p]()) : inlineProps.push(p, 1, startValue || target[p]));
36627        props.push(p);
36628      }
36629    }
36630    hasPriority && _sortPropTweensByPriority(this);
36631  },
36632  render: function render(ratio, data) {
36633    if (data.tween._time || !_reverting2()) {
36634      var pt = data._pt;
36635      while (pt) {
36636        pt.r(ratio, pt.d);
36637        pt = pt._next;
36638      }
36639    } else {
36640      data.styles.revert();
36641    }
36642  },
36643  get: _get,
36644  aliases: _propertyAliases,
36645  getSetter: function getSetter(target, property, plugin) {
36646    var p = _propertyAliases[property];
36647    p && p.indexOf(",") < 0 && (property = p);
36648    return property in _transformProps && property !== _transformOriginProp && (target._gsap.x || _get(target, "x")) ? plugin && _recentSetterPlugin === plugin ? property === "scale" ? _setterScale : _setterTransform : (_recentSetterPlugin = plugin || {}) && (property === "scale" ? _setterScaleWithRender : _setterTransformWithRender) : target.style && !_isUndefined(target.style[property]) ? _setterCSSStyle : ~property.indexOf("-") ? _setterCSSProp : _getSetter(target, property);
36649  },
36650  core: {
36651    _removeProperty,
36652    _getMatrix
36653  }
36654};
36655gsap.utils.checkPrefix = _checkPropPrefix;
36656gsap.core.getStyleSaver = _getStyleSaver;
36657(function(positionAndScale, rotation, others, aliases) {
36658  var all2 = _forEachName(positionAndScale + "," + rotation + "," + others, function(name) {
36659    _transformProps[name] = 1;
36660  });
36661  _forEachName(rotation, function(name) {
36662    _config.units[name] = "deg";
36663    _rotationalProperties[name] = 1;
36664  });
36665  _propertyAliases[all2[13]] = positionAndScale + "," + rotation;
36666  _forEachName(aliases, function(name) {
36667    var split = name.split(":");
36668    _propertyAliases[split[1]] = all2[split[0]];
36669  });
36670})("x,y,z,scale,scaleX,scaleY,xPercent,yPercent", "rotation,rotationX,rotationY,skewX,skewY", "transform,transformOrigin,svgOrigin,force3D,smoothOrigin,transformPerspective", "0:translateX,1:translateY,2:translateZ,8:rotate,8:rotationZ,8:rotateZ,9:rotateX,10:rotateY");
36671_forEachName("x,y,z,top,right,bottom,left,width,height,fontSize,padding,margin,perspective", function(name) {
36672  _config.units[name] = "px";
36673});
36674gsap.registerPlugin(CSSPlugin);
36675

vendor: 135 bytes, lines 36676-36679

36676// node_modules/gsap/index.js
36677var gsapWithCSS = gsap.registerPlugin(CSSPlugin) || gsap;
36678var TweenMaxWithCSS = gsapWithCSS.core.Tween;
36679

36680// app/javascript/theme/stickers.js
36681var ready3 = function() {
36682  if (import_jquery4.default(".stickers.index").length === 0) {
36683    return;
36684  }
36685  var $postits = import_jquery4.default(".stickers__postit");
36686  var $photos = import_jquery4.default(".stickers__photo");
36687  var postitsL = $postits.length;
36688  var organizedEls = [];
36689  organizedEls.push($photos[0]);
36690  [].shift.call($photos);
36691  organizedEls.push($postits[0]);
36692  [].shift.call($postits);
36693  for (var i = 0;i < postitsL; i++) {
36694    organizedEls.push($photos[0]);
36695    [].shift.call($photos);
36696    organizedEls.push($postits[0]);
36697    [].shift.call($postits);
36698  }
36699  import_jquery4.default(".stickers-container").html(organizedEls).addClass("ready");
36700  var controllerStickers = new import_scrollmagic.default.Controller({
36701    globalSceneOptions: {
36702      triggerHook: "onEnter",
36703      offset: -300
36704    }
36705  });
36706  var sticks = import_jquery4.default(".stickers-container > *").not(".stickers__button");
36707  var scenes = [];
36708  for (var i = 0;i < sticks.length; i++) {
36709    var yTrans, xTrans;
36710    if (i % 20 == 0) {
36711      yTrans = -430;
36712      xTrans = -430;
36713    } else if (i % 20 == 1) {
36714      yTrans = -110;
36715      xTrans = -430;
36716    } else if (i % 20 == 2) {
36717      yTrans = 0;
36718      xTrans = -430;
36719    } else if (i % 20 == 7) {
36720      yTrans = 250;
36721      xTrans = -430;
36722    } else if (i % 20 == 13) {
36723      yTrans = 160;
36724      xTrans = -430;
36725    } else if (i % 20 == 5) {
36726      yTrans = -430;
36727      xTrans = -250;
36728    } else if (i % 20 == 6) {
36729      yTrans = -430;
36730      xTrans = 0;
36731    } else if (i % 20 == 10) {
36732      yTrans = -430;
36733      xTrans = 110;
36734    } else if (i % 20 == 14) {
36735      yTrans = -430;
36736      xTrans = 160;
36737    } else if (i % 20 == 9) {
36738      yTrans = -430;
36739      xTrans = 160;
36740    } else if (i % 20 == 3) {
36741      yTrans = -110;
36742      xTrans = 160;
36743    } else if (i % 20 == 11) {
36744      yTrans = 0;
36745      xTrans = 160;
36746    } else if (i % 20 == 12) {
36747      yTrans = 250;
36748      xTrans = 160;
36749    } else if (i % 20 == 8) {
36750      yTrans = 160;
36751      xTrans = 160;
36752    } else if (i % 20 == 4) {
36753      yTrans = 160;
36754      xTrans = -250;
36755    } else if (i % 20 == 15) {
36756      yTrans = 160;
36757      xTrans = 0;
36758    } else if (i % 20 == 16) {
36759      yTrans = 160;
36760      xTrans = 110;
36761    } else if (i % 20 == 17) {
36762      yTrans = 160;
36763      xTrans = 160;
36764    } else {
36765      yTrans = 160;
36766      xTrans = -430;
36767    }
36768    yTrans = yTrans + Math.floor(Math.random() * 20) + 1;
36769    xTrans = xTrans + Math.floor(Math.random() * 20) + 1;
36770    var vRotate = Math.floor(Math.random() * 10) + 1;
36771    var time = (Math.floor(Math.random() * 6) + 1) / 10 + 0.6;
36772    if (i % 3 == 0) {
36773      vRotate = -vRotate;
36774    }
36775    const element = sticks[i];
36776    scenes[i] = new import_scrollmagic.default.Scene({
36777      triggerElement: element
36778    }).on("enter", function() {
36779      gsapWithCSS.to(element, {
36780        duration: time,
36781        opacity: 1,
36782        rotation: vRotate,
36783        y: yTrans,
36784        x: xTrans,
36785        scale: 1,
36786        ease: "power1.inOut"
36787      });
36788    });
36789  }
36790  controllerStickers.addScene(scenes);
36791};
36792import_jquery4.default(document).on("turbo:load", ready3);
36793

36794// app/javascript/theme/courses.js
36795var import_jquery5 = __toESM(require_jquery());
36796function isCourses() {
36797  return import_jquery5.default(".courses.show").length > 0;
36798}
36799function selectMenu(el) {
36800  var scrollSpyNav = import_jquery5.default("#scrollspy-nav");
36801  scrollSpyNav.find(".active").removeClass("active");
36802  scrollSpyNav.find('a[href="' + el + '"]').addClass("active");
36803}
36804var ready4 = function() {
36805  if (!isCourses()) {
36806    return;
36807  }
36808  var checkSidebar = false;
36809  import_jquery5.default(window).scroll(function() {
36810    if (!isCourses()) {
36811      return;
36812    }
36813    var scroll = import_jquery5.default(window).scrollTop();
36814    if (scroll >= 450) {
36815      import_jquery5.default(".fixed-training-nav").addClass("is-visible");
36816      checkSidebar = true;
36817    }
36818    if (scroll < 450) {
36819      import_jquery5.default(".fixed-training-nav").removeClass("is-visible");
36820      checkSidebar = false;
36821    }
36822    var descriptionPosition = import_jquery5.default("#description").offset().top;
36823    var outlinePosition = import_jquery5.default("#outline").offset().top;
36824    var trainerPosition = import_jquery5.default("#trainer").offset().top;
36825    if (scroll > descriptionPosition) {
36826      selectMenu("#description");
36827    }
36828    if (scroll > outlinePosition - 150) {
36829      selectMenu("#outline");
36830    }
36831    if (scroll > trainerPosition - 150) {
36832      selectMenu("#trainer");
36833    }
36834    if (import_jquery5.default("#quotes").length > 0) {
36835      var quotesPosition = import_jquery5.default("#quotes").offset().top;
36836      if (scroll > quotesPosition - 150) {
36837        selectMenu("#quotes");
36838      }
36839    }
36840    if (checkSidebar) {
36841      var footertotop = import_jquery5.default("#footer").position().top;
36842      var sidebarH = import_jquery5.default(".sidebar").height();
36843      var scrolltop = import_jquery5.default(document).scrollTop() + sidebarH;
36844      if (scrolltop > footertotop) {
36845        import_jquery5.default(".sidebar").addClass("is-absolute");
36846      } else {
36847        import_jquery5.default(".sidebar").removeClass("is-absolute");
36848      }
36849    }
36850  });
36851};
36852import_jquery5.default(document).on("turbo:load", ready4);
36853

36854// app/javascript/theme/quotes_carousel.js
36855document.addEventListener("turbo:load", function() {
36856  const isMobile = window.innerWidth <= 768 || /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent);
36857  if (isMobile)
36858    return;
36859  const carousels = document.querySelectorAll(".quotes-carousel");
36860  carousels.forEach((carousel, index) => {
36861    const quotes = carousel.querySelectorAll(".quote");
36862    if (quotes.length === 0)
36863      return;
36864    const clonedQuotes = Array.from(quotes).map((quote) => quote.cloneNode(true));
36865    clonedQuotes.forEach((clone2) => carousel.appendChild(clone2));
36866    const direction = index === 0 ? "left-to-right" : "right-to-left";
36867    carousel.classList.add(`scroll-${direction}`);
36868    if (direction === "right-to-left") {
36869      setTimeout(() => {
36870        const maxScroll = carousel.scrollWidth - carousel.clientWidth;
36871        carousel.scrollLeft = maxScroll;
36872      }, 100);
36873    }
36874    let isAnimating = true;
36875    let animationId;
36876    function startAnimation() {
36877      if (!isAnimating)
36878        return;
36879      const scrollSpeed = 0.5;
36880      const currentScroll = carousel.scrollLeft;
36881      const maxScroll = carousel.scrollWidth - carousel.clientWidth;
36882      if (direction === "left-to-right") {
36883        carousel.scrollLeft = currentScroll >= maxScroll ? 0 : currentScroll + scrollSpeed;
36884      } else {
36885        carousel.scrollLeft = currentScroll <= 0 ? maxScroll : currentScroll - scrollSpeed;
36886      }
36887      animationId = requestAnimationFrame(startAnimation);
36888    }
36889    function pauseAnimation() {
36890      isAnimating = false;
36891      if (animationId) {
36892        cancelAnimationFrame(animationId);
36893      }
36894    }
36895    function resumeAnimation() {
36896      isAnimating = true;
36897      startAnimation();
36898    }
36899    carousel.addEventListener("mouseenter", pauseAnimation);
36900    carousel.addEventListener("mouseleave", resumeAnimation);
36901    setTimeout(() => {
36902      startAnimation();
36903    }, 200);
36904    document.addEventListener("visibilitychange", function() {
36905      if (document.hidden) {
36906        pauseAnimation();
36907      } else {
36908        resumeAnimation();
36909      }
36910    });
36911    window.addEventListener("resize", function() {
36912      const isNowMobile = window.innerWidth <= 768;
36913      if (isNowMobile) {
36914        pauseAnimation();
36915      } else {
36916        resumeAnimation();
36917      }
36918    });
36919  });
36920});
36921

36922// app/javascript/terminal_config.js
36923var import_jquery6 = __toESM(require_jquery());
36924var import_jquery7 = __toESM(require_jquery_terminal());
36925document.addEventListener("turbo:load", function() {
36926  if (import_jquery6.default("body").hasClass("home")) {
36927    let typed = function(finish_typing) {
36928      return function(term2, message, delay, finish2) {
36929        anim = true;
36930        var prompt = term2.get_prompt();
36931        var c = 0;
36932        if (message.length > 0) {
36933          term2.set_prompt("");
36934          var interval = setInterval(function() {
36935            term2.insert(message[c++]);
36936            if (c == message.length) {
36937              clearInterval(interval);
36938              setTimeout(function() {
36939                finish_typing(term2, message, prompt);
36940                anim = false;
36941                finish2 && finish2();
36942              }, delay);
36943            }
36944          }, delay);
36945        }
36946      };
36947    };
36948    var splash = "[[;springgreen;]" + "";
36949    splash += `  _    _                                _____          _               
36950`;
36951    splash += ` | |  | |                              / ____|        | |              
36952`;
36953    splash += ` | |__| |_   _ _ __ ___   __ _ _ __   | |     ___   __| | ___ _ __ ___ 
36954`;
36955    splash += " |  __  | | | | '_ ` _ \\ / _` | '_ \\  | |    / _ \\ / _` |/ _ \\ '__/ __|\n";
36956    splash += ` | |  | | |_| | | | | | | (_| | | | | | |___| (_) | (_| |  __/ |  \\__ \\ 
36957`;
36958    splash += ` |_|  |_|\\__,_|_| |_| |_|\\__,_|_| |_|  \\_____\\___/ \\__,_|\\___|_|  |___/
36959`;
36960    splash += `
36961`;
36962    var anim = false;
36963    var typed_prompt = typed(function(term2, message, prompt) {
36964      term2.set_command("");
36965      term2.set_prompt(message + " ");
36966    });
36967    var typed_message = typed(function(term2, message, prompt) {
36968      term2.set_command("");
36969      term2.echo(message);
36970      term2.set_prompt(prompt);
36971    });
36972    window.terminalInit = function() {
36973      import_jquery6.default("#term_demo").terminal(function(command, term2) {
36974        var finish2 = false;
36975        if (command == "test") {
36976          term2.error("Pas trÃ¨s original... essaye encore !");
36977        } else if (command === "help") {
36978          term2.echo(`
36979Commandes disponibles:
36980
36981`);
36982          term2.echo("[[gb;<COLOR>;]clear] - Efface l'Ã©cran");
36983          term2.echo("[[gb;<COLOR>;]contact] - Affiche diffÃ©rents moyens de discuter avec nous");
36984          term2.echo("[[gb;<COLOR>;]love] - <3");
36985          term2.echo("[[gb;<COLOR>;]splash] - Affiche le splash screen");
36986        } else if (command == "contact") {
36987          term2.echo("Ecris-nous !");
36988          term2.echo('Email: <a href="mailto:[email protected]">[email protected]</a><br />', { raw: true });
36989          term2.echo('Phone: <a href="tel:+33-1-84-17-38-96">+33(0)1&nbsp;84&nbsp;17&nbsp;38&nbsp;96</a><br />', { raw: true });
36990          term2.echo('Twitter: <a href="https://x.com/humancoders">@humancoders</a><br />', { raw: true });
36991          term2.echo('LinkedIn: <a href="https://www.linkedin.com/company/2487898">Human Coders</a><br />', { raw: true });
36992          term2.echo('Facebook: <a href="https://www.facebook.com/humancoders/">Human Coders</a><br />', { raw: true });
36993        } else if (command === "love") {
36994          term2.echo("<3");
36995          window.open("/stickers", "_blank");
36996        } else if (command === "ls") {
36997          term2.error("C'est malin... mais ce n'est qu'un Ã©mulateur !");
36998        } else if (command === "dir") {
36999          term2.error("Il y a encore des gens qui utilisent Ã§a ??");
37000        } else if (command === "splash") {
37001          term2.echo(splash);
37002        } else {
37003          term2.error(command + ": Cette commande n'existe pas");
37004        }
37005      }, {
37006        name: "human_coders",
37007        height: 300,
37008        prompt: "www.humancoders.com$ ",
37009        greetings: false,
37010        onInit: function(term2) {
37011          var msg = "Connexion Ã  la console Human Coders...";
37012          typed_message(term2, msg, 50, function() {
37013            finish = true;
37014          });
37015          term2.echo(splash);
37016          term2.echo("<br />Tapez 'help' pour lister les commandes disponibles<br />", { raw: true });
37017        },
37018        onClear: function(term2) {
37019          term2.echo(splash);
37020          term2.echo("<br />Tapez 'help' pour lister les commandes disponibles<br />", { raw: true });
37021        },
37022        keydown: function(e) {
37023          if (anim) {
37024            return false;

37025          }
37026        }
37027      });
37028    };
37029  }
37030});
37031

37032// app/javascript/trainer_admin.js
37033var import_jquery8 = __toESM(require_jquery());
37034document.addEventListener("turbo:load", function() {
37035  import_jquery8.default('[data-toggle="tooltip"]').tooltip();
37036  import_jquery8.default("button[data-copy-emails]").click(function(e) {
37037    e.preventDefault();
37038    var emails = import_jquery8.default(this).data("copy-emails");
37039    if (navigator.clipboard && window.isSecureContext) {
37040      navigator.clipboard.writeText(emails).then(function() {
37041        showCopyAlert();
37042      }).catch(function() {
37043        fallbackCopyTextToClipboard(emails);
37044      });
37045    } else {
37046      fallbackCopyTextToClipboard(emails);
37047    }
37048  });
37049  function fallbackCopyTextToClipboard(text2) {
37050    var textArea = document.createElement("textarea");
37051    textArea.value = text2;
37052    textArea.style.position = "fixed";
37053    textArea.style.left = "-999999px";
37054    textArea.style.top = "-999999px";
37055    document.body.appendChild(textArea);
37056    textArea.focus();
37057    textArea.select();
37058    try {
37059      document.execCommand("copy");
37060      showCopyAlert();
37061    } catch (err) {
37062      console.error("Fallback: Unable to copy", err);
37063    }
37064    document.body.removeChild(textArea);
37065  }
37066  function showCopyAlert() {
37067    var alertHtml = '<div class="alert alert-success alert-dismissible fade show" role="alert">' + "Le(s) contact(s) ont bien Ã©tÃ© copiÃ©" + '<button type="button" class="close" data-dismiss="alert" aria-label="Close">' + '<span aria-hidden="true">&times;</span>' + "</button>" + "</div>";
37068    import_jquery8.default(".alert-container").html(alertHtml);
37069    setTimeout(function() {
37070      import_jquery8.default(".alert-container .alert").alert("close");
37071    }, 3000);
37072  }
37073});
37074document.addEventListener("turbo:before-cache", function() {
37075  import_jquery8.default('[data-toggle="tooltip"]').tooltip("dispose");
37076});
37077

37078// app/javascript/attendee.js
37079var import_jquery9 = __toESM(require_jquery());
37080document.addEventListener("turbo:load", function() {
37081  if (import_jquery9.default("body").hasClass("before_session_self_ratings")) {
37082    import_jquery9.default(document).on("click", "#accesibility", function() {
37083      import_jquery9.default("#accessibility_text_area").removeClass("hidden");
37084    });
37085    import_jquery9.default(document).on("change", ".ai-tools-checkbox", function() {
37086      if (import_jquery9.default(this).is(":checked")) {
37087        import_jquery9.default(".evaluation_question_8").removeClass("hidden");
37088        import_jquery9.default(".ai-tools-hidden-field").val("true");
37089      } else {
37090        import_jquery9.default(".evaluation_question_8").addClass("hidden");
37091        import_jquery9.default("#ai_tools_text_area").val("");
37092        import_jquery9.default(".ai-tools-hidden-field").val("false");
37093      }
37094    });
37095  }
37096});
37097

vendor: 15,944 bytes, lines 37098-37568

37098// node_modules/@algolia/client-common/dist/common.js
37099function createBrowserLocalStorageCache(options2) {
37100  let storage;
37101  const namespaceKey = `algolia-client-js-${options2.key}`;
37102  function getStorage() {
37103    if (storage === undefined) {
37104      storage = options2.localStorage || window.localStorage;
37105    }
37106    return storage;
37107  }
37108  function getNamespace() {
37109    return JSON.parse(getStorage().getItem(namespaceKey) || "{}");
37110  }
37111  function setNamespace(namespace) {
37112    getStorage().setItem(namespaceKey, JSON.stringify(namespace));
37113  }
37114  function removeOutdatedCacheItems() {
37115    const timeToLive = options2.timeToLive ? options2.timeToLive * 1000 : null;
37116    const namespace = getNamespace();
37117    const filteredNamespaceWithoutOldFormattedCacheItems = Object.fromEntries(Object.entries(namespace).filter(([, cacheItem]) => {
37118      return cacheItem.timestamp !== undefined;
37119    }));
37120    setNamespace(filteredNamespaceWithoutOldFormattedCacheItems);
37121    if (!timeToLive) {
37122      return;
37123    }
37124    const filteredNamespaceWithoutExpiredItems = Object.fromEntries(Object.entries(filteredNamespaceWithoutOldFormattedCacheItems).filter(([, cacheItem]) => {
37125      const currentTimestamp = (/* @__PURE__ */ new Date()).getTime();
37126      const isExpired = cacheItem.timestamp + timeToLive < currentTimestamp;
37127      return !isExpired;
37128    }));
37129    setNamespace(filteredNamespaceWithoutExpiredItems);
37130  }
37131  return {
37132    get(key, defaultValue, events = {
37133      miss: () => Promise.resolve()
37134    }) {
37135      return Promise.resolve().then(() => {
37136        removeOutdatedCacheItems();
37137        return getNamespace()[JSON.stringify(key)];
37138      }).then((value) => {
37139        return Promise.all([value ? value.value : defaultValue(), value !== undefined]);
37140      }).then(([value, exists]) => {
37141        return Promise.all([value, exists || events.miss(value)]);
37142      }).then(([value]) => value);
37143    },
37144    set(key, value) {
37145      return Promise.resolve().then(() => {
37146        const namespace = getNamespace();
37147        namespace[JSON.stringify(key)] = {
37148          timestamp: (/* @__PURE__ */ new Date()).getTime(),
37149          value
37150        };
37151        getStorage().setItem(namespaceKey, JSON.stringify(namespace));
37152        return value;
37153      });
37154    },
37155    delete(key) {
37156      return Promise.resolve().then(() => {
37157        const namespace = getNamespace();
37158        delete namespace[JSON.stringify(key)];
37159        getStorage().setItem(namespaceKey, JSON.stringify(namespace));
37160      });
37161    },
37162    clear() {
37163      return Promise.resolve().then(() => {
37164        getStorage().removeItem(namespaceKey);
37165      });
37166    }
37167  };
37168}
37169function createNullCache() {
37170  return {
37171    get(_key, defaultValue, events = {
37172      miss: () => Promise.resolve()
37173    }) {
37174      const value = defaultValue();
37175      return value.then((result) => Promise.all([result, events.miss(result)])).then(([result]) => result);
37176    },
37177    set(_key, value) {
37178      return Promise.resolve(value);
37179    },
37180    delete(_key) {
37181      return Promise.resolve();
37182    },
37183    clear() {
37184      return Promise.resolve();
37185    }
37186  };
37187}
37188function createFallbackableCache(options2) {
37189  const caches = [...options2.caches];
37190  const current = caches.shift();
37191  if (current === undefined) {
37192    return createNullCache();
37193  }
37194  return {
37195    get(key, defaultValue, events = {
37196      miss: () => Promise.resolve()
37197    }) {
37198      return current.get(key, defaultValue, events).catch(() => {
37199        return createFallbackableCache({ caches }).get(key, defaultValue, events);
37200      });
37201    },
37202    set(key, value) {
37203      return current.set(key, value).catch(() => {
37204        return createFallbackableCache({ caches }).set(key, value);
37205      });
37206    },
37207    delete(key) {
37208      return current.delete(key).catch(() => {
37209        return createFallbackableCache({ caches }).delete(key);
37210      });
37211    },
37212    clear() {
37213      return current.clear().catch(() => {
37214        return createFallbackableCache({ caches }).clear();
37215      });
37216    }
37217  };
37218}
37219function createMemoryCache(options2 = { serializable: true }) {
37220  let cache = {};
37221  return {
37222    get(key, defaultValue, events = {
37223      miss: () => Promise.resolve()
37224    }) {
37225      const keyAsString = JSON.stringify(key);
37226      if (keyAsString in cache) {
37227        return Promise.resolve(options2.serializable ? JSON.parse(cache[keyAsString]) : cache[keyAsString]);
37228      }
37229      const promise = defaultValue();
37230      return promise.then((value) => events.miss(value)).then(() => promise);
37231    },
37232    set(key, value) {
37233      cache[JSON.stringify(key)] = options2.serializable ? JSON.stringify(value) : value;
37234      return Promise.resolve(value);
37235    },
37236    delete(key) {
37237      delete cache[JSON.stringify(key)];
37238      return Promise.resolve();
37239    },
37240    clear() {
37241      cache = {};
37242      return Promise.resolve();
37243    }
37244  };
37245}
37246function createAlgoliaAgent(version) {
37247  const algoliaAgent = {
37248    value: `Algolia for JavaScript (${version})`,
37249    add(options2) {
37250      const addedAlgoliaAgent = `; ${options2.segment}${options2.version !== undefined ? ` (${options2.version})` : ""}`;
37251      if (algoliaAgent.value.indexOf(addedAlgoliaAgent) === -1) {
37252        algoliaAgent.value = `${algoliaAgent.value}${addedAlgoliaAgent}`;
37253      }
37254      return algoliaAgent;
37255    }
37256  };
37257  return algoliaAgent;
37258}
37259function createAuth(appId, apiKey, authMode = "WithinHeaders") {
37260  const credentials = {
37261    "x-algolia-api-key": apiKey,
37262    "x-algolia-application-id": appId
37263  };
37264  return {
37265    headers() {
37266      return authMode === "WithinHeaders" ? credentials : {};
37267    },
37268    queryParameters() {
37269      return authMode === "WithinQueryParameters" ? credentials : {};
37270    }
37271  };
37272}
37273function getAlgoliaAgent({ algoliaAgents, client, version }) {
37274  const defaultAlgoliaAgent = createAlgoliaAgent(version).add({
37275    segment: client,
37276    version
37277  });
37278  algoliaAgents.forEach((algoliaAgent) => defaultAlgoliaAgent.add(algoliaAgent));
37279  return defaultAlgoliaAgent;
37280}
37281function createNullLogger() {
37282  return {
37283    debug(_message, _args) {
37284      return Promise.resolve();
37285    },
37286    info(_message, _args) {
37287      return Promise.resolve();
37288    },
37289    error(_message, _args) {
37290      return Promise.resolve();
37291    }
37292  };
37293}
37294var EXPIRATION_DELAY = 2 * 60 * 1000;
37295function createStatefulHost(host, status = "up") {
37296  const lastUpdate = Date.now();
37297  function isUp() {
37298    return status === "up" || Date.now() - lastUpdate > EXPIRATION_DELAY;
37299  }
37300  function isTimedOut() {
37301    return status === "timed out" && Date.now() - lastUpdate <= EXPIRATION_DELAY;
37302  }
37303  return { ...host, status, lastUpdate, isUp, isTimedOut };
37304}
37305var AlgoliaError = class extends Error {
37306  name = "AlgoliaError";
37307  constructor(message, name) {
37308    super(message);
37309    if (name) {
37310      this.name = name;
37311    }
37312  }
37313};
37314var ErrorWithStackTrace = class extends AlgoliaError {
37315  stackTrace;
37316  constructor(message, stackTrace, name) {
37317    super(message, name);
37318    this.stackTrace = stackTrace;
37319  }
37320};
37321var RetryError = class extends ErrorWithStackTrace {
37322  constructor(stackTrace) {
37323    super("Unreachable hosts - your application id may be incorrect. If the error persists, please visit our help center https://alg.li/support-unreachable-hosts or reach out to the Algolia Support team: https://alg.li/support", stackTrace, "RetryError");
37324  }
37325};
37326var ApiError = class extends ErrorWithStackTrace {
37327  status;
37328  constructor(message, status, stackTrace, name = "ApiError") {
37329    super(message, stackTrace, name);
37330    this.status = status;
37331  }
37332};
37333var DeserializationError = class extends AlgoliaError {
37334  response;
37335  constructor(message, response) {
37336    super(message, "DeserializationError");
37337    this.response = response;
37338  }
37339};
37340var DetailedApiError = class extends ApiError {
37341  error;
37342  constructor(message, status, error, stackTrace) {
37343    super(message, status, stackTrace, "DetailedApiError");
37344    this.error = error;
37345  }
37346};
37347function shuffle2(array) {
37348  const shuffledArray = array;
37349  for (let c = array.length - 1;c > 0; c--) {
37350    const b = Math.floor(Math.random() * (c + 1));
37351    const a = array[c];
37352    shuffledArray[c] = array[b];
37353    shuffledArray[b] = a;
37354  }
37355  return shuffledArray;
37356}
37357function serializeUrl(host, path, queryParameters) {
37358  const queryParametersAsString = serializeQueryParameters(queryParameters);
37359  let url = `${host.protocol}://${host.url}${host.port ? `:${host.port}` : ""}/${path.charAt(0) === "/" ? path.substring(1) : path}`;
37360  if (queryParametersAsString.length) {
37361    url += `?${queryParametersAsString}`;
37362  }
37363  return url;
37364}
37365function serializeQueryParameters(parameters) {
37366  return Object.keys(parameters).filter((key) => parameters[key] !== undefined).sort().map((key) => `${key}=${encodeURIComponent(Object.prototype.toString.call(parameters[key]) === "[object Array]" ? parameters[key].join(",") : parameters[key]).replace(/\+/g, "%20")}`).join("&");
37367}
37368function serializeData(request, requestOptions) {
37369  if (request.method === "GET" || request.data === undefined && requestOptions.data === undefined) {
37370    return;
37371  }
37372  const data = Array.isArray(request.data) ? request.data : { ...request.data, ...requestOptions.data };
37373  return JSON.stringify(data);
37374}
37375function serializeHeaders(baseHeaders, requestHeaders, requestOptionsHeaders) {
37376  const headers = {
37377    Accept: "application/json",
37378    ...baseHeaders,
37379    ...requestHeaders,
37380    ...requestOptionsHeaders
37381  };
37382  const serializedHeaders = {};
37383  Object.keys(headers).forEach((header) => {
37384    const value = headers[header];
37385    serializedHeaders[header.toLowerCase()] = value;
37386  });
37387  return serializedHeaders;
37388}
37389function deserializeSuccess(response) {
37390  try {
37391    return JSON.parse(response.content);
37392  } catch (e) {
37393    throw new DeserializationError(e.message, response);
37394  }
37395}
37396function deserializeFailure({ content, status }, stackFrame) {
37397  try {
37398    const parsed = JSON.parse(content);
37399    if ("error" in parsed) {
37400      return new DetailedApiError(parsed.message, status, parsed.error, stackFrame);
37401    }
37402    return new ApiError(parsed.message, status, stackFrame);
37403  } catch {}
37404  return new ApiError(content, status, stackFrame);
37405}
37406function isNetworkError({ isTimedOut, status }) {
37407  return !isTimedOut && ~~status === 0;
37408}
37409function isRetryable({ isTimedOut, status }) {
37410  return isTimedOut || isNetworkError({ isTimedOut, status }) || ~~(status / 100) !== 2 && ~~(status / 100) !== 4;
37411}
37412function isSuccess({ status }) {
37413  return ~~(status / 100) === 2;
37414}
37415function stackTraceWithoutCredentials(stackTrace) {
37416  return stackTrace.map((stackFrame) => stackFrameWithoutCredentials(stackFrame));
37417}
37418function stackFrameWithoutCredentials(stackFrame) {
37419  const modifiedHeaders = stackFrame.request.headers["x-algolia-api-key"] ? { "x-algolia-api-key": "*****" } : {};
37420  return {
37421    ...stackFrame,
37422    request: {
37423      ...stackFrame.request,
37424      headers: {
37425        ...stackFrame.request.headers,
37426        ...modifiedHeaders
37427      }
37428    }
37429  };
37430}
37431function createTransporter({
37432  hosts,
37433  hostsCache,
37434  baseHeaders,
37435  logger,
37436  baseQueryParameters,
37437  algoliaAgent,
37438  timeouts,
37439  requester,
37440  requestsCache,
37441  responsesCache
37442}) {
37443  async function createRetryableOptions(compatibleHosts) {
37444    const statefulHosts = await Promise.all(compatibleHosts.map((compatibleHost) => {
37445      return hostsCache.get(compatibleHost, () => {
37446        return Promise.resolve(createStatefulHost(compatibleHost));
37447      });
37448    }));
37449    const hostsUp = statefulHosts.filter((host) => host.isUp());
37450    const hostsTimedOut = statefulHosts.filter((host) => host.isTimedOut());
37451    const hostsAvailable = [...hostsUp, ...hostsTimedOut];
37452    const compatibleHostsAvailable = hostsAvailable.length > 0 ? hostsAvailable : compatibleHosts;
37453    return {
37454      hosts: compatibleHostsAvailable,
37455      getTimeout(timeoutsCount, baseTimeout) {
37456        const timeoutMultiplier = hostsTimedOut.length === 0 && timeoutsCount === 0 ? 1 : hostsTimedOut.length + 3 + timeoutsCount;
37457        return timeoutMultiplier * baseTimeout;
37458      }
37459    };
37460  }
37461  async function retryableRequest(request, requestOptions, isRead) {
37462    const stackTrace = [];
37463    const data = serializeData(request, requestOptions);
37464    const headers = serializeHeaders(baseHeaders, request.headers, requestOptions.headers);
37465    const dataQueryParameters = request.method === "GET" ? {
37466      ...request.data,
37467      ...requestOptions.data
37468    } : {};
37469    const queryParameters = {
37470      ...baseQueryParameters,
37471      ...request.queryParameters,
37472      ...dataQueryParameters
37473    };
37474    if (algoliaAgent.value) {
37475      queryParameters["x-algolia-agent"] = algoliaAgent.value;
37476    }
37477    if (requestOptions && requestOptions.queryParameters) {
37478      for (const key of Object.keys(requestOptions.queryParameters)) {
37479        if (!requestOptions.queryParameters[key] || Object.prototype.toString.call(requestOptions.queryParameters[key]) === "[object Object]") {
37480          queryParameters[key] = requestOptions.queryParameters[key];
37481        } else {
37482          queryParameters[key] = requestOptions.queryParameters[key].toString();
37483        }
37484      }
37485    }
37486    let timeoutsCount = 0;
37487    const retry = async (retryableHosts, getTimeout) => {
37488      const host = retryableHosts.pop();
37489      if (host === undefined) {
37490        throw new RetryError(stackTraceWithoutCredentials(stackTrace));
37491      }
37492      const timeout = { ...timeouts, ...requestOptions.timeouts };
37493      const payload = {
37494        data,
37495        headers,
37496        method: request.method,
37497        url: serializeUrl(host, request.path, queryParameters),
37498        connectTimeout: getTimeout(timeoutsCount, timeout.connect),
37499        responseTimeout: getTimeout(timeoutsCount, isRead ? timeout.read : timeout.write)
37500      };
37501      const pushToStackTrace = (response2) => {
37502        const stackFrame = {
37503          request: payload,
37504          response: response2,
37505          host,
37506          triesLeft: retryableHosts.length
37507        };
37508        stackTrace.push(stackFrame);
37509        return stackFrame;
37510      };
37511      const response = await requester.send(payload);
37512      if (isRetryable(response)) {
37513        const stackFrame = pushToStackTrace(response);
37514        if (response.isTimedOut) {
37515          timeoutsCount++;
37516        }
37517        logger.info("Retryable failure", stackFrameWithoutCredentials(stackFrame));
37518        await hostsCache.set(host, createStatefulHost(host, response.isTimedOut ? "timed out" : "down"));
37519        return retry(retryableHosts, getTimeout);
37520      }
37521      if (isSuccess(response)) {
37522        return deserializeSuccess(response);
37523      }
37524      pushToStackTrace(response);
37525      throw deserializeFailure(response, stackTrace);
37526    };
37527    const compatibleHosts = hosts.filter((host) => host.accept === "readWrite" || (isRead ? host.accept === "read" : host.accept === "write"));
37528    const options2 = await createRetryableOptions(compatibleHosts);
37529    return retry([...options2.hosts].reverse(), options2.getTimeout);
37530  }
37531  function createRequest(request, requestOptions = {}) {
37532    const createRetryableRequest = () => {
37533      return retryableRequest(request, requestOptions, isRead);
37534    };
37535    const isRead = request.useReadTransporter || request.method === "GET";
37536    const cacheable = requestOptions.cacheable || request.cacheable;
37537    if (cacheable !== true) {
37538      return createRetryableRequest();
37539    }
37540    const key = {
37541      request,
37542      requestOptions,
37543      transporter: {
37544        queryParameters: baseQueryParameters,
37545        headers: baseHeaders
37546      }
37547    };
37548    return responsesCache.get(key, () => {
37549      return requestsCache.get(key, () => requestsCache.set(key, createRetryableRequest()).then((response) => Promise.all([requestsCache.delete(key), response]), (err) => Promise.all([requestsCache.delete(key), Promise.reject(err)])).then(([_, response]) => response));
37550    }, {
37551      miss: (response) => responsesCache.set(key, response)
37552    });
37553  }
37554  return {
37555    hostsCache,
37556    requester,
37557    timeouts,
37558    logger,
37559    algoliaAgent,
37560    baseHeaders,
37561    baseQueryParameters,
37562    hosts,
37563    request: createRequest,
37564    requestsCache,
37565    responsesCache
37566  };
37567}
37568

vendor: 998 bytes, lines 37569-37589

37569// node_modules/@algolia/requester-browser-xhr/dist/requester.xhr.js
37570function m2() {
37571  function r(t) {
37572    return new Promise((s) => {
37573      let e = new XMLHttpRequest;
37574      e.open(t.method, t.url, true), Object.keys(t.headers).forEach((n) => e.setRequestHeader(n, t.headers[n]));
37575      let i = (n, a) => setTimeout(() => {
37576        e.abort(), s({ status: 0, content: a, isTimedOut: true });
37577      }, n), u = i(t.connectTimeout, "Connection timeout"), o;
37578      e.onreadystatechange = () => {
37579        e.readyState > e.OPENED && o === undefined && (clearTimeout(u), o = i(t.responseTimeout, "Socket timeout"));
37580      }, e.onerror = () => {
37581        e.status === 0 && (clearTimeout(u), clearTimeout(o), s({ content: e.responseText || "Network request failed", status: e.status, isTimedOut: false }));
37582      }, e.onload = () => {
37583        clearTimeout(u), clearTimeout(o), s({ content: e.responseText, status: e.status, isTimedOut: false });
37584      }, e.send(t.data);
37585    });
37586  }
37587  return { send: r };
37588}
37589

vendor: 6,006 bytes, lines 37590-37790

37590// node_modules/algoliasearch/dist/lite/builds/browser.js
37591var apiClientVersion = "5.49.0";
37592function getDefaultHosts(appId) {
37593  return [
37594    {
37595      url: `${appId}-dsn.algolia.net`,
37596      accept: "read",
37597      protocol: "https"
37598    },
37599    {
37600      url: `${appId}.algolia.net`,
37601      accept: "write",
37602      protocol: "https"
37603    }
37604  ].concat(shuffle2([
37605    {
37606      url: `${appId}-1.algolianet.com`,
37607      accept: "readWrite",
37608      protocol: "https"
37609    },
37610    {
37611      url: `${appId}-2.algolianet.com`,
37612      accept: "readWrite",
37613      protocol: "https"
37614    },
37615    {
37616      url: `${appId}-3.algolianet.com`,
37617      accept: "readWrite",
37618      protocol: "https"
37619    }
37620  ]));
37621}
37622function createLiteClient({
37623  appId: appIdOption,
37624  apiKey: apiKeyOption,
37625  authMode,
37626  algoliaAgents,
37627  ...options2
37628}) {
37629  const auth = createAuth(appIdOption, apiKeyOption, authMode);
37630  const transporter = createTransporter({
37631    hosts: getDefaultHosts(appIdOption),
37632    ...options2,
37633    algoliaAgent: getAlgoliaAgent({
37634      algoliaAgents,
37635      client: "Lite",
37636      version: apiClientVersion
37637    }),
37638    baseHeaders: {
37639      "content-type": "text/plain",
37640      ...auth.headers(),
37641      ...options2.baseHeaders
37642    },
37643    baseQueryParameters: {
37644      ...auth.queryParameters(),
37645      ...options2.baseQueryParameters
37646    }
37647  });
37648  return {
37649    transporter,
37650    appId: appIdOption,
37651    apiKey: apiKeyOption,
37652    clearCache() {
37653      return Promise.all([transporter.requestsCache.clear(), transporter.responsesCache.clear()]).then(() => {
37654        return;
37655      });
37656    },
37657    get _ua() {
37658      return transporter.algoliaAgent.value;
37659    },
37660    addAlgoliaAgent(segment, version) {
37661      transporter.algoliaAgent.add({ segment, version });
37662    },
37663    setClientApiKey({ apiKey }) {
37664      if (!authMode || authMode === "WithinHeaders") {
37665        transporter.baseHeaders["x-algolia-api-key"] = apiKey;
37666      } else {
37667        transporter.baseQueryParameters["x-algolia-api-key"] = apiKey;
37668      }
37669    },
37670    searchForHits(searchMethodParams, requestOptions) {
37671      return this.search(searchMethodParams, requestOptions);
37672    },
37673    searchForFacets(searchMethodParams, requestOptions) {
37674      return this.search(searchMethodParams, requestOptions);
37675    },
37676    customPost({ path, parameters, body }, requestOptions) {
37677      if (!path) {
37678        throw new Error("Parameter `path` is required when calling `customPost`.");
37679      }
37680      const requestPath = "/{path}".replace("{path}", path);
37681      const headers = {};
37682      const queryParameters = parameters ? parameters : {};
37683      const request = {
37684        method: "POST",
37685        path: requestPath,
37686        queryParameters,
37687        headers,
37688        data: body ? body : {}
37689      };
37690      return transporter.request(request, requestOptions);
37691    },
37692    getRecommendations(getRecommendationsParams, requestOptions) {
37693      if (getRecommendationsParams && Array.isArray(getRecommendationsParams)) {
37694        const newSignatureRequest = {
37695          requests: getRecommendationsParams
37696        };
37697        getRecommendationsParams = newSignatureRequest;
37698      }
37699      if (!getRecommendationsParams) {
37700        throw new Error("Parameter `getRecommendationsParams` is required when calling `getRecommendations`.");
37701      }
37702      if (!getRecommendationsParams.requests) {
37703        throw new Error("Parameter `getRecommendationsParams.requests` is required when calling `getRecommendations`.");
37704      }
37705      const requestPath = "/1/indexes/*/recommendations";
37706      const headers = {};
37707      const queryParameters = {};
37708      const request = {
37709        method: "POST",
37710        path: requestPath,
37711        queryParameters,
37712        headers,
37713        data: getRecommendationsParams,
37714        useReadTransporter: true,
37715        cacheable: true
37716      };
37717      return transporter.request(request, requestOptions);
37718    },
37719    search(searchMethodParams, requestOptions) {
37720      if (searchMethodParams && Array.isArray(searchMethodParams)) {
37721        const newSignatureRequest = {
37722          requests: searchMethodParams.map(({ params, ...legacyRequest }) => {
37723            if (legacyRequest.type === "facet") {
37724              return {
37725                ...legacyRequest,
37726                ...params,
37727                type: "facet"
37728              };
37729            }
37730            return {
37731              ...legacyRequest,
37732              ...params,
37733              facet: undefined,
37734              maxFacetHits: undefined,
37735              facetQuery: undefined
37736            };
37737          })
37738        };
37739        searchMethodParams = newSignatureRequest;
37740      }
37741      if (!searchMethodParams) {
37742        throw new Error("Parameter `searchMethodParams` is required when calling `search`.");
37743      }
37744      if (!searchMethodParams.requests) {
37745        throw new Error("Parameter `searchMethodParams.requests` is required when calling `search`.");
37746      }
37747      const requestPath = "/1/indexes/*/queries";
37748      const headers = {};
37749      const queryParameters = {};
37750      const request = {
37751        method: "POST",
37752        path: requestPath,
37753        queryParameters,
37754        headers,
37755        data: searchMethodParams,
37756        useReadTransporter: true,
37757        cacheable: true
37758      };
37759      return transporter.request(request, requestOptions);
37760    }
37761  };
37762}
37763function liteClient(appId, apiKey, options2) {
37764  if (!appId || typeof appId !== "string") {
37765    throw new Error("`appId` is missing.");
37766  }
37767  if (!apiKey || typeof apiKey !== "string") {
37768    throw new Error("`apiKey` is missing.");
37769  }
37770  return createLiteClient({
37771    appId,
37772    apiKey,
37773    timeouts: {
37774      connect: 1000,
37775      read: 2000,
37776      write: 30000
37777    },
37778    logger: createNullLogger(),
37779    requester: m2(),
37780    algoliaAgents: [{ segment: "Browser" }],
37781    authMode: "WithinQueryParameters",
37782    responsesCache: createMemoryCache(),
37783    requestsCache: createMemoryCache({ serializable: false }),
37784    hostsCache: createFallbackableCache({
37785      caches: [createBrowserLocalStorageCache({ key: `${apiClientVersion}-${appId}` }), createMemoryCache()]
37786    }),
37787    ...options2
37788  });
37789}
37790

vendor: 147 bytes, lines 37791-37797

37791// node_modules/@algolia/autocomplete-shared/dist/esm/createRef.js
37792function createRef(initialValue) {
37793  return {
37794    current: initialValue
37795  };
37796}
37797

vendor: 441 bytes, lines 37798-37813

37798// node_modules/@algolia/autocomplete-shared/dist/esm/debounce.js
37799function debounce3(fn2, time) {
37800  var timerId = undefined;
37801  return function() {
37802    for (var _len = arguments.length, args2 = new Array(_len), _key = 0;_key < _len; _key++) {
37803      args2[_key] = arguments[_key];
37804    }
37805    if (timerId) {
37806      clearTimeout(timerId);
37807    }
37808    timerId = setTimeout(function() {
37809      return fn2.apply(undefined, args2);
37810    }, time);
37811  };
37812}
37813

vendor: 2,819 bytes, lines 37814-37899

37814// node_modules/@algolia/autocomplete-shared/dist/esm/decycle.js
37815function _slicedToArray(arr, i) {
37816  return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest();
37817}
37818function _nonIterableRest() {
37819  throw new TypeError(`Invalid attempt to destructure non-iterable instance.
37820In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
37821}
37822function _unsupportedIterableToArray(o, minLen) {
37823  if (!o)
37824    return;
37825  if (typeof o === "string")
37826    return _arrayLikeToArray(o, minLen);
37827  var n = Object.prototype.toString.call(o).slice(8, -1);
37828  if (n === "Object" && o.constructor)
37829    n = o.constructor.name;
37830  if (n === "Map" || n === "Set")
37831    return Array.from(o);
37832  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
37833    return _arrayLikeToArray(o, minLen);
37834}
37835function _arrayLikeToArray(arr, len) {
37836  if (len == null || len > arr.length)
37837    len = arr.length;
37838  for (var i = 0, arr2 = new Array(len);i < len; i++)
37839    arr2[i] = arr[i];
37840  return arr2;
37841}
37842function _iterableToArrayLimit(arr, i) {
37843  var _i = arr == null ? null : typeof Symbol != "undefined" && arr[Symbol.iterator] || arr["@@iterator"];
37844  if (_i != null) {
37845    var _s, _e, _x, _r, _arr = [], _n = true, _d = false;
37846    try {
37847      if (_x = (_i = _i.call(arr)).next, i === 0) {
37848        if (Object(_i) !== _i)
37849          return;
37850        _n = false;
37851      } else
37852        for (;!(_n = (_s = _x.call(_i)).done) && (_arr.push(_s.value), _arr.length !== i); _n = true)
37853          ;
37854    } catch (err) {
37855      _d = true, _e = err;
37856    } finally {
37857      try {
37858        if (!_n && _i.return != null && (_r = _i.return(), Object(_r) !== _r))
37859          return;
37860      } finally {
37861        if (_d)
37862          throw _e;
37863      }
37864    }
37865    return _arr;
37866  }
37867}
37868function _arrayWithHoles(arr) {
37869  if (Array.isArray(arr))
37870    return arr;
37871}
37872function _typeof(obj2) {
37873  "@babel/helpers - typeof";
37874  return _typeof = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
37875    return typeof obj2;
37876  } : function(obj2) {
37877    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
37878  }, _typeof(obj2);
37879}
37880function decycle(obj2) {
37881  var seen = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : new Set;
37882  if (!obj2 || _typeof(obj2) !== "object") {
37883    return obj2;
37884  }
37885  if (seen.has(obj2)) {
37886    return "[Circular]";
37887  }
37888  var newSeen = seen.add(obj2);
37889  if (Array.isArray(obj2)) {
37890    return obj2.map(function(x) {
37891      return decycle(x, newSeen);
37892    });
37893  }
37894  return Object.fromEntries(Object.entries(obj2).map(function(_ref) {
37895    var _ref2 = _slicedToArray(_ref, 2), key = _ref2[0], value = _ref2[1];
37896    return [key, decycle(value, newSeen)];
37897  }));
37898}
37899

vendor: 169 bytes, lines 37900-37906

37900// node_modules/@algolia/autocomplete-shared/dist/esm/flatten.js
37901function flatten(values) {
37902  return values.reduce(function(a, b) {
37903    return a.concat(b);
37904  }, []);
37905}
37906

vendor: 194 bytes, lines 37907-37912

37907// node_modules/@algolia/autocomplete-shared/dist/esm/generateAutocompleteId.js
37908var autocompleteId = 0;
37909function generateAutocompleteId() {
37910  return "autocomplete-".concat(autocompleteId++);
37911}
37912

vendor: 229 bytes, lines 37913-37919

37913// node_modules/@algolia/autocomplete-shared/dist/esm/getAttributeValueByPath.js
37914function getAttributeValueByPath(record, path) {
37915  return path.reduce(function(current, key) {
37916    return current && current[key];
37917  }, record);
37918}
37919

vendor: 277 bytes, lines 37920-37929

37920// node_modules/@algolia/autocomplete-shared/dist/esm/getItemsCount.js
37921function getItemsCount(state) {
37922  if (state.collections.length === 0) {
37923    return 0;
37924  }
37925  return state.collections.reduce(function(sum, collection) {
37926    return sum + collection.items.length;
37927  }, 0);
37928}
37929

vendor: 251 bytes, lines 37930-37937

37930// node_modules/@algolia/autocomplete-shared/dist/esm/invariant.js
37931function invariant(condition, message) {
37932  if (false) {}
37933  if (!condition) {
37934    throw new Error("[Autocomplete] ".concat(typeof message === "function" ? message() : message));
37935  }
37936}
37937

vendor: 710 bytes, lines 37938-37963

37938// node_modules/@algolia/autocomplete-shared/dist/esm/isEqual.js
37939function isPrimitive(obj2) {
37940  return obj2 !== Object(obj2);
37941}
37942function isEqual(first, second) {
37943  if (first === second) {
37944    return true;
37945  }
37946  if (isPrimitive(first) || isPrimitive(second) || typeof first === "function" || typeof second === "function") {
37947    return first === second;
37948  }
37949  if (Object.keys(first).length !== Object.keys(second).length) {
37950    return false;
37951  }
37952  for (var _i = 0, _Object$keys = Object.keys(first);_i < _Object$keys.length; _i++) {
37953    var key = _Object$keys[_i];
37954    if (!(key in second)) {
37955      return false;
37956    }
37957    if (!isEqual(first[key], second[key])) {
37958      return false;
37959    }
37960  }
37961  return true;
37962}
37963

vendor: 94 bytes, lines 37964-37966

37964// node_modules/@algolia/autocomplete-shared/dist/esm/noop.js
37965var noop = function noop() {};
37966

vendor: 215 bytes, lines 37967-37976

37967// node_modules/@algolia/autocomplete-shared/dist/esm/safelyRunOnBrowser.js
37968function safelyRunOnBrowser(callback) {
37969  if (typeof window !== "undefined") {
37970    return callback({
37971      window
37972    });
37973  }
37974  return;
37975}
37976

vendor: 90 bytes, lines 37977-37979

37977// node_modules/@algolia/autocomplete-shared/dist/esm/version.js
37978var version = "1.19.6";
37979

vendor: 135 bytes, lines 37980-37985

37980// node_modules/@algolia/autocomplete-shared/dist/esm/userAgents.js
37981var userAgents = [{
37982  segment: "autocomplete-core",
37983  version
37984}];
37985

vendor: 434 bytes, lines 37986-38002

37986// node_modules/@algolia/autocomplete-shared/dist/esm/warn.js
37987var warnCache = {
37988  current: {}
37989};
37990function warn2(condition, message) {
37991  if (false) {}
37992  if (condition) {
37993    return;
37994  }
37995  var sanitizedMessage = message.trim();
37996  var hasAlreadyPrinted = warnCache.current[sanitizedMessage];
37997  if (!hasAlreadyPrinted) {
37998    warnCache.current[sanitizedMessage] = true;
37999    console.warn("[Autocomplete] ".concat(sanitizedMessage));
38000  }
38001}
38002

vendor: 483 bytes, lines 38003-38016

38003// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/createClickedEvent.js
38004function createClickedEvent(_ref) {
38005  var { item, items: _ref$items } = _ref, items = _ref$items === undefined ? [] : _ref$items;
38006  return {
38007    index: item.__autocomplete_indexName,
38008    items: [item],
38009    positions: [1 + items.findIndex(function(x) {
38010      return x.objectID === item.objectID;
38011    })],
38012    queryID: item.__autocomplete_queryID,
38013    algoliaSource: ["autocomplete"]
38014  };
38015}
38016

vendor: 2,270 bytes, lines 38017-38082

38017// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/isModernInsightsClient.js
38018function _slicedToArray2(arr, i) {
38019  return _arrayWithHoles2(arr) || _iterableToArrayLimit2(arr, i) || _unsupportedIterableToArray2(arr, i) || _nonIterableRest2();
38020}
38021function _nonIterableRest2() {
38022  throw new TypeError(`Invalid attempt to destructure non-iterable instance.
38023In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
38024}
38025function _unsupportedIterableToArray2(o, minLen) {
38026  if (!o)
38027    return;
38028  if (typeof o === "string")
38029    return _arrayLikeToArray2(o, minLen);
38030  var n = Object.prototype.toString.call(o).slice(8, -1);
38031  if (n === "Object" && o.constructor)
38032    n = o.constructor.name;
38033  if (n === "Map" || n === "Set")
38034    return Array.from(o);
38035  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
38036    return _arrayLikeToArray2(o, minLen);
38037}
38038function _arrayLikeToArray2(arr, len) {
38039  if (len == null || len > arr.length)
38040    len = arr.length;
38041  for (var i = 0, arr2 = new Array(len);i < len; i++)
38042    arr2[i] = arr[i];
38043  return arr2;
38044}
38045function _iterableToArrayLimit2(arr, i) {
38046  var _i = arr == null ? null : typeof Symbol != "undefined" && arr[Symbol.iterator] || arr["@@iterator"];
38047  if (_i != null) {
38048    var _s, _e, _x, _r, _arr = [], _n = true, _d = false;
38049    try {
38050      if (_x = (_i = _i.call(arr)).next, i === 0) {
38051        if (Object(_i) !== _i)
38052          return;
38053        _n = false;
38054      } else
38055        for (;!(_n = (_s = _x.call(_i)).done) && (_arr.push(_s.value), _arr.length !== i); _n = true)
38056          ;
38057    } catch (err) {
38058      _d = true, _e = err;
38059    } finally {
38060      try {
38061        if (!_n && _i.return != null && (_r = _i.return(), Object(_r) !== _r))
38062          return;
38063      } finally {
38064        if (_d)
38065          throw _e;
38066      }
38067    }
38068    return _arr;
38069  }
38070}
38071function _arrayWithHoles2(arr) {
38072  if (Array.isArray(arr))
38073    return arr;
38074}
38075function isModernInsightsClient(client) {
38076  var _split$map = (client.version || "").split(".").map(Number), _split$map2 = _slicedToArray2(_split$map, 2), major = _split$map2[0], minor = _split$map2[1];
38077  var v3 = major >= 3;
38078  var v2_4 = major === 2 && minor >= 4;
38079  var v1_10 = major === 1 && minor >= 10;
38080  return v3 || v2_4 || v1_10;
38081}
38082

vendor: 9,694 bytes, lines 38083-38339

38083// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/createSearchInsightsApi.js
38084var _excluded = ["items"];
38085var _excluded2 = ["items"];
38086function _typeof2(obj2) {
38087  "@babel/helpers - typeof";
38088  return _typeof2 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
38089    return typeof obj2;
38090  } : function(obj2) {
38091    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
38092  }, _typeof2(obj2);
38093}
38094function _toConsumableArray(arr) {
38095  return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray3(arr) || _nonIterableSpread();
38096}
38097function _nonIterableSpread() {
38098  throw new TypeError(`Invalid attempt to spread non-iterable instance.
38099In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
38100}
38101function _unsupportedIterableToArray3(o, minLen) {
38102  if (!o)
38103    return;
38104  if (typeof o === "string")
38105    return _arrayLikeToArray3(o, minLen);
38106  var n = Object.prototype.toString.call(o).slice(8, -1);
38107  if (n === "Object" && o.constructor)
38108    n = o.constructor.name;
38109  if (n === "Map" || n === "Set")
38110    return Array.from(o);
38111  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
38112    return _arrayLikeToArray3(o, minLen);
38113}
38114function _iterableToArray(iter) {
38115  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
38116    return Array.from(iter);
38117}
38118function _arrayWithoutHoles(arr) {
38119  if (Array.isArray(arr))
38120    return _arrayLikeToArray3(arr);
38121}
38122function _arrayLikeToArray3(arr, len) {
38123  if (len == null || len > arr.length)
38124    len = arr.length;
38125  for (var i = 0, arr2 = new Array(len);i < len; i++)
38126    arr2[i] = arr[i];
38127  return arr2;
38128}
38129function _objectWithoutProperties(source, excluded) {
38130  if (source == null)
38131    return {};
38132  var target = _objectWithoutPropertiesLoose(source, excluded);
38133  var key, i;
38134  if (Object.getOwnPropertySymbols) {
38135    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
38136    for (i = 0;i < sourceSymbolKeys.length; i++) {
38137      key = sourceSymbolKeys[i];
38138      if (excluded.indexOf(key) >= 0)
38139        continue;
38140      if (!Object.prototype.propertyIsEnumerable.call(source, key))
38141        continue;
38142      target[key] = source[key];
38143    }
38144  }
38145  return target;
38146}
38147function _objectWithoutPropertiesLoose(source, excluded) {
38148  if (source == null)
38149    return {};
38150  var target = {};
38151  var sourceKeys = Object.keys(source);
38152  var key, i;
38153  for (i = 0;i < sourceKeys.length; i++) {
38154    key = sourceKeys[i];
38155    if (excluded.indexOf(key) >= 0)
38156      continue;
38157    target[key] = source[key];
38158  }
38159  return target;
38160}
38161function ownKeys(object, enumerableOnly) {
38162  var keys = Object.keys(object);
38163  if (Object.getOwnPropertySymbols) {
38164    var symbols = Object.getOwnPropertySymbols(object);
38165    enumerableOnly && (symbols = symbols.filter(function(sym) {
38166      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
38167    })), keys.push.apply(keys, symbols);
38168  }
38169  return keys;
38170}
38171function _objectSpread(target) {
38172  for (var i = 1;i < arguments.length; i++) {
38173    var source = arguments[i] != null ? arguments[i] : {};
38174    i % 2 ? ownKeys(Object(source), true).forEach(function(key) {
38175      _defineProperty(target, key, source[key]);
38176    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function(key) {
38177      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
38178    });
38179  }
38180  return target;
38181}
38182function _defineProperty(obj2, key, value) {
38183  key = _toPropertyKey(key);
38184  if (key in obj2) {
38185    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
38186  } else {
38187    obj2[key] = value;
38188  }
38189  return obj2;
38190}
38191function _toPropertyKey(arg) {
38192  var key = _toPrimitive(arg, "string");
38193  return _typeof2(key) === "symbol" ? key : String(key);
38194}
38195function _toPrimitive(input, hint) {
38196  if (_typeof2(input) !== "object" || input === null)
38197    return input;
38198  var prim = input[Symbol.toPrimitive];
38199  if (prim !== undefined) {
38200    var res = prim.call(input, hint || "default");
38201    if (_typeof2(res) !== "object")
38202      return res;
38203    throw new TypeError("@@toPrimitive must return a primitive value.");
38204  }
38205  return (hint === "string" ? String : Number)(input);
38206}
38207function chunk(item) {
38208  var chunkSize = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 20;
38209  var chunks = [];
38210  for (var i = 0;i < item.objectIDs.length; i += chunkSize) {
38211    chunks.push(_objectSpread(_objectSpread({}, item), {}, {
38212      objectIDs: item.objectIDs.slice(i, i + chunkSize)
38213    }));
38214  }
38215  return chunks;
38216}
38217function mapToInsightsParamsApi(params) {
38218  return params.map(function(_ref) {
38219    var items = _ref.items, param = _objectWithoutProperties(_ref, _excluded);
38220    return _objectSpread(_objectSpread({}, param), {}, {
38221      objectIDs: (items === null || items === undefined ? undefined : items.map(function(_ref2) {
38222        var objectID = _ref2.objectID;
38223        return objectID;
38224      })) || param.objectIDs
38225    });
38226  });
38227}
38228function createSearchInsightsApi(searchInsights) {
38229  var canSendHeaders = isModernInsightsClient(searchInsights);
38230  function sendToInsights(method, payloads, items) {
38231    if (canSendHeaders && typeof items !== "undefined") {
38232      var _items$0$__autocomple = items[0].__autocomplete_algoliaCredentials, { appId, apiKey } = _items$0$__autocomple;
38233      var headers = {
38234        "X-Algolia-Application-Id": appId,
38235        "X-Algolia-API-Key": apiKey
38236      };
38237      searchInsights.apply(undefined, [method].concat(_toConsumableArray(payloads), [{
38238        headers
38239      }]));
38240    } else {
38241      searchInsights.apply(undefined, [method].concat(_toConsumableArray(payloads)));
38242    }
38243  }
38244  return {
38245    init: function init(appId, apiKey) {
38246      searchInsights("init", {
38247        appId,
38248        apiKey
38249      });
38250    },
38251    setAuthenticatedUserToken: function setAuthenticatedUserToken(authenticatedUserToken) {
38252      searchInsights("setAuthenticatedUserToken", authenticatedUserToken);
38253    },
38254    setUserToken: function setUserToken(userToken) {
38255      searchInsights("setUserToken", userToken);
38256    },
38257    clickedObjectIDsAfterSearch: function clickedObjectIDsAfterSearch() {
38258      for (var _len = arguments.length, params = new Array(_len), _key = 0;_key < _len; _key++) {
38259        params[_key] = arguments[_key];
38260      }
38261      if (params.length > 0) {
38262        sendToInsights("clickedObjectIDsAfterSearch", mapToInsightsParamsApi(params), params[0].items);
38263      }
38264    },
38265    clickedObjectIDs: function clickedObjectIDs() {
38266      for (var _len2 = arguments.length, params = new Array(_len2), _key2 = 0;_key2 < _len2; _key2++) {
38267        params[_key2] = arguments[_key2];
38268      }
38269      if (params.length > 0) {
38270        sendToInsights("clickedObjectIDs", mapToInsightsParamsApi(params), params[0].items);
38271      }
38272    },
38273    clickedFilters: function clickedFilters() {
38274      for (var _len3 = arguments.length, params = new Array(_len3), _key3 = 0;_key3 < _len3; _key3++) {
38275        params[_key3] = arguments[_key3];
38276      }
38277      if (params.length > 0) {
38278        searchInsights.apply(undefined, ["clickedFilters"].concat(params));
38279      }
38280    },
38281    convertedObjectIDsAfterSearch: function convertedObjectIDsAfterSearch() {
38282      for (var _len4 = arguments.length, params = new Array(_len4), _key4 = 0;_key4 < _len4; _key4++) {
38283        params[_key4] = arguments[_key4];
38284      }
38285      if (params.length > 0) {
38286        sendToInsights("convertedObjectIDsAfterSearch", mapToInsightsParamsApi(params), params[0].items);
38287      }
38288    },
38289    convertedObjectIDs: function convertedObjectIDs() {
38290      for (var _len5 = arguments.length, params = new Array(_len5), _key5 = 0;_key5 < _len5; _key5++) {
38291        params[_key5] = arguments[_key5];
38292      }
38293      if (params.length > 0) {
38294        sendToInsights("convertedObjectIDs", mapToInsightsParamsApi(params), params[0].items);
38295      }
38296    },
38297    convertedFilters: function convertedFilters() {
38298      for (var _len6 = arguments.length, params = new Array(_len6), _key6 = 0;_key6 < _len6; _key6++) {
38299        params[_key6] = arguments[_key6];
38300      }
38301      if (params.length > 0) {
38302        searchInsights.apply(undefined, ["convertedFilters"].concat(params));
38303      }
38304    },
38305    viewedObjectIDs: function viewedObjectIDs() {
38306      for (var _len7 = arguments.length, params = new Array(_len7), _key7 = 0;_key7 < _len7; _key7++) {
38307        params[_key7] = arguments[_key7];
38308      }
38309      if (params.length > 0) {
38310        params.reduce(function(acc, _ref3) {
38311          var items = _ref3.items, param = _objectWithoutProperties(_ref3, _excluded2);
38312          return [].concat(_toConsumableArray(acc), _toConsumableArray(chunk(_objectSpread(_objectSpread({}, param), {}, {
38313            objectIDs: (items === null || items === undefined ? undefined : items.map(function(_ref4) {
38314              var objectID = _ref4.objectID;
38315              return objectID;
38316            })) || param.objectIDs
38317          })).map(function(payload) {
38318            return {
38319              items,
38320              payload
38321            };
38322          })));
38323        }, []).forEach(function(_ref5) {
38324          var { items, payload } = _ref5;
38325          return sendToInsights("viewedObjectIDs", [payload], items);
38326        });
38327      }
38328    },
38329    viewedFilters: function viewedFilters() {
38330      for (var _len8 = arguments.length, params = new Array(_len8), _key8 = 0;_key8 < _len8; _key8++) {
38331        params[_key8] = arguments[_key8];
38332      }
38333      if (params.length > 0) {
38334        searchInsights.apply(undefined, ["viewedFilters"].concat(params));
38335      }
38336    }
38337  };
38338}
38339

vendor: 693 bytes, lines 38340-38357

38340// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/createViewedEvents.js
38341function createViewedEvents(_ref) {
38342  var items = _ref.items;
38343  var itemsByIndexName = items.reduce(function(acc, current) {
38344    var _acc$current$__autoco;
38345    acc[current.__autocomplete_indexName] = ((_acc$current$__autoco = acc[current.__autocomplete_indexName]) !== null && _acc$current$__autoco !== undefined ? _acc$current$__autoco : []).concat(current);
38346    return acc;
38347  }, {});
38348  return Object.keys(itemsByIndexName).map(function(indexName) {
38349    var items = itemsByIndexName[indexName];
38350    return {
38351      index: indexName,
38352      items,
38353      algoliaSource: ["autocomplete"]
38354    };
38355  });
38356}
38357

vendor: 220 bytes, lines 38358-38362

38358// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/isAlgoliaInsightsHit.js
38359function isAlgoliaInsightsHit(hit) {
38360  return hit.objectID && hit.__autocomplete_indexName && hit.__autocomplete_queryID;
38361}
38362

vendor: 10,257 bytes, lines 38363-38648

38363// node_modules/@algolia/autocomplete-plugin-algolia-insights/dist/esm/createAlgoliaInsightsPlugin.js
38364function _typeof3(obj2) {
38365  "@babel/helpers - typeof";
38366  return _typeof3 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
38367    return typeof obj2;
38368  } : function(obj2) {
38369    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
38370  }, _typeof3(obj2);
38371}
38372function _toConsumableArray2(arr) {
38373  return _arrayWithoutHoles2(arr) || _iterableToArray2(arr) || _unsupportedIterableToArray4(arr) || _nonIterableSpread2();
38374}
38375function _nonIterableSpread2() {
38376  throw new TypeError(`Invalid attempt to spread non-iterable instance.
38377In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
38378}
38379function _unsupportedIterableToArray4(o, minLen) {
38380  if (!o)
38381    return;
38382  if (typeof o === "string")
38383    return _arrayLikeToArray4(o, minLen);
38384  var n = Object.prototype.toString.call(o).slice(8, -1);
38385  if (n === "Object" && o.constructor)
38386    n = o.constructor.name;
38387  if (n === "Map" || n === "Set")
38388    return Array.from(o);
38389  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
38390    return _arrayLikeToArray4(o, minLen);
38391}
38392function _iterableToArray2(iter) {
38393  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
38394    return Array.from(iter);
38395}
38396function _arrayWithoutHoles2(arr) {
38397  if (Array.isArray(arr))
38398    return _arrayLikeToArray4(arr);
38399}
38400function _arrayLikeToArray4(arr, len) {
38401  if (len == null || len > arr.length)
38402    len = arr.length;
38403  for (var i = 0, arr2 = new Array(len);i < len; i++)
38404    arr2[i] = arr[i];
38405  return arr2;
38406}
38407function ownKeys2(object, enumerableOnly) {
38408  var keys = Object.keys(object);
38409  if (Object.getOwnPropertySymbols) {
38410    var symbols = Object.getOwnPropertySymbols(object);
38411    enumerableOnly && (symbols = symbols.filter(function(sym) {
38412      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
38413    })), keys.push.apply(keys, symbols);
38414  }
38415  return keys;
38416}
38417function _objectSpread2(target) {
38418  for (var i = 1;i < arguments.length; i++) {
38419    var source = arguments[i] != null ? arguments[i] : {};
38420    i % 2 ? ownKeys2(Object(source), true).forEach(function(key) {
38421      _defineProperty2(target, key, source[key]);
38422    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys2(Object(source)).forEach(function(key) {
38423      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
38424    });
38425  }
38426  return target;
38427}
38428function _defineProperty2(obj2, key, value) {
38429  key = _toPropertyKey2(key);
38430  if (key in obj2) {
38431    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
38432  } else {
38433    obj2[key] = value;
38434  }
38435  return obj2;
38436}
38437function _toPropertyKey2(arg) {
38438  var key = _toPrimitive2(arg, "string");
38439  return _typeof3(key) === "symbol" ? key : String(key);
38440}
38441function _toPrimitive2(input, hint) {
38442  if (_typeof3(input) !== "object" || input === null)
38443    return input;
38444  var prim = input[Symbol.toPrimitive];
38445  if (prim !== undefined) {
38446    var res = prim.call(input, hint || "default");
38447    if (_typeof3(res) !== "object")
38448      return res;
38449    throw new TypeError("@@toPrimitive must return a primitive value.");
38450  }
38451  return (hint === "string" ? String : Number)(input);
38452}
38453var VIEW_EVENT_DELAY = 400;
38454var ALGOLIA_INSIGHTS_VERSION = "2.15.0";
38455var ALGOLIA_INSIGHTS_SRC = "https://cdn.jsdelivr.net/npm/search-insights@".concat(ALGOLIA_INSIGHTS_VERSION, "/dist/search-insights.min.js");
38456var sendViewedObjectIDs = debounce3(function(_ref) {
38457  var { onItemsChange, items, insights, state } = _ref;
38458  onItemsChange({
38459    insights,
38460    insightsEvents: createViewedEvents({
38461      items
38462    }).map(function(event) {
38463      return _objectSpread2({
38464        eventName: "Items Viewed"
38465      }, event);
38466    }),
38467    state
38468  });
38469}, VIEW_EVENT_DELAY);
38470function createAlgoliaInsightsPlugin(options2) {
38471  var _getOptions = getOptions(options2), { insightsClient: providedInsightsClient, insightsInitParams, onItemsChange, onSelect: onSelectEvent, onActive: onActiveEvent, __autocomplete_clickAnalytics } = _getOptions;
38472  var insightsClient = providedInsightsClient;
38473  if (!providedInsightsClient) {
38474    safelyRunOnBrowser(function(_ref2) {
38475      var window2 = _ref2.window;
38476      var pointer = window2.AlgoliaAnalyticsObject || "aa";
38477      if (typeof pointer === "string") {
38478        insightsClient = window2[pointer];
38479      }
38480      if (!insightsClient) {
38481        window2.AlgoliaAnalyticsObject = pointer;
38482        if (!window2[pointer]) {
38483          window2[pointer] = function() {
38484            if (!window2[pointer].queue) {
38485              window2[pointer].queue = [];
38486            }
38487            for (var _len = arguments.length, args2 = new Array(_len), _key = 0;_key < _len; _key++) {
38488              args2[_key] = arguments[_key];
38489            }
38490            window2[pointer].queue.push(args2);
38491          };
38492        }
38493        window2[pointer].version = ALGOLIA_INSIGHTS_VERSION;
38494        insightsClient = window2[pointer];
38495        loadInsights(window2);
38496      }
38497    });
38498  }
38499  if (!insightsClient) {
38500    return {};
38501  }
38502  if (insightsInitParams) {
38503    insightsClient("init", _objectSpread2({
38504      partial: true
38505    }, insightsInitParams));
38506  }
38507  var insights = createSearchInsightsApi(insightsClient);
38508  var previousItems = createRef([]);
38509  var debouncedOnStateChange = debounce3(function(_ref3) {
38510    var state = _ref3.state;
38511    if (!state.isOpen) {
38512      return;
38513    }
38514    var items = state.collections.reduce(function(acc, current) {
38515      return [].concat(_toConsumableArray2(acc), _toConsumableArray2(current.items));
38516    }, []).filter(isAlgoliaInsightsHit);
38517    if (!isEqual(previousItems.current.map(function(x) {
38518      return x.objectID;
38519    }), items.map(function(x) {
38520      return x.objectID;
38521    }))) {
38522      previousItems.current = items;
38523      if (items.length > 0) {
38524        sendViewedObjectIDs({
38525          onItemsChange,
38526          items,
38527          insights,
38528          state
38529        });
38530      }
38531    }
38532  }, 0);
38533  return {
38534    name: "aa.algoliaInsightsPlugin",
38535    subscribe: function subscribe(_ref4) {
38536      var { setContext, onSelect, onActive } = _ref4;
38537      function setInsightsContext(userToken) {
38538        setContext({
38539          algoliaInsightsPlugin: {
38540            __algoliaSearchParameters: _objectSpread2(_objectSpread2({}, __autocomplete_clickAnalytics ? {
38541              clickAnalytics: true
38542            } : {}), userToken ? {
38543              userToken: normalizeUserToken(userToken)
38544            } : {}),
38545            insights
38546          }
38547        });
38548      }
38549      insightsClient("addAlgoliaAgent", "insights-plugin");
38550      setInsightsContext();
38551      insightsClient("onUserTokenChange", function(userToken) {
38552        setInsightsContext(userToken);
38553      });
38554      insightsClient("getUserToken", null, function(_error, userToken) {
38555        setInsightsContext(userToken);
38556      });
38557      onSelect(function(_ref5) {
38558        var { item, state, event, source } = _ref5;
38559        if (!isAlgoliaInsightsHit(item)) {
38560          return;
38561        }
38562        onSelectEvent({
38563          state,
38564          event,
38565          insights,
38566          item,
38567          insightsEvents: [_objectSpread2({
38568            eventName: "Item Selected"
38569          }, createClickedEvent({
38570            item,
38571            items: source.getItems().filter(isAlgoliaInsightsHit)
38572          }))]
38573        });
38574      });
38575      onActive(function(_ref6) {
38576        var { item, source, state, event } = _ref6;
38577        if (!isAlgoliaInsightsHit(item)) {
38578          return;
38579        }
38580        onActiveEvent({
38581          state,
38582          event,
38583          insights,
38584          item,
38585          insightsEvents: [_objectSpread2({
38586            eventName: "Item Active"
38587          }, createClickedEvent({
38588            item,
38589            items: source.getItems().filter(isAlgoliaInsightsHit)
38590          }))]
38591        });
38592      });
38593    },
38594    onStateChange: function onStateChange(_ref7) {
38595      var state = _ref7.state;
38596      debouncedOnStateChange({
38597        state
38598      });
38599    },
38600    __autocomplete_pluginOptions: options2
38601  };
38602}
38603function getAlgoliaSources() {
38604  var _context$algoliaInsig;
38605  var algoliaSourceBase = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
38606  var context = arguments.length > 1 ? arguments[1] : undefined;
38607  return [].concat(_toConsumableArray2(algoliaSourceBase), ["autocomplete-internal"], _toConsumableArray2((_context$algoliaInsig = context.algoliaInsightsPlugin) !== null && _context$algoliaInsig !== undefined && _context$algoliaInsig.__automaticInsights ? ["autocomplete-automatic"] : []));
38608}
38609function getOptions(options2) {
38610  return _objectSpread2({
38611    onItemsChange: function onItemsChange(_ref8) {
38612      var { insights, insightsEvents, state } = _ref8;
38613      insights.viewedObjectIDs.apply(insights, _toConsumableArray2(insightsEvents.map(function(event) {
38614        return _objectSpread2(_objectSpread2({}, event), {}, {
38615          algoliaSource: getAlgoliaSources(event.algoliaSource, state.context)
38616        });
38617      })));
38618    },
38619    onSelect: function onSelect(_ref9) {
38620      var { insights, insightsEvents, state } = _ref9;
38621      insights.clickedObjectIDsAfterSearch.apply(insights, _toConsumableArray2(insightsEvents.map(function(event) {
38622        return _objectSpread2(_objectSpread2({}, event), {}, {
38623          algoliaSource: getAlgoliaSources(event.algoliaSource, state.context)
38624        });
38625      })));
38626    },
38627    onActive: noop,
38628    __autocomplete_clickAnalytics: true
38629  }, options2);
38630}
38631function loadInsights(environment) {
38632  var errorMessage = "[Autocomplete]: Could not load search-insights.js. Please load it manually following https://alg.li/insights-autocomplete";
38633  try {
38634    var script = environment.document.createElement("script");
38635    script.async = true;
38636    script.src = ALGOLIA_INSIGHTS_SRC;
38637    script.onerror = function() {
38638      console.error(errorMessage);
38639    };
38640    document.body.appendChild(script);
38641  } catch (cause) {
38642    console.error(errorMessage);
38643  }
38644}
38645function normalizeUserToken(userToken) {
38646  return typeof userToken === "number" ? userToken.toString() : userToken;
38647}
38648

vendor: 226 bytes, lines 38649-38653

38649// node_modules/@algolia/autocomplete-core/dist/esm/checkOptions.js
38650function checkOptions(options2) {
38651  warn2(!options2.debug, "The `debug` option is meant for development debugging and should not be used in production.");
38652}
38653

vendor: 1,975 bytes, lines 38654-38717

38654// node_modules/@algolia/autocomplete-core/dist/esm/utils/createCancelablePromise.js
38655function createInternalCancelablePromise(promise, initialState) {
38656  var state = initialState;
38657  return {
38658    then: function then(onfulfilled, onrejected) {
38659      return createInternalCancelablePromise(promise.then(createCallback(onfulfilled, state, promise), createCallback(onrejected, state, promise)), state);
38660    },
38661    catch: function _catch(onrejected) {
38662      return createInternalCancelablePromise(promise.catch(createCallback(onrejected, state, promise)), state);
38663    },
38664    finally: function _finally(onfinally) {
38665      if (onfinally) {
38666        state.onCancelList.push(onfinally);
38667      }
38668      return createInternalCancelablePromise(promise.finally(createCallback(onfinally && function() {
38669        state.onCancelList = [];
38670        return onfinally();
38671      }, state, promise)), state);
38672    },
38673    cancel: function cancel() {
38674      state.isCanceled = true;
38675      var callbacks = state.onCancelList;
38676      state.onCancelList = [];
38677      callbacks.forEach(function(callback) {
38678        callback();
38679      });
38680    },
38681    isCanceled: function isCanceled() {
38682      return state.isCanceled === true;
38683    }
38684  };
38685}
38686function createCancelablePromise(executor) {
38687  return createInternalCancelablePromise(new Promise(function(resolve, reject) {
38688    return executor(resolve, reject);
38689  }), {
38690    isCanceled: false,
38691    onCancelList: []
38692  });
38693}
38694createCancelablePromise.resolve = function(value) {
38695  return cancelable(Promise.resolve(value));
38696};
38697createCancelablePromise.reject = function(reason) {
38698  return cancelable(Promise.reject(reason));
38699};
38700function cancelable(promise) {
38701  return createInternalCancelablePromise(promise, {
38702    isCanceled: false,
38703    onCancelList: []
38704  });
38705}
38706function createCallback(onResult, state, fallback) {
38707  if (!onResult) {
38708    return fallback;
38709  }
38710  return function callback(arg) {
38711    if (state.isCanceled) {
38712      return arg;
38713    }
38714    return onResult(arg);
38715  };
38716}
38717

vendor: 1,092 bytes, lines 38718-38754

38718// node_modules/@algolia/autocomplete-core/dist/esm/utils/createCancelablePromiseList.js
38719var _hasWaitPromiseResolved = true;
38720var _waitPromise;
38721function createCancelablePromiseList() {
38722  var list = [];
38723  return {
38724    add: function add(cancelablePromise) {
38725      list.push(cancelablePromise);
38726      return cancelablePromise.finally(function() {
38727        list = list.filter(function(item) {
38728          return item !== cancelablePromise;
38729        });
38730      });
38731    },
38732    cancelAll: function cancelAll() {
38733      list.forEach(function(promise) {
38734        return promise.cancel();
38735      });
38736    },
38737    isEmpty: function isEmpty() {
38738      return list.length === 0;
38739    },
38740    wait: function wait(timeout) {
38741      if (!_hasWaitPromiseResolved) {
38742        return _waitPromise;
38743      }
38744      _hasWaitPromiseResolved = false;
38745      _waitPromise = !timeout ? Promise.all(list) : Promise.race([Promise.all(list), new Promise(function(resolve) {
38746        return setTimeout(resolve, timeout);
38747      })]);
38748      return _waitPromise.then(function() {
38749        _hasWaitPromiseResolved = true;
38750      });
38751    }
38752  };
38753}
38754

vendor: 618 bytes, lines 38755-38773

38755// node_modules/@algolia/autocomplete-core/dist/esm/utils/createConcurrentSafePromise.js
38756function createConcurrentSafePromise() {
38757  var basePromiseId = -1;
38758  var latestResolvedId = -1;
38759  var latestResolvedValue = undefined;
38760  return function runConcurrentSafePromise(promise) {
38761    basePromiseId++;
38762    var currentPromiseId = basePromiseId;
38763    return Promise.resolve(promise).then(function(x) {
38764      if (latestResolvedValue && currentPromiseId < latestResolvedId) {
38765        return latestResolvedValue;
38766      }
38767      latestResolvedId = currentPromiseId;
38768      latestResolvedValue = x;
38769      return x;
38770    });
38771  };
38772}
38773

vendor: 558 bytes, lines 38774-38788

38774// node_modules/@algolia/autocomplete-core/dist/esm/utils/getNextActiveItemId.js
38775function getNextActiveItemId(moveAmount, baseIndex, itemCount, defaultActiveItemId) {
38776  if (!itemCount) {
38777    return null;
38778  }
38779  if (moveAmount < 0 && (baseIndex === null || defaultActiveItemId !== null && baseIndex === 0)) {
38780    return itemCount + moveAmount;
38781  }
38782  var numericIndex = (baseIndex === null ? -1 : baseIndex) + moveAmount;
38783  if (numericIndex <= -1 || numericIndex >= itemCount) {
38784    return defaultActiveItemId === null ? null : 0;
38785  }
38786  return numericIndex;
38787}
38788

vendor: 3,698 bytes, lines 38789-38883

38789// node_modules/@algolia/autocomplete-core/dist/esm/utils/getNormalizedSources.js
38790function ownKeys3(object, enumerableOnly) {
38791  var keys = Object.keys(object);
38792  if (Object.getOwnPropertySymbols) {
38793    var symbols = Object.getOwnPropertySymbols(object);
38794    enumerableOnly && (symbols = symbols.filter(function(sym) {
38795      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
38796    })), keys.push.apply(keys, symbols);
38797  }
38798  return keys;
38799}
38800function _objectSpread3(target) {
38801  for (var i = 1;i < arguments.length; i++) {
38802    var source = arguments[i] != null ? arguments[i] : {};
38803    i % 2 ? ownKeys3(Object(source), true).forEach(function(key) {
38804      _defineProperty3(target, key, source[key]);
38805    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys3(Object(source)).forEach(function(key) {
38806      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
38807    });
38808  }
38809  return target;
38810}
38811function _defineProperty3(obj2, key, value) {
38812  key = _toPropertyKey3(key);
38813  if (key in obj2) {
38814    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
38815  } else {
38816    obj2[key] = value;
38817  }
38818  return obj2;
38819}
38820function _toPropertyKey3(arg) {
38821  var key = _toPrimitive3(arg, "string");
38822  return _typeof4(key) === "symbol" ? key : String(key);
38823}
38824function _toPrimitive3(input, hint) {
38825  if (_typeof4(input) !== "object" || input === null)
38826    return input;
38827  var prim = input[Symbol.toPrimitive];
38828  if (prim !== undefined) {
38829    var res = prim.call(input, hint || "default");
38830    if (_typeof4(res) !== "object")
38831      return res;
38832    throw new TypeError("@@toPrimitive must return a primitive value.");
38833  }
38834  return (hint === "string" ? String : Number)(input);
38835}
38836function _typeof4(obj2) {
38837  "@babel/helpers - typeof";
38838  return _typeof4 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
38839    return typeof obj2;
38840  } : function(obj2) {
38841    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
38842  }, _typeof4(obj2);
38843}
38844function getNormalizedSources(getSources, params) {
38845  var seenSourceIds = [];
38846  return Promise.resolve(getSources(params)).then(function(sources) {
38847    invariant(Array.isArray(sources), function() {
38848      return "The `getSources` function must return an array of sources but returned type ".concat(JSON.stringify(_typeof4(sources)), `:
38849
38850`).concat(JSON.stringify(decycle(sources), null, 2));
38851    });
38852    return Promise.all(sources.filter(function(maybeSource) {
38853      return Boolean(maybeSource);
38854    }).map(function(source) {
38855      invariant(typeof source.sourceId === "string", "A source must provide a `sourceId` string.");
38856      if (seenSourceIds.includes(source.sourceId)) {
38857        throw new Error("[Autocomplete] The `sourceId` ".concat(JSON.stringify(source.sourceId), " is not unique."));
38858      }
38859      seenSourceIds.push(source.sourceId);
38860      var defaultSource = {
38861        getItemInputValue: function getItemInputValue(_ref) {
38862          var state = _ref.state;
38863          return state.query;
38864        },
38865        getItemUrl: function getItemUrl() {
38866          return;
38867        },
38868        onSelect: function onSelect(_ref2) {
38869          var setIsOpen = _ref2.setIsOpen;
38870          setIsOpen(false);
38871        },
38872        onActive: noop,
38873        onResolve: noop
38874      };
38875      Object.keys(defaultSource).forEach(function(key) {
38876        defaultSource[key].__default = true;
38877      });
38878      var normalizedSource = _objectSpread3(_objectSpread3({}, defaultSource), source);
38879      return Promise.resolve(normalizedSource);
38880    }));
38881  });
38882}
38883

vendor: 3,056 bytes, lines 38884-38972

38884// node_modules/@algolia/autocomplete-core/dist/esm/utils/getPluginSubmitPromise.js
38885function _createForOfIteratorHelper(o, allowArrayLike) {
38886  var it = typeof Symbol !== "undefined" && o[Symbol.iterator] || o["@@iterator"];
38887  if (!it) {
38888    if (Array.isArray(o) || (it = _unsupportedIterableToArray5(o)) || allowArrayLike && o && typeof o.length === "number") {
38889      if (it)
38890        o = it;
38891      var i = 0;
38892      var F = function F() {};
38893      return { s: F, n: function n() {
38894        if (i >= o.length)
38895          return { done: true };
38896        return { done: false, value: o[i++] };
38897      }, e: function e(_e) {
38898        throw _e;
38899      }, f: F };
38900    }
38901    throw new TypeError(`Invalid attempt to iterate non-iterable instance.
38902In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
38903  }
38904  var normalCompletion = true, didErr = false, err;
38905  return { s: function s() {
38906    it = it.call(o);
38907  }, n: function n() {
38908    var step = it.next();
38909    normalCompletion = step.done;
38910    return step;
38911  }, e: function e(_e2) {
38912    didErr = true;
38913    err = _e2;
38914  }, f: function f() {
38915    try {
38916      if (!normalCompletion && it.return != null)
38917        it.return();
38918    } finally {
38919      if (didErr)
38920        throw err;
38921    }
38922  } };
38923}
38924function _unsupportedIterableToArray5(o, minLen) {
38925  if (!o)
38926    return;
38927  if (typeof o === "string")
38928    return _arrayLikeToArray5(o, minLen);
38929  var n = Object.prototype.toString.call(o).slice(8, -1);
38930  if (n === "Object" && o.constructor)
38931    n = o.constructor.name;
38932  if (n === "Map" || n === "Set")
38933    return Array.from(o);
38934  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
38935    return _arrayLikeToArray5(o, minLen);
38936}
38937function _arrayLikeToArray5(arr, len) {
38938  if (len == null || len > arr.length)
38939    len = arr.length;
38940  for (var i = 0, arr2 = new Array(len);i < len; i++)
38941    arr2[i] = arr[i];
38942  return arr2;
38943}
38944var getPluginSubmitPromise = function getPluginSubmitPromise(plugins, pendingRequests) {
38945  var waitUntilComplete = false;
38946  var timeouts = [];
38947  var _iterator = _createForOfIteratorHelper(plugins), _step;
38948  try {
38949    for (_iterator.s();!(_step = _iterator.n()).done; ) {
38950      var _plugin$__autocomplet, _plugin$__autocomplet2, _plugin$__autocomplet3;
38951      var plugin = _step.value;
38952      var value = (_plugin$__autocomplet = plugin.__autocomplete_pluginOptions) === null || _plugin$__autocomplet === undefined ? undefined : (_plugin$__autocomplet2 = (_plugin$__autocomplet3 = _plugin$__autocomplet).awaitSubmit) === null || _plugin$__autocomplet2 === undefined ? undefined : _plugin$__autocomplet2.call(_plugin$__autocomplet3);
38953      if (typeof value === "number") {
38954        timeouts.push(value);
38955      } else if (value === true) {
38956        waitUntilComplete = true;
38957        break;
38958      }
38959    }
38960  } catch (err) {
38961    _iterator.e(err);
38962  } finally {
38963    _iterator.f();
38964  }
38965  if (waitUntilComplete) {
38966    return pendingRequests.wait();
38967  } else if (timeouts.length > 0) {
38968    return pendingRequests.wait(Math.max.apply(Math, timeouts));
38969  }
38970  return;
38971};
38972

vendor: 1,605 bytes, lines 38973-39032

38973// node_modules/@algolia/autocomplete-core/dist/esm/utils/getActiveItem.js
38974function getCollectionFromActiveItemId(state) {
38975  var accumulatedCollectionsCount = state.collections.map(function(collections) {
38976    return collections.items.length;
38977  }).reduce(function(acc, collectionsCount, index) {
38978    var previousValue = acc[index - 1] || 0;
38979    var nextValue = previousValue + collectionsCount;
38980    acc.push(nextValue);
38981    return acc;
38982  }, []);
38983  var collectionIndex = accumulatedCollectionsCount.reduce(function(acc, current) {
38984    if (current <= state.activeItemId) {
38985      return acc + 1;
38986    }
38987    return acc;
38988  }, 0);
38989  return state.collections[collectionIndex];
38990}
38991function getRelativeActiveItemId(_ref) {
38992  var { state, collection } = _ref;
38993  var isOffsetFound = false;
38994  var counter = 0;
38995  var previousItemsOffset = 0;
38996  while (isOffsetFound === false) {
38997    var currentCollection = state.collections[counter];
38998    if (currentCollection === collection) {
38999      isOffsetFound = true;
39000      break;
39001    }
39002    previousItemsOffset += currentCollection.items.length;
39003    counter++;
39004  }
39005  return state.activeItemId - previousItemsOffset;
39006}
39007function getActiveItem(state) {
39008  var collection = getCollectionFromActiveItemId(state);
39009  if (!collection) {
39010    return null;
39011  }
39012  var item = collection.items[getRelativeActiveItemId({
39013    state,
39014    collection
39015  })];
39016  var source = collection.source;
39017  var itemInputValue = source.getItemInputValue({
39018    item,
39019    state
39020  });
39021  var itemUrl = source.getItemUrl({
39022    item,
39023    state
39024  });
39025  return {
39026    item,
39027    itemInputValue,
39028    itemUrl,
39029    source
39030  };
39031}
39032

vendor: 330 bytes, lines 39033-39037

39033// node_modules/@algolia/autocomplete-core/dist/esm/utils/getAutocompleteElementId.js
39034function getAutocompleteElementId(autocompleteInstanceId, elementId, source) {
39035  return [autocompleteInstanceId, source === null || source === undefined ? undefined : source.sourceId, elementId].filter(Boolean).join("-").replace(/\s/g, "");
39036}
39037

vendor: 177 bytes, lines 39038-39042

39038// node_modules/@algolia/autocomplete-core/dist/esm/utils/isOrContainsNode.js
39039function isOrContainsNode(parent, child) {
39040  return parent === child || parent.contains(child);
39041}
39042

vendor: 228 bytes, lines 39043-39048

39043// node_modules/@algolia/autocomplete-core/dist/esm/utils/isSamsung.js
39044var regex = /((gt|sm)-|galaxy nexus)|samsung[- ]|samsungbrowser/i;
39045function isSamsung(userAgent) {
39046  return Boolean(userAgent && userAgent.match(regex));
39047}
39048

vendor: 713 bytes, lines 39049-39072

39049// node_modules/@algolia/autocomplete-core/dist/esm/utils/mapToAlgoliaResponse.js
39050function mapToAlgoliaResponse(rawResults) {
39051  return {
39052    results: rawResults,
39053    hits: rawResults.map(function(result) {
39054      return result.hits;
39055    }).filter(Boolean),
39056    facetHits: rawResults.map(function(result) {
39057      var _facetHits;
39058      return (_facetHits = result.facetHits) === null || _facetHits === undefined ? undefined : _facetHits.map(function(facetHit) {
39059        return {
39060          label: facetHit.value,
39061          count: facetHit.count,
39062          _highlightResult: {
39063            label: {
39064              value: facetHit.highlighted
39065            }
39066          }
39067        };
39068      });
39069    }).filter(Boolean)
39070  };
39071}
39072

vendor: 149 bytes, lines 39073-39077

39073// node_modules/@algolia/autocomplete-core/dist/esm/utils/getNativeEvent.js
39074function getNativeEvent(event) {
39075  return event.nativeEvent || event;
39076}
39077

vendor: 2,644 bytes, lines 39078-39154

39078// node_modules/@algolia/autocomplete-core/dist/esm/createStore.js
39079function _typeof5(obj2) {
39080  "@babel/helpers - typeof";
39081  return _typeof5 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39082    return typeof obj2;
39083  } : function(obj2) {
39084    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39085  }, _typeof5(obj2);
39086}
39087function ownKeys4(object, enumerableOnly) {
39088  var keys = Object.keys(object);
39089  if (Object.getOwnPropertySymbols) {
39090    var symbols = Object.getOwnPropertySymbols(object);
39091    enumerableOnly && (symbols = symbols.filter(function(sym) {
39092      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39093    })), keys.push.apply(keys, symbols);
39094  }
39095  return keys;
39096}
39097function _objectSpread4(target) {
39098  for (var i = 1;i < arguments.length; i++) {
39099    var source = arguments[i] != null ? arguments[i] : {};
39100    i % 2 ? ownKeys4(Object(source), true).forEach(function(key) {
39101      _defineProperty4(target, key, source[key]);
39102    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys4(Object(source)).forEach(function(key) {
39103      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39104    });
39105  }
39106  return target;
39107}
39108function _defineProperty4(obj2, key, value) {
39109  key = _toPropertyKey4(key);
39110  if (key in obj2) {
39111    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39112  } else {
39113    obj2[key] = value;
39114  }
39115  return obj2;
39116}
39117function _toPropertyKey4(arg) {
39118  var key = _toPrimitive4(arg, "string");
39119  return _typeof5(key) === "symbol" ? key : String(key);
39120}
39121function _toPrimitive4(input, hint) {
39122  if (_typeof5(input) !== "object" || input === null)
39123    return input;
39124  var prim = input[Symbol.toPrimitive];
39125  if (prim !== undefined) {
39126    var res = prim.call(input, hint || "default");
39127    if (_typeof5(res) !== "object")
39128      return res;
39129    throw new TypeError("@@toPrimitive must return a primitive value.");
39130  }
39131  return (hint === "string" ? String : Number)(input);
39132}
39133function createStore(reducer, props, onStoreStateChange) {
39134  var state = props.initialState;
39135  return {
39136    getState: function getState() {
39137      return state;
39138    },
39139    dispatch: function dispatch(action, payload) {
39140      var prevState = _objectSpread4({}, state);
39141      state = reducer(state, {
39142        type: action,
39143        props,
39144        payload
39145      });
39146      onStoreStateChange({
39147        state,
39148        prevState
39149      });
39150    },
39151    pendingRequests: createCancelablePromiseList()
39152  };
39153}
39154

vendor: 3,280 bytes, lines 39155-39249

39155// node_modules/@algolia/autocomplete-core/dist/esm/getAutocompleteSetters.js
39156function _typeof6(obj2) {
39157  "@babel/helpers - typeof";
39158  return _typeof6 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39159    return typeof obj2;
39160  } : function(obj2) {
39161    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39162  }, _typeof6(obj2);
39163}
39164function ownKeys5(object, enumerableOnly) {
39165  var keys = Object.keys(object);
39166  if (Object.getOwnPropertySymbols) {
39167    var symbols = Object.getOwnPropertySymbols(object);
39168    enumerableOnly && (symbols = symbols.filter(function(sym) {
39169      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39170    })), keys.push.apply(keys, symbols);
39171  }
39172  return keys;
39173}
39174function _objectSpread5(target) {
39175  for (var i = 1;i < arguments.length; i++) {
39176    var source = arguments[i] != null ? arguments[i] : {};
39177    i % 2 ? ownKeys5(Object(source), true).forEach(function(key) {
39178      _defineProperty5(target, key, source[key]);
39179    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys5(Object(source)).forEach(function(key) {
39180      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39181    });
39182  }
39183  return target;
39184}
39185function _defineProperty5(obj2, key, value) {
39186  key = _toPropertyKey5(key);
39187  if (key in obj2) {
39188    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39189  } else {
39190    obj2[key] = value;
39191  }
39192  return obj2;
39193}
39194function _toPropertyKey5(arg) {
39195  var key = _toPrimitive5(arg, "string");
39196  return _typeof6(key) === "symbol" ? key : String(key);
39197}
39198function _toPrimitive5(input, hint) {
39199  if (_typeof6(input) !== "object" || input === null)
39200    return input;
39201  var prim = input[Symbol.toPrimitive];
39202  if (prim !== undefined) {
39203    var res = prim.call(input, hint || "default");
39204    if (_typeof6(res) !== "object")
39205      return res;
39206    throw new TypeError("@@toPrimitive must return a primitive value.");
39207  }
39208  return (hint === "string" ? String : Number)(input);
39209}
39210function getAutocompleteSetters(_ref) {
39211  var store = _ref.store;
39212  var setActiveItemId = function setActiveItemId(value) {
39213    store.dispatch("setActiveItemId", value);
39214  };
39215  var setQuery = function setQuery(value) {
39216    store.dispatch("setQuery", value);
39217  };
39218  var setCollections = function setCollections(rawValue) {
39219    var baseItemId = 0;
39220    var value = rawValue.map(function(collection) {
39221      return _objectSpread5(_objectSpread5({}, collection), {}, {
39222        items: flatten(collection.items).map(function(item) {
39223          return _objectSpread5(_objectSpread5({}, item), {}, {
39224            __autocomplete_id: baseItemId++
39225          });
39226        })
39227      });
39228    });
39229    store.dispatch("setCollections", value);
39230  };
39231  var setIsOpen = function setIsOpen(value) {
39232    store.dispatch("setIsOpen", value);
39233  };
39234  var setStatus = function setStatus(value) {
39235    store.dispatch("setStatus", value);
39236  };
39237  var setContext = function setContext(value) {
39238    store.dispatch("setContext", value);
39239  };
39240  return {
39241    setActiveItemId,
39242    setQuery,
39243    setCollections,
39244    setIsOpen,
39245    setStatus,
39246    setContext
39247  };
39248}
39249

vendor: 7,906 bytes, lines 39250-39451

39250// node_modules/@algolia/autocomplete-core/dist/esm/getDefaultProps.js
39251function _typeof7(obj2) {
39252  "@babel/helpers - typeof";
39253  return _typeof7 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39254    return typeof obj2;
39255  } : function(obj2) {
39256    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39257  }, _typeof7(obj2);
39258}
39259function _toConsumableArray3(arr) {
39260  return _arrayWithoutHoles3(arr) || _iterableToArray3(arr) || _unsupportedIterableToArray6(arr) || _nonIterableSpread3();
39261}
39262function _nonIterableSpread3() {
39263  throw new TypeError(`Invalid attempt to spread non-iterable instance.
39264In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
39265}
39266function _unsupportedIterableToArray6(o, minLen) {
39267  if (!o)
39268    return;
39269  if (typeof o === "string")
39270    return _arrayLikeToArray6(o, minLen);
39271  var n = Object.prototype.toString.call(o).slice(8, -1);
39272  if (n === "Object" && o.constructor)
39273    n = o.constructor.name;
39274  if (n === "Map" || n === "Set")
39275    return Array.from(o);
39276  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
39277    return _arrayLikeToArray6(o, minLen);
39278}
39279function _iterableToArray3(iter) {
39280  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
39281    return Array.from(iter);
39282}
39283function _arrayWithoutHoles3(arr) {
39284  if (Array.isArray(arr))
39285    return _arrayLikeToArray6(arr);
39286}
39287function _arrayLikeToArray6(arr, len) {
39288  if (len == null || len > arr.length)
39289    len = arr.length;
39290  for (var i = 0, arr2 = new Array(len);i < len; i++)
39291    arr2[i] = arr[i];
39292  return arr2;
39293}
39294function ownKeys6(object, enumerableOnly) {
39295  var keys = Object.keys(object);
39296  if (Object.getOwnPropertySymbols) {
39297    var symbols = Object.getOwnPropertySymbols(object);
39298    enumerableOnly && (symbols = symbols.filter(function(sym) {
39299      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39300    })), keys.push.apply(keys, symbols);
39301  }
39302  return keys;
39303}
39304function _objectSpread6(target) {
39305  for (var i = 1;i < arguments.length; i++) {
39306    var source = arguments[i] != null ? arguments[i] : {};
39307    i % 2 ? ownKeys6(Object(source), true).forEach(function(key) {
39308      _defineProperty6(target, key, source[key]);
39309    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys6(Object(source)).forEach(function(key) {
39310      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39311    });
39312  }
39313  return target;
39314}
39315function _defineProperty6(obj2, key, value) {
39316  key = _toPropertyKey6(key);
39317  if (key in obj2) {
39318    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39319  } else {
39320    obj2[key] = value;
39321  }
39322  return obj2;
39323}
39324function _toPropertyKey6(arg) {
39325  var key = _toPrimitive6(arg, "string");
39326  return _typeof7(key) === "symbol" ? key : String(key);
39327}
39328function _toPrimitive6(input, hint) {
39329  if (_typeof7(input) !== "object" || input === null)
39330    return input;
39331  var prim = input[Symbol.toPrimitive];
39332  if (prim !== undefined) {
39333    var res = prim.call(input, hint || "default");
39334    if (_typeof7(res) !== "object")
39335      return res;
39336    throw new TypeError("@@toPrimitive must return a primitive value.");
39337  }
39338  return (hint === "string" ? String : Number)(input);
39339}
39340function getDefaultProps(props, pluginSubscribers) {
39341  var _props$id;
39342  var environment = typeof window !== "undefined" ? window : {};
39343  var plugins = props.plugins || [];
39344  return _objectSpread6(_objectSpread6({
39345    debug: false,
39346    openOnFocus: false,
39347    enterKeyHint: undefined,
39348    ignoreCompositionEvents: false,
39349    placeholder: "",
39350    autoFocus: false,
39351    defaultActiveItemId: null,
39352    stallThreshold: 300,
39353    insights: undefined,
39354    environment,
39355    shouldPanelOpen: function shouldPanelOpen(_ref) {
39356      var state = _ref.state;
39357      return getItemsCount(state) > 0;
39358    },
39359    reshape: function reshape(_ref2) {
39360      var sources = _ref2.sources;
39361      return sources;
39362    }
39363  }, props), {}, {
39364    id: (_props$id = props.id) !== null && _props$id !== undefined ? _props$id : generateAutocompleteId(),
39365    plugins,
39366    initialState: _objectSpread6({
39367      activeItemId: null,
39368      query: "",
39369      completion: null,
39370      collections: [],
39371      isOpen: false,
39372      status: "idle",
39373      context: {}
39374    }, props.initialState),
39375    onStateChange: function onStateChange(params) {
39376      var _props$onStateChange;
39377      (_props$onStateChange = props.onStateChange) === null || _props$onStateChange === undefined || _props$onStateChange.call(props, params);
39378      plugins.forEach(function(x) {
39379        var _x$onStateChange;
39380        return (_x$onStateChange = x.onStateChange) === null || _x$onStateChange === undefined ? undefined : _x$onStateChange.call(x, params);
39381      });
39382    },
39383    onSubmit: function onSubmit(params) {
39384      var _props$onSubmit;
39385      (_props$onSubmit = props.onSubmit) === null || _props$onSubmit === undefined || _props$onSubmit.call(props, params);
39386      plugins.forEach(function(x) {
39387        var _x$onSubmit;
39388        return (_x$onSubmit = x.onSubmit) === null || _x$onSubmit === undefined ? undefined : _x$onSubmit.call(x, params);
39389      });
39390    },
39391    onReset: function onReset(params) {
39392      var _props$onReset;
39393      (_props$onReset = props.onReset) === null || _props$onReset === undefined || _props$onReset.call(props, params);
39394      plugins.forEach(function(x) {
39395        var _x$onReset;
39396        return (_x$onReset = x.onReset) === null || _x$onReset === undefined ? undefined : _x$onReset.call(x, params);
39397      });
39398    },
39399    getSources: function getSources(params) {
39400      return Promise.all([].concat(_toConsumableArray3(plugins.map(function(plugin) {
39401        return plugin.getSources;
39402      })), [props.getSources]).filter(Boolean).map(function(getSources) {
39403        return getNormalizedSources(getSources, params);
39404      })).then(function(nested) {
39405        return flatten(nested);
39406      }).then(function(sources) {
39407        return sources.map(function(source) {
39408          return _objectSpread6(_objectSpread6({}, source), {}, {
39409            onSelect: function onSelect(params) {
39410              source.onSelect(params);
39411              pluginSubscribers.forEach(function(x) {
39412                var _x$onSelect;
39413                return (_x$onSelect = x.onSelect) === null || _x$onSelect === undefined ? undefined : _x$onSelect.call(x, params);
39414              });
39415            },
39416            onActive: function onActive(params) {
39417              source.onActive(params);
39418              pluginSubscribers.forEach(function(x) {
39419                var _x$onActive;
39420                return (_x$onActive = x.onActive) === null || _x$onActive === undefined ? undefined : _x$onActive.call(x, params);
39421              });
39422            },
39423            onResolve: function onResolve(params) {
39424              source.onResolve(params);
39425              pluginSubscribers.forEach(function(x) {
39426                var _x$onResolve;
39427                return (_x$onResolve = x.onResolve) === null || _x$onResolve === undefined ? undefined : _x$onResolve.call(x, params);
39428              });
39429            }
39430          });
39431        });
39432      });
39433    },
39434    navigator: _objectSpread6({
39435      navigate: function navigate(_ref3) {
39436        var itemUrl = _ref3.itemUrl;
39437        environment.location.assign(itemUrl);
39438      },
39439      navigateNewTab: function navigateNewTab(_ref4) {
39440        var itemUrl = _ref4.itemUrl;
39441        var windowReference = environment.open(itemUrl, "_blank", "noopener");
39442        windowReference === null || windowReference === undefined || windowReference.focus();
39443      },
39444      navigateNewWindow: function navigateNewWindow(_ref5) {
39445        var itemUrl = _ref5.itemUrl;
39446        environment.open(itemUrl, "_blank", "noopener");
39447      }
39448    }, props.navigator)
39449  });
39450}
39451

vendor: 3,127 bytes, lines 39452-39537

39452// node_modules/@algolia/autocomplete-core/dist/esm/reshape.js
39453function _typeof8(obj2) {
39454  "@babel/helpers - typeof";
39455  return _typeof8 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39456    return typeof obj2;
39457  } : function(obj2) {
39458    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39459  }, _typeof8(obj2);
39460}
39461function ownKeys7(object, enumerableOnly) {
39462  var keys = Object.keys(object);
39463  if (Object.getOwnPropertySymbols) {
39464    var symbols = Object.getOwnPropertySymbols(object);
39465    enumerableOnly && (symbols = symbols.filter(function(sym) {
39466      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39467    })), keys.push.apply(keys, symbols);
39468  }
39469  return keys;
39470}
39471function _objectSpread7(target) {
39472  for (var i = 1;i < arguments.length; i++) {
39473    var source = arguments[i] != null ? arguments[i] : {};
39474    i % 2 ? ownKeys7(Object(source), true).forEach(function(key) {
39475      _defineProperty7(target, key, source[key]);
39476    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys7(Object(source)).forEach(function(key) {
39477      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39478    });
39479  }
39480  return target;
39481}
39482function _defineProperty7(obj2, key, value) {
39483  key = _toPropertyKey7(key);
39484  if (key in obj2) {
39485    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39486  } else {
39487    obj2[key] = value;
39488  }
39489  return obj2;
39490}
39491function _toPropertyKey7(arg) {
39492  var key = _toPrimitive7(arg, "string");
39493  return _typeof8(key) === "symbol" ? key : String(key);
39494}
39495function _toPrimitive7(input, hint) {
39496  if (_typeof8(input) !== "object" || input === null)
39497    return input;
39498  var prim = input[Symbol.toPrimitive];
39499  if (prim !== undefined) {
39500    var res = prim.call(input, hint || "default");
39501    if (_typeof8(res) !== "object")
39502      return res;
39503    throw new TypeError("@@toPrimitive must return a primitive value.");
39504  }
39505  return (hint === "string" ? String : Number)(input);
39506}
39507function reshape(_ref) {
39508  var { collections, props, state } = _ref;
39509  var originalSourcesBySourceId = collections.reduce(function(acc, collection) {
39510    return _objectSpread7(_objectSpread7({}, acc), {}, _defineProperty7({}, collection.source.sourceId, _objectSpread7(_objectSpread7({}, collection.source), {}, {
39511      getItems: function getItems() {
39512        return flatten(collection.items);
39513      }
39514    })));
39515  }, {});
39516  var _props$plugins$reduce = props.plugins.reduce(function(acc, plugin) {
39517    if (plugin.reshape) {
39518      return plugin.reshape(acc);
39519    }
39520    return acc;
39521  }, {
39522    sourcesBySourceId: originalSourcesBySourceId,
39523    state
39524  }), sourcesBySourceId = _props$plugins$reduce.sourcesBySourceId;
39525  var reshapeSources = props.reshape({
39526    sourcesBySourceId,
39527    sources: Object.values(sourcesBySourceId),
39528    state
39529  });
39530  return flatten(reshapeSources).filter(Boolean).map(function(source) {
39531    return {
39532      source,
39533      items: source.getItems()
39534    };
39535  });
39536}
39537

vendor: 7,183 bytes, lines 39538-39730

39538// node_modules/@algolia/autocomplete-core/dist/esm/resolve.js
39539function _typeof9(obj2) {
39540  "@babel/helpers - typeof";
39541  return _typeof9 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39542    return typeof obj2;
39543  } : function(obj2) {
39544    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39545  }, _typeof9(obj2);
39546}
39547function ownKeys8(object, enumerableOnly) {
39548  var keys = Object.keys(object);
39549  if (Object.getOwnPropertySymbols) {
39550    var symbols = Object.getOwnPropertySymbols(object);
39551    enumerableOnly && (symbols = symbols.filter(function(sym) {
39552      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39553    })), keys.push.apply(keys, symbols);
39554  }
39555  return keys;
39556}
39557function _objectSpread8(target) {
39558  for (var i = 1;i < arguments.length; i++) {
39559    var source = arguments[i] != null ? arguments[i] : {};
39560    i % 2 ? ownKeys8(Object(source), true).forEach(function(key) {
39561      _defineProperty8(target, key, source[key]);
39562    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys8(Object(source)).forEach(function(key) {
39563      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39564    });
39565  }
39566  return target;
39567}
39568function _defineProperty8(obj2, key, value) {
39569  key = _toPropertyKey8(key);
39570  if (key in obj2) {
39571    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39572  } else {
39573    obj2[key] = value;
39574  }
39575  return obj2;
39576}
39577function _toPropertyKey8(arg) {
39578  var key = _toPrimitive8(arg, "string");
39579  return _typeof9(key) === "symbol" ? key : String(key);
39580}
39581function _toPrimitive8(input, hint) {
39582  if (_typeof9(input) !== "object" || input === null)
39583    return input;
39584  var prim = input[Symbol.toPrimitive];
39585  if (prim !== undefined) {
39586    var res = prim.call(input, hint || "default");
39587    if (_typeof9(res) !== "object")
39588      return res;
39589    throw new TypeError("@@toPrimitive must return a primitive value.");
39590  }
39591  return (hint === "string" ? String : Number)(input);
39592}
39593function _toConsumableArray4(arr) {
39594  return _arrayWithoutHoles4(arr) || _iterableToArray4(arr) || _unsupportedIterableToArray7(arr) || _nonIterableSpread4();
39595}
39596function _nonIterableSpread4() {
39597  throw new TypeError(`Invalid attempt to spread non-iterable instance.
39598In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
39599}
39600function _unsupportedIterableToArray7(o, minLen) {
39601  if (!o)
39602    return;
39603  if (typeof o === "string")
39604    return _arrayLikeToArray7(o, minLen);
39605  var n = Object.prototype.toString.call(o).slice(8, -1);
39606  if (n === "Object" && o.constructor)
39607    n = o.constructor.name;
39608  if (n === "Map" || n === "Set")
39609    return Array.from(o);
39610  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
39611    return _arrayLikeToArray7(o, minLen);
39612}
39613function _iterableToArray4(iter) {
39614  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
39615    return Array.from(iter);
39616}
39617function _arrayWithoutHoles4(arr) {
39618  if (Array.isArray(arr))
39619    return _arrayLikeToArray7(arr);
39620}
39621function _arrayLikeToArray7(arr, len) {
39622  if (len == null || len > arr.length)
39623    len = arr.length;
39624  for (var i = 0, arr2 = new Array(len);i < len; i++)
39625    arr2[i] = arr[i];
39626  return arr2;
39627}
39628function isDescription(item) {
39629  return Boolean(item.execute);
39630}
39631function isRequesterDescription(description) {
39632  return Boolean(description === null || description === undefined ? undefined : description.execute);
39633}
39634function preResolve(itemsOrDescription, sourceId, state) {
39635  if (isRequesterDescription(itemsOrDescription)) {
39636    var contextParameters = itemsOrDescription.requesterId === "algolia" ? Object.assign.apply(Object, [{}].concat(_toConsumableArray4(Object.keys(state.context).map(function(key) {
39637      var _state$context$key;
39638      return (_state$context$key = state.context[key]) === null || _state$context$key === undefined ? undefined : _state$context$key.__algoliaSearchParameters;
39639    })))) : {};
39640    return _objectSpread8(_objectSpread8({}, itemsOrDescription), {}, {
39641      requests: itemsOrDescription.queries.map(function(query) {
39642        return {
39643          query: itemsOrDescription.requesterId === "algolia" ? _objectSpread8(_objectSpread8({}, query), {}, {
39644            params: _objectSpread8(_objectSpread8({}, contextParameters), query.params)
39645          }) : query,
39646          sourceId,
39647          transformResponse: itemsOrDescription.transformResponse
39648        };
39649      })
39650    });
39651  }
39652  return {
39653    items: itemsOrDescription,
39654    sourceId
39655  };
39656}
39657function resolve(items) {
39658  var packed = items.reduce(function(acc, current) {
39659    if (!isDescription(current)) {
39660      acc.push(current);
39661      return acc;
39662    }
39663    var { searchClient, execute, requesterId, requests: requests2 } = current;
39664    var container = acc.find(function(item) {
39665      return isDescription(current) && isDescription(item) && item.searchClient === searchClient && Boolean(requesterId) && item.requesterId === requesterId;
39666    });
39667    if (container) {
39668      var _container$items;
39669      (_container$items = container.items).push.apply(_container$items, _toConsumableArray4(requests2));
39670    } else {
39671      var request = {
39672        execute,
39673        requesterId,
39674        items: requests2,
39675        searchClient
39676      };
39677      acc.push(request);
39678    }
39679    return acc;
39680  }, []);
39681  var values = packed.map(function(maybeDescription) {
39682    if (!isDescription(maybeDescription)) {
39683      return Promise.resolve(maybeDescription);
39684    }
39685    var _ref = maybeDescription, { execute, items, searchClient } = _ref;
39686    return execute({
39687      searchClient,
39688      requests: items
39689    });
39690  });
39691  return Promise.all(values).then(function(responses) {
39692    return flatten(responses);
39693  });
39694}
39695function postResolve(responses, sources, store) {
39696  return sources.map(function(source) {
39697    var matches = responses.filter(function(response) {
39698      return response.sourceId === source.sourceId;
39699    });
39700    var results = matches.map(function(_ref2) {
39701      var items = _ref2.items;
39702      return items;
39703    });
39704    var transform = matches[0].transformResponse;
39705    var items = transform ? transform(mapToAlgoliaResponse(results)) : results;
39706    source.onResolve({
39707      source,
39708      results,
39709      items,
39710      state: store.getState()
39711    });
39712    invariant(Array.isArray(items), function() {
39713      return 'The `getItems` function from source "'.concat(source.sourceId, '" must return an array of items but returned type ').concat(JSON.stringify(_typeof9(items)), `:
39714
39715`).concat(JSON.stringify(decycle(items), null, 2), `.
39716
39717See: https://www.algolia.com/doc/ui-libraries/autocomplete/core-concepts/sources/#param-getitems`);
39718    });
39719    invariant(items.every(Boolean), 'The `getItems` function from source "'.concat(source.sourceId, '" must return an array of items but returned ').concat(JSON.stringify(undefined), `.
39720
39721Did you forget to return items?
39722
39723See: https://www.algolia.com/doc/ui-libraries/autocomplete/core-concepts/sources/#param-getitems`));
39724    return {
39725      source,
39726      items
39727    };
39728  });
39729}
39730

vendor: 6,982 bytes, lines 39731-39916

39731// node_modules/@algolia/autocomplete-core/dist/esm/onInput.js
39732function _typeof10(obj2) {
39733  "@babel/helpers - typeof";
39734  return _typeof10 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39735    return typeof obj2;
39736  } : function(obj2) {
39737    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39738  }, _typeof10(obj2);
39739}
39740var _excluded3 = ["event", "nextState", "props", "query", "refresh", "store"];
39741function ownKeys9(object, enumerableOnly) {
39742  var keys = Object.keys(object);
39743  if (Object.getOwnPropertySymbols) {
39744    var symbols = Object.getOwnPropertySymbols(object);
39745    enumerableOnly && (symbols = symbols.filter(function(sym) {
39746      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39747    })), keys.push.apply(keys, symbols);
39748  }
39749  return keys;
39750}
39751function _objectSpread9(target) {
39752  for (var i = 1;i < arguments.length; i++) {
39753    var source = arguments[i] != null ? arguments[i] : {};
39754    i % 2 ? ownKeys9(Object(source), true).forEach(function(key) {
39755      _defineProperty9(target, key, source[key]);
39756    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys9(Object(source)).forEach(function(key) {
39757      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39758    });
39759  }
39760  return target;
39761}
39762function _defineProperty9(obj2, key, value) {
39763  key = _toPropertyKey9(key);
39764  if (key in obj2) {
39765    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39766  } else {
39767    obj2[key] = value;
39768  }
39769  return obj2;
39770}
39771function _toPropertyKey9(arg) {
39772  var key = _toPrimitive9(arg, "string");
39773  return _typeof10(key) === "symbol" ? key : String(key);
39774}
39775function _toPrimitive9(input, hint) {
39776  if (_typeof10(input) !== "object" || input === null)
39777    return input;
39778  var prim = input[Symbol.toPrimitive];
39779  if (prim !== undefined) {
39780    var res = prim.call(input, hint || "default");
39781    if (_typeof10(res) !== "object")
39782      return res;
39783    throw new TypeError("@@toPrimitive must return a primitive value.");
39784  }
39785  return (hint === "string" ? String : Number)(input);
39786}
39787function _objectWithoutProperties2(source, excluded) {
39788  if (source == null)
39789    return {};
39790  var target = _objectWithoutPropertiesLoose2(source, excluded);
39791  var key, i;
39792  if (Object.getOwnPropertySymbols) {
39793    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
39794    for (i = 0;i < sourceSymbolKeys.length; i++) {
39795      key = sourceSymbolKeys[i];
39796      if (excluded.indexOf(key) >= 0)
39797        continue;
39798      if (!Object.prototype.propertyIsEnumerable.call(source, key))
39799        continue;
39800      target[key] = source[key];
39801    }
39802  }
39803  return target;
39804}
39805function _objectWithoutPropertiesLoose2(source, excluded) {
39806  if (source == null)
39807    return {};
39808  var target = {};
39809  var sourceKeys = Object.keys(source);
39810  var key, i;
39811  for (i = 0;i < sourceKeys.length; i++) {
39812    key = sourceKeys[i];
39813    if (excluded.indexOf(key) >= 0)
39814      continue;
39815    target[key] = source[key];
39816  }
39817  return target;
39818}
39819var lastStalledId = null;
39820var runConcurrentSafePromise = createConcurrentSafePromise();
39821function onInput(_ref) {
39822  var { event, nextState: _ref$nextState } = _ref, nextState = _ref$nextState === undefined ? {} : _ref$nextState, { props, query, refresh, store } = _ref, setters = _objectWithoutProperties2(_ref, _excluded3);
39823  if (lastStalledId) {
39824    props.environment.clearTimeout(lastStalledId);
39825  }
39826  var { setCollections, setIsOpen, setQuery, setActiveItemId, setStatus, setContext } = setters;
39827  setQuery(query);
39828  setActiveItemId(props.defaultActiveItemId);
39829  if (!query && props.openOnFocus === false) {
39830    var _nextState$isOpen;
39831    var collections = store.getState().collections.map(function(collection) {
39832      return _objectSpread9(_objectSpread9({}, collection), {}, {
39833        items: []
39834      });
39835    });
39836    setStatus("idle");
39837    setCollections(collections);
39838    setIsOpen((_nextState$isOpen = nextState.isOpen) !== null && _nextState$isOpen !== undefined ? _nextState$isOpen : props.shouldPanelOpen({
39839      state: store.getState()
39840    }));
39841    var _request = cancelable(runConcurrentSafePromise(collections).then(function() {
39842      return Promise.resolve();
39843    }));
39844    return store.pendingRequests.add(_request);
39845  }
39846  setStatus("loading");
39847  lastStalledId = props.environment.setTimeout(function() {
39848    setStatus("stalled");
39849  }, props.stallThreshold);
39850  var request = cancelable(runConcurrentSafePromise(props.getSources(_objectSpread9({
39851    query,
39852    refresh,
39853    state: store.getState()
39854  }, setters)).then(function(sources) {
39855    return Promise.all(sources.map(function(source) {
39856      return Promise.resolve(source.getItems(_objectSpread9({
39857        query,
39858        refresh,
39859        state: store.getState()
39860      }, setters))).then(function(itemsOrDescription) {
39861        return preResolve(itemsOrDescription, source.sourceId, store.getState());
39862      });
39863    })).then(resolve).then(function(responses) {
39864      var __automaticInsights = responses.some(function(_ref2) {
39865        var items = _ref2.items;
39866        return isSearchResponseWithAutomaticInsightsFlag(items);
39867      });
39868      if (__automaticInsights) {
39869        var _store$getState$conte;
39870        setContext({
39871          algoliaInsightsPlugin: _objectSpread9(_objectSpread9({}, ((_store$getState$conte = store.getState().context) === null || _store$getState$conte === undefined ? undefined : _store$getState$conte.algoliaInsightsPlugin) || {}), {}, {
39872            __automaticInsights
39873          })
39874        });
39875      }
39876      return postResolve(responses, sources, store);
39877    }).then(function(collections) {
39878      return reshape({
39879        collections,
39880        props,
39881        state: store.getState()
39882      });
39883    });
39884  }))).then(function(collections) {
39885    var _nextState$isOpen2;
39886    setStatus("idle");
39887    setCollections(collections);
39888    var isPanelOpen = props.shouldPanelOpen({
39889      state: store.getState()
39890    });
39891    setIsOpen((_nextState$isOpen2 = nextState.isOpen) !== null && _nextState$isOpen2 !== undefined ? _nextState$isOpen2 : props.openOnFocus && !query && isPanelOpen || isPanelOpen);
39892    var highlightedItem = getActiveItem(store.getState());
39893    if (store.getState().activeItemId !== null && highlightedItem) {
39894      var { item, itemInputValue, itemUrl, source } = highlightedItem;
39895      source.onActive(_objectSpread9({
39896        event,
39897        item,
39898        itemInputValue,
39899        itemUrl,
39900        refresh,
39901        source,
39902        state: store.getState()
39903      }, setters));
39904    }
39905  }).finally(function() {
39906    setStatus("idle");
39907    if (lastStalledId) {
39908      props.environment.clearTimeout(lastStalledId);
39909    }
39910  });
39911  return store.pendingRequests.add(request);
39912}
39913function isSearchResponseWithAutomaticInsightsFlag(items) {
39914  return !Array.isArray(items) && Boolean(items === null || items === undefined ? undefined : items._automaticInsights);
39915}
39916

vendor: 7,498 bytes, lines 39917-40149

39917// node_modules/@algolia/autocomplete-core/dist/esm/onKeyDown.js
39918function _typeof11(obj2) {
39919  "@babel/helpers - typeof";
39920  return _typeof11 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
39921    return typeof obj2;
39922  } : function(obj2) {
39923    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
39924  }, _typeof11(obj2);
39925}
39926var _excluded4 = ["event", "props", "refresh", "store"];
39927function ownKeys10(object, enumerableOnly) {
39928  var keys = Object.keys(object);
39929  if (Object.getOwnPropertySymbols) {
39930    var symbols = Object.getOwnPropertySymbols(object);
39931    enumerableOnly && (symbols = symbols.filter(function(sym) {
39932      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
39933    })), keys.push.apply(keys, symbols);
39934  }
39935  return keys;
39936}
39937function _objectSpread10(target) {
39938  for (var i = 1;i < arguments.length; i++) {
39939    var source = arguments[i] != null ? arguments[i] : {};
39940    i % 2 ? ownKeys10(Object(source), true).forEach(function(key) {
39941      _defineProperty10(target, key, source[key]);
39942    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys10(Object(source)).forEach(function(key) {
39943      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
39944    });
39945  }
39946  return target;
39947}
39948function _defineProperty10(obj2, key, value) {
39949  key = _toPropertyKey10(key);
39950  if (key in obj2) {
39951    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
39952  } else {
39953    obj2[key] = value;
39954  }
39955  return obj2;
39956}
39957function _toPropertyKey10(arg) {
39958  var key = _toPrimitive10(arg, "string");
39959  return _typeof11(key) === "symbol" ? key : String(key);
39960}
39961function _toPrimitive10(input, hint) {
39962  if (_typeof11(input) !== "object" || input === null)
39963    return input;
39964  var prim = input[Symbol.toPrimitive];
39965  if (prim !== undefined) {
39966    var res = prim.call(input, hint || "default");
39967    if (_typeof11(res) !== "object")
39968      return res;
39969    throw new TypeError("@@toPrimitive must return a primitive value.");
39970  }
39971  return (hint === "string" ? String : Number)(input);
39972}
39973function _objectWithoutProperties3(source, excluded) {
39974  if (source == null)
39975    return {};
39976  var target = _objectWithoutPropertiesLoose3(source, excluded);
39977  var key, i;
39978  if (Object.getOwnPropertySymbols) {
39979    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
39980    for (i = 0;i < sourceSymbolKeys.length; i++) {
39981      key = sourceSymbolKeys[i];
39982      if (excluded.indexOf(key) >= 0)
39983        continue;
39984      if (!Object.prototype.propertyIsEnumerable.call(source, key))
39985        continue;
39986      target[key] = source[key];
39987    }
39988  }
39989  return target;
39990}
39991function _objectWithoutPropertiesLoose3(source, excluded) {
39992  if (source == null)
39993    return {};
39994  var target = {};
39995  var sourceKeys = Object.keys(source);
39996  var key, i;
39997  for (i = 0;i < sourceKeys.length; i++) {
39998    key = sourceKeys[i];
39999    if (excluded.indexOf(key) >= 0)
40000      continue;
40001    target[key] = source[key];
40002  }
40003  return target;
40004}
40005function onKeyDown(_ref) {
40006  var { event, props, refresh, store } = _ref, setters = _objectWithoutProperties3(_ref, _excluded4);
40007  if (event.key === "ArrowUp" || event.key === "ArrowDown") {
40008    var triggerScrollIntoView = function triggerScrollIntoView() {
40009      var highlightedItem = getActiveItem(store.getState());
40010      var nodeItem = props.environment.document.getElementById(getAutocompleteElementId(props.id, "item-".concat(store.getState().activeItemId), highlightedItem === null || highlightedItem === undefined ? undefined : highlightedItem.source));
40011      if (nodeItem) {
40012        nodeItem.scrollIntoView({
40013          block: "nearest",
40014          inline: "nearest"
40015        });
40016      }
40017    };
40018    var triggerOnActive = function triggerOnActive() {
40019      var highlightedItem = getActiveItem(store.getState());
40020      if (store.getState().activeItemId !== null && highlightedItem) {
40021        var { item, itemInputValue, itemUrl, source } = highlightedItem;
40022        source.onActive(_objectSpread10({
40023          event,
40024          item,
40025          itemInputValue,
40026          itemUrl,
40027          refresh,
40028          source,
40029          state: store.getState()
40030        }, setters));
40031      }
40032    };
40033    event.preventDefault();
40034    if (store.getState().isOpen === false && (props.openOnFocus || Boolean(store.getState().query))) {
40035      onInput(_objectSpread10({
40036        event,
40037        props,
40038        query: store.getState().query,
40039        refresh,
40040        store
40041      }, setters)).then(function() {
40042        store.dispatch(event.key, {
40043          nextActiveItemId: props.defaultActiveItemId
40044        });
40045        triggerOnActive();
40046        setTimeout(triggerScrollIntoView, 0);
40047      });
40048    } else {
40049      store.dispatch(event.key, {});
40050      triggerOnActive();
40051      triggerScrollIntoView();
40052    }
40053  } else if (event.key === "Escape") {
40054    event.preventDefault();
40055    store.dispatch(event.key, null);
40056    store.pendingRequests.cancelAll();
40057  } else if (event.key === "Tab") {
40058    store.dispatch("blur", null);
40059    store.pendingRequests.cancelAll();
40060  } else if (event.key === "Enter") {
40061    if (store.getState().activeItemId === null || store.getState().collections.every(function(collection) {
40062      return collection.items.length === 0;
40063    })) {
40064      var waitForSubmit = getPluginSubmitPromise(props.plugins, store.pendingRequests);
40065      if (waitForSubmit !== undefined) {
40066        waitForSubmit.then(store.pendingRequests.cancelAll);
40067      } else if (!props.debug) {
40068        store.pendingRequests.cancelAll();
40069      }
40070      return;
40071    }
40072    event.preventDefault();
40073    var _ref2 = getActiveItem(store.getState()), { item, itemInputValue, itemUrl, source } = _ref2;
40074    if (event.metaKey || event.ctrlKey) {
40075      if (itemUrl !== undefined) {
40076        source.onSelect(_objectSpread10({
40077          event,
40078          item,
40079          itemInputValue,
40080          itemUrl,
40081          refresh,
40082          source,
40083          state: store.getState()
40084        }, setters));
40085        props.navigator.navigateNewTab({
40086          itemUrl,
40087          item,
40088          state: store.getState()
40089        });
40090      }
40091    } else if (event.shiftKey) {
40092      if (itemUrl !== undefined) {
40093        source.onSelect(_objectSpread10({
40094          event,
40095          item,
40096          itemInputValue,
40097          itemUrl,
40098          refresh,
40099          source,
40100          state: store.getState()
40101        }, setters));
40102        props.navigator.navigateNewWindow({
40103          itemUrl,
40104          item,
40105          state: store.getState()
40106        });
40107      }
40108    } else if (event.altKey) {} else {
40109      if (itemUrl !== undefined) {
40110        source.onSelect(_objectSpread10({
40111          event,
40112          item,
40113          itemInputValue,
40114          itemUrl,
40115          refresh,
40116          source,
40117          state: store.getState()
40118        }, setters));
40119        props.navigator.navigate({
40120          itemUrl,
40121          item,
40122          state: store.getState()
40123        });
40124        return;
40125      }
40126      onInput(_objectSpread10({
40127        event,
40128        nextState: {
40129          isOpen: false
40130        },
40131        props,
40132        query: itemInputValue,
40133        refresh,
40134        store
40135      }, setters)).then(function() {
40136        source.onSelect(_objectSpread10({
40137          event,
40138          item,
40139          itemInputValue,
40140          itemUrl,
40141          refresh,
40142          source,
40143          state: store.getState()
40144        }, setters));
40145      });
40146    }
40147  }
40148}
40149

vendor: 13,082 bytes, lines 40150-40504

40150// node_modules/@algolia/autocomplete-core/dist/esm/getPropGetters.js
40151function _typeof12(obj2) {
40152  "@babel/helpers - typeof";
40153  return _typeof12 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
40154    return typeof obj2;
40155  } : function(obj2) {
40156    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
40157  }, _typeof12(obj2);
40158}
40159var _excluded5 = ["props", "refresh", "store"];
40160var _excluded22 = ["inputElement", "formElement", "panelElement"];
40161var _excluded32 = ["inputElement"];
40162var _excluded42 = ["inputElement", "maxLength"];
40163var _excluded52 = ["source"];
40164var _excluded6 = ["item", "source"];
40165function ownKeys11(object, enumerableOnly) {
40166  var keys = Object.keys(object);
40167  if (Object.getOwnPropertySymbols) {
40168    var symbols = Object.getOwnPropertySymbols(object);
40169    enumerableOnly && (symbols = symbols.filter(function(sym) {
40170      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
40171    })), keys.push.apply(keys, symbols);
40172  }
40173  return keys;
40174}
40175function _objectSpread11(target) {
40176  for (var i = 1;i < arguments.length; i++) {
40177    var source = arguments[i] != null ? arguments[i] : {};
40178    i % 2 ? ownKeys11(Object(source), true).forEach(function(key) {
40179      _defineProperty11(target, key, source[key]);
40180    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys11(Object(source)).forEach(function(key) {
40181      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
40182    });
40183  }
40184  return target;
40185}
40186function _defineProperty11(obj2, key, value) {
40187  key = _toPropertyKey11(key);
40188  if (key in obj2) {
40189    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
40190  } else {
40191    obj2[key] = value;
40192  }
40193  return obj2;
40194}
40195function _toPropertyKey11(arg) {
40196  var key = _toPrimitive11(arg, "string");
40197  return _typeof12(key) === "symbol" ? key : String(key);
40198}
40199function _toPrimitive11(input, hint) {
40200  if (_typeof12(input) !== "object" || input === null)
40201    return input;
40202  var prim = input[Symbol.toPrimitive];
40203  if (prim !== undefined) {
40204    var res = prim.call(input, hint || "default");
40205    if (_typeof12(res) !== "object")
40206      return res;
40207    throw new TypeError("@@toPrimitive must return a primitive value.");
40208  }
40209  return (hint === "string" ? String : Number)(input);
40210}
40211function _objectWithoutProperties4(source, excluded) {
40212  if (source == null)
40213    return {};
40214  var target = _objectWithoutPropertiesLoose4(source, excluded);
40215  var key, i;
40216  if (Object.getOwnPropertySymbols) {
40217    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
40218    for (i = 0;i < sourceSymbolKeys.length; i++) {
40219      key = sourceSymbolKeys[i];
40220      if (excluded.indexOf(key) >= 0)
40221        continue;
40222      if (!Object.prototype.propertyIsEnumerable.call(source, key))
40223        continue;
40224      target[key] = source[key];
40225    }
40226  }
40227  return target;
40228}
40229function _objectWithoutPropertiesLoose4(source, excluded) {
40230  if (source == null)
40231    return {};
40232  var target = {};
40233  var sourceKeys = Object.keys(source);
40234  var key, i;
40235  for (i = 0;i < sourceKeys.length; i++) {
40236    key = sourceKeys[i];
40237    if (excluded.indexOf(key) >= 0)
40238      continue;
40239    target[key] = source[key];
40240  }
40241  return target;
40242}
40243function getPropGetters(_ref) {
40244  var { props, refresh, store } = _ref, setters = _objectWithoutProperties4(_ref, _excluded5);
40245  var getEnvironmentProps = function getEnvironmentProps(providedProps) {
40246    var { inputElement, formElement, panelElement } = providedProps, rest = _objectWithoutProperties4(providedProps, _excluded22);
40247    function onMouseDownOrTouchStart(event) {
40248      var isAutocompleteInteraction = store.getState().isOpen || !store.pendingRequests.isEmpty();
40249      if (!isAutocompleteInteraction || event.target === inputElement) {
40250        return;
40251      }
40252      var isTargetWithinAutocomplete = [formElement, panelElement].some(function(contextNode) {
40253        return isOrContainsNode(contextNode, event.target);
40254      });
40255      if (isTargetWithinAutocomplete === false) {
40256        store.dispatch("blur", null);
40257        if (!props.debug) {
40258          store.pendingRequests.cancelAll();
40259        }
40260      }
40261    }
40262    return _objectSpread11({
40263      onTouchStart: onMouseDownOrTouchStart,
40264      onMouseDown: onMouseDownOrTouchStart,
40265      onTouchMove: function onTouchMove(event) {
40266        if (store.getState().isOpen === false || inputElement !== props.environment.document.activeElement || event.target === inputElement) {
40267          return;
40268        }
40269        inputElement.blur();
40270      }
40271    }, rest);
40272  };
40273  var getRootProps = function getRootProps(rest) {
40274    return _objectSpread11({
40275      role: "combobox",
40276      "aria-expanded": store.getState().isOpen,
40277      "aria-haspopup": "listbox",
40278      "aria-controls": store.getState().isOpen ? store.getState().collections.map(function(_ref2) {
40279        var source = _ref2.source;
40280        return getAutocompleteElementId(props.id, "list", source);
40281      }).join(" ") : undefined,
40282      "aria-labelledby": getAutocompleteElementId(props.id, "label")
40283    }, rest);
40284  };
40285  var getFormProps = function getFormProps(providedProps) {
40286    var inputElement = providedProps.inputElement, rest = _objectWithoutProperties4(providedProps, _excluded32);
40287    var handleSubmit = function handleSubmit(event) {
40288      var _providedProps$inputE;
40289      props.onSubmit(_objectSpread11({
40290        event,
40291        refresh,
40292        state: store.getState()
40293      }, setters));
40294      store.dispatch("submit", null);
40295      (_providedProps$inputE = providedProps.inputElement) === null || _providedProps$inputE === undefined || _providedProps$inputE.blur();
40296    };
40297    return _objectSpread11({
40298      action: "",
40299      noValidate: true,
40300      role: "search",
40301      onSubmit: function onSubmit(event) {
40302        event.preventDefault();
40303        var waitForSubmit = getPluginSubmitPromise(props.plugins, store.pendingRequests);
40304        if (waitForSubmit !== undefined) {
40305          waitForSubmit.then(function() {
40306            return handleSubmit(event);
40307          });
40308        } else {
40309          handleSubmit(event);
40310        }
40311      },
40312      onReset: function onReset(event) {
40313        var _providedProps$inputE2;
40314        event.preventDefault();
40315        props.onReset(_objectSpread11({
40316          event,
40317          refresh,
40318          state: store.getState()
40319        }, setters));
40320        store.dispatch("reset", null);
40321        (_providedProps$inputE2 = providedProps.inputElement) === null || _providedProps$inputE2 === undefined || _providedProps$inputE2.focus();
40322      }
40323    }, rest);
40324  };
40325  var getInputProps = function getInputProps(providedProps) {
40326    var _props$environment$na;
40327    function onFocus(event) {
40328      if (props.openOnFocus || Boolean(store.getState().query)) {
40329        onInput(_objectSpread11({
40330          event,
40331          props,
40332          query: store.getState().completion || store.getState().query,
40333          refresh,
40334          store
40335        }, setters));
40336      }
40337      store.dispatch("focus", null);
40338    }
40339    var _ref3 = providedProps || {}, { inputElement, maxLength: _ref3$maxLength } = _ref3, maxLength = _ref3$maxLength === undefined ? 512 : _ref3$maxLength, rest = _objectWithoutProperties4(_ref3, _excluded42);
40340    var activeItem = getActiveItem(store.getState());
40341    var userAgent = ((_props$environment$na = props.environment.navigator) === null || _props$environment$na === undefined ? undefined : _props$environment$na.userAgent) || "";
40342    var shouldFallbackKeyHint = isSamsung(userAgent);
40343    var enterKeyHint = props.enterKeyHint || (activeItem !== null && activeItem !== undefined && activeItem.itemUrl && !shouldFallbackKeyHint ? "go" : "search");
40344    return _objectSpread11({
40345      "aria-autocomplete": "both",
40346      "aria-activedescendant": store.getState().isOpen && store.getState().activeItemId !== null ? getAutocompleteElementId(props.id, "item-".concat(store.getState().activeItemId), activeItem === null || activeItem === undefined ? undefined : activeItem.source) : undefined,
40347      "aria-controls": store.getState().isOpen ? store.getState().collections.filter(function(collection) {
40348        return collection.items.length > 0;
40349      }).map(function(_ref4) {
40350        var source = _ref4.source;
40351        return getAutocompleteElementId(props.id, "list", source);
40352      }).join(" ") : undefined,
40353      "aria-labelledby": getAutocompleteElementId(props.id, "label"),
40354      value: store.getState().completion || store.getState().query,
40355      id: getAutocompleteElementId(props.id, "input"),
40356      autoComplete: "off",
40357      autoCorrect: "off",
40358      autoCapitalize: "off",
40359      enterKeyHint,
40360      spellCheck: "false",
40361      autoFocus: props.autoFocus,
40362      placeholder: props.placeholder,
40363      maxLength,
40364      type: "search",
40365      onChange: function onChange(event) {
40366        var value = event.currentTarget.value;
40367        if (props.ignoreCompositionEvents && getNativeEvent(event).isComposing) {
40368          setters.setQuery(value);
40369          return;
40370        }
40371        onInput(_objectSpread11({
40372          event,
40373          props,
40374          query: value.slice(0, maxLength),
40375          refresh,
40376          store
40377        }, setters));
40378      },
40379      onCompositionEnd: function onCompositionEnd(event) {
40380        onInput(_objectSpread11({
40381          event,
40382          props,
40383          query: event.currentTarget.value.slice(0, maxLength),
40384          refresh,
40385          store
40386        }, setters));
40387      },
40388      onKeyDown: function onKeyDown2(event) {
40389        if (getNativeEvent(event).isComposing) {
40390          return;
40391        }
40392        onKeyDown(_objectSpread11({
40393          event,
40394          props,
40395          refresh,
40396          store
40397        }, setters));
40398      },
40399      onFocus,
40400      onBlur: noop,
40401      onClick: function onClick(event) {
40402        if (providedProps.inputElement === props.environment.document.activeElement && !store.getState().isOpen) {
40403          onFocus(event);
40404        }
40405      }
40406    }, rest);
40407  };
40408  var getLabelProps = function getLabelProps(rest) {
40409    return _objectSpread11({
40410      htmlFor: getAutocompleteElementId(props.id, "input"),
40411      id: getAutocompleteElementId(props.id, "label")
40412    }, rest);
40413  };
40414  var getListProps = function getListProps(providedProps) {
40415    var _ref5 = providedProps || {}, source = _ref5.source, rest = _objectWithoutProperties4(_ref5, _excluded52);
40416    return _objectSpread11({
40417      role: "listbox",
40418      "aria-labelledby": getAutocompleteElementId(props.id, "label"),
40419      id: getAutocompleteElementId(props.id, "list", source)
40420    }, rest);
40421  };
40422  var getPanelProps = function getPanelProps(rest) {
40423    return _objectSpread11({
40424      onMouseDown: function onMouseDown(event) {
40425        event.preventDefault();
40426      },
40427      onMouseLeave: function onMouseLeave() {
40428        store.dispatch("mouseleave", null);
40429      }
40430    }, rest);
40431  };
40432  var getItemProps = function getItemProps(providedProps) {
40433    var { item, source } = providedProps, rest = _objectWithoutProperties4(providedProps, _excluded6);
40434    return _objectSpread11({
40435      id: getAutocompleteElementId(props.id, "item-".concat(item.__autocomplete_id), source),
40436      role: "option",
40437      "aria-selected": store.getState().activeItemId === item.__autocomplete_id,
40438      onMouseMove: function onMouseMove(event) {
40439        if (item.__autocomplete_id === store.getState().activeItemId) {
40440          return;
40441        }
40442        store.dispatch("mousemove", item.__autocomplete_id);
40443        var activeItem = getActiveItem(store.getState());
40444        if (store.getState().activeItemId !== null && activeItem) {
40445          var { item: _item, itemInputValue, itemUrl, source: _source } = activeItem;
40446          _source.onActive(_objectSpread11({
40447            event,
40448            item: _item,
40449            itemInputValue,
40450            itemUrl,
40451            refresh,
40452            source: _source,
40453            state: store.getState()
40454          }, setters));
40455        }
40456      },
40457      onMouseDown: function onMouseDown(event) {
40458        event.preventDefault();
40459      },
40460      onClick: function onClick(event) {
40461        var itemInputValue = source.getItemInputValue({
40462          item,
40463          state: store.getState()
40464        });
40465        var itemUrl = source.getItemUrl({
40466          item,
40467          state: store.getState()
40468        });
40469        var runPreCommand = itemUrl ? Promise.resolve() : onInput(_objectSpread11({
40470          event,
40471          nextState: {
40472            isOpen: false
40473          },
40474          props,
40475          query: itemInputValue,
40476          refresh,
40477          store
40478        }, setters));
40479        runPreCommand.then(function() {
40480          source.onSelect(_objectSpread11({
40481            event,
40482            item,
40483            itemInputValue,
40484            itemUrl,
40485            refresh,
40486            source,
40487            state: store.getState()
40488          }, setters));
40489        });
40490      }
40491    }, rest);
40492  };
40493  return {
40494    getEnvironmentProps,
40495    getRootProps,
40496    getFormProps,
40497    getLabelProps,
40498    getInputProps,
40499    getPanelProps,
40500    getListProps,
40501    getItemProps
40502  };
40503}
40504

vendor: 4,095 bytes, lines 40505-40592

40505// node_modules/@algolia/autocomplete-core/dist/esm/metadata.js
40506function _typeof13(obj2) {
40507  "@babel/helpers - typeof";
40508  return _typeof13 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
40509    return typeof obj2;
40510  } : function(obj2) {
40511    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
40512  }, _typeof13(obj2);
40513}
40514function ownKeys12(object, enumerableOnly) {
40515  var keys = Object.keys(object);
40516  if (Object.getOwnPropertySymbols) {
40517    var symbols = Object.getOwnPropertySymbols(object);
40518    enumerableOnly && (symbols = symbols.filter(function(sym) {
40519      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
40520    })), keys.push.apply(keys, symbols);
40521  }
40522  return keys;
40523}
40524function _objectSpread12(target) {
40525  for (var i = 1;i < arguments.length; i++) {
40526    var source = arguments[i] != null ? arguments[i] : {};
40527    i % 2 ? ownKeys12(Object(source), true).forEach(function(key) {
40528      _defineProperty12(target, key, source[key]);
40529    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys12(Object(source)).forEach(function(key) {
40530      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
40531    });
40532  }
40533  return target;
40534}
40535function _defineProperty12(obj2, key, value) {
40536  key = _toPropertyKey12(key);
40537  if (key in obj2) {
40538    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
40539  } else {
40540    obj2[key] = value;
40541  }
40542  return obj2;
40543}
40544function _toPropertyKey12(arg) {
40545  var key = _toPrimitive12(arg, "string");
40546  return _typeof13(key) === "symbol" ? key : String(key);
40547}
40548function _toPrimitive12(input, hint) {
40549  if (_typeof13(input) !== "object" || input === null)
40550    return input;
40551  var prim = input[Symbol.toPrimitive];
40552  if (prim !== undefined) {
40553    var res = prim.call(input, hint || "default");
40554    if (_typeof13(res) !== "object")
40555      return res;
40556    throw new TypeError("@@toPrimitive must return a primitive value.");
40557  }
40558  return (hint === "string" ? String : Number)(input);
40559}
40560function getMetadata(_ref) {
40561  var _, _options$__autocomple, _options$__autocomple2, _options$__autocomple3;
40562  var { plugins, options: options2 } = _ref;
40563  var optionsKey = (_ = (((_options$__autocomple = options2.__autocomplete_metadata) === null || _options$__autocomple === undefined ? undefined : _options$__autocomple.userAgents) || [])[0]) === null || _ === undefined ? undefined : _.segment;
40564  var extraOptions = optionsKey ? _defineProperty12({}, optionsKey, Object.keys(((_options$__autocomple2 = options2.__autocomplete_metadata) === null || _options$__autocomple2 === undefined ? undefined : _options$__autocomple2.options) || {})) : {};
40565  return {
40566    plugins: plugins.map(function(plugin) {
40567      return {
40568        name: plugin.name,
40569        options: Object.keys(plugin.__autocomplete_pluginOptions || [])
40570      };
40571    }),
40572    options: _objectSpread12({
40573      "autocomplete-core": Object.keys(options2)
40574    }, extraOptions),
40575    ua: userAgents.concat(((_options$__autocomple3 = options2.__autocomplete_metadata) === null || _options$__autocomple3 === undefined ? undefined : _options$__autocomple3.userAgents) || [])
40576  };
40577}
40578function injectMetadata(_ref3) {
40579  var _environment$navigato, _environment$navigato2;
40580  var { metadata, environment } = _ref3;
40581  var isMetadataEnabled = (_environment$navigato = environment.navigator) === null || _environment$navigato === undefined ? undefined : (_environment$navigato2 = _environment$navigato.userAgent) === null || _environment$navigato2 === undefined ? undefined : _environment$navigato2.includes("Algolia Crawler");
40582  if (isMetadataEnabled) {
40583    var metadataContainer = environment.document.createElement("meta");
40584    var headRef = environment.document.querySelector("head");
40585    metadataContainer.name = "algolia:metadata";
40586    setTimeout(function() {
40587      metadataContainer.content = JSON.stringify(metadata);
40588      headRef.appendChild(metadataContainer);
40589    }, 0);
40590  }
40591}
40592

vendor: 380 bytes, lines 40593-40602

40593// node_modules/@algolia/autocomplete-core/dist/esm/getCompletion.js
40594function getCompletion(_ref) {
40595  var _getActiveItem;
40596  var state = _ref.state;
40597  if (state.isOpen === false || state.activeItemId === null) {
40598    return null;
40599  }
40600  return ((_getActiveItem = getActiveItem(state)) === null || _getActiveItem === undefined ? undefined : _getActiveItem.itemInputValue) || null;
40601}
40602

vendor: 5,774 bytes, lines 40603-40773

40603// node_modules/@algolia/autocomplete-core/dist/esm/stateReducer.js
40604function _typeof14(obj2) {
40605  "@babel/helpers - typeof";
40606  return _typeof14 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
40607    return typeof obj2;
40608  } : function(obj2) {
40609    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
40610  }, _typeof14(obj2);
40611}
40612function ownKeys13(object, enumerableOnly) {
40613  var keys = Object.keys(object);
40614  if (Object.getOwnPropertySymbols) {
40615    var symbols = Object.getOwnPropertySymbols(object);
40616    enumerableOnly && (symbols = symbols.filter(function(sym) {
40617      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
40618    })), keys.push.apply(keys, symbols);
40619  }
40620  return keys;
40621}
40622function _objectSpread13(target) {
40623  for (var i = 1;i < arguments.length; i++) {
40624    var source = arguments[i] != null ? arguments[i] : {};
40625    i % 2 ? ownKeys13(Object(source), true).forEach(function(key) {
40626      _defineProperty13(target, key, source[key]);
40627    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys13(Object(source)).forEach(function(key) {
40628      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
40629    });
40630  }
40631  return target;
40632}
40633function _defineProperty13(obj2, key, value) {
40634  key = _toPropertyKey13(key);
40635  if (key in obj2) {
40636    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
40637  } else {
40638    obj2[key] = value;
40639  }
40640  return obj2;
40641}
40642function _toPropertyKey13(arg) {
40643  var key = _toPrimitive13(arg, "string");
40644  return _typeof14(key) === "symbol" ? key : String(key);
40645}
40646function _toPrimitive13(input, hint) {
40647  if (_typeof14(input) !== "object" || input === null)
40648    return input;
40649  var prim = input[Symbol.toPrimitive];
40650  if (prim !== undefined) {
40651    var res = prim.call(input, hint || "default");
40652    if (_typeof14(res) !== "object")
40653      return res;
40654    throw new TypeError("@@toPrimitive must return a primitive value.");
40655  }
40656  return (hint === "string" ? String : Number)(input);
40657}
40658var stateReducer = function stateReducer(state, action) {
40659  switch (action.type) {
40660    case "setActiveItemId": {
40661      return _objectSpread13(_objectSpread13({}, state), {}, {
40662        activeItemId: action.payload
40663      });
40664    }
40665    case "setQuery": {
40666      return _objectSpread13(_objectSpread13({}, state), {}, {
40667        query: action.payload,
40668        completion: null
40669      });
40670    }
40671    case "setCollections": {
40672      return _objectSpread13(_objectSpread13({}, state), {}, {
40673        collections: action.payload
40674      });
40675    }
40676    case "setIsOpen": {
40677      return _objectSpread13(_objectSpread13({}, state), {}, {
40678        isOpen: action.payload
40679      });
40680    }
40681    case "setStatus": {
40682      return _objectSpread13(_objectSpread13({}, state), {}, {
40683        status: action.payload
40684      });
40685    }
40686    case "setContext": {
40687      return _objectSpread13(_objectSpread13({}, state), {}, {
40688        context: _objectSpread13(_objectSpread13({}, state.context), action.payload)
40689      });
40690    }
40691    case "ArrowDown": {
40692      var nextState = _objectSpread13(_objectSpread13({}, state), {}, {
40693        activeItemId: action.payload.hasOwnProperty("nextActiveItemId") ? action.payload.nextActiveItemId : getNextActiveItemId(1, state.activeItemId, getItemsCount(state), action.props.defaultActiveItemId)
40694      });
40695      return _objectSpread13(_objectSpread13({}, nextState), {}, {
40696        completion: getCompletion({
40697          state: nextState
40698        })
40699      });
40700    }
40701    case "ArrowUp": {
40702      var _nextState = _objectSpread13(_objectSpread13({}, state), {}, {
40703        activeItemId: getNextActiveItemId(-1, state.activeItemId, getItemsCount(state), action.props.defaultActiveItemId)
40704      });
40705      return _objectSpread13(_objectSpread13({}, _nextState), {}, {
40706        completion: getCompletion({
40707          state: _nextState
40708        })
40709      });
40710    }
40711    case "Escape": {
40712      if (state.isOpen) {
40713        return _objectSpread13(_objectSpread13({}, state), {}, {
40714          activeItemId: null,
40715          isOpen: false,
40716          completion: null
40717        });
40718      }
40719      return _objectSpread13(_objectSpread13({}, state), {}, {
40720        activeItemId: null,
40721        query: "",
40722        status: "idle",
40723        collections: []
40724      });
40725    }
40726    case "submit": {
40727      return _objectSpread13(_objectSpread13({}, state), {}, {
40728        activeItemId: null,
40729        isOpen: false,
40730        status: "idle"
40731      });
40732    }
40733    case "reset": {
40734      return _objectSpread13(_objectSpread13({}, state), {}, {
40735        activeItemId: action.props.openOnFocus === true ? action.props.defaultActiveItemId : null,
40736        status: "idle",
40737        completion: null,
40738        query: ""
40739      });
40740    }
40741    case "focus": {
40742      return _objectSpread13(_objectSpread13({}, state), {}, {
40743        activeItemId: action.props.defaultActiveItemId,
40744        isOpen: (action.props.openOnFocus || Boolean(state.query)) && action.props.shouldPanelOpen({
40745          state
40746        })
40747      });
40748    }
40749    case "blur": {
40750      if (action.props.debug) {
40751        return state;
40752      }
40753      return _objectSpread13(_objectSpread13({}, state), {}, {
40754        isOpen: false,
40755        activeItemId: null
40756      });
40757    }
40758    case "mousemove": {
40759      return _objectSpread13(_objectSpread13({}, state), {}, {
40760        activeItemId: action.payload
40761      });
40762    }
40763    case "mouseleave": {
40764      return _objectSpread13(_objectSpread13({}, state), {}, {
40765        activeItemId: action.props.defaultActiveItemId
40766      });
40767    }
40768    default:
40769      invariant(false, "The reducer action ".concat(JSON.stringify(action.type), " is not supported."));
40770      return state;
40771  }
40772};
40773

vendor: 5,052 bytes, lines 40774-40919

40774// node_modules/@algolia/autocomplete-core/dist/esm/createAutocomplete.js
40775function _typeof15(obj2) {
40776  "@babel/helpers - typeof";
40777  return _typeof15 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
40778    return typeof obj2;
40779  } : function(obj2) {
40780    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
40781  }, _typeof15(obj2);
40782}
40783function ownKeys14(object, enumerableOnly) {
40784  var keys = Object.keys(object);
40785  if (Object.getOwnPropertySymbols) {
40786    var symbols = Object.getOwnPropertySymbols(object);
40787    enumerableOnly && (symbols = symbols.filter(function(sym) {
40788      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
40789    })), keys.push.apply(keys, symbols);
40790  }
40791  return keys;
40792}
40793function _objectSpread14(target) {
40794  for (var i = 1;i < arguments.length; i++) {
40795    var source = arguments[i] != null ? arguments[i] : {};
40796    i % 2 ? ownKeys14(Object(source), true).forEach(function(key) {
40797      _defineProperty14(target, key, source[key]);
40798    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys14(Object(source)).forEach(function(key) {
40799      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
40800    });
40801  }
40802  return target;
40803}
40804function _defineProperty14(obj2, key, value) {
40805  key = _toPropertyKey14(key);
40806  if (key in obj2) {
40807    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
40808  } else {
40809    obj2[key] = value;
40810  }
40811  return obj2;
40812}
40813function _toPropertyKey14(arg) {
40814  var key = _toPrimitive14(arg, "string");
40815  return _typeof15(key) === "symbol" ? key : String(key);
40816}
40817function _toPrimitive14(input, hint) {
40818  if (_typeof15(input) !== "object" || input === null)
40819    return input;
40820  var prim = input[Symbol.toPrimitive];
40821  if (prim !== undefined) {
40822    var res = prim.call(input, hint || "default");
40823    if (_typeof15(res) !== "object")
40824      return res;
40825    throw new TypeError("@@toPrimitive must return a primitive value.");
40826  }
40827  return (hint === "string" ? String : Number)(input);
40828}
40829function createAutocomplete(options2) {
40830  checkOptions(options2);
40831  var subscribers = [];
40832  var props = getDefaultProps(options2, subscribers);
40833  var store = createStore(stateReducer, props, onStoreStateChange);
40834  var setters = getAutocompleteSetters({
40835    store
40836  });
40837  var propGetters = getPropGetters(_objectSpread14({
40838    props,
40839    refresh,
40840    store,
40841    navigator: props.navigator
40842  }, setters));
40843  function onStoreStateChange(_ref) {
40844    var _state$context, _state$context$algoli;
40845    var { prevState, state } = _ref;
40846    props.onStateChange(_objectSpread14({
40847      prevState,
40848      state,
40849      refresh,
40850      navigator: props.navigator
40851    }, setters));
40852    if (!isAlgoliaInsightsPluginEnabled() && (_state$context = state.context) !== null && _state$context !== undefined && (_state$context$algoli = _state$context.algoliaInsightsPlugin) !== null && _state$context$algoli !== undefined && _state$context$algoli.__automaticInsights && props.insights !== false) {
40853      var plugin = createAlgoliaInsightsPlugin({
40854        __autocomplete_clickAnalytics: false
40855      });
40856      props.plugins.push(plugin);
40857      subscribePlugins([plugin]);
40858    }
40859  }
40860  function refresh() {
40861    return onInput(_objectSpread14({
40862      event: new Event("input"),
40863      nextState: {
40864        isOpen: store.getState().isOpen
40865      },
40866      props,
40867      navigator: props.navigator,
40868      query: store.getState().query,
40869      refresh,
40870      store
40871    }, setters));
40872  }
40873  function subscribePlugins(plugins) {
40874    plugins.forEach(function(plugin) {
40875      var _plugin$subscribe;
40876      return (_plugin$subscribe = plugin.subscribe) === null || _plugin$subscribe === undefined ? undefined : _plugin$subscribe.call(plugin, _objectSpread14(_objectSpread14({}, setters), {}, {
40877        navigator: props.navigator,
40878        refresh,
40879        onSelect: function onSelect(fn2) {
40880          subscribers.push({
40881            onSelect: fn2
40882          });
40883        },
40884        onActive: function onActive(fn2) {
40885          subscribers.push({
40886            onActive: fn2
40887          });
40888        },
40889        onResolve: function onResolve(fn2) {
40890          subscribers.push({
40891            onResolve: fn2
40892          });
40893        }
40894      }));
40895    });
40896  }
40897  function isAlgoliaInsightsPluginEnabled() {
40898    return props.plugins.some(function(plugin) {
40899      return plugin.name === "aa.algoliaInsightsPlugin";
40900    });
40901  }
40902  if (props.insights && !isAlgoliaInsightsPluginEnabled()) {
40903    var insightsParams = typeof props.insights === "boolean" ? {} : props.insights;
40904    props.plugins.push(createAlgoliaInsightsPlugin(insightsParams));
40905  }
40906  subscribePlugins(props.plugins);
40907  injectMetadata({
40908    metadata: getMetadata({
40909      plugins: props.plugins,
40910      options: options2
40911    }),
40912    environment: props.environment
40913  });
40914  return _objectSpread14(_objectSpread14({
40915    refresh,
40916    navigator: props.navigator
40917  }, propGetters), setters);
40918}
40919

vendor: 1,774 bytes, lines 40920-40945

40920// node_modules/htm/dist/htm.module.js
40921var n = function(t, s, r, e) {
40922  var u;
40923  s[0] = 0;
40924  for (var h = 1;h < s.length; h++) {
40925    var p = s[h++], a = s[h] ? (s[0] |= p ? 1 : 2, r[s[h++]]) : s[++h];
40926    p === 3 ? e[0] = a : p === 4 ? e[1] = Object.assign(e[1] || {}, a) : p === 5 ? (e[1] = e[1] || {})[s[++h]] = a : p === 6 ? e[1][s[++h]] += a + "" : p ? (u = t.apply(a, n(t, a, r, ["", null])), e.push(u), a[0] ? s[0] |= 2 : (s[h - 2] = 0, s[h] = u)) : e.push(a);
40927  }
40928  return e;
40929};
40930var t = new Map;
40931function htm_module_default(s) {
40932  var r = t.get(this);
40933  return r || (r = new Map, t.set(this, r)), (r = n(this, r.get(s) || (r.set(s, r = function(n) {
40934    for (var t, s, r = 1, e = "", u = "", h = [0], p = function(n) {
40935      r === 1 && (n || (e = e.replace(/^\s*\n\s*|\s*\n\s*$/g, ""))) ? h.push(0, n, e) : r === 3 && (n || e) ? (h.push(3, n, e), r = 2) : r === 2 && e === "..." && n ? h.push(4, n, 0) : r === 2 && e && !n ? h.push(5, 0, true, e) : r >= 5 && ((e || !n && r === 5) && (h.push(r, 0, e, s), r = 6), n && (h.push(r, n, 0, s), r = 6)), e = "";
40936    }, a = 0;a < n.length; a++) {
40937      a && (r === 1 && p(), p(a));
40938      for (var l = 0;l < n[a].length; l++)
40939        t = n[a][l], r === 1 ? t === "<" ? (p(), h = [h], r = 3) : e += t : r === 4 ? e === "--" && t === ">" ? (r = 1, e = "") : e = t + e[0] : u ? t === u ? u = "" : e += t : t === '"' || t === "'" ? u = t : t === ">" ? (p(), r = 1) : r && (t === "=" ? (r = 5, s = e, e = "") : t === "/" && (r < 5 || n[a][l + 1] === ">") ? (p(), r === 3 && (h = h[0]), r = h, (h = h[0]).push(2, 0, r), r = 0) : t === " " || t === "\t" || t === `
40940` || t === "\r" ? (p(), r = 2) : e += t), r === 3 && e === "!--" && (r = 4, h = h[0]);
40941    }
40942    return p(), h;
40943  }(s)), r), arguments, [])).length > 1 ? r : r[0];
40944}
40945

vendor: 961 bytes, lines 40946-40960

40946// node_modules/@algolia/autocomplete-js/dist/esm/elements/ClearIcon.js
40947var ClearIcon = function ClearIcon(_ref) {
40948  var environment = _ref.environment;
40949  var element = environment.document.createElementNS("http://www.w3.org/2000/svg", "svg");
40950  element.setAttribute("class", "aa-ClearIcon");
40951  element.setAttribute("viewBox", "0 0 24 24");
40952  element.setAttribute("width", "18");
40953  element.setAttribute("height", "18");
40954  element.setAttribute("fill", "currentColor");
40955  var path = environment.document.createElementNS("http://www.w3.org/2000/svg", "path");
40956  path.setAttribute("d", "M5.293 6.707l5.293 5.293-5.293 5.293c-0.391 0.391-0.391 1.024 0 1.414s1.024 0.391 1.414 0l5.293-5.293 5.293 5.293c0.391 0.391 1.024 0.391 1.414 0s0.391-1.024 0-1.414l-5.293-5.293 5.293-5.293c0.391-0.391 0.391-1.024 0-1.414s-1.024-0.391-1.414 0l-5.293 5.293-5.293-5.293c-0.391-0.391-1.024-0.391-1.414 0s-0.391 1.024 0 1.414z");
40957  element.appendChild(path);
40958  return element;
40959};
40960

vendor: 366 bytes, lines 40961-40970

40961// node_modules/@algolia/autocomplete-js/dist/esm/utils/getHTMLElement.js
40962function getHTMLElement(environment, value) {
40963  if (typeof value === "string") {
40964    var element = environment.document.querySelector(value);
40965    invariant(element !== null, "The element ".concat(JSON.stringify(value), " is not in the document."));
40966    return element;
40967  }
40968  return value;
40969}
40970

vendor: 560 bytes, lines 40971-40987

40971// node_modules/@algolia/autocomplete-js/dist/esm/utils/mergeClassNames.js
40972function mergeClassNames() {
40973  for (var _len = arguments.length, values = new Array(_len), _key = 0;_key < _len; _key++) {
40974    values[_key] = arguments[_key];
40975  }
40976  return values.reduce(function(acc, current) {
40977    Object.keys(current).forEach(function(key) {
40978      var accValue = acc[key];
40979      var currentValue = current[key];
40980      if (accValue !== currentValue) {
40981        acc[key] = [accValue, currentValue].filter(Boolean).join(" ");
40982      }
40983    });
40984    return acc;
40985  }, {});
40986}
40987

vendor: 2,569 bytes, lines 40988-41054

40988// node_modules/@algolia/autocomplete-js/dist/esm/utils/mergeDeep.js
40989function _toConsumableArray5(arr) {
40990  return _arrayWithoutHoles5(arr) || _iterableToArray5(arr) || _unsupportedIterableToArray8(arr) || _nonIterableSpread5();
40991}
40992function _nonIterableSpread5() {
40993  throw new TypeError(`Invalid attempt to spread non-iterable instance.
40994In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
40995}
40996function _unsupportedIterableToArray8(o, minLen) {
40997  if (!o)
40998    return;
40999  if (typeof o === "string")
41000    return _arrayLikeToArray8(o, minLen);
41001  var n = Object.prototype.toString.call(o).slice(8, -1);
41002  if (n === "Object" && o.constructor)
41003    n = o.constructor.name;
41004  if (n === "Map" || n === "Set")
41005    return Array.from(o);
41006  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
41007    return _arrayLikeToArray8(o, minLen);
41008}
41009function _iterableToArray5(iter) {
41010  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
41011    return Array.from(iter);
41012}
41013function _arrayWithoutHoles5(arr) {
41014  if (Array.isArray(arr))
41015    return _arrayLikeToArray8(arr);
41016}
41017function _arrayLikeToArray8(arr, len) {
41018  if (len == null || len > arr.length)
41019    len = arr.length;
41020  for (var i = 0, arr2 = new Array(len);i < len; i++)
41021    arr2[i] = arr[i];
41022  return arr2;
41023}
41024function _typeof16(obj2) {
41025  "@babel/helpers - typeof";
41026  return _typeof16 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
41027    return typeof obj2;
41028  } : function(obj2) {
41029    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
41030  }, _typeof16(obj2);
41031}
41032var isPlainObject = function isPlainObject(value) {
41033  return value && _typeof16(value) === "object" && Object.prototype.toString.call(value) === "[object Object]";
41034};
41035function mergeDeep() {
41036  for (var _len = arguments.length, values = new Array(_len), _key = 0;_key < _len; _key++) {
41037    values[_key] = arguments[_key];
41038  }
41039  return values.reduce(function(acc, current) {
41040    Object.keys(current).forEach(function(key) {
41041      var accValue = acc[key];
41042      var currentValue = current[key];
41043      if (Array.isArray(accValue) && Array.isArray(currentValue)) {
41044        acc[key] = accValue.concat.apply(accValue, _toConsumableArray5(currentValue));
41045      } else if (isPlainObject(accValue) && isPlainObject(currentValue)) {
41046        acc[key] = mergeDeep(accValue, currentValue);
41047      } else {
41048        acc[key] = currentValue;
41049      }
41050    });
41051    return acc;
41052  }, {});
41053}
41054

vendor: 4,348 bytes, lines 41055-41179

41055// node_modules/@algolia/autocomplete-js/dist/esm/utils/pickBy.js
41056function _typeof17(obj2) {
41057  "@babel/helpers - typeof";
41058  return _typeof17 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
41059    return typeof obj2;
41060  } : function(obj2) {
41061    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
41062  }, _typeof17(obj2);
41063}
41064function ownKeys15(object, enumerableOnly) {
41065  var keys = Object.keys(object);
41066  if (Object.getOwnPropertySymbols) {
41067    var symbols = Object.getOwnPropertySymbols(object);
41068    enumerableOnly && (symbols = symbols.filter(function(sym) {
41069      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
41070    })), keys.push.apply(keys, symbols);
41071  }
41072  return keys;
41073}
41074function _objectSpread15(target) {
41075  for (var i = 1;i < arguments.length; i++) {
41076    var source = arguments[i] != null ? arguments[i] : {};
41077    i % 2 ? ownKeys15(Object(source), true).forEach(function(key) {
41078      _defineProperty15(target, key, source[key]);
41079    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys15(Object(source)).forEach(function(key) {
41080      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
41081    });
41082  }
41083  return target;
41084}
41085function _defineProperty15(obj2, key, value) {
41086  key = _toPropertyKey15(key);
41087  if (key in obj2) {
41088    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
41089  } else {
41090    obj2[key] = value;
41091  }
41092  return obj2;
41093}
41094function _toPropertyKey15(arg) {
41095  var key = _toPrimitive15(arg, "string");
41096  return _typeof17(key) === "symbol" ? key : String(key);
41097}
41098function _toPrimitive15(input, hint) {
41099  if (_typeof17(input) !== "object" || input === null)
41100    return input;
41101  var prim = input[Symbol.toPrimitive];
41102  if (prim !== undefined) {
41103    var res = prim.call(input, hint || "default");
41104    if (_typeof17(res) !== "object")
41105      return res;
41106    throw new TypeError("@@toPrimitive must return a primitive value.");
41107  }
41108  return (hint === "string" ? String : Number)(input);
41109}
41110function _slicedToArray3(arr, i) {
41111  return _arrayWithHoles3(arr) || _iterableToArrayLimit3(arr, i) || _unsupportedIterableToArray9(arr, i) || _nonIterableRest3();
41112}
41113function _nonIterableRest3() {
41114  throw new TypeError(`Invalid attempt to destructure non-iterable instance.
41115In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
41116}
41117function _unsupportedIterableToArray9(o, minLen) {
41118  if (!o)
41119    return;
41120  if (typeof o === "string")
41121    return _arrayLikeToArray9(o, minLen);
41122  var n = Object.prototype.toString.call(o).slice(8, -1);
41123  if (n === "Object" && o.constructor)
41124    n = o.constructor.name;
41125  if (n === "Map" || n === "Set")
41126    return Array.from(o);
41127  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
41128    return _arrayLikeToArray9(o, minLen);
41129}
41130function _arrayLikeToArray9(arr, len) {
41131  if (len == null || len > arr.length)
41132    len = arr.length;
41133  for (var i = 0, arr2 = new Array(len);i < len; i++)
41134    arr2[i] = arr[i];
41135  return arr2;
41136}
41137function _iterableToArrayLimit3(arr, i) {
41138  var _i = arr == null ? null : typeof Symbol != "undefined" && arr[Symbol.iterator] || arr["@@iterator"];
41139  if (_i != null) {
41140    var _s, _e, _x, _r, _arr = [], _n = true, _d = false;
41141    try {
41142      if (_x = (_i = _i.call(arr)).next, i === 0) {
41143        if (Object(_i) !== _i)
41144          return;
41145        _n = false;
41146      } else
41147        for (;!(_n = (_s = _x.call(_i)).done) && (_arr.push(_s.value), _arr.length !== i); _n = true)
41148          ;
41149    } catch (err) {
41150      _d = true, _e = err;
41151    } finally {
41152      try {
41153        if (!_n && _i.return != null && (_r = _i.return(), Object(_r) !== _r))
41154          return;
41155      } finally {
41156        if (_d)
41157          throw _e;
41158      }
41159    }
41160    return _arr;
41161  }
41162}
41163function _arrayWithHoles3(arr) {
41164  if (Array.isArray(arr))
41165    return arr;
41166}
41167function pickBy(obj2, predicate) {
41168  return Object.entries(obj2).reduce(function(acc, _ref) {
41169    var _ref2 = _slicedToArray3(_ref, 2), key = _ref2[0], value = _ref2[1];
41170    if (predicate({
41171      key,
41172      value
41173    })) {
41174      return _objectSpread15(_objectSpread15({}, acc), {}, _defineProperty15({}, key, value));
41175    }
41176    return acc;
41177  }, {});
41178}
41179

vendor: 2,548 bytes, lines 41180-41260

41180// node_modules/@algolia/autocomplete-js/dist/esm/utils/setProperties.js
41181var TOUCH_EVENTS_ALIASES = ["ontouchstart", "ontouchend", "ontouchmove", "ontouchcancel"];
41182function setStyle(style, key, value) {
41183  if (value === null) {
41184    style[key] = "";
41185  } else if (typeof value !== "number") {
41186    style[key] = value;
41187  } else {
41188    style[key] = value + "px";
41189  }
41190}
41191function eventProxy(event) {
41192  var _this$_listeners;
41193  this === null || this === undefined || (_this$_listeners = this._listeners) === null || _this$_listeners === undefined || _this$_listeners[event.type](event);
41194}
41195function setProperty(dom, name, value) {
41196  var useCapture;
41197  var nameLower;
41198  var oldValue = dom[name];
41199  if (name === "style") {
41200    if (typeof value == "string") {
41201      dom.style = value;
41202    } else {
41203      if (value === null) {
41204        dom.style = "";
41205      } else {
41206        for (name in value) {
41207          if (!oldValue || value[name] !== oldValue[name]) {
41208            setStyle(dom.style, name, value[name]);
41209          }
41210        }
41211      }
41212    }
41213  } else if (name[0] === "o" && name[1] === "n") {
41214    useCapture = name !== (name = name.replace(/Capture$/, ""));
41215    nameLower = name.toLowerCase();
41216    if (nameLower in dom || TOUCH_EVENTS_ALIASES.includes(nameLower))
41217      name = nameLower;
41218    name = name.slice(2);
41219    if (!dom._listeners)
41220      dom._listeners = {};
41221    dom._listeners[name] = value;
41222    if (value) {
41223      if (!oldValue)
41224        dom.addEventListener(name, eventProxy, useCapture);
41225    } else {
41226      dom.removeEventListener(name, eventProxy, useCapture);
41227    }
41228  } else if (name !== "list" && name !== "tagName" && name !== "form" && name !== "type" && name !== "size" && name !== "download" && name !== "href" && name in dom) {
41229    dom[name] = value == null ? "" : value;
41230  } else if (typeof value != "function" && name !== "dangerouslySetInnerHTML") {
41231    if (value == null || value === false && !/^ar/.test(name)) {
41232      dom.removeAttribute(name);
41233    } else {
41234      dom.setAttribute(name, value);
41235    }
41236  }
41237}
41238function getNormalizedName(name) {
41239  switch (name) {
41240    case "onChange":
41241      return "onInput";
41242    case "onCompositionEnd":
41243      return "oncompositionend";
41244    default:
41245      return name;
41246  }
41247}
41248function setProperties(dom, props) {
41249  for (var name in props) {
41250    setProperty(dom, getNormalizedName(name), props[name]);
41251  }
41252}
41253function setPropertiesWithoutEvents(dom, props) {
41254  for (var name in props) {
41255    if (!(name[0] === "o" && name[1] === "n")) {
41256      setProperty(dom, getNormalizedName(name), props[name]);
41257    }
41258  }
41259}
41260

vendor: 2,723 bytes, lines 41261-41339

41261// node_modules/@algolia/autocomplete-js/dist/esm/getCreateDomElement.js
41262var _excluded7 = ["children"];
41263function _toConsumableArray6(arr) {
41264  return _arrayWithoutHoles6(arr) || _iterableToArray6(arr) || _unsupportedIterableToArray10(arr) || _nonIterableSpread6();
41265}
41266function _nonIterableSpread6() {
41267  throw new TypeError(`Invalid attempt to spread non-iterable instance.
41268In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
41269}
41270function _unsupportedIterableToArray10(o, minLen) {
41271  if (!o)
41272    return;
41273  if (typeof o === "string")
41274    return _arrayLikeToArray10(o, minLen);
41275  var n = Object.prototype.toString.call(o).slice(8, -1);
41276  if (n === "Object" && o.constructor)
41277    n = o.constructor.name;
41278  if (n === "Map" || n === "Set")
41279    return Array.from(o);
41280  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
41281    return _arrayLikeToArray10(o, minLen);
41282}
41283function _iterableToArray6(iter) {
41284  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
41285    return Array.from(iter);
41286}
41287function _arrayWithoutHoles6(arr) {
41288  if (Array.isArray(arr))
41289    return _arrayLikeToArray10(arr);
41290}
41291function _arrayLikeToArray10(arr, len) {
41292  if (len == null || len > arr.length)
41293    len = arr.length;
41294  for (var i = 0, arr2 = new Array(len);i < len; i++)
41295    arr2[i] = arr[i];
41296  return arr2;
41297}
41298function _objectWithoutProperties5(source, excluded) {
41299  if (source == null)
41300    return {};
41301  var target = _objectWithoutPropertiesLoose5(source, excluded);
41302  var key, i;
41303  if (Object.getOwnPropertySymbols) {
41304    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
41305    for (i = 0;i < sourceSymbolKeys.length; i++) {
41306      key = sourceSymbolKeys[i];
41307      if (excluded.indexOf(key) >= 0)
41308        continue;
41309      if (!Object.prototype.propertyIsEnumerable.call(source, key))
41310        continue;
41311      target[key] = source[key];
41312    }
41313  }
41314  return target;
41315}
41316function _objectWithoutPropertiesLoose5(source, excluded) {
41317  if (source == null)
41318    return {};
41319  var target = {};
41320  var sourceKeys = Object.keys(source);
41321  var key, i;
41322  for (i = 0;i < sourceKeys.length; i++) {
41323    key = sourceKeys[i];
41324    if (excluded.indexOf(key) >= 0)
41325      continue;
41326    target[key] = source[key];
41327  }
41328  return target;
41329}
41330function getCreateDomElement(environment) {
41331  return function createDomElement(tagName, _ref) {
41332    var _ref$children = _ref.children, children = _ref$children === undefined ? [] : _ref$children, props = _objectWithoutProperties5(_ref, _excluded7);
41333    var element = environment.document.createElement(tagName);
41334    setProperties(element, props);
41335    element.append.apply(element, _toConsumableArray6(children));
41336    return element;
41337  };
41338}
41339

vendor: 3,965 bytes, lines 41340-41449

41340// node_modules/@algolia/autocomplete-js/dist/esm/elements/Input.js
41341function _typeof18(obj2) {
41342  "@babel/helpers - typeof";
41343  return _typeof18 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
41344    return typeof obj2;
41345  } : function(obj2) {
41346    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
41347  }, _typeof18(obj2);
41348}
41349var _excluded8 = ["autocompleteScopeApi", "environment", "classNames", "getInputProps", "getInputPropsCore", "isDetached", "state"];
41350function ownKeys16(object, enumerableOnly) {
41351  var keys = Object.keys(object);
41352  if (Object.getOwnPropertySymbols) {
41353    var symbols = Object.getOwnPropertySymbols(object);
41354    enumerableOnly && (symbols = symbols.filter(function(sym) {
41355      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
41356    })), keys.push.apply(keys, symbols);
41357  }
41358  return keys;
41359}
41360function _objectSpread16(target) {
41361  for (var i = 1;i < arguments.length; i++) {
41362    var source = arguments[i] != null ? arguments[i] : {};
41363    i % 2 ? ownKeys16(Object(source), true).forEach(function(key) {
41364      _defineProperty16(target, key, source[key]);
41365    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys16(Object(source)).forEach(function(key) {
41366      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
41367    });
41368  }
41369  return target;
41370}
41371function _defineProperty16(obj2, key, value) {
41372  key = _toPropertyKey16(key);
41373  if (key in obj2) {
41374    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
41375  } else {
41376    obj2[key] = value;
41377  }
41378  return obj2;
41379}
41380function _toPropertyKey16(arg) {
41381  var key = _toPrimitive16(arg, "string");
41382  return _typeof18(key) === "symbol" ? key : String(key);
41383}
41384function _toPrimitive16(input, hint) {
41385  if (_typeof18(input) !== "object" || input === null)
41386    return input;
41387  var prim = input[Symbol.toPrimitive];
41388  if (prim !== undefined) {
41389    var res = prim.call(input, hint || "default");
41390    if (_typeof18(res) !== "object")
41391      return res;
41392    throw new TypeError("@@toPrimitive must return a primitive value.");
41393  }
41394  return (hint === "string" ? String : Number)(input);
41395}
41396function _objectWithoutProperties6(source, excluded) {
41397  if (source == null)
41398    return {};
41399  var target = _objectWithoutPropertiesLoose6(source, excluded);
41400  var key, i;
41401  if (Object.getOwnPropertySymbols) {
41402    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
41403    for (i = 0;i < sourceSymbolKeys.length; i++) {
41404      key = sourceSymbolKeys[i];
41405      if (excluded.indexOf(key) >= 0)
41406        continue;
41407      if (!Object.prototype.propertyIsEnumerable.call(source, key))
41408        continue;
41409      target[key] = source[key];
41410    }
41411  }
41412  return target;
41413}
41414function _objectWithoutPropertiesLoose6(source, excluded) {
41415  if (source == null)
41416    return {};
41417  var target = {};
41418  var sourceKeys = Object.keys(source);
41419  var key, i;
41420  for (i = 0;i < sourceKeys.length; i++) {
41421    key = sourceKeys[i];
41422    if (excluded.indexOf(key) >= 0)
41423      continue;
41424    target[key] = source[key];
41425  }
41426  return target;
41427}
41428var Input = function Input(_ref) {
41429  var { autocompleteScopeApi, environment, classNames, getInputProps, getInputPropsCore, isDetached, state } = _ref, props = _objectWithoutProperties6(_ref, _excluded8);
41430  var createDomElement = getCreateDomElement(environment);
41431  var element = createDomElement("input", props);
41432  var inputProps = getInputProps(_objectSpread16({
41433    state,
41434    props: getInputPropsCore({
41435      inputElement: element
41436    }),
41437    inputElement: element
41438  }, autocompleteScopeApi));
41439  setProperties(element, _objectSpread16(_objectSpread16({}, inputProps), {}, {
41440    onKeyDown: function onKeyDown(event) {
41441      if (isDetached && event.key === "Tab") {
41442        return;
41443      }
41444      inputProps.onKeyDown(event);
41445    }
41446  }));
41447  return element;
41448};
41449

vendor: 1,081 bytes, lines 41450-41488

41450// node_modules/@algolia/autocomplete-js/dist/esm/elements/LoadingIcon.js
41451var LoadingIcon = function LoadingIcon(_ref) {
41452  var environment = _ref.environment;
41453  var element = environment.document.createElementNS("http://www.w3.org/2000/svg", "svg");
41454  element.setAttribute("class", "aa-LoadingIcon");
41455  element.setAttribute("viewBox", "0 0 100 100");
41456  element.setAttribute("width", "20");
41457  element.setAttribute("height", "20");
41458  element.innerHTML = `<circle
41459  cx="50"
41460  cy="50"
41461  fill="none"
41462  r="35"
41463  stroke="currentColor"
41464  stroke-dasharray="164.93361431346415 56.97787143782138"
41465  stroke-width="6"
41466>
41467  <animateTransform
41468    attributeName="transform"
41469    type="rotate"
41470    repeatCount="indefinite"
41471    dur="1s"
41472    values="0 50 50;90 50 50;180 50 50;360 50 50"
41473    keyTimes="0;0.40;0.65;1"
41474  />
41475</circle>`;
41476  var pauseAnimations = function pauseAnimations() {
41477    if (!element.parentElement) {
41478      setTimeout(pauseAnimations, 0);
41479      return;
41480    }
41481    element.pauseAnimations();
41482  };
41483  if ("pauseAnimations" in element) {
41484    pauseAnimations();
41485  }
41486  return element;
41487};
41488

vendor: 1,247 bytes, lines 41489-41503

41489// node_modules/@algolia/autocomplete-js/dist/esm/elements/SearchIcon.js
41490var SearchIcon = function SearchIcon(_ref) {
41491  var environment = _ref.environment;
41492  var element = environment.document.createElementNS("http://www.w3.org/2000/svg", "svg");
41493  element.setAttribute("class", "aa-SubmitIcon");
41494  element.setAttribute("viewBox", "0 0 24 24");
41495  element.setAttribute("width", "20");
41496  element.setAttribute("height", "20");
41497  element.setAttribute("fill", "currentColor");
41498  var path = environment.document.createElementNS("http://www.w3.org/2000/svg", "path");
41499  path.setAttribute("d", "M16.041 15.856c-0.034 0.026-0.067 0.055-0.099 0.087s-0.060 0.064-0.087 0.099c-1.258 1.213-2.969 1.958-4.855 1.958-1.933 0-3.682-0.782-4.95-2.050s-2.050-3.017-2.050-4.95 0.782-3.682 2.050-4.95 3.017-2.050 4.95-2.050 3.682 0.782 4.95 2.050 2.050 3.017 2.050 4.95c0 1.886-0.745 3.597-1.959 4.856zM21.707 20.293l-3.675-3.675c1.231-1.54 1.968-3.493 1.968-5.618 0-2.485-1.008-4.736-2.636-6.364s-3.879-2.636-6.364-2.636-4.736 1.008-6.364 2.636-2.636 3.879-2.636 6.364 1.008 4.736 2.636 6.364 3.879 2.636 6.364 2.636c2.125 0 4.078-0.737 5.618-1.968l3.675 3.675c0.391 0.391 1.024 0.391 1.414 0s0.391-1.024 0-1.414z");
41500  element.appendChild(path);
41501  return element;
41502};
41503

vendor: 7,254 bytes, lines 41504-41717

41504// node_modules/@algolia/autocomplete-js/dist/esm/createAutocompleteDom.js
41505function _typeof19(obj2) {
41506  "@babel/helpers - typeof";
41507  return _typeof19 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
41508    return typeof obj2;
41509  } : function(obj2) {
41510    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
41511  }, _typeof19(obj2);
41512}
41513function ownKeys17(object, enumerableOnly) {
41514  var keys = Object.keys(object);
41515  if (Object.getOwnPropertySymbols) {
41516    var symbols = Object.getOwnPropertySymbols(object);
41517    enumerableOnly && (symbols = symbols.filter(function(sym) {
41518      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
41519    })), keys.push.apply(keys, symbols);
41520  }
41521  return keys;
41522}
41523function _objectSpread17(target) {
41524  for (var i = 1;i < arguments.length; i++) {
41525    var source = arguments[i] != null ? arguments[i] : {};
41526    i % 2 ? ownKeys17(Object(source), true).forEach(function(key) {
41527      _defineProperty17(target, key, source[key]);
41528    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys17(Object(source)).forEach(function(key) {
41529      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
41530    });
41531  }
41532  return target;
41533}
41534function _defineProperty17(obj2, key, value) {
41535  key = _toPropertyKey17(key);
41536  if (key in obj2) {
41537    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
41538  } else {
41539    obj2[key] = value;
41540  }
41541  return obj2;
41542}
41543function _toPropertyKey17(arg) {
41544  var key = _toPrimitive17(arg, "string");
41545  return _typeof19(key) === "symbol" ? key : String(key);
41546}
41547function _toPrimitive17(input, hint) {
41548  if (_typeof19(input) !== "object" || input === null)
41549    return input;
41550  var prim = input[Symbol.toPrimitive];
41551  if (prim !== undefined) {
41552    var res = prim.call(input, hint || "default");
41553    if (_typeof19(res) !== "object")
41554      return res;
41555    throw new TypeError("@@toPrimitive must return a primitive value.");
41556  }
41557  return (hint === "string" ? String : Number)(input);
41558}
41559function createAutocompleteDom(_ref) {
41560  var { autocomplete, autocompleteScopeApi, classNames, environment, isDetached, placeholder: _ref$placeholder } = _ref, placeholder = _ref$placeholder === undefined ? "Search" : _ref$placeholder, { propGetters, setIsModalOpen, state, translations } = _ref;
41561  var createDomElement = getCreateDomElement(environment);
41562  var rootProps = propGetters.getRootProps(_objectSpread17({
41563    state,
41564    props: autocomplete.getRootProps({})
41565  }, autocompleteScopeApi));
41566  var root2 = createDomElement("div", _objectSpread17({
41567    class: classNames.root
41568  }, rootProps));
41569  var detachedContainer = createDomElement("div", {
41570    class: classNames.detachedContainer,
41571    onMouseDown: function onMouseDown(event) {
41572      event.stopPropagation();
41573    }
41574  });
41575  var detachedOverlay = createDomElement("div", {
41576    class: classNames.detachedOverlay,
41577    children: [detachedContainer],
41578    onMouseDown: function onMouseDown() {
41579      setIsModalOpen(false);
41580      autocomplete.setIsOpen(false);
41581    }
41582  });
41583  var labelProps = propGetters.getLabelProps(_objectSpread17({
41584    state,
41585    props: autocomplete.getLabelProps({})
41586  }, autocompleteScopeApi));
41587  var submitButton = createDomElement("button", {
41588    class: classNames.submitButton,
41589    type: "submit",
41590    title: translations.submitButtonTitle,
41591    children: [SearchIcon({
41592      environment
41593    })]
41594  });
41595  var label = createDomElement("label", _objectSpread17({
41596    class: classNames.label,
41597    children: [submitButton],
41598    ariaLabel: translations.submitButtonTitle
41599  }, labelProps));
41600  var clearButton = createDomElement("button", {
41601    class: classNames.clearButton,
41602    type: "reset",
41603    title: translations.clearButtonTitle,
41604    children: [ClearIcon({
41605      environment
41606    })]
41607  });
41608  var loadingIndicator = createDomElement("div", {
41609    class: classNames.loadingIndicator,
41610    children: [LoadingIcon({
41611      environment
41612    })]
41613  });
41614  var input = Input({
41615    class: classNames.input,
41616    environment,
41617    state,
41618    getInputProps: propGetters.getInputProps,
41619    getInputPropsCore: autocomplete.getInputProps,
41620    autocompleteScopeApi,
41621    isDetached
41622  });
41623  var inputWrapperPrefix = createDomElement("div", {
41624    class: classNames.inputWrapperPrefix,
41625    children: [label, loadingIndicator]
41626  });
41627  var inputWrapperSuffix = createDomElement("div", {
41628    class: classNames.inputWrapperSuffix,
41629    children: [clearButton]
41630  });
41631  var inputWrapper = createDomElement("div", {
41632    class: classNames.inputWrapper,
41633    children: [input]
41634  });
41635  var formProps = propGetters.getFormProps(_objectSpread17({
41636    state,
41637    props: autocomplete.getFormProps({
41638      inputElement: input
41639    })
41640  }, autocompleteScopeApi));
41641  var form = createDomElement("form", _objectSpread17({
41642    class: classNames.form,
41643    children: [inputWrapperPrefix, inputWrapper, inputWrapperSuffix]
41644  }, formProps));
41645  var panelProps = propGetters.getPanelProps(_objectSpread17({
41646    state,
41647    props: autocomplete.getPanelProps({})
41648  }, autocompleteScopeApi));
41649  var panel = createDomElement("div", _objectSpread17({
41650    class: classNames.panel
41651  }, panelProps));
41652  var detachedSearchButtonQuery = createDomElement("div", {
41653    class: classNames.detachedSearchButtonQuery,
41654    textContent: state.query
41655  });
41656  var detachedSearchButtonPlaceholder = createDomElement("div", {
41657    class: classNames.detachedSearchButtonPlaceholder,
41658    hidden: Boolean(state.query),
41659    textContent: placeholder
41660  });
41661  if (false) {}
41662  if (isDetached) {
41663    var detachedSearchButtonIcon = createDomElement("div", {
41664      class: classNames.detachedSearchButtonIcon,
41665      ariaLabel: translations.detachedSearchButtonTitle,
41666      children: [SearchIcon({
41667        environment
41668      })]
41669    });
41670    var detachedSearchButton = createDomElement("button", {
41671      type: "button",
41672      class: classNames.detachedSearchButton,
41673      title: translations.detachedSearchButtonTitle,
41674      id: labelProps.id,
41675      onClick: function onClick() {
41676        setIsModalOpen(true);
41677      },
41678      children: [detachedSearchButtonIcon, detachedSearchButtonPlaceholder, detachedSearchButtonQuery]
41679    });
41680    var detachedCancelButton = createDomElement("button", {
41681      type: "button",
41682      class: classNames.detachedCancelButton,
41683      textContent: translations.detachedCancelButtonText,
41684      onTouchStart: function onTouchStart(event) {
41685        event.stopPropagation();
41686      },
41687      onClick: function onClick() {
41688        autocomplete.setIsOpen(false);
41689        setIsModalOpen(false);
41690      }
41691    });
41692    var detachedFormContainer = createDomElement("div", {
41693      class: classNames.detachedFormContainer,
41694      children: [form, detachedCancelButton]
41695    });
41696    detachedContainer.appendChild(detachedFormContainer);
41697    root2.appendChild(detachedSearchButton);
41698  } else {
41699    root2.appendChild(form);
41700  }
41701  return {
41702    detachedContainer,
41703    detachedOverlay,
41704    detachedSearchButtonQuery,
41705    detachedSearchButtonPlaceholder,
41706    inputWrapper,
41707    input,
41708    root: root2,
41709    form,
41710    label,
41711    submitButton,
41712    clearButton,
41713    loadingIndicator,
41714    panel
41715  };
41716}
41717

vendor: 681 bytes, lines 41718-41745

41718// node_modules/@algolia/autocomplete-js/dist/esm/createEffectWrapper.js
41719function createEffectWrapper() {
41720  var effects = [];
41721  var cleanups = [];
41722  function runEffect(fn2) {
41723    effects.push(fn2);
41724    var effectCleanup = fn2();
41725    cleanups.push(effectCleanup);
41726  }
41727  return {
41728    runEffect,
41729    cleanupEffects: function cleanupEffects() {
41730      var currentCleanups = cleanups;
41731      cleanups = [];
41732      currentCleanups.forEach(function(cleanup) {
41733        cleanup();
41734      });
41735    },
41736    runEffects: function runEffects() {
41737      var currentEffects = effects;
41738      effects = [];
41739      currentEffects.forEach(function(effect) {
41740        runEffect(effect);
41741      });
41742    }
41743  };
41744}
41745

vendor: 667 bytes, lines 41746-41774

41746// node_modules/@algolia/autocomplete-js/dist/esm/createReactiveWrapper.js
41747function createReactiveWrapper() {
41748  var reactives = [];
41749  return {
41750    reactive: function reactive(value) {
41751      var current = value();
41752      var reactive = {
41753        _fn: value,
41754        _ref: {
41755          current
41756        },
41757        get value() {
41758          return this._ref.current;
41759        },
41760        set value(value) {
41761          this._ref.current = value;
41762        }
41763      };
41764      reactives.push(reactive);
41765      return reactive;
41766    },
41767    runReactives: function runReactives() {
41768      reactives.forEach(function(value) {
41769        value._ref.current = value._fn();
41770      });
41771    }
41772  };
41773}
41774

vendor: 14,313 bytes, lines 41775-42083

41775// node_modules/preact/dist/preact.module.js
41776var n2;
41777var l;
41778var u;
41779var t2;
41780var i;
41781var r;
41782var o;
41783var e;
41784var f;
41785var c;
41786var s;
41787var a;
41788var h;
41789var p = {};
41790var v = [];
41791var y = /acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;
41792var d = Array.isArray;
41793function w(n, l) {
41794  for (var u in l)
41795    n[u] = l[u];
41796  return n;
41797}
41798function g(n) {
41799  n && n.parentNode && n.parentNode.removeChild(n);
41800}
41801function _(l, u, t) {
41802  var i, r, o, e = {};
41803  for (o in u)
41804    o == "key" ? i = u[o] : o == "ref" ? r = u[o] : e[o] = u[o];
41805  if (arguments.length > 2 && (e.children = arguments.length > 3 ? n2.call(arguments, 2) : t), typeof l == "function" && l.defaultProps != null)
41806    for (o in l.defaultProps)
41807      e[o] === undefined && (e[o] = l.defaultProps[o]);
41808  return m3(l, e, i, r, null);
41809}
41810function m3(n, t, i, r, o) {
41811  var e = { type: n, props: t, key: i, ref: r, __k: null, __: null, __b: 0, __e: null, __c: null, constructor: undefined, __v: o == null ? ++u : o, __i: -1, __u: 0 };
41812  return o == null && l.vnode != null && l.vnode(e), e;
41813}
41814function k(n) {
41815  return n.children;
41816}
41817function x(n, l) {
41818  this.props = n, this.context = l;
41819}
41820function S(n, l) {
41821  if (l == null)
41822    return n.__ ? S(n.__, n.__i + 1) : null;
41823  for (var u;l < n.__k.length; l++)
41824    if ((u = n.__k[l]) != null && u.__e != null)
41825      return u.__e;
41826  return typeof n.type == "function" ? S(n) : null;
41827}
41828function C(n) {
41829  if (n.__P && n.__d) {
41830    var u = n.__v, t = u.__e, i = [], r = [], o = w({}, u);
41831    o.__v = u.__v + 1, l.vnode && l.vnode(o), z(n.__P, o, u, n.__n, n.__P.namespaceURI, 32 & u.__u ? [t] : null, i, t == null ? S(u) : t, !!(32 & u.__u), r), o.__v = u.__v, o.__.__k[o.__i] = o, V(i, o, r), u.__e = u.__ = null, o.__e != t && M(o);
41832  }
41833}
41834function M(n) {
41835  if ((n = n.__) != null && n.__c != null)
41836    return n.__e = n.__c.base = null, n.__k.some(function(l) {
41837      if (l != null && l.__e != null)
41838        return n.__e = n.__c.base = l.__e;
41839    }), M(n);
41840}
41841function $10(n) {
41842  (!n.__d && (n.__d = true) && i.push(n) && !I.__r++ || r != l.debounceRendering) && ((r = l.debounceRendering) || o)(I);
41843}
41844function I() {
41845  for (var n, l = 1;i.length; )
41846    i.length > l && i.sort(e), n = i.shift(), l = i.length, C(n);
41847  I.__r = 0;
41848}
41849function P(n, l, u, t, i, r, o, e, f, c, s) {
41850  var a, h, y, d, w, g, _, m2 = t && t.__k || v, b = l.length;
41851  for (f = A(u, l, m2, f, b), a = 0;a < b; a++)
41852    (y = u.__k[a]) != null && (h = y.__i != -1 && m2[y.__i] || p, y.__i = a, g = z(n, y, h, i, r, o, e, f, c, s), d = y.__e, y.ref && h.ref != y.ref && (h.ref && D(h.ref, null, y), s.push(y.ref, y.__c || d, y)), w == null && d != null && (w = d), (_ = !!(4 & y.__u)) || h.__k === y.__k ? f = H(y, f, n, _) : typeof y.type == "function" && g !== undefined ? f = g : d && (f = d.nextSibling), y.__u &= -7);
41853  return u.__e = w, f;
41854}
41855function A(n, l, u, t, i) {
41856  var r, o, e, f, c, s = u.length, a = s, h = 0;
41857  for (n.__k = new Array(i), r = 0;r < i; r++)
41858    (o = l[r]) != null && typeof o != "boolean" && typeof o != "function" ? (typeof o == "string" || typeof o == "number" || typeof o == "bigint" || o.constructor == String ? o = n.__k[r] = m3(null, o, null, null, null) : d(o) ? o = n.__k[r] = m3(k, { children: o }, null, null, null) : o.constructor === undefined && o.__b > 0 ? o = n.__k[r] = m3(o.type, o.props, o.key, o.ref ? o.ref : null, o.__v) : n.__k[r] = o, f = r + h, o.__ = n, o.__b = n.__b + 1, e = null, (c = o.__i = T(o, u, f, a)) != -1 && (a--, (e = u[c]) && (e.__u |= 2)), e == null || e.__v == null ? (c == -1 && (i > s ? h-- : i < s && h++), typeof o.type != "function" && (o.__u |= 4)) : c != f && (c == f - 1 ? h-- : c == f + 1 ? h++ : (c > f ? h-- : h++, o.__u |= 4))) : n.__k[r] = null;
41859  if (a)
41860    for (r = 0;r < s; r++)
41861      (e = u[r]) != null && (2 & e.__u) == 0 && (e.__e == t && (t = S(e)), E(e, e));
41862  return t;
41863}
41864function H(n, l, u, t) {
41865  var i, r;
41866  if (typeof n.type == "function") {
41867    for (i = n.__k, r = 0;i && r < i.length; r++)
41868      i[r] && (i[r].__ = n, l = H(i[r], l, u, t));
41869    return l;
41870  }
41871  n.__e != l && (t && (l && n.type && !l.parentNode && (l = S(n)), u.insertBefore(n.__e, l || null)), l = n.__e);
41872  do {
41873    l = l && l.nextSibling;
41874  } while (l != null && l.nodeType == 8);
41875  return l;
41876}
41877function T(n, l, u, t) {
41878  var i, r, o, { key: e, type: f } = n, c = l[u], s = c != null && (2 & c.__u) == 0;
41879  if (c === null && e == null || s && e == c.key && f == c.type)
41880    return u;
41881  if (t > (s ? 1 : 0)) {
41882    for (i = u - 1, r = u + 1;i >= 0 || r < l.length; )
41883      if ((c = l[o = i >= 0 ? i-- : r++]) != null && (2 & c.__u) == 0 && e == c.key && f == c.type)
41884        return o;
41885  }
41886  return -1;
41887}
41888function j(n, l, u) {
41889  l[0] == "-" ? n.setProperty(l, u == null ? "" : u) : n[l] = u == null ? "" : typeof u != "number" || y.test(l) ? u : u + "px";
41890}
41891function F(n, l, u, t, i) {
41892  var r, o;
41893  n:
41894    if (l == "style")
41895      if (typeof u == "string")
41896        n.style.cssText = u;
41897      else {
41898        if (typeof t == "string" && (n.style.cssText = t = ""), t)
41899          for (l in t)
41900            u && l in u || j(n.style, l, "");
41901        if (u)
41902          for (l in u)
41903            t && u[l] == t[l] || j(n.style, l, u[l]);
41904      }
41905    else if (l[0] == "o" && l[1] == "n")
41906      r = l != (l = l.replace(f, "$1")), o = l.toLowerCase(), l = o in n || l == "onFocusOut" || l == "onFocusIn" ? o.slice(2) : l.slice(2), n.l || (n.l = {}), n.l[l + r] = u, u ? t ? u.u = t.u : (u.u = c, n.addEventListener(l, r ? a : s, r)) : n.removeEventListener(l, r ? a : s, r);
41907    else {
41908      if (i == "http://www.w3.org/2000/svg")
41909        l = l.replace(/xlink(H|:h)/, "h").replace(/sName$/, "s");
41910      else if (l != "width" && l != "height" && l != "href" && l != "list" && l != "form" && l != "tabIndex" && l != "download" && l != "rowSpan" && l != "colSpan" && l != "role" && l != "popover" && l in n)
41911        try {
41912          n[l] = u == null ? "" : u;
41913          break n;
41914        } catch (n) {}
41915      typeof u == "function" || (u == null || u === false && l[4] != "-" ? n.removeAttribute(l) : n.setAttribute(l, l == "popover" && u == 1 ? "" : u));
41916    }
41917}
41918function O(n) {
41919  return function(u) {
41920    if (this.l) {
41921      var t = this.l[u.type + n];
41922      if (u.t == null)
41923        u.t = c++;
41924      else if (u.t < t.u)
41925        return;
41926      return t(l.event ? l.event(u) : u);
41927    }
41928  };
41929}
41930function z(n, u, t, i, r, o, e, f, c, s) {
41931  var a, h, p, y, _, m2, b, S, C, M, $2, I, A, H, L, T = u.type;
41932  if (u.constructor !== undefined)
41933    return null;
41934  128 & t.__u && (c = !!(32 & t.__u), o = [f = u.__e = t.__e]), (a = l.__b) && a(u);
41935  n:
41936    if (typeof T == "function")
41937      try {
41938        if (S = u.props, C = "prototype" in T && T.prototype.render, M = (a = T.contextType) && i[a.__c], $2 = a ? M ? M.props.value : a.__ : i, t.__c ? b = (h = u.__c = t.__c).__ = h.__E : (C ? u.__c = h = new T(S, $2) : (u.__c = h = new x(S, $2), h.constructor = T, h.render = G), M && M.sub(h), h.state || (h.state = {}), h.__n = i, p = h.__d = true, h.__h = [], h._sb = []), C && h.__s == null && (h.__s = h.state), C && T.getDerivedStateFromProps != null && (h.__s == h.state && (h.__s = w({}, h.__s)), w(h.__s, T.getDerivedStateFromProps(S, h.__s))), y = h.props, _ = h.state, h.__v = u, p)
41939          C && T.getDerivedStateFromProps == null && h.componentWillMount != null && h.componentWillMount(), C && h.componentDidMount != null && h.__h.push(h.componentDidMount);
41940        else {
41941          if (C && T.getDerivedStateFromProps == null && S !== y && h.componentWillReceiveProps != null && h.componentWillReceiveProps(S, $2), u.__v == t.__v || !h.__e && h.shouldComponentUpdate != null && h.shouldComponentUpdate(S, h.__s, $2) === false) {
41942            u.__v != t.__v && (h.props = S, h.state = h.__s, h.__d = false), u.__e = t.__e, u.__k = t.__k, u.__k.some(function(n) {
41943              n && (n.__ = u);
41944            }), v.push.apply(h.__h, h._sb), h._sb = [], h.__h.length && e.push(h);
41945            break n;
41946          }
41947          h.componentWillUpdate != null && h.componentWillUpdate(S, h.__s, $2), C && h.componentDidUpdate != null && h.__h.push(function() {
41948            h.componentDidUpdate(y, _, m2);
41949          });
41950        }
41951        if (h.context = $2, h.props = S, h.__P = n, h.__e = false, I = l.__r, A = 0, C)
41952          h.state = h.__s, h.__d = false, I && I(u), a = h.render(h.props, h.state, h.context), v.push.apply(h.__h, h._sb), h._sb = [];
41953        else
41954          do {
41955            h.__d = false, I && I(u), a = h.render(h.props, h.state, h.context), h.state = h.__s;
41956          } while (h.__d && ++A < 25);
41957        h.state = h.__s, h.getChildContext != null && (i = w(w({}, i), h.getChildContext())), C && !p && h.getSnapshotBeforeUpdate != null && (m2 = h.getSnapshotBeforeUpdate(y, _)), H = a != null && a.type === k && a.key == null ? q(a.props.children) : a, f = P(n, d(H) ? H : [H], u, t, i, r, o, e, f, c, s), h.base = u.__e, u.__u &= -161, h.__h.length && e.push(h), b && (h.__E = h.__ = null);
41958      } catch (n) {
41959        if (u.__v = null, c || o != null)
41960          if (n.then) {
41961            for (u.__u |= c ? 160 : 128;f && f.nodeType == 8 && f.nextSibling; )
41962              f = f.nextSibling;
41963            o[o.indexOf(f)] = null, u.__e = f;
41964          } else {
41965            for (L = o.length;L--; )
41966              g(o[L]);
41967            N(u);
41968          }
41969        else
41970          u.__e = t.__e, u.__k = t.__k, n.then || N(u);
41971        l.__e(n, u, t);
41972      }
41973    else
41974      o == null && u.__v == t.__v ? (u.__k = t.__k, u.__e = t.__e) : f = u.__e = B(t.__e, u, t, i, r, o, e, c, s);
41975  return (a = l.diffed) && a(u), 128 & u.__u ? undefined : f;
41976}
41977function N(n) {
41978  n && (n.__c && (n.__c.__e = true), n.__k && n.__k.some(N));
41979}
41980function V(n, u, t) {
41981  for (var i = 0;i < t.length; i++)
41982    D(t[i], t[++i], t[++i]);
41983  l.__c && l.__c(u, n), n.some(function(u) {
41984    try {
41985      n = u.__h, u.__h = [], n.some(function(n) {
41986        n.call(u);
41987      });
41988    } catch (n) {
41989      l.__e(n, u.__v);
41990    }
41991  });
41992}
41993function q(n) {
41994  return typeof n != "object" || n == null || n.__b > 0 ? n : d(n) ? n.map(q) : w({}, n);
41995}
41996function B(u, t, i, r, o, e, f, c, s) {
41997  var a, h, v, y, w, _, m2, b = i.props || p, { props: k, type: x } = t;
41998  if (x == "svg" ? o = "http://www.w3.org/2000/svg" : x == "math" ? o = "http://www.w3.org/1998/Math/MathML" : o || (o = "http://www.w3.org/1999/xhtml"), e != null) {
41999    for (a = 0;a < e.length; a++)
42000      if ((w = e[a]) && "setAttribute" in w == !!x && (x ? w.localName == x : w.nodeType == 3)) {
42001        u = w, e[a] = null;
42002        break;
42003      }
42004  }
42005  if (u == null) {
42006    if (x == null)
42007      return document.createTextNode(k);
42008    u = document.createElementNS(o, x, k.is && k), c && (l.__m && l.__m(t, e), c = false), e = null;
42009  }
42010  if (x == null)
42011    b === k || c && u.data == k || (u.data = k);
42012  else {
42013    if (e = e && n2.call(u.childNodes), !c && e != null)
42014      for (b = {}, a = 0;a < u.attributes.length; a++)
42015        b[(w = u.attributes[a]).name] = w.value;
42016    for (a in b)
42017      w = b[a], a == "dangerouslySetInnerHTML" ? v = w : a == "children" || (a in k) || a == "value" && ("defaultValue" in k) || a == "checked" && ("defaultChecked" in k) || F(u, a, null, w, o);
42018    for (a in k)
42019      w = k[a], a == "children" ? y = w : a == "dangerouslySetInnerHTML" ? h = w : a == "value" ? _ = w : a == "checked" ? m2 = w : c && typeof w != "function" || b[a] === w || F(u, a, w, b[a], o);
42020    if (h)
42021      c || v && (h.__html == v.__html || h.__html == u.innerHTML) || (u.innerHTML = h.__html), t.__k = [];
42022    else if (v && (u.innerHTML = ""), P(t.type == "template" ? u.content : u, d(y) ? y : [y], t, i, r, x == "foreignObject" ? "http://www.w3.org/1999/xhtml" : o, e, f, e ? e[0] : i.__k && S(i, 0), c, s), e != null)
42023      for (a = e.length;a--; )
42024        g(e[a]);
42025    c || (a = "value", x == "progress" && _ == null ? u.removeAttribute("value") : _ != null && (_ !== u[a] || x == "progress" && !_ || x == "option" && _ != b[a]) && F(u, a, _, b[a], o), a = "checked", m2 != null && m2 != u[a] && F(u, a, m2, b[a], o));
42026  }
42027  return u;
42028}
42029function D(n, u, t) {
42030  try {
42031    if (typeof n == "function") {
42032      var i = typeof n.__u == "function";
42033      i && n.__u(), i && u == null || (n.__u = n(u));
42034    } else
42035      n.current = u;
42036  } catch (n) {
42037    l.__e(n, t);
42038  }
42039}
42040function E(n, u, t) {
42041  var i, r;
42042  if (l.unmount && l.unmount(n), (i = n.ref) && (i.current && i.current != n.__e || D(i, null, u)), (i = n.__c) != null) {
42043    if (i.componentWillUnmount)
42044      try {
42045        i.componentWillUnmount();
42046      } catch (n) {
42047        l.__e(n, u);
42048      }
42049    i.base = i.__P = null;
42050  }
42051  if (i = n.__k)
42052    for (r = 0;r < i.length; r++)
42053      i[r] && E(i[r], u, t || typeof n.type != "function");
42054  t || g(n.__e), n.__c = n.__ = n.__e = undefined;
42055}
42056function G(n, l, u) {
42057  return this.constructor(n, u);
42058}
42059function J(u, t, i) {
42060  var r, o, e, f;
42061  t == document && (t = document.documentElement), l.__ && l.__(u, t), o = (r = typeof i == "function") ? null : i && i.__k || t.__k, e = [], f = [], z(t, u = (!r && i || t).__k = _(k, null, [u]), o || p, p, t.namespaceURI, !r && i ? [i] : o ? null : t.firstChild ? n2.call(t.childNodes) : null, e, !r && i ? i : o ? o.__e : t.firstChild, r, f), V(e, u, f);
42062}
42063n2 = v.slice, l = { __e: function(n, l, u, t) {
42064  for (var i, r, o;l = l.__; )
42065    if ((i = l.__c) && !i.__)
42066      try {
42067        if ((r = i.constructor) && r.getDerivedStateFromError != null && (i.setState(r.getDerivedStateFromError(n)), o = i.__d), i.componentDidCatch != null && (i.componentDidCatch(n, t || {}), o = i.__d), o)
42068          return i.__E = i;
42069      } catch (l) {
42070        n = l;
42071      }
42072  throw n;
42073} }, u = 0, t2 = function(n) {
42074  return n != null && n.constructor === undefined;
42075}, x.prototype.setState = function(n, l) {
42076  var u;
42077  u = this.__s != null && this.__s != this.state ? this.__s : this.__s = w({}, this.state), typeof n == "function" && (n = n(w({}, u), this.props)), n && w(u, n), n != null && this.__v && (l && this._sb.push(l), $10(this));
42078}, x.prototype.forceUpdate = function(n) {
42079  this.__v && (this.__e = true, n && this.__h.push(n), $10(this));
42080}, x.prototype.render = k, i = [], o = typeof Promise == "function" ? Promise.prototype.then.bind(Promise.resolve()) : setTimeout, e = function(n, l) {
42081  return n.__v.__b - l.__v.__b;
42082}, I.__r = 0, f = /(PointerCapture)$|Capture$/i, c = 0, s = O(false), a = O(true), h = 0;
42083

vendor: 172 bytes, lines 42084-42087

42084// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/constants/index.js
42085var HIGHLIGHT_PRE_TAG = "__aa-highlight__";
42086var HIGHLIGHT_POST_TAG = "__/aa-highlight__";
42087

vendor: 1,331 bytes, lines 42088-42132

42088// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/parseAttribute.js
42089function createAttributeSet() {
42090  var initialValue = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
42091  var value = initialValue;
42092  return {
42093    get: function get() {
42094      return value;
42095    },
42096    add: function add(part) {
42097      var lastPart = value[value.length - 1];
42098      if ((lastPart === null || lastPart === undefined ? undefined : lastPart.isHighlighted) === part.isHighlighted) {
42099        value[value.length - 1] = {
42100          value: lastPart.value + part.value,
42101          isHighlighted: lastPart.isHighlighted
42102        };
42103      } else {
42104        value.push(part);
42105      }
42106    }
42107  };
42108}
42109function parseAttribute(_ref) {
42110  var highlightedValue = _ref.highlightedValue;
42111  var preTagParts = highlightedValue.split(HIGHLIGHT_PRE_TAG);
42112  var firstValue = preTagParts.shift();
42113  var parts = createAttributeSet(firstValue ? [{
42114    value: firstValue,
42115    isHighlighted: false
42116  }] : []);
42117  preTagParts.forEach(function(part) {
42118    var postTagParts = part.split(HIGHLIGHT_POST_TAG);
42119    parts.add({
42120      value: postTagParts[0],
42121      isHighlighted: true
42122    });
42123    if (postTagParts[1] !== "") {
42124      parts.add({
42125        value: postTagParts[1],
42126        isHighlighted: false
42127      });
42128    }
42129  });
42130  return parts.get();
42131}
42132

vendor: 2,085 bytes, lines 42133-42182

42133// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/parseAlgoliaHitHighlight.js
42134function _toConsumableArray7(arr) {
42135  return _arrayWithoutHoles7(arr) || _iterableToArray7(arr) || _unsupportedIterableToArray11(arr) || _nonIterableSpread7();
42136}
42137function _nonIterableSpread7() {
42138  throw new TypeError(`Invalid attempt to spread non-iterable instance.
42139In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
42140}
42141function _unsupportedIterableToArray11(o, minLen) {
42142  if (!o)
42143    return;
42144  if (typeof o === "string")
42145    return _arrayLikeToArray11(o, minLen);
42146  var n = Object.prototype.toString.call(o).slice(8, -1);
42147  if (n === "Object" && o.constructor)
42148    n = o.constructor.name;
42149  if (n === "Map" || n === "Set")
42150    return Array.from(o);
42151  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
42152    return _arrayLikeToArray11(o, minLen);
42153}
42154function _iterableToArray7(iter) {
42155  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
42156    return Array.from(iter);
42157}
42158function _arrayWithoutHoles7(arr) {
42159  if (Array.isArray(arr))
42160    return _arrayLikeToArray11(arr);
42161}
42162function _arrayLikeToArray11(arr, len) {
42163  if (len == null || len > arr.length)
42164    len = arr.length;
42165  for (var i = 0, arr2 = new Array(len);i < len; i++)
42166    arr2[i] = arr[i];
42167  return arr2;
42168}
42169function parseAlgoliaHitHighlight(_ref) {
42170  var { hit, attribute } = _ref;
42171  var path = Array.isArray(attribute) ? attribute : [attribute];
42172  var highlightedValue = getAttributeValueByPath(hit, ["_highlightResult"].concat(_toConsumableArray7(path), ["value"]));
42173  if (typeof highlightedValue !== "string") {
42174    warn2(false, 'The attribute "'.concat(path.join("."), '" described by the path ').concat(JSON.stringify(path), " does not exist on the hit. Did you set it in `attributesToHighlight`?") + `
42175See https://www.algolia.com/doc/api-reference/api-parameters/attributesToHighlight/`);
42176    highlightedValue = getAttributeValueByPath(hit, path) || "";
42177  }
42178  return parseAttribute({
42179    highlightedValue
42180  });
42181}
42182

vendor: 1,171 bytes, lines 42183-42215

42183// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/isPartHighlighted.js
42184var htmlEscapes = {
42185  "&amp;": "&",
42186  "&lt;": "<",
42187  "&gt;": ">",
42188  "&quot;": '"',
42189  "&#39;": "'"
42190};
42191var hasLetterOrNumber = function() {
42192  try {
42193    return new RegExp("[\\p{L}\\p{N}_]", "u");
42194  } catch (_unused) {
42195    return new RegExp(/\w/i);
42196  }
42197}();
42198var regexEscapedHtml = /&(amp|quot|lt|gt|#39);/g;
42199var regexHasEscapedHtml = RegExp(regexEscapedHtml.source);
42200function unescape(value) {
42201  return value && regexHasEscapedHtml.test(value) ? value.replace(regexEscapedHtml, function(character) {
42202    return htmlEscapes[character];
42203  }) : value;
42204}
42205function isPartHighlighted(parts, i) {
42206  var _parts, _parts2;
42207  var current = parts[i];
42208  var isNextHighlighted = ((_parts = parts[i + 1]) === null || _parts === undefined ? undefined : _parts.isHighlighted) || true;
42209  var isPreviousHighlighted = ((_parts2 = parts[i - 1]) === null || _parts2 === undefined ? undefined : _parts2.isHighlighted) || true;
42210  if (!hasLetterOrNumber.test(unescape(current.value)) && isPreviousHighlighted === isNextHighlighted) {
42211    return isPreviousHighlighted;
42212  }
42213  return current.isHighlighted;
42214}
42215

vendor: 2,628 bytes, lines 42216-42287

42216// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/reverseHighlightedParts.js
42217function _typeof20(obj2) {
42218  "@babel/helpers - typeof";
42219  return _typeof20 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
42220    return typeof obj2;
42221  } : function(obj2) {
42222    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
42223  }, _typeof20(obj2);
42224}
42225function ownKeys18(object, enumerableOnly) {
42226  var keys = Object.keys(object);
42227  if (Object.getOwnPropertySymbols) {
42228    var symbols = Object.getOwnPropertySymbols(object);
42229    enumerableOnly && (symbols = symbols.filter(function(sym) {
42230      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
42231    })), keys.push.apply(keys, symbols);
42232  }
42233  return keys;
42234}
42235function _objectSpread18(target) {
42236  for (var i = 1;i < arguments.length; i++) {
42237    var source = arguments[i] != null ? arguments[i] : {};
42238    i % 2 ? ownKeys18(Object(source), true).forEach(function(key) {
42239      _defineProperty18(target, key, source[key]);
42240    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys18(Object(source)).forEach(function(key) {
42241      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
42242    });
42243  }
42244  return target;
42245}
42246function _defineProperty18(obj2, key, value) {
42247  key = _toPropertyKey18(key);
42248  if (key in obj2) {
42249    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
42250  } else {
42251    obj2[key] = value;
42252  }
42253  return obj2;
42254}
42255function _toPropertyKey18(arg) {
42256  var key = _toPrimitive18(arg, "string");
42257  return _typeof20(key) === "symbol" ? key : String(key);
42258}
42259function _toPrimitive18(input, hint) {
42260  if (_typeof20(input) !== "object" || input === null)
42261    return input;
42262  var prim = input[Symbol.toPrimitive];
42263  if (prim !== undefined) {
42264    var res = prim.call(input, hint || "default");
42265    if (_typeof20(res) !== "object")
42266      return res;
42267    throw new TypeError("@@toPrimitive must return a primitive value.");
42268  }
42269  return (hint === "string" ? String : Number)(input);
42270}
42271function reverseHighlightedParts(parts) {
42272  if (!parts.some(function(part) {
42273    return part.isHighlighted;
42274  })) {
42275    return parts.map(function(part) {
42276      return _objectSpread18(_objectSpread18({}, part), {}, {
42277        isHighlighted: false
42278      });
42279    });
42280  }
42281  return parts.map(function(part, i) {
42282    return _objectSpread18(_objectSpread18({}, part), {}, {
42283      isHighlighted: !isPartHighlighted(parts, i)
42284    });
42285  });
42286}
42287

vendor: 227 bytes, lines 42288-42292

42288// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/parseAlgoliaHitReverseHighlight.js
42289function parseAlgoliaHitReverseHighlight(props) {
42290  return reverseHighlightedParts(parseAlgoliaHitHighlight(props));
42291}
42292

vendor: 2,075 bytes, lines 42293-42342

42293// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/parseAlgoliaHitSnippet.js
42294function _toConsumableArray8(arr) {
42295  return _arrayWithoutHoles8(arr) || _iterableToArray8(arr) || _unsupportedIterableToArray12(arr) || _nonIterableSpread8();
42296}
42297function _nonIterableSpread8() {
42298  throw new TypeError(`Invalid attempt to spread non-iterable instance.
42299In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
42300}
42301function _unsupportedIterableToArray12(o, minLen) {
42302  if (!o)
42303    return;
42304  if (typeof o === "string")
42305    return _arrayLikeToArray12(o, minLen);
42306  var n = Object.prototype.toString.call(o).slice(8, -1);
42307  if (n === "Object" && o.constructor)
42308    n = o.constructor.name;
42309  if (n === "Map" || n === "Set")
42310    return Array.from(o);
42311  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
42312    return _arrayLikeToArray12(o, minLen);
42313}
42314function _iterableToArray8(iter) {
42315  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
42316    return Array.from(iter);
42317}
42318function _arrayWithoutHoles8(arr) {
42319  if (Array.isArray(arr))
42320    return _arrayLikeToArray12(arr);
42321}
42322function _arrayLikeToArray12(arr, len) {
42323  if (len == null || len > arr.length)
42324    len = arr.length;
42325  for (var i = 0, arr2 = new Array(len);i < len; i++)
42326    arr2[i] = arr[i];
42327  return arr2;
42328}
42329function parseAlgoliaHitSnippet(_ref) {
42330  var { hit, attribute } = _ref;
42331  var path = Array.isArray(attribute) ? attribute : [attribute];
42332  var highlightedValue = getAttributeValueByPath(hit, ["_snippetResult"].concat(_toConsumableArray8(path), ["value"]));
42333  if (typeof highlightedValue !== "string") {
42334    warn2(false, 'The attribute "'.concat(path.join("."), '" described by the path ').concat(JSON.stringify(path), " does not exist on the hit. Did you set it in `attributesToSnippet`?") + `
42335See https://www.algolia.com/doc/api-reference/api-parameters/attributesToSnippet/`);
42336    highlightedValue = getAttributeValueByPath(hit, path) || "";
42337  }
42338  return parseAttribute({
42339    highlightedValue
42340  });
42341}
42342

vendor: 221 bytes, lines 42343-42347

42343// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/highlight/parseAlgoliaHitReverseSnippet.js
42344function parseAlgoliaHitReverseSnippet(props) {
42345  return reverseHighlightedParts(parseAlgoliaHitSnippet(props));
42346}
42347

vendor: 3,019 bytes, lines 42348-42430

42348// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/requester/createRequester.js
42349function _typeof21(obj2) {
42350  "@babel/helpers - typeof";
42351  return _typeof21 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
42352    return typeof obj2;
42353  } : function(obj2) {
42354    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
42355  }, _typeof21(obj2);
42356}
42357function ownKeys19(object, enumerableOnly) {
42358  var keys = Object.keys(object);
42359  if (Object.getOwnPropertySymbols) {
42360    var symbols = Object.getOwnPropertySymbols(object);
42361    enumerableOnly && (symbols = symbols.filter(function(sym) {
42362      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
42363    })), keys.push.apply(keys, symbols);
42364  }
42365  return keys;
42366}
42367function _objectSpread19(target) {
42368  for (var i = 1;i < arguments.length; i++) {
42369    var source = arguments[i] != null ? arguments[i] : {};
42370    i % 2 ? ownKeys19(Object(source), true).forEach(function(key) {
42371      _defineProperty19(target, key, source[key]);
42372    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys19(Object(source)).forEach(function(key) {
42373      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
42374    });
42375  }
42376  return target;
42377}
42378function _defineProperty19(obj2, key, value) {
42379  key = _toPropertyKey19(key);
42380  if (key in obj2) {
42381    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
42382  } else {
42383    obj2[key] = value;
42384  }
42385  return obj2;
42386}
42387function _toPropertyKey19(arg) {
42388  var key = _toPrimitive19(arg, "string");
42389  return _typeof21(key) === "symbol" ? key : String(key);
42390}
42391function _toPrimitive19(input, hint) {
42392  if (_typeof21(input) !== "object" || input === null)
42393    return input;
42394  var prim = input[Symbol.toPrimitive];
42395  if (prim !== undefined) {
42396    var res = prim.call(input, hint || "default");
42397    if (_typeof21(res) !== "object")
42398      return res;
42399    throw new TypeError("@@toPrimitive must return a primitive value.");
42400  }
42401  return (hint === "string" ? String : Number)(input);
42402}
42403function createRequester(fetcher, requesterId) {
42404  function execute(fetcherParams) {
42405    return fetcher({
42406      searchClient: fetcherParams.searchClient,
42407      queries: fetcherParams.requests.map(function(x) {
42408        return x.query;
42409      })
42410    }).then(function(responses) {
42411      return responses.map(function(response, index) {
42412        var _fetcherParams$reques = fetcherParams.requests[index], { sourceId, transformResponse } = _fetcherParams$reques;
42413        return {
42414          items: response,
42415          sourceId,
42416          transformResponse
42417        };
42418      });
42419    });
42420  }
42421  return function createSpecifiedRequester(requesterParams) {
42422    return function requester(requestParams) {
42423      return _objectSpread19(_objectSpread19({
42424        requesterId,
42425        execute
42426      }, requesterParams), requestParams);
42427    };
42428  };
42429}
42430

vendor: 588 bytes, lines 42431-42445

42431// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/utils/getAppIdAndApiKey.js
42432function getAppIdAndApiKey(searchClient) {
42433  var transporter = searchClient.transporter || {};
42434  var headers = transporter.headers || transporter.baseHeaders || {};
42435  var queryParameters = transporter.queryParameters || transporter.baseQueryParameters || {};
42436  var APP_ID = "x-algolia-application-id";
42437  var API_KEY = "x-algolia-api-key";
42438  var appId = headers[APP_ID] || queryParameters[APP_ID];
42439  var apiKey = headers[API_KEY] || queryParameters[API_KEY];
42440  return {
42441    appId,
42442    apiKey
42443  };
42444}
42445

vendor: 6,270 bytes, lines 42446-42608

42446// node_modules/@algolia/autocomplete-preset-algolia/dist/esm/search/fetchAlgoliaResults.js
42447function _typeof22(obj2) {
42448  "@babel/helpers - typeof";
42449  return _typeof22 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
42450    return typeof obj2;
42451  } : function(obj2) {
42452    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
42453  }, _typeof22(obj2);
42454}
42455var _excluded9 = ["params"];
42456function ownKeys20(object, enumerableOnly) {
42457  var keys = Object.keys(object);
42458  if (Object.getOwnPropertySymbols) {
42459    var symbols = Object.getOwnPropertySymbols(object);
42460    enumerableOnly && (symbols = symbols.filter(function(sym) {
42461      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
42462    })), keys.push.apply(keys, symbols);
42463  }
42464  return keys;
42465}
42466function _objectSpread20(target) {
42467  for (var i = 1;i < arguments.length; i++) {
42468    var source = arguments[i] != null ? arguments[i] : {};
42469    i % 2 ? ownKeys20(Object(source), true).forEach(function(key) {
42470      _defineProperty20(target, key, source[key]);
42471    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys20(Object(source)).forEach(function(key) {
42472      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
42473    });
42474  }
42475  return target;
42476}
42477function _defineProperty20(obj2, key, value) {
42478  key = _toPropertyKey20(key);
42479  if (key in obj2) {
42480    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
42481  } else {
42482    obj2[key] = value;
42483  }
42484  return obj2;
42485}
42486function _toPropertyKey20(arg) {
42487  var key = _toPrimitive20(arg, "string");
42488  return _typeof22(key) === "symbol" ? key : String(key);
42489}
42490function _toPrimitive20(input, hint) {
42491  if (_typeof22(input) !== "object" || input === null)
42492    return input;
42493  var prim = input[Symbol.toPrimitive];
42494  if (prim !== undefined) {
42495    var res = prim.call(input, hint || "default");
42496    if (_typeof22(res) !== "object")
42497      return res;
42498    throw new TypeError("@@toPrimitive must return a primitive value.");
42499  }
42500  return (hint === "string" ? String : Number)(input);
42501}
42502function _objectWithoutProperties7(source, excluded) {
42503  if (source == null)
42504    return {};
42505  var target = _objectWithoutPropertiesLoose7(source, excluded);
42506  var key, i;
42507  if (Object.getOwnPropertySymbols) {
42508    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
42509    for (i = 0;i < sourceSymbolKeys.length; i++) {
42510      key = sourceSymbolKeys[i];
42511      if (excluded.indexOf(key) >= 0)
42512        continue;
42513      if (!Object.prototype.propertyIsEnumerable.call(source, key))
42514        continue;
42515      target[key] = source[key];
42516    }
42517  }
42518  return target;
42519}
42520function _objectWithoutPropertiesLoose7(source, excluded) {
42521  if (source == null)
42522    return {};
42523  var target = {};
42524  var sourceKeys = Object.keys(source);
42525  var key, i;
42526  for (i = 0;i < sourceKeys.length; i++) {
42527    key = sourceKeys[i];
42528    if (excluded.indexOf(key) >= 0)
42529      continue;
42530    target[key] = source[key];
42531  }
42532  return target;
42533}
42534function _toConsumableArray9(arr) {
42535  return _arrayWithoutHoles9(arr) || _iterableToArray9(arr) || _unsupportedIterableToArray13(arr) || _nonIterableSpread9();
42536}
42537function _nonIterableSpread9() {
42538  throw new TypeError(`Invalid attempt to spread non-iterable instance.
42539In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`);
42540}
42541function _unsupportedIterableToArray13(o, minLen) {
42542  if (!o)
42543    return;
42544  if (typeof o === "string")
42545    return _arrayLikeToArray13(o, minLen);
42546  var n = Object.prototype.toString.call(o).slice(8, -1);
42547  if (n === "Object" && o.constructor)
42548    n = o.constructor.name;
42549  if (n === "Map" || n === "Set")
42550    return Array.from(o);
42551  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
42552    return _arrayLikeToArray13(o, minLen);
42553}
42554function _iterableToArray9(iter) {
42555  if (typeof Symbol !== "undefined" && iter[Symbol.iterator] != null || iter["@@iterator"] != null)
42556    return Array.from(iter);
42557}
42558function _arrayWithoutHoles9(arr) {
42559  if (Array.isArray(arr))
42560    return _arrayLikeToArray13(arr);
42561}
42562function _arrayLikeToArray13(arr, len) {
42563  if (len == null || len > arr.length)
42564    len = arr.length;
42565  for (var i = 0, arr2 = new Array(len);i < len; i++)
42566    arr2[i] = arr[i];
42567  return arr2;
42568}
42569function fetchAlgoliaResults(_ref) {
42570  var { searchClient, queries, userAgents: _ref$userAgents } = _ref, userAgents2 = _ref$userAgents === undefined ? [] : _ref$userAgents;
42571  if (typeof searchClient.addAlgoliaAgent === "function") {
42572    var algoliaAgents = [].concat(_toConsumableArray9(userAgents), _toConsumableArray9(userAgents2));
42573    algoliaAgents.forEach(function(_ref2) {
42574      var { segment, version } = _ref2;
42575      searchClient.addAlgoliaAgent(segment, version);
42576    });
42577  }
42578  var _getAppIdAndApiKey = getAppIdAndApiKey(searchClient), { appId, apiKey } = _getAppIdAndApiKey;
42579  invariant(Boolean(appId), "The Algolia `appId` was not accessible from the searchClient passed.");
42580  invariant(Boolean(apiKey), "The Algolia `apiKey` was not accessible from the searchClient passed.");
42581  return searchClient.search(queries.map(function(searchParameters) {
42582    var params = searchParameters.params, headers = _objectWithoutProperties7(searchParameters, _excluded9);
42583    return _objectSpread20(_objectSpread20({}, headers), {}, {
42584      params: _objectSpread20({
42585        hitsPerPage: 5,
42586        highlightPreTag: HIGHLIGHT_PRE_TAG,
42587        highlightPostTag: HIGHLIGHT_POST_TAG
42588      }, params)
42589    });
42590  })).then(function(response) {
42591    return response.results.map(function(result, resultIndex) {
42592      var _result$hits;
42593      return _objectSpread20(_objectSpread20({}, result), {}, {
42594        hits: (_result$hits = result.hits) === null || _result$hits === undefined ? undefined : _result$hits.map(function(hit) {
42595          return _objectSpread20(_objectSpread20({}, hit), {}, {
42596            __autocomplete_indexName: result.index || queries[resultIndex].indexName,
42597            __autocomplete_queryID: result.queryID,
42598            __autocomplete_algoliaCredentials: {
42599              appId,
42600              apiKey
42601            }
42602          });
42603        })
42604      });
42605    });
42606  });
42607}
42608

vendor: 633 bytes, lines 42609-42626

42609// node_modules/@algolia/autocomplete-js/dist/esm/components/Highlight.js
42610function createHighlightComponent(_ref) {
42611  var { createElement, Fragment } = _ref;
42612  function Highlight(_ref2) {
42613    var { hit, attribute, tagName: _ref2$tagName } = _ref2, tagName = _ref2$tagName === undefined ? "mark" : _ref2$tagName;
42614    return createElement(Fragment, {}, parseAlgoliaHitHighlight({
42615      hit,
42616      attribute
42617    }).map(function(x, index) {
42618      return x.isHighlighted ? createElement(tagName, {
42619        key: index
42620      }, x.value) : x.value;
42621    }));
42622  }
42623  Highlight.__autocomplete_componentName = "Highlight";
42624  return Highlight;
42625}
42626

vendor: 682 bytes, lines 42627-42644

42627// node_modules/@algolia/autocomplete-js/dist/esm/components/ReverseHighlight.js
42628function createReverseHighlightComponent(_ref) {
42629  var { createElement, Fragment } = _ref;
42630  function ReverseHighlight(_ref2) {
42631    var { hit, attribute, tagName: _ref2$tagName } = _ref2, tagName = _ref2$tagName === undefined ? "mark" : _ref2$tagName;
42632    return createElement(Fragment, {}, parseAlgoliaHitReverseHighlight({
42633      hit,
42634      attribute
42635    }).map(function(x, index) {
42636      return x.isHighlighted ? createElement(tagName, {
42637        key: index
42638      }, x.value) : x.value;
42639    }));
42640  }
42641  ReverseHighlight.__autocomplete_componentName = "ReverseHighlight";
42642  return ReverseHighlight;
42643}
42644

vendor: 668 bytes, lines 42645-42662

42645// node_modules/@algolia/autocomplete-js/dist/esm/components/ReverseSnippet.js
42646function createReverseSnippetComponent(_ref) {
42647  var { createElement, Fragment } = _ref;
42648  function ReverseSnippet(_ref2) {
42649    var { hit, attribute, tagName: _ref2$tagName } = _ref2, tagName = _ref2$tagName === undefined ? "mark" : _ref2$tagName;
42650    return createElement(Fragment, {}, parseAlgoliaHitReverseSnippet({
42651      hit,
42652      attribute
42653    }).map(function(x, index) {
42654      return x.isHighlighted ? createElement(tagName, {
42655        key: index
42656      }, x.value) : x.value;
42657    }));
42658  }
42659  ReverseSnippet.__autocomplete_componentName = "ReverseSnippet";
42660  return ReverseSnippet;
42661}
42662

vendor: 619 bytes, lines 42663-42680

42663// node_modules/@algolia/autocomplete-js/dist/esm/components/Snippet.js
42664function createSnippetComponent(_ref) {
42665  var { createElement, Fragment } = _ref;
42666  function Snippet(_ref2) {
42667    var { hit, attribute, tagName: _ref2$tagName } = _ref2, tagName = _ref2$tagName === undefined ? "mark" : _ref2$tagName;
42668    return createElement(Fragment, {}, parseAlgoliaHitSnippet({
42669      hit,
42670      attribute
42671    }).map(function(x, index) {
42672      return x.isHighlighted ? createElement(tagName, {
42673        key: index
42674      }, x.value) : x.value;
42675    }));
42676  }
42677  Snippet.__autocomplete_componentName = "Snippet";
42678  return Snippet;
42679}
42680

vendor: 9,984 bytes, lines 42681-42881

42681// node_modules/@algolia/autocomplete-js/dist/esm/getDefaultOptions.js
42682function _typeof23(obj2) {
42683  "@babel/helpers - typeof";
42684  return _typeof23 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
42685    return typeof obj2;
42686  } : function(obj2) {
42687    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
42688  }, _typeof23(obj2);
42689}
42690var _excluded10 = ["classNames", "container", "getEnvironmentProps", "getFormProps", "getInputProps", "getItemProps", "getLabelProps", "getListProps", "getPanelProps", "getRootProps", "panelContainer", "panelPlacement", "render", "renderNoResults", "renderer", "detachedMediaQuery", "components", "translations"];
42691function ownKeys21(object, enumerableOnly) {
42692  var keys = Object.keys(object);
42693  if (Object.getOwnPropertySymbols) {
42694    var symbols = Object.getOwnPropertySymbols(object);
42695    enumerableOnly && (symbols = symbols.filter(function(sym) {
42696      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
42697    })), keys.push.apply(keys, symbols);
42698  }
42699  return keys;
42700}
42701function _objectSpread21(target) {
42702  for (var i = 1;i < arguments.length; i++) {
42703    var source = arguments[i] != null ? arguments[i] : {};
42704    i % 2 ? ownKeys21(Object(source), true).forEach(function(key) {
42705      _defineProperty21(target, key, source[key]);
42706    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys21(Object(source)).forEach(function(key) {
42707      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
42708    });
42709  }
42710  return target;
42711}
42712function _defineProperty21(obj2, key, value) {
42713  key = _toPropertyKey21(key);
42714  if (key in obj2) {
42715    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
42716  } else {
42717    obj2[key] = value;
42718  }
42719  return obj2;
42720}
42721function _toPropertyKey21(arg) {
42722  var key = _toPrimitive21(arg, "string");
42723  return _typeof23(key) === "symbol" ? key : String(key);
42724}
42725function _toPrimitive21(input, hint) {
42726  if (_typeof23(input) !== "object" || input === null)
42727    return input;
42728  var prim = input[Symbol.toPrimitive];
42729  if (prim !== undefined) {
42730    var res = prim.call(input, hint || "default");
42731    if (_typeof23(res) !== "object")
42732      return res;
42733    throw new TypeError("@@toPrimitive must return a primitive value.");
42734  }
42735  return (hint === "string" ? String : Number)(input);
42736}
42737function _objectWithoutProperties8(source, excluded) {
42738  if (source == null)
42739    return {};
42740  var target = _objectWithoutPropertiesLoose8(source, excluded);
42741  var key, i;
42742  if (Object.getOwnPropertySymbols) {
42743    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
42744    for (i = 0;i < sourceSymbolKeys.length; i++) {
42745      key = sourceSymbolKeys[i];
42746      if (excluded.indexOf(key) >= 0)
42747        continue;
42748      if (!Object.prototype.propertyIsEnumerable.call(source, key))
42749        continue;
42750      target[key] = source[key];
42751    }
42752  }
42753  return target;
42754}
42755function _objectWithoutPropertiesLoose8(source, excluded) {
42756  if (source == null)
42757    return {};
42758  var target = {};
42759  var sourceKeys = Object.keys(source);
42760  var key, i;
42761  for (i = 0;i < sourceKeys.length; i++) {
42762    key = sourceKeys[i];
42763    if (excluded.indexOf(key) >= 0)
42764      continue;
42765    target[key] = source[key];
42766  }
42767  return target;
42768}
42769var defaultClassNames = {
42770  clearButton: "aa-ClearButton",
42771  detachedCancelButton: "aa-DetachedCancelButton",
42772  detachedContainer: "aa-DetachedContainer",
42773  detachedFormContainer: "aa-DetachedFormContainer",
42774  detachedOverlay: "aa-DetachedOverlay",
42775  detachedSearchButton: "aa-DetachedSearchButton",
42776  detachedSearchButtonIcon: "aa-DetachedSearchButtonIcon",
42777  detachedSearchButtonPlaceholder: "aa-DetachedSearchButtonPlaceholder",
42778  detachedSearchButtonQuery: "aa-DetachedSearchButtonQuery",
42779  form: "aa-Form",
42780  input: "aa-Input",
42781  inputWrapper: "aa-InputWrapper",
42782  inputWrapperPrefix: "aa-InputWrapperPrefix",
42783  inputWrapperSuffix: "aa-InputWrapperSuffix",
42784  item: "aa-Item",
42785  label: "aa-Label",
42786  list: "aa-List",
42787  loadingIndicator: "aa-LoadingIndicator",
42788  panel: "aa-Panel",
42789  panelLayout: "aa-PanelLayout aa-Panel--scrollable",
42790  root: "aa-Autocomplete",
42791  source: "aa-Source",
42792  sourceFooter: "aa-SourceFooter",
42793  sourceHeader: "aa-SourceHeader",
42794  sourceNoResults: "aa-SourceNoResults",
42795  submitButton: "aa-SubmitButton"
42796};
42797var defaultRender = function defaultRender(_ref, root2) {
42798  var { children, render } = _ref;
42799  render(children, root2);
42800};
42801var defaultRenderer = {
42802  createElement: _,
42803  Fragment: k,
42804  render: J
42805};
42806function getDefaultOptions(options2) {
42807  var _core$id;
42808  var { classNames, container, getEnvironmentProps, getFormProps, getInputProps, getItemProps, getLabelProps, getListProps, getPanelProps, getRootProps, panelContainer, panelPlacement, render, renderNoResults, renderer, detachedMediaQuery, components, translations } = options2, core = _objectWithoutProperties8(options2, _excluded10);
42809  var environment = typeof window !== "undefined" ? window : {};
42810  var containerElement = getHTMLElement(environment, container);
42811  invariant(containerElement.tagName !== "INPUT", "The `container` option does not support `input` elements. You need to change the container to a `div`.");
42812  warn2(!(render && renderer && !(renderer !== null && renderer !== undefined && renderer.render)), "You provided the `render` option but did not provide a `renderer.render`. Since v1.6.0, you can provide a `render` function directly in `renderer`." + `
42813To get rid of this warning, do any of the following depending on your use case.` + "\n- If you are using the `render` option only to override Autocomplete's default `render` function, pass the `render` function into `renderer` and remove the `render` option." + "\n- If you are using the `render` option to customize the layout, pass your `render` function into `renderer` and use it from the provided parameters of the `render` option." + "\n- If you are using the `render` option to work with React 18, pass an empty `render` function into `renderer`." + `
42814See https://www.algolia.com/doc/ui-libraries/autocomplete/api-reference/autocomplete-js/autocomplete/#param-render`);
42815  warn2(!renderer || render || renderer.Fragment && renderer.createElement && renderer.render, "You provided an incomplete `renderer` (missing: ".concat([!(renderer !== null && renderer !== undefined && renderer.createElement) && "`renderer.createElement`", !(renderer !== null && renderer !== undefined && renderer.Fragment) && "`renderer.Fragment`", !(renderer !== null && renderer !== undefined && renderer.render) && "`renderer.render`"].filter(Boolean).join(", "), "). This can cause rendering issues.") + `
42816See https://www.algolia.com/doc/ui-libraries/autocomplete/api-reference/autocomplete-js/autocomplete/#param-renderer`);
42817  var defaultedRenderer = _objectSpread21(_objectSpread21({}, defaultRenderer), renderer);
42818  var defaultComponents = {
42819    Highlight: createHighlightComponent(defaultedRenderer),
42820    ReverseHighlight: createReverseHighlightComponent(defaultedRenderer),
42821    ReverseSnippet: createReverseSnippetComponent(defaultedRenderer),
42822    Snippet: createSnippetComponent(defaultedRenderer)
42823  };
42824  var defaultTranslations = {
42825    clearButtonTitle: "Clear",
42826    detachedCancelButtonText: "Cancel",
42827    detachedSearchButtonTitle: "Search",
42828    submitButtonTitle: "Submit"
42829  };
42830  return {
42831    renderer: {
42832      classNames: mergeClassNames(defaultClassNames, classNames !== null && classNames !== undefined ? classNames : {}),
42833      container: containerElement,
42834      getEnvironmentProps: getEnvironmentProps !== null && getEnvironmentProps !== undefined ? getEnvironmentProps : function(_ref2) {
42835        var props = _ref2.props;
42836        return props;
42837      },
42838      getFormProps: getFormProps !== null && getFormProps !== undefined ? getFormProps : function(_ref3) {
42839        var props = _ref3.props;
42840        return props;
42841      },
42842      getInputProps: getInputProps !== null && getInputProps !== undefined ? getInputProps : function(_ref4) {
42843        var props = _ref4.props;
42844        return props;
42845      },
42846      getItemProps: getItemProps !== null && getItemProps !== undefined ? getItemProps : function(_ref5) {
42847        var props = _ref5.props;
42848        return props;
42849      },
42850      getLabelProps: getLabelProps !== null && getLabelProps !== undefined ? getLabelProps : function(_ref6) {
42851        var props = _ref6.props;
42852        return props;
42853      },
42854      getListProps: getListProps !== null && getListProps !== undefined ? getListProps : function(_ref7) {
42855        var props = _ref7.props;
42856        return props;
42857      },
42858      getPanelProps: getPanelProps !== null && getPanelProps !== undefined ? getPanelProps : function(_ref8) {
42859        var props = _ref8.props;
42860        return props;
42861      },
42862      getRootProps: getRootProps !== null && getRootProps !== undefined ? getRootProps : function(_ref9) {
42863        var props = _ref9.props;
42864        return props;
42865      },
42866      panelContainer: panelContainer ? getHTMLElement(environment, panelContainer) : environment.document.body,
42867      panelPlacement: panelPlacement !== null && panelPlacement !== undefined ? panelPlacement : "input-wrapper-width",
42868      render: render !== null && render !== undefined ? render : defaultRender,
42869      renderNoResults,
42870      renderer: defaultedRenderer,
42871      detachedMediaQuery: detachedMediaQuery !== null && detachedMediaQuery !== undefined ? detachedMediaQuery : getComputedStyle(environment.document.documentElement).getPropertyValue("--aa-detached-media-query"),
42872      components: _objectSpread21(_objectSpread21({}, defaultComponents), components),
42873      translations: _objectSpread21(_objectSpread21({}, defaultTranslations), translations)
42874    },
42875    core: _objectSpread21(_objectSpread21({}, core), {}, {
42876      id: (_core$id = core.id) !== null && _core$id !== undefined ? _core$id : generateAutocompleteId(),
42877      environment
42878    })
42879  };
42880}
42881

vendor: 1,347 bytes, lines 42882-42925

42882// node_modules/@algolia/autocomplete-js/dist/esm/getPanelPlacementStyle.js
42883function getPanelPlacementStyle(_ref) {
42884  var { panelPlacement, container, form, environment } = _ref;
42885  var containerRect = container.getBoundingClientRect();
42886  var scrollTop = environment.pageYOffset || environment.document.documentElement.scrollTop || environment.document.body.scrollTop || 0;
42887  var top = scrollTop + containerRect.top + containerRect.height;
42888  switch (panelPlacement) {
42889    case "start": {
42890      return {
42891        top,
42892        left: containerRect.left
42893      };
42894    }
42895    case "end": {
42896      return {
42897        top,
42898        right: environment.document.documentElement.clientWidth - (containerRect.left + containerRect.width)
42899      };
42900    }
42901    case "full-width": {
42902      return {
42903        top,
42904        left: 0,
42905        right: 0,
42906        width: "unset",
42907        maxWidth: "unset"
42908      };
42909    }
42910    case "input-wrapper-width": {
42911      var formRect = form.getBoundingClientRect();
42912      return {
42913        top,
42914        left: formRect.left,
42915        right: environment.document.documentElement.clientWidth - (formRect.left + formRect.width),
42916        width: "unset",
42917        maxWidth: "unset"
42918      };
42919    }
42920    default: {
42921      throw new Error("[Autocomplete] The `panelPlacement` value ".concat(JSON.stringify(panelPlacement), " is not valid."));
42922    }
42923  }
42924}
42925

vendor: 7,150 bytes, lines 42926-43134

42926// node_modules/@algolia/autocomplete-js/dist/esm/render.js
42927function _typeof24(obj2) {
42928  "@babel/helpers - typeof";
42929  return _typeof24 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
42930    return typeof obj2;
42931  } : function(obj2) {
42932    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
42933  }, _typeof24(obj2);
42934}
42935function _extends() {
42936  _extends = Object.assign ? Object.assign.bind() : function(target) {
42937    for (var i = 1;i < arguments.length; i++) {
42938      var source = arguments[i];
42939      for (var key in source) {
42940        if (Object.prototype.hasOwnProperty.call(source, key)) {
42941          target[key] = source[key];
42942        }
42943      }
42944    }
42945    return target;
42946  };
42947  return _extends.apply(this, arguments);
42948}
42949function ownKeys22(object, enumerableOnly) {
42950  var keys = Object.keys(object);
42951  if (Object.getOwnPropertySymbols) {
42952    var symbols = Object.getOwnPropertySymbols(object);
42953    enumerableOnly && (symbols = symbols.filter(function(sym) {
42954      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
42955    })), keys.push.apply(keys, symbols);
42956  }
42957  return keys;
42958}
42959function _objectSpread22(target) {
42960  for (var i = 1;i < arguments.length; i++) {
42961    var source = arguments[i] != null ? arguments[i] : {};
42962    i % 2 ? ownKeys22(Object(source), true).forEach(function(key) {
42963      _defineProperty22(target, key, source[key]);
42964    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys22(Object(source)).forEach(function(key) {
42965      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
42966    });
42967  }
42968  return target;
42969}
42970function _defineProperty22(obj2, key, value) {
42971  key = _toPropertyKey22(key);
42972  if (key in obj2) {
42973    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
42974  } else {
42975    obj2[key] = value;
42976  }
42977  return obj2;
42978}
42979function _toPropertyKey22(arg) {
42980  var key = _toPrimitive22(arg, "string");
42981  return _typeof24(key) === "symbol" ? key : String(key);
42982}
42983function _toPrimitive22(input, hint) {
42984  if (_typeof24(input) !== "object" || input === null)
42985    return input;
42986  var prim = input[Symbol.toPrimitive];
42987  if (prim !== undefined) {
42988    var res = prim.call(input, hint || "default");
42989    if (_typeof24(res) !== "object")
42990      return res;
42991    throw new TypeError("@@toPrimitive must return a primitive value.");
42992  }
42993  return (hint === "string" ? String : Number)(input);
42994}
42995function renderSearchBox(_ref) {
42996  var { autocomplete, autocompleteScopeApi, dom, propGetters, state } = _ref;
42997  setPropertiesWithoutEvents(dom.root, propGetters.getRootProps(_objectSpread22({
42998    state,
42999    props: autocomplete.getRootProps({})
43000  }, autocompleteScopeApi)));
43001  setPropertiesWithoutEvents(dom.input, propGetters.getInputProps(_objectSpread22({
43002    state,
43003    props: autocomplete.getInputProps({
43004      inputElement: dom.input
43005    }),
43006    inputElement: dom.input
43007  }, autocompleteScopeApi)));
43008  setProperties(dom.label, {
43009    hidden: state.status === "stalled"
43010  });
43011  setProperties(dom.loadingIndicator, {
43012    hidden: state.status !== "stalled"
43013  });
43014  toggleAnimation(dom.loadingIndicator, state.status === "stalled");
43015  setProperties(dom.clearButton, {
43016    hidden: !state.query
43017  });
43018  setProperties(dom.detachedSearchButtonQuery, {
43019    textContent: state.query
43020  });
43021  setProperties(dom.detachedSearchButtonPlaceholder, {
43022    hidden: Boolean(state.query)
43023  });
43024}
43025function toggleAnimation(element, isActive) {
43026  var _element$firstChild;
43027  var svgElement = ((_element$firstChild = element.firstChild) === null || _element$firstChild === undefined ? undefined : _element$firstChild.nodeName) === "svg" ? element.firstChild : null;
43028  if (!svgElement || !svgElement.pauseAnimations || !svgElement.unpauseAnimations) {
43029    return;
43030  }
43031  if (isActive) {
43032    svgElement.unpauseAnimations();
43033  } else {
43034    svgElement.pauseAnimations();
43035  }
43036}
43037function renderPanel(render, _ref2) {
43038  var { autocomplete, autocompleteScopeApi, classNames, html, dom, panelContainer, propGetters, state, components, renderer } = _ref2;
43039  if (!state.isOpen) {
43040    if (panelContainer.contains(dom.panel)) {
43041      panelContainer.removeChild(dom.panel);
43042    }
43043    return;
43044  }
43045  if (!panelContainer.contains(dom.panel) && state.status !== "loading") {
43046    panelContainer.appendChild(dom.panel);
43047  }
43048  dom.panel.classList.toggle("aa-Panel--stalled", state.status === "stalled");
43049  var sections = state.collections.filter(function(_ref3) {
43050    var { source, items } = _ref3;
43051    return source.templates.noResults || items.length > 0;
43052  }).map(function(_ref4, sourceIndex) {
43053    var { source, items } = _ref4;
43054    return renderer.createElement("section", {
43055      key: sourceIndex,
43056      className: classNames.source,
43057      "data-autocomplete-source-id": source.sourceId
43058    }, source.templates.header && renderer.createElement("div", {
43059      className: classNames.sourceHeader
43060    }, source.templates.header({
43061      components,
43062      createElement: renderer.createElement,
43063      Fragment: renderer.Fragment,
43064      items,
43065      source,
43066      state,
43067      html
43068    })), source.templates.noResults && items.length === 0 ? renderer.createElement("div", {
43069      className: classNames.sourceNoResults
43070    }, source.templates.noResults({
43071      components,
43072      createElement: renderer.createElement,
43073      Fragment: renderer.Fragment,
43074      source,
43075      state,
43076      html
43077    })) : renderer.createElement("ul", _extends({
43078      className: classNames.list
43079    }, propGetters.getListProps(_objectSpread22({
43080      state,
43081      props: autocomplete.getListProps({
43082        source
43083      })
43084    }, autocompleteScopeApi))), items.map(function(item) {
43085      var itemProps = autocomplete.getItemProps({
43086        item,
43087        source
43088      });
43089      return renderer.createElement("li", _extends({
43090        key: itemProps.id,
43091        className: classNames.item
43092      }, propGetters.getItemProps(_objectSpread22({
43093        state,
43094        props: itemProps
43095      }, autocompleteScopeApi))), source.templates.item({
43096        components,
43097        createElement: renderer.createElement,
43098        Fragment: renderer.Fragment,
43099        item,
43100        state,
43101        html
43102      }));
43103    })), source.templates.footer && renderer.createElement("div", {
43104      className: classNames.sourceFooter
43105    }, source.templates.footer({
43106      components,
43107      createElement: renderer.createElement,
43108      Fragment: renderer.Fragment,
43109      items,
43110      source,
43111      state,
43112      html
43113    })));
43114  });
43115  var children = renderer.createElement(renderer.Fragment, null, renderer.createElement("div", {
43116    className: classNames.panelLayout
43117  }, sections), renderer.createElement("div", {
43118    className: "aa-GradientBottom"
43119  }));
43120  var elements = sections.reduce(function(acc, current) {
43121    acc[current.props["data-autocomplete-source-id"]] = current;
43122    return acc;
43123  }, {});
43124  render(_objectSpread22(_objectSpread22({
43125    children,
43126    state,
43127    sections,
43128    elements
43129  }, renderer), {}, {
43130    components,
43131    html
43132  }, autocompleteScopeApi), dom.panel);
43133}
43134

vendor: 130 bytes, lines 43135-43140

43135// node_modules/@algolia/autocomplete-js/dist/esm/userAgents.js
43136var userAgents2 = [{
43137  segment: "autocomplete-js",
43138  version
43139}];
43140

vendor: 13,798 bytes, lines 43141-43489

43141// node_modules/@algolia/autocomplete-js/dist/esm/autocomplete.js
43142var _excluded11 = ["components"];
43143function _typeof25(obj2) {
43144  "@babel/helpers - typeof";
43145  return _typeof25 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
43146    return typeof obj2;
43147  } : function(obj2) {
43148    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
43149  }, _typeof25(obj2);
43150}
43151function _objectWithoutProperties9(source, excluded) {
43152  if (source == null)
43153    return {};
43154  var target = _objectWithoutPropertiesLoose9(source, excluded);
43155  var key, i;
43156  if (Object.getOwnPropertySymbols) {
43157    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);
43158    for (i = 0;i < sourceSymbolKeys.length; i++) {
43159      key = sourceSymbolKeys[i];
43160      if (excluded.indexOf(key) >= 0)
43161        continue;
43162      if (!Object.prototype.propertyIsEnumerable.call(source, key))
43163        continue;
43164      target[key] = source[key];
43165    }
43166  }
43167  return target;
43168}
43169function _objectWithoutPropertiesLoose9(source, excluded) {
43170  if (source == null)
43171    return {};
43172  var target = {};
43173  var sourceKeys = Object.keys(source);
43174  var key, i;
43175  for (i = 0;i < sourceKeys.length; i++) {
43176    key = sourceKeys[i];
43177    if (excluded.indexOf(key) >= 0)
43178      continue;
43179    target[key] = source[key];
43180  }
43181  return target;
43182}
43183function ownKeys23(object, enumerableOnly) {
43184  var keys = Object.keys(object);
43185  if (Object.getOwnPropertySymbols) {
43186    var symbols = Object.getOwnPropertySymbols(object);
43187    enumerableOnly && (symbols = symbols.filter(function(sym) {
43188      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
43189    })), keys.push.apply(keys, symbols);
43190  }
43191  return keys;
43192}
43193function _objectSpread23(target) {
43194  for (var i = 1;i < arguments.length; i++) {
43195    var source = arguments[i] != null ? arguments[i] : {};
43196    i % 2 ? ownKeys23(Object(source), true).forEach(function(key) {
43197      _defineProperty23(target, key, source[key]);
43198    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys23(Object(source)).forEach(function(key) {
43199      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
43200    });
43201  }
43202  return target;
43203}
43204function _defineProperty23(obj2, key, value) {
43205  key = _toPropertyKey23(key);
43206  if (key in obj2) {
43207    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
43208  } else {
43209    obj2[key] = value;
43210  }
43211  return obj2;
43212}
43213function _toPropertyKey23(arg) {
43214  var key = _toPrimitive23(arg, "string");
43215  return _typeof25(key) === "symbol" ? key : String(key);
43216}
43217function _toPrimitive23(input, hint) {
43218  if (_typeof25(input) !== "object" || input === null)
43219    return input;
43220  var prim = input[Symbol.toPrimitive];
43221  if (prim !== undefined) {
43222    var res = prim.call(input, hint || "default");
43223    if (_typeof25(res) !== "object")
43224      return res;
43225    throw new TypeError("@@toPrimitive must return a primitive value.");
43226  }
43227  return (hint === "string" ? String : Number)(input);
43228}
43229var instancesCount = 0;
43230function autocomplete(options2) {
43231  var _createEffectWrapper = createEffectWrapper(), { runEffect, cleanupEffects, runEffects } = _createEffectWrapper;
43232  var _createReactiveWrappe = createReactiveWrapper(), { reactive, runReactives } = _createReactiveWrappe;
43233  var hasNoResultsSourceTemplateRef = createRef(false);
43234  var optionsRef = createRef(options2);
43235  var onStateChangeRef = createRef(undefined);
43236  var props = reactive(function() {
43237    return getDefaultOptions(optionsRef.current);
43238  });
43239  var isDetached = reactive(function() {
43240    return props.value.core.environment.matchMedia(props.value.renderer.detachedMediaQuery).matches;
43241  });
43242  var autocomplete = reactive(function() {
43243    return createAutocomplete(_objectSpread23(_objectSpread23({}, props.value.core), {}, {
43244      onStateChange: function onStateChange(params) {
43245        var _onStateChangeRef$cur, _props$value$core$onS, _props$value$core;
43246        hasNoResultsSourceTemplateRef.current = params.state.collections.some(function(collection) {
43247          return collection.source.templates.noResults;
43248        });
43249        (_onStateChangeRef$cur = onStateChangeRef.current) === null || _onStateChangeRef$cur === undefined || _onStateChangeRef$cur.call(onStateChangeRef, params);
43250        (_props$value$core$onS = (_props$value$core = props.value.core).onStateChange) === null || _props$value$core$onS === undefined || _props$value$core$onS.call(_props$value$core, params);
43251      },
43252      shouldPanelOpen: optionsRef.current.shouldPanelOpen || function(_ref) {
43253        var state = _ref.state;
43254        if (isDetached.value) {
43255          return true;
43256        }
43257        var hasItems = getItemsCount(state) > 0;
43258        if (!props.value.core.openOnFocus && !state.query) {
43259          return hasItems;
43260        }
43261        var hasNoResultsTemplate = Boolean(hasNoResultsSourceTemplateRef.current || props.value.renderer.renderNoResults);
43262        return !hasItems && hasNoResultsTemplate || hasItems;
43263      },
43264      __autocomplete_metadata: {
43265        userAgents: userAgents2,
43266        options: options2
43267      }
43268    }));
43269  });
43270  var lastStateRef = createRef(_objectSpread23({
43271    collections: [],
43272    completion: null,
43273    context: {},
43274    isOpen: false,
43275    query: "",
43276    activeItemId: null,
43277    status: "idle"
43278  }, props.value.core.initialState));
43279  var propGetters = {
43280    getEnvironmentProps: props.value.renderer.getEnvironmentProps,
43281    getFormProps: props.value.renderer.getFormProps,
43282    getInputProps: props.value.renderer.getInputProps,
43283    getItemProps: props.value.renderer.getItemProps,
43284    getLabelProps: props.value.renderer.getLabelProps,
43285    getListProps: props.value.renderer.getListProps,
43286    getPanelProps: props.value.renderer.getPanelProps,
43287    getRootProps: props.value.renderer.getRootProps
43288  };
43289  var autocompleteScopeApi = {
43290    setActiveItemId: autocomplete.value.setActiveItemId,
43291    setQuery: autocomplete.value.setQuery,
43292    setCollections: autocomplete.value.setCollections,
43293    setIsOpen: autocomplete.value.setIsOpen,
43294    setStatus: autocomplete.value.setStatus,
43295    setContext: autocomplete.value.setContext,
43296    refresh: autocomplete.value.refresh,
43297    navigator: autocomplete.value.navigator
43298  };
43299  var html = reactive(function() {
43300    return htm_module_default.bind(props.value.renderer.renderer.createElement);
43301  });
43302  var dom = reactive(function() {
43303    return createAutocompleteDom({
43304      autocomplete: autocomplete.value,
43305      autocompleteScopeApi,
43306      classNames: props.value.renderer.classNames,
43307      environment: props.value.core.environment,
43308      isDetached: isDetached.value,
43309      placeholder: props.value.core.placeholder,
43310      propGetters,
43311      setIsModalOpen,
43312      state: lastStateRef.current,
43313      translations: props.value.renderer.translations
43314    });
43315  });
43316  function setPanelPosition() {
43317    setProperties(dom.value.panel, {
43318      style: isDetached.value ? {} : getPanelPlacementStyle({
43319        panelPlacement: props.value.renderer.panelPlacement,
43320        container: dom.value.root,
43321        form: dom.value.form,
43322        environment: props.value.core.environment
43323      })
43324    });
43325  }
43326  function scheduleRender(state) {
43327    lastStateRef.current = state;
43328    var renderProps = {
43329      autocomplete: autocomplete.value,
43330      autocompleteScopeApi,
43331      classNames: props.value.renderer.classNames,
43332      components: props.value.renderer.components,
43333      container: props.value.renderer.container,
43334      html: html.value,
43335      dom: dom.value,
43336      panelContainer: isDetached.value ? dom.value.detachedContainer : props.value.renderer.panelContainer,
43337      propGetters,
43338      state: lastStateRef.current,
43339      renderer: props.value.renderer.renderer
43340    };
43341    var render = !getItemsCount(state) && !hasNoResultsSourceTemplateRef.current && props.value.renderer.renderNoResults || props.value.renderer.render;
43342    renderSearchBox(renderProps);
43343    renderPanel(render, renderProps);
43344  }
43345  runEffect(function() {
43346    var environmentProps = autocomplete.value.getEnvironmentProps({
43347      formElement: dom.value.form,
43348      panelElement: dom.value.panel,
43349      inputElement: dom.value.input
43350    });
43351    setProperties(props.value.core.environment, environmentProps);
43352    return function() {
43353      setProperties(props.value.core.environment, Object.keys(environmentProps).reduce(function(acc, key) {
43354        return _objectSpread23(_objectSpread23({}, acc), {}, _defineProperty23({}, key, undefined));
43355      }, {}));
43356    };
43357  });
43358  runEffect(function() {
43359    var panelContainerElement = isDetached.value ? props.value.core.environment.document.body : props.value.renderer.panelContainer;
43360    var panelElement = isDetached.value ? dom.value.detachedOverlay : dom.value.panel;
43361    if (isDetached.value && lastStateRef.current.isOpen) {
43362      setIsModalOpen(true);
43363    }
43364    scheduleRender(lastStateRef.current);
43365    return function() {
43366      if (panelContainerElement.contains(panelElement)) {
43367        panelContainerElement.removeChild(panelElement);
43368        panelContainerElement.classList.remove("aa-Detached");
43369      }
43370    };
43371  });
43372  runEffect(function() {
43373    var containerElement = props.value.renderer.container;
43374    containerElement.appendChild(dom.value.root);
43375    return function() {
43376      containerElement.removeChild(dom.value.root);
43377    };
43378  });
43379  runEffect(function() {
43380    var debouncedRender = debounce3(function(_ref2) {
43381      var state = _ref2.state;
43382      scheduleRender(state);
43383    }, 0);
43384    onStateChangeRef.current = function(_ref3) {
43385      var { state, prevState } = _ref3;
43386      if (isDetached.value && prevState.isOpen !== state.isOpen) {
43387        setIsModalOpen(state.isOpen);
43388      }
43389      if (!isDetached.value && state.isOpen && !prevState.isOpen) {
43390        setPanelPosition();
43391      }
43392      if (state.query !== prevState.query) {
43393        var scrollablePanels = props.value.core.environment.document.querySelectorAll(".aa-Panel--scrollable");
43394        scrollablePanels.forEach(function(scrollablePanel) {
43395          if (scrollablePanel.scrollTop !== 0) {
43396            scrollablePanel.scrollTop = 0;
43397          }
43398        });
43399      }
43400      debouncedRender({
43401        state
43402      });
43403    };
43404    return function() {
43405      onStateChangeRef.current = undefined;
43406    };
43407  });
43408  runEffect(function() {
43409    var onResize = debounce3(function() {
43410      var previousIsDetached = isDetached.value;
43411      isDetached.value = props.value.core.environment.matchMedia(props.value.renderer.detachedMediaQuery).matches;
43412      if (previousIsDetached !== isDetached.value) {
43413        update({});
43414      } else {
43415        requestAnimationFrame(setPanelPosition);
43416      }
43417    }, 20);
43418    props.value.core.environment.addEventListener("resize", onResize);
43419    return function() {
43420      props.value.core.environment.removeEventListener("resize", onResize);
43421    };
43422  });
43423  runEffect(function() {
43424    if (!isDetached.value) {
43425      return function() {};
43426    }
43427    function toggleModalClassname(isActive) {
43428      dom.value.detachedContainer.classList.toggle("aa-DetachedContainer--modal", isActive);
43429    }
43430    function onChange(event) {
43431      toggleModalClassname(event.matches);
43432    }
43433    var isModalDetachedMql = props.value.core.environment.matchMedia(getComputedStyle(props.value.core.environment.document.documentElement).getPropertyValue("--aa-detached-modal-media-query"));
43434    toggleModalClassname(isModalDetachedMql.matches);
43435    var hasModernEventListener = Boolean(isModalDetachedMql.addEventListener);
43436    hasModernEventListener ? isModalDetachedMql.addEventListener("change", onChange) : isModalDetachedMql.addListener(onChange);
43437    return function() {
43438      hasModernEventListener ? isModalDetachedMql.removeEventListener("change", onChange) : isModalDetachedMql.removeListener(onChange);
43439    };
43440  });
43441  runEffect(function() {
43442    requestAnimationFrame(setPanelPosition);
43443    return function() {};
43444  });
43445  function destroy() {
43446    instancesCount--;
43447    cleanupEffects();
43448  }
43449  function update() {
43450    var updatedOptions = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
43451    cleanupEffects();
43452    var _props$value$renderer = props.value.renderer, components = _props$value$renderer.components, rendererProps = _objectWithoutProperties9(_props$value$renderer, _excluded11);
43453    optionsRef.current = mergeDeep(rendererProps, props.value.core, {
43454      components: pickBy(components, function(_ref4) {
43455        var value = _ref4.value;
43456        return !value.hasOwnProperty("__autocomplete_componentName");
43457      }),
43458      initialState: lastStateRef.current
43459    }, updatedOptions);
43460    runReactives();
43461    runEffects();
43462    autocomplete.value.refresh().then(function() {
43463      scheduleRender(lastStateRef.current);
43464    });
43465  }
43466  function setIsModalOpen(value) {
43467    var prevValue = props.value.core.environment.document.body.contains(dom.value.detachedOverlay);
43468    if (value === prevValue) {
43469      return;
43470    }
43471    if (value) {
43472      props.value.core.environment.document.body.appendChild(dom.value.detachedOverlay);
43473      props.value.core.environment.document.body.classList.add("aa-Detached");
43474      dom.value.input.focus();
43475    } else {
43476      props.value.core.environment.document.body.removeChild(dom.value.detachedOverlay);
43477      props.value.core.environment.document.body.classList.remove("aa-Detached");
43478    }
43479  }
43480  warn2(instancesCount === 0, `Autocomplete doesn't support multiple instances running at the same time. Make sure to destroy the previous instance before creating a new one.
43481
43482See: https://www.algolia.com/doc/ui-libraries/autocomplete/api-reference/autocomplete-js/autocomplete/#param-destroy`);
43483  instancesCount++;
43484  return _objectSpread23(_objectSpread23({}, autocompleteScopeApi), {}, {
43485    update,
43486    destroy
43487  });
43488}
43489

vendor: 2,378 bytes, lines 43490-43550

43490// node_modules/@algolia/autocomplete-js/dist/esm/requesters/createAlgoliaRequester.js
43491function _typeof26(obj2) {
43492  "@babel/helpers - typeof";
43493  return _typeof26 = typeof Symbol == "function" && typeof Symbol.iterator == "symbol" ? function(obj2) {
43494    return typeof obj2;
43495  } : function(obj2) {
43496    return obj2 && typeof Symbol == "function" && obj2.constructor === Symbol && obj2 !== Symbol.prototype ? "symbol" : typeof obj2;
43497  }, _typeof26(obj2);
43498}
43499function ownKeys24(object, enumerableOnly) {
43500  var keys = Object.keys(object);
43501  if (Object.getOwnPropertySymbols) {
43502    var symbols = Object.getOwnPropertySymbols(object);
43503    enumerableOnly && (symbols = symbols.filter(function(sym) {
43504      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
43505    })), keys.push.apply(keys, symbols);
43506  }
43507  return keys;
43508}
43509function _objectSpread24(target) {
43510  for (var i = 1;i < arguments.length; i++) {
43511    var source = arguments[i] != null ? arguments[i] : {};
43512    i % 2 ? ownKeys24(Object(source), true).forEach(function(key) {
43513      _defineProperty24(target, key, source[key]);
43514    }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys24(Object(source)).forEach(function(key) {
43515      Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
43516    });
43517  }
43518  return target;
43519}
43520function _defineProperty24(obj2, key, value) {
43521  key = _toPropertyKey24(key);
43522  if (key in obj2) {
43523    Object.defineProperty(obj2, key, { value, enumerable: true, configurable: true, writable: true });
43524  } else {
43525    obj2[key] = value;
43526  }
43527  return obj2;
43528}
43529function _toPropertyKey24(arg) {
43530  var key = _toPrimitive24(arg, "string");
43531  return _typeof26(key) === "symbol" ? key : String(key);
43532}
43533function _toPrimitive24(input, hint) {
43534  if (_typeof26(input) !== "object" || input === null)
43535    return input;
43536  var prim = input[Symbol.toPrimitive];
43537  if (prim !== undefined) {
43538    var res = prim.call(input, hint || "default");
43539    if (_typeof26(res) !== "object")
43540      return res;
43541    throw new TypeError("@@toPrimitive must return a primitive value.");
43542  }
43543  return (hint === "string" ? String : Number)(input);
43544}
43545var createAlgoliaRequester = createRequester(function(params) {
43546  return fetchAlgoliaResults(_objectSpread24(_objectSpread24({}, params), {}, {
43547    userAgents: userAgents2
43548  }));
43549}, "algolia");
43550

vendor: 226 bytes, lines 43551-43557

43551// node_modules/@algolia/autocomplete-js/dist/esm/requesters/getAlgoliaResults.js
43552var getAlgoliaResults = createAlgoliaRequester({
43553  transformResponse: function transformResponse(response) {
43554    return response.hits;
43555  }
43556});
43557

vendor: 18,436 bytes, lines 43558-43953

43558// node_modules/search-insights/dist/search-insights-browser.mjs
43559var version2 = "2.17.3";
43560function extractAdditionalParams(e) {
43561  return e.reduce(function(e, t) {
43562    var { events: n, additionalParams: e } = e;
43563    return "index" in t ? { additionalParams: e, events: n.concat([t]) } : { events: n, additionalParams: t };
43564  }, { events: [], additionalParams: undefined });
43565}
43566var supportsCookies = function() {
43567  try {
43568    return Boolean(navigator.cookieEnabled);
43569  } catch (e) {
43570    return false;
43571  }
43572};
43573var supportsSendBeacon = function() {
43574  try {
43575    return Boolean(navigator.sendBeacon);
43576  } catch (e) {
43577    return false;
43578  }
43579};
43580var supportsXMLHttpRequest = function() {
43581  try {
43582    return Boolean(XMLHttpRequest);
43583  } catch (e) {
43584    return false;
43585  }
43586};
43587var supportsNativeFetch = function() {
43588  try {
43589    return fetch !== undefined;
43590  } catch (e) {
43591    return false;
43592  }
43593};
43594var LocalStorage = function() {};
43595function ensureLocalStorage() {
43596  try {
43597    var e = "__test_localStorage__";
43598    return globalThis.localStorage.setItem(e, e), globalThis.localStorage.removeItem(e), globalThis.localStorage;
43599  } catch (e) {}
43600}
43601LocalStorage.get = function(e) {
43602  var t = (t = this.store) == null ? undefined : t.getItem(e);
43603  if (!t)
43604    return null;
43605  try {
43606    return JSON.parse(t);
43607  } catch (e) {
43608    return null;
43609  }
43610}, LocalStorage.set = function(t, e) {
43611  var n;
43612  try {
43613    (n = this.store) != null && n.setItem(t, JSON.stringify(e));
43614  } catch (e) {
43615    console.error("Unable to set " + t + " in localStorage, storage may be full.");
43616  }
43617}, LocalStorage.remove = function(e) {
43618  var t;
43619  (t = this.store) != null && t.removeItem(e);
43620}, LocalStorage.store = ensureLocalStorage();
43621var STORE = "AlgoliaObjectQueryCache";
43622var LIMIT = 5000;
43623var FREE = 1000;
43624function getCache() {
43625  var e;
43626  return (e = LocalStorage.get(STORE)) != null ? e : {};
43627}
43628function setCache(e) {
43629  LocalStorage.set(STORE, limited(e));
43630}
43631function limited(e) {
43632  return Object.keys(e).length > LIMIT ? purgeOldest(e) : e;
43633}
43634function purgeOldest(e) {
43635  e = Object.entries(e).sort(function(e, t) {
43636    e = e[1][1];
43637    return t[1][1] - e;
43638  });
43639  return e.slice(0, e.length - FREE - 1).reduce(function(e, t) {
43640    var n = t[0], t = t[1];
43641    return Object.assign(Object.assign({}, e), ((e = {})[n] = t, e));
43642  }, {});
43643}
43644function makeKey(e, t) {
43645  return e + "_" + t;
43646}
43647function storeQueryForObject(e, t, n) {
43648  var i = getCache();
43649  i[makeKey(e, t)] = [n, Date.now()], setCache(i);
43650}
43651function getQueryForObject(e, t) {
43652  return getCache()[makeKey(e, t)];
43653}
43654function removeQueryForObjects(t, e) {
43655  var n = getCache();
43656  e.forEach(function(e) {
43657    delete n[makeKey(t, e)];
43658  }), setCache(n);
43659}
43660var isUndefined = function(e) {
43661  return e === undefined;
43662};
43663var isNumber = function(e) {
43664  return typeof e == "number";
43665};
43666var isFunction = function(e) {
43667  return typeof e == "function";
43668};
43669var isPromise = function(e) {
43670  return typeof (e == null ? undefined : e.then) == "function";
43671};
43672function getFunctionalInterface(i) {
43673  return function(e) {
43674    for (var t = [], n = arguments.length - 1;0 < n--; )
43675      t[n] = arguments[n + 1];
43676    if (e && isFunction(i[e]))
43677      return i[e].apply(i, t);
43678    console.warn("The method `" + e + "` doesn't exist.");
43679  };
43680}
43681var DEFAULT_ALGOLIA_AGENTS = ["insights-js (" + version2 + ")", "insights-js-browser-esm (" + version2 + ")"];
43682function addAlgoliaAgent(e) {
43683  this._ua.indexOf(e) === -1 && this._ua.push(e);
43684}
43685function getVersion(e) {
43686  return isFunction(e) && e(this.version), this.version;
43687}
43688function __rest(e, t) {
43689  var n = {};
43690  for (r in e)
43691    Object.prototype.hasOwnProperty.call(e, r) && t.indexOf(r) < 0 && (n[r] = e[r]);
43692  if (e != null && typeof Object.getOwnPropertySymbols == "function")
43693    for (var i = 0, r = Object.getOwnPropertySymbols(e);i < r.length; i++)
43694      t.indexOf(r[i]) < 0 && Object.prototype.propertyIsEnumerable.call(e, r[i]) && (n[r[i]] = e[r[i]]);
43695  return n;
43696}
43697function addQueryId(e) {
43698  return e.map(function(i) {
43699    var r, e;
43700    return !isValidEventForQueryIdLookup(i) || (r = [], e = (e = i.objectIDs) == null ? undefined : e.map(function(e, t) {
43701      var n = (n = i.objectData) == null ? undefined : n[t];
43702      return n != null && n.queryID ? n : ((t = ((t = getQueryForObject(i.index, e)) != null ? t : [])[0]) && r.push(e), Object.assign(Object.assign({}, n), { queryID: t }));
43703    }), r.length === 0) ? i : Object.assign(Object.assign({}, i), { objectData: e, objectIDsWithInferredQueryID: r });
43704  });
43705}
43706function isValidEventForQueryIdLookup(e) {
43707  return !e.queryID && e.eventType === "conversion";
43708}
43709function makeSendEvents(r) {
43710  return function(e, t) {
43711    var i = this;
43712    if (this._userHasOptedOut)
43713      return Promise.resolve(false);
43714    if (!(!isUndefined(this._apiKey) && !isUndefined(this._appId) || ((n = t == null ? undefined : t.headers) == null ? undefined : n["X-Algolia-Application-Id"]) && ((n = t == null ? undefined : t.headers) == null ? undefined : n["X-Algolia-API-Key"])))
43715      throw new Error("Before calling any methods on the analytics, you first need to call the 'init' function with appId and apiKey parameters or provide custom credentials in additional parameters.");
43716    !this._userToken && this._anonymousUserToken && this.setAnonymousUserToken(true);
43717    var n = (t != null && t.inferQueryID ? addQueryId(e) : e).map(function(e) {
43718      var t = e.filters, n = __rest(e, ["filters"]), e = Object.assign(Object.assign({}, n), { userToken: (n = e == null ? undefined : e.userToken) != null ? n : i._userToken, authenticatedUserToken: (n = e == null ? undefined : e.authenticatedUserToken) != null ? n : i._authenticatedUserToken });
43719      return isUndefined(t) || (e.filters = t.map(encodeURIComponent)), e;
43720    });
43721    return n.length === 0 ? Promise.resolve(false) : (e = sendRequest(r, this._ua, this._endpointOrigin, n, this._appId, this._apiKey, t == null ? undefined : t.headers), isPromise(e) ? e.then(purgePurchased(n)) : e);
43722  };
43723}
43724function purgePurchased(t) {
43725  return function(e) {
43726    return e && t.filter(function(e) {
43727      var { eventType: t, eventSubtype: n, objectIDs: e } = e;
43728      return t === "conversion" && n === "purchase" && (e == null ? undefined : e.length);
43729    }).forEach(function(e) {
43730      return removeQueryForObjects(e.index, e.objectIDs);
43731    }), e;
43732  };
43733}
43734function sendRequest(e, t, n, i, r, o, s) {
43735  var a = (s = s === undefined ? {} : s)["X-Algolia-Application-Id"], c = s["X-Algolia-API-Key"], s = __rest(s, ["X-Algolia-Application-Id", "X-Algolia-API-Key"]), u = Object.assign({ "X-Algolia-Application-Id": a != null ? a : r, "X-Algolia-API-Key": c != null ? c : o, "X-Algolia-Agent": encodeURIComponent(t.join("; ")) }, s);
43736  return e(n + "/1/events?" + Object.keys(u).map(function(e) {
43737    return e + "=" + u[e];
43738  }).join("&"), { events: i });
43739}
43740function createUUID() {
43741  return "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(/[xy]/g, function(e) {
43742    var t = 16 * Math.random() | 0;
43743    return (e === "x" ? t : 3 & t | 8).toString(16);
43744  });
43745}
43746var COOKIE_KEY = "_ALGOLIA";
43747var MONTH = 2592000000;
43748var setCookie = function(e, t, n) {
43749  var i = new Date, n = (i.setTime(i.getTime() + n), "expires=" + i.toUTCString());
43750  document.cookie = e + "=" + t + ";" + n + ";path=/";
43751};
43752var getCookie = function(e) {
43753  for (var t = e + "=", n = document.cookie.split(";"), i = 0;i < n.length; i++) {
43754    for (var r = n[i];r.charAt(0) === " "; )
43755      r = r.substring(1);
43756    if (r.indexOf(t) === 0)
43757      return r.substring(t.length, r.length);
43758  }
43759  return "";
43760};
43761function checkIfAnonymousToken(e) {
43762  return typeof e != "number" && e.indexOf("anonymous-") === 0;
43763}
43764function saveTokenAsCookie() {
43765  var e = getCookie(COOKIE_KEY);
43766  !this._userToken || e && e !== "" && e.indexOf("anonymous-") === 0 || setCookie(COOKIE_KEY, this._userToken, this._cookieDuration);
43767}
43768function setAnonymousUserToken(e) {
43769  (e = e !== undefined && e) ? this.setUserToken("anonymous-" + createUUID()) : supportsCookies() && ((e = getCookie(COOKIE_KEY)) && e !== "" && e.indexOf("anonymous-") === 0 ? this.setUserToken(e) : (e = this.setUserToken("anonymous-" + createUUID()), setCookie(COOKIE_KEY, e, this._cookieDuration)));
43770}
43771function setUserToken(e) {
43772  return this._userToken = e, isFunction(this._onUserTokenChangeCallback) && this._onUserTokenChangeCallback(this._userToken), this._userToken;
43773}
43774function getUserToken(e, t) {
43775  return isFunction(t) && t(null, this._userToken), this._userToken;
43776}
43777function onUserTokenChange(e, t) {
43778  this._onUserTokenChangeCallback = e, t && t.immediate && isFunction(this._onUserTokenChangeCallback) && this._onUserTokenChangeCallback(this._userToken);
43779}
43780function setAuthenticatedUserToken(e) {
43781  return this._authenticatedUserToken = e, isFunction(this._onAuthenticatedUserTokenChangeCallback) && this._onAuthenticatedUserTokenChangeCallback(this._authenticatedUserToken), this._authenticatedUserToken;
43782}
43783function getAuthenticatedUserToken(e, t) {
43784  return isFunction(t) && t(null, this._authenticatedUserToken), this._authenticatedUserToken;
43785}
43786function onAuthenticatedUserTokenChange(e, t) {
43787  this._onAuthenticatedUserTokenChangeCallback = e, t && t.immediate && isFunction(this._onAuthenticatedUserTokenChangeCallback) && this._onAuthenticatedUserTokenChangeCallback(this._authenticatedUserToken);
43788}
43789function addEventType(t, e) {
43790  return e.map(function(e) {
43791    return Object.assign({ eventType: t }, e);
43792  });
43793}
43794function addEventTypeAndSubtype(t, n, e) {
43795  return e.map(function(e) {
43796    return Object.assign({ eventType: t, eventSubtype: n }, e);
43797  });
43798}
43799function clickedObjectIDsAfterSearch() {
43800  for (var i = this, e = [], t = arguments.length;t--; )
43801    e[t] = arguments[t];
43802  var n = extractAdditionalParams(e), { events: r, additionalParams: n } = n;
43803  return r.forEach(function(e) {
43804    var { index: t, queryID: n } = e;
43805    return e.objectIDs.forEach(function(e) {
43806      return !i._userHasOptedOut && storeQueryForObject(t, e, n);
43807    });
43808  }), this.sendEvents(addEventType("click", r), n);
43809}
43810function clickedObjectIDs() {
43811  for (var e = [], t = arguments.length;t--; )
43812    e[t] = arguments[t];
43813  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43814  return this.sendEvents(addEventType("click", i), n);
43815}
43816function clickedFilters() {
43817  for (var e = [], t = arguments.length;t--; )
43818    e[t] = arguments[t];
43819  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43820  return this.sendEvents(addEventType("click", i), n);
43821}
43822function convertedObjectIDsAfterSearch() {
43823  for (var e = [], t = arguments.length;t--; )
43824    e[t] = arguments[t];
43825  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43826  return this.sendEvents(addEventType("conversion", i), n);
43827}
43828function addedToCartObjectIDsAfterSearch() {
43829  for (var o = this, e = [], t = arguments.length;t--; )
43830    e[t] = arguments[t];
43831  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43832  return i.forEach(function(e) {
43833    var { index: n, queryID: i, objectIDs: t, objectData: r } = e;
43834    return t.forEach(function(e, t) {
43835      t = (t = (t = r == null ? undefined : r[t]) == null ? undefined : t.queryID) != null ? t : i;
43836      !o._userHasOptedOut && t && storeQueryForObject(n, e, t);
43837    });
43838  }), this.sendEvents(addEventTypeAndSubtype("conversion", "addToCart", i), n);
43839}
43840function purchasedObjectIDsAfterSearch() {
43841  for (var e = [], t = arguments.length;t--; )
43842    e[t] = arguments[t];
43843  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43844  return this.sendEvents(addEventTypeAndSubtype("conversion", "purchase", i), n);
43845}
43846function convertedObjectIDs() {
43847  for (var e = [], t = arguments.length;t--; )
43848    e[t] = arguments[t];
43849  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43850  return this.sendEvents(addEventType("conversion", i), n);
43851}
43852function addedToCartObjectIDs() {
43853  for (var r = this, e = [], t = arguments.length;t--; )
43854    e[t] = arguments[t];
43855  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43856  return i.forEach(function(e) {
43857    var { index: n, objectIDs: t, objectData: i } = e;
43858    return t.forEach(function(e, t) {
43859      t = (t = i == null ? undefined : i[t]) == null ? undefined : t.queryID;
43860      !r._userHasOptedOut && t && storeQueryForObject(n, e, t);
43861    });
43862  }), this.sendEvents(addEventTypeAndSubtype("conversion", "addToCart", i), n);
43863}
43864function purchasedObjectIDs() {
43865  for (var e = [], t = arguments.length;t--; )
43866    e[t] = arguments[t];
43867  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43868  return this.sendEvents(addEventTypeAndSubtype("conversion", "purchase", i), n);
43869}
43870function convertedFilters() {
43871  for (var e = [], t = arguments.length;t--; )
43872    e[t] = arguments[t];
43873  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43874  return this.sendEvents(addEventType("conversion", i), n);
43875}
43876var SUPPORTED_REGIONS = ["de", "us"];
43877function init(e) {
43878  var t;
43879  if (!isUndefined((e = e === undefined ? {} : e).region) && SUPPORTED_REGIONS.indexOf(e.region) === -1)
43880    throw new Error("optional region is incorrect, please provide either one of: " + SUPPORTED_REGIONS.join(", ") + ".");
43881  if (!(isUndefined(e.cookieDuration) || isNumber(e.cookieDuration) && isFinite(e.cookieDuration) && Math.floor(e.cookieDuration) === e.cookieDuration))
43882    throw new Error("optional cookieDuration is incorrect, expected an integer.");
43883  setOptions(this, e, { _userHasOptedOut: Boolean(e.userHasOptedOut), _region: e.region, _host: e.host, _anonymousUserToken: (t = e.anonymousUserToken) == null || t, _useCookie: (t = e.useCookie) != null && t, _cookieDuration: e.cookieDuration || 6 * MONTH }), this._endpointOrigin = this._host || (this._region ? "https://insights." + this._region + ".algolia.io" : "https://insights.algolia.io"), this._ua = [].concat(DEFAULT_ALGOLIA_AGENTS), e.authenticatedUserToken && this.setAuthenticatedUserToken(e.authenticatedUserToken), e.userToken ? this.setUserToken(e.userToken) : this._userToken || this._userHasOptedOut || !this._useCookie ? checkIfTokenNeedsToBeSaved(this) && this.saveTokenAsCookie() : this.setAnonymousUserToken();
43884}
43885function setOptions(e, t, n) {
43886  var i = t.partial, r = __rest(t, ["partial"]);
43887  i || Object.assign(e, n), Object.assign(e, Object.keys(r).reduce(function(e, t) {
43888    return Object.assign(Object.assign({}, e), ((e = {})["_" + t] = r[t], e));
43889  }, {}));
43890}
43891function checkIfTokenNeedsToBeSaved(e) {
43892  return e._userToken !== undefined && checkIfAnonymousToken(e._userToken) && e._useCookie && !e._userHasOptedOut;
43893}
43894function viewedObjectIDs() {
43895  for (var e = [], t = arguments.length;t--; )
43896    e[t] = arguments[t];
43897  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43898  return this.sendEvents(addEventType("view", i), n);
43899}
43900function viewedFilters() {
43901  for (var e = [], t = arguments.length;t--; )
43902    e[t] = arguments[t];
43903  var n = extractAdditionalParams(e), { events: i, additionalParams: n } = n;
43904  return this.sendEvents(addEventType("view", i), n);
43905}
43906var AlgoliaAnalytics = function(e) {
43907  e = e.requestFn;
43908  this._endpointOrigin = "https://insights.algolia.io", this._anonymousUserToken = true, this._userHasOptedOut = false, this._useCookie = false, this._cookieDuration = 6 * MONTH, this._ua = [], this.version = version2, this.sendEvents = makeSendEvents(e).bind(this), this.init = init.bind(this), this.addAlgoliaAgent = addAlgoliaAgent.bind(this), this.saveTokenAsCookie = saveTokenAsCookie.bind(this), this.setUserToken = setUserToken.bind(this), this.setAnonymousUserToken = setAnonymousUserToken.bind(this), this.getUserToken = getUserToken.bind(this), this.onUserTokenChange = onUserTokenChange.bind(this), this.setAuthenticatedUserToken = setAuthenticatedUserToken.bind(this), this.getAuthenticatedUserToken = getAuthenticatedUserToken.bind(this), this.onAuthenticatedUserTokenChange = onAuthenticatedUserTokenChange.bind(this), this.clickedObjectIDsAfterSearch = clickedObjectIDsAfterSearch.bind(this), this.clickedObjectIDs = clickedObjectIDs.bind(this), this.clickedFilters = clickedFilters.bind(this), this.convertedObjectIDsAfterSearch = convertedObjectIDsAfterSearch.bind(this), this.purchasedObjectIDsAfterSearch = purchasedObjectIDsAfterSearch.bind(this), this.addedToCartObjectIDsAfterSearch = addedToCartObjectIDsAfterSearch.bind(this), this.convertedObjectIDs = convertedObjectIDs.bind(this), this.addedToCartObjectIDs = addedToCartObjectIDs.bind(this), this.purchasedObjectIDs = purchasedObjectIDs.bind(this), this.convertedFilters = convertedFilters.bind(this), this.viewedObjectIDs = viewedObjectIDs.bind(this), this.viewedFilters = viewedFilters.bind(this), this.getVersion = getVersion.bind(this);
43909};
43910function createInsightsClient(e) {
43911  var t, e = getFunctionalInterface(new AlgoliaAnalytics({ requestFn: e }));
43912  if (typeof window == "object" && !window.AlgoliaAnalyticsObject) {
43913    for (;t = createUUID(), window[t] !== undefined; )
43914      ;
43915    window.AlgoliaAnalyticsObject = t, window[window.AlgoliaAnalyticsObject] = e;
43916  }
43917  return e.version = version2, e;
43918}
43919var requestWithXMLHttpRequest = function(r, o) {
43920  return new Promise(function(e, t) {
43921    var n = JSON.stringify(o), i = new XMLHttpRequest;
43922    i.addEventListener("readystatechange", function() {
43923      i.readyState === 4 && i.status === 200 ? e(true) : i.readyState === 4 && e(false);
43924    }), i.addEventListener("error", function() {
43925      return t();
43926    }), i.addEventListener("timeout", function() {
43927      return e(false);
43928    }), i.open("POST", r), i.setRequestHeader("Content-Type", "application/json"), i.send(n);
43929  });
43930};
43931var requestWithSendBeacon = function(e, t) {
43932  var n = JSON.stringify(t), n = navigator.sendBeacon(e, n);
43933  return Promise.resolve(!!n || requestWithXMLHttpRequest(e, t));
43934};
43935var requestWithNativeFetch = function(e, i) {
43936  return new Promise(function(t, n) {
43937    fetch(e, { method: "POST", body: JSON.stringify(i), headers: { "Content-Type": "application/json" } }).then(function(e) {
43938      t(e.status === 200);
43939    }).catch(function(e) {
43940      n(e);
43941    });
43942  });
43943};
43944function getRequesterForBrowser() {
43945  if (supportsSendBeacon())
43946    return requestWithSendBeacon;
43947  if (supportsXMLHttpRequest())
43948    return requestWithXMLHttpRequest;
43949  if (supportsNativeFetch())
43950    return requestWithNativeFetch;
43951  throw new Error("Could not find a supported HTTP request client in this environment.");
43952}
43953var entryBrowser = createInsightsClient(getRequesterForBrowser());

vendor: 93 bytes, lines 43954-43956

43954// node_modules/search-insights/index-browser.mjs
43955var index_browser_default = entryBrowser;
43956

43957// app/javascript/autocomplete.js
43958var inlineInstance = null;
43959var modalInstance = null;
43960var currentActiveItemId = 0;
43961var keydownHandlerAttached = false;
43962var INLINE_CONTAINERS = ["#autocomplete", "#header-autocomplete"];
43963var MODAL_CONTAINER_ID = "search-modal-autocomplete";
43964function toPathname(url) {
43965  try {
43966    return new URL(url).pathname;
43967  } catch {
43968    return url;
43969  }
43970}
43971function getConfig2() {
43972  const appId = document.querySelector('meta[name="algolia-app-id"]')?.content;
43973  const searchKey = document.querySelector('meta[name="algolia-search-key"]')?.content;
43974  const indexPrefix = document.querySelector('meta[name="algolia-index-prefix"]')?.content || "development";
43975  if (!appId || !searchKey)
43976    return null;
43977  return { appId, searchKey, indexPrefix };
43978}
43979function getItemElements() {
43980  return Array.from(document.querySelectorAll(".aa-Item"));
43981}
43982function highlightItem(index) {
43983  const items = getItemElements();
43984  items.forEach((el, i) => {
43985    el.setAttribute("aria-selected", i === index ? "true" : "false");
43986  });
43987  currentActiveItemId = index;
43988  if (items[index]) {
43989    items[index].scrollIntoView({ block: "nearest" });
43990  }
43991}
43992function buildSources(searchClient, config, searchUrl) {
43993  return ({ query }) => {
43994    if (!query)
43995      return [];
43996    const searchPageUrl = `${searchUrl}?q=${encodeURIComponent(query)}`;
43997    return [
43998      {
43999        sourceId: "suggestions",
44000        async getItems() {
44001          const suggestions = [{ label: query, url: searchPageUrl }];
44002          const response = await searchClient.search({
44003            requests: [
44004              { indexName: `Tag_${config.indexPrefix}`, query, hitsPerPage: 2 },
44005              { indexName: `Course_${config.indexPrefix}`, query, hitsPerPage: 2 }
44006            ]
44007          });
44008          const seen = new Set([query.toLowerCase()]);
44009          for (const result of response.results || []) {
44010            for (const hit of result.hits || []) {
44011              const lower = hit.title.toLowerCase();
44012              if (!seen.has(lower)) {
44013                seen.add(lower);
44014                suggestions.push({
44015                  label: hit.title.toLowerCase(),
44016                  url: `${searchUrl}?q=${encodeURIComponent(hit.title)}`
44017                });
44018              }
44019            }
44020          }
44021          return suggestions.slice(0, 3);
44022        },
44023        getItemUrl({ item }) {
44024          return item.url;
44025        },
44026        onSelect({ item }) {
44027          Turbo.visit(item.url);
44028        },
44029        templates: {
44030          item({ item, html }) {
44031            return html`
44032              <div class="aa-ItemWrapper" data-item-url="${item.url}">
44033                <div class="aa-ItemContent">
44034                  <div class="aa-ItemIcon aa-ItemIcon--search">
44035                    <svg viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2">
44036                      <circle cx="11" cy="11" r="8"></circle>
44037                      <line x1="21" y1="21" x2="16.65" y2="16.65"></line>
44038                    </svg>
44039                  </div>
44040                  <div class="aa-ItemContentBody">
44041                    <div class="aa-ItemContentTitle">Rechercher Â« ${item.label} Â»</div>
44042                  </div>
44043                </div>
44044              </div>
44045            `;
44046          }
44047        }
44048      },
44049      {
44050        sourceId: "tags",
44051        getItems() {
44052          return getAlgoliaResults({
44053            searchClient,
44054            queries: [{ indexName: `Tag_${config.indexPrefix}`, params: { query, hitsPerPage: 2, clickAnalytics: true } }]
44055          });
44056        },
44057        getItemUrl({ item }) {
44058          return `/formations/tags/${item.slug}`;
44059        },
44060        onSelect({ item }) {
44061          Turbo.visit(`/formations/tags/${item.slug}`);
44062        },
44063        templates: {
44064          header({ html }) {
44065            return html`<span class="aa-SourceHeaderTitle">CatÃ©gories</span>`;
44066          },
44067          item({ item, html }) {
44068            const count = item.courses_count || 0;
44069            const label = count > 1 ? "formations" : "formation";
44070            return html`
44071              <div class="aa-ItemWrapper" data-item-url="${`/formations/tags/${item.slug}`}">
44072                <div class="aa-ItemContent">
44073                  <div class="aa-ItemIcon aa-ItemIcon--tag">
44074                    <svg viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2">
44075                      <path d="M20.59 13.41l-7.17 7.17a2 2 0 01-2.83 0L2 12V2h10l8.59 8.59a2 2 0 010 2.82z"></path>
44076                      <line x1="7" y1="7" x2="7.01" y2="7"></line>
44077                    </svg>
44078                  </div>
44079                  <div class="aa-ItemContentBody">
44080                    <div class="aa-ItemContentTitle">${item.title}</div>
44081                    <div class="aa-ItemContentDescription">

44081${count} ${label}</div>
44082                  </div>
44083                </div>
44084              </div>
44085            `;
44086          }
44087        }
44088      },
44089      {
44090        sourceId: "courses",
44091        getItems() {
44092          return getAlgoliaResults({
44093            searchClient,
44094            queries: [{ indexName: `Course_${config.indexPrefix}`, params: { query, hitsPerPage: 4, clickAnalytics: true } }]
44095          });
44096        },
44097        getItemUrl({ item }) {
44098          return `/formations/${item.slug}`;
44099        },
44100        onSelect({ item }) {
44101          Turbo.visit(`/formations/${item.slug}`);
44102        },
44103        templates: {
44104          header({ html }) {
44105            return html`<span class="aa-SourceHeaderTitle">Formations</span>`;
44106          },
44107          item({ item, html }) {
44108            const logoSrc = item.logo;
44109            const duration = item.duration;
44110            const durationLabel = duration === 1 ? "jour" : "jours";
44111            return html`
44112              <div class="aa-ItemWrapper" data-item-url="${`/formations/${item.slug}`}">
44113                <div class="aa-ItemContent">
44114                  <div class="aa-ItemIcon aa-ItemIcon--course">
44115                    ${logoSrc ? html`<img src="${logoSrc}" alt="" />` : html`<svg viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2"><path d="M2 3h6a4 4 0 014 4v14a3 3 0 00-3-3H2z"></path><path d="M22 3h-6a4 4 0 00-4 4v14a3 3 0 013-3h7z"></path></svg>`}
44116                  </div>
44117                  <div class="aa-ItemContentBody">
44118                    <div class="aa-ItemContentTitle">${item.title}</div>
44119                    <div class="aa-ItemContentDescription">${duration} ${durationLabel}</div>
44120                  </div>
44121                </div>
44122              </div>
44123            `;
44124          }
44125        }
44126      },
44127      {
44128        sourceId: "pages",
44129        getItems() {
44130          return getAlgoliaResults({
44131            searchClient,
44132            queries: [{ indexName: "human_coders_pages", params: { query, hitsPerPage: 3, clickAnalytics: true } }]
44133          });
44134        },
44135        getItemUrl({ item }) {
44136          return toPathname(item.url);
44137        },
44138        onSelect({ item }) {
44139          Turbo.visit(toPathname(item.url));
44140        },
44141        templates: {
44142          header({ html }) {
44143            return html`<span class="aa-SourceHeaderTitle">Pages</span>`;
44144          },
44145          item({ item, html }) {
44146            const title = item.title || "";
44147            const itemPath = toPathname(item.url);
44148            return html`
44149              <div class="aa-ItemWrapper" data-item-url="${itemPath}">
44150                <div class="aa-ItemContent">
44151                  <div class="aa-ItemIcon aa-ItemIcon--page">
44152                    <svg viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2">
44153                      <path d="M14 2H6a2 2 0 00-2 2v16a2 2 0 002 2h12a2 2 0 002-2V8z"></path>
44154                      <polyline points="14 2 14 8 20 8"></polyline>
44155                      <line x1="16" y1="13" x2="8" y2="13"></line>
44156                      <line x1="16" y1="17" x2="8" y2="17"></line>
44157                    </svg>
44158                  </div>
44159                  <div class="aa-ItemContentBody">
44160                    <div class="aa-ItemContentTitle">${title}</div>
44161                  </div>
44162                </div>
44163              </div>
44164            `;
44165          }
44166        }
44167      }
44168    ];
44169  };
44170}
44171function clearInlineContainers() {
44172  for (const selector of INLINE_CONTAINERS) {
44173    const container = document.querySelector(selector);
44174    if (container)
44175      container.innerHTML = "";
44176  }
44177}
44178function destroyAllInstances() {
44179  if (inlineInstance) {
44180    inlineInstance.destroy();
44181    inlineInstance = null;
44182  }
44183  if (modalInstance) {
44184    modalInstance.destroy();
44185    modalInstance = null;
44186  }
44187  document.getElementById(MODAL_CONTAINER_ID)?.remove();
44188  clearInlineContainers();
44189}
44190function initAutocomplete() {
44191  destroyAllInstances();
44192  const config = getConfig2();
44193  if (!config)
44194    return;
44195  const searchClient = liteClient(config.appId, config.searchKey);
44196  const searchUrl = "/formations/search";
44197  index_browser_default("init", { appId: config.appId, apiKey: config.searchKey });
44198  const algoliaInsightsPlugin = createAlgoliaInsightsPlugin({ insightsClient: index_browser_default });
44199  function createInlineInstance() {
44200    for (const selector of INLINE_CONTAINERS) {
44201      const container = document.querySelector(selector);
44202      if (!container)
44203        continue;
44204      const url = container.dataset.searchUrl || searchUrl;
44205      const initialQuery = container.dataset.initialQuery || "";
44206      inlineInstance = autocomplete({
44207        container,
44208        placeholder: "Claude Code, Python, React...",
44209        detachedMediaQuery: "none",
44210        initialState: { query: initialQuery },
44211        defaultActiveItemId: 0,
44212        plugins: [algoliaInsightsPlugin],
44213        onSubmit({ state }) {
44214          Turbo.visit(`${url}?q=${encodeURIComponent(state.query)}`);
44215        },
44216        getSources: buildSources(searchClient, config, url)
44217      });
44218      break;
44219    }
44220  }
44221  createInlineInstance();
44222  function openSearchModal() {
44223    if (inlineInstance) {
44224      inlineInstance.destroy();
44225      inlineInstance = null;
44226    }
44227    let modalContainer = document.getElementById(MODAL_CONTAINER_ID);
44228    if (!modalContainer) {
44229      modalContainer = document.createElement("div");
44230      modalContainer.id = MODAL_CONTAINER_ID;
44231      modalContainer.style.display = "none";
44232      document.body.appendChild(modalContainer);
44233    }
44234    modalInstance = autocomplete({

44235      container: `#${MODAL_CONTAINER_ID}`,
44236      placeholder: "Claude Code, Python, React...",
44237      detachedMediaQuery: "(min-width: 0px)",
44238      openOnFocus: true,
44239      defaultActiveItemId: 0,
44240      plugins: [algoliaInsightsPlugin],
44241      onSubmit({ state }) {
44242        Turbo.visit(`${searchUrl}?q=${encodeURIComponent(state.query)}`);
44243      },
44244      getSources: buildSources(searchClient, config, searchUrl)
44245    });
44246    const btn = modalContainer.querySelector(".aa-DetachedSearchButton");
44247    if (btn)
44248      btn.click();
44249    const observer = new MutationObserver(() => {
44250      if (!document.querySelector(".aa-DetachedOverlay")) {
44251        observer.disconnect();
44252        if (modalInstance) {
44253          modalInstance.destroy();
44254          modalInstance = null;
44255        }
44256        document.getElementById(MODAL_CONTAINER_ID)?.remove();
44257        createInlineInstance();
44258      }
44259    });
44260    observer.observe(document.body, { childList: true });
44261  }
44262  document.querySelectorAll(".nav-search-link, .mobile-search-link").forEach((link) => {
44263    link.addEventListener("click", (e) => {
44264      e.preventDefault();
44265      openSearchModal();
44266    });
44267  });
44268  if (!keydownHandlerAttached) {
44269    keydownHandlerAttached = true;
44270    document.addEventListener("keydown", (event) => {
44271      if (!event.target.classList?.contains("aa-Input"))
44272        return;
44273      event.stopImmediatePropagation();
44274      const panel = document.querySelector(".aa-Panel");
44275      const panelVisible = panel && !panel.hasAttribute("hidden") && panel.childElementCount > 0;
44276      if (event.key === "ArrowDown" || event.key === "ArrowUp") {
44277        event.preventDefault();
44278        if (!panelVisible)
44279          return;
44280        const items = getItemElements();
44281        const total = items.length;
44282        if (total === 0)
44283          return;
44284        if (event.key === "ArrowDown") {
44285          currentActiveItemId = (currentActiveItemId + 1) % total;
44286        } else {
44287          currentActiveItemId = (currentActiveItemId - 1 + total) % total;
44288        }
44289        highlightItem(currentActiveItemId);
44290      } else if (event.key === "Enter") {
44291        event.preventDefault();
44292        if (panelVisible) {
44293          const items = getItemElements();
44294          const activeItem = items[currentActiveItemId];
44295          if (activeItem) {
44296            const wrapper = activeItem.querySelector("[data-item-url]");
44297            if (wrapper) {
44298              Turbo.visit(wrapper.dataset.itemUrl);
44299              return;
44300            }
44301          }
44302        }
44303        const query = event.target.value?.trim();
44304        if (query) {
44305          Turbo.visit(`${searchUrl}?q=${encodeURIComponent(query)}`);
44306        }
44307      } else if (event.key === "Escape") {
44308        inlineInstance?.setIsOpen(false);
44309        modalInstance?.setIsOpen(false);
44310      }
44311    }, true);
44312  }
44313}
44314function reparentMobileSearch() {
44315  const mobileSearch = document.querySelector(".mobile-search");
44316  const navbarBrand = document.querySelector(".navbar-brand");
44317  const toggleMenu = document.querySelector(".toggle-menu");
44318  if (mobileSearch && navbarBrand && toggleMenu && mobileSearch.parentElement !== navbarBrand) {
44319    navbarBrand.insertBefore(mobileSearch, toggleMenu);
44320  }
44321}
44322document.addEventListener("turbo:load", () => {
44323  currentActiveItemId = 0;
44324  reparentMobileSearch();
44325  initAutocomplete();
44326});
44327document.addEventListener("turbo:before-cache", () => {
44328  destroyAllInstances();
44329  const mobileSearch = document.querySelector(".mobile-search");
44330  const header = document.querySelector("header");
44331  if (mobileSearch && header && mobileSearch.closest(".navbar-brand")) {
44332    header.appendChild(mobileSearch);
44333  }
44334});
44335

44336// app/javascript/application.js
44337import_smoothscroll_polyfill.default.polyfill();
44338
44339//# debugId=74EE030488D8D8FA64756E2164756E21

Line numbers count LF bytes from the start of the resource, as the search results do. Vendor segments are library code the classifier recognised; they are stored but not indexed. Bytes are shown as Latin1 characters, one per byte.