1$(function() { 2 $("#modal-custom").iziModal({ 3 overlayClose: !1, 4 overlayColor: "rgba(0, 0, 0, 0.6)" 5 }), $("#modal-custom").on("click", "header a", function(t) { 6 t.preventDefault(); 7 t = $(this).index(); 8 $(this).addClass("active").siblings("a").removeClass("active"), $(this).parents("div").find("section").eq(t).removeClass("hide").siblings("section").addClass("hide"), 0 === $(this).index() ? $("#modal-custom .iziModal-content .icon-close").css("background", "#ddd") : $("#modal-custom .iziModal-content .icon-close").attr("style", "") 9 }), $("#modal-custom").on("click", ".submit", function(t) { 10 t.preventDefault(); 11 var e = "wobble", 12 i = $(this).closest(".iziModal"); 13 i.hasClass(e) || (i.addClass(e), setTimeout(function() { 14 i.removeClass(e) 15 }, 1500)) 16 }) 17 }), 18 function(i) { 19 "function" == typeof define && define.amd ? define(["jquery"], i) : "object" == typeof module && module.exports ? module.exports = function(t, e) { 20 return void 0 === e && (e = "undefined" != typeof window ? require("jquery") : require("jquery")(t)), i(e), e 21 } : i(jQuery) 22 }(function(c) { 23 function d(t) { 24 return -1 < (t = t || navigator.userAgent).indexOf("MSIE ") || -1 < t.indexOf("Trident/") 25 } 26 27 function u(t) { 28 return parseInt(String(t).split(/%|px|em|cm|vh|vw/)[0]) 29 } 30 31 function l(t, e) { 32 this.init(t, e) 33 } 34 var h = c(window), 35 s = c(document), 36 p = "iziModal", 37 o = "closing", 38 a = "closed", 39 f = "opening", 40 m = "opened", 41 e = "destroyed", 42 r = function() { 43 var t, e = document.createElement("fakeelement"), 44 i = { 45 animation: "animationend", 46 OAnimation: "oAnimationEnd", 47 MozAnimation: "animationend", 48 WebkitAnimation: "webkitAnimationEnd" 49 }; 50 for (t in i) 51 if (void 0 !== e.style[t]) return i[t] 52 }(), 53 g = !!/Mobi/.test(navigator.userAgent), 54 v = 0; 55 return l.prototype = { 56 constructor: l, 57 init: function(t, n) { 58 var o = this; 59 this.$element = c(t), void 0 !== this.$element[0].id && "" !== this.$element[0].id ? this.id = this.$element[0].id : (this.id = p + Math.floor(1e7 * Math.random() + 1), this.$element.attr("id", this.id)), this.classes = void 0 !== this.$element.attr("class") ? this.$element.attr("class") : "", this.content = this.$element.html(), this.state = a, this.options = n, this.width = 0, this.timer = null, this.timerTimeout = null, this.progressBar = null, this.isPaused = !1, this.isFullscreen = !1, this.headerHeight = 0, this.modalHeight = 0, this.$overlay = c('<div class="' + p + '-overlay" style="background-color:' + n.overlayColor + '"></div>'), this.$navigate = c('<div class="' + p + '-navigate"><div class="' + p + '-navigate-caption">Use</div><button class="' + p + '-navigate-prev"></button><button class="' + p + '-navigate-next"></button></div>'), this.group = { 60 name: this.$element.attr("data-" + p + "-group"), 61 index: null, 62 ids: [] 63 }, this.$element.attr("aria-hidden", "true"), this.$element.attr("aria-labelledby", this.id), this.$element.attr("role", "dialog"), this.$element.hasClass("iziModal") || this.$element.addClass("iziModal"), void 0 === this.group.name && "" !== n.group && (this.group.name = n.group, this.$element.attr("data-" + p + "-group", n.group)), !0 === this.options.loop && this.$element.attr("data-" + p + "-loop", !0), c.each(this.options, function(t, e) { 64 var i = o.$element.attr("data-" + p + "-" + t); 65 try { 66 void 0 !== i && (n[t] = "" === i || "true" == i || "false" != i && ("function" == typeof e ? new Function(i) : i)) 67 } catch (t) {} 68 }), !1 !== n.appendTo && this.$element.appendTo(n.appendTo), !0 === n.iframe ? (this.$element.html('<div class="' + p + '-wrap"><div class="' + p + '-content"><iframe class="' + p + '-iframe"></iframe>' + this.content + "</div></div>"), null !== n.iframeHeight && this.$element.find("." + p + "-iframe").css("height", n.iframeHeight)) : this.$element.html('<div class="' + p + '-wrap"><div class="' + p + '-content">' + this.content + "</div></div>"), this.$wrap = this.$element.find("." + p + "-wrap"), null === n.zindex || isNaN(parseInt(n.zindex)) || (this.$element.css("z-index", n.zindex), this.$navigate.css("z-index", n.zindex - 1), this.$overlay.css("z-index", n.zindex - 2)), "" !== n.radius && this.$element.css("border-radius", n.radius), "" !== n.padding && this.$element.find("." + p + "-content").css("padding", n.padding), ""
68!== n.theme && ("light" === n.theme ? this.$element.addClass(p + "-light") : this.$element.addClass(n.theme)), !0 === n.rtl && this.$element.addClass(p + "-rtl"), !0 === n.openFullscreen && (this.isFullscreen = !0, this.$element.addClass("isFullscreen")), this.createHeader(), this.recalcWidth(), this.recalcVerticalPos() 69 }, 70 createHeader: function() { 71 this.$header = c('<div class="' + p + '-header"><h2 class="' + p + '-header-title">' + this.options.title + '</h2><p class="' + p + '-header-subtitle">' + this.options.subtitle + '</p><div class="' + p + '-header-buttons"></div></div>'), !0 === this.options.closeButton && this.$header.find("." + p + "-header-buttons").append('<a href="javascript:void(0)" class="' + p + "-button " + p + '-button-close" data-' + p + "-close></a>"), !0 === this.options.fullscreen && this.$header.find("." + p + "-header-buttons").append('<a href="javascript:void(0)" class="' + p + "-button " + p + '-button-fullscreen" data-' + p + "-fullscreen></a>"), !0 !== this.options.timeoutProgressbar || isNaN(parseInt(this.options.timeout)) || !1 === this.options.timeout || 0 === this.options.timeout || this.$header.prepend('<div class="' + p + '-progressbar"><div style="background-color:' + this.options.timeoutProgressbarColor + '"></div></div>'), "" === this.options.subtitle && this.$header.addClass(p + "-noSubtitle"), "" !== this.options.title && (null !== this.options.headerColor && (!0 === this.options.borderBottom && this.$element.css("border-bottom", "3px solid " + this.options.headerColor), this.$header.css("background", this.options.headerColor)), null === this.options.icon && null === this.options.iconText || (this.$header.prepend('<i class="' + p + '-header-icon"></i>'), null !== this.options.icon && this.$header.find("." + p + "-header-icon").addClass(this.options.icon).css("color", this.options.iconColor), null !== this.options.iconText && this.$header.find("." + p + "-header-icon").html(this.options.iconText)), this.$element.css("overflow", "hidden").prepend(this.$header)) 72 }, 73 setGroup: function(t) { 74 var i, n = this, 75 e = this.group.name || t; 76 this.group.ids = [], void 0 !== t && t !== this.group.name && (this.group.name = e = t, this.$element.attr("data-" + p + "-group", e)), void 0 !== e && "" !== e && (i = 0, c.each(c("." + p + "[data-" + p + "-group=" + e + "]"), function(t, e) { 77 n.group.ids.push(c(this)[0].id), n.id == c(this)[0].id && (n.group.index = i), i++ 78 })) 79 }, 80 toggle: function() { 81 this.state == m && this.close(), this.state == a && this.open() 82 }, 83 open: function(i) { 84 function n() { 85 o.state = m, o.$element.trigger(m), o.options.onOpened && "function" == typeof o.options.onOpened && o.options.onOpened(o) 86 } 87 var o = this; 88 if (this.state == a) { 89 if (o.$element.off("click", "[data-" + p + "-close]").on("click", "[data-" + p + "-close]", function(t) { 90 t.preventDefault(); 91 t = c(t.currentTarget).attr("data-" + p + "-transitionOut"); 92 void 0 !== t ? o.close({ 93 transition: t 94 }) : o.close() 95 }), o.$element.off("click", "[data-" + p + "-fullscreen]").on("click", "[data-" + p + "-fullscreen]", function(t) { 96 t.preventDefault(), !0 === o.isFullscreen ? (o.isFullscreen = !1, o.$element.removeClass("isFullscreen")) : (o.isFullscreen = !0, o.$element.addClass("isFullscreen")), o.options.onFullscreen && "function" == typeof o.options.onFullscreen && o.options.onFullscreen(o), o.$element.trigger("fullscreen", o) 97 }), o.$navigate.off("click", "." + p + "-navigate-next").on("click", "." + p + "-navigate-next", function(t) { 98 o.next(t) 99 }), o.$element.off("click", "[data-" + p + "-next]").on("click", "[data-" + p + "-next]", function(t) { 100 o.next(t) 101 }), o.$navigate.off("click", "." + p + "-navigate-prev").on("click", "." + p + "-navigate-prev", function(t) { 102 o.prev(t) 103 }), o.$element.off("click", "[data-" + p + "-prev]").on("click", "[data-" + p + "-prev]", function(t) { 104 o.prev(t) 105 }), this.setGroup(), this.state = f, this.$element.trigger(f), this.$element.attr("aria-hidden", "false"), !0 === this.options.iframe) { 106 this.$element.find("." + p + "-content").addClass(p + "-content-loader"), this.$element.find("." + p + "-iframe").on("load", function() { 107 c(this).parent().removeClass(p + "-content-loader") 108 }); 109 var t = null; 110 try { 111 t = "" !== c(i.currentTarget).attr("href") ? c(i.currentTarget).attr("href") : null 112 } catch (t) {} 113 if (null == (t = null !== this.options.iframeURL && null == t ? this.options.iframeURL : t)) throw new Error("Failed to find iframe URL"); 114 this.$element.find("." + p + "-iframe").attr("src", t) 115 }(this.options.bodyOverflow || g) && (c("html").addClass(p + "-isOverflow"), g && c("body").css("overflow", "hidden")), this.options.onOpening && "function" == typeof this.options.onOpening && this.options.onOpening(this), 116 function() { 117 var t; 118 1 < o.group.ids.length && (o.$navigate.appendTo("body"), o.$navigate.addClass(o.options.transitionInOverlay), !0 === o.options.navigateCaption && o.$navigate.find("." + p + "-navigate-caption").show(), t = o.$element.outerWidth(), !1 !== o.options.navigateArrows ? "closeScreenEdge" === o.options.navigateArrows ? (o.$navigate.find("." + p + "-navigate-prev").css("left", 0).show(), o.$navigate.find("." + p + "-navigate-next").
vendor: 12,879 bytes, lines 118-308
118css("right", 0).show()) : (o.$navigate.find("." + p + "-navigate-prev").css("margin-left", -(t / 2 + 84)).show(), o.$navigate.find("." + p + "-navigate-next").css("margin-right", -(t / 2 + 84)).show()) : (o.$navigate.find("." + p + "-navigate-prev").hide(), o.$navigate.find("." + p + "-navigate-next").hide()), 0 !== o.group.index || 0 === c("." + p + "[data-" + p + '-group="' + o.group.name + '"][data-' + p + "-loop]").length && !1 === o.options.loop && o.$navigate.find("." + p + "-navigate-prev").hide(), o.group.index + 1 !== o.group.ids.length || 0 === c("." + p + "[data-" + p + '-group="' + o.group.name + '"][data-' + p + "-loop]").length && !1 === o.options.loop && o.$navigate.find("." + p + "-navigate-next").hide()), !0 === o.options.overlay ? o.$overlay.appendTo("body") : 0 < c(o.options.overlay).length && o.$overlay.appendTo(c(o.options.overlay)), o.options.transitionInOverlay && o.$overlay.addClass(o.options.transitionInOverlay); 119 var e = o.options.transitionIn; 120 "object" == typeof i && (void 0 === i.transition && void 0 === i.transitionIn || (e = i.transition || i.transitionIn)), "" !== e ? (o.$element.addClass("transitionIn " + e).show(), o.$wrap.one(r, function() { 121 o.$element.removeClass(e + " transitionIn"), o.$overlay.removeClass(o.options.transitionInOverlay), o.$navigate.removeClass(o.options.transitionInOverlay), n() 122 })) : (o.$element.show(), n()), !0 !== o.options.pauseOnHover || !0 !== o.options.pauseOnHover || !1 === o.options.timeout || isNaN(parseInt(o.options.timeout)) || !1 === o.options.timeout || 0 === o.options.timeout || (o.$element.off("mouseenter").on("mouseenter", function(t) { 123 t.preventDefault(), o.isPaused = !0 124 }), o.$element.off("mouseleave").on("mouseleave", function(t) { 125 t.preventDefault(), o.isPaused = !1 126 })) 127 }(), !1 === this.options.timeout || isNaN(parseInt(this.options.timeout)) || !1 === this.options.timeout || 0 === this.options.timeout || (!0 === this.options.timeoutProgressbar ? (this.progressBar = { 128 hideEta: null, 129 maxHideTime: null, 130 currentTime: (new Date).getTime(), 131 el: this.$element.find("." + p + "-progressbar > div"), 132 updateProgress: function() { 133 var t; 134 o.isPaused || (o.progressBar.currentTime = o.progressBar.currentTime + 10, t = (o.progressBar.hideEta - o.progressBar.currentTime) / o.progressBar.maxHideTime * 100, o.progressBar.el.width(t + "%"), t < 0 && o.close()) 135 } 136 }, 0 < this.options.timeout && (this.progressBar.maxHideTime = parseFloat(this.options.timeout), this.progressBar.hideEta = (new Date).getTime() + this.progressBar.maxHideTime, this.timerTimeout = setInterval(this.progressBar.updateProgress, 10))) : this.timerTimeout = setTimeout(function() { 137 o.close() 138 }, o.options.timeout)), this.options.overlayClose && !this.$element.hasClass(this.options.transitionOut) && this.$overlay.click(function() { 139 o.close() 140 }), this.options.focusInput && this.$element.find(":input:not(button):enabled:visible:first").focus(), 141 function t() { 142 o.recalcLayout(), o.timer = setTimeout(t, 100) 143 }(), o.options.history && (t = document.title, document.title = t + " - " + o.options.title, document.location.hash = o.id, document.title = t), s.on("keydown." + p, function(t) { 144 o.options.closeOnEscape && 27 === t.keyCode && o.close() 145 }) 146 } 147 }, 148 close: function(t) { 149 function e() { 150 n.state = a, n.$element.trigger(a), !0 === n.options.iframe && n.$element.find("." + p + "-iframe").attr("src", ""), (n.options.bodyOverflow || g) && (c("html").removeClass(p + "-isOverflow"), g && c("body").css("overflow", "auto")), n.options.onClosed && "function" == typeof n.options.onClosed && n.options.onClosed(n), !0 === n.options.restoreDefaultContent && n.$element.find("." + p + "-content").html(n.content), 0 === c("." + p + ":visible").length && c("html").removeClass(p + "-isAttached") 151 } 152 var i, n = this; 153 this.state != m && this.state != f || (s.off("keydown." + p), this.state = o, this.$element.trigger(o), this.$element.attr("aria-hidden", "true"), clearTimeout(this.timer), clearTimeout(this.timerTimeout), n.options.onClosing && "function" == typeof n.options.onClosing && n.options.onClosing(this), i = this.options.transitionOut, "object" == typeof t && (void 0 === t.transition && void 0 === t.transitionOut || (i = t.transition || t.transitionOut)), "" !== i ? (this.$element.attr("class", [this.classes, p, i, "light" == this.options.theme ? p + "-light" : this.options.theme, !0 === this.isFullscreen ? "isFullscreen" : "", this.options.rtl ? p + "-rtl" : ""].join(" ")), this.$overlay.attr("class", p + "-overlay " + this.options.transitionOutOverlay), !1 !== n.options.navigateArrows && this.$navigate.attr("class", p + "-navigate " + this.options.transitionOutOverlay), this.$element.one(r, function() { 154 n.$element.hasClass(i) && n.$element.removeClass(i + " transitionOut").hide(), n.$overlay.removeClass(n.options.transitionOutOverlay).remove(), n.$navigate.removeClass(n.options.transitionOutOverlay).remove(), e() 155 })) : (this.$element.hide(), this.$overlay.remove(), this.$navigate.remove(), e())) 156 }, 157 next: function(t) { 158 var n = this, 159 o = "fadeInRight", 160 e = "fadeOutLeft", 161 i = c("." + p + ":visible"), 162 s = {}; 163 s.out = this, void 0 !== t && "object" != typeof t ? (t.preventDefault(), i = c(t.currentTarget), o = i.attr("data-" + p + "-transitionIn"), e = i.attr("data-" + p + "-transitionOut")) : void 0 !== t && (void 0 !== t.transitionIn && (o = t.transitionIn), void 0 !== t.transitionOut && (e = t.transitionOut)), this.close({ 164 transition: e 165 }), setTimeout(function() { 166 for (var t = c("." + p + "[data-" + p + '-group="' + n.group.name + '"][data-' + p + "-loop]").length, e = n.group.index + 1; e <= n.group.ids.length; e++) { 167 try { 168 s.in = c("#" + n.group.ids[e]).data().iziModal 169 } catch (t) {} 170 if (void 0 !== s.in) { 171 c("#" + n.group.ids[e]).iziModal("open", { 172 transition: o 173 }); 174 break 175 } 176 if (e == n.group.ids.length && 0 < t || !0 === n.options.loop) 177 for (var i = 0; i <= n.group.ids.length; i++) 178 if (s.in = c("#" + n.group.ids[i]).data().iziModal, void 0 !== s.in) { 179 c("#" + n.group.ids[i]).iziModal("open", { 180 transition: o 181 }); 182 break 183 } 184 } 185 }, 200), c(document).trigger(p + "-group-change", s) 186 }, 187 prev: function(t) { 188 var n = this, 189 o = "fadeInLeft", 190 e = "fadeOutRight", 191 i = c("." + p + ":visible"), 192 s = {}; 193 s.out = this, void 0 !== t && "object" != typeof t ? (t.preventDefault(), i = c(t.currentTarget), o = i.attr("data-" + p + "-transitionIn"), e = i.attr("data-" + p + "-transitionOut")) : void 0 !== t && (void 0 !== t.transitionIn && (o = t.transitionIn), void 0 !== t.transitionOut && (e = t.transitionOut)), this.close({ 194 transition: e 195 }), setTimeout(function() { 196 for (var t = c("." + p + "[data-" + p + '-group="' + n.group.name + '"][data-' + p + "-loop]").length, e = n.group.index; 0 <= e; e--) { 197 try { 198 s.in = c("#" + n.group.ids[e - 1]).data().iziModal 199 } catch (t) {} 200 if (void 0 !== s.in) { 201 c("#" + n.group.ids[e - 1]).iziModal("open", { 202 transition: o 203 }); 204 break 205 } 206 if (0 === e && 0 < t || !0 === n.options.loop) 207 for (var i = n.group.ids.length - 1; 0 <= i; i--) 208 if (s.in = c("#" + n.group.ids[i]).data().iziModal, void 0 !== s.in) { 209 c("#" + n.group.ids[i]).iziModal("open", { 210 transition: o 211 }); 212 break 213 } 214 } 215 }, 200), c(document).trigger(p + "-group-change", s) 216 }, 217 destroy: function() { 218 var t = c.Event("destroy"); 219 this.$element.trigger(t), s.off("keydown." + p), clearTimeout(this.timer), clearTimeout(this.timerTimeout), !0 === this.options.iframe && this.$element.find("." + p + "-iframe").remove(), this.$element.html(this.$element.find("." + p + "-content").html()), this.$element.off("click", "[data-" + p + "-close]"), this.$element.off("click", "[data-" + p + "-fullscreen]"), this.$element.off("." + p).removeData(p).attr("style", ""), this.$overlay.remove(), this.$navigate.remove(), this.$element.trigger(e), this.$element = null 220 }, 221 getState: function() { 222 return this.state 223 }, 224 getGroup: function() { 225 return this.group 226 }, 227 setWidth: function(t) { 228 this.options.width = t, this.recalcWidth(); 229 t = this.$element.outerWidth(); 230 !0 !== this.options.navigateArrows && "closeToModal" != this.options.navigateArrows || (this.$navigate.find("." + p + "-navigate-prev").css("margin-left", -(t / 2 + 84)).show(), this.$navigate.find("." + p + "-navigate-next").css("margin-right", -(t / 2 + 84)).show()) 231 }, 232 setTop: function(t) { 233 this.options.top = t, this.recalcVerticalPos(!1) 234 }, 235 setBottom: function(t) { 236 this.options.bottom = t, this.recalcVerticalPos(!1) 237 }, 238 setHeader: function(t) { 239 t ? this.$element.find("." + p + "-header").show() : (this.headerHeight = 0, this.$element.find("." + p + "-header").hide()) 240 }, 241 setTitle: function(t) { 242 this.options.title = t, 0 === this.headerHeight && this.createHeader(), 0 === this.$header.find("." + p + "-header-title").length && this.$header.append('<h2 class="' + p + '-header-title"></h2>'), this.$header.find("." + p + "-header-title").html(t) 243 }, 244 setSubtitle: function(t) { 245 "" === t ? (this.$header.find("." + p + "-header-subtitle").remove(), this.$header.addClass(p + "-noSubtitle")) : (0 === this.$header.find("." + p + "-header-subtitle").length && this.$header.append('<p class="' + p + '-header-subtitle"></p>'), this.$header.removeClass(p + "-noSubtitle")), this.$header.find("." + p + "-header-subtitle").html(t), this.options.subtitle = t 246 }, 247 setIcon: function(t) { 248 0 === this.$header.find("." + p + "-header-icon").length && this.$header.prepend('<i class="' + p + '-header-icon"></i>'), this.$header.find("." + p + "-header-icon").attr("class", p + "-header-icon " + t), this.options.icon = t 249 }, 250 setIconText: function(t) { 251 this.$header.find("." + p + "-header-icon").html(t), this.options.iconText = t 252 }, 253 setHeaderColor: function(t) { 254 !0 === this.options.borderBottom && this.$element.css("border-bottom", "3px solid " + t), this.$header.css("background", t), this.options.headerColor = t 255 }, 256 setZindex: function(t) { 257 isNaN(parseInt(this.options.zindex)) || (this.options.zindex = t, this.$element.css("z-index", t), this.$navigate.css("z-index", t - 1), this.$overlay.css("z-index", t - 2)) 258 }, 259 setFullscreen: function(t) { 260 t ? (this.isFullscreen = !0, this.$element.addClass("isFullscreen")) : (this.isFullscreen = !1, this.$element.removeClass("isFullscreen")) 261 }, 262 setTransitionIn: function(t) { 263 this.options.transitionIn = t 264 }, 265 setTransitionOut: function(t) { 266 this.options.transitionOut = t 267 }, 268 startLoading: function() { 269 this.$element.find("." + p + "-loader").length || this.$element.append('<div class="' + p + '-loader fadeIn"></div>'), this.$element.find("." + p + "-loader").css({ 270 top: this.headerHeight, 271 borderRadius: this.options.radius 272 }) 273 }, 274 stopLoading: function() { 275 var t = this.$element.find("." + p + "-loader"); 276 t.length || (this.$element.prepend('<div class="' + p + '-loader fadeIn"></div>'), t = this.$element.find("." + p + "-loader").css("border-radius", this.options.radius)), t.removeClass("fadeIn").addClass("fadeOut"), setTimeout(function() { 277 t.remove() 278 }, 600) 279 }, 280 recalcWidth: function() { 281 var t; 282 this.$element.css("max-width", this.options.width), d() && (1 < (t = this.options.width).toString().split("%").length && (t = this.$element.outerWidth()), this.$element.css({ 283 left: "50%", 284 marginLeft: -t / 2 285 })) 286 }, 287 recalcVerticalPos: function(t) { 288 null !== this.options.top && !1 !== this.options.top ? (this.$element.css("margin-top", this.options.top), 0 === this.options.top && this.$element.css({ 289 borderTopRightRadius: 0, 290 borderTopLeftRadius: 0 291 })) : !1 === t && this.$element.css({ 292 marginTop: "", 293 borderRadius: this.options.radius 294 }), null !== this.options.bottom && !1 !== this.options.bottom ? (this.$element.css("margin-bottom", this.options.bottom), 0 === this.options.bottom && this.$element.css({ 295 borderBottomRightRadius: 0, 296 borderBottomLeftRadius: 0 297 })) : !1 === t && this.$element.css({ 298 marginBottom: "", 299 borderRadius: this.options.radius 300 }) 301 }, 302 recalcLayout: function() { 303 var t = this, 304 e = h.height(), 305 i = this.$element.outerHeight(), 306 n = this.$element.outerWidth(), 307 o = this.$element.find("." + p + "-content")[0].scrollHeight, 308 s = o + this.headerHeight,
309 a = this.$element.innerHeight() - this.headerHeight, 310 r = (parseInt(-(this.$element.innerHeight() + 1) / 2), this.$wrap.scrollTop()), 311 l = 0; 312 d() && (n >= h.width() || !0 === this.isFullscreen ? this.$element.css({ 313 left: "", 314 marginLeft: "" 315 }) : this.$element.css({ 316 left: "50%", 317 marginLeft: -n / 2 318 })), !0 === this.options.borderBottom && (l = 3), this.$element.find("." + p + "-header").length && this.$element.find("." + p + "-header").is(":visible") ? (this.headerHeight = parseInt(this.$element.find("." + p + "-header").innerHeight()), this.$element.css("overflow", "hidden")) : (this.headerHeight = 0, this.$element.css("overflow", "")), this.$element.find("." + p + "-loader").length && this.$element.find("." + p + "-loader").css("top", this.headerHeight), i !== this.modalHeight && (this.modalHeight = i, this.options.onResize && "function" == typeof this.options.onResize && this.options.onResize(this)), this.state != m && this.state != f || (!0 === this.options.iframe && (e < this.options.iframeHeight + this.headerHeight + l || !0 === this.isFullscreen ? this.$element.find("." + p + "-iframe").css("height", e - (this.headerHeight + l)) : this.$element.find("." + p + "-iframe").css("height", this.options.iframeHeight)), i == e ? this.$element.addClass("isAttached") : this.$element.removeClass("isAttached"), !1 === this.isFullscreen && this.$element.width() >= h.width() ? this.$element.find("." + p + "-button-fullscreen").hide() : this.$element.find("." + p + "-button-fullscreen").show(), this.recalcButtons(), (e = !1 === this.isFullscreen ? e - (u(this.options.top) || 0) - (u(this.options.bottom) || 0) : e) < s ? (0 < this.options.top && null === this.options.bottom && o < h.height() && this.$element.addClass("isAttachedBottom"), 0 < this.options.bottom && null === this.options.top && o < h.height() && this.$element.addClass("isAttachedTop"), c("html").addClass(p + "-isAttached"), this.$element.css("height", e)) : (this.$element.css("height", o + (this.headerHeight + l)), this.$element.removeClass("isAttachedTop isAttachedBottom"), c("html").removeClass(p + "-isAttached")), a < o && e < s ? (t.$element.addClass("hasScroll"), t.$wrap.css("height", i - (t.headerHeight + l))) : (t.$element.removeClass("hasScroll"), t.$wrap.css("height", "auto")), a + r < o - 30 ? t.$element.addClass("hasShadow") : t.$element.removeClass("hasShadow")) 319 }, 320 recalcButtons: function() { 321 var t = this.$header.find("." + p + "-header-buttons").innerWidth() + 10; 322 !0 === this.options.rtl ? this.$header.css("padding-left", t) : this.$header.css("padding-right", t) 323 } 324 }, h.off("hashchange." + p + " load." + p).on("hashchange." + p + " load." + p, function(t) { 325 var n = document.location.hash; 326 if (0 === v) 327 if ("" !== n) { 328 c.each(c("." + p), function(t, e) { 329 var i = c(e).iziModal("getState"); 330 "opened" != i && "opening" != i || "#" + c(e)[0].id !== n && c(e).iziModal("close") 331 }); 332 try { 333 var e = c(n).data(); 334 void 0 !== e && ("load" === t.type ? !1 !== e.iziModal.options.autoOpen && c(n).iziModal("open") : setTimeout(function() { 335 c(n).iziModal("open") 336 }, 200)) 337 } catch (t) {} 338 } else c.each(c("." + p), function(t, e) { 339 var i; 340 void 0 !== c(e).data().iziModal && ("opened" != (i = c(e).iziModal("getState")) && "opening" != i || c(e).iziModal("close")) 341 }); 342 else v = 0 343 }), s.off("click", "[data-" + p + "-open]").on("click", "[data-" + p + "-open]", function(t) { 344 t.preventDefault(); 345 var e = c("." + p + ":visible"), 346 i = c(t.currentTarget).attr("data-" + p + "-open"), 347 n = c(t.currentTarget).attr("data-" + p + "-transitionIn"), 348 t = c(t.currentTarget).attr("data-" + p + "-transitionOut"); 349 void 0 !== t ? e.iziModal("close", { 350 transition: t 351 }) : e.iziModal("close"), setTimeout(function() { 352 void 0 !== n ? c(i).iziModal("open", { 353 transition: n 354 }) : c(i).iziModal("open") 355 }, 200) 356 }), s.off("keyup." + p).on("keyup." + p, function(t) { 357 var e, i, n; 358 c("." + p + ":visible").length && (e = c("." + p + ":visible")[0].id, i = c("#" + e).iziModal("getGroup"), t = (n = t || window.event).target || n.srcElement, void 0 === e || void 0 === i.name || n.ctrlKey || n.metaKey || n.altKey || "INPUT" === t.tagName.toUpperCase() || "TEXTAREA" == t.tagName.toUpperCase() || (37 === n.keyCode ? c("#" + e).iziModal("prev", n) : 39 === n.keyCode && c("#" + e).iziModal("next", n))) 359 }), c.fn[p] = function(t, e) { 360 if (!c(this).length && "object" == typeof t) { 361 var i = { 362 $el: document.createElement("div"), 363 id: this.selector.split("#"), 364 class: this.selector.split(".") 365 }; 366 if (1 < i.id.length) { 367 try { 368 i.$el = document.createElement(id[0]) 369 } catch (t) {} 370 i.$el.id = this.selector.split("#")[1].trim() 371 } else if (1 < i.class.length) { 372 try { 373 i.$el = document.createElement(i.class[0]) 374 } catch (t) {} 375 for (var n = 1; n < i.class.length; n++) i.$el.classList.add(i.class[n].trim()) 376 } 377 document.body.appendChild(i.$el), this.push(c(this.selector)) 378 } 379 for (var o = 0; o < this.length; o++) { 380 var s = c(this[o]), 381 a = s.data(p), 382 r = c.extend({}, c.fn[p].defaults, s.data(), "object" == typeof t && t); 383 if (a || t && "object" != typeof t) { 384 if ("string" == typeof t && void 0 !== a) return a[t].apply(a, [].concat(e)) 385 } else s.data(p, a = new l(s, r)); 386 r.autoOpen && (isNaN(parseInt(r.autoOpen)) ? !0 === r.autoOpen && a.open() : setTimeout(function() { 387 a.open() 388 }, r.autoOpen), v++) 389 } 390 return this 391 }, c.fn[p].defaults = { 392 title: "", 393 subtitle: "", 394 headerColor: "#88A0B9", 395 theme: "", 396 appendTo: ".body", 397 icon: null, 398 iconText: null, 399 iconColor: "", 400 rtl: !1, 401 width: 600, 402 top: null, 403 bottom: null, 404 borderBottom: !0, 405 padding: 0, 406 radius: 3, 407 zindex: 999, 408 iframe: !1, 409 iframeHeight: 400, 410 iframeURL: null, 411 focusInput: !0, 412 group: "", 413 loop: !1, 414 navigateCaption: !0, 415 navigateArrows: !0, 416 history: !1, 417 restoreDefaultContent: !1, 418 autoOpen: 0, 419 bodyOverflow: !1, 420 fullscreen: !1, 421 openFullscreen: !1, 422 closeOnEscape: !0, 423 closeButton: !0, 424 overlay: !0, 425 overlayClose: !0, 426 overlayColor: "rgba(0, 0, 0, 0.4)", 427 timeout: !1, 428 timeoutProgressbar: !1, 429 pauseOnHover: !1, 430 timeoutProgressbarColor: "rgba(255,255,255,0.5)", 431 transitionIn: "comingIn", 432 transitionOut: "comingOut", 433 transitionInOverlay: "fadeIn", 434 transitionOutOverlay: "fadeOut", 435 onFullscreen: function() {}, 436 onResize: function() {}, 437 onOpening: function() {}, 438 onOpened: function() {}, 439 onClosing: function() {}, 440 onClosed: function() {} 441 }, c.fn[p].Constructor = l, c.fn.iziModal 442 }), 443 function(t, e) { 444 "object" == typeof exports && "undefined" != typeof module ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : t.Popper = e() 445 }(this, function() { 446 "use strict"; 447 448 function o(t) { 449 return t && "[object Function]" === {}.toString.call(t) 450 } 451 452 function h(t, e) { 453 if (1 !== t.nodeType) return []; 454 t = getComputedStyle(t, null); 455 return e ? t[e] : t 456 } 457 458 function p(t) { 459 return "HTML" === t.nodeName ? t : t.parentNode || t.host 460 } 461 462 function f(t) { 463 if (!t) return document.body; 464 switch (t.nodeName) { 465 case "HTML":
466 case "BODY": 467 return t.ownerDocument.body; 468 case "#document": 469 return t.body 470 } 471 var e = h(t), 472 i = e.overflow, 473 n = e.overflowX, 474 e = e.overflowY; 475 return /(auto|scroll)/.test(i + e + n) ? t : f(p(t)) 476 } 477 478 function c(t) { 479 var e = t && t.offsetParent, 480 i = e && e.nodeName; 481 return i && "BODY" !== i && "HTML" !== i ? -1 !== ["TD", "TABLE"].indexOf(e.nodeName) && "static" === h(e, "position") ? c(e) : e : (t ? t.ownerDocument : document).documentElement 482 } 483 484 function s(t) { 485 return null === t.parentNode ? t : s(t.parentNode) 486 } 487 488 function m(t, e) { 489 if (!(t && t.nodeType && e && e.nodeType)) return document.documentElement; 490 var i = t.compareDocumentPosition(e) & Node.DOCUMENT_POSITION_FOLLOWING, 491 n = i ? t : e, 492 o = i ? e : t, 493 i = document.createRange(); 494 i.setStart(n, 0), i.setEnd(o, 0); 495 i = i.commonAncestorContainer; 496 if (t !== i && e !== i || n.contains(o)) return "BODY" === (o = (n = i).nodeName) || "HTML" !== o && c(n.firstElementChild) !== n ? c(i) : i; 497 i = s(t); 498 return i.host ? m(i.host, e) : m(t, s(e).host) 499 } 500 501 function g(t, e) { 502 var i = "top" === (1 < arguments.length && void 0 !== e ? e : "top") ? "scrollTop" : "scrollLeft", 503 e = t.nodeName; 504 if ("BODY" !== e && "HTML" !== e) return t[i]; 505 e = t.ownerDocument.documentElement; 506 return (t.ownerDocument.scrollingElement || e)[i] 507 } 508 509 function a(t, e) { 510 var i = "x" === e ? "Left" : "Top", 511 e = "Left" == i ? "Right" : "Bottom"; 512 return parseFloat(t["border" + i + "Width"], 10) + parseFloat(t["border" + e + "Width"], 10) 513 } 514 515 function n(t, e, i, n) { 516 return D(e["offset" + t], e["scroll" + t], i["client" + t], i["offset" + t], i["scroll" + t], W() ? i["offset" + t] + n["margin" + ("Height" === t ? "Top" : "Left")] + n["margin" + ("Height" === t ? "Bottom" : "Right")] : 0) 517 } 518 519 function v() { 520 var t = document.body, 521 e = document.documentElement, 522 i = W() && getComputedStyle(e); 523 return { 524 height: n("Height", t, e, i), 525 width: n("Width", t, e, i) 526 } 527 } 528 529 function b(t) { 530 return q({}, t, { 531 right: t.left + t.width, 532 bottom: t.top + t.height 533 }) 534 } 535 536 function d(t) { 537 var e = {}; 538 if (W()) try { 539 var e = t.getBoundingClientRect(), 540 i = g(t, "top"), 541 n = g(t, "left"); 542 e.top += i, e.left += n, e.bottom += i, e.right += n 543 } catch (t) {} else e = t.getBoundingClientRect(); 544 var o = { 545 left: e.left, 546 top: e.top, 547 width: e.right - e.left, 548 height: e.bottom - e.top 549 }, 550 i = "HTML" === t.nodeName ? v() : {}, 551 n = i.width || t.clientWidth || o.right - o.left, 552 e = i.height || t.clientHeight || o.bottom - o.top, 553 i = t.offsetWidth - n, 554 n = t.offsetHeight - e; 555 return (i || n) && (i -= a(e = h(t), "x"), n -= a(e, "y"), o.width -= i, o.height -= n), b(o) 556 } 557 558 function y(t, e) { 559 var i = W(), 560 n = "HTML" === e.nodeName, 561 o = d(t), 562 s = d(e), 563 a = f(t), 564 r = h(e), 565 l = parseFloat(r.borderTopWidth, 10), 566 t = parseFloat(r.borderLeftWidth, 10), 567 o = b({ 568 top: o.top - s.top - l, 569 left: o.left - s.left - t, 570 width: o.width, 571 height: o.height 572 }); 573 return o.marginTop = 0, o.marginLeft = 0, !i && n && (n = parseFloat(r.marginTop, 10), r = parseFloat(r.marginLeft, 10), o.top -= l - n, o.bottom -= l - n, o.left -= t - r, o.right -= t - r, o.marginTop = n, o.marginLeft = r), o = (i ? e.contains(a) : e === a && "BODY"
573!== a.nodeName) ? function(t, e, i) { 574 var n = 2 < arguments.length && void 0 !== i && i, 575 i = g(e, "top"), 576 e = g(e, "left"), 577 n = n ? -1 : 1; 578 return t.top += i * n, t.bottom += i * n, t.left += e * n, t.right += e * n, t 579 }(o, e) : o 580 } 581 582 function r(t, e, i, n) { 583 var o, s, a, r, l, c, d = { 584 top: 0, 585 left: 0 586 }, 587 u = m(t, e); 588 return "viewport" === n ? (a = (s = u).ownerDocument.documentElement, r = y(s, a), l = D(a.clientWidth, window.innerWidth || 0), c = D(a.clientHeight, window.innerHeight || 0), s = g(a), a = g(a, "left"), d = b({ 589 top: s - r.top + r.marginTop, 590 left: a - r.left + r.marginLeft, 591 width: l, 592 height: c 593 })) : ("scrollParent" === n ? "BODY" === (o = f(p(e))).nodeName && (o = t.ownerDocument.documentElement) : o = "window" === n ? t.ownerDocument.documentElement : n, n = y(o, u), "HTML" !== o.nodeName || function t(e) { 594 var i = e.nodeName; 595 return "BODY" !== i && "HTML" !== i && ("fixed" === h(e, "position") || t(p(e))) 596 }(u) ? d = n : (u = (o = v()).height, o = o.width, d.top += n.top - n.marginTop, d.bottom = u + n.top, d.left += n.left - n.marginLeft, d.right = o + n.left)), d.left += i, d.top += i, d.right -= i, d.bottom -= i, d 597 } 598 599 function l(t, e, i, n, o, s) { 600 s = 5 < arguments.length && void 0 !== s ? s : 0; 601 if (-1 === t.indexOf("auto")) return t; 602 var o = r(i, n, s, o), 603 a = { 604 top: { 605 width: o.width, 606 height: e.top - o.top 607 }, 608 right: { 609 width: o.right - e.right, 610 height: o.height 611 }, 612 bottom: { 613 width: o.width, 614 height: o.bottom - e.bottom 615 }, 616 left: { 617 width: e.left - o.left, 618 height: o.height 619 } 620 }, 621 e = Object.keys(a).map(function(t) { 622 return q({ 623 key: t 624 }, a[t], { 625 area: (t = a[t]).width * t.height 626 }) 627 }).sort(function(t, e) { 628 return e.area - t.area 629 }), 630 o = e.filter(function(t) { 631 var e = t.width, 632 t = t.height; 633 return e >= i.clientWidth && t >= i.clientHeight 634 }), 635 e = (0 < o.length ? o : e)[0].key, 636 t = t.split("-")[1]; 637 return e + (t ? "-" + t : "") 638 } 639 640 function u(t, e, i) { 641 return y(i, m(e, i)) 642 } 643 644 function w(t) { 645 var e = getComputedStyle(t), 646 i = parseFloat(e.marginTop) + parseFloat(e.marginBottom), 647 e = parseFloat(e.marginLeft) + parseFloat(e.marginRight); 648 return { 649 width: t.offsetWidth + e, 650 height: t.offsetHeight + i 651 } 652 } 653 654 function C(t) { 655 var e = { 656 left: "right", 657 right: "left", 658 bottom: "top", 659 top: "bottom" 660 }; 661 return t.replace(/left|right|bottom|top/g, function(t) { 662 return e[t] 663 }) 664 } 665 666 function x(t, e, i) { 667 i = i.split("-")[0]; 668 var n = w(t), 669 o = { 670 width: n.width, 671 height: n.height 672 }, 673 s = -1 !== ["right", "left"].indexOf(i), 674 a = s ? "top" : "left", 675 r = s ? "left" : "top", 676 t = s ? "height" : "width", 677 s = s ? "width" : "height"; 678 return o[a] = e[a] + e[t] / 2 - n[t] / 2, o[r] = i === r ? e[r] - n[s] : e[C(r)], o 679 } 680 681 function _(t, e) { 682 return Array.prototype.find ? t.find(e) : t.filter(e)[0] 683 } 684 685 function S(t, i, e) { 686 return (void 0 === e ? t : t.slice(0, function(t, e, i) { 687 if (Array.prototype.findIndex) return t.findIndex(function(t) { 688 return t[e] === i 689 }); 690 var n = _(t, function(t) { 691 return t[e] === i 692 }); 693 return t.indexOf(n) 694 }(t, "name", e))).forEach(function(t) { 695 t.function && console.warn("`modifier.function` is deprecated, use `modifier.fn`!"); 696 var e = t.function || t.fn; 697 t.enabled && o(e) && (i.offsets.popper = b(i.offsets.popper), i.offsets.reference = b(i.offsets.reference), i = e(i, t)) 698 }), i 699 } 700 701 function t(t, i) { 702 return t.some(function(t) { 703 var e = t.name; 704 return t.enabled && e === i 705 }) 706 } 707 708 function T(t) { 709 for (var e = [!1, "ms", "Webkit", "Moz", "O"], i = t.charAt(0).toUpperCase() + t.slice(1), n = 0; n < e.length - 1; n++) { 710 var o = e[n], 711 o = o ? "" + o + i : t; 712 if (void 0 !== document.body.style[o]) return o 713 } 714 return null 715 } 716 717 function $(t) { 718 t = t.ownerDocument; 719 return t ? t.defaultView : window 720 } 721 722 function e(t, e, i, n) { 723 i.updateBound = n, $(t).addEventListener("resize", i.updateBound, { 724 passive: !0 725 }); 726 t = f(t); 727 return function t(e, i, n, o) { 728 var s = "BODY" === e.nodeName, 729 e = s ? e.ownerDocument.defaultView : e; 730 e.addEventListener(i, n, { 731 passive: !0 732 }), s || t(f(e.parentNode), i, n, o), o.push(e) 733 }(t, "scroll", i.updateBound, i.scrollParents), i.scrollElement = t, i.eventsEnabled = !0, i 734 } 735 736 function i() { 737 var t, e; 738 this.state.eventsEnabled && (cancelAnimationFrame(this.scheduleUpdate), this.state = (t = this.reference, e = this.state, $(t).removeEventListener("resize", e.updateBound), e.scrollParents.forEac
738h(function(t) { 739 t.removeEventListener("scroll", e.updateBound) 740 }), e.updateBound = null, e.scrollParents = [], e.scrollElement = null, e.eventsEnabled = !1, e)) 741 } 742 743 function E(t) { 744 return "" !== t && !isNaN(parseFloat(t)) && isFinite(t) 745 } 746 747 function k(i, n) { 748 Object.keys(n).forEach(function(t) { 749 var e = ""; - 1 !== ["width", "height", "top", "right", "bottom", "left"].indexOf(t) && E(n[t]) && (e = "px"), i.style[t] = n[t] + e 750 }) 751 } 752 753 function I(t, e, i) { 754 var n = _(t, function(t) { 755 return t.name === e 756 }), 757 o = !!n && t.some(function(t) { 758 return t.name === i && t.enabled && t.order < n.order 759 }); 760 return o || (t = "`" + e + "`", console.warn("`" + i + "` modifier is required by " + t + " modifier in order to work, be sure to include it before " + t + "!")), o 761 } 762 763 function O(t, e) { 764 e = 1 < arguments.length && void 0 !== e && e, t = U.indexOf(t), t = U.slice(t + 1).concat(U.slice(0, t)); 765 return e ? t.reverse() : t 766 } 767 768 function z(t, r, l, e) { 769 var o = [0, 0], 770 n = -1 !== ["right", "left"].indexOf(e), 771 i = t.split(/(\+|\-)/).map(function(t) { 772 return t.trim() 773 }), 774 e = i.indexOf(_(i, function(t) { 775 return -1 !== t.search(/,|\s/) 776 })); 777 i[e] && -1 === i[e].indexOf(",") && console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead."); 778 t = /\s*,\s*|\s+/; 779 return (-1 === e ? [i] : [i.slice(0, e).concat([i[e].split(t)[0]]), [i[e].split(t)[1]].concat(i.slice(e + 1))]).map(function(t, e) { 780 var a = (1 === e ? !n : n) ? "height" : "width", 781 i = !1; 782 return t.reduce(function(t, e) { 783 return "" === t[t.length - 1] && -1 !== ["+", "-"].indexOf(e) ? (t[t.length - 1] = e, i = !0, t) : i ? (t[t.length - 1] += e, i = !1, t) : t.concat(e) 784 }, []).map(function(t) { 785 return i = a, n = r, o = l, t = +(s = (e = t).match(/((?:\-|\+)?\d*\.?\d*)(.*)/))[1], s = s[2], t ? 0 !== s.indexOf("%") ? "vh" !== s && "vw" !== s ? t : ("vh" === s ? D(document.documentElement.clientHeight, window.innerHeight || 0) : D(document.documentElement.clientWidth, window.innerWidth || 0)) / 100 * t : b(o = "%p" === s ? n : o)[i] / 100 * t : e; 786 var e, i, n, o, s 787 }) 788 }).forEach(function(i, n) { 789 i.forEach(function(t, e) { 790 E(t) && (o[n] += t * ("-" === i[e - 1] ? -1 : 1)) 791 }) 792 }), o 793 } 794 for (var A = Math.min, P = Math.floor, D = Math.max, L = "undefined" != typeof window && "undefined" != typeof document, M = ["Edge", "Trident", "Firefox"], N = 0, H = 0; H < M.length; H += 1) 795 if (L && 0 <= navigator.userAgent.indexOf(M[H])) { 796 N = 1; 797 break 798 } 799 function j(t, e, i) { 800 return e in t ? Object.defineProperty(t, e, { 801 value: i, 802 enumerable: !0, 803 configurable: !0, 804 writable: !0 805 }) : t[e] = i, t 806 } 807 var B, R = L && window.Promise ? function(t) { 808 var e = !1; 809 return function() { 810 e || (e = !0, window.Promise.resolve().then(function() { 811 e = !1, t() 812 })) 813 } 814 } : function(t) { 815 var e = !1; 816 return function() { 817 e || (e = !0, setTimeout(function() { 818 e = !1, t() 819 }, N)) 820 } 821 }, 822 W = function() { 823 return B = null == B ? -1 !== navigator.appVersion.indexOf("MSIE 10") : B 824 }, 825 F = function(t, e, i) { 826 return e && Z(t.prototype, e), i && Z(t, i), t 827 }, 828 q = Object.assign || function(t) { 829 for (var e, i = 1; i < arguments.length; i++) 830 for (var n in e = arguments[i]) Object.prototype.hasOwnProperty.call(e, n) && (t[n] = e[n]); 831 return t 832 }, 833 V = ["auto-start", "auto", "auto-end", "top-start", "top", "top-end", "right-start", "right", "right-end", "bottom-end", "bottom", "bottom-start", "left-end", "left", "left-start"], 834 U = V.slice(3), 835 G = "flip", 836 Y = "clockwise", 837 X = "counterclockwise", 838 F = (F(K, [{ 839 key: "update", 840 value: function() { 841 return function() { 842 var t; 843 this.state.isDestroyed || ((t = { 844 instance: this, 845 styles: {}, 846 arrowStyles: {}, 847 attributes: {}, 848 flipped: !1, 849 offsets: {} 850 }).offsets.reference = u(this.state, this.popper, this.reference), t.placement = l(this.options.placement, t.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding), t.originalPlacement = t.placement, t.offsets.popper = x(this.popper, t.offsets.reference, t.placement), t.offsets.popper.position = "absolute", t = S(this.modifiers, t), this.state.isCreated ? this.options.onUpdate(t) : (this.state.isCreated = !0, this.options.onCreate(t))) 851 }.call(this) 852 } 853 }, {
854 key: "destroy", 855 value: function() { 856 return function() { 857 return this.state.isDestroyed = !0, t(this.modifiers, "applyStyle") && (this.popper.removeAttribute("x-placement"), this.popper.style.left = "", this.popper.style.position = "", this.popper.style.top = "", this.popper.style[T("transform")] = ""), this.disableEventListeners(), this.options.removeOnDestroy && this.popper.parentNode.removeChild(this.popper), this 858 }.call(this) 859 } 860 }, { 861 key: "enableEventListeners", 862 value: function() { 863 return function() { 864 this.state.eventsEnabled || (this.state = e(this.reference, this.options, this.state, this.scheduleUpdate)) 865 }.call(this) 866 } 867 }, { 868 key: "disableEventListeners", 869 value: function() { 870 return i.call(this) 871 } 872 }]), K); 873 874 function K(t, e) { 875 var i = this, 876 n = 2 < arguments.length && void 0 !== arguments[2] ? arguments[2] : {}; 877 (function(t, e) { 878 if (!(t instanceof e)) throw new TypeError("Cannot call a class as a function") 879 })(this, K), this.scheduleUpdate = function() { 880 return requestAnimationFrame(i.update) 881 }, this.update = R(this.update.bind(this)), this.options = q({}, K.Defaults, n), this.state = { 882 isDestroyed: !1, 883 isCreated: !1, 884 scrollParents: [] 885 }, this.reference = t && t.jquery ? t[0] : t, this.popper = e && e.jquery ? e[0] : e, this.options.modifiers = {}, Object.keys(q({}, K.Defaults.modifiers, n.modifiers)).forEach(function(t) { 886 i.options.modifiers[t] = q({}, K.Defaults.modifiers[t] || {}, n.modifiers ? n.modifiers[t] : {}) 887 }), this.modifiers = Object.keys(this.options.modifiers).map(function(t) { 888 return q({ 889 name: t 890 }, i.options.modifiers[t]) 891 }).sort(function(t, e) { 892 return t.order - e.order 893 }), this.modifiers.forEach(function(t) { 894 t.enabled && o(t.onLoad) && t.onLoad(i.reference, i.popper, i.options, t, i.state) 895 }), this.update(); 896 e = this.options.eventsEnabled; 897 e && this.enableEventListeners(), this.state.eventsEnabled = e 898 } 899 900 function Z(t, e) { 901 for (var i, n = 0; n < e.length; n++)(i = e[n]).enumerable = i.enumerable || !1, i.configurable = !0, "value" in i && (i.writable = !0), Object.defineProperty(t, i.key, i) 902 } 903 return F.Utils = ("undefined" == typeof window ? global : window).PopperUtils, F.placements = V, F.Defaults = { 904 placement: "bottom", 905 eventsEnabled: !0, 906 removeOnDestroy: !1, 907 onCreate: function() {}, 908 onUpdate: function() {}, 909 modifiers: { 910 shift: { 911 order: 100, 912 enabled: !0, 913 fn: function(t) { 914 var e, i, n = t.placement, 915 o = n.split("-")[0], 916 s = n.split("-")[1]; 917 return s && (e = (i = t.offsets).reference, n = i.popper, o = (i = -1 !== ["bottom", "top"].indexOf(o)) ? "width" : "height", o = { 918 start: j({}, i = i ? "left" : "top", e[i]), 919 end: j({}, i, e[i] + e[o] - n[o]) 920 }, t.offsets.popper = q({}, n, o[s])), t 921 } 922 }, 923 offset: { 924 order: 200, 925 enabled: !0, 926 fn: function(t, e) { 927 var i = e.offset, 928 n = t.placement, 929 e = (o = t.offsets).popper, 930 o = o.reference, 931 n = n.split("-")[0], 932 o = E(+i) ? [+i, 0] : z(i, e, o, n); 933 return "left" === n ? (e.top += o[0], e.left -= o[1]) : "right" === n ? (e.top += o[0], e.left += o[1]) : "top" === n ? (e.left += o[0], e.top -= o[1]) : "bottom" === n && (e.left += o[0], e.top += o[1]), t.popper = e, t 934 }, 935 offset: 0 936 }, 937 preventOverflow: { 938 order: 300, 939 enabled: !0, 940 fn: function(t, n) { 941 var e = n.boundariesElement || c(t.instance.popper); 942 t.instance.reference === e && (e = c(e)); 943 var o = r(t.instance.popper, t.instance.reference, n.padding, e); 944 n.boundaries = o; 945 var e = n.priority, 946 s = t.offsets.popper, 947 i = { 948 primary: function(t) { 949 var e = s[t]; 950 return s[t] < o[t] && !n.escapeWithReference && (e = D(s[t], o[t])), j({}, t, e) 951 }, 952 secondary: function(t) { 953 var e = "right" === t ? "left" : "top", 954 i = s[e]; 955 return s[t] > o[t] && !n.escapeWithReference && (i = A(s[e], o[t] - ("right" === t ? s.width : s.height))), j({}, e, i) 956 } 957 }; 958 return e.forEach(function(t) { 959 var e = -1 === ["left", "top"].indexOf(t) ? "secondary" : "primary"; 960 s = q({}, s, i[e](t)) 961 }), t.offsets.popper = s, t 962 }, 963 priority: ["left", "right", "top", "bottom"], 964 padding: 5, 965 boundariesElement: "scrollParent" 966 }, 967 keepTogether: { 968 order: 400, 969 enabled: !0, 970 fn: function(t) { 971 var e = t.offsets, 972 i = e.popper, 973 n = e.reference, 974 o = t.placement.split("-")[0], 975 s = P, 976 a = -1 !== ["top", "bottom"].indexOf(o), 977 e = a ? "right" : "bottom", 978 o = a ? "left" : "top", 979 a = a ? "width" : "height"; 980 return i[e] < s(n[o]) && (t.offsets.popper[o] = s(n[o]) - i[a]), i[o] > s(n[e]) && (t.offsets.popper[o] = s(n[e])), t 981 } 982 }, 983 arrow: { 984 order: 500, 985 enabled: !0, 986 fn: function(t, e) { 987 if (!I(t.instance.modifiers, "arrow", "keepTogether")) return t; 988 var i = e.element; 989 if ("string" == typeof i) { 990 if (!(i = t.instance.popper.querySelector(i))) return t 991 } else if (!t.instance.popper.contains(i)) return console.warn("WARNING: `arrow.element` must be child of its popper element!"), t; 992 var n = t.placement.split("-")[0], 993 o = t.offsets, 994 s = o.popper, 995 a = o.reference, 996 r = -1 !== ["left", "right"].indexOf(n), 997 l = r ? "height" : "width", 998 c = r ? "Top" : "Left", 999 d = c.toLowerCase(), 1000 e = r ? "left" : "top", 1001 o = r ? "bottom" : "right", 1002 n = w(i)[l];
1003 a[o] - n < s[d] && (t.offsets.popper[d] -= s[d] - (a[o] - n)), a[d] + n > s[o] && (t.offsets.popper[d] += a[d] + n - s[o]), t.offsets.popper = b(t.offsets.popper); 1004 r = a[d] + a[l] / 2 - n / 2, o = h(t.instance.popper), a = parseFloat(o["margin" + c], 10), c = parseFloat(o["border" + c + "Width"], 10), c = r - t.offsets.popper[d] - a - c, c = D(A(s[l] - n, c), 0); 1005 return t.arrowElement = i, t.offsets.arrow = (j(i = {}, d, Math.round(c)), j(i, e, ""), i), t 1006 }, 1007 element: "[x-arrow]" 1008 }, 1009 flip: { 1010 order: 600, 1011 enabled: !0, 1012 fn: function(l, c) { 1013 if (t(l.instance.modifiers, "inner")) return l; 1014 if (l.flipped && l.placement === l.originalPlacement) return l; 1015 var d = r(l.instance.popper, l.instance.reference, c.padding, c.boundariesElement), 1016 u = l.placement.split("-")[0], 1017 h = C(u), 1018 p = l.placement.split("-")[1] || "", 1019 f = []; 1020 switch (c.behavior) { 1021 case G: 1022 f = [u, h]; 1023 break; 1024 case Y: 1025 f = O(u); 1026 break; 1027 case X: 1028 f = O(u, !0); 1029 break; 1030 default: 1031 f = c.behavior 1032 } 1033 return f.forEach(function(t, e) { 1034 if (u !== t || f.length === e + 1) return l; 1035 u = l.placement.split("-")[0], h = C(u); 1036 var i = l.offsets.popper, 1037 n = l.offsets.reference, 1038 o = P, 1039 s = "left" === u && o(i.right) > o(n.left) || "right" === u && o(i.left) < o(n.right) || "top" === u && o(i.bottom) > o(n.top) || "bottom" === u && o(i.top) < o(n.bottom), 1040 a = o(i.left) < o(d.left), 1041 r = o(i.right) > o(d.right), 1042 t = o(i.top) < o(d.top), 1043 n = o(i.bottom) > o(d.bottom), 1044 i = "left" === u && a || "right" === u && r || "top" === u && t || "bottom" === u && n, 1045 o = -1 !== ["top", "bottom"].indexOf(u), 1046 n = !!c.flipVariations && (o && "start" === p && a || o && "end" === p && r || !o && "start" === p && t || !o && "end" === p && n); 1047 (s || i || n) && (l.flipped = !0, (s || i) && (u = f[e + 1]), n && (p = "end" === (n = p) ? "start" : "start" === n ? "end" : n), l.placement = u + (p ? "-" + p : ""), l.offsets.popper = q({}, l.offsets.popper, x(l.instance.popper, l.offsets.reference, l.placement)), l = S(l.instance.modifiers, l, "flip")) 1048 }), l 1049 }, 1050 behavior: "flip", 1051 padding: 5, 1052 boundariesElement: "viewport" 1053 }, 1054 inner: { 1055 order: 700, 1056 enabled: !1, 1057 fn: function(t) { 1058 var e = t.placement, 1059 i = e.split("-")[0], 1060 n = t.offsets, 1061 o = n.popper, 1062 s = n.reference, 1063 a = -1 !== ["left", "right"].indexOf(i), 1064 n = -1 === ["top", "left"].indexOf(i); 1065 return o[a ? "left" : "top"] = s[i] - (n ? o[a ? "width" : "height"] : 0), t.placement = C(e), t.offsets.popper = b(o), t 1066 } 1067 }, 1068 hide: { 1069 order: 800, 1070 enabled: !0, 1071 fn: function(t) { 1072 if (!I(t.instance.modifiers, "hide", "preventOverflow")) return t; 1073 var e = t.offsets.reference, 1074 i = _(t.instance.modifiers, function(t) { 1075 return "preventOverflow" === t.name 1076 }).boundaries; 1077 if (e.bottom < i.top || e.left > i.right || e.top > i.bottom || e.right < i.left) { 1078 if (!0 === t.hide) return t; 1079 t.hide = !0, t.attributes["x-out-of-boundaries"] = "" 1080 } else { 1081 if (!1 === t.hide) return t; 1082 t.hide = !1, t.attributes["x-out-of-boundaries"] = !1 1083 } 1084 return t 1085 } 1086 }, 1087 computeStyle: { 1088 order: 850, 1089 enabled: !0, 1090 fn: function(t, e) { 1091 var i = e.x, 1092 n = e.y, 1093 o = t.offsets.popper, 1094 s = _(t.instance.modifiers, function(t) { 1095 return "applyStyle" === t.name 1096 }).gpuAcceleration; 1097 void 0 !== s && console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!"); 1098 var a = void 0 === s ? e.gpuAcceleration : s, 1099 r = d(c(t.instance.popper)), 1100 l = { 1101 position: o.position 1102 }, 1103 e = { 1104 left: P(o.left), 1105 top: P(o.top), 1106 bottom: P(o.bottom), 1107 right: P(o.right) 1108 }, 1109 s = "bottom" === i ? "top" : "bottom", 1110 o = "right" === n ? "left" : "right", 1111 i = T("transform"), 1112 n = "bottom" == s ? -r.height + e.bottom : e.top, 1113 e = "right" == o ? -r.width + e.right : e.left; 1114 a && i ? (l[i] = "translate3d(" + e + "px, " + n + "px, 0)", l[s] = 0, l[o] = 0, l.willChange = "transform") : (i = "right" == o ? -1 : 1, l[s] = n * ("bottom" == s ? -1 : 1), l[o] = e * i, l.willChange = s + ", " + o); 1115 o = { 1116 "x-placement": t.placement 1117 }; 1118 return t.attributes = q({}, o, t.attributes), t.styles = q({}, l, t.styles), t.arrowStyles = q({}, t.offsets.arrow, t.arrowStyles), t 1119 }, 1120 gpuAcceleration: !0, 1121 x: "bottom", 1122 y: "right" 1123 }, 1124 applyStyle: { 1125 order: 900, 1126 enabled: !0, 1127 fn: function(t) { 1128 return k(t.instance.popper, t.styles), e = t.instance.popper, i = t.attributes, Object.keys(i).forEac
1128h(function(t) { 1129 !1 === i[t] ? e.removeAttribute(t) : e.setAttribute(t, i[t]) 1130 }), t.arrowElement && Object.keys(t.arrowStyles).length && k(t.arrowElement, t.arrowStyles), t; 1131 var e, i 1132 }, 1133 onLoad: function(t, e, i, n, o) { 1134 var s = u(0, e, t), 1135 t = l(i.placement, s, e, t, i.modifiers.flip.boundariesElement, i.modifiers.flip.padding); 1136 return e.setAttribute("x-placement", t), k(e, { 1137 position: "absolute" 1138 }), i 1139 }, 1140 gpuAcceleration: void 0 1141 } 1142 } 1143 }, F 1144 }), 1145 function(t, e) { 1146 "object" == typeof exports && "undefined" != typeof module ? e(exports, require("jquery"), require("popper.js")) : "function" == typeof define && define.amd ? define(["exports", "jquery", "popper.js"], e) : e(t.bootstrap = {}, t.jQuery, t.Popper) 1147 }(this, function(t, e, o) { 1148 "use strict"; 1149 1150 function n(t, e) { 1151 for (var i = 0; i < e.length; i++) { 1152 var n = e[i]; 1153 n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n) 1154 } 1155 } 1156 1157 function x(t, e, i) { 1158 return e && n(t.prototype, e), i && n(t, i), t 1159 } 1160 1161 function _() { 1162 return (_ = Object.assign || function(t) { 1163 for (var e = 1; e < arguments.length; e++) { 1164 var i, n = arguments[e]; 1165 for (i in n) Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]) 1166 } 1167 return t 1168 }).apply(this, arguments) 1169 } 1170 e = e && e.hasOwnProperty("default") ? e.default : e, o = o && o.hasOwnProperty("default") ? o.default : o; 1171 var s, i, a, r, l, c, d, u, h, p, f, m, g, v, b, y, w, C, S, T, $, E, k, I, O, z, A, P, D, L, M, N, H, j, B, R, W, F, q, V, U, G, Y, X, K, Z, Q, J, tt, et, it, nt, ot, st, at, rt, lt, ct, dt, ut, ht, pt, ft, mt, gt, vt, bt = (mt = e, gt = !1, vt = { 1172 TRANSITION_END: "bsTransitionEnd", 1173 getUID: function(t) { 1174 for (; t += ~~(1e6 * Math.random()), document.getElementById(t);); 1175 return t 1176 }, 1177 getSelectorFromElement: function(t) { 1178 var e = t.getAttribute("data-target"); 1179 "#" === (e = !e || "#" === e ? t.getAttribute("href") || "" : e).charAt(0) && (t = e, e = t = "function" == typeof mt.escapeSelector ? mt.escapeSelector(t).substr(1) : t.replace(/(:|\.|\[|\]|,|=|@)/g, "\\$1")); 1180 try { 1181 return 0 < mt(document).find(e).length ? e : null 1182 } catch (t) { 1183 return null 1184 } 1185 }, 1186 reflow: function(t) { 1187 return t.offsetHeight 1188 }, 1189 triggerTransitionEnd: function(t) { 1190 mt(t).trigger(gt.end) 1191 }, 1192 supportsTransitionEnd: function() { 1193 return Boolean(gt) 1194 }, 1195 isElement: function(t) { 1196 return (t[0] || t).nodeType 1197 }, 1198 typeCheckConfig: function(t, e, i) { 1199 for (var n in i) 1200 if (Object.prototype.hasOwnProperty.call(i, n)) { 1201 var o = i[n], 1202 s = e[n], 1203 s = s && vt.isElement(s) ? "element" : {}.toString.call(s).match(/\s([a-zA-Z]+)/)[1].toLowerCase(); 1204 if (!new RegExp(o).test(s)) throw new Error(t.toUpperCase() + ': Option "' + n + '" provided type "' + s + '" but expected type "' + o + '".') 1205 } 1206 } 1207 }, gt = ("undefined" == typeof window || !window.QUnit) && { 1208 end: "transitionend" 1209 }, mt.fn.emulateTransitionEnd = function(t) { 1210 var e = this, 1211 i = !1; 1212 return mt(this).one(vt.TRANSITION_END, function() { 1213 i = !0 1214 }), setTimeout(function() { 1215 i || vt.triggerTransitionEnd(e) 1216 }, t), this 1217 }, vt.supportsTransitionEnd() && (mt.event.special[vt.TRANSITION_END] = { 1218 bindType: gt.end, 1219 delegateType: gt.end, 1220 handle: function(t) { 1221 if (mt(t.target).is(this)) return t.handleObj.handler.apply(this, arguments) 1222 } 1223 }), vt), 1224 yt = (xt = "." + (a = "bs.alert"), r = (s = e).fn[i = "alert"], l = { 1225 CLOSE: "close" + xt, 1226 CLOSED: "closed" + xt, 1227 CLICK_DATA_API: "click" + xt + ".data-api" 1228 }, (ft = zt.prototype).close = function(t) { 1229 t = t || this._element; 1230 t = this._getRootElement(t); 1231 this._triggerCloseEvent(t).isDefaultPrevented() || this._removeElement(t) 1232 }, ft.dispose = function() { 1233 s.removeData(this._element, a), this._element = null 1234 }, ft._getRootElement = function(t) { 1235 var e = bt.getSelectorFromElement(t), 1236 i = !1; 1237 return i = (i = e ? s(e)[0] : i) || s(t).closest(".alert")[0] 1238 }, ft._triggerCloseEvent = function(t) { 1239 var e = s.Event(l.CLOSE); 1240 return s(t).trigger(e), e 1241 }, ft._removeElement = function(e) { 1242 var i = this; 1243 s(e).removeClass("show"), bt.supportsTransitionEnd() && s(e).hasClass("fade") ? s(e).one(bt.TRANSITION_END, function(t) { 1244 return i._destroyElement(e, t) 1245 }).emulateTransitionEnd(150) : this._destroyElement(e) 1246 }, ft._destroyElement = function(t) { 1247 s(t).detach().trigger(l.CLOSED).remove() 1248 }, zt._jQueryInterface = function(i) { 1249 return this.each(function() { 1250 var t = s(this), 1251 e = t.data(a); 1252 e || (e = new zt(this), t.data(a, e)), "close" === i && e[i](this) 1253 }) 1254 }, zt._handleDismiss = function(e) { 1255 return function(t) { 1256 t && t.preventDefault(), e.close(this) 1257 } 1258 }, x(zt, null, [{ 1259 key: "VERSION", 1260 get: function() { 1261 return "4.0.0" 1262 } 1263 }]), c = zt, s(document).on(l.CLICK_DATA_API, '[data-dismiss="alert"]', c._handleDismiss(new c)), s.fn[i] = c._jQueryInterface, s.fn[i].Constructor = c, s.fn[i].noConflict = function() { 1264 return s.fn[i] = r, c._jQueryInterface 1265 }, c), 1266 wt = (_t = "." + (h = "bs.button"), p = (d = e).fn[u = "button"], f = "active", $t = '[data-toggle^="button"]', Tt = { 1267 CLICK_DATA_API: "click" + _t + (St = ".data-api"), 1268 FOCUS_BLUR_DATA_API: "focus" + _t + St + " blur" + _t + St 1269 }, (pt = Ot.prototype).toggle = function() { 1270 var t = !0, 1271 e = !0, 1272 i = d(this._element).closest('[data-toggle="buttons"]')[0]; 1273 if (i) { 1274 var n, o = d(this._element).find("input")[0]; 1275 if (o) { 1276 if ("radio" === o.type && (o.checked && d(this._element).hasClass(f) ? t = !1 : (n = d(i).find(".active")[0]) && d(n).removeClass(f)), t) { 1277 if (o.hasAttribute("disabled") || i.hasAttribute("disabled") || o.classList.contains("disabled") || i.classList.contains("disabled")) return; 1278 o.checked = !d(this._element).hasClass(f), d(o).trigger("change") 1279 } 1280 o.focus(), e = !1 1281 } 1282 } 1283 e && this._element.setAttribute("aria-pressed", !d(this._element).hasClass(f)), t && d(this._element).toggleClass(f) 1284 }, pt.dispose = function() { 1285 d.removeData(this._element, h), this._element = null 1286 }, Ot._jQueryInterface = function(e) { 1287 return this.each(function() { 1288 var t = d(this).data(h); 1289 t || (t = new Ot(this), d(this).data(h, t)), "toggle" === e && t[e]() 1290 }) 1291 }, x(Ot, null, [{ 1292 key: "VERSION", 1293 get: function() { 1294 return "4.0.0" 1295 } 1296 }]), m = Ot, d(document).on(Tt.CLICK_DATA_API, $t, function(t) { 1297 t.preventDefault(); 1298 t = t.target; 1299 d(t).hasClass("btn") || (t = d(t).closest(".btn")), m._jQueryInterface.call(d(t), "toggle") 1300 }).on(Tt.FOCUS_BLUR_DATA_API, $t, function(t) { 1301 var e = d(t.target).closest(".btn")[0]; 1302 d(e).toggleClass("focus", /^focus(in)?$/.test(t.type)) 1303 }), d.fn[u] = m._jQueryInterface, d.fn[u].Constructor = m, d.fn[u].noConflict = function() { 1304 return d.fn[u] = p, m._jQueryInterface 1305 }, m), 1306 Ct = function(d) { 1307 var t, e = "carousel", 1308 o = "bs.carousel", 1309 i = "." + o, 1310 n = d.fn[e], 1311 s = { 1312 interval: 5e3, 1313 keyboard: !0, 1314 slide: !1, 1315 pause: "hover", 1316 wrap: !0 1317 }, 1318 a = { 1319 interval: "(number|boolean)", 1320 keyboard: "boolean", 1321 slide: "(boolean|string)", 1322 pause: "(string|boolean)", 1323 wrap: "boolean" 1324 }, 1325 u = "next", 1326 r = "prev", 1327 h = { 1328 SLIDE: "slide" + i, 1329 SLID: "slid" + i, 1330 KEYDOWN: "keydown" + i, 1331 MOUSEENTER: "mouseenter" + i, 1332 MOUSELEAVE: "mouseleave" + i, 1333 TOUCHEND: "touchend" + i, 1334 LOAD_DATA_API: "load" + i + ".data-api", 1335 CLICK_DATA_API: "click" + i + ".data-api" 1336 }, 1337 p = "active", 1338 l = ".active", 1339 f = ".active.carousel-item", 1340 c = ".carousel-item", 1341 m = ".carousel-item-next, .carousel-item-prev", 1342 g = ".carousel-indicators",
1343 v = "[data-slide], [data-slide-to]", 1344 b = '[data-ride="carousel"]', 1345 y = ((t = w.prototype).next = function() { 1346 this._isSliding || this._slide(u) 1347 }, t.nextWhenVisible = function() { 1348 !document.hidden && d(this._element).is(":visible") && "hidden" !== d(this._element).css("visibility") && this.next() 1349 }, t.prev = function() { 1350 this._isSliding || this._slide(r) 1351 }, t.pause = function(t) { 1352 t || (this._isPaused = !0), d(this._element).find(m)[0] && bt.supportsTransitionEnd() && (bt.triggerTransitionEnd(this._element), this.cycle(!0)), clearInterval(this._interval), this._interval = null 1353 }, t.cycle = function(t) { 1354 t || (this._isPaused = !1), this._interval && (clearInterval(this._interval), this._interval = null), this._config.interval && !this._isPaused && (this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval)) 1355 }, t.to = function(t) { 1356 var e = this; 1357 this._activeElement = d(this._element).find(f)[0]; 1358 var i = this._getItemIndex(this._activeElement); 1359 if (!(t > this._items.length - 1 || t < 0)) 1360 if (this._isSliding) d(this._element).one(h.SLID, function() { 1361 return e.to(t) 1362 }); 1363 else { 1364 if (i === t) return this.pause(), void this.cycle(); 1365 this._slide(i < t ? u : r, this._items[t]) 1366 } 1367 }, t.dispose = function() { 1368 d(this._element).off(i), d.removeData(this._element, o), this._items = null, this._config = null, this._element = null, this._interval = null, this._isPaused = null, this._isSliding = null, this._activeElement = null, this._indicatorsElement = null 1369 }, t._getConfig = function(t) { 1370 return t = _({}, s, t), bt.typeCheckConfig(e, t, a), t 1371 }, t._addEventListeners = function() { 1372 var e = this; 1373 this._config.keyboard && d(this._element).on(h.KEYDOWN, function(t) { 1374 return e._keydown(t) 1375 }), "hover" === this._config.pause && (d(this._element).on(h.MOUSEENTER, function(t) { 1376 return e.pause(t) 1377 }).on(h.MOUSELEAVE, function(t) { 1378 return e.cycle(t) 1379 }), "ontouchstart" in document.documentElement && d(this._element).on(h.TOUCHEND, function() { 1380 e.pause(), e.touchTimeout && clearTimeout(e.touchTimeout), e.touchTimeout = setTimeout(function(t) { 1381 return e.cycle(t) 1382 }, 500 + e._config.interval) 1383 })) 1384 }, t._keydown = function(t) { 1385 if (!/input|textarea/i.test(t.target.tagName)) switch (t.which) { 1386 case 37: 1387 t.preventDefault(), this.prev(); 1388 break; 1389 case 39: 1390 t.preventDefault(), this.next() 1391 } 1392 }, t._getItemIndex = function(t) { 1393 return this._items = d.makeArray(d(t).parent().find(c)), this._items.indexOf(t) 1394 }, t._getItemByDirection = function(t, e) { 1395 var i = t === u, 1396 n = t === r, 1397 o = this._getItemIndex(e), 1398 s = this._items.length - 1; 1399 if ((n && 0 === o || i && o === s) && !this._config.wrap) return e; 1400 t = (o + (t === r ? -1 : 1)) % this._items.length; 1401 return -1 == t ? this._items[this._items.length - 1] : this._items[t] 1402 }, t._triggerSlideEvent = function(t, e) { 1403 var i = this._getItemIndex(t), 1404 n = this._getItemIndex(d(this._element).find(f)[0]), 1405 i = d.Event(h.SLIDE, { 1406 relatedTarget: t, 1407 direction: e, 1408 from: n, 1409 to: i 1410 }); 1411 return d(this._element).trigger(i), i 1412 }, t._setActiveIndicatorElement = function(t) { 1413 this._indicatorsElement && (d(this._indicatorsElement).find(l).removeClass(p), (t = this._indicatorsElement.children[this._getItemIndex(t)]) && d(t).addClass(p)) 1414 }, t._slide = function(t, e) { 1415 var i, n, o, s = this, 1416 a = d(this._element).find(f)[0], 1417 r = this._getItemIndex(a), 1418 l = e || a && this._getItemByDirection(t, a), 1419 c = this._getItemIndex(l), 1420 e = Boolean(this._interval), 1421 t = t === u ? (i = "carousel-item-left", n = "carousel-item-next", "left") : (i = "carousel-item-right", n = "carousel-item-prev", "right"); 1422 l && d(l).hasClass(p) ? this._isSliding = !1 : !this._triggerSlideEvent(l, t).isDefaultPrevented() && a && l && (this._isSliding = !0, e && this.pause(), this._setActiveIndicatorElement(l), o = d.Event(h.SLID, { 1423 relatedTarget: l, 1424 direction: t, 1425 from: r, 1426 to: c 1427 }), bt.supportsTransitionEnd() && d(this._element).hasClass("slide") ? (d(l).addClass(n), bt.reflow(l), d(a).addClass(i), d(l).addClass(i), d(a).one(bt.TRANSITION_END, function() {
1428 d(l).removeClass(i + " " + n).addClass(p), d(a).removeClass(p + " " + n + " " + i), s._isSliding = !1, setTimeout(function() { 1429 return d(s._element).trigger(o) 1430 }, 0) 1431 }).emulateTransitionEnd(600)) : (d(a).removeClass(p), d(l).addClass(p), this._isSliding = !1, d(this._element).trigger(o)), e && this.cycle()) 1432 }, w._jQueryInterface = function(n) { 1433 return this.each(function() { 1434 var t = d(this).data(o), 1435 e = _({}, s, d(this).data()); 1436 "object" == typeof n && (e = _({}, e, n)); 1437 var i = "string" == typeof n ? n : e.slide; 1438 if (t || (t = new w(this, e), d(this).data(o, t)), "number" == typeof n) t.to(n); 1439 else if ("string" == typeof i) { 1440 if (void 0 === t[i]) throw new TypeError('No method named "' + i + '"'); 1441 t[i]() 1442 } else e.interval && (t.pause(), t.cycle()) 1443 }) 1444 }, w._dataApiClickHandler = function(t) { 1445 var e, i, n = bt.getSelectorFromElement(this); 1446 !n || (e = d(n)[0]) && d(e).hasClass("carousel") && (i = _({}, d(e).data(), d(this).data()), (n = this.getAttribute("data-slide-to")) && (i.interval = !1), w._jQueryInterface.call(d(e), i), n && d(e).data(o).to(n), t.preventDefault()) 1447 }, x(w, null, [{ 1448 key: "VERSION", 1449 get: function() { 1450 return "4.0.0" 1451 } 1452 }, {
1453 key: "Default", 1454 get: function() { 1455 return s 1456 } 1457 }]), w); 1458 1459 function w(t, e) { 1460 this._items = null, this._interval = null, this._activeElement = null, this._isPaused = !1, this._isSliding = !1, this.touchTimeout = null, this._config = this._getConfig(e), this._element = d(t)[0], this._indicatorsElement = d(this._element).find(g)[0], this._addEventListeners() 1461 } 1462 return d(document).on(h.CLICK_DATA_API, v, y._dataApiClickHandler), d(window).on(h.LOAD_DATA_API, function() { 1463 d(b).each(function() { 1464 var t = d(this); 1465 y._jQueryInterface.call(t, t.data()) 1466 }) 1467 }), d.fn[e] = y._jQueryInterface, d.fn[e].Constructor = y, d.fn[e].noConflict = function() { 1468 return d.fn[e] = n, y._jQueryInterface 1469 }, y 1470 }(e), 1471 xt = function(a) { 1472 var e = "collapse", 1473 s = "bs.collapse", 1474 t = "." + s, 1475 i = a.fn[e], 1476 o = { 1477 toggle: !0, 1478 parent: "" 1479 }, 1480 n = { 1481 toggle: "boolean", 1482 parent: "(string|element)" 1483 }, 1484 r = { 1485 SHOW: "show" + t, 1486 SHOWN: "shown" + t, 1487 HIDE: "hide" + t, 1488 HIDDEN: "hidden" + t, 1489 CLICK_DATA_API: "click" + t + ".data-api" 1490 }, 1491 l = "show", 1492 c = "collapse", 1493 d = "collapsing", 1494 u = "collapsed", 1495 h = ".show, .collapsing", 1496 p = '[data-toggle="collapse"]', 1497 f = ((t = m.prototype).toggle = function() { 1498 a(this._element).hasClass(l) ? this.hide() : this.show() 1499 }, t.show = function() { 1500 var t, e, i, n, o = this; 1501 this._isTransitioning || a(this._element).hasClass(l) || (n = this._parent && 0 === (n = a.makeArray(a(this._parent).find(h).filter('[data-parent="' + this._config.parent + '"]'))).length ? null : n) && (i = a(n).not(this._selector).data(s)) && i._isTransitioning || (t = a.Event(r.SHOW), a(this._element).trigger(t), t.isDefaultPrevented() || (n && (m._jQueryInterface.call(a(n).not(this._selector), "hide"), i || a(n).data(s, null)), e = this._getDimension(), a(this._element).removeClass(c).addClass(d), (this._element.style[e] = 0) < this._triggerArray.length && a(this._triggerArray).removeClass(u).attr("aria-expanded", !0), this.setTransitioning(!0), i = function() { 1502 a(o._element).removeClass(d).addClass(c).addClass(l), o._element.style[e] = "", o.setTransitioning(!1), a(o._element).trigger(r.SHOWN) 1503 }, bt.supportsTransitionEnd() ? (n = "scroll" + (e[0].toUpperCase() + e.slice(1)), a(this._element).one(bt.TRANSITION_END, i).emulateTransitionEnd(600), this._element.style[e] = this._element[n] + "px") : i())) 1504 }, t.hide = function() { 1505 var t = this; 1506 if (!this._isTransitioning && a(this._element).hasClass(l)) { 1507 var e = a.Event(r.HIDE); 1508 if (a(this._element).trigger(e), !e.isDefaultPrevented()) { 1509 var i = this._getDimension(); 1510 if (this._element.style[i] = this._element.getBoundingClientRect()[i] + "px", bt.reflow(this._element), a(this._element).addClass(d).removeClass(c).removeClass(l), 0 < this._triggerArray.length) 1511 for (var n = 0; n < this._triggerArray.length; n++) { 1512 var o = this._triggerArray[n], 1513 s = bt.getSelectorFromElement(o); 1514 null !== s && (a(s).hasClass(l) || a(o).addClass(u).attr("aria-expanded", !1)) 1515 } 1516 this.setTransitioning(!0); 1517 e = function() { 1518 t.setTransitioning(!1), a(t._element).removeClass(d).addClass(c).trigger(r.HIDDEN) 1519 }; 1520 this._element.style[i] = "", bt.supportsTransitionEnd() ? a(this._element).one(bt.TRANSITION_END, e).emulateTransitionEnd(600) : e() 1521 } 1522 } 1523 }, t.setTransitioning = function(t) { 1524 this._isTransitioning = t 1525 }, t.dispose = function() { 1526 a.removeData(this._element, s), this._config = null, this._parent = null, this._element = null, this._triggerArray = null, this._isTransitioning = null 1527 }, t._getConfig = function(t) { 1528 return (t = _({}, o, t)).toggle = Boolean(t.toggle), bt.typeCheckConfig(e, t, n), t 1529 }, t._getDimension = function() { 1530 return a(this._element).hasClass("width") ? "width" : "height" 1531 }, t._getParent = function() { 1532 var i = this, 1533 t = null; 1534 bt.isElement(this._config.parent) ? (t = this._config.parent, void 0 !== this._config.parent.jquery && (t = this._config.parent[0])) : t = a(this._config.parent)[0]; 1535 var e = '[data-toggle="collapse"][data-parent="' + this._config.parent + '"]'; 1536 return a(t).find(e).each(function(t, e) { 1537 i._addAriaAndCollapsedClass(m._getTargetFromElement(e), [e]) 1538 }), t 1539 }, t._addAriaAndCollapsedClass = function(t, e) { 1540 t && (t = a(t).hasClass(l), 0 < e.length && a(e).toggleClass(u, !t).attr("aria-expanded", t)) 1541 }, m._getTargetFromElement = function(t) { 1542 t = bt.getSelectorFromElement(t); 1543 return t ? a(t)[0] : null 1544 }, m._jQueryInterface = function(n) { 1545 return this.each(function() { 1546 var t = a(this), 1547 e = t.data(s), 1548 i = _({}, o, t.data(), "object" == typeof n && n); 1549 if (!e && i.toggle && /show|hide/.test(n) && (i.toggle = !1), e || (e = new m(this, i), t.data(s, e)), "string" == typeof n) {
1550 if (void 0 === e[n]) throw new TypeError('No method named "' + n + '"'); 1551 e[n]() 1552 } 1553 }) 1554 }, x(m, null, [{ 1555 key: "VERSION", 1556 get: function() { 1557 return "4.0.0" 1558 } 1559 }, { 1560 key: "Default", 1561 get: function() { 1562 return o 1563 } 1564 }]), m); 1565 1566 function m(t, e) { 1567 this._isTransitioning = !1, this._element = t, this._config = this._getConfig(e), this._triggerArray = a.makeArray(a('[data-toggle="collapse"][href="#' + t.id + '"],[data-toggle="collapse"][data-target="#' + t.id + '"]')); 1568 for (var i = a(p), n = 0; n < i.length; n++) { 1569 var o = i[n], 1570 s = bt.getSelectorFromElement(o); 1571 null !== s && 0 < a(s).filter(t).length && (this._selector = s, this._triggerArray.push(o)) 1572 } 1573 this._parent = this._config.parent ? this._getParent() : null, this._config.parent || this._addAriaAndCollapsedClass(this._element, this._triggerArray), this._config.toggle && this.toggle() 1574 } 1575 return a(document).on(r.CLICK_DATA_API, p, function(t) { 1576 "A" === t.currentTarget.tagName && t.preventDefault(); 1577 var i = a(this), 1578 t = bt.getSelectorFromElement(this); 1579 a(t).each(function() { 1580 var t = a(this), 1581 e = t.data(s) ? "toggle" : i.data(); 1582 f._jQueryInterface.call(t, e) 1583 }) 1584 }), a.fn[e] = f._jQueryInterface, a.fn[e].Constructor = f, a.fn[e].noConflict = function() { 1585 return a.fn[e] = i, f._jQueryInterface 1586 }, f 1587 }(e), 1588 _t = (J = "dropdown", et = "." + (tt = "bs.dropdown"), ft = ".data-api", it = (Q = e).fn[J], nt = new RegExp("38|40|27"), ot = { 1589 HIDE: "hide" + et, 1590 HIDDEN: "hidden" + et, 1591 SHOW: "show" + et, 1592 SHOWN: "shown" + et, 1593 CLICK: "click" + et, 1594 CLICK_DATA_API: "click" + et + ft, 1595 KEYDOWN_DATA_API: "keydown" + et + ft, 1596 KEYUP_DATA_API: "keyup" + et + ft 1597 }, st = "disabled", at = "show", rt = "dropdown-menu-right", lt = '[data-toggle="dropdown"]', ct = ".dropdown-menu", dt = { 1598 offset: 0, 1599 flip: !0, 1600 boundary: "scrollParent" 1601 }, ut = { 1602 offset: "(number|string|function)", 1603 flip: "boolean", 1604 boundary: "(string|element)" 1605 }, (ft = It.prototype).toggle = function() { 1606 if (!this._element.disabled && !Q(this._element).hasClass(st)) { 1607 var t = It._getParentFromElement(this._element), 1608 e = Q(this._menu).hasClass(at); 1609 if (It._clearMenus(), !e) { 1610 var i = { 1611 relatedTarget: this._element 1612 }, 1613 e = Q.Event(ot.SHOW, i); 1614 if (Q(t).trigger(e), !e.isDefaultPrevented()) { 1615 if (!this._inNavbar) { 1616 if (void 0 === o) throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)"); 1617 e = this._element; 1618 Q(t).hasClass("dropup") && (Q(this._menu).hasClass("dropdown-menu-left") || Q(this._menu).hasClass(rt)) && (e = t), "scrollParent" !== this._config.boundary && Q(t).addClass("position-static"), this._popper = new o(e, this._menu, this._getPopperConfig()) 1619 } 1620 "ontouchstart" in document.documentElement && 0 === Q(t).closest(".navbar-nav").length && Q("body").children().on("mouseover", null, Q.noop), this._element.focus(), this._element.setAttribute("aria-expanded", !0), Q(this._menu).toggleClass(at), Q(t).toggleClass(at).trigger(Q.Event(ot.SHOWN, i)) 1621 } 1622 } 1623 } 1624 }, ft.dispose = function() { 1625 Q.removeData(this._element, tt), Q(this._element).off(et), this._element = null, (this._menu = null) !== this._popper && (this._popper.destroy(), this._popper = null) 1626 }, ft.update = function() { 1627 this._inNavbar = this._detectNavbar(), null !== this._popper && this._popper.scheduleUpdate() 1628 }, ft._addEventListeners = function() { 1629 var e = this; 1630 Q(this._element).on(ot.CLICK, function(t) { 1631 t.preventDefault(), t.stopPropagation(), e.toggle() 1632 }) 1633 }, ft._getConfig = function(t) { 1634 return t = _({}, this.constructor.Default, Q(this._element).data(), t), bt.typeCheckConfig(J, t, this.constructor.DefaultType), t 1635 }, ft._getMenuElement = function() { 1636 var t; 1637 return this._menu || (t = It._getParentFromElement(this._element), this._menu = Q(t).find(ct)[0]), this._menu 1638 }, ft._getPlacement = function() { 1639 var t = Q(this._element).parent(), 1640 e = "bottom-start"; 1641 return t.hasClass("dropup") ? (e = "top-start", Q(this._menu).hasClass(rt) && (e = "top-end")) : t.hasClass("dropright") ? e = "right-start" : t.hasClass("dropleft") ? e = "left-start" : Q(this._menu).hasClass(rt) && (e = "bottom-end"), e 1642 }, ft._detectNavbar = function() {
1643 return 0 < Q(this._element).closest(".navbar").length 1644 }, ft._getPopperConfig = function() { 1645 var e = this, 1646 t = {}; 1647 return "function" == typeof this._config.offset ? t.fn = function(t) { 1648 return t.offsets = _({}, t.offsets, e._config.offset(t.offsets) || {}), t 1649 } : t.offset = this._config.offset, { 1650 placement: this._getPlacement(), 1651 modifiers: { 1652 offset: t, 1653 flip: { 1654 enabled: this._config.flip 1655 }, 1656 preventOverflow: { 1657 boundariesElement: this._config.boundary 1658 } 1659 } 1660 } 1661 }, It._jQueryInterface = function(e) { 1662 return this.each(function() { 1663 var t = Q(this).data(tt); 1664 if (t || (t = new It(this, "object" == typeof e ? e : null), Q(this).data(tt, t)), "string" == typeof e) { 1665 if (void 0 === t[e]) throw new TypeError('No method named "' + e + '"'); 1666 t[e]() 1667 } 1668 }) 1669 }, It._clearMenus = function(t) { 1670 if (!t || 3 !== t.which && ("keyup" !== t.type || 9 === t.which)) 1671 for (var e = Q.makeArray(Q(lt)), i = 0; i < e.length; i++) { 1672 var n, o = It._getParentFromElement(e[i]), 1673 s = Q(e[i]).data(tt), 1674 a = { 1675 relatedTarget: e[i] 1676 }; 1677 s && (n = s._menu, !Q(o).hasClass(at) || t && ("click" === t.type && /input|textarea/i.test(t.target.tagName) || "keyup" === t.type && 9 === t.which) && Q.contains(o, t.target) || (s = Q.Event(ot.HIDE, a), Q(o).trigger(s), s.isDefaultPrevented() || ("ontouchstart" in document.documentElement && Q("body").children().off("mouseover", null, Q.noop), e[i].setAttribute("aria-expanded", "false"), Q(n).removeClass(at), Q(o).removeClass(at).trigger(Q.Event(ot.HIDDEN, a))))) 1678 } 1679 }, It._getParentFromElement = function(t) { 1680 var e, i = bt.getSelectorFromElement(t); 1681 return (e = i ? Q(i)[0] : e) || t.parentNode 1682 }, It._dataApiKeydownHandler = function(t) { 1683 var e, i, n; 1684 (/input|textarea/i.test(t.target.tagName) ? 32 === t.which || 27 !== t.which && (40 !== t.which && 38 !== t.which || Q(t.target).closest(ct).length) : !nt.test(t.which)) || (t.preventDefault(), t.stopPropagation(), this.disabled || Q(this).hasClass(st)) || (n = It._getParentFromElement(this), ((i = Q(n).hasClass(at)) || 27 === t.which && 32 === t.which) && (!i || 27 !== t.which && 32 !== t.which) ? 0 !== (e = Q(n).find(".dropdown-menu .dropdown-item:not(.disabled)").get()).length && (i = e.indexOf(t.target), 38 === t.which && 0 < i && i--, 40 === t.which && i < e.length - 1 && i++, e[i = i < 0 ? 0 : i].focus()) : (27 === t.which && (n = Q(n).find(lt)[0], Q(n).trigger("focus")), Q(this).trigger("click"))) 1685 }, x(It, null, [{ 1686 key: "VERSION", 1687 get: function() { 1688 return "4.0.0" 1689 } 1690 }, { 1691 key: "Default", 1692 get: function() { 1693 return dt 1694 } 1695 }, { 1696 key: "DefaultType", 1697 get: function() { 1698 return ut 1699 } 1700 }]), ht = It, Q(document).on(ot.KEYDOWN_DATA_API, lt, ht._dataApiKeydownHandler).on(ot.KEYDOWN_DATA_API, ct, ht._dataApiKeydownHandler).on(ot.CLICK_DATA_API + " " + ot.KEYUP_DATA_API, ht._clearMenus).on(ot.CLICK_DATA_API, lt, function(t) { 1701 t.preventDefault(), t.stopPropagation(), ht._jQueryInterface.call(Q(this), "toggle") 1702 }).on(ot.CLICK_DATA_API, ".dropdown form", function(t) { 1703 t.stopPropagation() 1704 }), Q.fn[J] = ht._jQueryInterface, Q.fn[J].Constructor = ht, Q.fn[J].noConflict = function() { 1705 return Q.fn[J] = it, ht._jQueryInterface 1706 }, ht), 1707 St = function(s) { 1708 var t, a = "bs.modal", 1709 e = "." + a, 1710 i = s.fn.modal, 1711 n = { 1712 backdrop: !0, 1713 keyboard: !0, 1714 focus: !0, 1715 show: !0 1716 }, 1717 o = { 1718 backdrop: "(boolean|string)", 1719 keyboard: "boolean", 1720 focus: "boolean", 1721 show: "boolean" 1722 }, 1723 r = { 1724 HIDE: "hide" + e, 1725 HIDDEN: "hidden" + e, 1726 SHOW: "show" + e, 1727 SHOWN: "shown" + e, 1728 FOCUSIN: "focusin" + e, 1729 RESIZE: "resize" + e, 1730 CLICK_DISMISS: "click.dismiss" + e, 1731 KEYDOWN_DISMISS: "keydown.dismiss" + e, 1732 MOUSEUP_DISMISS: "mouseup.dismiss" + e, 1733 MOUSEDOWN_DISMISS: "mousedown.dismiss" + e, 1734 CLICK_DATA_API: "click" + e + ".data-api" 1735 },
1736 l = "modal-open", 1737 c = "fade", 1738 d = "show", 1739 u = ".modal-dialog", 1740 h = '[data-toggle="modal"]', 1741 p = '[data-dismiss="modal"]', 1742 f = ".fixed-top, .fixed-bottom, .is-fixed, .sticky-top", 1743 m = ".sticky-top", 1744 g = ".navbar-toggler", 1745 v = ((t = b.prototype).toggle = function(t) { 1746 return this._isShown ? this.hide() : this.show(t) 1747 }, t.show = function(t) { 1748 var e, i = this; 1749 this._isTransitioning || this._isShown || (bt.supportsTransitionEnd() && s(this._element).hasClass(c) && (this._isTransitioning = !0), e = s.Event(r.SHOW, { 1750 relatedTarget: t 1751 }), s(this._element).trigger(e), this._isShown || e.isDefaultPrevented() || (this._isShown = !0, this._checkScrollbar(), this._setScrollbar(), this._adjustDialog(), s(document.body).addClass(l), this._setEscapeEvent(), this._setResizeEvent(), s(this._element).on(r.CLICK_DISMISS, p, function(t) { 1752 return i.hide(t) 1753 }), s(this._dialog).on(r.MOUSEDOWN_DISMISS, function() { 1754 s(i._element).one(r.MOUSEUP_DISMISS, function(t) { 1755 s(t.target).is(i._element) && (i._ignoreBackdropClick = !0) 1756 }) 1757 }), this._showBackdrop(function() { 1758 return i._showElement(t) 1759 }))) 1760 }, t.hide = function(t) { 1761 var e = this; 1762 t && t.preventDefault(), !this._isTransitioning && this._isShown && (t = s.Event(r.HIDE), s(this._element).trigger(t), this._isShown && !t.isDefaultPrevented() && (this._isShown = !1, (t = bt.supportsTransitionEnd() && s(this._element).hasClass(c)) && (this._isTransitioning = !0), this._setEscapeEvent(), this._setResizeEvent(), s(document).off(r.FOCUSIN), s(this._element).removeClass(d), s(this._element).off(r.CLICK_DISMISS), s(this._dialog).off(r.MOUSEDOWN_DISMISS), t ? s(this._element).one(bt.TRANSITION_END, function(t) { 1763 return e._hideModal(t) 1764 }).emulateTransitionEnd(300) : this._hideModal())) 1765 }, t.dispose = function() { 1766 s.removeData(this._element, a), s(window, document, this._element, this._backdrop).off(e), this._config = null, this._element = null, this._dialog = null, this._backdrop = null, this._isShown = null, this._isBodyOverflowing = null, this._ignoreBackdropClick = null, this._scrollbarWidth = null 1767 }, t.handleUpdate = function() { 1768 this._adjustDialog() 1769 }, t._getConfig = function(t) { 1770 return t = _({}, n, t), bt.typeCheckConfig("modal", t, o), t 1771 }, t._showElement = function(t) { 1772 var e = this, 1773 i = bt.supportsTransitionEnd() && s(this._element).hasClass(c); 1774 this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE || document.body.appendChild(this._element), this._element.style.display = "block", this._element.removeAttribute("aria-hidden"), this._element.scrollTop = 0, i && bt.reflow(this._element), s(this._element).addClass(d), this._config.focus && this._enforceFocus(); 1775 var n = s.Event(r.SHOWN, { 1776 relatedTarget: t 1777 }), 1778 t = function() { 1779 e._config.focus && e._element.focus(), e._isTransitioning = !1, s(e._element).trigger(n) 1780 }; 1781 i ? s(this._dialog).one(bt.TRANSITION_END, t).emulateTransitionEnd(300) : t() 1782 }, t._enforceFocus = function() { 1783 var e = this; 1784 s(document).off(r.FOCUSIN).on(r.FOCUSIN, function(t) { 1785 document !== t.target && e._element !== t.target && 0 === s(e._element).has(t.target).length && e._element.focus() 1786 }) 1787 }, t._setEscapeEvent = function() { 1788 var e = this; 1789 this._isShown && this._config.keyboard ? s(this._element).on(r.KEYDOWN_DISMISS, function(t) { 1790 27 === t.which && (t.preventDefault(), e.hide()) 1791 }) : this._isShown || s(this._element).off(r.KEYDOWN_DISMISS) 1792 }, t._setResizeEvent = function() { 1793 var e = this; 1794 this._isShown ? s(window).on(r.RESIZE, function(t) { 1795 return e.handleUpdate(t) 1796 }) : s(window).off(r.RESIZE) 1797 }, t._hideModal = function() { 1798 var t = this; 1799 this._element.style.display = "none", this._element.setAttribute("aria-hidden", !0), this._isTransitioning = !1, this._showBackdrop(function() { 1800 s(document.body).removeClass(l), t._resetAdjustments(), t._resetScrollbar(), s(t._element).trigger(r.HIDDEN) 1801 }) 1802 }, t._removeBackdrop = function() { 1803 this._backdrop && (s(this._backdrop).remove(), this._backdrop = null) 1804 }, t._showBackdrop = function(t) { 1805 var e, i = this, 1806 n = s(this._element).hasClass(c) ? c : ""; 1807 this._isShown && this._config.backdrop ? (e = bt.supportsTransitionEnd() && n, this._backdrop = document.createElement("div"), this._backdrop.className = "modal
1807-backdrop", n && s(this._backdrop).addClass(n), s(this._backdrop).appendTo(document.body), s(this._element).on(r.CLICK_DISMISS, function(t) { 1808 i._ignoreBackdropClick ? i._ignoreBackdropClick = !1 : t.target === t.currentTarget && ("static" === i._config.backdrop ? i._element.focus() : i.hide()) 1809 }), e && bt.reflow(this._backdrop), s(this._backdrop).addClass(d), t && (e ? s(this._backdrop).one(bt.TRANSITION_END, t).emulateTransitionEnd(150) : t())) : !this._isShown && this._backdrop ? (s(this._backdrop).removeClass(d), e = function() { 1810 i._removeBackdrop(), t && t() 1811 }, bt.supportsTransitionEnd() && s(this._element).hasClass(c) ? s(this._backdrop).one(bt.TRANSITION_END, e).emulateTransitionEnd(150) : e()) : t && t() 1812 }, t._adjustDialog = function() { 1813 var t = this._element.scrollHeight > document.documentElement.clientHeight; 1814 !this._isBodyOverflowing && t && (this._element.style.paddingLeft = this._scrollbarWidth + "px"), this._isBodyOverflowing && !t && (this._element.style.paddingRight = this._scrollbarWidth + "px") 1815 }, t._resetAdjustments = function() { 1816 this._element.style.paddingLeft = "", this._element.style.paddingRight = "" 1817 }, t._checkScrollbar = function() { 1818 var t = document.body.getBoundingClientRect(); 1819 this._isBodyOverflowing = t.left + t.right < window.innerWidth, this._scrollbarWidth = this._getScrollbarWidth() 1820 }, t._setScrollbar = function() { 1821 var t, e, o = this; 1822 this._isBodyOverflowing && (s(f).each(function(t, e) { 1823 var i = s(e)[0].style.paddingRight, 1824 n = s(e).css("padding-right"); 1825 s(e).data("padding-right", i).css("padding-right", parseFloat(n) + o._scrollbarWidth + "px") 1826 }), s(m).each(function(t, e) { 1827 var i = s(e)[0].style.marginRight, 1828 n = s(e).css("margin-right"); 1829 s(e).data("margin-right", i).css("margin-right", parseFloat(n) - o._scrollbarWidth + "px") 1830 }), s(g).each(function(t, e) { 1831 var i = s(e)[0].style.marginRight, 1832 n = s(e).css("margin-right"); 1833 s(e).data("margin-right", i).css("margin-right", parseFloat(n) + o._scrollbarWidth + "px") 1834 }), t = document.body.style.paddingRight, e = s("body").css("padding-right"), s("body").data("padding-right", t).css("padding-right", parseFloat(e) + this._scrollbarWidth + "px")) 1835 }, t._resetScrollbar = function() { 1836 s(f).each(function(t, e) { 1837 var i = s(e).data("padding-right"); 1838 void 0 !== i && s(e).css("padding-right", i).removeData("padding-right") 1839 }), s(m + ", " + g).each(function(t, e) { 1840 var i = s(e).data("margin-right"); 1841 void 0 !== i && s(e).css("margin-right", i).removeData("margin-right") 1842 }); 1843 var t = s("body").data("padding-right"); 1844 void 0 !== t && s("body").css("padding-right", t).removeData("padding-right") 1845 }, t._getScrollbarWidth = function() { 1846 var t = document.createElement("div"); 1847 t.className = "modal-scrollbar-measure", document.body.appendChild(t); 1848 var e = t.getBoundingClientRect().width - t.clientWidth; 1849 return document.body.removeChild(t), e 1850 }, b._jQueryInterface = function(i, n) { 1851 return this.each(function() { 1852 var t = s(this).data(a), 1853 e = _({}, b.Default, s(this).data(), "object" == typeof i && i); 1854 if (t || (t = new b(this, e), s(this).data(a, t)), "string" == typeof i) { 1855 if (void 0 === t[i]) throw new TypeError('No method named "' + i + '"'); 1856 t[i](n) 1857 } else e.show && t.show(n) 1858 }) 1859 }, x(b, null, [{ 1860 key: "VERSION", 1861 get: function() { 1862 return "4.0.0" 1863 } 1864 }, {
1865 key: "Default", 1866 get: function() { 1867 return n 1868 } 1869 }]), b); 1870 1871 function b(t, e) { 1872 this._config = this._getConfig(e), this._element = t, this._dialog = s(t).find(u)[0], this._backdrop = null, this._isShown = !1, this._isBodyOverflowing = !1, this._ignoreBackdropClick = !1, this._originalBodyPadding = 0, this._scrollbarWidth = 0 1873 } 1874 return s(document).on(r.CLICK_DATA_API, h, function(t) { 1875 var e, i = this, 1876 n = bt.getSelectorFromElement(this); 1877 n && (e = s(n)[0]); 1878 n = s(e).data(a) ? "toggle" : _({}, s(e).data(), s(this).data()); 1879 "A" !== this.tagName && "AREA" !== this.tagName || t.preventDefault(); 1880 var o = s(e).one(r.SHOW, function(t) { 1881 t.isDefaultPrevented() || o.one(r.HIDDEN, function() { 1882 s(i).is(":visible") && i.focus() 1883 }) 1884 }); 1885 v._jQueryInterface.call(s(e), n, this) 1886 }), s.fn.modal = v._jQueryInterface, s.fn.modal.Constructor = v, s.fn.modal.noConflict = function() { 1887 return s.fn.modal = i, v._jQueryInterface 1888 }, v 1889 }(e), 1890 Tt = (N = "tooltip", j = "." + (H = "bs.tooltip"), B = (M = e).fn[N], R = new RegExp("(^|\\s)bs-tooltip\\S+", "g"), q = { 1891 animation: !0, 1892 template: '<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>', 1893 trigger: "hover focus", 1894 title: "", 1895 delay: 0, 1896 html: !(F = { 1897 AUTO: "auto", 1898 TOP: "top", 1899 RIGHT: "right", 1900 BOTTOM: "bottom", 1901 LEFT: "left" 1902 }), 1903 selector: !(W = { 1904 animation: "boolean", 1905 template: "string", 1906 title: "(string|element|function)", 1907 trigger: "string", 1908 delay: "(number|object)", 1909 html: "boolean", 1910 selector: "(string|boolean)", 1911 placement: "(string|function)", 1912 offset: "(number|string)", 1913 container: "(string|element|boolean)", 1914 fallbackPlacement: "(string|array)", 1915 boundary: "(string|element)" 1916 }), 1917 placement: "top", 1918 offset: 0, 1919 container: !1, 1920 fallbackPlacement: "flip", 1921 boundary: "scrollParent" 1922 }, U = { 1923 HIDE: "hide" + j, 1924 HIDDEN: "hidden" + j, 1925 SHOW: (V = "show") + j, 1926 SHOWN: "shown" + j, 1927 INSERTED: "inserted" + j, 1928 CLICK: "click" + j, 1929 FOCUSIN: "focusin" + j, 1930 FOCUSOUT: "focusout" + j, 1931 MOUSEENTER: "mouseenter" + j, 1932 MOUSELEAVE: "mouseleave" + j 1933 }, G = "fade", Y = "show", X = "hover", K = "focus", (pt = kt.prototype).enable = function() { 1934 this._isEnabled = !0 1935 }, pt.disable = function() { 1936 this._isEnabled = !1 1937 }, pt.toggleEnabled = function() { 1938 this._isEnabled = !this._isEnabled 1939 }, pt.toggle = function(t) { 1940 var e, i; 1941 this._isEnabled && (t ? (e = this.constructor.DATA_KEY, (i = M(t.currentTarget).data(e)) || (i = new this.constructor(t.currentTarget, this._getDelegateConfig()), M(t.currentTarget).data(e, i)), i._activeTrigger.click = !i._activeTrigger.click, i._isWithActiveTrigger() ? i._enter(null, i) : i._leave(null, i)) : M(this.getTipElement()).hasClass(Y) ? this._leave(null, this) : this._enter(null, this)) 1942 }, pt.dispose = function() { 1943 clearTimeout(this._timeout), M.removeData(this.element, this.constructor.DATA_KEY), M(this.element).off(this.constructor.EVENT_KEY), M(this.element).closest(".modal").off("hide.bs.modal"), this.tip && M(this.tip).remove(), this._isEnabled = null, this._timeout = null, this._hoverState = null, (this._activeTrigger = null) !== this._popper && this._popper.destroy(), this._popper = null, this.element = null, this.config = null, this.tip = null 1944 }, pt.show = function() { 1945 var e = this; 1946 if ("none" === M(this.element).css("display")) throw new Error("Please use show on visible elements"); 1947 var t, i, n = M.Event(this.constructor.Event.SHOW); 1948 this.isWithContent() && this._isEnabled && (M(this.element).trigger(n), t = M.contains(this.element.ownerDocument.documentElement, this.element), !n.isDefaultPrevented() && t && (i = this.getTipElement(), n = bt.getUID(this.constructor.NAME), i.setAttribute("id", n), this.element.setAttribute("aria-describedby", n), this.setContent(), this.config.animation && M(i).addClass(G), t = "function" == typeof this.config.placement ? this.config.placement.call(this, i, this.element) : this.config.placement, n = this._getAttachment(t), this.addAttachmentClass(n), t = !1 === this.config.container ? document.body : M(this.config.container), M(i).data(this.constructor.DATA_KEY, this), M.contains(this.element.ownerDocument.documentElement, this.tip) || M(i).appendTo(t), M(this.element).trigger(this.constructor.Event.INSERTED), this._popper = new o(this.element, i, { 1949 placement: n, 1950 modifiers: { 1951 offset: { 1952 offset: this.config.offset 1953 }, 1954 flip: { 1955 behavior: this.config.fallbackPlacement 1956 }, 1957 arrow: { 1958 element: ".arrow" 1959 }, 1960 preventOverflow: {
1961 boundariesElement: this.config.boundary 1962 } 1963 }, 1964 onCreate: function(t) { 1965 t.originalPlacement !== t.placement && e._handlePopperPlacementChange(t) 1966 }, 1967 onUpdate: function(t) { 1968 e._handlePopperPlacementChange(t) 1969 } 1970 }), M(i).addClass(Y), "ontouchstart" in document.documentElement && M("body").children().on("mouseover", null, M.noop), i = function() { 1971 e.config.animation && e._fixTransition(); 1972 var t = e._hoverState; 1973 e._hoverState = null, M(e.element).trigger(e.constructor.Event.SHOWN), "out" === t && e._leave(null, e) 1974 }, bt.supportsTransitionEnd() && M(this.tip).hasClass(G) ? M(this.tip).one(bt.TRANSITION_END, i).emulateTransitionEnd(kt._TRANSITION_DURATION) : i())) 1975 }, pt.hide = function(t) { 1976 function e() { 1977 i._hoverState !== V && n.parentNode && n.parentNode.removeChild(n), i._cleanTipClass(), i.element.removeAttribute("aria-describedby"), M(i.element).trigger(i.constructor.Event.HIDDEN), null !== i._popper && i._popper.destroy(), t && t() 1978 } 1979 var i = this, 1980 n = this.getTipElement(), 1981 o = M.Event(this.constructor.Event.HIDE); 1982 M(this.element).trigger(o), o.isDefaultPrevented() || (M(n).removeClass(Y), "ontouchstart" in document.documentElement && M("body").children().off("mouseover", null, M.noop), this._activeTrigger.click = !1, this._activeTrigger[K] = !1, this._activeTrigger[X] = !1, bt.supportsTransitionEnd() && M(this.tip).hasClass(G) ? M(n).one(bt.TRANSITION_END, e).emulateTransitionEnd(150) : e(), this._hoverState = "") 1983 }, pt.update = function() { 1984 null !== this._popper && this._popper.scheduleUpdate() 1985 }, pt.isWithContent = function() { 1986 return Boolean(this.getTitle()) 1987 }, pt.addAttachmentClass = function(t) { 1988 M(this.getTipElement()).addClass("bs-tooltip-" + t) 1989 }, pt.getTipElement = function() { 1990 return this.tip = this.tip || M(this.config.template)[0], this.tip 1991 }, pt.setContent = function() { 1992 var t = M(this.getTipElement()); 1993 this.setElementContent(t.find(".tooltip-inner"), this.getTitle()), t.removeClass(G + " " + Y) 1994 }, pt.setElementContent = function(t, e) { 1995 var i = this.config.html; 1996 "object" == typeof e && (e.nodeType || e.jquery) ? i ? M(e).parent().is(t) || t.empty().append(e) : t.text(M(e).text()) : t[i ? "html" : "text"](e) 1997 }, pt.getTitle = function() { 1998 return this.element.getAttribute("data-original-title") || ("function" == typeof this.config.title ? this.config.title.call(this.element) : this.config.title) 1999 }, pt._getAttachment = function(t) { 2000 return F[t.toUpperCase()] 2001 }, pt._setListeners = function() { 2002 var i = this; 2003 this.config.trigger.split(" ").forEach(function(t) { 2004 var e; 2005 "click" === t ? M(i.element).on(i.constructor.Event.CLICK, i.config.selector, function(t) { 2006 return i.toggle(t) 2007 }) : "manual" !== t && (e = t === X ? i.constructor.Event.MOUSEENTER : i.constructor.Event.FOCUSIN, t = t === X ? i.constructor.Event.MOUSELEAVE : i.constructor.Event.FOCUSOUT, M(i.element).on(e, i.config.selector, function(t) { 2008 return i._enter(t) 2009 }).on(t, i.config.selector, function(t) { 2010 return i._leave(t) 2011 })), M(i.element).closest(".modal").on("hide.bs.modal", function() { 2012 return i.hide() 2013 }) 2014 }), this.config.selector ? this.config = _({}, this.config, { 2015 trigger: "manual", 2016 selector: "" 2017 }) : this._fixTitle() 2018 }, pt._fixTitle = function() { 2019 var t = typeof this.element.getAttribute("data-original-title"); 2020 !this.element.getAttribute("title") && "string" == t || (this.element.setAttribute("data-original-title", this.element.getAttribute("title") || ""), this.element.setAttribute("title", "")) 2021 }, pt._enter = function(t, e) { 2022 var i = this.constructor.DATA_KEY; 2023 (e = e || M(t.currentTarget).data(i)) || (e = new this.constructor(t.currentTarget, this._getDelegateConfig()), M(t.currentTarget).data(i, e)), t && (e._activeTrigger["focusin" === t.type ? K : X] = !0), M(e.getTipElement()).hasClass(Y) || e._hoverState === V ? e._hoverState = V : (clearTimeout(e._timeout), e._hoverState = V, e.config.delay && e.config.delay.show ? e._timeout = setTimeout(function() { 2024 e._hoverState === V && e.show() 2025 }, e.config.delay.show) : e.show()) 2026 }, pt._leave = function(t, e) { 2027 var i = this.constructor.DATA_KEY; 2028 (e = e || M(t.currentTarget).data(i)) || (e = new this.constructor(t.currentTarget, this._getDelegateConfig()), M(t.currentTarget).data(i, e)), t && (e._activeTrigger["focusout" === t.type ? K : X] = !1), e._isWithActiveTrigger() || (clearTimeout(e._timeout), e._hoverState = "out", e.config.delay && e.config.delay.hide ? e._timeout = setTimeout(function() { 2029 "out" === e._hoverState && e.hide() 2030 }, e.config.delay.hide) : e.hide()) 2031 }, pt._isWithActiveTrigger = function() { 2032 for (var t in this._activeTrigger) 2033 if (this._activeTrigger[t]) return !0; 2034 return !1 2035 }, pt._getConfig = function(t) { 2036 return "number" == typeof(t = _({}, this.constructor.Default, M(this.element).data(), t)).delay && (t.delay = { 2037 show: t.delay, 2038 hide: t.delay 2039 }), "number" == typeof t.title && (t.title = t.title.toString()), "number" == typeof t.content && (t.content = t.content.toString()), bt.typeCheckConfig(N, t, this.constructor.DefaultType), t 2040 }, pt._getDelegateConfig = function() { 2041 var t = {}; 2042 if (this.config) 2043 for (var e in this.config) this.constructor.Default[e] !== this.config[e] && (t[e] = this.config[e]); 2044 return t 2045 }, pt._cleanTipClass = function() { 2046 var t = M(this.getTipElement()), 2047 e = t.attr("class").match(R); 2048 null !== e && 0 < e.length && t.removeClass(e.join("")) 2049 }, pt._handlePopperPlacementChange = function(t) { 2050 this._cleanTipClass(), this.addAttachmentClass(this._getAttachment(t.placement)) 2051 }, pt._fixTransition = function() { 2052 var t = this.getTipElement(), 2053 e = this.config.animation; 2054 null === t.getAttribute("x-placement") && (M(t).removeClass(G), this.config.animation = !1, this.hide(), this.show(), this.config.animation = e) 2055 }, kt._jQueryInterface = function(i) { 2056 return this.each(function() { 2057 var t = M(this).data(H), 2058 e = "object" == typeof i && i; 2059 if ((t || !/dispose|hide/.test(i)) && (t || (t = new kt(this, e), M(this).data(H, t)), "string" == typeof i)) {
2060 if (void 0 === t[i]) throw new TypeError('No method named "' + i + '"'); 2061 t[i]() 2062 } 2063 }) 2064 }, x(kt, null, [{ 2065 key: "VERSION", 2066 get: function() { 2067 return "4.0.0" 2068 } 2069 }, { 2070 key: "Default", 2071 get: function() { 2072 return q 2073 } 2074 }, { 2075 key: "NAME", 2076 get: function() { 2077 return N 2078 } 2079 }, { 2080 key: "DATA_KEY", 2081 get: function() { 2082 return H 2083 } 2084 }, { 2085 key: "Event", 2086 get: function() { 2087 return U 2088 } 2089 }, { 2090 key: "EVENT_KEY", 2091 get: function() { 2092 return j 2093 } 2094 }, { 2095 key: "DefaultType", 2096 get: function() { 2097 return W 2098 } 2099 }]), Z = kt, M.fn[N] = Z._jQueryInterface, M.fn[N].Constructor = Z, M.fn[N].noConflict = function() { 2100 return M.fn[N] = B, Z._jQueryInterface 2101 }, Z), 2102 $t = (E = "popover", I = "." + (k = "bs.popover"), O = ($ = e).fn[E], z = new RegExp("(^|\\s)bs-popover\\S+", "g"), A = _({}, Tt.Default, { 2103 placement: "right", 2104 trigger: "click", 2105 content: "", 2106 template: '<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>' 2107 }), P = _({}, Tt.DefaultType, { 2108 content: "(string|element|function)" 2109 }), D = { 2110 HIDE: "hide" + I, 2111 HIDDEN: "hidden" + I, 2112 SHOW: "show" + I, 2113 SHOWN: "shown" + I, 2114 INSERTED: "inserted" + I, 2115 CLICK: "click" + I, 2116 FOCUSIN: "focusin" + I, 2117 FOCUSOUT: "focusout" + I, 2118 MOUSEENTER: "mouseenter" + I, 2119 MOUSELEAVE: "mouseleave" + I 2120 }, L = function(t) { 2121 var e; 2122 2123 function n() { 2124 return t.apply(this, arguments) || this 2125 } 2126 i = t, (e = n).prototype = Object.create(i.prototype), (e.prototype.constructor = e).__proto__ = i; 2127 var i = n.prototype; 2128 return i.isWithContent = function() { 2129 return this.getTitle() || this._getContent() 2130 }, i.addAttachmentClass = function(t) { 2131 $(this.getTipElement()).addClass("bs-popover-" + t) 2132 }, i.getTipElement = function() { 2133 return this.tip = this.tip || $(this.config.template)[0], this.tip 2134 }, i.setContent = function() { 2135 var t = $(this.getTipElement()); 2136 this.setElementContent(t.find(".popover-header"), this.getTitle()); 2137 var e = this._getContent(); 2138 "function" == typeof e && (e = e.call(this.element)), this.setElementContent(t.find(".popover-body"), e), t.removeClass("fade show") 2139 }, i._getContent = function() { 2140 return this.element.getAttribute("data-content") || this.config.content 2141 }, i._cleanTipClass = function() { 2142 var t = $(this.getTipElement()), 2143 e = t.attr("class").match(z); 2144 null !== e && 0 < e.length && t.removeClass(e.join("")) 2145 }, n._jQueryInterface = function(i) { 2146 return this.each(function() { 2147 var t = $(this).data(k), 2148 e = "object" == typeof i ? i : null; 2149 if ((t || !/destroy|hide/.test(i)) && (t || (t = new n(this, e), $(this).data(k, t)), "string" == typeof i)) { 2150 if (void 0 === t[i]) throw new TypeError('No method named "' + i + '"'); 2151 t[i]() 2152 } 2153 }) 2154 }, x(n, null, [{ 2155 key: "VERSION", 2156 get: function() { 2157 return "4.0.0" 2158 } 2159 }, { 2160 key: "Default", 2161 get: function() { 2162 return A 2163 } 2164 }, { 2165 key: "NAME", 2166 get: function() { 2167 return E 2168 } 2169 }, { 2170 key: "DATA_KEY", 2171 get: function() { 2172 return k 2173 } 2174 }, { 2175 key: "Event", 2176 get: function() { 2177 return D 2178 } 2179 }, { 2180 key: "EVENT_KEY", 2181 get: function() { 2182 return I 2183 } 2184 }, { 2185 key: "DefaultType", 2186 get: function() { 2187 return P 2188 } 2189 }]), n 2190 }(Tt), $.fn[E] = L._jQueryInterface, $.fn[E].Constructor = L, $.fn[E].noConflict = function() { 2191 return $.fn[E] = O, L._jQueryInterface 2192 }, L), 2193 ft = function(s) { 2194 var t, i = "scrollspy", 2195 n = "bs.scrollspy", 2196 e = "." + n, 2197 o = s.fn[i], 2198 a = { 2199 offset: 10, 2200 method: "auto", 2201 target: "" 2202 }, 2203 r = { 2204 offset: "number", 2205 method: "string", 2206 target: "(string|element)" 2207 }, 2208 l = { 2209 ACTIVATE: "activate" + e, 2210 SCROLL: "scroll" + e, 2211 LOAD_DATA_API: "load" + e + ".data-api" 2212 }, 2213 c = "active", 2214 d = '[data-spy="scroll"]', 2215 u = ".active", 2216 h = ".nav, .list-group", 2217 p = ".nav-link", 2218 f = ".nav-item", 2219 m = ".list-group-item", 2220 g = ".dropdown", 2221 v = ".dropdown-item", 2222 b = ".dropdown-toggle", 2223 y = "position", 2224 w = ((t = C.prototype).refresh = function() { 2225 var e = this, 2226 t = this._scrollElement === this._scrollElement.window ? "offset" : y, 2227 n = "auto" === this._config.method ? t : this._config.method, 2228 o = n === y ? this._getScrollTop() : 0; 2229 this._offsets = [], this._targets = [], this._scrollHeight = this._getScrollHeight(), s.makeArray(s(this._selector)).map(function(t) { 2230 var e, i = bt.getSelectorFromElement(t); 2231 if (e = i ? s(i)[0] : e) { 2232 t = e.getBoundingClientRect(); 2233 if (t.width || t.height) return [s(e)[n]().top + o, i] 2234 } 2235 return null 2236 }).filter(function(t) { 2237 return t 2238 }).sort(function(t, e) { 2239 return t[0] - e[0] 2240 }
2240).forEach(function(t) { 2241 e._offsets.push(t[0]), e._targets.push(t[1]) 2242 }) 2243 }, t.dispose = function() { 2244 s.removeData(this._element, n), s(this._scrollElement).off(e), this._element = null, this._scrollElement = null, this._config = null, this._selector = null, this._offsets = null, this._targets = null, this._activeTarget = null, this._scrollHeight = null 2245 }, t._getConfig = function(t) { 2246 var e; 2247 return "string" != typeof(t = _({}, a, t)).target && ((e = s(t.target).attr("id")) || (e = bt.getUID(i), s(t.target).attr("id", e)), t.target = "#" + e), bt.typeCheckConfig(i, t, r), t 2248 }, t._getScrollTop = function() { 2249 return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop 2250 }, t._getScrollHeight = function() { 2251 return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight) 2252 }, t._getOffsetHeight = function() { 2253 return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height 2254 }, t._process = function() { 2255 var t = this._getScrollTop() + this._config.offset, 2256 e = this._getScrollHeight(), 2257 i = this._config.offset + e - this._getOffsetHeight(); 2258 if (this._scrollHeight !== e && this.refresh(), i <= t) { 2259 i = this._targets[this._targets.length - 1]; 2260 this._activeTarget !== i && this._activate(i) 2261 } else { 2262 if (this._activeTarget && t < this._offsets[0] && 0 < this._offsets[0]) return this._activeTarget = null, void this._clear(); 2263 for (var n = this._offsets.length; n--;) this._activeTarget !== this._targets[n] && t >= this._offsets[n] && (void 0 === this._offsets[n + 1] || t < this._offsets[n + 1]) && this._activate(this._targets[n]) 2264 } 2265 }, t._activate = function(e) { 2266 this._activeTarget = e, this._clear(); 2267 var t = (t = this._selector.split(",")).map(function(t) { 2268 return t + '[data-target="' + e + '"],' + t + '[href="' + e + '"]' 2269 }), 2270 t = s(t.join(",")); 2271 t.hasClass("dropdown-item") ? (t.closest(g).find(b).addClass(c), t.addClass(c)) : (t.addClass(c), t.parents(h).prev(p + ", " + m).addClass(c), t.parents(h).prev(f).children(p).addClass(c)), s(this._scrollElement).trigger(l.ACTIVATE, { 2272 relatedTarget: e 2273 }) 2274 }, t._clear = function() { 2275 s(this._selector).filter(u).removeClass(c) 2276 }, C._jQueryInterface = function(e) { 2277 return this.each(function() { 2278 var t = s(this).data(n); 2279 if (t || (t = new C(this, "object" == typeof e && e), s(this).data(n, t)), "string" == typeof e) { 2280 if (void 0 === t[e]) throw new TypeError('No method named "' + e + '"'); 2281 t[e]() 2282 } 2283 }) 2284 }, x(C, null, [{ 2285 key: "VERSION", 2286 get: function() { 2287 return "4.0.0" 2288 } 2289 }, {
2290 key: "Default", 2291 get: function() { 2292 return a 2293 } 2294 }]), C); 2295 2296 function C(t, e) { 2297 var i = this; 2298 this._element = t, this._scrollElement = "BODY" === t.tagName ? window : t, this._config = this._getConfig(e), this._selector = this._config.target + " " + p + "," + this._config.target + " " + m + "," + this._config.target + " " + v, this._offsets = [], this._targets = [], this._activeTarget = null, this._scrollHeight = 0, s(this._scrollElement).on(l.SCROLL, function(t) { 2299 return i._process(t) 2300 }), this.refresh(), this._process() 2301 } 2302 return s(window).on(l.LOAD_DATA_API, function() { 2303 for (var t = s.makeArray(s(d)), e = t.length; e--;) { 2304 var i = s(t[e]); 2305 w._jQueryInterface.call(i, i.data()) 2306 } 2307 }), s.fn[i] = w._jQueryInterface, s.fn[i].Constructor = w, s.fn[i].noConflict = function() { 2308 return s.fn[i] = o, w._jQueryInterface 2309 }, w 2310 }(e), 2311 pt = (pt = "." + (v = "bs.tab"), b = (g = e).fn.tab, y = { 2312 HIDE: "hide" + pt, 2313 HIDDEN: "hidden" + pt, 2314 SHOW: "show" + pt, 2315 SHOWN: "shown" + pt, 2316 CLICK_DATA_API: "click.bs.tab.data-api" 2317 }, w = "active", C = ".active", S = "> li > .active", (pt = Et.prototype).show = function() { 2318 var t, e, i, n, o, s, a = this; 2319 this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && g(this._element).hasClass(w) || g(this._element).hasClass("disabled") || (s = g(this._element).closest(".nav, .list-group")[0], e = bt.getSelectorFromElement(this._element), s && (o = "UL" === s.nodeName ? S : C, i = (i = g.makeArray(g(s).find(o)))[i.length - 1]), n = g.Event(y.HIDE, { 2320 relatedTarget: this._element 2321 }), o = g.Event(y.SHOW, { 2322 relatedTarget: i 2323 }), i && g(i).trigger(n), g(this._element).trigger(o), o.isDefaultPrevented() || n.isDefaultPrevented() || (e && (t = g(e)[0]), this._activate(this._element, s), s = function() { 2324 var t = g.Event(y.HIDDEN, { 2325 relatedTarget: a._element 2326 }), 2327 e = g.Event(y.SHOWN, { 2328 relatedTarget: i 2329 }); 2330 g(i).trigger(t), g(a._element).trigger(e) 2331 }, t ? this._activate(t, t.parentNode, s) : s())) 2332 }, pt.dispose = function() { 2333 g.removeData(this._element, v), this._element = null 2334 }, pt._activate = function(t, e, i) { 2335 var n = this, 2336 o = ("UL" === e.nodeName ? g(e).find(S) : g(e).children(C))[0], 2337 s = i && bt.supportsTransitionEnd() && o && g(o).hasClass("fade"), 2338 e = function() { 2339 return n._transitionComplete(t, o, i) 2340 }; 2341 o && s ? g(o).one(bt.TRANSITION_END, e).emulateTransitionEnd(150) : e() 2342 }, pt._transitionComplete = function(t, e, i) { 2343 var n; 2344 e && (g(e).removeClass("show " + w), (n = g(e.parentNode).find("> .dropdown-menu .active")[0]) && g(n).removeClass(w), "tab" === e.getAttribute("role") && e.setAttribute("aria-selected", !1)), g(t).addClass(w), "tab" === t.getAttribute("role") && t.setAttribute("aria-selected", !0), bt.reflow(t), g(t).addClass("show"), t.parentNode && g(t.parentNode).hasClass("dropdown-menu") && ((e = g(t).closest(".dropdown")[0]) && g(e).find(".dropdown-toggle").addClass(w), t.setAttribute("aria-expanded", !0)), i && i() 2345 }, Et._jQueryInterface = function(i) { 2346 return this.each(function() { 2347 var t = g(this), 2348 e = t.data(v); 2349 if (e || (e = new Et(this), t.data(v, e)), "string" == typeof i) { 2350 if (void 0 === e[i]) throw new TypeError('No method named "' + i + '"'); 2351 e[i]() 2352 } 2353 }) 2354 }, x(Et, null, [{ 2355 key: "VERSION", 2356 get: function() { 2357 return "4.0.0" 2358 } 2359 }]), T = Et, g(document).on(y.CLICK_DATA_API, '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]', function(t) { 2360 t.preventDefault(), T._jQueryInterface.call(g(this), "show") 2361 }), g.fn.tab = T._jQueryInterface, g.fn.tab.Constructor = T, g.fn.tab.noConflict = function() { 2362 return g.fn.tab = b, T._jQueryInterface 2363 }, T); 2364 2365 function Et(t) { 2366 this._element = t 2367 } 2368 2369 function kt(t, e) { 2370 if (void 0 === o) throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)"); 2371 this._isEnabled = !0, this._timeout = 0, this._hoverState = "", this._activeTrigger = {}, this._popper = null, this.element = t, this.config = this._getConfig(e), this.tip = null, this._setListeners() 2372 } 2373 2374 function It(t, e) { 2375 this._element = t, this._popper = null, this._config = this._getConfig(e), this._menu = this._getMenuElement(), this._inNavbar = this._detectNavbar(), this._addEventListeners() 2376 } 2377 2378 function Ot(t) { 2379 this._element = t 2380 } 2381 2382 function zt(t) { 2383 this._element = t 2384 }! function(t) { 2385 if (void 0 === t) throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript."); 2386 t = t.fn.jquery.split(" ")[0].split("."); 2387 if (t[0] < 2 && t[1] < 9 || 1 === t[0] && 9 === t[1] && t[2] < 1 || 4 <= t[0]) throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0") 2388 }(e), t.Util = bt, t.Alert = yt, t.Button = wt, t.Carousel = Ct, t.Collapse = xt, t.Dropdown = _t, t.Modal = St, t.Popover = $t, t.Scrollspy = ft, t.Tab = pt, t.Tooltip = Tt, Object.defineProperty(t, "__esModule", { 2389 value: !0 2390 }) 2391 }), 2392 function(t, e) { 2393 "object" == typeof exports && "undefined" != typeof module ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : (t = t || self).Swiper = e() 2394 }(this, function() { 2395 "use strict"; 2396 2397 function t(t, e) { 2398 for (var i = 0; i < e.length; i++) { 2399 var n = e[i]; 2400 n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n) 2401 } 2402 } 2403 2404 function e() { 2405 return (e = Object.assign || function(t) { 2406 for (var e = 1; e < arguments.length; e++) { 2407 var i, n = arguments[e]; 2408 for (i in n) Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]) 2409 } 2410 return t 2411 }).apply(this, arguments) 2412 } 2413 2414 function n(t) { 2415 return null !== t && "object" == typeof t && "constructor" in t && t.constructor === Object 2416 } 2417 2418 function o(e, i) { 2419 void 0 === e && (e = {}), void 0 === i && (i = {}
2419), Object.keys(i).forEach(function(t) { 2420 void 0 === e[t] ? e[t] = i[t] : n(i[t]) && n(e[t]) && 0 < Object.keys(i[t]).length && o(e[t], i[t]) 2421 }) 2422 } 2423 var i = { 2424 body: {}, 2425 addEventListener: function() {}, 2426 removeEventListener: function() {}, 2427 activeElement: { 2428 blur: function() {}, 2429 nodeName: "" 2430 }, 2431 querySelector: function() { 2432 return null 2433 }, 2434 querySelectorAll: function() { 2435 return [] 2436 }, 2437 getElementById: function() { 2438 return null 2439 }, 2440 createEvent: function() { 2441 return { 2442 initEvent: function() {} 2443 } 2444 }, 2445 createElement: function() { 2446 return { 2447 children: [], 2448 childNodes: [], 2449 style: {}, 2450 setAttribute: function() {}, 2451 getElementsByTagName: function() { 2452 return [] 2453 } 2454 } 2455 }, 2456 createElementNS: function() { 2457 return {} 2458 }, 2459 importNode: function() { 2460 return null 2461 }, 2462 location: { 2463 hash: "", 2464 host: "", 2465 hostname: "", 2466 href: "", 2467 origin: "", 2468 pathname: "", 2469 protocol: "", 2470 search: "" 2471 } 2472 }; 2473 2474 function v() { 2475 var t = "undefined" != typeof document ? document : {}; 2476 return o(t, i), t 2477 } 2478 var s = { 2479 document: i, 2480 navigator: { 2481 userAgent: "" 2482 }, 2483 location: { 2484 hash: "", 2485 host: "", 2486 hostname: "", 2487 href: "", 2488 origin: "", 2489 pathname: "", 2490 protocol: "", 2491 search: "" 2492 }, 2493 history: { 2494 replaceState: function() {}, 2495 pushState: function() {}, 2496 go: function() {}, 2497 back: function() {} 2498 }, 2499 CustomEvent: function() { 2500 return this 2501 }, 2502 addEventListener: function() {}, 2503 removeEventListener: function() {}, 2504 getComputedStyle: function() { 2505 return { 2506 getPropertyValue: function() { 2507 return "" 2508 } 2509 } 2510 }, 2511 Image: function() {}, 2512 Date: function() {}, 2513 screen: {}, 2514 setTimeout: function() {}, 2515 clearTimeout: function() {}, 2516 matchMedia: function() { 2517 return {} 2518 }, 2519 requestAnimationFrame: function(t) { 2520 return "undefined" == typeof setTimeout ? (t(), null) : setTimeout(t, 0) 2521 }, 2522 cancelAnimationFrame: function(t) { 2523 "undefined" != typeof setTimeout && clearTimeout(t) 2524 } 2525 }; 2526 2527 function Y() { 2528 var t = "undefined" != typeof window ? window : {}; 2529 return o(t, s), t 2530 } 2531 2532 function a(t) { 2533 return (a = Object.setPrototypeOf ? Object.getPrototypeOf : function(t) { 2534 return t.__proto__ || Object.getPrototypeOf(t) 2535 })(t) 2536 } 2537 2538 function r(t, e) { 2539 return (r = Object.setPrototypeOf || function(t, e) { 2540 return t.__proto__ = e, t 2541 })(t, e) 2542 } 2543 2544 function l(t, e, i) { 2545 return (l = function() { 2546 if ("undefined" != typeof Reflect && Reflect.construct && !Reflect.construct.sham) { 2547 if ("function" == typeof Proxy) return 1; 2548 try { 2549 return Date.prototype.toString.call(Reflect.construct(Date, [], function() {})), 1 2550 } catch (t) { 2551 return 2552 } 2553 } 2554 }() ? Reflect.construct : function(t, e, i) { 2555 var n = [null]; 2556 n.push.apply(n, e); 2557 n = new(Function.bind.apply(t, n)); 2558 return i && r(n, i.prototype), n 2559 }).apply(null, arguments) 2560 } 2561 2562 function c(t) { 2563 var i = "function" == typeof Map ? new Map : void 0; 2564 return function(t) { 2565 if (null === t || -1 === Function.toString.call(t).indexOf("[native code]")) return t; 2566 if ("function" != typeof t) throw new TypeError("Super expression must either be null or a function"); 2567 if (void 0 !== i) { 2568 if (i.has(t)) return i.get(t); 2569 i.set(t, e) 2570 } 2571 2572 function e() { 2573 return l(t, arguments, a(this).constructor) 2574 } 2575 return e.prototype = Object.create(t.prototype, { 2576 constructor: { 2577 value: e, 2578 enumerable: !1, 2579 writable: !0, 2580 configurable: !0 2581 } 2582 }), r(e, t) 2583 }(t) 2584 } 2585 var d, u = (d = c(Array), P = d, (D = h).prototype = Object.create(P.prototype), (D.prototype.constructor = D).__proto__ = P, h); 2586 2587 function h(t) { 2588 var e = d.call.apply(d, [this].concat(t)) || this, 2589 t = function(t) { 2590 if (void 0 === t) throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); 2591 return t 2592 }(e), 2593 i = t.__proto__; 2594 return Object.defineProperty(t, "__proto__", { 2595 get: function() { 2596 return i 2597 }, 2598 set: function(t) { 2599 i.__proto__ = t 2600 } 2601 }), e 2602 } 2603 2604 function p(t) { 2605 var e = []; 2606 return (t = void 0 === t ? [] : t).forEach(function(t) { 2607 Array.isArray(t) ? e.push.apply(e, p(t)) : e.push(t) 2608 }), e 2609 } 2610 2611 function f(t, e) { 2612 return Array.prototype.filter.call(t, e) 2613 } 2614 2615 function _(t, o) { 2616 var e = Y(), 2617 s = v(), 2618 i = []; 2619 if (!o && t instanceof u) return t; 2620 if (!t) return new u(i); 2621 if ("string" == typeof t) { 2622 var n = t.trim(); 2623 if (0 <= n.indexOf("<") && 0 <= n.indexOf(">")) { 2624 var a = "div"; 2625 0 === n.indexOf("<li") && (a = "ul"), 0 === n.indexOf("<tr") && (a = "tbody"), 0 !== n.indexOf("<td") && 0 !== n.indexOf("<th") || (a = "tr"), 0 === n.indexOf("<tbody") && (a = "table"), 0 === n.indexOf("<option") && (a = "select"); 2626 var r = s.createElement(a); 2627 r.innerHTML = n; 2628 for (var l = 0; l < r.childNodes.length; l += 1) i.push(r.childNodes[l]) 2629 } else i = function(t) { 2630 if ("string" != typeof t) return [t]; 2631 for (var e = [], i = (o || s).querySelectorAll(t), n = 0; n < i.length; n += 1) e.push(i[n]); 2632 return e 2633 }(t.trim()) 2634 } else if (t.nodeType || t === e || t === s) i.push(t); 2635 else if (Array.isArray(t)) { 2636 if (t instanceof u) return t; 2637 i = t 2638 } 2639 return new u(function(t) { 2640 for (var e = [], i = 0; i < t.length; i += 1) - 1 === e.indexOf(t[i]) && e.push(t[i]); 2641 return e 2642 }(i)) 2643 } 2644 _.fn = u.prototype; 2645 var m, C, x, g = { 2646 addClass: function() { 2647 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2648 var n = p(e.map(function(t) { 2649 return t.split(" ") 2650 })); 2651 return this.forEach(function(t) { 2652 (t = t.classList).add.apply(t, n) 2653 }), this 2654 }, 2655 removeClass: function() { 2656 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2657 var n = p(e.map(function(t) { 2658 return t.split(" ") 2659 })); 2660 return this.forEach(function(t) { 2661 (t = t.classList).remove.apply(t, n) 2662 }), this 2663 }, 2664 hasClass: function() { 2665 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2666 var n = p(e.map(function(t) { 2667 return t.split(" ") 2668 })); 2669 return 0 < f(this, function(e) { 2670 return 0 < n.filter(function(t) { 2671 return e.classList.contains(t) 2672 }).length 2673 }).length 2674 }, 2675 toggleClass: function() { 2676 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2677 var n = p(e.map(function(t) { 2678 return t.split(" ") 2679 })); 2680 this.forEach(function(e) {
2681 n.forEach(function(t) { 2682 e.classList.toggle(t) 2683 }) 2684 }) 2685 }, 2686 attr: function(t, e) { 2687 if (1 === arguments.length && "string" == typeof t) return this[0] ? this[0].getAttribute(t) : void 0; 2688 for (var i = 0; i < this.length; i += 1) 2689 if (2 === arguments.length) this[i].setAttribute(t, e); 2690 else 2691 for (var n in t) this[i][n] = t[n], this[i].setAttribute(n, t[n]); 2692 return this 2693 }, 2694 removeAttr: function(t) { 2695 for (var e = 0; e < this.length; e += 1) this[e].removeAttribute(t); 2696 return this 2697 }, 2698 transform: function(t) { 2699 for (var e = 0; e < this.length; e += 1) this[e].style.transform = t; 2700 return this 2701 }, 2702 transition: function(t) { 2703 for (var e = 0; e < this.length; e += 1) this[e].style.transition = "string" != typeof t ? t + "ms" : t; 2704 return this 2705 }, 2706 on: function() { 2707 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2708 var n = e[0], 2709 s = e[1], 2710 a = e[2], 2711 o = e[3]; 2712 2713 function r(t) { 2714 var e = t.target; 2715 if (e) { 2716 var i = t.target.dom7EventData || []; 2717 if (i.indexOf(t) < 0 && i.unshift(t), _(e).is(s)) a.apply(e, i); 2718 else 2719 for (var n = _(e).parents(), o = 0; o < n.length; o += 1) _(n[o]).is(s) && a.apply(n[o], i) 2720 } 2721 } 2722 2723 function l(t) { 2724 var e = t && t.target && t.target.dom7EventData || []; 2725 e.indexOf(t) < 0 && e.unshift(t), a.apply(this, e) 2726 } 2727 "function" == typeof e[1] && (n = e[0], a = e[1], o = e[2], s = void 0); 2728 for (var c, o = o || !1, d = n.split(" "), u = 0; u < this.length; u += 1) { 2729 var h = this[u]; 2730 if (s) 2731 for (c = 0; c < d.length; c += 1) { 2732 var p = d[c]; 2733 h.dom7LiveListeners || (h.dom7LiveListeners = {}), h.dom7LiveListeners[p] || (h.dom7LiveListeners[p] = []), h.dom7LiveListeners[p].push({ 2734 listener: a, 2735 proxyListener: r 2736 }), h.addEventListener(p, r, o) 2737 } else 2738 for (c = 0; c < d.length; c += 1) { 2739 var f = d[c]; 2740 h.dom7Listeners || (h.dom7Listeners = {}), h.dom7Listeners[f] || (h.dom7Listeners[f] = []), h.dom7Listeners[f].push({ 2741 listener: a, 2742 proxyListener: l 2743 }), h.addEventListener(f, l, o) 2744 } 2745 } 2746 return this 2747 }, 2748 off: function() { 2749 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 2750 var n = e[0], 2751 o = e[1], 2752 s = e[2], 2753 a = e[3]; 2754 "function" == typeof e[1] && (n = e[0], s = e[1], a = e[2], o = void 0); 2755 for (var a = a || !1, r = n.split(" "), l = 0; l < r.length; l += 1) 2756 for (var c = r[l], d = 0; d < this.length; d += 1) { 2757 var u = this[d], 2758 h = void 0; 2759 if (!o && u.dom7Listeners ? h = u.dom7Listeners[c] : o && u.dom7LiveListeners && (h = u.dom7LiveListeners[c]), h && h.length) 2760 for (var p = h.length - 1; 0 <= p; --p) { 2761 var f = h[p]; 2762 !(s && f.listener === s || s && f.listener && f.listener.dom7proxy && f.listener.dom7proxy === s) && s || (u.removeEventListener(c, f.proxyListener, a), h.splice(p, 1)) 2763 } 2764 } 2765 return this 2766 }, 2767 trigger: function() { 2768 for (var t = Y(), e = arguments.length, i = new Array(e), n = 0; n < e; n++) i[n] = arguments[n]; 2769 for (var o = i[0].split(" "), s = i[1], a = 0; a < o.length; a += 1) 2770 for (var r = o[a], l = 0; l < this.length; l += 1) { 2771 var c, d = this[l]; 2772 t.CustomEvent && (c = new t.CustomEvent(r, { 2773 detail: s, 2774 bubbles: !0, 2775 cancelable: !0 2776 }), d.dom7EventData = i.filter(function(t, e) { 2777 return 0 < e 2778 }), d.dispatchEvent(c), d.dom7EventData = [], delete d.dom7EventData) 2779 } 2780 return this 2781 }, 2782 transitionEnd: function(i) { 2783 var n = this; 2784 return i && n.on("transitionend", function t(e) { 2785 e.target === this && (i.call(this, e), n.off("transitionend", t)) 2786 }), this 2787 }, 2788 outerWidth: function(t) { 2789 if (0 < this.length) { 2790 if (t) { 2791 t = this.styles(); 2792 return this[0].offsetWidth + parseFloat(t.getPropertyValue("margin-right")) + parseFloat(t.getPropertyValue("margin-left")) 2793 } 2794 return this[0].offsetWidth 2795 } 2796 return null 2797 }, 2798 outerHeight: function(t) { 2799 if (0 < this.length) { 2800 if (t) { 2801 t = this.styles(); 2802 return this[0].offsetHeight + parseFloat(t.getPropertyValue("margin-top")) + parseFloat(t.getPropertyValue("margin-bottom")) 2803 } 2804 return this[0].offsetHeight 2805 } 2806 return null 2807 }, 2808 styles: function() { 2809 var t = Y(); 2810 return this[0] ? t.getComputedStyle(this[0], null) : {} 2811 }, 2812 offset: function() { 2813 if (0 < this.length) { 2814 var t = Y(), 2815 e = v(), 2816 i = this[0], 2817 n = i.getBoundingClientRect(), 2818 o = e.body, 2819 s = i.clientTop || o.clientTop || 0, 2820 e = i.clientLeft || o.clientLeft || 0, 2821 o = i === t ? t.scrollY : i.scrollTop, 2822 i = i === t ? t.scrollX : i.scrollLeft; 2823 return { 2824 top: n.top + o - s, 2825 left: n.left + i - e 2826 } 2827 } 2828 return null 2829 }, 2830 css: function(t, e) { 2831 var i, n = Y(); 2832 if (1 === arguments.length) { 2833 if ("string" != typeof t) { 2834 for (i = 0; i < this.length; i += 1) 2835 for (var o in t) this[i].style[o] = t[o]; 2836 return this 2837 } 2838 if (this[0]) return n.getComputedStyle(this[0], null).getPropertyValue(t) 2839 } 2840 if (2 !== arguments.length || "string" != typeof t) return this; 2841 for (i = 0; i < this.length; i += 1) this[i].style[t] = e; 2842 return this 2843 }, 2844 each: function(i) { 2845 return i && this.forEach(function(t, e) { 2846 i.apply(t, [t, e]) 2847 }), this 2848 }, 2849 html: function(t) { 2850 if (void 0 === t) return this[0] ? this[0].innerHTML : null; 2851 for (var e = 0; e < this.length; e += 1) this[e].innerHTML = t; 2852 return this 2853 }, 2854 text: function(t) { 2855 if (void 0 === t) return this[0] ? this[0].textContent.trim() : null; 2856 for (var e = 0; e < this.length; e += 1) this[e].textContent = t; 2857 return this 2858 }, 2859 is: function(t) { 2860 var e, i, n = Y(), 2861 o = v(), 2862 s = this[0]; 2863 if (!s || void 0 === t) return !1; 2864 if ("string" == typeof t) { 2865 if (s.matches) return s.matches(t); 2866 if (s.webkitMatchesSelector) return s.webkitMatchesSelector(t); 2867 if (s.msMatchesSelector) return s.msMatchesSelector(t); 2868 for (e = _(t), i = 0; i < e.length; i += 1) 2869 if (e[i] === s) return !0; 2870 return !1 2871 } 2872 if (t === o) return s === o; 2873 if (t === n) return s === n; 2874 if (t.nodeType || t instanceof u) { 2875 for (e = t.nodeType ? [t] : t, i = 0; i < e.length; i += 1) 2876 if (e[i] === s) return !0; 2877 return !1 2878 } 2879 return !1 2880 }, 2881 index: function() { 2882 var t, e = this[0]; 2883 if (e) { 2884 for (t = 0; null !== (e = e.previousSibling);) 1 === e.nodeType && (t += 1); 2885 return t 2886 } 2887 }, 2888 eq: function(t) { 2889 if (void 0 === t) return this; 2890 var e = this.length; 2891 if (e - 1 < t) return _([]); 2892 if (t < 0) { 2893 e = e + t; 2894 return _(e < 0 ? [] : [this[e]]) 2895 } 2896 return _([this[t]]) 2897 }, 2898 append: function() { 2899 for (var t = v(), e = 0; e < arguments.length; e += 1) 2900 for (var i = e < 0 || arguments.length <= e ? void 0 : arguments[e], n = 0; n < this.length; n += 1) 2901 if ("string" == typeof i) { 2902 var o = t.createElement("div"); 2903 for (o.innerHTML = i; o.firstChild;) this[n].appendChild(o.firstChild) 2904 } else if (i instanceof u) 2905 for (var s = 0; s < i.length; s += 1) this[n].appendChild(i[s]); 2906 else this[n].appendChild(i); 2907 return this 2908 }, 2909 prepend: function(t) { 2910 for (var e, i = v(), n = 0; n < this.length; n += 1) 2911 if ("string" == typeof t) { 2912 var o = i.createElement("div"); 2913 for (o.innerHTML = t, e = o.childNodes.length - 1; 0 <= e; --e) this[n].insertBefore(o.childNodes[e], this[n].childNodes[0]) 2914 } else if (t instanceof u) 2915 for (e = 0; e < t.length; e += 1) this[n].insertBefore(t[e], this[n].childNodes[0]); 2916 else this[n].insertBefore(t, this[n].childNodes[0]); 2917 return this 2918 }, 2919 next: function(t) { 2920 return 0 < this.length ? t ? this[0].nextElementSibling && _(this[0].nextElementSibling).is(t) ? _([this[0].nextElementSibling]) : _([]) : this[0].nextElementSibling ? _([this[0].nextElementSibling]) : _([]) : _([]) 2921 }, 2922 nextAll: function(t) { 2923 var e = [], 2924 i = this[0]; 2925 if (!i) return _([]); 2926 for (; i.nextElementSibling;) { 2927 var n = i.nextElementSibling; 2928 t && !_(n).is(t) || e.push(n), i = n 2929 } 2930 return _(e) 2931 }, 2932 prev: function(t) { 2933 if (0 < this.length) { 2934 var e = this[0]; 2935 return t ? e.previousElementSibling && _(e.previousElementSibling).is(t) ? _([e.previousElementSibling]) : _([]) : e.previousElementSibling ? _([e.previousElementSibling]) : _([]) 2936 } 2937 return _([]) 2938 }, 2939 prevAll: function(t) { 2940 var e = [], 2941 i = this[0]; 2942 if (!i) return _([]); 2943 for (; i.previousElementSibling;) { 2944 var n = i.previousElementSibling; 2945 t && !_(n).is(t) || e.push(n), i = n 2946 } 2947 return _(e) 2948 }, 2949 parent: function(t) { 2950 for (var e = [], i = 0; i < this.length; i += 1) null === this[i].parentNode || t && !_(this[i].parentNode).is(t) || e.push(this[i].parentNode); 2951 return _(e) 2952 }, 2953 parents: function(t) { 2954 for (var e = [], i = 0; i < this.length; i += 1) 2955 for (var n = this[i].parentNode; n;) t && !_(n).is(t) || e.push(n), n = n.parentNode; 2956 return _(e) 2957 }, 2958 closest: function(t) { 2959 var e = this; 2960 return void 0 === t ? _([]) : e = !e.is(t) ? e.parents(t).eq(0) : e
2961 }, 2962 find: function(t) { 2963 for (var e = [], i = 0; i < this.length; i += 1) 2964 for (var n = this[i].querySelectorAll(t), o = 0; o < n.length; o += 1) e.push(n[o]); 2965 return _(e) 2966 }, 2967 children: function(t) { 2968 for (var e = [], i = 0; i < this.length; i += 1) 2969 for (var n = this[i].children, o = 0; o < n.length; o += 1) t && !_(n[o]).is(t) || e.push(n[o]); 2970 return _(e) 2971 }, 2972 filter: function(t) { 2973 return _(f(this, t)) 2974 }, 2975 remove: function() { 2976 for (var t = 0; t < this.length; t += 1) this[t].parentNode && this[t].parentNode.removeChild(this[t]); 2977 return this 2978 } 2979 }; 2980 2981 function S(t, e) { 2982 return void 0 === e && (e = 0), setTimeout(t, e) 2983 } 2984 2985 function T() { 2986 return Date.now() 2987 } 2988 2989 function b(t, e) { 2990 void 0 === e && (e = "x"); 2991 var i, n, o, s = Y(), 2992 t = s.getComputedStyle(t, null); 2993 return s.WebKitCSSMatrix ? (6 < (n = t.transform || t.webkitTransform).split(",").length && (n = n.split(", ").map(function(t) { 2994 return t.replace(",", ".") 2995 }).join(", ")), o = new s.WebKitCSSMatrix("none" === n ? "" : n)) : i = (o = t.MozTransform || t.OTransform || t.MsTransform || t.msTransform || t.transform || t.getPropertyValue("transform").replace("translate(", "matrix(1, 0, 0, 1,")).toString().split(","), "x" === e && (n = s.WebKitCSSMatrix ? o.m41 : 16 === i.length ? parseFloat(i[12]) : parseFloat(i[4])), (n = "y" === e ? s.WebKitCSSMatrix ? o.m42 : 16 === i.length ? parseFloat(i[13]) : parseFloat(i[5]) : n) || 0 2996 } 2997 2998 function y(t) { 2999 return "object" == typeof t && null !== t && t.constructor && t.constructor === Object 3000 } 3001 3002 function X(t) { 3003 for (var e = Object(arguments.length <= 0 ? void 0 : t), i = 1; i < arguments.length; i += 1) { 3004 var n = i < 0 || arguments.length <= i ? void 0 : arguments[i]; 3005 if (null != n) 3006 for (var o = Object.keys(Object(n)), s = 0, a = o.length; s < a; s += 1) { 3007 var r = o[s], 3008 l = Object.getOwnPropertyDescriptor(n, r); 3009 void 0 !== l && l.enumerable && (y(e[r]) && y(n[r]) ? X(e[r], n[r]) : !y(e[r]) && y(n[r]) ? (e[r] = {}, X(e[r], n[r])) : e[r] = n[r]) 3010 } 3011 } 3012 return e 3013 } 3014 3015 function w(i, n) { 3016 Object.keys(n).forEach(function(e) { 3017 y(n[e]) && Object.keys(n[e]).forEach(function(t) { 3018 "function" == typeof n[e][t] && (n[e][t] = n[e][t].bind(i)) 3019 }), i[e] = n[e] 3020 }) 3021 } 3022 3023 function $() { 3024 return m || (i = Y(), t = v(), m = { 3025 touch: !!("ontouchstart" in i || i.DocumentTouch && t instanceof i.DocumentTouch), 3026 pointerEvents: !!i.PointerEvent && "maxTouchPoints" in i.navigator && 0 <= i.navigator.maxTouchPoints, 3027 observer: "MutationObserver" in i || "WebkitMutationObserver" in i, 3028 passiveListener: function() { 3029 var t = !1; 3030 try { 3031 var e = Object.defineProperty({}, "passive", { 3032 get: function() { 3033 t = !0 3034 } 3035 }); 3036 i.addEventListener("testPassiveListener", null, e) 3037 } catch (t) {} 3038 return t 3039 }(), 3040 gestures: "ongesturestart" in i 3041 }), m; 3042 var i, t 3043 } 3044 Object.keys(g).forEach(function(t) { 3045 _.fn[t] = g[t] 3046 }); 3047 var E = { 3048 name: "resize", 3049 create: function() { 3050 var t = this; 3051 X(t, { 3052 resize: { 3053 resizeHandler: function() { 3054 t && !t.destroyed && t.initialized && (t.emit("beforeResize"), t.emit("resize")) 3055 }, 3056 orientationChangeHandler: function() { 3057 t && !t.destroyed && t.initialized && t.emit("orientationchange") 3058 } 3059 } 3060 }) 3061 }, 3062 on: { 3063 init: function(t) { 3064 var e = Y(); 3065 e.addEventListener("resize", t.resize.resizeHandler), e.addEventListener("orientationchange", t.resize.orientationChangeHandler) 3066 }, 3067 destroy: function(t) { 3068 var e = Y(); 3069 e.removeEventListener("resize", t.resize.resizeHandler), e.removeEventListener("orientationchange", t.resize.orientationChangeHandler) 3070 } 3071 } 3072 }, 3073 k = { 3074 attach: function(t, e) { 3075 void 0 === e && (e = {}); 3076 var i = Y(), 3077 n = this, 3078 o = new(i.MutationObserver || i.WebkitMutationObserver)(function(t) { 3079 var e; 3080 1 !== t.length ? (e = function() { 3081 n.emit("observerUpdate", t[0]) 3082 }, i.requestAnimationFrame ? i.requestAnimationFrame(e) : i.setTimeout(e, 0)) : n.emit("observerUpdate", t[0]) 3083 }); 3084 o.observe(t, { 3085 attributes: void 0 === e.attributes || e.attributes, 3086 childList: void 0 === e.childList || e.childList, 3087 characterData: void 0 === e.characterData || e.characterData 3088 }), n.observer.observers.push(o) 3089 }, 3090 init: function() { 3091 if (this.support.observer && this.params.observer) { 3092 if (this.params.observeParents) 3093 for (var t = this.$el.parents(), e = 0; e < t.length; e += 1) this.observer.attach(t[e]); 3094 this.observer.attach(this.$el[0], { 3095 childList: this.params.observeSlideChildren 3096 }), this.observer.attach(this.$wrapperEl[0], { 3097 attributes: !1 3098 }) 3099 } 3100 }, 3101 destroy: function() {
3102 this.observer.observers.forEach(function(t) { 3103 t.disconnect() 3104 }), this.observer.observers = [] 3105 } 3106 }, 3107 I = { 3108 name: "observer", 3109 params: { 3110 observer: !1, 3111 observeParents: !1, 3112 observeSlideChildren: !1 3113 }, 3114 create: function() { 3115 w(this, { 3116 observer: e(e({}, k), {}, { 3117 observers: [] 3118 }) 3119 }) 3120 }, 3121 on: { 3122 init: function(t) { 3123 t.observer.init() 3124 }, 3125 destroy: function(t) { 3126 t.observer.destroy() 3127 } 3128 } 3129 }; 3130 3131 function O() { 3132 var t, e, i = this.params, 3133 n = this.el; 3134 n && 0 === n.offsetWidth || (i.breakpoints && this.setBreakpoint(), t = this.allowSlideNext, e = this.allowSlidePrev, n = this.snapGrid, this.allowSlideNext = !0, this.allowSlidePrev = !0, this.updateSize(), this.updateSlides(), this.updateSlidesClasses(), ("auto" === i.slidesPerView || 1 < i.slidesPerView) && this.isEnd && !this.isBeginning && !this.params.centeredSlides ? this.slideTo(this.slides.length - 1, 0, !1, !0) : this.slideTo(this.activeIndex, 0, !1, !0), this.autoplay && this.autoplay.running && this.autoplay.paused && this.autoplay.run(), this.allowSlidePrev = e, this.allowSlideNext = t, this.params.watchOverflow && n !== this.snapGrid && this.checkOverflow()) 3135 } 3136 var z = !1; 3137 3138 function A() {} 3139 var P, D, L = { 3140 init: !0, 3141 direction: "horizontal", 3142 touchEventsTarget: "container", 3143 initialSlide: 0, 3144 speed: 300, 3145 cssMode: !1, 3146 updateOnWindowResize: !0, 3147 width: null, 3148 height: null, 3149 preventInteractionOnTransition: !1, 3150 userAgent: null, 3151 url: null, 3152 edgeSwipeDetection: !1, 3153 edgeSwipeThreshold: 20, 3154 freeMode: !1, 3155 freeModeMomentum: !0, 3156 freeModeMomentumRatio: 1, 3157 freeModeMomentumBounce: !0, 3158 freeModeMomentumBounceRatio: 1, 3159 freeModeMomentumVelocityRatio: 1, 3160 freeModeSticky: !1, 3161 freeModeMinimumVelocity: .02, 3162 autoHeight: !1, 3163 setWrapperSize: !1, 3164 virtualTranslate: !1, 3165 effect: "slide", 3166 breakpoints: void 0, 3167 spaceBetween: 0, 3168 slidesPerView: 1, 3169 slidesPerColumn: 1, 3170 slidesPerColumnFill: "column", 3171 slidesPerGroup: 1, 3172 slidesPerGroupSkip: 0, 3173 centeredSlides: !1, 3174 centeredSlidesBounds: !1, 3175 slidesOffsetBefore: 0, 3176 slidesOffsetAfter: 0, 3177 normalizeSlideIndex: !0, 3178 centerInsufficientSlides: !1, 3179 watchOverflow: !1, 3180 roundLengths: !1, 3181 touchRatio: 1, 3182 touchAngle: 45, 3183 simulateTouch: !0, 3184 shortSwipes: !0, 3185 longSwipes: !0, 3186 longSwipesRatio: .5, 3187 longSwipesMs: 300, 3188 followFinger: !0, 3189 allowTouchMove: !0, 3190 threshold: 0, 3191 touchMoveStopPropagation: !1, 3192 touchStartPreventDefault: !0, 3193 touchStartForcePreventDefault: !1, 3194 touchReleaseOnEdges: !1, 3195 uniqueNavElements: !0, 3196 resistance: !0, 3197 resistanceRatio: .85, 3198 watchSlidesProgress: !1, 3199 watchSlidesVisibility: !1, 3200 grabCursor: !1, 3201 preventClicks: !0, 3202 preventClicksPropagation: !0, 3203 slideToClickedSlide: !1, 3204 preloadImages: !0, 3205 updateOnImagesReady: !0, 3206 loop: !1, 3207 loopAdditionalSlides: 0, 3208 loopedSlides: null, 3209 loopFillGroupWithBlank: !1, 3210 loopPreventsSlide: !0, 3211 allowSlidePrev: !0, 3212 allowSlideNext: !0, 3213 swipeHandler: null, 3214 noSwiping: !0, 3215 noSwipingClass: "swiper-no-swiping", 3216 noSwipingSelector: null, 3217 passiveListeners: !0, 3218 containerModifierClass: "swiper-container-", 3219 slideClass: "swiper-slide", 3220 slideBlankClass: "swiper-slide-invisible-blank", 3221 slideActiveClass: "swiper-slide-active", 3222 slideDuplicateActiveClass: "swiper-slide-duplicate-active", 3223 slideVisibleClass: "swiper-slide-visible", 3224 slideDuplicateClass: "swiper-slide-duplicate", 3225 slideNextClass: "swiper-slide-next", 3226 slideDuplicateNextClass: "swiper-slide-duplicate-next", 3227 slidePrevClass: "swiper-slide-prev", 3228 slideDuplicatePrevClass: "swiper-slide-duplicate-prev", 3229 wrapperClass: "swiper-wrapper", 3230 runCallbacksOnInit: !0, 3231 _emitClasses: !1 3232 }, 3233 M = { 3234 modular: { 3235 useParams: function(e) { 3236 var i = this; 3237 i.modules && Object.keys(i.modules).forEach(function(t) { 3238 t = i.modules[t]; 3239 t.params && X(e, t.params) 3240 }) 3241 }, 3242 useModules: function(i) { 3243 void 0 === i && (i = {}); 3244 var n = this;
3245 n.modules && Object.keys(n.modules).forEach(function(t) { 3246 var e = n.modules[t], 3247 t = i[t] || {}; 3248 e.on && n.on && Object.keys(e.on).forEach(function(t) { 3249 n.on(t, e.on[t]) 3250 }), e.create && e.create.bind(n)(t) 3251 }) 3252 } 3253 }, 3254 eventsEmitter: { 3255 on: function(t, e, i) { 3256 var n = this; 3257 if ("function" != typeof e) return n; 3258 var o = i ? "unshift" : "push"; 3259 return t.split(" ").forEach(function(t) { 3260 n.eventsListeners[t] || (n.eventsListeners[t] = []), n.eventsListeners[t][o](e) 3261 }), n 3262 }, 3263 once: function(n, o, t) { 3264 var s = this; 3265 return "function" != typeof o ? s : (a.__emitterProxy = o, s.on(n, a, t)); 3266 3267 function a() { 3268 s.off(n, a), a.__emitterProxy && delete a.__emitterProxy; 3269 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 3270 o.apply(s, e) 3271 } 3272 }, 3273 onAny: function(t, e) { 3274 if ("function" != typeof t) return this; 3275 e = e ? "unshift" : "push"; 3276 return this.eventsAnyListeners.indexOf(t) < 0 && this.eventsAnyListeners[e](t), this 3277 }, 3278 offAny: function(t) { 3279 if (!this.eventsAnyListeners) return this; 3280 t = this.eventsAnyListeners.indexOf(t); 3281 return 0 <= t && this.eventsAnyListeners.splice(t, 1), this 3282 }, 3283 off: function(t, n) { 3284 var o = this; 3285 return o.eventsListeners && t.split(" ").forEach(function(i) { 3286 void 0 === n ? o.eventsListeners[i] = [] : o.eventsListeners[i] && o.eventsListeners[i].forEac
3286h(function(t, e) { 3287 (t === n || t.__emitterProxy && t.__emitterProxy === n) && o.eventsListeners[i].splice(e, 1) 3288 }) 3289 }), o 3290 }, 3291 emit: function() { 3292 var t, n, o, s = this; 3293 if (!s.eventsListeners) return s; 3294 for (var e = arguments.length, i = new Array(e), a = 0; a < e; a++) i[a] = arguments[a]; 3295 return o = "string" == typeof i[0] || Array.isArray(i[0]) ? (t = i[0], n = i.slice(1, i.length), s) : (t = i[0].events, n = i[0].data, i[0].context || s), n.unshift(o), (Array.isArray(t) ? t : t.split(" ")).forEach(function(e) { 3296 var i; 3297 s.eventsAnyListeners && s.eventsAnyListeners.length && s.eventsAnyListeners.forEach(function(t) { 3298 t.apply(o, [e].concat(n)) 3299 }), s.eventsListeners && s.eventsListeners[e] && (i = [], s.eventsListeners[e].forEach(function(t) { 3300 i.push(t) 3301 }), i.forEach(function(t) { 3302 t.apply(o, n) 3303 })) 3304 }), s 3305 } 3306 }, 3307 update: { 3308 updateSize: function() { 3309 var t = this.$el, 3310 e = void 0 !== this.params.width && null !== this.params.width ? this.params.width : t[0].clientWidth, 3311 i = void 0 !== this.params.height && null !== this.params.width ? this.params.height : t[0].clientHeight; 3312 0 === e && this.isHorizontal() || 0 === i && this.isVertical() || (e = e - parseInt(t.css("padding-left") || 0, 10) - parseInt(t.css("padding-right") || 0, 10), i = i - parseInt(t.css("padding-top") || 0, 10) - parseInt(t.css("padding-bottom") || 0, 10), X(this, { 3313 width: e = Number.isNaN(e) ? 0 : e, 3314 height: i = Number.isNaN(i) ? 0 : i, 3315 size: this.isHorizontal() ? e : i 3316 })) 3317 }, 3318 updateSlides: function() { 3319 var t = Y(), 3320 i = this.params, 3321 e = this.$wrapperEl, 3322 n = this.size, 3323 o = this.rtlTranslate, 3324 s = this.wrongRTL, 3325 a = this.virtual && i.virtual.enabled, 3326 r = (a ? this.virtual : this).slides.length, 3327 l = e.children("." + this.params.slideClass), 3328 c = (a ? this.virtual.slides : l).length, 3329 d = [], 3330 u = [], 3331 h = []; 3332 3333 function p(t, e) { 3334 return !i.cssMode || e !== l.length - 1 3335 } 3336 var f = i.slidesOffsetBefore; 3337 "function" == typeof f && (f = i.slidesOffsetBefore.call(this)); 3338 var m = i.slidesOffsetAfter; 3339 "function" == typeof m && (m = i.slidesOffsetAfter.call(this)); 3340 var g, v = this.snapGrid.length, 3341 a = this.snapGrid.length, 3342 b = i.spaceBetween, 3343 y = -f, 3344 w = 0, 3345 C = 0; 3346 if (void 0 !== n) { 3347 "string" == typeof b && 0 <= b.indexOf("%") && (b = parseFloat(b.replace("%", "")) / 100 * n), this.virtualSize = -b, o ? l.css({ 3348 marginLeft: "", 3349 marginTop: "" 3350 }) : l.css({ 3351 marginRight: "", 3352 marginBottom: "" 3353 }), 1 < i.slidesPerColumn && (g = Math.floor(c / i.slidesPerColumn) === c / this.params.slidesPerColumn ? c : Math.ceil(c / i.slidesPerColumn) * i.slidesPerColumn, "auto" !== i.slidesPerView && "row" === i.slidesPerColumnFill && (g = Math.max(g, i.slidesPerView * i.slidesPerColumn))); 3354 for (var x, _, S, T, $ = i.slidesPerColumn, E = g / $, k = Math.floor(c / i.slidesPerColumn), I = 0; I < c; I += 1) { 3355 L = 0; 3356 var O, z, A, P, D, L, M, N, H, j, B, R, W = l.eq(I); 3357 1 < i.slidesPerColumn && (D = P = A = void 0, "row" === i.slidesPerColumnFill && 1 < i.slidesPerGroup ? (R = Math.floor(I / (i.slidesPerGroup * i.slidesPerColumn)), O = I - i.slidesPerColumn * i.slidesPerGroup * R, z = 0 === R ? i.slidesPerGroup : Math.min(Math.ceil((c - R * $ * i.slidesPerGroup) / $), i.slidesPerGroup), A = (P = O - (D = Math.floor(O / z)) * z + R * i.slidesPerGroup) + D * g / $, W.css({ 3358 "-webkit-box-ordinal-group": A, 3359 "-moz-box-ordinal-group": A, 3360 "-ms-flex-order": A, 3361 "-webkit-order": A, 3362 order: A 3363 })) : "column" === i.slidesPerColumnFill ? (D = I - (P = Math.floor(I / $)) * $, (k < P || P === k && D === $ - 1) && (D += 1) >= $ && (D = 0, P += 1)) : P = I - (D = Math.floor(I / E)) * E, W.css("margin-" + (this.isHorizontal() ? "top" : "left"), 0 !== D && i.spaceBetween && i.spaceBetween + "px")), "none" !== W.css("display") && ("auto" === i.slidesPerView ? (R = t.getComputedStyle(W[0], null), A = W[0].style.transform, P = W[0].style.webkitTransform, A && (W[0].style.transform = "none"), P && (W[0].style.webkitTransform = "none"), L = i.roundLengths ? this.isHorizontal() ? W.outerWidth(!0) : W.outerHeight(!0) : this.isHorizontal() ? (M = parseFloat(R.getPropertyValue("width") || 0), N = parseFloat(R.getPropertyValue("padding-left") || 0), H = parseFloat(R.getPropertyValue("padding-right") || 0), j = parseFloat(R.getPropertyValue("margin-left") || 0), B = parseFloat(R.getPropertyValue("margin-right") || 0), (D = R.getPropertyValue("box-sizing")) && "border-box" === D ? M + j + B : M + N + H + j + B) : (M = parseFloat(R.getPropertyValue("height") || 0), N = parseFloat(R.getPropertyValue("padding-top") || 0), H = parseFloat(R.getPropertyValue("padding-bottom") || 0), j = parseFloat(R.getPropertyValue("margin-top") || 0), B = parseFloat(R.getPropertyValue("margin-bottom") || 0), (R = R.getPropertyValue("box-sizing")) && "border-box" === R ? M + j + B : M + N + H + j + B), A && (W[0].style.transform = A), P && (W[0].style.webkitTransform = P), i.roundLengths && (L = Math.floor(L))) : (L = (n - (i.slidesPerView - 1) * b) / i.slidesPerView, i.roundLengths && (L = Math.floor(L)), l[I] && (this.isHorizontal() ? l[I].style.width = L + "px" : l[I].style.height = L + "px")), l[I] && (l[I].swiperSlideSize = L), h.push(L), i.centeredSlides ? (y = y + L / 2 + w / 2 + b, 0 === w && 0 !== I && (y = y - n / 2 - b), 0 === I && (y = y - n / 2 - b), Math.abs(y) < .001 && (y = 0), i.roundLengths && (y = Math.floor(y)), C % i.slidesPerGroup == 0 && d.push(y), u.push(y)) : (i.roundLengths && (y = Math.floor(y)), (C - Math.min(this.params.slidesPerGroupSkip, C)) % this.params.slidesPerGroup == 0 && d.push(y), u.push(y), y = y + L + b), this.virtualSize += L + b, w = L, C += 1) 3364 } 3365 if (this.virtualSize = Math.max(this.virtualSize, n) + m, o && s && ("slide" === i.effect || "coverflow" === i.effect) && e.css({ 3366 width: this.virtualSize + i.spaceBetween + "px" 3367 }), i.setWrapperSize && (this.isHorizontal() ? e.css({ 3368 width: this.virtualSize + i.spaceBetween + "px" 3369 }) : e.css({ 3370 height: this.virtualSize + i.spaceBetween + "px" 3371 })), 1 < i.slidesPerColumn && (this.virtualSize = (L + i.spaceBetween) * g, this.virtualSize = Math.
3371ceil(this.virtualSize / i.slidesPerColumn) - i.spaceBetween, this.isHorizontal() ? e.css({ 3372 width: this.virtualSize + i.spaceBetween + "px" 3373 }) : e.css({ 3374 height: this.virtualSize + i.spaceBetween + "px" 3375 }), i.centeredSlides)) { 3376 for (var F = [], q = 0; q < d.length; q += 1) { 3377 var V = d[q]; 3378 i.roundLengths && (V = Math.floor(V)), d[q] < this.virtualSize + d[0] && F.push(V) 3379 } 3380 d = F 3381 } 3382 if (!i.centeredSlides) { 3383 F = []; 3384 for (var U = 0; U < d.length; U += 1) { 3385 var G = d[U]; 3386 i.roundLengths && (G = Math.floor(G)), d[U] <= this.virtualSize - n && F.push(G) 3387 } 3388 d = F, 1 < Math.floor(this.virtualSize - n) - Math.floor(d[d.length - 1]) && d.push(this.virtualSize - n) 3389 } 3390 0 === d.length && (d = [0]), 0 !== i.spaceBetween && (this.isHorizontal() ? o ? l.filter(p).css({ 3391 marginLeft: b + "px" 3392 }) : l.filter(p).css({ 3393 marginRight: b + "px" 3394 }) : l.filter(p).css({ 3395 marginBottom: b + "px" 3396 })), i.centeredSlides && i.centeredSlidesBounds && (x = 0, h.forEach(function(t) { 3397 x += t + (i.spaceBetween || 0) 3398 }), _ = (x -= i.spaceBetween) - n, d = d.map(function(t) { 3399 return t < 0 ? -f : _ < t ? _ + m : t 3400 })), i.centerInsufficientSlides && (S = 0, h.forEach(function(t) { 3401 S += t + (i.spaceBetween || 0) 3402 }), (S -= i.spaceBetween) < n && (T = (n - S) / 2, d.forEach(function(t, e) { 3403 d[e] = t - T 3404 }), u.forEach(function(t, e) { 3405 u[e] = t + T 3406 }))), X(this, { 3407 slides: l, 3408 snapGrid: d, 3409 slidesGrid: u, 3410 slidesSizesGrid: h 3411 }), c !== r && this.emit("slidesLengthChange"), d.length !== v && (this.params.watchOverflow && this.checkOverflow(), this.emit("snapGridLengthChange")), u.length !== a && this.emit("slidesGridLengthChange"), (i.watchSlidesProgress || i.watchSlidesVisibility) && this.updateSlidesOffset() 3412 } 3413 }, 3414 updateAutoHeight: function(t) { 3415 var e, i, n = [], 3416 o = 0; 3417 if ("number" == typeof t ? this.setTransition(t) : !0 === t && this.setTransition(this.params.speed), "auto" !== this.params.slidesPerView && 1 < this.params.slidesPerView) 3418 if (this.params.centeredSlides) this.visibleSlides.each(function(t) { 3419 n.push(t) 3420 }); 3421 else 3422 for (e = 0; e < Math.ceil(this.params.slidesPerView); e += 1) { 3423 var s = this.activeIndex + e; 3424 if (s > this.slides.length) break; 3425 n.push(this.slides.eq(s)[0]) 3426 } else n.push(this.slides.eq(this.activeIndex)[0]); 3427 for (e = 0; e < n.length; e += 1) void 0 !== n[e] && (o = o < (i = n[e].offsetHeight) ? i : o); 3428 o && this.$wrapperEl.css("height", o + "px") 3429 }, 3430 updateSlidesOffset: function() { 3431 for (var t = this.slides, e = 0; e < t.length; e += 1) t[e].swiperSlideOffset = this.isHorizontal() ? t[e].offsetLeft : t[e].offsetTop 3432 }, 3433 updateSlidesProgress: function(t) { 3434 void 0 === t && (t = this && this.translate || 0); 3435 var e = this.params, 3436 i = this.slides, 3437 n = this.rtlTranslate; 3438 if (0 !== i.length) { 3439 void 0 === i[0].swiperSlideOffset && this.updateSlidesOffset(); 3440 var o = n ? t : -t; 3441 i.removeClass(e.slideVisibleClass), this.visibleSlidesIndexes = [], this.visibleSlides = []; 3442 for (var s = 0; s < i.length; s += 1) { 3443 var a, r, l = i[s], 3444 c = (o + (e.centeredSlides ? this.minTranslate() : 0) - l.swiperSlideOffset) / (l.swiperSlideSize + e.spaceBetween); 3445 (e.watchSlidesVisibility || e.centeredSlides && e.autoHeight) && (r = (a = -(o - l.swiperSlideOffset)) + this.slidesSizesGrid[s], (0 <= a && a < this.size - 1 || 1 < r && r <= this.size || a <= 0 && r >= this.size) && (this.visibleSlides.push(l), this.visibleSlidesIndexes.push(s), i.eq(s).addClass(e.slideVisibleClass))), l.progress = n ? -c : c 3446 } 3447 this.visibleSlides = _(this.visibleSlides) 3448 } 3449 }, 3450 updateProgress: function(t) { 3451 void 0 === t && (a = this.rtlTranslate ? -1 : 1, t = this && this.translate && this.translate * a || 0); 3452 var e = this.params, 3453 i = this.maxTranslate() - this.minTranslate(), 3454 n = this.progress,
3455 o = this.isBeginning, 3456 s = o, 3457 a = r = this.isEnd, 3458 r = 0 == i ? o = !(n = 0) : (o = (n = (t - this.minTranslate()) / i) <= 0, 1 <= n); 3459 X(this, { 3460 progress: n, 3461 isBeginning: o, 3462 isEnd: r 3463 }), (e.watchSlidesProgress || e.watchSlidesVisibility || e.centeredSlides && e.autoHeight) && this.updateSlidesProgress(t), o && !s && this.emit("reachBeginning toEdge"), r && !a && this.emit("reachEnd toEdge"), (s && !o || a && !r) && this.emit("fromEdge"), this.emit("progress", n) 3464 }, 3465 updateSlidesClasses: function() { 3466 var t = this.slides, 3467 e = this.params, 3468 i = this.$wrapperEl, 3469 n = this.activeIndex, 3470 o = this.realIndex, 3471 s = this.virtual && e.virtual.enabled; 3472 t.removeClass(e.slideActiveClass + " " + e.slideNextClass + " " + e.slidePrevClass + " " + e.slideDuplicateActiveClass + " " + e.slideDuplicateNextClass + " " + e.slideDuplicatePrevClass), (n = s ? this.$wrapperEl.find("." + e.slideClass + '[data-swiper-slide-index="' + n + '"]') : t.eq(n)).addClass(e.slideActiveClass), e.loop && (n.hasClass(e.slideDuplicateClass) ? i.children("." + e.slideClass + ":not(." + e.slideDuplicateClass + ')[data-swiper-slide-index="' + o + '"]') : i.children("." + e.slideClass + "." + e.slideDuplicateClass + '[data-swiper-slide-index="' + o + '"]')).addClass(e.slideDuplicateActiveClass); 3473 o = n.nextAll("." + e.slideClass).eq(0).addClass(e.slideNextClass); 3474 e.loop && 0 === o.length && (o = t.eq(0)).addClass(e.slideNextClass); 3475 n = n.prevAll("." + e.slideClass).eq(0).addClass(e.slidePrevClass); 3476 e.loop && 0 === n.length && (n = t.eq(-1)).addClass(e.slidePrevClass), e.loop && ((o.hasClass(e.slideDuplicateClass) ? i.children("." + e.slideClass + ":not(." + e.slideDuplicateClass + ')[data-swiper-slide-index="' + o.attr("data-swiper-slide-index") + '"]') : i.children("." + e.slideClass + "." + e.slideDuplicateClass + '[data-swiper-slide-index="' + o.attr("data-swiper-slide-index") + '"]')).addClass(e.slideDuplicateNextClass), (n.hasClass(e.slideDuplicateClass) ? i.children("." + e.slideClass + ":not(." + e.slideDuplicateClass + ')[data-swiper-slide-index="' + n.attr("data-swiper-slide-index") + '"]') : i.children("." + e.slideClass + "." + e.slideDuplicateClass + '[data-swiper-slide-index="' + n.attr("data-swiper-slide-index") + '"]')).addClass(e.slideDuplicatePrevClass)), this.emitSlidesClasses() 3477 }, 3478 updateActiveIndex: function(t) { 3479 var e = this.rtlTranslate ? this.translate : -this.translate, 3480 i = this.slidesGrid, 3481 n = this.snapGrid, 3482 o = this.params, 3483 s = this.activeIndex, 3484 a = this.realIndex, 3485 r = this.snapIndex, 3486 l = t; 3487 if (void 0 === l) { 3488 for (var c = 0; c < i.length; c += 1) void 0 !== i[c + 1] ? e >= i[c] && e < i[c + 1] - (i[c + 1] - i[c]) / 2 ? l = c : e >= i[c] && e < i[c + 1] && (l = c + 1) : e >= i[c] && (l = c); 3489 o.normalizeSlideIndex && (l < 0 || void 0 === l) && (l = 0) 3490 }(o = 0 <= n.indexOf(e) ? n.indexOf(e) : (t = Math.min(o.slidesPerGroupSkip, l)) + Math.floor((l - t) / o.slidesPerGroup)) >= n.length && (o = n.length - 1), l !== s ? (n = parseInt(this.slides.eq(l).attr("data-swiper-slide-index") || l, 10), X(this, { 3491 snapIndex: o, 3492 realIndex: n, 3493 previousIndex: s, 3494 activeIndex: l 3495 }), this.emit("activeIndexChange"), this.emit("snapIndexChange"), a !== n && this.emit("realIndexChange"), (this.initialized || this.params.runCallbacksOnInit) && this.emit("slideChange")) : o !== r && (this.snapIndex = o, this.emit("snapIndexChange")) 3496 }, 3497 updateClickedSlide: function(t) { 3498 var e = this.params, 3499 i = _(t.target).closest("." + e.slideClass)[0], 3500 n = !1; 3501 if (i) 3502 for (var o = 0; o < this.slides.length; o += 1) this.slides[o] === i && (n = !0); 3503 if (!i || !n) return this.clickedSlide = void 0, void(this.clickedIndex = void 0); 3504 this.clickedSlide = i, this.virtual && this.params.virtual.enabled ? this.clickedIndex = parseInt(_(i).attr("data-swiper-slide-index"), 10) : this.clickedIndex = _(i).index(), e.slideToClickedSlide && void 0 !== this.clickedIndex && this.clickedIndex !== this.activeIndex && this.slideToClickedSlide() 3505 } 3506 }, 3507 translate: { 3508 getTranslate: function(t) { 3509 void 0 === t && (t = this.isHorizontal() ? "x" : "y"); 3510 var e = this.params, 3511 i = this.rtlTranslate, 3512 n = this.translate, 3513 o = this.$wrapperEl; 3514 if (e.virtualTranslate) return i ? -n : n; 3515 if (e.cssMode) return n; 3516 t = b(o[0], t); 3517 return (t = i ? -t : t) || 0 3518 }, 3519 setTranslate: function(t, e) { 3520 var i = this.rtlTranslate, 3521 n = this.params, 3522 o = this.$wrapperEl, 3523 s = this.wrapperEl, 3524 a = this.progress, 3525 r = 0, 3526 l = 0;
3527 this.isHorizontal() ? r = i ? -t : t : l = t, n.roundLengths && (r = Math.floor(r), l = Math.floor(l)), n.cssMode ? s[this.isHorizontal() ? "scrollLeft" : "scrollTop"] = this.isHorizontal() ? -r : -l : n.virtualTranslate || o.transform("translate3d(" + r + "px, " + l + "px, 0px)"), this.previousTranslate = this.translate, this.translate = this.isHorizontal() ? r : l; 3528 l = this.maxTranslate() - this.minTranslate(); 3529 (0 == l ? 0 : (t - this.minTranslate()) / l) !== a && this.updateProgress(t), this.emit("setTranslate", this.translate, e) 3530 }, 3531 minTranslate: function() { 3532 return -this.snapGrid[0] 3533 }, 3534 maxTranslate: function() { 3535 return -this.snapGrid[this.snapGrid.length - 1] 3536 }, 3537 translateTo: function(t, e, i, n, o) { 3538 void 0 === t && (t = 0), void 0 === e && (e = this.params.speed), void 0 === i && (i = !0), void 0 === n && (n = !0); 3539 var s = this, 3540 a = s.params, 3541 r = s.wrapperEl; 3542 if (s.animating && a.preventInteractionOnTransition) return !1; 3543 var l = s.minTranslate(), 3544 c = s.maxTranslate(), 3545 c = n && l < t ? l : n && t < c ? c : t; 3546 if (s.updateProgress(c), a.cssMode) { 3547 t = s.isHorizontal(); 3548 return 0 !== e && r.scrollTo ? r.scrollTo(((a = {})[t ? "left" : "top"] = -c, a.behavior = "smooth", a)) : r[t ? "scrollLeft" : "scrollTop"] = -c, !0 3549 } 3550 return 0 === e ? (s.setTransition(0), s.setTranslate(c), i && (s.emit("beforeTransitionStart", e, o), s.emit("transitionEnd"))) : (s.setTransition(e), s.setTranslate(c), i && (s.emit("beforeTransitionStart", e, o), s.emit("transitionStart")), s.animating || (s.animating = !0, s.onTranslateToWrapperTransitionEnd || (s.onTranslateToWrapperTransitionEnd = function(t) { 3551 s && !s.destroyed && t.target === this && (s.$wrapperEl[0].removeEventListener("transitionend", s.onTranslateToWrapperTransitionEnd), s.$wrapperEl[0].removeEventListener("webkitTransitionEnd", s.onTranslateToWrapperTransitionEnd), s.onTranslateToWrapperTransitionEnd = null, delete s.onTranslateToWrapperTransitionEnd, i && s.emit("transitionEnd")) 3552 }), s.$wrapperEl[0].addEventListener("transitionend", s.onTranslateToWrapperTransitionEnd), s.$wrapperEl[0].addEventListener("webkitTransitionEnd", s.onTranslateToWrapperTransitionEnd))), !0 3553 } 3554 }, 3555 transition: { 3556 setTransition: function(t, e) { 3557 this.params.cssMode || this.$wrapperEl.transition(t), this.emit("setTransition", t, e) 3558 }, 3559 transitionStart: function(t, e) { 3560 void 0 === t && (t = !0); 3561 var i = this.activeIndex, 3562 n = this.params, 3563 o = this.previousIndex; 3564 n.cssMode || (n.autoHeight && this.updateAutoHeight(), e = (e = e) || (o < i ? "next" : i < o ? "prev" : "reset"), this.emit("transitionStart"), t && i !== o && ("reset" !== e ? (this.emit
3564("slideChangeTransitionStart"), "next" === e ? this.emit("slideNextTransitionStart") : this.emit("slidePrevTransitionStart")) : this.emit("slideResetTransitionStart"))) 3565 }, 3566 transitionEnd: function(t, e) { 3567 void 0 === t && (t = !0); 3568 var i = this.activeIndex, 3569 n = this.previousIndex, 3570 o = this.params; 3571 this.animating = !1, o.cssMode || (this.setTransition(0), e = (e = e) || (n < i ? "next" : i < n ? "prev" : "reset"), this.emit("transitionEnd"), t && i !== n && ("reset" !== e ? (this.emit("slideChangeTransitionEnd"), "next" === e ? this.emit("slideNextTransitionEnd") : this.emit("slidePrevTransitionEnd")) : this.emit("slideResetTransitionEnd"))) 3572 } 3573 }, 3574 slide: { 3575 slideTo: function(t, e, i, n) { 3576 void 0 === e && (e = this.params.speed), void 0 === i && (i = !0); 3577 var o = this, 3578 s = t = void 0 === t ? 0 : t; 3579 s < 0 && (s = 0); 3580 var a = o.params, 3581 r = o.snapGrid, 3582 l = o.slidesGrid, 3583 c = o.previousIndex, 3584 d = o.activeIndex, 3585 u = o.rtlTranslate, 3586 h = o.wrapperEl; 3587 if (o.animating && a.preventInteractionOnTransition) return !1; 3588 t = Math.min(o.params.slidesPerGroupSkip, s), t += Math.floor((s - t) / o.params.slidesPerGroup); 3589 t >= r.length && (t = r.length - 1), (d || a.initialSlide || 0) === (c || 0) && i && o.emit("beforeSlideChangeStart"); 3590 var p, f = -r[t]; 3591 if (o.updateProgress(f), a.normalizeSlideIndex) 3592 for (var m = 0; m < l.length; m += 1) - Math.floor(100 * f) >= Math.floor(100 * l[m]) && (s = m); 3593 if (o.initialized && s !== d) { 3594 if (!o.allowSlideNext && f < o.translate && f < o.minTranslate()) return !1; 3595 if (!o.allowSlidePrev && f > o.translate && f > o.maxTranslate() && (d || 0) !== s) return !1 3596 } 3597 if (p = d < s ? "next" : s < d ? "prev" : "reset", u && -f === o.translate || !u && f === o.translate) return o.updateActiveIndex(s), a.autoHeight && o.updateAutoHeight(), o.updateSlidesClasses(), "slide" !== a.effect && o.setTranslate(f), "reset" != p && (
3597o.transitionStart(i, p), o.transitionEnd(i, p)), !1; 3598 if (a.cssMode) { 3599 d = o.isHorizontal(), a = -f; 3600 return u && (a = h.scrollWidth - h.offsetWidth - a), 0 !== e && h.scrollTo ? h.scrollTo(((u = {})[d ? "left" : "top"] = a, u.behavior = "smooth", u)) : h[d ? "scrollLeft" : "scrollTop"] = a, !0 3601 } 3602 return 0 === e ? (o.setTransition(0), o.setTranslate(f), o.updateActiveIndex(s), o.updateSlidesClasses(), o.emit("beforeTransitionStart", e, n), o.transitionStart(i, p), o.transitionEnd(i, p)) : (o.setTransition(e), o.setTranslate(f), o.updateActiveIndex(s), o.updateSlidesClasses(), o.emit("beforeTransitionStart", e, n), o.transitionStart(i, p), o.animating || (o.animating = !0, o.onSlideToWrapperTransitionEnd || (o.onSlideToWrapperTransitionEnd = function(t) { 3603 o && !o.destroyed && t.target === this && (o.$wrapperEl[0].removeEventListener("transitionend", o.onSlideToWrapperTransitionEnd), o.$wrapperEl[0].removeEventListener("webkitTransitionEnd", o.onSlideToWrapperTransitionEnd), o.onSlideToWrapperTransitionEnd = null, delete o.onSlideToWrapperTransitionEnd, o.transitionEnd(i, p)) 3604 }), o.$wrapperEl[0].addEventListener("transitionend", o.onSlideToWrapperTransitionEnd), o.$wrapperEl[0].addEventListener("webkitTransitionEnd", o.onSlideToWrapperTransitionEnd))), !0 3605 }, 3606 slideToLoop: function(t, e, i, n) { 3607 void 0 === e && (e = this.params.speed); 3608 t = void 0 === t ? 0 : t; 3609 return this.params.loop && (t += this.loopedSlides), this.slideTo(t, e, i = void 0 === i ? !0 : i, n) 3610 }, 3611 slideNext: function(t, e, i) { 3612 void 0 === t && (t = this.params.speed), void 0 === e && (e = !0); 3613 var n = this.params, 3614 o = this.animating, 3615 s = this.activeIndex < n.slidesPerGroupSkip ? 1 : n.slidesPerGroup; 3616 if (n.loop) { 3617 if (o && n.loopPreventsSlide) return !1; 3618 this.loopFix(), this._clientLeft = this.$wrapperEl[0].clientLeft 3619 } 3620 return this.slideTo(this.activeIndex + s, t, e, i) 3621 }, 3622 slidePrev: function(t, e, i) { 3623 void 0 === t && (t = this.params.speed), void 0 === e && (e = !0); 3624 var n = this.params, 3625 o = this.animating, 3626 s = this.snapGrid, 3627 a = this.slidesGrid, 3628 r = this.rtlTranslate; 3629 if (n.loop) { 3630 if (o && n.loopPreventsSlide) return !1; 3631 this.loopFix(), this._clientLeft = this.$wrapperEl[0].clientLeft 3632 } 3633 3634 function l(t) { 3635 return t < 0 ? -Math.floor(Math.abs(t)) : Math.floor(t) 3636 } 3637 var c, d = l(r ? this.translate : -this.translate), 3638 r = s.map(l), 3639 u = (s[r.indexOf(d)], s[r.indexOf(d) - 1]);
3640 return void 0 === u && n.cssMode && s.forEach(function(t) { 3641 !u && t <= d && (u = t) 3642 }), void 0 !== u && (c = a.indexOf(u)) < 0 && (c = this.activeIndex - 1), this.slideTo(c, t, e, i) 3643 }, 3644 slideReset: function(t, e, i) { 3645 return void 0 === t && (t = this.params.speed), this.slideTo(this.activeIndex, t, e = void 0 === e ? !0 : e, i) 3646 }, 3647 slideToClosest: function(t, e, i, n) { 3648 void 0 === t && (t = this.params.speed), void 0 === e && (e = !0), void 0 === n && (n = .5); 3649 var o = this.activeIndex, 3650 s = Math.min(this.params.slidesPerGroupSkip, o), 3651 a = s + Math.floor((o - s) / this.params.slidesPerGroup), 3652 r = this.rtlTranslate ? this.translate : -this.translate; 3653 return r >= this.snapGrid[a] ? r - (s = this.snapGrid[a]) > (this.snapGrid[a + 1] - s) * n && (o += this.params.slidesPerGroup) : r - (r = this.snapGrid[a - 1]) <= (this.snapGrid[a] - r) * n && (o -= this.params.slidesPerGroup), o = Math.max(o, 0), o = Math.min(o, this.slidesGrid.length - 1), this.slideTo(o, t, e, i) 3654 }, 3655 slideToClickedSlide: function() { 3656 var t, e = this, 3657 i = e.params, 3658 n = e.$wrapperEl, 3659 o = "auto" === i.slidesPerView ? e.slidesPerViewDynamic() : i.slidesPerView, 3660 s = e.clickedIndex; 3661 i.loop ? e.animating || (t = parseInt(_(e.clickedSlide).attr("data-swiper-slide-index"), 10), i.centeredSlides ? s < e.loopedSlides - o / 2 || s > e.slides.length - e.loopedSlides + o / 2 ? (e.loopFix(), s = n.children("." + i.slideClass + '[data-swiper-slide-index="' + t + '"]:not(.' + i.slideDuplicateClass + ")").eq(0).index(), S(function() { 3662 e.slideTo(s) 3663 })) : e.slideTo(s) : s > e.slides.length - o ? (e.loopFix(), s = n.children("." + i.slideClass + '[data-swiper-slide-index="' + t + '"]:not(.' + i.slideDuplicateClass + ")").eq(0).index(), S(function() { 3664 e.slideTo(s) 3665 })) : e.slideTo(s)) : e.slideTo(s) 3666 } 3667 }, 3668 loop: { 3669 loopCreate: function() { 3670 var n = this, 3671 t = v(), 3672 e = n.params, 3673 i = n.$wrapperEl; 3674 i.children("." + e.slideClass + "." + e.slideDuplicateClass).remove(); 3675 var o = i.children("." + e.slideClass); 3676 if (e.loopFillGroupWithBlank) { 3677 var s = e.slidesPerGroup - o.length % e.slidesPerGroup; 3678 if (s !== e.slidesPerGroup) { 3679 for (var a = 0; a < s; a += 1) { 3680 var r = _(t.createElement("div")).addClass(e.slideClass + " " + e.slideBlankClass); 3681 i.append(r) 3682 } 3683 o = i.children("." + e.slideClass) 3684 } 3685 } 3686 "auto" !== e.slidesPerView || e.loopedSlides || (e.loopedSlides = o.length), n.loopedSlides = Math.ceil(parseFloat(e.loopedSlides || e.slidesPerView, 10)), n.loopedSlides += e.loopAdditionalSlides, n.loopedSlides > o.length && (n.loopedSlides = o.length); 3687 var l = [], 3688 c = []; 3689 o.each(function(t, e) { 3690 var i = _(t); 3691 e < n.loopedSlides && c.push(t), e < o.length && e >= o.length - n.loopedSlides && l.push(t), i.attr("data-swiper-slide-index", e) 3692 }); 3693 for (var d = 0; d < c.length; d += 1) i.append(_(c[d].cloneNode(!0)).addClass(e.slideDuplicateClass)); 3694 for (var u = l.length - 1; 0 <= u; --u) i.prepend(_(l[u].cloneNode(!0)).addClass(e.slideDuplicateClass)) 3695 }, 3696 loopFix: function() { 3697 this.emit("beforeLoopFix"); 3698 var t, e = this.activeIndex, 3699 i = this.slides, 3700 n = this.loopedSlides, 3701 o = this.allowSlidePrev, 3702 s = this.allowSlideNext, 3703 a = this.snapGrid, 3704 r = this.rtlTranslate; 3705 this.allowSlidePrev = !0, this.allowSlideNext = !0; 3706 a = -a[e] - this.getTranslate(); 3707 e < n ? (t = i.length - 3 * n + e, this.slideTo(t += n, 0, !1, !0) && 0 != a && this.setTranslate((r ? -this.translate : this.translate) - a)) : e >= i.length - n && (t = -i.length + e + n, this.slideTo(t += n, 0, !1, !0) && 0 != a && this.setTranslate((r ? -this.translate : this.translate) - a)), this.allowSlidePrev = o, this.allowSlideNext = s, this.emit("loopFix") 3708 }, 3709 loopDestroy: function() { 3710 var t = this.$wrapperEl, 3711 e = this.params, 3712 i = this.slides; 3713 t.children("." + e.slideClass + "." + e.slideDuplicateClass + ",." + e.slideClass + "." + e.slideBlankClass).remove(), i.removeAttr("data-swiper-slide-index") 3714 } 3715 }, 3716 grabCursor: { 3717 setGrabCursor: function(t) { 3718 var e; 3719 this.support.touch || !this.params.simulateTouch || this.params.watchOverflow && this.isLocked || this.params.cssMode || ((e = this.el).style.cursor = "move", e.style.cursor = t ? "-webkit-grabbing" : "-webkit-grab", e.style.cursor = t ? "-moz-grabbin" : "-moz-grab", e.style.cursor = t ? "grabbing" : "grab") 3720 }, 3721 unsetGrabCursor: function() { 3722 this.support.touch || this.params.watchOverflow && this.isLocked || this.params.cssMode || (this.el.style.cursor = "") 3723 } 3724 }, 3725 manipulation: { 3726 appendSlide: function(t) { 3727 var e = this.$wrapperEl, 3728 i = this.params; 3729 if (i.loop && this.loopDestroy(), "object" == typeof t && "length" in t) 3730 for (var n = 0; n < t.length; n += 1) t[n] && e.append(t[n]); 3731 else e.append(t); 3732 i.loop && this.loopCreate(), i.observer && this.support.observer || this.update() 3733 }, 3734 prependSlide: function(t) { 3735 var e = this.params, 3736 i = this.$wrapperEl, 3737 n = this.activeIndex; 3738 e.loop && this.loopDestroy(); 3739 var o = n + 1; 3740 if ("object" == typeof t && "length" in t) { 3741 for (var s = 0; s < t.length; s += 1) t[s] && i.prepend(t[s]); 3742 o = n + t.length 3743 } else i.prepend(t); 3744 e.loop && this.loopCreate(), e.observer && this.support.observer || this.update(), this.slideTo(o, 0, !1) 3745 }, 3746 addSlide: function(t, e) { 3747 var i = this.$wrapperEl, 3748 n = this.params, 3749 o = this.activeIndex; 3750 n.loop && (o -= this.loopedSlides, this.loopDestroy(), this.slides = i.children("." + n.slideClass)); 3751 var s = this.slides.length; 3752 if (t <= 0) this.prependSlide(e); 3753 else if (s <= t) this.appendSlide(e); 3754 else { 3755 for (var a = t < o ? o + 1 : o, r = [], l = s - 1; t <= l; --l) { 3756 var c = this.slides.eq(l); 3757 c.remove(), r.unshift(c) 3758 } 3759 if ("object" == typeof e && "length" in e) { 3760 for (var d = 0; d < e.length; d += 1) e[d] && i.append(e[d]); 3761 a = t < o ? o + e.length : o 3762 } else i.append(e); 3763 for (var u = 0; u < r.length; u += 1) i.append(r[u]); 3764 n.loop && this.loopCreate(), n.observer && this.support.observer || this.update(), n.loop ? this.slideTo(a + this.loopedSlides, 0, !1) : this.slideTo(a, 0, !1) 3765 } 3766 }, 3767 removeSlide: function(t) { 3768 var e = this.params, 3769 i = this.$wrapperEl, 3770 n = this.activeIndex; 3771 e.loop && (n -= this.loopedSlides, this.loopDestroy(), this.slides = i.children("." + e.slideClass)); 3772 var o, s = n; 3773 if ("object" == typeof t && "length" in t) { 3774 for (var a = 0; a < t.length; a += 1) o = t[a], this.slides[o] && this.slides.eq(o).remove(), o < s && --s; 3775 s = Math.max(s, 0) 3776 } else this.slides[o = t] && this.slides.eq(o).remove(), o < s && --s, s = Math.max(s, 0); 3777 e.loop && this.loopCreate(), e.observer && this.support.observer || this.update(), e.loop ? this.slideTo(s + this.loopedSlides, 0, !1) : this.slideTo(s, 0, !1) 3778 }, 3779 removeAllSlides: function() { 3780 for (var t = [], e = 0; e < this.slides.length; e += 1) t.push(e); 3781 this.removeSlide(t) 3782 } 3783 }, 3784 events: { 3785 attachEvents: function() { 3786 var t = v(), 3787 e = this.params, 3788 i = this.touchEvents, 3789 n = this.el, 3790 o = this.wrapperEl, 3791 s = this.device, 3792 a = this.support; 3793 this.onTouchStart = function(t) { 3794 var e, i, n, o, s, a = v(), 3795 r = Y(), 3796 l = this.touchEventsData, 3797 c = this.params, 3798 d = this.touches; 3799 this.animating && c.preventInteractionOnTransition || (i = _((e = (e = t).originalEvent ? e.originalEvent : e).target), "wrapper" === c.touchEventsTarget && !i.closest(this.wrapperEl).length || (l.isTouchEvent = "touchstart" === e.type, !l.isTouchEvent && "which" in e && 3 === e.which || !l.isTouchEvent && "button" in e && 0 < e.button || l.isTouched && l.isMoved) || (c.noSwiping && i.closest(c.noSwipingSelector || "." + c.noSwipingClass)[0] ? this.allowClick = !0 : c.swipeHandler && !i.closest(c.swipeHandler)[0] || (d.currentX = ("touchstart" === e.type ? e.targetTouches[0] : e).pageX, d.currentY = ("touchstart" === e.type ? e.targetTouches[0] : e).pageY, n = d.
3799currentX, s = d.currentY, o = c.edgeSwipeDetection || c.iOSEdgeSwipeDetection, t = c.edgeSwipeThreshold || c.iOSEdgeSwipeThreshold, o && (n <= t || n >= r.screen.width - t) || (X(l, { 3800 isTouched: !0, 3801 isMoved: !1, 3802 allowTouchCallbacks: !0, 3803 isScrolling: void 0, 3804 startMoving: void 0 3805 }), d.startX = n, d.startY = s, l.touchStartTime = T(), this.allowClick = !0, this.updateSize(), this.swipeDirection = void 0, 0 < c.threshold && (l.allowThresholdMove = !1), "touchstart" !== e.type && (s = !0, i.is(l.formElements) && (s = !1), a.activeElement && _(a.activeElement).is(l.formElements) && a.activeElement !== i[0] && a.activeElement.blur(), s = s && this.allowTouchMove && c.touchStartPreventDefault, (c.touchStartForcePreventDefault || s) && e.preventDefault()), this.emit("touchStart", e))))) 3806 }.bind(this), this.onTouchMove = function(t) { 3807 var e = v(), 3808 i = this.touchEventsData, 3809 n = this.params, 3810 o = this.touches, 3811 s = this.rtlTranslate, 3812 a = t; 3813 if (a.originalEvent && (a = a.originalEvent), i.isTouched) { 3814 if (!i.isTouchEvent || "touchmove" === a.type) { 3815 var r = "touchmove" === a.type && a.targetTouches && (a.targetTouches[0] || a.changedTouches[0]), 3816 t = ("touchmove" === a.type ? r : a).pageX, 3817 r = ("touchmove" === a.type ? r : a).pageY; 3818 if (a.preventedByNestedSwiper) return o.startX = t, void(o.startY = r); 3819 if (!this.allowTouchMove) return this.allowClick = !1, void(i.isTouched && (X(o, { 3820 startX: t, 3821 startY: r, 3822 currentX: t, 3823 currentY: r 3824 }), i.touchStartTime = T())); 3825 if (i.isTouchEvent && n.touchReleaseOnEdges && !n.loop) 3826 if (this.isVertical()) { 3827 if (r < o.startY && this.translate <= this.maxTranslate() || r > o.startY && this.translate >= this.minTranslate()) return i.isTouched = !1, void(i.isMoved = !1) 3828 } else if (t < o.startX && this.translate <= this.maxTranslate() || t > o.startX && this.translate >= this.minTranslate()) return; 3829 if (i.isTouchEvent && e.activeElement && a.target === e.activeElement && _(a.target).is(i.formElements)) return i.isMoved = !0, void(this.allowClick = !1); 3830 if (i.allowTouchCallbacks && this.emit("touchMove", a), !(a.targetTouches && 1 < a.targetTouches.length)) { 3831 o.currentX = t, o.currentY = r; 3832 e = o.currentX - o.startX, t = o.currentY - o.startY; 3833 if (!(this.params.threshold && Math.sqrt(Math.pow(e, 2) + Math.pow(t, 2)) < this.params.threshold)) 3834 if (void 0 === i.isScrolling && (this.isHorizontal() && o.currentY === o.startY || this.isVertical() && o.currentX === o.startX ? i.isScrolling = !1 : 25 <= e * e + t * t && (r = 180 * Math.atan2(Math.abs(t), Math.abs(e)) / Math.PI, i.isScrolling = this.isHorizontal() ? r > n.touchAngle : 90 - r > n.touchAngle)), i.isScrolling && this.emit("touchMoveOpposite", a), void 0 === i.startMoving && (o.currentX === o.startX && o.currentY === o.startY || (i.startMoving = !0)), i.isScrolling) i.isTouched = !1; 3835 else if (i.startMoving) { 3836 this.allowClick = !1, !n.cssMode && a.cancelable && a.preventDefault(), n.touchMoveStopPropagation && !n.nested && a.stopPropagation(), i.isMoved || (n.loop && this.loopFix(), i.startTranslate = this.getTranslate(), this.setTransition(0), this.animating && this.$wrapperEl.trigger("webkitTransitionEnd transitionend"), i.allowMomentumBounce = !1, !n.grabCursor || !0 !== this.allowSlideNext && !0 !== this.allowSlidePrev || this.setGrabCursor(!0), this.emit("sliderFirstMove", a)), this.emit("sliderMove", a), i.isMoved = !0; 3837 e = this.isHorizontal() ? e : t; 3838 o.diff = e, e *= n.touchRatio, this.swipeDirection = 0 < (e = s ? -e : e) ? "prev" : "next", i.currentTranslate = e + i.startTranslate; 3839 t = !0, s = n.resistanceRatio; 3840 if (n.touchReleaseOnEdges && (s = 0), 0 < e && i.currentTranslate > this.minTranslate() ? (t = !1, n.resistance && (i.currentTranslate = this.minTranslate() - 1 + Math.pow(-this.minTranslate() + i.startTranslate + e, s))) : e < 0 && i.currentTranslate < this.maxTranslate() && (t = !1, n.resistance && (i.currentTranslate = this.maxTranslate() + 1 - Math.pow(this.maxTranslate() - i.startTranslate - e, s))), t && (a.preventedByNestedSwiper = !0), !this.allowSlideNext && "next" === this.swipeDirection && i.currentTranslate < i.startTranslate && (i.currentTranslate = i.startTranslate), !this.allowSlidePrev && "prev" === this.swipeDirection && i.currentTranslate > i.startTranslate && (i.currentTranslate = i.startTranslate), 0 < n.threshold) { 3841 if (!(Math.abs(e) > n.threshold || i.allowThresholdMove)) return void(i.currentTranslate = i.startTranslate); 3842 if (!i.allowThresholdMove) return i.allowThresholdMove = !0, o.startX = o.currentX, o.startY = o.currentY, i.currentTranslate = i.startTranslate, void(o.diff = this.isHorizontal() ? o.currentX - o.startX : o.currentY - o.startY) 3843 } 3844 n.followFinger && !n.cssMode && ((n.freeMode || n.watchSlidesProgress || n.watchSlidesVisibility) && (this.updateActiveIndex(), this.updateSlidesClasses()), n.freeMode && (0 === i.velocities.length && i.velocities.push({ 3845 position: o[this.isHorizontal() ? "startX" : "startY"], 3846 time: i.touchStartTime 3847 }), i.velocities.push({ 3848 position: o[this.isHorizontal() ? "currentX" : "currentY"], 3849 time: T() 3850 })), this.updateProgress(i.currentTranslate), this.setTranslate(i.currentTranslate)) 3851 } 3852 } 3853 } 3854 }
3854 else i.startMoving && i.isScrolling && this.emit("touchMoveOpposite", a) 3855 }.bind(this), this.onTouchEnd = function(t) { 3856 var e = this, 3857 i = e.touchEventsData, 3858 n = e.params, 3859 o = e.touches, 3860 s = e.rtlTranslate, 3861 a = e.$wrapperEl, 3862 r = e.slidesGrid, 3863 l = e.snapGrid, 3864 c = t; 3865 if (c.originalEvent && (c = c.originalEvent), i.allowTouchCallbacks && e.emit("touchEnd", c), i.allowTouchCallbacks = !1, !i.isTouched) return i.isMoved && n.grabCursor && e.setGrabCursor(!1), i.isMoved = !1, void(i.startMoving = !1); 3866 n.grabCursor && i.isMoved && i.isTouched && (!0 === e.allowSlideNext || !0 === e.allowSlidePrev) && e.setGrabCursor(!1); 3867 var d, u = T(), 3868 t = u - i.touchStartTime; 3869 if (e.allowClick && (e.updateClickedSlide(c), e.emit("tap click", c), t < 300 && u - i.lastClickTime < 300 && e.emit("doubleTap doubleClick", c)), i.lastClickTime = T(), S(function() { 3870 e.destroyed || (e.allowClick = !0) 3871 }), !i.isTouched || !i.isMoved || !e.swipeDirection || 0 === o.diff || i.currentTranslate === i.startTranslate) return i.isTouched = !1, i.isMoved = !1, void(i.startMoving = !1); 3872 if (i.isTouched = !1, i.isMoved = !1, i.startMoving = !1, d = n.followFinger ? s ? e.translate : -e.translate : -i.currentTranslate, !n.cssMode) 3873 if (n.freeMode) 3874 if (d < -e.minTranslate()) e.slideTo(e.activeIndex); 3875 else if (d > -e.maxTranslate()) e.slides.length < l.length ? e.slideTo(l.length - 1) : e.slideTo(e.slides.length - 1); 3876 else { 3877 if (n.freeModeMomentum) { 3878 1 < i.velocities.length ? (v = i.velocities.pop(), p = i.velocities.pop(), h = v.position - p.position, p = v.time - p.time, e.velocity = h / p, e.velocity /= 2, Math.abs(e.velocity) < n.freeModeMinimumVelocity && (e.velocity = 0), (150 < p || 300 < T() - v.time) && (e.velocity = 0)) : e.velocity = 0, e.velocity *= n.freeModeMomentumVelocityRatio, i.velocities.length = 0; 3879 var h = 1e3 * n.freeModeMomentumRatio, 3880 p = e.velocity * h, 3881 f = e.translate + p; 3882 s && (f = -f); 3883 var m, g, v = !1, 3884 p = 20 * Math.abs(e.velocity) * n.freeModeMomentumBounceRatio; 3885 if (f < e.maxTranslate()) n.freeModeMomentumBounce ? (f + e.maxTranslate() < -p && (f = e.maxTranslate() - p), m = e.maxTranslate(), i.allowMomentumBounce = v = !0) : f = e.maxTranslate(), n.loop && n.centeredSlides && (g = !0); 3886 else if (f > e.minTranslate()) n.freeModeMomentumBounce ? (f - e.minTranslate() > p && (f = e.minTranslate() + p), m = e.minTranslate(), i.allowMomentumBounce = v = !0) : f = e.minTranslate(), n.loop && n.centeredSlides && (g = !0); 3887 else if (n.freeModeSticky) { 3888 for (var b, y = 0; y < l.length; y += 1) 3889 if (l[y] > -f) { 3890 b = y; 3891 break 3892 } f = -(Math.abs(l[b] - f) < Math.abs(l[b - 1] - f) || "next" === e.swipeDirection ? l[b] : l[b - 1]) 3893 } 3894 if (g && e.once("transitionEnd", function() { 3895 e.loopFix() 3896 }), 0 !== e.velocity) h = s ? Math.abs((-f - e.translate) / e.velocity) : Math.abs((f - e.translate) / e.velocity), n.freeModeSticky && (h = (g = Math.abs((s ? -f : f) - e.translate)) < (s = e.slidesSizesGrid[e.activeIndex]) ? n.speed : g < 2 * s ? 1.5 * n.speed : 2.5 * n.speed); 3897 else if (n.freeModeSticky) return void e.slideToClosest(); 3898 n.freeModeMomentumBounce && v ? (e.updateProgress(m), e.setTransition(h), e.setTranslate(f), e.transitionStart(!0, e.swipeDirection), e.animating = !0, a.transitionEnd(function() { 3899 e && !e.destroyed && i.allowMomentumBounce && (e.emit("momentumBounce"), e.setTransition(n.speed), setTimeout(function() { 3900 e.setTranslate(m), a.transitionEnd(function() { 3901 e && !e.destroyed && e.transitionEnd() 3902 }) 3903 }, 0)) 3904 })) : e.velocity ? (e.updateProgress(f), e.setTransition(h), e.setTranslate(f), e.transitionStart(!0, e.swipeDirection), e.animating || (e.animating = !0, a.transitionEnd(function() { 3905 e && !e.destroyed && e.transitionEnd() 3906 }))) : e.updateProgress(f), e.updateActiveIndex(), e.updateSlidesClasses() 3907 } else if (n.freeModeSticky) return void e.slideToClosest(); 3908 (!n.freeModeMomentum || t >= n.longSwipesMs) && (e.updateProgress(), e.updateActiveIndex(), e.updateSlidesClasses()) 3909 } else { 3910 for (var w = 0, C = e.slidesSizesGrid[0], x = 0; x < r.length; x += x < n.slidesPerGroupSkip ? 1 : n.slidesPerGroup) { 3911 var _ = x < n.slidesPerGroupSkip - 1 ? 1 : n.slidesPerGroup; 3912 void 0 !== r[x + _] ? d >= r[x] && d < r[x + _] && (C = r[(w = x) + _] - r[x]) : d >= r[x] && (w = x, C = r[r.length - 1] - r[r.length - 2]) 3913 } 3914 v = (d - r[w]) / C, h = w < n.slidesPerGroupSkip - 1 ? 1 : n.slidesPerGroup; 3915 t > n.longSwipesMs ? n.longSwipes ? ("next" === e.swipeDirection && (v >= n.longSwipesRatio ? e.slideTo(w + h) : e.slideTo(w)), "prev" === e.swipeDirection && (v > 1 - n.longSwipesRatio ? e.slideTo(w + h) : e.slideTo(w))) : e.slideTo(e.activeIndex) : n.shortSwipes ? !e.navigation || c.target !== e.navigation.nextEl && c.target !== e.navigation.prevEl ? ("next" === e.swipeDirection && e.slideTo(w + h), "prev" === e.swipeDirection && e.slideTo(w)) : c.target === e.navigation.nextEl ? e.slideTo(w + h) : e.slideTo(w) : e.slideTo(e.activeIndex) 3916 } 3917 }.bind(this), e.cssMode && (this.onScroll = function() { 3918 var t = this.wrapperEl, 3919 e = this.rtlTranslate; 3920 this.previousTranslate = this.translate, this.isHorizontal() ? this.translate = e ? t.scrollWidth - t.offsetWidth - t.scrollLeft : -t.scrollLeft : this.translate = -t.scrollTop, -0 === this.translate && (this.translate = 0), this.updateActiveIndex(), this.updateSlidesClasses(), (0 == (t = this.maxTranslate() - this.minTranslate()) ? 0 : (this.translate - this.minTranslate()) / t) !== this.progress && this.updateProgress(e ? -this.translate : this.translate), this.emit
3920("setTranslate", this.translate, !1) 3921 }.bind(this)), this.onClick = function(t) { 3922 this.allowClick || (this.params.preventClicks && t.preventDefault(), this.params.preventClicksPropagation && this.animating && (t.stopPropagation(), t.stopImmediatePropagation())) 3923 }.bind(this); 3924 var r, l = !!e.nested; 3925 !a.touch && a.pointerEvents ? (n.addEventListener(i.start, this.onTouchStart, !1), t.addEventListener(i.move, this.onTouchMove, l), t.addEventListener(i.end, this.onTouchEnd, !1)) : (a.touch && (r = !("touchstart" !== i.start || !a.passiveListener || !e.passiveListeners) && { 3926 passive: !0, 3927 capture: !1 3928 }, n.addEventListener(i.start, this.onTouchStart, r), n.addEventListener(i.move, this.onTouchMove, a.passiveListener ? { 3929 passive: !1, 3930 capture: l 3931 } : l), n.addEventListener(i.end, this.onTouchEnd, r), i.cancel && n.addEventListener(i.cancel, this.onTouchEnd, r), z || (t.addEventListener("touchstart", A), z = !0)), (e.simulateTouch && !s.ios && !s.android || e.simulateTouch && !a.touch && s.ios) && (n.addEventListener("mousedown", this.onTouchStart, !1), t.addEventListener("mousemove", this.onTouchMove, l), t.addEventListener("mouseup", this.onTouchEnd, !1))), (e.preventClicks || e.preventClicksPropagation) && n.addEventListener("click", this.onClick, !0), e.cssMode && o.addEventListener("scroll", this.onScroll), e.updateOnWindowResize ? this.on(s.ios || s.android ? "resize orientationchange observerUpdate" : "resize observerUpdate", O, !0) : this.on("observerUpdate", O, !0) 3932 }, 3933 detachEvents: function() { 3934 var t, e = v(), 3935 i = this.params, 3936 n = this.touchEvents, 3937 o = this.el, 3938 s = this.wrapperEl, 3939 a = this.device, 3940 r = this.support, 3941 l = !!i.nested; 3942 !r.touch && r.pointerEvents ? (o.removeEventListener(n.start, this.onTouchStart, !1), e.removeEventListener(n.move, this.onTouchMove, l), e.removeEventListener(n.end, this.onTouchEnd, !1)) : (r.touch && (t = !("onTouchStart" !== n.start || !r.passiveListener || !i.passiveListeners) && { 3943 passive: !0, 3944 capture: !1 3945 }, o.removeEventListener(n.start, this.onTouchStart, t), o.removeEventListener(n.move, this.onTouchMove, l), o.removeEventListener(n.end, this.onTouchEnd, t), n.cancel && o.removeEventListener(n.cancel, this.onTouchEnd, t)), (i.simulateTouch && !a.ios && !a.android || i.simulateTouch && !r.touch && a.ios) && (o.removeEventListener("mousedown", this.onTouchStart, !1), e.removeEventListener("mousemove", this.onTouchMove, l), e.removeEventListener("mouseup", this.onTouchEnd, !1))), (i.preventClicks || i.preventClicksPropagation) && o.removeEventListener("click", this.onClick, !0), i.cssMode && s.removeEventListener("scroll", this.onScroll), this.off(a.ios || a.android ? "resize orientationchange observerUpdate" : "resize observerUpdate", O) 3946 } 3947 }, 3948 breakpoints: { 3949 setBreakpoint: function() { 3950 var t, i, e, n = this.activeIndex, 3951 o = this.initialized, 3952 s = this.loopedSlides, 3953 a = void 0 === s ? 0 : s, 3954 r = this.params, 3955 l = this.$el, 3956 c = r.breakpoints; 3957 c && 0 !== Object.keys(c).length && (t = this.getBreakpoint(c)) && this.currentBreakpoint !== t && ((i = t in c ? c[t] : void 0) && ["slidesPerView", "spaceBetween", "slidesPerGroup", "slidesPerGroupSkip", "slidesPerColumn"].forEach(function(t) { 3958 var e = i[t]; 3959 void 0 !== e && (i[t] = "slidesPerView" !== t || "AUTO" !== e && "auto" !== e ? "slidesPerView" === t ? parseFloat(e) : parseInt(e, 10) : "auto") 3960 }), e = i || this.originalParams, s = 1 < r.slidesPerColumn, c = 1 < e.slidesPerColumn, s && !c ? (l.removeClass(r.containerModifierClass + "multirow " + r.containerModifierClass + "multirow-column"), this.emitContainerClasses()) : !s && c && (l.addClass(r.containerModifierClass + "multirow"), "column" === e.slidesPerColumnFill && l.addClass(r.containerModifierClass + "multirow-column"), this.emitContainerClasses()), l = e.direction && e.direction !== r.direction, r = r.loop && (e.slidesPerView !== r.slidesPerView || l), l && o && this.changeDirection(), X(this.params, e), X(this, { 3961 allowTouchMove: this.params.allowTouchMove, 3962 allowSlideNext: this.params.allowSlideNext, 3963 allowSlidePrev: this.params.allowSlidePrev 3964 }
3964), this.currentBreakpoint = t, this.emit("_beforeBreakpoint", e), r && o && (this.loopDestroy(), this.loopCreate(), this.updateSlides(), this.slideTo(n - a + this.loopedSlides, 0, !1)), this.emit("breakpoint", e)) 3965 }, 3966 getBreakpoint: function(t) { 3967 var i = Y(); 3968 if (t) { 3969 var e = !1, 3970 n = Object.keys(t).map(function(t) { 3971 if ("string" != typeof t || 0 !== t.indexOf("@")) return { 3972 value: t, 3973 point: t 3974 }; 3975 var e = parseFloat(t.substr(1)); 3976 return { 3977 value: i.innerHeight * e, 3978 point: t 3979 } 3980 }); 3981 n.sort(function(t, e) { 3982 return parseInt(t.value, 10) - parseInt(e.value, 10) 3983 }); 3984 for (var o = 0; o < n.length; o += 1) { 3985 var s = n[o], 3986 a = s.point; 3987 s.value <= i.innerWidth && (e = a) 3988 } 3989 return e || "max" 3990 } 3991 } 3992 }, 3993 checkOverflow: { 3994 checkOverflow: function() { 3995 var t = this.params, 3996 e = this.isLocked, 3997 i = 0 < this.slides.length && t.slidesOffsetBefore + t.spaceBetween * (this.slides.length - 1) + this.slides[0].offsetWidth * this.slides.length; 3998 t.slidesOffsetBefore && t.slidesOffsetAfter && i ? this.isLocked = i <= this.size : this.isLocked = 1 === this.snapGrid.length, this.allowSlideNext = !this.isLocked, this.allowSlidePrev = !this.isLocked, e !== this.isLocked && this.emit(this.isLocked ? "lock" : "unlock"), e && e !== this.isLocked && (this.isEnd = !1, this.navigation && this.navigation.update()) 3999 } 4000 }, 4001 classes: { 4002 addClasses: function() { 4003 var e = this.classNames, 4004 i = this.params, 4005 t = this.rtl, 4006 n = this.$el, 4007 o = this.device, 4008 s = []; 4009 s.push("initialized"), s.push(i.direction), i.freeMode && s.push("free-mode"), i.autoHeight && s.push("autoheight"), t && s.push("rtl"), 1 < i.slidesPerColumn && (s.push("multirow"), "column" === i.slidesPerColumnFill && s.push("multirow-column")), o.android && s.push("android"), o.ios && s.push("ios"), i.cssMode && s.push("css-mode"), s.forEach(function(t) { 4010 e.push(i.containerModifierClass + t) 4011 }), n.addClass(e.join(" ")), this.emitContainerClasses() 4012 }, 4013 removeClasses: function() { 4014 var t = this.$el, 4015 e = this.classNames; 4016 t.removeClass(e.join(" ")), this.emitContainerClasses() 4017 } 4018 }, 4019 images: { 4020 loadImage: function(t, e, i, n, o, s) { 4021 var a = Y(); 4022 4023 function r() { 4024 s && s() 4025 }!(_(t).parent("picture")[0] || t.complete && o) && e ? ((a = new a.Image).onload = r, a.onerror = r, n && (a.sizes = n), i && (a.srcset = i), e && (a.src = e)) : r() 4026 }, 4027 preloadImages: function() { 4028 var t = this; 4029 4030 function e() { 4031 null != t && t && !t.destroyed && (void 0 !== t.imagesLoaded && (t.imagesLoaded += 1), t.imagesLoaded === t.imagesToLoad.length && (t.params.updateOnImagesReady && t.update(), t.emit("imagesReady"))) 4032 } 4033 t.imagesToLoad = t.$el.find("img"); 4034 for (var i = 0; i < t.imagesToLoad.length; i += 1) { 4035 var n = t.imagesToLoad[i]; 4036 t.loadImage(n, n.currentSrc || n.getAttribute("src"), n.srcset || n.getAttribute("srcset"), n.sizes || n.getAttribute("sizes"), !0, e) 4037 } 4038 } 4039 } 4040 }, 4041 N = {}, 4042 H = ((D = j.prototype).emitContainerClasses = function() { 4043 var t, e = this; 4044 e.params._emitClasses && e.el && (t = e.el.className.split(" ").filter(function(t) { 4045 return 0 === t.indexOf("swiper-container") || 0 === t.indexOf(e.params.containerModifierClass) 4046 }), e.emit("_containerClasses", t.join(" "))) 4047 }, D.emitSlidesClasses = function() { 4048 var i = this; 4049 i.params._emitClasses && i.el && i.slides.each(function(t) { 4050 var e = t.className.split(" ").filter(function(t) { 4051 return 0 === t.indexOf("swiper-slide") || 0 === t.indexOf(i.params.slideClass) 4052 }); 4053 i.emit("_slideClass", t, e.join(" ")) 4054 }) 4055 }, D.slidesPerViewDynamic = function() { 4056 var t = this.params, 4057 e = this.slides, 4058 i = this.slidesGrid, 4059 n = this.size, 4060 o = this.activeIndex, 4061 s = 1; 4062 if (t.centeredSlides) { 4063 for (var a, r = e[o].swiperSlideSize, l = o + 1; l < e.length; l += 1) e[l] && !a && (s += 1, (r += e[l].swiperSlideSize) > n && (a = !0)); 4064 for (var c = o - 1; 0 <= c; --c) e[c] && !a && (s += 1, (r += e[c].swiperSlideSize) > n && (a = !0)) 4065 } else 4066 for (var d = o + 1; d < e.length; d += 1) i[d] - i[o] < n && (s += 1); 4067 return s 4068 }, D.update = function() { 4069 var t, e, i = this; 4070 4071 function n() { 4072 var t = i.rtlTranslate ? -1 * i.translate : i.translate, 4073 t = Math.min(Math.max(t, i.maxTranslate()), i.minTranslate()); 4074 i.setTranslate(t), i.updateActiveIndex(), i.updateSlidesClasses() 4075 } 4076 i && !i.destroyed && (t = i.snapGrid, (e = i.params).breakpoints && i.setBreakpoint(), i.updateSize(), i.updateSlides(), i.updateProgress(), i.updateSlidesClasses(), i.params.freeMode ? (n(), i.params.autoHeight && i.updateAutoHeight()) : (("auto" === i.params.slidesPerView || 1 < i.params.slidesPerView) && i.isEnd && !i.params.centeredSlides ? i.slideTo(i.slides.length - 1, 0, !1, !0) : i.slideTo(i.activeIndex, 0, !1, !0)) || n(), e.watchOverflow && t !== i.snapGrid && i.checkOverflow(), i.emit("update")) 4077 }, D.changeDirection = function(e, t) { 4078 void 0 === t && (t = !0); 4079 var i = this.params.direction; 4080 return (e = e || ("horizontal" === i ? "vertical" : "horizontal")) === i || "horizontal" !== e && "vertical" !== e || (this.$el.removeClass("" + this.params.containerModifierClass + i
4080).addClass("" + this.params.containerModifierClass + e), this.emitContainerClasses(), this.params.direction = e, this.slides.each(function(t) { 4081 "vertical" === e ? t.style.width = "" : t.style.height = "" 4082 }), this.emit("changeDirection"), t && this.update()), this 4083 }, D.init = function() { 4084 this.initialized || (this.emit("beforeInit"), this.params.breakpoints && this.setBreakpoint(), this.addClasses(), this.params.loop && this.loopCreate(), this.updateSize(), this.updateSlides(), this.params.watchOverflow && this.checkOverflow(), this.params.grabCursor && this.setGrabCursor(), this.params.preloadImages && this.preloadImages(), this.params.loop ? this.slideTo(this.params.initialSlide + this.loopedSlides, 0, this.params.runCallbacksOnInit) : this.slideTo(this.params.initialSlide, 0, this.params.runCallbacksOnInit), this.attachEvents(), this.initialized = !0, this.emit("init")) 4085 }, D.destroy = function(t, e) { 4086 void 0 === t && (t = !0), void 0 === e && (e = !0); 4087 var i, n = this, 4088 o = n.params, 4089 s = n.$el, 4090 a = n.$wrapperEl, 4091 r = n.slides; 4092 return void 0 === n.params || n.destroyed || (n.emit("beforeDestroy"), n.initialized = !1, n.detachEvents(), o.loop && n.loopDestroy(), e && (n.removeClasses(), s.removeAttr("style"), a.removeAttr("style"), r && r.length && r.removeClass([o.slideVisibleClass, o.slideActiveClass, o.slideNextClass, o.slidePrevClass].join(" ")).removeAttr("style").removeAttr("data-swiper-slide-index")), n.emit("destroy"), Object.keys(n.eventsListeners).forEach(function(t) { 4093 n.off(t) 4094 }), !1 !== t && (n.$el[0].swiper = null, i = n, Object.keys(i).forEac
4094h(function(t) { 4095 try { 4096 i[t] = null 4097 } catch (t) {} 4098 try { 4099 delete i[t] 4100 } catch (t) {} 4101 })), n.destroyed = !0), null 4102 }, j.extendDefaults = function(t) { 4103 X(N, t) 4104 }, j.installModule = function(t) { 4105 j.prototype.modules || (j.prototype.modules = {}); 4106 var e = t.name || Object.keys(j.prototype.modules).length + "_" + T(); 4107 j.prototype.modules[e] = t 4108 }, j.use = function(t) { 4109 return Array.isArray(t) ? t.forEach(function(t) { 4110 return j.installModule(t) 4111 }) : j.installModule(t), j 4112 }, P = j, D = [{ 4113 key: "extendedDefaults", 4114 get: function() { 4115 return N 4116 } 4117 }, { 4118 key: "defaults", 4119 get: function() { 4120 return L 4121 } 4122 }], null && t(P.prototype, null), t(P, D), j); 4123 4124 function j() { 4125 for (var i, t = arguments.length, e = new Array(t), n = 0; n < t; n++) e[n] = arguments[n]; 4126 i = X({}, i = (i = 1 === e.length && e[0].constructor && e[0].constructor === Object ? e[0] : (b = e[0], e[1])) || {}), b && !i.el && (i.el = b); 4127 var o, s, a, r, l, c, d, u, h, p, f, m = this; 4128 m.support = $(), m.device = (void 0 === (o = { 4129 userAgent: i.userAgent 4130 }) && (o = {}), C || (s = (void 0 === o ? {} : o).userAgent, a = $(), r = Y(), l = r.navigator.platform, c = s || r.navigator.userAgent, d = { 4131 ios: !1, 4132 android: !1 4133 }, u = r.screen.width, h = r.screen.height, p = c.match(/(Android);?[\s\/]+([\d.]+)?/), f = c.match(/(iPad).*OS\s([\d_]+)/), o = c.match(/(iPod)(.*OS\s([\d_]+))?/), s = !f && c.match(/(iPhone\sOS|iOS)\s([\d_]+)/), r = "Win32" === l, l = "MacIntel" === l, !f && l && a.touch && 0 <= ["1024x1366", "1366x1024", "834x1194", "1194x834", "834x1112", "1112x834", "768x1024", "1024x768"].indexOf(u + "x" + h) && ((f = c.match(/(Version)\/([\d.]+)/)) || (f = [0, 1, "13_0_0"]), l = !1), p && !r && (d.os = "android", d.android = !0), (f || s || o) && (d.os = "ios", d.ios = !0), C = d), C), m.browser = (x || (g = Y(), x = { 4134 isEdge: !!g.navigator.userAgent.match(/Edge/g), 4135 isSafari: 0 <= (d = g.navigator.userAgent.toLowerCase()).indexOf("safari") && d.indexOf("chrome") < 0 && d.indexOf("android") < 0, 4136 isWebView: /(iPhone|iPod|iPad).*AppleWebKit(?!.*Safari)/i.test(g.navigator.userAgent) 4137 }), x), m.eventsListeners = {}, m.eventsAnyListeners = [], void 0 === m.modules && (m.modules = {}), Object.keys(m.modules).forEach(function(t) { 4138 var e = m.modules[t]; 4139 e.params && (t = Object.keys(e.params)[0], "object" == typeof(e = e.params[t]) && null !== e && t in i && "enabled" in e && (!0 === i[t] && (i[t] = { 4140 enabled: !0 4141 }), "object" != typeof i[t] || "enabled" in i[t] || (i[t].enabled = !0), i[t] || (i[t] = { 4142 enabled: !1 4143 }))) 4144 }); 4145 var g = X({}, L); 4146 m.useParams(g), m.params = X({}, g, N, i), m.originalParams = X({}, m.params), m.passedParams = X({}, i), m.params && m.params.on && Object.keys(m.params.on).forEac
4146h(function(t) { 4147 m.on(t, m.params.on[t]) 4148 }), m.params && m.params.onAny && m.onAny(m.params.onAny); 4149 var v, b, y = (m.$ = _)(m.params.el); 4150 if (b = y[0]) { 4151 if (1 < y.length) { 4152 var w = []; 4153 return y.each(function(t) { 4154 t = X({}, i, { 4155 el: t 4156 }); 4157 w.push(new j(t)) 4158 }), w 4159 } 4160 return b.swiper = m, b && b.shadowRoot && b.shadowRoot.querySelector ? (v = _(b.shadowRoot.querySelector("." + m.params.wrapperClass))).children = function(t) { 4161 return y.children(t) 4162 } : v = y.children("." + m.params.wrapperClass), X(m, { 4163 $el: y, 4164 el: b, 4165 $wrapperEl: v, 4166 wrapperEl: v[0], 4167 classNames: [], 4168 slides: _(), 4169 slidesGrid: [], 4170 snapGrid: [], 4171 slidesSizesGrid: [], 4172 isHorizontal: function() { 4173 return "horizontal" === m.params.direction 4174 }, 4175 isVertical: function() { 4176 return "vertical" === m.params.direction 4177 }, 4178 rtl: "rtl" === b.dir.toLowerCase() || "rtl" === y.css("direction"), 4179 rtlTranslate: "horizontal" === m.params.direction && ("rtl" === b.dir.toLowerCase() || "rtl" === y.css("direction")), 4180 wrongRTL: "-webkit-box" === v.css("display"), 4181 activeIndex: 0, 4182 realIndex: 0, 4183 isBeginning: !0, 4184 isEnd: !1, 4185 translate: 0, 4186 previousTranslate: 0, 4187 progress: 0, 4188 velocity: 0, 4189 animating: !1, 4190 allowSlideNext: m.params.allowSlideNext, 4191 allowSlidePrev: m.params.allowSlidePrev, 4192 touchEvents: (b = ["mousedown", "mousemove", "mouseup"], m.support.pointerEvents && (b = ["pointerdown", "pointermove", "pointerup"]), m.touchEventsTouch = { 4193 start: (v = ["touchstart", "touchmove", "touchend", "touchcancel"])[0], 4194 move: v[1], 4195 end: v[2], 4196 cancel: v[3] 4197 }, m.touchEventsDesktop = { 4198 start: b[0], 4199 move: b[1], 4200 end: b[2] 4201 }, m.support.touch || !m.params.simulateTouch ? m.touchEventsTouch : m.touchEventsDesktop), 4202 touchEventsData: { 4203 isTouched: void 0, 4204 isMoved: void 0, 4205 allowTouchCallbacks: void 0, 4206 touchStartTime: void 0, 4207 isScrolling: void 0, 4208 currentTranslate: void 0, 4209 startTranslate: void 0, 4210 allowThresholdMove: void 0, 4211 formElements: "input, select, option, textarea, button, video, label", 4212 lastClickTime: T(), 4213 clickTimeout: void 0, 4214 velocities: [], 4215 allowMomentumBounce: void 0, 4216 isTouchEvent: void 0, 4217 startMoving: void 0 4218 }, 4219 allowClick: !0, 4220 allowTouchMove: m.params.allowTouchMove, 4221 touches: { 4222 startX: 0, 4223 startY: 0, 4224 currentX: 0, 4225 currentY: 0, 4226 diff: 0 4227 }, 4228 imagesToLoad: [], 4229 imagesLoaded: 0 4230 }), m.useModules(), m.emit("_swiper"), m.params.init && m.init(), m 4231 } 4232 } 4233 Object.keys(M).forEach(function(e) { 4234 Object.keys(M[e]).forEach(function(t) { 4235 H.prototype[t] = M[e][t] 4236 }) 4237 }), H.use([E, I]); 4238 var B = { 4239 update: function(t) { 4240 var e = this, 4241 i = e.params, 4242 n = i.slidesPerView, 4243 o = i.slidesPerGroup, 4244 s = i.centeredSlides, 4245 a = e.params.virtual, 4246 r = a.addSlidesBefore, 4247 l = a.addSlidesAfter, 4248 c = e.virtual, 4249 d = c.from, 4250 u = c.to, 4251 h = c.slides, 4252 p = c.slidesGrid, 4253 f = c.renderSlide, 4254 i = c.offset; 4255 e.updateActiveIndex(); 4256 var a = e.activeIndex || 0, 4257 c = e.rtlTranslate ? "right" : e.isHorizontal() ? "left" : "top", 4258 r = s ? (v = Math.floor(n / 2) + o + l, Math.floor(n / 2) + o + r) : (v = n + (o - 1) + l, o + r), 4259 m = Math.max((a || 0) - r, 0), 4260 g = Math.min((a || 0) + v, h.length - 1), 4261 v = (e.slidesGrid[m] || 0) - (e.slidesGrid[0] || 0); 4262 4263 function b() { 4264 e.updateSlides(), e.updateProgress(), e.updateSlidesClasses(), e.lazy && e.params.lazy.enabled && e.lazy.load() 4265 } 4266 if (X(e.virtual, { 4267 from: m, 4268 to: g, 4269 offset: v, 4270 slidesGrid: e.slidesGrid 4271 }), d === m && u === g && !t) return e.slidesGrid !== p && v !== i && e.slides.css(c, v + "px"), void e.updateProgress(); 4272 if (e.params.virtual.renderExternal) return e.params.virtual.renderExternal.call(e, { 4273 offset: v, 4274 from: m, 4275 to: g, 4276 slides: function() { 4277 for (var t = [], e = m; e <= g; e += 1) t.push(h[e]); 4278 return t 4279 }() 4280 }), void(e.params.virtual.renderExternalUpdate && b()); 4281 var y = [], 4282 w = []; 4283 if (t) e.$wrapperEl.find("." + e.params.slideClass).remove(); 4284 else 4285 for (var C = d; C <= u; C += 1)(C < m || g < C) && e.$wrapperEl.find("." + e.params.slideClass + '[data-swiper-slide-index="' + C + '"]').remove(); 4286 for (var x = 0; x < h.length; x += 1) m <= x && x <= g && (void 0 === u || t ? w.push(x) : (u < x && w.push(x), x < d && y.push(x)));
4287 w.forEach(function(t) { 4288 e.$wrapperEl.append(f(h[t], t)) 4289 }), y.sort(function(t, e) { 4290 return e - t 4291 }).forEach(function(t) { 4292 e.$wrapperEl.prepend(f(h[t], t)) 4293 }), e.$wrapperEl.children(".swiper-slide").css(c, v + "px"), b() 4294 }, 4295 renderSlide: function(t, e) { 4296 var i = this.params.virtual; 4297 if (i.cache && this.virtual.cache[e]) return this.virtual.cache[e]; 4298 t = i.renderSlide ? _(i.renderSlide.call(this, t, e)) : _('<div class="' + this.params.slideClass + '" data-swiper-slide-index="' + e + '">' + t + "</div>"); 4299 return t.attr("data-swiper-slide-index") || t.attr("data-swiper-slide-index", e), i.cache && (this.virtual.cache[e] = t), t 4300 }, 4301 appendSlide: function(t) { 4302 if ("object" == typeof t && "length" in t) 4303 for (var e = 0; e < t.length; e += 1) t[e] && this.virtual.slides.push(t[e]); 4304 else this.virtual.slides.push(t); 4305 this.virtual.update(!0) 4306 }, 4307 prependSlide: function(t) { 4308 var n, o, e = this.activeIndex, 4309 i = e + 1, 4310 s = 1; 4311 if (Array.isArray(t)) { 4312 for (var a = 0; a < t.length; a += 1) t[a] && this.virtual.slides.unshift(t[a]); 4313 i = e + t.length, s = t.length 4314 } else this.virtual.slides.unshift(t); 4315 this.params.virtual.cache && (n = this.virtual.cache, o = {}, Object.keys(n).forEach(function(t) { 4316 var e = n[t], 4317 i = e.attr("data-swiper-slide-index"); 4318 i && e.attr("data-swiper-slide-index", parseInt(i, 10) + 1), o[parseInt(t, 10) + s] = e 4319 }), this.virtual.cache = o), this.virtual.update(!0), this.slideTo(i, 0) 4320 }, 4321 removeSlide: function(t) { 4322 if (null != t) { 4323 var e = this.activeIndex; 4324 if (Array.isArray(t)) 4325 for (var i = t.length - 1; 0 <= i; --i) this.virtual.slides.splice(t[i], 1), this.params.virtual.cache && delete this.virtual.cache[t[i]], t[i] < e && --e, e = Math.max(e, 0); 4326 else this.virtual.slides.splice(t, 1), this.params.virtual.cache && delete this.virtual.cache[t], t < e && --e, e = Math.max(e, 0); 4327 this.virtual.update(!0), this.slideTo(e, 0) 4328 } 4329 }, 4330 removeAllSlides: function() { 4331 this.virtual.slides = [], this.params.virtual.cache && (this.virtual.cache = {}), this.virtual.update(!0), this.slideTo(0, 0) 4332 } 4333 }, 4334 E = { 4335 name: "virtual", 4336 params: { 4337 virtual: { 4338 enabled: !1, 4339 slides: [], 4340 cache: !0, 4341 renderSlide: null, 4342 renderExternal: null, 4343 renderExternalUpdate: !0, 4344 addSlidesBefore: 0, 4345 addSlidesAfter: 0 4346 } 4347 }, 4348 create: function() { 4349 w(this, { 4350 virtual: e(e({}, B), {}, { 4351 slides: this.params.virtual.slides, 4352 cache: {} 4353 }) 4354 }) 4355 }, 4356 on: { 4357 beforeInit: function(t) { 4358 var e; 4359 t.params.virtual.enabled && (t.classNames.push(t.params.containerModifierClass + "virtual"), X(t.params, e = { 4360 watchSlidesProgress: !0 4361 }), X(t.originalParams, e), t.params.initialSlide || t.virtual.update(
4361)) 4362 }, 4363 setTranslate: function(t) { 4364 t.params.virtual.enabled && t.virtual.update() 4365 } 4366 } 4367 }, 4368 R = { 4369 handle: function(t) { 4370 var e = Y(), 4371 i = v(), 4372 n = this.rtlTranslate, 4373 o = t, 4374 s = (o = o.originalEvent ? o.originalEvent : o).keyCode || o.charCode, 4375 a = this.params.keyboard.pageUpDown, 4376 r = a && 33 === s, 4377 l = a && 34 === s, 4378 c = 37 === s, 4379 d = 39 === s, 4380 t = 38 === s, 4381 a = 40 === s; 4382 if (!this.allowSlideNext && (this.isHorizontal() && d || this.isVertical() && a || l)) return !1; 4383 if (!this.allowSlidePrev && (this.isHorizontal() && c || this.isVertical() && t || r)) return !1; 4384 if (!(o.shiftKey || o.altKey || o.ctrlKey || o.metaKey || i.activeElement && i.activeElement.nodeName && ("input" === i.activeElement.nodeName.toLowerCase() || "textarea" === i.activeElement.nodeName.toLowerCase()))) { 4385 if (this.params.keyboard.onlyInViewport && (r || l || c || d || t || a)) { 4386 var u = !1; 4387 if (0 < this.$el.parents("." + this.params.slideClass).length && 0 === this.$el.parents("." + this.params.slideActiveClass).length) return; 4388 var h = e.innerWidth, 4389 p = e.innerHeight, 4390 e = this.$el.offset(); 4391 n && (e.left -= this.$el[0].scrollLeft); 4392 for (var f = [ 4393 [e.left, e.top], 4394 [e.left + this.width, e.top], 4395 [e.left, e.top + this.height], 4396 [e.left + this.width, e.top + this.height] 4397 ], m = 0; m < f.length; m += 1) { 4398 var g = f[m]; 4399 0 <= g[0] && g[0] <= h && 0 <= g[1] && g[1] <= p && (u = !0) 4400 } 4401 if (!u) return 4402 } 4403 this.isHorizontal() ? ((r || l || c || d) && (o.preventDefault ? o.preventDefault() : o.returnValue = !1), ((l || d) && !n || (r || c) && n) && this.slideNext(), ((r || c) && !n || (l || d) && n) && this.slidePrev()) : ((r || l || t || a) && (o.preventDefault ? o.preventDefault() : o.returnValue = !1), (l || a) && this.slideNext(), (r || t) && this.slidePrev()), this.emit("keyPress", s) 4404 } 4405 }, 4406 enable: function() { 4407 var t = v(); 4408 this.keyboard.enabled || (_(t).on("keydown", this.keyboard.handle), this.keyboard.enabled = !0) 4409 }, 4410 disable: function() { 4411 var t = v(); 4412 this.keyboard.enabled && (_(t).off("keydown", this.keyboard.handle), this.keyboard.enabled = !1) 4413 } 4414 }, 4415 I = { 4416 name: "keyboard", 4417 params: { 4418 keyboard: { 4419 enabled: !1, 4420 onlyInViewport: !0, 4421 pageUpDown: !0 4422 } 4423 }, 4424 create: function() { 4425 w(this, { 4426 keyboard: e({ 4427 enabled: !1 4428 }, R) 4429 }) 4430 }, 4431 on: { 4432 init: function(t) { 4433 t.params.keyboard.enabled && t.keyboard.enable() 4434 }, 4435 destroy: function(t) { 4436 t.keyboard.enabled && t.keyboard.disable() 4437 } 4438 } 4439 }, 4440 W = { 4441 lastScrollTime: T(), 4442 lastEventBeforeSnap: void 0, 4443 recentWheelEvents: [], 4444 event: function() { 4445 return -1 < Y().navigator.userAgent.indexOf("firefox") ? "DOMMouseScroll" : (e = v(), (i = "onwheel" in e) || ((t = e.createElement("div")).setAttribute("onwheel", "return;"), i = "function" == typeof t.onwheel), (i = !i && e.implementation && e.implementation.hasFeature && !0 !== e.implementation.hasFeature("", "") ? e.implementation.hasFeature("Events.wheel", "3.0") : i) ? "wheel" : "mousewheel"); 4446 var t, e, i 4447 }, 4448 normalize: function(t) { 4449 var e = 0, 4450 i = 0, 4451 n = 0, 4452 o = 0; 4453 return "detail" in t && (i = t.detail), "wheelDelta" in t && (i = -t.wheelDelta / 120), "wheelDeltaY" in t && (i = -t.wheelDeltaY / 120), "wheelDeltaX" in t && (e = -t.wheelDeltaX / 120), "axis" in t && t.axis === t.HORIZONTAL_AXIS && (e = i, i = 0), n = 10 * e, o = 10 * i, "deltaY" in t && (o = t.deltaY), "deltaX" in t && (n = t.deltaX), t.shiftKey && !n && (n = o, o = 0), (n || o) && t.deltaMode && (1 === t.deltaMode ? (n *= 40, o *= 40) : (n *= 800, o *= 800)), { 4454 spinX: e = n && !e ? n < 1 ? -1 : 1 : e, 4455 spinY: i = o && !i ? o < 1 ? -1 : 1 : i, 4456 pixelX: n, 4457 pixelY: o 4458 } 4459 }, 4460 handleMouseEnter: function() { 4461 this.mouseEntered = !0 4462 }, 4463 handleMouseLeave: function() { 4464 this.mouseEntered = !1 4465 }, 4466 handle: function(t) { 4467 var e = t, 4468 i = this, 4469 n = i.params.mousewheel; 4470 i.params.cssMode && e.preventDefault(); 4471 var o = i.$el; 4472 if ("container" !== i.params.mousewheel.eventsTarget && (o = _(i.params.mousewheel.eventsTarget)), !i.mouseEntered && !o[0].contains(e.target) && !n.releaseOnEdges) return !0; 4473 e.originalEvent && (e = e.originalEvent); 4474 var s = 0, 4475 a = i.rtlTranslate ? -1 : 1, 4476 o = W.normalize(e); 4477 if (n.forceToAxis) 4478 if (i.isHorizontal()) { 4479 if (!(Math.abs(o.pixelX) > Math.abs(o.pixelY))) return !0;
4480 s = -o.pixelX * a 4481 } else { 4482 if (!(Math.abs(o.pixelY) > Math.abs(o.pixelX))) return !0; 4483 s = -o.pixelY 4484 } 4485 else s = Math.abs(o.pixelX) > Math.abs(o.pixelY) ? -o.pixelX * a : -o.pixelY; 4486 if (0 === s) return !0; 4487 if (n.invert && (s = -s), i.params.freeMode) { 4488 var r = { 4489 time: T(), 4490 delta: Math.abs(s), 4491 direction: Math.sign(s) 4492 }, 4493 a = i.mousewheel.lastEventBeforeSnap, 4494 o = a && r.time < a.time + 500 && r.delta <= a.delta && r.direction === a.direction; 4495 if (!o) { 4496 i.mousewheel.lastEventBeforeSnap = void 0, i.params.loop && i.loopFix(); 4497 var l, c, d = i.getTranslate() + s * n.sensitivity, 4498 a = i.isBeginning, 4499 n = i.isEnd; 4500 if ((d = d >= i.minTranslate() ? i.minTranslate() : d) <= i.maxTranslate() && (d = i.maxTranslate()), i.setTransition(0), i.setTranslate(d), i.updateProgress(), i.updateActiveIndex(), i.updateSlidesClasses(), (!a && i.isBeginning || !n && i.isEnd) && i.updateSlidesClasses(), i.params.freeModeSticky && (clearTimeout(i.mousewheel.timeout), i.mousewheel.timeout = void 0, 15 <= (l = i.mousewheel.recentWheelEvents).length && l.shift(), a = l.length ? l[l.length - 1] : void 0, n = l[0], l.push(r), a && (r.delta > a.delta || r.direction !== a.direction) ? l.splice(0) : 15 <= l.length && r.time - n.time < 500 && 1 <= n.delta - r.delta && r.delta <= 6 && (c = 0 < s ? .8 : .2, i.mousewheel.lastEventBeforeSnap = r, l.splice(0), i.mousewheel.timeout = S(function() { 4501 i.slideToClosest(i.params.speed, !0, void 0, c) 4502 }, 0)), i.mousewheel.timeout || (i.mousewheel.timeout = S(function() { 4503 i.mousewheel.lastEventBeforeSnap = r, l.splice(0), i.slideToClosest(i.params.speed, !0, void 0, .5) 4504 }, 500))), o || i.emit("scroll", e), i.params.autoplay && i.params.autoplayDisableOnInteraction && i.autoplay.stop(), d === i.minTranslate() || d === i.maxTranslate()) return !0 4505 } 4506 } else { 4507 d = { 4508 time: T(), 4509 delta: Math.abs(s), 4510 direction: Math.sign(s), 4511 raw: t 4512 }, s = i.mousewheel.recentWheelEvents; 4513 2 <= s.length && s.shift(); 4514 t = s.length ? s[s.length - 1] : void 0; 4515 if (s.push(d), (!t || d.direction !== t.direction || d.delta > t.delta || d.time > t.time + 150) && i.mousewheel.animateSlider(d), i.mousewheel.releaseScroll(d)) return !0 4516 } 4517 return e.preventDefault ? e.preventDefault() : e.returnValue = !1, !1 4518 }, 4519 animateSlider: function(t) { 4520 var e = Y(); 4521 return !(this.params.mousewheel.thresholdDelta && t.delta < this.params.mousewheel.thresholdDelta || this.params.mousewheel.thresholdTime && T() - this.mousewheel.lastScrollTime < this.params.mousewheel.thresholdTime || !(6 <= t.delta && T() - this.mousewheel.lastScrollTime < 60) && (t.direction < 0 ? this.isEnd && !this.params.loop || this.animating || (this.slideNext(), this.emit("scroll", t.raw)) : this.isBeginning && !this.params.loop || this.animating || (this.slidePrev(), this.emit("scroll", t.raw)), this.mousewheel.lastScrollTime = (new e.Date).getTime(), 1)) 4522 }, 4523 releaseScroll: function(t) { 4524 var e = this.params.mousewheel; 4525 if (t.direction < 0) { 4526 if (this.isEnd && !this.params.loop && e.releaseOnEdges) return !0 4527 } else if (this.isBeginning && !this.params.loop && e.releaseOnEdges) return !0; 4528 return !1 4529 }, 4530 enable: function() { 4531 var t = W.event(); 4532 if (this.params.cssMode) return this.wrapperEl.removeEventListener(t, this.mousewheel.handle), !0; 4533 if (!t) return !1; 4534 if (this.mousewheel.enabled) return !1; 4535 var e = this.$el; 4536 return (e = "container" !== this.params.mousewheel.eventsTarget ? _(this.params.mousewheel.eventsTarget) : e).on("mouseenter", this.mousewheel.handleMouseEnter), e.on("mouseleave", this.mousewheel.handleMouseLeave), e.on(t, this.mousewheel.handle), this.mousewheel.enabled = !0 4537 }, 4538 disable: function() { 4539 var t = W.event(); 4540 if (this.params.cssMode) return this.wrapperEl.addEventListener(t, this.mousewheel.handle), !0; 4541 if (!t) return !1; 4542 if (!this.mousewheel.enabled) return !1; 4543 var e = this.$el; 4544 return (e = "container" !== this.params.mousewheel.eventsTarget ? _(this.params.mousewheel.eventsTarget) : e).off(t, this.mousewheel.handle), !(this.mousewheel.enabled = !1) 4545 } 4546 }, 4547 F = { 4548 update: function() { 4549 var t, e, i = this.params.navigation; 4550 this.params.loop || (t = (e = this.navigation).$nextEl, (e = e.$prevEl) && 0 < e.length && (this.isBeg
4550inning ? e.addClass(i.disabledClass) : e.removeClass(i.disabledClass), e[this.params.watchOverflow && this.isLocked ? "addClass" : "removeClass"](i.lockClass)), t && 0 < t.length && (this.isEnd ? t.addClass(i.disabledClass) : t.removeClass(i.disabledClass), t[this.params.watchOverflow && this.isLocked ? "addClass" : "removeClass"](i.lockClass))) 4551 }, 4552 onPrevClick: function(t) { 4553 t.preventDefault(), this.isBeginning && !this.params.loop || this.slidePrev() 4554 }, 4555 onNextClick: function(t) { 4556 t.preventDefault(), this.isEnd && !this.params.loop || this.slideNext() 4557 }, 4558 init: function() { 4559 var t, e, i = this.params.navigation; 4560 (i.nextEl || i.prevEl) && (i.nextEl && (t = _(i.nextEl), this.params.uniqueNavElements && "string" == typeof i.nextEl && 1 < t.length && 1 === this.$el.find(i.nextEl).length && (t = this.$el.find(i.nextEl))), i.prevEl && (e = _(i.prevEl), this.params.uniqueNavElements && "string" == typeof i.prevEl && 1 < e.length && 1 === this.$el.find(i.prevEl).length && (e = this.$el.find(i.prevEl))), t && 0 < t.length && t.on("click", this.navigation.onNextClick), e && 0 < e.length && e.on("click", this.navigation.onPrevClick), X(this.navigation, { 4561 $nextEl: t, 4562 nextEl: t && t[0], 4563 $prevEl: e, 4564 prevEl: e && e[0] 4565 })) 4566 }, 4567 destroy: function() { 4568 var t = this.navigation, 4569 e = t.$nextEl, 4570 t = t.$prevEl; 4571 e && e.length && (e.off("click", this.navigation.onNextClick), e.removeClass(this.params.navigation.disabledClass)), t && t.length && (t.off("click", this.navigation.onPrevClick), t.removeClass(this.params.navigation.disabledClass)) 4572 } 4573 }, 4574 q = { 4575 update: function() { 4576 var t = this.rtl, 4577 i = this.params.pagination; 4578 if (i.el && this.pagination.el && this.pagination.$el && 0 !== this.pagination.$el.length) { 4579 var n, e = (this.virtual && this.params.virtual.enabled ? this.virtual : this).slides.length, 4580 o = this.pagination.$el, 4581 s = this.params.loop ? Math.ceil((e - 2 * this.loopedSlides) / this.params.slidesPerGroup) : this.snapGrid.length; 4582 if (this.params.loop ? ((n = Math.ceil((this.activeIndex - this.loopedSlides) / this.params.slidesPerGroup)) > e - 1 - 2 * this.loopedSlides && (n -= e - 2 * this.loopedSlides), s - 1 < n && (n -= s), n < 0 && "bullets" !== this.params.paginationType && (n = s + n)) : n = void 0 !== this.snapIndex ? this.snapIndex : this.activeIndex || 0, "bullets" === i.type && this.pagination.bullets && 0 < this.pagination.bullets.length) { 4583 var a, r, l, c, d, u = this.pagination.bullets; 4584 if (i.dynamicBullets && (this.pagination.bulletSize = u.eq(0)[this.isHorizontal() ? "outerWidth" : "outerHeight"](!0), o.css(this.isHorizontal() ? "width" : "height", this.pagination.bulletSize * (i.dynamicMainBullets + 4) + "px"), 1 < i.dynamicMainBullets && void 0 !== this.previousIndex && (this.pagination.dynamicBulletIndex += n - this.previousIndex, this.pagination.dynamicBulletIndex > i.dynamicMainBullets - 1 ? this.pagination.dynamicBulletIndex = i.dynamicMainBullets - 1 : this.pagination.dynamicBulletIndex < 0 && (this.pagination.dynamicBulletIndex = 0)), a = n - this.pagination.dynamicBulletIndex, l = ((r = a + (Math.min(u.length, i.dynamicMainBullets) - 1)) + a) / 2), u.removeClass(i.bulletActiveClass + " " + i.bulletActiveClass + "-next " + i.bulletActiveClass + "-next-next " + i.bulletActiveClass + "-prev " + i.bulletActiveClass + "-prev-prev " + i.bulletActiveClass + "-main"), 1 < o.length) u.each(function(t) { 4585 var e = _(t), 4586 t = e.index(); 4587 t === n && e.addClass(i.bulletActiveClass), i.dynamicBullets && (a <= t && t <= r && e.addClass(i.bulletActiveClass + "-main"), t === a && e.prev().addClass(i.bulletActiveClass + "-prev").prev().addClass(i.bulletActiveClass + "-prev-prev"), t === r && e.next().addClass(i.bulletActiveClass + "-next").next().addClass(i.bulletActiveClass + "-next-next")) 4588 }); 4589 else { 4590 var h = u.eq(n), 4591 p = h.index(); 4592 if (h.addClass(i.bulletActiveClass), i.dynamicBullets) { 4593 for (var e = u.eq(a), h = u.eq(r), f = a;
4593 f <= r; f += 1) u.eq(f).addClass(i.bulletActiveClass + "-main"); 4594 if (this.params.loop) 4595 if (p >= u.length - i.dynamicMainBullets) { 4596 for (var m = i.dynamicMainBullets; 0 <= m; --m) u.eq(u.length - m).addClass(i.bulletActiveClass + "-main"); 4597 u.eq(u.length - i.dynamicMainBullets - 1).addClass(i.bulletActiveClass + "-prev") 4598 } else e.prev().addClass(i.bulletActiveClass + "-prev").prev().addClass(i.bulletActiveClass + "-prev-prev"), h.next().addClass(i.bulletActiveClass + "-next").next().addClass(i.bulletActiveClass + "-next-next"); 4599 else e.prev().addClass(i.bulletActiveClass + "-prev").prev().addClass(i.bulletActiveClass + "-prev-prev"), h.next().addClass(i.bulletActiveClass + "-next").next().addClass(i.bulletActiveClass + "-next-next") 4600 } 4601 } 4602 i.dynamicBullets && (d = Math.min(u.length, i.dynamicMainBullets + 4), c = (this.pagination.bulletSize * d - this.pagination.bulletSize) / 2 - l * this.pagination.bulletSize, d = t ? "right" : "left", u.css(this.isHorizontal() ? d : "top", c + "px")) 4603 } 4604 "fraction" === i.type && (o.find("." + i.currentClass).text(i.formatFractionCurrent(n + 1)), o.find("." + i.totalClass).text(i.formatFractionTotal(s))), "progressbar" === i.type && (l = i.progressbarOpposite ? this.isHorizontal() ? "vertical" : "horizontal" : this.isHorizontal() ? "horizontal" : "vertical", t = (n + 1) / s, c = d = 1, "horizontal" == l ? d = t : c = t, o.find("." + i.progressbarFillClass).transform("translate3d(0,0,0) scaleX(" + d + ") scaleY(" + c + ")").transition(this.params.speed)), "custom" === i.type && i.renderCustom ? (o.html(i.renderCustom(this, n + 1, s)), this.emit("paginationRender", o[0])) : this.emit("paginationUpdate", o[0]), o[this.params.watchOverflow && this.isLocked ? "addClass" : "removeClass"](i.lockClass) 4605 } 4606 }, 4607 render: function() { 4608 var t = this.params.pagination; 4609 if (t.el && this.pagination.el && this.pagination.$el && 0 !== this.pagination.$el.length) { 4610 var e = (this.virtual && this.params.virtual.enabled ? this.virtual : this).slides.length, 4611 i = this.pagination.$el, 4612 n = ""; 4613 if ("bullets" === t.type) { 4614 for (var o = this.params.loop ? Math.ceil((e - 2 * this.loopedSlides) / this.params.slidesPerGroup) : this.snapGrid.length, s = 0; s < o; s += 1) t.renderBullet ? n += t.renderBullet.call(this, s, t.bulletClass) : n += "<" + t.bulletElement + ' class="' + t.bulletClass + '"></' + t.bulletElement + ">"; 4615 i.html(n), this.pagination.bullets = i.find("." + t.bulletClass) 4616 } 4617 "fraction" === t.type && (n = t.renderFraction ? t.renderFraction.call(this, t.currentClass, t.totalClass) : '<span class="' + t.currentClass + '"></span> / <span class="' + t.totalClass + '"></span>', i.html(n)), "progressbar" === t.type && (n = t.renderProgressbar ? t.renderProgressbar.call(this, t.progressbarFillClass) : '<span class="' + t.progressbarFillClass + '"></span>', i.html(n)), "custom" !== t.type && this.emit("paginationRender", this.pagination.$el[0]) 4618 } 4619 }, 4620 init: function() { 4621 var t, e = this, 4622 i = e.params.pagination; 4623 !i.el || 0 !== (t = _(i.el)).length && (e.params.uniqueNavElements && "string" == typeof i.el && 1 < t.length && (t = e.$el.find(i.el)), "bullets" === i.type && i.clickable && t.addClass(i.clickableClass), t.addClass(i.modifierClass + i.type), "bullets" === i.type && i.dynamicBullets && (t.addClass("" + i.modifierClass + i.type + "-dynamic"), e.pagination.dynamicBulletIndex = 0, i.dynamicMainBullets < 1 && (i.dynamicMainBullets = 1)), "progressbar" === i.type && i.progressbarOpposite && t.addClass(i.progressbarOppositeClass), i.clickable && t.on("click", "." + i.bulletClass, function(t) { 4624 t.preventDefault(); 4625 t = _(this).index() * e.params.slidesPerGroup; 4626 e.params.loop && (t += e.loopedSlides), e.slideTo(t) 4627 }), X(e.pagination, { 4628 $el: t, 4629 el: t[0] 4630 })) 4631 }, 4632 destroy: function() { 4633 var t, e = this.params.pagination; 4634 e.el && this.pagination.el && this.pagination.$el && 0 !== this.pagination.$el.length && ((t = this.pagination.$el).removeClass(e.hiddenClass), t.removeClass(e.modifierClass + e.type), this.pagination.bullets && this.pagination.bullets.removeClass(e.bulletActiveClass), e.clickable && t.off("click", "." + e.bulletClass)) 4635 } 4636 }, 4637 V = { 4638 setTranslate: function() { 4639 var t, e, i, n, o, s, a, r; 4640 this.params.scrollbar.el && this.scrollbar.el && (a = this.scrollbar, t = this.rtlTranslate, r = this.progress, e = a.dragSize, i = a.trackSize, n = a.$dragEl, o = a.$el, s = this.params.scrollbar, r = (i - (a = e)) * r, t ? 0 < (r = -r) ? (a = e - r, r = 0) : i < -r + e && (a = i + r) : r < 0 ? (
4640a = e + r, r = 0) : i < r + e && (a = i - r), this.isHorizontal() ? (n.transform("translate3d(" + r + "px, 0, 0)"), n[0].style.width = a + "px") : (n.transform("translate3d(0px, " + r + "px, 0)"), n[0].style.height = a + "px"), s.hide && (clearTimeout(this.scrollbar.timeout), o[0].style.opacity = 1, this.scrollbar.timeout = setTimeout(function() { 4641 o[0].style.opacity = 0, o.transition(400) 4642 }, 1e3))) 4643 }, 4644 setTransition: function(t) { 4645 this.params.scrollbar.el && this.scrollbar.el && this.scrollbar.$dragEl.transition(t) 4646 }, 4647 updateSize: function() { 4648 var t, e, i, n, o, s, a; 4649 this.params.scrollbar.el && this.scrollbar.el && (e = (t = this.scrollbar).$dragEl, i = t.$el, e[0].style.width = "", e[0].style.height = "", n = this.isHorizontal() ? i[0].offsetWidth : i[0].offsetHeight, s = (o = this.size / this.virtualSize) * (n / this.size), a = "auto" === this.params.scrollbar.dragSize ? n * o : parseInt(this.params.scrollbar.dragSize, 10), this.isHorizontal() ? e[0].style.width = a + "px" : e[0].style.height = a + "px", i[0].style.display = 1 <= o ? "none" : "", this.params.scrollbar.hide && (i[0].style.opacity = 0), X(t, { 4650 trackSize: n, 4651 divider: o, 4652 moveDivider: s, 4653 dragSize: a 4654 }), t.$el[this.params.watchOverflow && this.isLocked ? "addClass" : "removeClass"](this.params.scrollbar.lockClass)) 4655 }, 4656 getPointerPosition: function(t) { 4657 return this.isHorizontal() ? ("touchstart" === t.type || "touchmove" === t.type ? t.targetTouches[0] : t).clientX : ("touchstart" === t.type || "touchmove" === t.type ? t.targetTouches[0] : t).clientY 4658 }, 4659 setDragPosition: function(t) { 4660 var e = this.scrollbar, 4661 i = this.rtlTranslate, 4662 n = e.$el, 4663 o = e.dragSize, 4664 s = e.trackSize, 4665 a = e.dragStartPos, 4666 o = (e.getPointerPosition(t) - n.offset()[this.isHorizontal() ? "left" : "top"] - (null !== a ? a : o / 2)) / (s - o); 4667 o = Math.max(Math.min(o, 1), 0), i && (o = 1 - o); 4668 o = this.minTranslate() + (this.maxTranslate() - this.minTranslate()) * o; 4669 this.updateProgress(o), this.setTranslate(o), this.updateActiveIndex(), this.updateSlidesClasses() 4670 }, 4671 onDragStart: function(t) { 4672 var e = this.params.scrollbar, 4673 i = this.scrollbar, 4674 n = this.$wrapperEl, 4675 o = i.$el, 4676 s = i.$dragEl; 4677 this.scrollbar.isTouched = !0, this.scrollbar.dragStartPos = t.target === s[0] || t.target === s ? i.getPointerPosition(t) - t.target.getBoundingClientRect()[this.isHorizontal() ? "left" : "top"] : null, t.preventDefault(), t.stopPropagation(), n.transition(100), s.transition(100), i.setDragPosition(t), clearTimeout(this.scrollbar.dragTimeout), o.transition(0), e.hide && o.css("opacity", 1), this.params.cssMode && this.$wrapperEl.css("scroll-snap-type", "none"), this.emit("scrollbarDragStart", t) 4678 }, 4679 onDragMove: function(t) { 4680 var e = this.scrollbar, 4681 i = this.$wrapperEl, 4682 n = e.$el, 4683 o = e.$dragEl; 4684 this.scrollbar.isTouched && (t.preventDefault ? t.preventDefault() : t.returnValue = !1, e.setDragPosition(t), i.transition(0), n.transition(0), o.transition(0), this.emit("scrollbarDragMove", t)) 4685 }, 4686 onDragEnd: function(t) { 4687 var e = this.params.scrollbar, 4688 i = this.scrollbar, 4689 n = this.$wrapperEl, 4690 o = i.$el; 4691 this.scrollbar.isTouched && (this.scrollbar.isTouched = !1, this.params.cssMode && (this.$wrapperEl.css("scroll-snap-type", ""), n.transition("")), e.hide && (clearTimeout(this.scrollbar.dragTimeout), this.scrollbar.dragTimeout = S(function() { 4692 o.css("opacity", 0), o.transition(400) 4693 }, 1e3)), this.emit("scrollbarDragEnd", t), e.snapOnRelease && this.slideToClosest()) 4694 }, 4695 enableDraggable: function() { 4696 var t, e, i, n, o, s, a; 4697 this.params.scrollbar.el && (t = v(), s = this.scrollbar, e = this.touchEventsTouch, i = this.touchEventsDesktop, a = this.params, n = this.support, o = s.$el[0], s = !(!n.passiveListener || !a.passiveListeners) && { 4698 passive: !1, 4699 capture: !1 4700 }, a = !(!n.passiveListener || !a.passiveListeners) && { 4701 passive: !0, 4702 capture: !1 4703 }, n.touch ? (o.addEventListener(e.start, this.scrollbar.onDragStart, s), o.addEventListener(e.move, this.scrollbar.onDragMove, s), o.addEventListener(e.end, this.scrollbar.onDragEnd, a)) : (o.addEventListener(i.start, this.scrollbar.onDragStart, s), t.addEventListener(i.move, this.scrollbar.onDragMove, s), t.addEventListener(i.end, this.scrollbar.onDragEnd, a))) 4704 }, 4705 disableDraggable: function() { 4706 var t, e, i, n, o, s, a; 4707 this.params.scrollbar.el && (t = v(), s = this.scrollbar, e = this.touchEventsTouch, i = this.touchEventsDesktop, a = this.params, n = this.support, o = s.$el[0], s = !(!n.passiveListener || !a.passiveListeners) && { 4708 passive: !1, 4709 capture: !1 4710 }, a = !(!n.passiveListener || !a.passiveListeners) && { 4711 passive: !0, 4712 capture: !1 4713 }, n.touch ? (o.removeEventListener(e.start, this.scrollbar.onDragStart, s), o.removeEventListener(e.move, this.scrollbar.onDragMove, s), o.removeEventListener(e.end, this.scrollbar.onDragEnd, a)) : (o.removeEventListener(i.start, this.scrollbar.onDragStart, s), t.removeEventListener(i.move, this.scrollbar.onDragMove, s), t.removeEventListener(i.end, this.scrollbar.onDragEnd, a))) 4714 }, 4715 init: function() { 4716 var t, e, i, n; 4717 this.params.scrollbar.el && (t = this.scrollbar, n = this.$el, i = _((e = this.params.scrollbar).el), 0 === (n = (i = this.params.uniqueNavElements && "string" == typeof e.el && 1 < i.length && 1 === n.find(e.el).length ? n.find(e.el) : i).find("." + this.params.scrollbar.dragClass)).length && (n = _('<div class="' + this.params.scrollbar.dragClass + '"></div>'), i.append(n)), X(t, { 4718 $el: i, 4719 el: i[0], 4720 $dragEl: n, 4721 dragEl: n[0] 4722 }), e.draggable && t.enableDraggable()) 4723 }, 4724 destroy: function() { 4725 this.scrollbar.disableDraggable() 4726 } 4727 }, 4728 U = { 4729 setTransform: function(t, e) { 4730 var i = this.rtl, 4731 n = _(t), 4732 o = i ? -1 : 1, 4733 s = n.attr("data-swiper-parallax") || "0", 4734 a = n.attr("data-swiper-parallax-x"), 4735 r = n.attr("data-swiper-parallax-y"), 4736 t = n.attr("data-swiper-parallax-scale"), 4737 i = n.attr("data-swiper-parallax-opacity"); 4738 a || r ? (a = a || "0", r = r || "0") : this.isHorizontal() ? (a = s, r = "0") : (r = s, a = "0"), a = 0 <= a.indexOf("%") ? parseInt(a, 10) * e * o + "%" : a * e * o + "px", r = 0 <= r.indexOf("%") ? parseInt(r, 10) * e + "%" : r * e + "px", null != i && (i = i - (i - 1) * (1 - Math.abs(e)), n[0].style.opacity = i), null == t ? n.transform("translate3d(" + a + ", " + r + ", 0px)") : (e = t - (t - 1) * (1 - Math.abs(e)), n.transform("translate3d(" + a + ", " + r + ", 0px) scale(" + e + ")")) 4739 }, 4740 setTranslate: function() { 4741 var n = this, 4742 t = n.$el, 4743 e = n.slides, 4744 o = n.progress, 4745 s = n.snapGrid; 4746 t.children("[data-swiper-parallax], [data-swiper-parallax-x], [data-swiper-parallax-y], [data-swiper-parallax-opacity], [data-swiper-parallax-scale]").each(function(t) { 4747 n.parallax.setTransform(t, o) 4748 }), e.each(function(t, e) { 4749 var i = t.progress; 4750 1 < n.params.slidesPerGroup && "auto" !== n.params.slidesPerView && (i += Math.ceil(e / 2) - o * (s.length - 1)), i = Math.min(Math.max(i, -1), 1), _(t).find("[data-swiper-parallax], [data-swiper-parallax-x], [data-swiper-parallax-y], [data-swiper-parallax-opacity], [data-swiper-parallax-scale]").each(function(t) { 4751 n.parallax.setTransform(t, i) 4752 }) 4753 }) 4754 }, 4755 setTransition: function(i) { 4756 void 0 === i && (i = this.params.speed), this.$el.find("[data-swiper-parallax], [data-swiper-parallax-x], [data-swiper-parallax-y], [data-swiper-parallax-opacity], [data-swiper-parallax-scale]").each(function(t) { 4757 var e = _(t), 4758 t = parseInt(e.attr("data-swiper-parallax-duration"), 10) || i; 4759 0 === i && (t = 0), e.transition(t) 4760 }) 4761 } 4762 }, 4763 G = { 4764 getDistanceBetweenTouches: function(t) { 4765 if (t.targetTouches.length < 2) return 1; 4766 var e = t.targetTouches[0].pageX, 4767 i = t.targetTouches[0].pageY, 4768 n = t.targetTouches[1].pageX, 4769 t = t.targetTouches[1].pageY; 4770 return Math.sqrt(Math.pow(n - e, 2) + Math.pow(t - i, 2)) 4771 }, 4772 onGestureStart: function(t) { 4773 var e = this.support, 4774 i = this.params.zoom, 4775 n = this.zoom, 4776 o = n.gesture; 4777 if (n.fakeGestureTouched = !1, n.fakeGestureMoved = !1, !e.gestures) { 4778 if ("touchstart" !== t.type || "touchstart" === t.type && t.targetTouches.length < 2) return; 4779 n.fakeGestureTouched = !0, o.scaleStart = G.getDistanceBetweenTouches(t) 4780 } 4781 o.$slideEl && o.$slideEl.length || (o.$slideEl = _(t.target).closest("." + this.params.slideClass), 0 === o.$slideEl.length && (o.$slideEl = this.slides.eq(this.activeIndex)), o.$imageEl = o.$slideEl.find("img, svg, canvas, picture, .swiper-zoom-target"), o.$imageWrapEl = o.$imageEl.parent("." + i.containerClass), o.maxRatio = o.$imageWrapEl.attr("data-swiper-zoom") || i.maxRatio, 0 !== o.$imageWrapEl.length) ? (o.$imageEl && o.$imageEl.transition(0), this.zoom.isScaling = !0) : o.$imageEl = void 0 4782 }, 4783 onGestureChange: function(t) { 4784 var e = this.support, 4785 i = this.params.zoom, 4786 n = this.zoom, 4787 o = n.gesture; 4788 if (!e.gestures) { 4789 if ("touchmove" !== t.type || "touchmove" === t.type && t.targetTouches.length < 2) return; 4790 n.fakeGestureMoved = !0, o.scaleMove = G.getDistanceBetweenTouches(t) 4791 } 4792 o.$imageEl && 0 !== o.$imageEl.length ? (e.gestures ? n.scale = t.scale * n.currentScale : n.scale = o.scaleMove / o.scaleStart * n.currentScale, n.scale > o.maxRatio && (n.scale = o.maxRatio - 1 + Math.pow(n.scale - o.maxRatio + 1, .5)), n.scale < i.minRatio && (n.scale = i.minRatio + 1 - Math.pow(i.minRatio - n.scale + 1, .5)), o.$imageEl.transform("translate3d(0,
vendor: 4,371 bytes, lines 4792-4845
47920,0) scale(" + n.scale + ")")) : "gesturechange" === t.type && n.onGestureStart(t) 4793 }, 4794 onGestureEnd: function(t) { 4795 var e = this.device, 4796 i = this.support, 4797 n = this.params.zoom, 4798 o = this.zoom, 4799 s = o.gesture; 4800 if (!i.gestures) { 4801 if (!o.fakeGestureTouched || !o.fakeGestureMoved) return; 4802 if ("touchend" !== t.type || "touchend" === t.type && t.changedTouches.length < 2 && !e.android) return; 4803 o.fakeGestureTouched = !1, o.fakeGestureMoved = !1 4804 } 4805 s.$imageEl && 0 !== s.$imageEl.length && (o.scale = Math.max(Math.min(o.scale, s.maxRatio), n.minRatio), s.$imageEl.transition(this.params.speed).transform("translate3d(0,0,0) scale(" + o.scale + ")"), o.currentScale = o.scale, o.isScaling = !1, 1 === o.scale && (s.$slideEl = void 0)) 4806 }, 4807 onTouchStart: function(t) { 4808 var e = this.device, 4809 i = this.zoom, 4810 n = i.gesture, 4811 i = i.image; 4812 n.$imageEl && 0 !== n.$imageEl.length && (i.isTouched || (e.android && t.cancelable && t.preventDefault(), i.isTouched = !0, i.touchesStart.x = ("touchstart" === t.type ? t.targetTouches[0] : t).pageX, i.touchesStart.y = ("touchstart" === t.type ? t.targetTouches[0] : t).pageY)) 4813 }, 4814 onTouchMove: function(t) { 4815 var e = this.zoom, 4816 i = e.gesture, 4817 n = e.image, 4818 o = e.velocity; 4819 if (i.$imageEl && 0 !== i.$imageEl.length && (this.allowClick = !1, n.isTouched && i.$slideEl)) { 4820 n.isMoved || (n.width = i.$imageEl[0].offsetWidth, n.height = i.$imageEl[0].offsetHeight, n.startX = b(i.$imageWrapEl[0], "x") || 0, n.startY = b(i.$imageWrapEl[0], "y") || 0, i.slideWidth = i.$slideEl[0].offsetWidth, i.slideHeight = i.$slideEl[0].offsetHeight, i.$imageWrapEl.transition(0), this.rtl && (n.startX = -n.startX, n.startY = -n.startY)); 4821 var s = n.width * e.scale, 4822 a = n.height * e.scale; 4823 if (!(s < i.slideWidth && a < i.slideHeight)) { 4824 if (n.minX = Math.min(i.slideWidth / 2 - s / 2, 0), n.maxX = -n.minX, n.minY = Math.min(i.slideHeight / 2 - a / 2, 0), n.maxY = -n.minY, n.touchesCurrent.x = ("touchmove" === t.type ? t.targetTouches[0] : t).pageX, n.touchesCurrent.y = ("touchmove" === t.type ? t.targetTouches[0] : t).pageY, !n.isMoved && !e.isScaling) { 4825 if (this.isHorizontal() && (Math.floor(n.minX) === Math.floor(n.startX) && n.touchesCurrent.x < n.touchesStart.x || Math.floor(n.maxX) === Math.floor(n.startX) && n.touchesCurrent.x > n.touchesStart.x)) return void(n.isTouched = !1); 4826 if (!this.isHorizontal() && (Math.floor(n.minY) === Math.floor(n.startY) && n.touchesCurrent.y < n.touchesStart.y || Math.floor(n.maxY) === Math.floor(n.startY) && n.touchesCurrent.y > n.touchesStart.y)) return void(n.isTouched = !1) 4827 } 4828 t.cancelable && t.preventDefault(), t.stopPropagation(), n.isMoved = !0, n.currentX = n.touchesCurrent.x - n.touchesStart.x + n.startX, n.currentY = n.touchesCurrent.y - n.touchesStart.y + n.startY, n.currentX < n.minX && (n.currentX = n.minX + 1 - Math.pow(n.minX - n.currentX + 1, .8)), n.currentX > n.maxX && (n.currentX = n.maxX - 1 + Math.pow(n.currentX - n.maxX + 1, .8)), n.currentY < n.minY && (n.currentY = n.minY + 1 - Math.pow(n.minY - n.currentY + 1, .8)), n.currentY > n.maxY && (n.currentY = n.maxY - 1 + Math.pow(n.currentY - n.maxY + 1, .8)), o.prevPositionX || (o.prevPositionX = n.touchesCurrent.x), o.prevPositionY || (o.prevPositionY = n.touchesCurrent.y), o.prevTime || (o.prevTime = Date.now()), o.x = (n.touchesCurrent.x - o.prevPositionX) / (Date.now() - o.prevTime) / 2, o.y = (n.touchesCurrent.y - o.prevPositionY) / (Date.now() - o.prevTime) / 2, Math.abs(n.touchesCurrent.x - o.prevPositionX) < 2 && (o.x = 0), Math.abs(n.touchesCurrent.y - o.prevPositionY) < 2 && (o.y = 0), o.prevPositionX = n.touchesCurrent.x, o.prevPositionY = n.touchesCurrent.y, o.prevTime = Date.now(), i.$imageWrapEl.transform("translate3d(" + n.currentX + "px, " + n.currentY + "px,0)") 4829 } 4830 } 4831 }, 4832 onTouchEnd: function() { 4833 var t = this.zoom, 4834 e = t.gesture, 4835 i = t.image, 4836 n = t.velocity; 4837 if (e.$imageEl && 0 !== e.$imageEl.length) { 4838 if (!i.isTouched || !i.isMoved) return i.isTouched = !1, void(i.isMoved = !1); 4839 i.isTouched = !1, i.isMoved = !1; 4840 var o = 300, 4841 s = 300, 4842 a = n.x * o, 4843 r = i.currentX + a, 4844 a = n.y * s, 4845 a = i.currentY + a;
4846 0 !== n.x && (o = Math.abs((r - i.currentX) / n.x)), 0 !== n.y && (s = Math.abs((a - i.currentY) / n.y)); 4847 s = Math.max(o, s); 4848 i.currentX = r, i.currentY = a; 4849 a = i.width * t.scale, t = i.height * t.scale; 4850 i.minX = Math.min(e.slideWidth / 2 - a / 2, 0), i.maxX = -i.minX, i.minY = Math.min(e.slideHeight / 2 - t / 2, 0), i.maxY = -i.minY, i.currentX = Math.max(Math.min(i.currentX, i.maxX), i.minX), i.currentY = Math.max(Math.min(i.currentY, i.maxY), i.minY), e.$imageWrapEl.transition(s).transform("translate3d(" + i.currentX + "px, " + i.currentY + "px,0)") 4851 } 4852 }, 4853 onTransitionEnd: function() { 4854 var t = this.zoom, 4855 e = t.gesture; 4856 e.$slideEl && this.previousIndex !== this.activeIndex && (e.$imageEl && e.$imageEl.transform("translate3d(0,0,0) scale(1)"), e.$imageWrapEl && e.$imageWrapEl.transform("translate3d(0,0,0)"), t.scale = 1, t.currentScale = 1, e.$slideEl = void 0, e.$imageEl = void 0, e.$imageWrapEl = void 0) 4857 }, 4858 toggle: function(t) { 4859 var e = this.zoom; 4860 e.scale && 1 !== e.scale ? e.out() : e.in(t) 4861 }, 4862 in: function(t) { 4863 var e, i, n, o = this.zoom, 4864 s = this.params.zoom, 4865 a = o.gesture, 4866 r = o.image; 4867 a.$slideEl || (this.params.virtual && this.params.virtual.enabled && this.virtual ? a.$slideEl = this.$wrapperEl.children("." + this.params.slideActiveClass) : a.$slideEl = this.slides.eq(this.activeIndex), a.$imageEl = a.$slideEl.find("img, svg, canvas, picture, .swiper-zoom-target"), a.$imageWrapEl = a.$imageEl.parent("." + s.containerClass)), a.$imageEl && 0 !== a.$imageEl.length && (a.$slideEl.addClass("" + s.zoomedSlideClass), r = void 0 === r.touchesStart.x && t ? (n = ("touchend" === t.type ? t.changedTouches[0] : t).pageX, ("touchend" === t.type ? t.changedTouches[0] : t).pageY) : (n = r.touchesStart.x, r.touchesStart.y), o.scale = a.$imageWrapEl.attr("data-swiper-zoom") || s.maxRatio, o.currentScale = a.$imageWrapEl.attr("data-swiper-zoom") || s.maxRatio, t ? (s = a.$slideEl[0].offsetWidth, t = a.$slideEl[0].offsetHeight, e = a.$slideEl.offset().left + s / 2 - n, i = a.$slideEl.offset().top + t / 2 - r, n = a.$imageEl[0].offsetWidth, r = a.$imageEl[0].offsetHeight, n = n * o.scale, r = r * o.scale, n = -(s = Math.min(s / 2 - n / 2, 0)), r = -(t = Math.min(t / 2 - r / 2, 0)), n < (e = (e = e * o.scale) < s ? s : e) && (e = n), r < (i = (i = i * o.scale) < t ? t : i) && (i = r)) : i = e = 0, a.$imageWrapEl.transition(300).transform("translate3d(" + e + "px, " + i + "px,0)"), a.$imageEl.transition(300).transform("translate3d(0,0,0) scale(" + o.scale + ")")) 4868 }, 4869 out: function() { 4870 var t = this.zoom, 4871 e = this.params.zoom, 4872 i = t.gesture; 4873 i.$slideEl || (this.params.virtual && this.params.virtual.enabled && this.virtual ? i.$slideEl = this.$wrapperEl.children("." + this.params.slideActiveClass) : i.$slideEl = this.slides.eq(this.activeIndex), i.$imageEl = i.$slideEl.find("img, svg, canvas, picture, .swiper-zoom-target"), i.$imageWrapEl = i.$imageEl.parent("." + e.containerClass)), i.$imageEl && 0 !== i.$imageEl.length && (t.scale = 1, t.currentScale = 1, i.$imageWrapEl.transition(300).transform("translate3d(0,0,0)"), i.$imageEl.transition(300).transform("translate3d(0,0,0) scale(1)"), i.$slideEl.removeClass("" + e.zoomedSlideClass), i.$slideEl = void 0) 4874 }, 4875 toggleGestures: function(t) { 4876 var e = this.zoom, 4877 i = e.slideSelector, 4878 n = e.passiveListener; 4879 this.$wrapperEl[t]("gesturestart", i, e.onGestureStart, n), this.$wrapperEl[t]("gesturechange", i, e.onGestureChange, n), this.$wrapperEl[t]("gestureend", i, e.onGestureEnd, n) 4880 }, 4881 enableGestures: function() { 4882 this.zoom.gesturesEnabled || (this.zoom.gesturesEnabled = !0, this.zoom.toggleGestures("on")) 4883 }, 4884 disableGestures: function() { 4885 this.zoom.gesturesEnabled && (this.zoom.gesturesEnabled = !1, this.zoom.toggleGestures("off")) 4886 }, 4887 enable: function() { 4888 var t, e, i, n = this.support, 4889 o = this.zoom; 4890 o.enabled || (o.enabled = !0, t = !("touchstart" !== this.touchEvents.start || !n.passiveListener || !this.params.passiveListeners) && { 4891 passive: !0, 4892 capture: !1 4893 }, e = !n.passiveListener || { 4894 passive: !1, 4895 capture: !0 4896 }, i = "." + this.params.slideClass, this.zoom.passiveListener = t, this.zoom.slideSelector = i, n.gestures ? (this.$wrapperEl.on(this.touchEvents.start, this.zoom.enableGestures, t), this.$wrapperEl.on(this.touchEvents.end, this.zoom.disableGestures, t)) : "touchstart" === this.touchEvents.start && (this.$wrapperEl.on(this.touchEvents.start, i, o.onGestureStart, t), this.$wrapperEl.on(this.touchEvents.move, i, o.onGestureChange, e), this.$wrapperEl.on(this.touchEvents.end, i, o.onGestureEnd, t), this.touchEvents.cancel && this.$wrapperEl.on(this.touchEvents.cancel, i, o.onGestureEnd, t)), this.$wrapperEl.on(this.touchEvents.move, "." + this.params.zoom.containerClass, o.onTouchMove, e)) 4897 }, 4898 disable: function() { 4899 var t, e, i, n, o = this.zoom; 4900 o.enabled && (t = this.support, this.zoom.enabled = !1, e = !("touchstart" !== this.touchEvents.start || !t.passiveListener || !this.params.passiveListeners) && { 4901 passive: !0, 4902 capture: !1 4903 }, i = !t.passiveListener || { 4904 passive: !1, 4905 capture: !0 4906 }, n = "." + this.params.slideClass, t.gestures ? (this.$wrapperEl.off(this.touchEvents.start, this.zoom.enableGestures, e), this.$wrapperEl.off(this.touchEvents.end, this.zoom.disableGestures, e)) : "touchstart" === this.touchEvents.start && (this.$wrapperEl.off(this.touchEvents.start, n, o.onGestureStart, e), this.$wrapperEl.off(this.touchEvents.move, n, o.onGestureChange, i), this.$wrapperEl.off(this.touchEvents.end, n, o.onGestureEnd, e), this.touchEvents.cancel && this.$wrapperEl.off(this.touchEvents.cancel, n, o.onGestureEnd, e)), this.$wrapperEl.off(this.touchEvents.move, "." + this.params.zoom.containerClass, o.onTouchMove, i)) 4907 } 4908 }, 4909 K = { 4910 loadInSlide: function(t, l) { 4911 void 0 === l && (l = !0); 4912 var c, d = this, 4913 u = d.params.lazy; 4914 void 0 !== t && 0 !== d.slides.length && (t = (c = d.virtual && d.params.virtual.enabled ? d.$wrapperEl.children("." + d.params.slideClass + '[data-swiper-slide-index="' + t + '"]') : d.slides.eq(t)).find("." + u.elementClass + ":not(." + u.loadedClass + "):not(." + u.loadingClass + ")"), !c.hasClass(u.elementClass) || c.hasClass(u.loadedClass) || c.hasClass(u.loadingClass) || t.push(c[0]), 0 !== t.length && t.each(function(t) { 4915 var i = _(t); 4916 i.addClass(u.loadingClass); 4917 var n = i.attr("data-background"), 4918 o = i.attr("data-src"), 4919 s = i.attr("data-srcset"), 4920 a = i.attr("data-sizes"), 4921 r = i.parent("picture"); 4922 d.loadImage(i[0], o || n, s, a, !1, function() { 4923 var t, e; 4924 null == d || !d || d && !d.params || d.destroyed || (n ? (i.css("background-image", 'url("' + n + '")'), i.removeAttr("data-background")) : (s && (i.attr("srcset", s), i.removeAttr("data-srcset")), a && (i.attr("sizes", a), i.removeAttr("data-sizes")), r.length && r.children("source").each(function(t) { 4925 t = _(t); 4926 t.attr("data-srcset") && (t.attr("srcset", t.attr("data-srcset")), t.removeAttr("data-srcset")) 4927 }), o && (i.attr("src", o), i.removeAttr("data-src"))), i.addClass(u.loadedClass).removeClass(u.loadingClass), c.find("." + u.preloaderClass).remove(), d.params.loop && l && (e = c.attr("data-swiper-slide-index"), c.hasClass(d.params.slideDuplicateClass) ? (t = d.$wrapperEl.children('[data-swiper-slide-index="' + e + '"]:not(.' + d.params.slideDuplicateClass + ")"), d.lazy.loadInSlide(t.index(), !1)) : (e = d.$wrapperEl.children("." + d.params.slideDuplicateClass + '[data-swiper-slide-index="' + e + '"]'), d.lazy.loadInSlide(e.index(), !1))), d.emit("lazyImageReady", c[0], i[0]), d.params.autoHeight && d.updateAutoHeight()) 4928 }), d.emit("lazyImageLoad", c[0], i[0]) 4929 })) 4930 }, 4931 load: function() { 4932 var e = this, 4933 i = e.$wrapperEl, 4934 n = e.params, 4935 o = e.slides, 4936 t = e.activeIndex, 4937 s = e.virtual && n.virtual.enabled, 4938 a = n.lazy, 4939 r = n.slidesPerView; 4940 4941 function l(t) { 4942 if (s) { 4943 if (i.children("." + n.slideClass + '[data-swiper-slide-index="' + t + '"]').length) return 1 4944 } else if (o[t]) return 1 4945 } 4946 4947 function c(t) { 4948 return s ? _(t).attr("data-swiper-slide-index") : _(t).index() 4949 } 4950 if ("auto" === r && (r = 0), e.lazy.initialImageLoaded || (e.lazy.initialImageLoaded = !0), e.params.watchSlidesVisibility) i.children("." + n.slideVisibleClass).each(function(t) { 4951 t = s ? _(t).attr("data-swiper-slide-index") : _(t).index(); 4952 e.lazy.loadInSlide(t) 4953 }); 4954 else if (1 < r) 4955 for (var d = t; d < t + r; d += 1) l(d) && e.lazy.loadInSlide(d); 4956 else e.lazy.loadInSlide(t); 4957 if (a.loadPrevNext) 4958 if (1 < r || a.loadPrevNextAmount && 1 < a.loadPrevNextAmount) { 4959 for (var u = a.loadPrevNextAmount, a = r, h = Math.min(t + a + Math.max(u, a), o.length), u = Math.max(t - Math.max(a, u), 0), p = t + r; p < h; p += 1) l(p) && e.lazy.loadInSlide(p); 4960 for (var f = u; f < t; f += 1) l(f) && e.lazy.loadInSlide(f) 4961 } else { 4962 u = i.children("." + n.slideNextClass); 4963 0 < u.length && e.lazy.loadInSlide(c(u)); 4964 u = i.children("." + n.slidePrevClass); 4965 0 < u.length && e.lazy.loadInSlide(c(u)) 4966 } 4967 } 4968 }, 4969 Z = { 4970 LinearSpline: function(t, e) { 4971 var i, n, o, s, a; 4972 return this.x = t, this.y = e, this.lastIndex = t.length - 1, this.interpolate = function(t) { 4973 return t ? (a = function(t, e) { 4974 for (n = -1, i = t.length; 1 < i - n;) t[o = i + n >> 1] <= e ? n = o : i = o; 4975 return i 4976 }
4976(this.x, t), s = a - 1, (t - this.x[s]) * (this.y[a] - this.y[s]) / (this.x[a] - this.x[s]) + this.y[s]) : 0 4977 }, this 4978 }, 4979 getInterpolateFunction: function(t) { 4980 this.controller.spline || (this.controller.spline = this.params.loop ? new Z.LinearSpline(this.slidesGrid, t.slidesGrid) : new Z.LinearSpline(this.snapGrid, t.snapGrid)) 4981 }, 4982 setTranslate: function(t, e) { 4983 var i, n, o = this, 4984 s = o.controller.control, 4985 a = o.constructor; 4986 4987 function r(t) { 4988 var e = o.rtlTranslate ? -o.translate : o.translate; 4989 "slide" === o.params.controller.by && (o.controller.getInterpolateFunction(t), n = -o.controller.spline.interpolate(-e)), n && "container" !== o.params.controller.by || (i = (t.maxTranslate() - t.minTranslate()) / (o.maxTranslate() - o.minTranslate()), n = (e - o.minTranslate()) * i + t.minTranslate()), o.params.controller.inverse && (n = t.maxTranslate() - n), t.updateProgress(n), t.setTranslate(n, o), t.updateActiveIndex(), t.updateSlidesClasses() 4990 } 4991 if (Array.isArray(s)) 4992 for (var l = 0; l < s.length; l += 1) s[l] !== e && s[l] instanceof a && r(s[l]); 4993 else s instanceof a && e !== s && r(s) 4994 }, 4995 setTransition: function(e, t) { 4996 var i, n = this, 4997 o = n.constructor, 4998 s = n.controller.control; 4999 5000 function a(t) { 5001 t.setTransition(e, n), 0 !== e && (t.transitionStart(), t.params.autoHeight && S(function() { 5002 t.updateAutoHeight() 5003 }), t.$wrapperEl.transitionEnd(function() { 5004 s && (t.params.loop && "slide" === n.params.controller.by && t.loopFix(), t.transitionEnd()) 5005 })) 5006 } 5007 if (Array.isArray(s)) 5008 for (i = 0; i < s.length; i += 1) s[i] !== t && s[i] instanceof o && a(s[i]); 5009 else s instanceof o && t !== s && a(s) 5010 } 5011 }, 5012 Q = { 5013 makeElFocusable: function(t) { 5014 return t.attr("tabIndex", "0"), t 5015 }, 5016 makeElNotFocusable: function(t) { 5017 return t.attr("tabIndex", "-1"), t 5018 }, 5019 addElRole: function(t, e) { 5020 return t.attr("role", e), t 5021 }, 5022 addElLabel: function(t, e) { 5023 return t.attr("aria-label", e), t 5024 }, 5025 disableEl: function(t) { 5026 return t.attr("aria-disabled", !0), t 5027 }, 5028 enableEl: function(t) { 5029 return t.attr("aria-disabled", !1), t 5030 }, 5031 onEnterKey: function(t) { 5032 var e = this.params.a11y; 5033 13 === t.keyCode && (t = _(t.target), this.navigation && this.navigation.$nextEl && t.is(this.navigation.$nextEl) && (this.isEnd && !this.params.loop || this.slideNext(), this.isEnd ? this.a11y.notify(e.lastSlideMessage) : this.a11y.notify(e.nextSlideMessage)), this.navigation && this.navigation.$prevEl && t.is(this.navigation.$prevEl) && (this.isBeginning && !this.params.loop || this.slidePrev(), this.isBeginning ? this.a11y.notify(e.firstSlideMessage) : this.a11y.notify(e.prevSlideMessage)), this.pagination && t.is("." + this.params.pagination.bulletClass) && t[0].click()) 5034 }, 5035 notify: function(t) { 5036 var e = this.a11y.liveRegion; 5037 0 !== e.length && (e.html(""), e.html(t)) 5038 }, 5039 updateNavigation: function() { 5040 var t, e; 5041 !this.params.loop && this.navigation && (t = (e = this.navigation).$nextEl, (e = e.$prevEl) && 0 < e.length && (this.isBeginning ? (this.a11y.disableEl(e), this.a11y.makeElNotFocusable(e)) : (this.a11y.enableEl(e), this.a11y.makeElFocusable(e))), t && 0 < t.length && (this.isEnd ? (this.a11y.disableEl(t), this.a11y.makeElNotFocusable(t)) : (this.a11y.enableEl(t), this.a11y.makeElFocusable(t)))) 5042 }, 5043 updatePagination: function() { 5044 var e = this, 5045 i = e.params.a11y; 5046 e.pagination && e.params.pagination.clickable && e.pagination.bullets && e.pagination.bullets.length && e.pagination.bullets.each(function(t) { 5047 t = _(t); 5048 e.a11y.makeElFocusable(t), e.params.pagination.renderBullet || (e.a11y.addElRole(t, "button"), e.a11y.addElLabel(t, i.paginationBulletMessage.replace(/\{\{index\}\}/, t.index() + 1))) 5049 }) 5050 }, 5051 init: function() { 5052 this.$el.append(this.a11y.liveRegion); 5053 var t, e, i = this.params.a11y; 5054 this.navigation && this.navigation.$nextEl && (t = this.navigation.$nextEl), this.navigation && this.navigation.$prevEl && (e = this.navigation.$prevEl), t && (this.a11y.makeElFocusable(t), this.a11y.addElRole(t, "button"), this.a11y.addElLabel(t, i.nextSlideMessage), t.on("key
5054down", this.a11y.onEnterKey)), e && (this.a11y.makeElFocusable(e), this.a11y.addElRole(e, "button"), this.a11y.addElLabel(e, i.prevSlideMessage), e.on("keydown", this.a11y.onEnterKey)), this.pagination && this.params.pagination.clickable && this.pagination.bullets && this.pagination.bullets.length && this.pagination.$el.on("keydown", "." + this.params.pagination.bulletClass, this.a11y.onEnterKey) 5055 }, 5056 destroy: function() { 5057 var t, e; 5058 this.a11y.liveRegion && 0 < this.a11y.liveRegion.length && this.a11y.liveRegion.remove(), this.navigation && this.navigation.$nextEl && (t = this.navigation.$nextEl), this.navigation && this.navigation.$prevEl && (e = this.navigation.$prevEl), t && t.off("keydown", this.a11y.onEnterKey), e && e.off("keydown", this.a11y.onEnterKey), this.pagination && this.params.pagination.clickable && this.pagination.bullets && this.pagination.bullets.length && this.pagination.$el.off("keydown", "." + this.params.pagination.bulletClass, this.a11y.onEnterKey) 5059 } 5060 }, 5061 J = { 5062 init: function() { 5063 var t = Y(); 5064 if (this.params.history) { 5065 if (!t.history || !t.history.pushState) return this.params.history.enabled = !1, void(this.params.hashNavigation.enabled = !0); 5066 var e = this.history; 5067 e.initialized = !0, e.paths = J.getPathValues(this.params.url), (e.paths.key || e.paths.value) && (e.scrollToSlide(0, e.paths.value, this.params.runCallbacksOnInit), this.params.history.replaceState || t.addEventListener("popstate", this.history.setHistoryPopState)) 5068 } 5069 }, 5070 destroy: function() { 5071 var t = Y(); 5072 this.params.history.replaceState || t.removeEventListener("popstate", this.history.setHistoryPopState) 5073 }, 5074 setHistoryPopState: function() { 5075 this.history.paths = J.getPathValues(this.params.url), this.history.scrollToSlide(this.params.speed, this.history.paths.value, !1) 5076 }, 5077 getPathValues: function(t) { 5078 var e = Y(), 5079 t = (t ? new URL(t) : e.location).pathname.slice(1).split("/").filter(function(t) { 5080 return "" !== t 5081 }), 5082 e = t.length; 5083 return { 5084 key: t[e - 2], 5085 value: t[e - 1] 5086 } 5087 }, 5088 setHistory: function(t, e) { 5089 var i, n = Y(); 5090 this.history.initialized && this.params.history.enabled && (i = this.params.url ? new URL(this.params.url) : n.location, e = this.slides.eq(e), e = J.slugify(e.attr("data-history")), i.pathname.includes(t) || (e = t + "/" + e), (t = n.history.state) && t.value === e || (this.params.history.replaceState ? n.history.replaceState({ 5091 value: e 5092 }, null, e) : n.history.pushState({ 5093 value: e 5094 }, null, e))) 5095 }, 5096 slugify: function(t) { 5097 return t.toString().replace(/\s+/g, "-").replace(/[^\w-]+/g, "").replace(/--+/g, "-").replace(/^-+/, "").replace(/-+$/, "") 5098 }, 5099 scrollToSlide: function(t, e, i) { 5100 if (e) 5101 for (var n = 0, o = this.slides.length; n < o; n += 1) { 5102 var s = this.slides.eq(n); 5103 J.slugify(s.attr("data-history")) !== e || s.hasClass(this.params.slideDuplicateClass) || (s = s.index(), this.slideTo(s, t, i)) 5104 } else this.slideTo(0, t, i) 5105 } 5106 }, 5107 tt = { 5108 onHashCange: function() { 5109 var t = v(); 5110 this.emit("hashChange"); 5111 t = t.location.hash.replace("#", ""); 5112 t === this.slides.eq(this.activeIndex).attr("data-hash") || void 0 !== (t = this.$wrapperEl.children("." + this.params.slideClass + '[data-hash="' + t + '"]').index()) && this.slideTo(t) 5113 }, 5114 setHash: function() { 5115 var t = Y(), 5116 e = v(); 5117 this.hashNavigation.initialized && this.params.hashNavigation.enabled && (this.params.hashNavigation.replaceState && t.history && t.history.replaceState ? t.history.replaceState(null, null, "#" + this.slides.eq(this.activeIndex).attr("data-hash") || "") : (t = (t = this.slides.eq(this.activeIndex)).attr("data-hash") || t.attr("data-history"), e.location.hash = t || ""), this.emit("hashSet")) 5118 }, 5119 init: function() { 5120 var t = v(), 5121 e = Y(); 5122 if (!(!this.params.hashNavigation.enabled || this.params.history && this.params.history.enabled)) { 5123 this.hashNavigation.initialized = !0; 5124 var i = t.location.hash.replace("#", ""); 5125 if (i) 5126 for (var n = 0, o = this.slides.length; n < o; n += 1) { 5127 var s = this.slides.eq(n); 5128 (s.attr("data-hash") || s.attr("data-history")) !== i || s.hasClass(this.params.slideDuplicateClass) || (s = s.index(), this.slideTo(s, 0, this.params.runCallbacksOnInit, !0)) 5129 } 5130 this.params.hashNavigation.watchState && _(e).on("hashchange", this.hashNavigation.onHashCange) 5131 } 5132 }, 5133 destroy: function() { 5134 var t = Y(); 5135 this.params.hashNavigation.watchState && _(t).off("hashchange", this.hashNavigation.onHashCange) 5136 } 5137 }, 5138 et = { 5139 run: function() { 5140 var t = this, 5141 e = t.slides.eq(t.activeIndex), 5142 i = t.params.autoplay.delay; 5143 e.attr("data-swiper-autoplay") && (i = e.attr("data-swiper-autoplay") || t.params.autoplay.delay), clearTimeout(t.autoplay.timeout), t.autoplay.timeout = S(function() { 5144 t.params.autoplay.reverseDirection ? t.params.loop ? (t.loopFix(), t.slidePrev(t.params.speed, !0, !0), t.emit("autoplay")) : t.isBeginning ? t.params.autoplay.stopOnLastSlide ? t.autoplay.stop() : (t.slideTo(t.slides.length - 1, t.params.speed, !0, !0), t.emit("autoplay")) : (t.slidePrev(t.params.speed, !0, !0), t.emit("autoplay")) : t.params.loop ? (t.loopFix(), t.slideNext(t.params.speed, !0, !0), t.emit("autoplay")) : t.isEnd ? t.params.autoplay.stopOnLastSlide ? t.autoplay.stop() : (t.slideTo(0, t.params.speed, !0, !0), t.emit("autoplay")) : (t.slideNext(t.params.speed, !0, !0), t.emit("autoplay")), t.params.cssMode && t.autoplay.running && t.autoplay.run() 5145 }, i) 5146 }, 5147 start: function() { 5148 return void 0 === this.autoplay.timeout && !this.autoplay.running && (this.autoplay.running = !0, this.emit
5148("autoplayStart"), this.autoplay.run(), !0) 5149 }, 5150 stop: function() { 5151 return !!this.autoplay.running && void 0 !== this.autoplay.timeout && (this.autoplay.timeout && (clearTimeout(this.autoplay.timeout), this.autoplay.timeout = void 0), this.autoplay.running = !1, this.emit("autoplayStop"), !0) 5152 }, 5153 pause: function(t) { 5154 this.autoplay.running && (this.autoplay.paused || (this.autoplay.timeout && clearTimeout(this.autoplay.timeout), this.autoplay.paused = !0, 0 !== t && this.params.autoplay.waitForTransition ? (this.$wrapperEl[0].addEventListener("transitionend", this.autoplay.onTransitionEnd), this.$wrapperEl[0].addEventListener("webkitTransitionEnd", this.autoplay.onTransitionEnd)) : (this.autoplay.paused = !1, this.autoplay.run()))) 5155 }, 5156 onVisibilityChange: function() { 5157 var t = v(); 5158 "hidden" === t.visibilityState && this.autoplay.running && this.autoplay.pause(), "visible" === t.visibilityState && this.autoplay.paused && (this.autoplay.run(), this.autoplay.paused = !1) 5159 }, 5160 onTransitionEnd: function(t) { 5161 this && !this.destroyed && this.$wrapperEl && t.target === this.$wrapperEl[0] && (this.$wrapperEl[0].removeEventListener("transitionend", this.autoplay.onTransitionEnd), this.$wrapperEl[0].removeEventListener("webkitTransitionEnd", this.autoplay.onTransitionEnd), this.autoplay.paused = !1, this.autoplay.running ? this.autoplay.run() : this.autoplay.stop()) 5162 } 5163 }, 5164 it = { 5165 setTranslate: function() { 5166 for (var t = this.slides, e = 0; e < t.length; e += 1) { 5167 var i = this.slides.eq(e), 5168 n = -i[0].swiperSlideOffset; 5169 this.params.virtualTranslate || (n -= this.translate); 5170 var o = 0; 5171 this.isHorizontal() || (o = n, n = 0); 5172 var s = this.params.fadeEffect.crossFade ? Math.max(1 - Math.abs(i[0].progress), 0) : 1 + Math.min(Math.max(i[0].progress, -1), 0); 5173 i.css({ 5174 opacity: s 5175 }).transform("translate3d(" + n + "px, " + o + "px, 0px)") 5176 } 5177 }, 5178 setTransition: function(t) { 5179 var i, n = this, 5180 e = n.slides, 5181 o = n.$wrapperEl; 5182 e.transition(t), n.params.virtualTranslate && 0 !== t && (i = !1, e.transitionEnd(function() { 5183 if (!i && n && !n.destroyed) { 5184 i = !0, n.animating = !1; 5185 for (var t = ["webkitTransitionEnd", "transitionend"], e = 0; e < t.length; e += 1) o.trigger(t[e]) 5186 } 5187 })) 5188 } 5189 }, 5190 nt = { 5191 setTranslate: function() { 5192 var t, e = this.$el, 5193 i = this.$wrapperEl, 5194 n = this.slides, 5195 o = this.width, 5196 s = this.height, 5197 a = this.rtlTranslate, 5198 r = this.size, 5199 l = this.browser, 5200 c = this.params.cubeEffect, 5201 d = this.isHorizontal(), 5202 u = this.virtual && this.params.virtual.enabled, 5203 h = 0; 5204 c.shadow && (d ? (0 === (t = i.find(".swiper-cube-shadow")).length && (t = _('<div class="swiper-cube-shadow"></div>'), i.append(t)), t.css({ 5205 height: o + "px" 5206 })) : 0 === (t = e.find(".swiper-cube-shadow")).length && (t = _('<div class="swiper-cube-shadow"></div>'), e.append(t))); 5207 for (var p, f = 0; f < n.length; f += 1) { 5208 var m = n.eq(f), 5209 g = f, 5210 v = 90 * (g = u ? parseInt(m.attr("data-swiper-slide-index"), 10) : g), 5211 b = Math.floor(v / 360); 5212 a && (v = -v, b = Math.floor(-v / 360)); 5213 var y = Math.max(Math.min(m[0].progress, 1), -1), 5214 w = 0, 5215 C = 0, 5216 x = 0; 5217 g % 4 == 0 ? (w = 4 * -b * r, x = 0) : (g - 1) % 4 == 0 ? (w = 0, x = 4 * -b * r) : (g - 2) % 4 == 0 ? (w = r + 4 * b * r, x = r) : (g - 3) % 4 == 0 && (w = -r, x = 3 * r + 4 * r * b), a && (w = -w), d || (C = w, w = 0), y <= 1 && -1 < y && (h = a ? 90 * -g - 90 * y : 90 * g + 90 * y), m.transform("rotateX(" + (d ? 0 : -v) + "deg) rotateY(" + (d ? v : 0) + "deg) translate3d(" + w + "px, " + C + "px, " + x + "px)"), c.slideShadows && (C = d ? m.find(".swiper-slide-shadow-left") : m.find(".swiper-slide-shadow-top"), x = d ? m.find(".swiper-slide-shadow-right") : m.find(".swiper-slide-shadow-bottom"), 0 === C.length && (C = _('<div class="swiper-slide-shadow-' + (d ? "left" : "top") + '"></div>'), m.append(C)), 0 === x.length && (x = _('<div class="swiper-slide-shadow-' + (d ? "right" : "bottom") + '"></div>'), m.append(x)), C.length && (C[0].style.opacity = Math.max(-y, 0)), x.length && (x[0].style.opacity = Math.max(y, 0))) 5218 } 5219 i.css({ 5220 "-webkit-transform-origin": "50% 50% -" + r / 2 + "px", 5221 "-moz-transform-origin": "50% 50% -" + r / 2 + "px", 5222 "-ms-transform-origin": "50% 50% -" + r / 2 + "px", 5223 "transform-origin": "50% 50% -" + r / 2 + "px" 5224 }), c.shadow && (d ? t.transform("translate3d(0px, " + (o / 2 + c.shadowOffset) + "px, " + -o / 2 + "px) rotateX(90deg) rotateZ(0deg) scale(" + c.shadowScale + ")") : (p = Math.abs(h) - 90 * Math.floor(Math.abs(h) / 90), e = 1.5 - (Math.sin(2 * p * Math.PI / 360) / 2 + Math.cos(2 * p * Math.PI / 360) / 2), o = c.shadowScale, p = c.shadowScale / e, e = c.shadowOffset, t.transform("scale3d(" + o + ", 1, " + p + ") translate3d(0px, " + (s / 2 + e) + "px, " + -s / 2 / p + "px) rotateX(-90deg)"))); 5225 l = l.isSafari || l.isWebView ? -r / 2 : 0; 5226 i.transform("translate3d(0px,0," + l + "px) rotateX(" + (this.isHorizontal() ? 0 : h) + "deg) rotateY(" + (this.isHorizontal() ? -h : 0) + "deg)") 5227 }, 5228 setTransition: function(t) { 5229 var e = this.$el; 5230 this.slides.transition(t).find(".swiper-slide-shadow-top, .swiper-slide-shadow-right, .swiper-slide-shadow-bottom, .swiper-slide-shadow-left").transition(t), this.params.cubeEffect.shadow && !this.isHorizontal() && e.find(".swiper-cube-shadow").transition(t) 5231 } 5232 }, 5233 ot = { 5234 setTranslate: function() { 5235 for (var t = this.slides, e = this.rtlTranslate, i = 0; i < t.length; i += 1) { 5236 var n, o, s = t.eq(i), 5237 a = s[0].progress, 5238 r = -180 * (a = this.params.flipEffect.limitRotation ? Math.max(Math.min(s[0].progress, 1), -1) : a), 5239 l = 0, 5240 c = -s[0].swiperSlideOffset, 5241 d = 0; 5242 this.isHorizontal() ? e && (r = -r) : (d = c, l = -r, r = c = 0), s[0].style.zIndex = -Math.abs(Math.round(a)) + t.length, this.params.flipEffect.slideShadows && (n = this.isHorizontal() ? s.find(".swiper-slide-shadow-left") : s.find(".swiper-slide-shadow-top"), o = this.isHorizontal() ? s.find(".swiper-slide-shadow-right") : s.find(".swiper-slide-shadow-bottom"), 0 === n.length && (n = _('<div class="swiper-slide-shadow-' + (this.isHorizontal() ? "left" : "top") + '"></div>'), s.append(n)), 0 === o.length && (o = _('<div class="swiper-slide-shadow-' + (this.isHorizontal() ? "right" : "bottom") + '"></div>'), s.append(o)), n.length && (n[0].style.opacity = Math.max(-a, 0)), o.length && (o[0].style.opacity = Math.max(a, 0))), s.transform("translate3d(" + c + "px, " + d + "px, 0px) rotateX(" + l + "deg) rotateY(" + r + "deg)") 5243 } 5244 }, 5245 setTransition: function(t) { 5246 var i, n = this, 5247 e = n.slides, 5248 o = n.activeIndex, 5249 s = n.$wrapperEl; 5250 e.transition(t).find(".swiper-slide-shadow-top, .swiper-slide-shadow-right, .swiper-slide-shadow-bottom, .swiper-slide-shadow-left").transition(t), n.params.virtualTranslate && 0 !== t && (i = !1, e.eq(o).transitionEnd(function() { 5251 if (!i && n && !n.destroyed) { 5252 i = !0, n.animating = !1; 5253 for (var t = ["webkitTransitionEnd", "transitionend"], e = 0; e < t.length; e += 1) s.trigger(t[e]) 5254 } 5255 })) 5256 } 5257 }, 5258 st = { 5259 setTranslate: function() { 5260 for (var t = this.width, e = this.height, i = this.slides, n = this.slidesSizesGrid, o = this.params.coverflowEffect, s = this.isHorizontal(), a = this.translate, r = s ? t / 2 - a : e / 2 - a, l = s ? o.rotate : -o.rotate, c = o.depth, d = 0, u = i.length; d < u; d += 1) { 5261 var h = i.eq(d), 5262 p = n[d], 5263 f = (r - h[0].swiperSlideOffset - p / 2) / p * o.modifier, 5264 m = s ? l * f : 0, 5265 g = s ? 0 : l * f, 5266 v = -c * Math.abs(f), 5267 b = o.stretch; 5268 "string" == typeof b && -1 !== b.indexOf("%") && (b = parseFloat(o.stretch) / 100 * p); 5269 var y = s ? 0 : b * f, 5270 p = s ? b * f : 0, 5271 b = 1 - (1 - o.scale) * Math.abs(f); 5272 Math.abs(p) < .001 && (p = 0), Math.abs(y) < .001 && (y = 0), Math.abs(v) < .001 && (v = 0), Math.abs(m) < .001 && (m = 0), Math.abs(g) < .001 && (g = 0), Math.abs(b) < .001 && (b = 0), h.transform("translate3d(" + p + "px," + y + "px," + v + "px) rotateX(" + g + "deg) rotateY(" + m + "deg) scale(" + b + ")"), h[0].style.zIndex = 1 - Math.abs(Math.round(f)), o.slideShadows && (m = s ? h.find(".swiper-slide-shadow-left") : h.find(".swiper-slide-shadow-top"), b = s ? h.find(".swiper-slide-shadow-right") : h.find(".swiper-slide-shadow-bottom"), 0 === m.length && (m = _('<div class="swiper-slide-shadow-' + (s ? "left" : "top") + '"></div>'), h.append(m)), 0 === b.length && (b = _('<div class="swiper-slide-shadow-' + (s ? "right" : "bottom") + '"></div>'), h.append(b)), m.length && (m[0].style.opacity = 0 < f ? f : 0), b.length && (b[0].style.opacity = 0 < -f ? -f : 0)) 5273 } 5274 }, 5275 setTransition: function(t) { 5276 this.slides.transition(t).find(".swiper-slide-shadow-top, .swiper-slide-shadow-right, .swiper-slide-shadow-bottom, .swiper-slide-shadow-left").transition(t) 5277 } 5278 }, 5279 at = { 5280 init: function() { 5281 var t = this.params.thumbs; 5282 if (this.thumbs.initialized) return !1; 5283 this.thumbs.initialized = !0; 5284 var e = this.constructor; 5285 return t.swiper instanceof e ? (this.thumbs.swiper = t.swiper, X(this.thumbs.swiper.originalParams, { 5286 watchSlidesProgress: !0, 5287 slideToClickedSlide: !1 5288 }), X(this.thumbs.swiper.params, { 5289 watchSlidesProgress: !0, 5290 slideToClickedSlide: !1 5291 })) : y(t.swiper) && (this.thumbs.swiper = new e(X({}, t.swiper, { 5292 watchSlidesVisibility: !0, 5293 watchSlidesProgress: !0, 5294 slideToClickedSlide: !1 5295 })), this.thumbs.swiperCreated = !0), this.thumbs.swiper.$el.addClass(this.params.thumbs.thumbsContainerClass), this.thumbs.swiper.on("tap", this.thumbs.onThumbClick), !0 5296 }, 5297 onThumbClick: function() { 5298 var t, e, i, n = this.thumbs.swiper; 5299 n && (e = n.clickedIndex, (t = n.clickedSlide) && _(t).hasClass(this.params.thumbs.slideThumbActiveClass) || null == e || (i = n.params.loop ? parseInt(_(n.clickedSlide).attr("data-swiper-slide-index"), 10) : e, this.params.loop && (t = this.activeIndex, this.slides.eq(t).hasClass(this.params.slideDuplicateClass) && (this.loopFix(), this._clientLeft = this.$wrapperEl[0].clientLeft, t = this.activeIndex), n = this.slides.eq(t).prevAll('[data-swiper-slide-index="' + i + '"]').eq(0).index(), e = this.slides.eq(t).nextAll('[data-swiper-slide-index="' + i + '"]').eq(0).index(), i = void 0 === n || void 0 !== e && e - t < t - n ? e : n), this.slideTo(i))
5299) 5300 }, 5301 update: function(t) { 5302 var e = this.thumbs.swiper; 5303 if (e) { 5304 var i, n, o, s = "auto" === e.params.slidesPerView ? e.slidesPerViewDynamic() : e.params.slidesPerView, 5305 a = this.params.thumbs.autoScrollOffset, 5306 r = a && !e.params.loop; 5307 this.realIndex === e.realIndex && !r || (i = e.activeIndex, o = e.params.loop ? (e.slides.eq(i).hasClass(e.params.slideDuplicateClass) && (e.loopFix(), e._clientLeft = e.$wrapperEl[0].clientLeft, i = e.activeIndex), o = e.slides.eq(i).prevAll('[data-swiper-slide-index="' + this.realIndex + '"]').eq(0).index(), n = e.slides.eq(i).nextAll('[data-swiper-slide-index="' + this.realIndex + '"]').eq(0).index(), n = void 0 === o ? n : void 0 === n ? o : n - i == i - o ? i : n - i < i - o ? n : o, this.activeIndex > this.previousIndex ? "next" : "prev") : (n = this.realIndex) > this.previousIndex ? "next" : "prev", r && (n += "next" === o ? a : -1 * a), e.visibleSlidesIndexes && e.visibleSlidesIndexes.indexOf(n) < 0 && (e.params.centeredSlides ? n = i < n ? n - Math.floor(s / 2) + 1 : n + Math.floor(s / 2) - 1 : i < n && (n = n - s + 1), e.slideTo(n, t ? 0 : void 0))); 5308 var l = 1, 5309 c = this.params.thumbs.slideThumbActiveClass; 5310 if (1 < this.params.slidesPerView && !this.params.centeredSlides && (l = this.params.slidesPerView), this.params.thumbs.multipleActiveThumbs || (l = 1), l = Math.floor(l), e.slides.removeClass(c), e.params.loop || e.params.virtual && e.params.virtual.enabled) 5311 for (var d = 0; d < l; d += 1) e.$wrapperEl.children('[data-swiper-slide-index="' + (this.realIndex + d) + '"]').addClass(c); 5312 else 5313 for (var u = 0; u < l; u += 1) e.slides.eq(this.realIndex + u).addClass(c) 5314 } 5315 } 5316 }, 5317 I = [E, I, { 5318 name: "mousewheel", 5319 params: { 5320 mousewheel: { 5321 enabled: !1, 5322 releaseOnEdges: !1, 5323 invert: !1, 5324 forceToAxis: !1, 5325 sensitivity: 1, 5326 eventsTarget: "container", 5327 thresholdDelta: null, 5328 thresholdTime: null 5329 } 5330 }, 5331 create: function() { 5332 w(this, { 5333 mousewheel: { 5334 enabled: !1, 5335 lastScrollTime: T(), 5336 lastEventBeforeSnap: void 0, 5337 recentWheelEvents: [], 5338 enable: W.enable, 5339 disable: W.disable, 5340 handle: W.handle, 5341 handleMouseEnter: W.handleMouseEnter, 5342 handleMouseLeave: W.handleMouseLeave, 5343 animateSlider: W.animateSlider, 5344 releaseScroll: W.releaseScroll 5345 } 5346 }) 5347 }, 5348 on: { 5349 init: function(t) { 5350 !t.params.mousewheel.enabled && t.params.cssMode && t.mousewheel.disable(), t.params.mousewheel.enabled && t.mousewheel.enable() 5351 }, 5352 destroy: function(t) { 5353 t.params.cssMode && t.mousewheel.enable(), t.mousewheel.enabled && t.mousewheel.disable() 5354 } 5355 } 5356 }, { 5357 name: "navigation", 5358 params: { 5359 navigation: { 5360 nextEl: null, 5361 prevEl: null, 5362 hideOnClick: !1, 5363 disabledClass: "swiper-button-disabled", 5364 hiddenClass: "swiper-button-hidden", 5365 lockClass: "swiper-button-lock" 5366 } 5367 }, 5368 create: function() { 5369 w(this, { 5370 navigation: e({}, F) 5371 }) 5372 }, 5373 on: { 5374 init: function(t) { 5375 t.navigation.init(), t.navigation.update() 5376 }, 5377 toEdge: function(t) { 5378 t.navigation.update() 5379 }, 5380 fromEdge: function(t) { 5381 t.navigation.update() 5382 }, 5383 destroy: function(t) { 5384 t.navigation.destroy() 5385 }, 5386 click: function(t, e) { 5387 var i, n = t.navigation, 5388 o = n.$nextEl, 5389 n = n.$prevEl; 5390 !t.params.navigation.hideOnClick || _(e.target).is(n) || _(e.target).is(o) || (o ? i = o.hasClass(t.params.navigation.hiddenClass) : n && (i = n.hasClass(t.params.navigation.hiddenClass)), !0 === i ? t.emit("navigationShow") : t.emit("navigationHide"), o && o.toggleClass(t.params.navigation.hiddenClass), n && n.toggleClass(t.params.navigation.hiddenClass)) 5391 } 5392 } 5393 }, { 5394 name: "pagination", 5395 params: { 5396 pagination: { 5397 el: null, 5398 bulletElement: "span", 5399 clickable: !1, 5400 hideOnClick: !1, 5401 renderBullet: null, 5402 renderProgressbar: null, 5403 renderFraction: null, 5404 renderCustom: null, 5405 progressbarOpposite: !1, 5406 type: "bullets", 5407 dynamicBullets: !1, 5408 dynamicMainBullets: 1, 5409 formatFractionCurrent: function(t) { 5410 return t 5411 }, 5412 formatFractionTotal: function(t) { 5413 return t 5414 }, 5415 bulletClass: "swiper-pagination-bullet", 5416 bulletActiveClass: "swiper-pagination-bullet-active", 5417 modifierClass: "swiper-pagination-", 5418 currentClass: "swiper-pagination-current", 5419 totalClass: "swiper-pagination-total", 5420 hiddenClass: "swiper-pagination-hidden", 5421 progressbarFillClass: "swiper-pagination-progressbar-fill", 5422 progressbarOppositeClass: "swiper-pagination-progressbar-opposite", 5423 clickableClass: "swiper-pagination-clickable", 5424 lockClass: "swiper-pagination-lock" 5425 } 5426 }, 5427 create: function() { 5428 w(this, { 5429 pagination: e({ 5430 dynamicBulletIndex: 0 5431 }, q) 5432 }) 5433 }, 5434 on: { 5435 init: function(t) { 5436 t.pagination.init(), t.pagination.render(), t.pagination.update() 5437 }, 5438 activeIndexChange: function(t) { 5439 !t.params.loop && void 0 !== t.snapIndex || t.pagination.update() 5440 }, 5441 snapIndexChange: function(t) { 5442 t.params.loop || t.pagination.update() 5443 }, 5444 slidesLengthChange: function(t) { 5445 t.params.loop && (t.pagination.render(), t.pagination.update()) 5446 }, 5447 snapGridLengthChange: function(t) { 5448 t.params.loop || (t.pagination.render(), t.pagination.update()) 5449 }, 5450 destroy: function(t) { 5451 t.pagination.destroy() 5452 }, 5453 click: function(t, e) { 5454 t.params.pagination.el && t.params.pagination.hideOnClick && 0 < t.pagination.$el.length && !_(e.target).hasClass(t.params.pagination.bulletClass) && (!0 === t.pagination.$el.hasClass(t.params.pagination.hiddenClass) ? t.emit("paginationShow") : t.emit("paginationHide"), t.pagination.$el.toggleClass(t.params.pagination.hiddenClass)) 5455 } 5456 } 5457 }, { 5458 name: "scrollbar", 5459 params: { 5460 scrollbar: { 5461 el: null, 5462 dragSize: "auto", 5463 hide: !1, 5464 draggable: !1, 5465 snapOnRelease: !0, 5466 lockClass: "swiper-scrollbar-lock", 5467 dragClass: "swiper-scrollbar-drag" 5468 } 5469 }, 5470 create: function() { 5471 w(this, { 5472 scrollbar: e({ 5473 isTouched: !1, 5474 timeout: null, 5475 dragTimeout: null 5476 }, V) 5477 }) 5478 }, 5479 on: { 5480 init: function(t) { 5481 t.scrollbar.init(), t.scrollbar.updateSize(), t.scrollbar.setTranslate() 5482 }, 5483 update: function(t) { 5484 t.scrollbar.updateSize() 5485 }, 5486 resize: function(t) { 5487 t.scrollbar.updateSize() 5488 }, 5489 observerUpdate: function(t) { 5490 t.scrollbar.updateSize() 5491 }, 5492 setTranslate: function(t) { 5493 t.scrollbar.setTranslate() 5494 }, 5495 setTransition: function(t, e) { 5496 t.scrollbar.setTransition(e) 5497 }, 5498 destroy: function(t) { 5499 t.scrollbar.destroy() 5500 } 5501 } 5502 }, { 5503 name: "parallax", 5504 params: { 5505 parallax: { 5506 enabled: !1 5507 } 5508 }, 5509 create: function() { 5510 w(this, { 5511 parallax: e({}, U) 5512 }) 5513 }, 5514 on: { 5515 beforeInit: function(t) { 5516 t.params.parallax.enabled && (t.params.watchSlidesProgress = !0, t.originalParams.watchSlidesProgress = !0) 5517 }, 5518 init: function(t) { 5519 t.params.parallax.enabled && t.parallax.setTranslate() 5520 }, 5521 setTranslate: function(t) { 5522 t.params.parallax.enabled && t.parallax.setTranslate() 5523 }, 5524 setTransition: function(t, e) { 5525 t.params.parallax.enabled && t.parallax.setTransition(e) 5526 } 5527 } 5528 }, { 5529 name: "zoom", 5530 params: { 5531 zoom: { 5532 enabled: !1, 5533 maxRatio: 3, 5534 minRatio: 1, 5535 toggle: !0, 5536 containerClass: "swiper-zoom-container", 5537 zoomedSlideClass: "swiper-slide-zoomed" 5538 } 5539 }, 5540 create: function() { 5541 var n = this; 5542 w(n, { 5543 zoom: e({ 5544 enabled: !1, 5545 scale: 1, 5546 currentScale: 1, 5547 isScaling: !1, 5548 gesture: { 5549 $slideEl: void 0, 5550 slideWidth: void 0, 5551 slideHeight: void 0, 5552 $imageEl: void 0, 5553 $imageWrapEl: void 0, 5554 maxRatio: 3 5555 }, 5556 image: { 5557 isTouched: void 0, 5558 isMoved: void 0, 5559 currentX: void 0, 5560 currentY: void 0, 5561 minX: void 0, 5562 minY: void 0, 5563 maxX: void 0, 5564 maxY: void 0, 5565 width: void 0, 5566 height: void 0, 5567 startX: void 0, 5568 startY: void 0, 5569 touchesStart: {}, 5570 touchesCurrent: {} 5571 }, 5572 velocity: { 5573 x: void 0, 5574 y: void 0, 5575 prevPositionX: void 0, 5576 prevPositionY: void 0, 5577 prevTime: void 0 5578 } 5579 }, G) 5580 }); 5581 var o = 1; 5582 Object.defineProperty(n.zoom, "scale", { 5583 get: function() { 5584 return o 5585 }, 5586 set: function(t) { 5587 var e, i; 5588 o !== t && (e = n.zoom.gesture.$imageEl ? n.zoom.gesture.$imageEl[0] : void 0, i = n.zoom.gesture.$slideEl ? n.zoom.gesture.$slideEl[0] : void 0, n.emit("zoomChange", t, e, i)), o = t 5589 } 5590 }) 5591 }, 5592 on: { 5593 init: function(t) { 5594 t.params.zoom.enabled && t.zoom.enable() 5595 }, 5596 destroy: function(t) { 5597 t.zoom.disable() 5598 }, 5599 touchStart: function(t, e) { 5600 t.zoom.enabled && t.zoom.onTouchStart(e) 5601 }, 5602 touchEnd: function(t, e) { 5603 t.zoom.enabled && t.zoom.onTouchEnd(e) 5604 }, 5605 doubleTap: function(t, e) { 5606 t.params.zoom.enabled && t.zoom.enabled && t.params.zoom.toggle && t.zoom.toggle(e) 5607 }, 5608 transitionEnd: function(t) { 5609 t.zoom.enabled && t.params.zoom.enabled && t.zoom.onTransitionEnd() 5610 }, 5611 slideChange: function(t) { 5612 t.zoom.enabled && t.params.zoom.enabled && t.params.cssMode && t.zoom.onTransitionEnd() 5613 } 5614 } 5615 }, { 5616 name: "lazy", 5617 params: { 5618 lazy: { 5619 enabled: !1, 5620 loadPrevNext: !1, 5621 loadPrevNextAmount: 1, 5622 loadOnTransitionStart: !1, 5623 elementClass: "swiper-lazy", 5624 loadingClass: "swiper-lazy-loading", 5625 loadedClass: "swiper-lazy-loaded", 5626 preloaderClass: "swiper-lazy-preloader" 5627 } 5628 }, 5629 create: function() { 5630 w(this, { 5631 lazy: e({ 5632 initialImageLoaded: !1 5633 }, K) 5634 }) 5635 }, 5636 on: { 5637 beforeInit: function(t) { 5638 t.params.lazy.enabled && t.params.preloadImages && (t.params.preloadImages = !1) 5639 }, 5640 init: function(t) { 5641 t.params.lazy.enabled && !t.params.loop && 0 === t.params.initialSlide && t.lazy.load() 5642 }, 5643 scroll: function(t) { 5644 t.params.freeMode && !t.params.freeModeSticky && t.lazy.load() 5645 }, 5646 resize: function(t) { 5647 t.params.lazy.enabled && t.lazy.load() 5648 }, 5649 scrollbarDragMove: function(t) { 5650 t.params.lazy.enabled && t.lazy.load() 5651 }, 5652 transitionStart: function(t) { 5653 t.params.lazy.enabled && (t.params.lazy.loadOnTransitionStart || !t.params.lazy.loadOnTransitionStart && !t.lazy.initialImageLoaded) && t.lazy.load() 5654 }, 5655 transitionEnd: function(t) { 5656 t.params.lazy.enabled && !t.params.lazy.loadOnTransitionStart && t.lazy.load() 5657 }, 5658 slideChange: function(t) { 5659 t.params.lazy.enabled && t.params.cssMode && t.lazy.load() 5660 } 5661 } 5662 }, { 5663 name: "controller", 5664 params: { 5665 controller: { 5666 control: void 0, 5667 inverse: !1, 5668 by: "slide" 5669 } 5670 }, 5671 create: function() { 5672 w(this, { 5673 controller: e({ 5674 control: this.params.controller.control 5675 }, Z) 5676 }) 5677 }, 5678 on: { 5679 update: function(t) { 5680 t.controller.control && t.controller.spline && (t.controller.spline = void 0, delete t.controller.spline) 5681 }, 5682 resize: function(t) { 5683 t.controller.control && t.controller.spline && (t.controller.spline = void 0, delete t.controller.spline) 5684 }, 5685 observerUpdate: function(t) { 5686 t.controller.control && t.controller.spline && (t.controller.spline = void 0, delete t.controller.spline) 5687 }, 5688 setTranslate: function(t, e, i) { 5689 t.controller.control && t.controller.setTranslate(e, i) 5690 }, 5691 setTransition: function(t, e, i) { 5692 t.controller.control && t.controller.setTransition(e, i) 5693 } 5694 } 5695 }, { 5696 name: "a11y", 5697 params: { 5698 a11y: { 5699 enabled: !0, 5700 notificationClass: "swiper-notification", 5701 prevSlideMessage: "Previous slide", 5702 nextSlideMessage: "Next slide", 5703 firstSlideMessage: "This is the first slide", 5704 lastSlideMessage: "This is the last slide", 5705 paginationBulletMessage: "Go to slide {{index}}" 5706 } 5707 }, 5708 create: function() { 5709 w(this, { 5710 a11y: e(e({}, Q), {}, { 5711 liveRegion: _('<span class="' + this.params.a11y.notificationClass + '" aria-live="assertive" aria-atomic="true"></span>') 5712 }) 5713 }) 5714 }, 5715 on: { 5716 init: function(t) { 5717 t.params.a11y.enabled && (t.a11y.init(), t.a11y.updateNavigation()) 5718 }, 5719 toEdge: function(t) { 5720 t.params.a11y.enabled && t.a11y.updateNavigation() 5721 }, 5722 fromEdge: function(t) { 5723 t.params.a11y.enabled && t.a11y.updateNavigation() 5724 }, 5725 paginationUpdate: function(t) { 5726 t.params.a11y.enabled && t.a11y.updatePagination() 5727 }, 5728 destroy: function(t) { 5729 t.params.a11y.enabled && t.a11y.destroy() 5730 } 5731 } 5732 }, { 5733 name: "history", 5734 params: { 5735 history: { 5736 enabled: !1, 5737 replaceState: !1, 5738 key: "slides" 5739 } 5740 }, 5741 create: function() { 5742 w(this, { 5743 history: e({}, J) 5744 }) 5745 }, 5746 on: { 5747 init: function(t) { 5748 t.params.history.enabled && t.history.init() 5749 }, 5750 destroy: function(t) { 5751 t.params.history.enabled && t.history.destroy() 5752 }, 5753 transitionEnd: function(t) { 5754 t.history.initialized && t.history.setHistory(t.params.history.key, t.activeIndex) 5755 }, 5756 slideChange: function(t) { 5757 t.history.initialized && t.params.cssMode && t.history.setHistory(t.params.history.key, t.activeIndex) 5758 } 5759 } 5760 }, { 5761 name: "hash-navigation", 5762 params: { 5763 hashNavigation: { 5764 enabled: !1, 5765 replaceState: !1, 5766 watchState: !1 5767 } 5768 }, 5769 create: function() { 5770 w(this, { 5771 hashNavigation: e({ 5772 initialized: !1 5773 }, tt) 5774 }) 5775 }, 5776 on: { 5777 init: function(t) { 5778 t.params.hashNavigation.enabled && t.hashNavigation.init() 5779 }, 5780 destroy: function(t) { 5781 t.params.hashNavigation.enabled && t.hashNavigation.destroy() 5782 }, 5783 transitionEnd: function(t) { 5784 t.hashNavigation.initialized && t.hashNavigation.setHash() 5785 }, 5786 slideChange: function(t) { 5787 t.hashNavigation.initialized && t.params.cssMode && t.hashNavigation.setHash() 5788 } 5789 } 5790 }, { 5791 name: "autoplay", 5792 params: { 5793 autoplay: { 5794 enabled: !1, 5795 delay: 3e3, 5796 waitForTransition: !0, 5797 disableOnInteraction: !0, 5798 stopOnLastSlide: !1, 5799 reverseDirection: !1 5800 } 5801 }, 5802 create: function() { 5803 w(this, { 5804 autoplay: e(e({}, et), {}, { 5805 running: !1, 5806 paused: !1 5807 }) 5808 }) 5809 }, 5810 on: { 5811 init: function(t) {
5812 t.params.autoplay.enabled && (t.autoplay.start(), v().addEventListener("visibilitychange", t.autoplay.onVisibilityChange)) 5813 }, 5814 beforeTransitionStart: function(t, e, i) { 5815 t.autoplay.running && (i || !t.params.autoplay.disableOnInteraction ? t.autoplay.pause(e) : t.autoplay.stop()) 5816 }, 5817 sliderFirstMove: function(t) { 5818 t.autoplay.running && (t.params.autoplay.disableOnInteraction ? t.autoplay.stop() : t.autoplay.pause()) 5819 }, 5820 touchEnd: function(t) { 5821 t.params.cssMode && t.autoplay.paused && !t.params.autoplay.disableOnInteraction && t.autoplay.run() 5822 }, 5823 destroy: function(t) { 5824 t.autoplay.running && t.autoplay.stop(), v().removeEventListener("visibilitychange", t.autoplay.onVisibilityChange) 5825 } 5826 } 5827 }, { 5828 name: "effect-fade", 5829 params: { 5830 fadeEffect: { 5831 crossFade: !1 5832 } 5833 }, 5834 create: function() { 5835 w(this, { 5836 fadeEffect: e({}, it) 5837 }) 5838 }, 5839 on: { 5840 beforeInit: function(t) { 5841 var e; 5842 "fade" === t.params.effect && (t.classNames.push(t.params.containerModifierClass + "fade"), X(t.params, e = { 5843 slidesPerView: 1, 5844 slidesPerColumn: 1, 5845 slidesPerGroup: 1, 5846 watchSlidesProgress: !0, 5847 spaceBetween: 0, 5848 virtualTranslate: !0 5849 }), X(t.originalParams, e)) 5850 }, 5851 setTranslate: function(t) { 5852 "fade" === t.params.effect && t.fadeEffect.setTranslate() 5853 }, 5854 setTransition: function(t, e) { 5855 "fade" === t.params.effect && t.fadeEffect.setTransition(e) 5856 } 5857 } 5858 }, { 5859 name: "effect-cube", 5860 params: { 5861 cubeEffect: { 5862 slideShadows: !0, 5863 shadow: !0, 5864 shadowOffset: 20, 5865 shadowScale: .94 5866 } 5867 }, 5868 create: function() { 5869 w(this, { 5870 cubeEffect: e({}, nt) 5871 }) 5872 }, 5873 on: { 5874 beforeInit: function(t) { 5875 var e; 5876 "cube" === t.params.effect && (t.classNames.push(t.params.containerModifierClass + "cube"), t.classNames.push(t.params.containerModifierClass + "3d"), X(t.params, e = { 5877 slidesPerView: 1, 5878 slidesPerColumn: 1, 5879 slidesPerGroup: 1, 5880 watchSlidesProgress: !0, 5881 resistanceRatio: 0, 5882 spaceBetween: 0, 5883 centeredSlides: !1, 5884 virtualTranslate: !0 5885 }), X(t.originalParams, e)) 5886 }, 5887 setTranslate: function(t) { 5888 "cube" === t.params.effect && t.cubeEffect.setTranslate() 5889 }, 5890 setTransition: function(t, e) { 5891 "cube" === t.params.effect && t.cubeEffect.setTransition(e) 5892 } 5893 } 5894 }, { 5895 name: "effect-flip", 5896 params: { 5897 flipEffect: { 5898 slideShadows: !0, 5899 limitRotation: !0 5900 } 5901 }, 5902 create: function() { 5903 w(this, { 5904 flipEffect: e({}, ot) 5905 }) 5906 }, 5907 on: { 5908 beforeInit: function(t) { 5909 var e; 5910 "flip" === t.params.effect && (t.classNames.push(t.params.containerModifierClass + "flip"), t.classNames.push(t.params.containerModifierClass + "3d"), X(t.params, e = { 5911 slidesPerView: 1, 5912 slidesPerColumn: 1, 5913 slidesPerGroup: 1, 5914 watchSlidesProgress: !0, 5915 spaceBetween: 0, 5916 virtualTranslate: !0 5917 }), X(t.originalParams, e)) 5918 }, 5919 setTranslate: function(t) { 5920 "flip" === t.params.effect && t.flipEffect.setTranslate() 5921 }, 5922 setTransition: function(t, e) { 5923 "flip" === t.params.effect && t.flipEffect.setTransition(e) 5924 } 5925 } 5926 }, { 5927 name: "effect-coverflow", 5928 params: { 5929 coverflowEffect: { 5930 rotate: 50, 5931 stretch: 0, 5932 depth: 100, 5933 scale: 1, 5934 modifier: 1, 5935 slideShadows: !0 5936 } 5937 }, 5938 create: function() { 5939 w(this, { 5940 coverflowEffect: e({}, st) 5941 }) 5942 }, 5943 on: { 5944 beforeInit: function(t) { 5945 "coverflow" === t.params.effect && (t.classNames.push(t.params.containerModifierClass + "coverflow"), t.classNames.push(t.params.containerModifierClass + "3d"), t.params.watchSlidesProgress = !0, t.originalParams.watchSlidesProgress = !0) 5946 }, 5947 setTranslate: function(t) { 5948 "coverflow" === t.params.effect && t.coverflowEffect.setTranslate() 5949 }, 5950 setTransition: function(t, e) { 5951 "coverflow" === t.params.effect && t.coverflowEffect.setTransition(e) 5952 } 5953 } 5954 }, { 5955 name: "thumbs", 5956 params: { 5957 thumbs: { 5958 swiper: null, 5959 multipleActiveThumbs: !0, 5960 autoScrollOffset: 0, 5961 slideThumbActiveClass: "swiper-slide-thumb-active", 5962 thumbsContainerClass: "swiper-container-thumbs" 5963 } 5964 }, 5965 create: function() { 5966 w(this, { 5967 thumbs: e({ 5968 swiper: null, 5969 initialized: !1 5970 }, at) 5971 }) 5972 }, 5973 on: { 5974 beforeInit: function(t) { 5975 var e = t.params.thumbs; 5976 e && e.swiper && (t.thumbs.init(), t.thumbs.update(!0)) 5977 }, 5978 slideChange: function(t) { 5979 t.thumbs.swiper && t.thumbs.update() 5980 }, 5981 update: function(t) { 5982 t.thumbs.swiper && t.thumbs.update() 5983 }, 5984 resize: function(t) { 5985 t.thumbs.swiper && t.thumbs.update() 5986 }, 5987 observerUpdate: function(t) { 5988 t.thumbs.swiper && t.thumbs.update() 5989 }, 5990 setTransition: function(t, e) { 5991 t = t.thumbs.swiper; 5992 t && t.setTransition(e) 5993 }, 5994 beforeDestroy: function(t) { 5995 var e = t.thumbs.swiper; 5996 e && t.thumbs.swiperCreated && e && e.destroy() 5997 } 5998 } 5999 }]; 6000 return H.use(I), H 6001 }), 6002 function(i) { 6003 "function" == typeof define && define.amd ? define(["jquery"], i) : "object" == typeof module && module.exports ? module.exports = function(t, e) { 6004 return void 0 === e && (e = "undefined" != typeof window ? require("jquery") : require("jquery")(t)), i(e), e 6005 } : i(jQuery) 6006 }(function(e) { 6007 var t, i, n, h, s, a, p, f, m, g, v, b, o, r, y, l, l = ((t = e && e.fn && e.fn.select2 && e.fn.select2.amd ? e.fn.select2.amd : t) && t.requirejs || (t ? n = t : t = {}, m = {}, g = {}, v = {}, b = {}, o = Object.prototype.hasOwnProperty, r = [].slice, y = /\.js$/, p = function(t, e) { 6008 var i, n, o = d(t), 6009 s = o[0], 6010 e = e[1]; 6011 return t = o[1], s && (i = x(s = c(s, e))), s ? t = i && i.normalize ? i.normalize(t, (n = e, function(t) { 6012 return c(t, n) 6013 })) : c(t, e) : (s = (o = d(t = c(t, e)))[0], t = o[1], s && (i = x(s))), { 6014 f: s ? s + "!" + t : t, 6015 n: t, 6016 pr: s, 6017 p: i 6018 } 6019 }, f = { 6020 require: function(t) { 6021 return C(t) 6022 }, 6023 exports: function(t) { 6024 var e = m[t]; 6025 return void 0 !== e ? e : m[t] = {} 6026 }, 6027 module: function(t) { 6028 return { 6029 id: t, 6030 uri: "", 6031 exports: m[t], 6032 config: (e = t, function() { 6033 return v && v.config && v.config[e] || {} 6034 }) 6035 }; 6036 var e 6037 } 6038 }, s = function(t, e, i, n) { 6039 var o, s, a, r, l, c = [], 6040 d = typeof i, 6041 u = _(n = n || t); 6042 if ("undefined" == d || "function" == d) { 6043 for (e = !e.length && i.length ? ["require", "exports", "module"] : e, r = 0; r < e.length; r += 1) 6044 if ("require" === (s = (a = p(e[r], u)).f)) c[r] = f.require(t); 6045 else if ("exports" === s) c[r] = f.exports(t), l = !0; 6046 else if ("module" === s) o = c[r] = f.module(t); 6047 else if (w(m, s) || w(g, s) || w(b, s)) c[r] = x(s); 6048 else { 6049 if (!a.p) throw new Error(t + " missing " + s); 6050 a.p.load(a.n, C(n, !0), function(e) { 6051 return function(t) { 6052 m[e] = t 6053 } 6054 }(s), {}), c[r] = m[s] 6055 } 6056 d = i ? i.apply(m[t], c) : void 0, t && (o && o.exports !== h && o.exports !== m[t] ? m[t] = o.exports : d === h && l || (m[t] = d)) 6057 } else t && (m[t] = i) 6058 }, i = n = a = function(t, e, i, n, o) { 6059 if ("string" == typeof t) return f[t] ? f[t](e) : x(p(t, _(e)).f); 6060 if (!t.splice) { 6061 if ((v = t).deps && a(v.deps, v.callback), !e) return; 6062 e.splice ? (t = e, e = i, i = null) : t = h 6063 } 6064 return e = e || function() {}, "function" == typeof i && (i = n, n = o), n ? s(h, t, e, i) : setTimeout(function() { 6065 s(h, t, e, i) 6066 }, 4), a 6067 }, a.config = function(t) { 6068 return a(t) 6069 }, i._defined = m, (l = function(t, e, i) { 6070 if ("string" != typeof t) throw new Error("See almond README: incorrect module build, no module name"); 6071 e.splice || (i = e, e = []), w(m, t) || w(g, t) || (g[t] = [t, e, i]) 6072 }).amd = { 6073 jQuery: !0 6074 }, t.requirejs = i, t.require = n, t.define = l), t.define("almond", function() {}), t.define("jquery", [], function() { 6075 var t = e || $; 6076 return null == t && console && console.error && console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."), t 6077 }), t.define("select2/utils", ["jquery"], function(s) { 6078 var n = {}; 6079 6080 function c(t) { 6081 var e, i = t.prototype, 6082 n = [];
6083 for (e in i) "function" == typeof i[e] && "constructor" !== e && n.push(e); 6084 return n 6085 } 6086 6087 function t() { 6088 this.listeners = {} 6089 } 6090 n.Extend = function(t, e) { 6091 var i, n = {}.hasOwnProperty; 6092 6093 function o() { 6094 this.constructor = t 6095 } 6096 for (i in e) n.call(e, i) && (t[i] = e[i]); 6097 return o.prototype = e.prototype, t.prototype = new o, t.__super__ = e.prototype, t 6098 }, n.Decorate = function(n, o) { 6099 var t = c(o), 6100 e = c(n); 6101 6102 function s() { 6103 var t = Array.prototype.unshift, 6104 e = o.prototype.constructor.length, 6105 i = n.prototype.constructor; 6106 0 < e && (t.call(arguments, n.prototype.constructor), i = o.prototype.constructor), i.apply(this, arguments) 6107 } 6108 o.displayName = n.displayName, s.prototype = new function() { 6109 this.constructor = s 6110 }; 6111 for (var i = 0; i < e.length; i++) { 6112 var a = e[i]; 6113 s.prototype[a] = n.prototype[a] 6114 } 6115 for (var r = 0; r < t.length; r++) { 6116 var l = t[r]; 6117 s.prototype[l] = function(t) { 6118 var e = function() {}; 6119 t in s.prototype && (e = s.prototype[t]); 6120 var i = o.prototype[t]; 6121 return function() { 6122 return Array.prototype.unshift.call(arguments, e), i.apply(this, arguments) 6123 } 6124 }(l) 6125 } 6126 return s 6127 }, t.prototype.on = function(t, e) { 6128 this.listeners = this.listeners || {}, t in this.listeners ? this.listeners[t].push(e) : this.listeners[t] = [e] 6129 }, t.prototype.trigger = function(t) { 6130 var e = Array.prototype.slice, 6131 i = e.call(arguments, 1); 6132 this.listeners = this.listeners || {}, 0 === (i = null == i ? [] : i).length && i.push({}), (i[0]._type = t) in this.listeners && this.invoke(this.listeners[t], e.call(arguments, 1)), "*" in this.listeners && this.invoke(this.listeners["*"], arguments) 6133 }, t.prototype.invoke = function(t, e) { 6134 for (var i = 0, n = t.length; i < n; i++) t[i].apply(this, e) 6135 }, n.Observable = t, n.generateChars = function(t) { 6136 for (var e = "", i = 0; i < t; i++) e += Math.floor(36 * Math.random()).toString(36); 6137 return e 6138 }, n.bind = function(t, e) { 6139 return function() { 6140 t.apply(e, arguments) 6141 } 6142 }, n._convertData = function(t) { 6143 for (var e in t) { 6144 var i = e.split("-"), 6145 n = t; 6146 if (1 !== i.length) { 6147 for (var o = 0; o < i.length; o++) { 6148 var s = i[o]; 6149 (s = s.substring(0, 1).toLowerCase() + s.substring(1)) in n || (n[s] = {}), o == i.length - 1 && (n[s] = t[e]), n = n[s] 6150 } 6151 delete t[e] 6152 } 6153 } 6154 return t 6155 }, n.hasScroll = function(t, e) { 6156 var i = s(e), 6157 n = e.style.overflowX, 6158 o = e.style.overflowY; 6159 return (n !== o || "hidden" !== o && "visible" !== o) && ("scroll" === n || "scroll" === o || i.innerHeight() < e.scrollHeight || i.innerWidth() < e.scrollWidth) 6160 }, n.escapeMarkup = function(t) { 6161 var e = { 6162 "\\": "\", 6163 "&": "&", 6164 "<": "<", 6165 ">": ">", 6166 '"': """, 6167 "'": "'", 6168 "/": "/" 6169 }; 6170 return "string" != typeof t ? t : String(t).replace(/[&<>"'\/\\]/g, function(t) { 6171 return e[t] 6172 }) 6173 }, n.appendMany = function(t, e) { 6174 var i; 6175 "1.7" === s.fn.jquery.substr(0, 3) && (i = s(), s.map(e, function(t) { 6176 i = i.add(t) 6177 }), e = i), t.append(e) 6178 }, n.__cache = {}; 6179 var i = 0; 6180 return n.GetUniqueElementId = function(t) { 6181 var e = t.getAttribute("data-select2-id"); 6182 return null == e && (t.id ? (e = t.id, t.setAttribute("data-select2-id", e)) : (t.setAttribute("data-select2-id", ++i), e = i.toString())), e 6183 }, n.StoreData = function(t, e, i) { 6184 t = n.GetUniqueElementId(t); 6185 n.__cache[t] || (n.__cache[t] = {}), n.__cache[t][e] = i 6186 }, n.GetData = function(t, e) { 6187 var i = n.GetUniqueElementId(t); 6188 return e ? n.__cache[i] && null != n.__cache[i][e] ? n.__cache[i][e] : s(t).data(e) : n.__cache[i] 6189 }, n.RemoveData = function(t) { 6190 var e = n.GetUniqueElementId(t); 6191 null != n.__cache[e] && delete n.__cache[e], t.removeAttribute("data-select2-id") 6192 }, n 6193 }), t.define("select2/results", ["jquery", "./utils"], function(u, h) { 6194 function n(t, e, i) { 6195 this.$element = t, this.data = i, this.options = e, n.__super__.constructor.call(this) 6196 } 6197 return h.Extend(n, h.Observable), n.prototype.render = function() { 6198 var t = u('<ul class="select2-results__options" role="listbox"></ul>'); 6199 return this.options.get("multiple") && t.attr("aria-multiselectable", "true"), this.$results = t 6200 }, n.prototype.clear = function() { 6201 this.$results.empty() 6202 }, n.prototype.displayMessage = function(t) { 6203 var e = this.options.get("escapeMarkup"); 6204 this.clear(), this.hideLoading(); 6205 var i = u('<li role="alert" aria-live="assertive" class="select2-results__option"></li>'), 6206 n = this.options.get("translations").get(t.message); 6207 i.append(e(n(t.args))), i[0].className += " select2-results__message", this.$results.append(i) 6208 }, n.prototype.hideMessages = function() { 6209 this.$results.find(".select2-results__message").remove() 6210 }, n.prototype.append = function(t) { 6211 this.hideLoading(); 6212 var e = []; 6213 if (null != t.results && 0 !== t.results.length) { 6214 t.results = this.sort(t.results); 6215 for (var i = 0; i < t.results.length; i++) { 6216 var n = t.results[i], 6217 n = this.option(n); 6218 e.push(n) 6219 } 6220 this.$results.append(e) 6221 } else 0 === this.$results.children().length && this.trigger("results:message", { 6222 message: "noResults" 6223 }) 6224 }, n.prototype.position = function(t, e) { 6225 e.find(".select2-results").append(t) 6226 }, n.prototype.sort = function(t) { 6227 return this.options.get("sorter")(t) 6228 }, n.prototype.highlightFirstItem = function() { 6229 var t = this.$results.find(".select2-results__option[aria-selected]"), 6230 e = t.filter("[aria-selected=true]"); 6231 (0 < e.length ? e : t).first().trigger("mouseenter"), this.ensureHighlightVisible() 6232 }, n.prototype.setClasses = function() { 6233 var e = this; 6234 this.data.current(function(t) { 6235 var n = u.map(t, function(t) { 6236 return t.id.toString() 6237 }); 6238 e.$results.find(".select2-results__option[aria-selected]").each(function() { 6239 var t = u(this), 6240 e = h.GetData(this, "data"), 6241 i = "" + e.id; 6242 null != e.element && e.element.selected || null == e.element && -1 < u.inArray(i, n) ? t.attr("aria-selected", "true") : t.attr("aria-selected", "false") 6243 }) 6244 }) 6245 }, n.prototype.showLoading = function(t) { 6246 this.hideLoading(); 6247 t = { 6248 disabled: !0, 6249 loading: !0, 6250 text: this.options.get("translations").get("searching")(t) 6251 }, t = this.option(t); 6252 t.className += " loading-results", this.$results.prepend(t) 6253 }, n.prototype.hideLoading = function() { 6254 this.$results.find(".loading-results").remove() 6255 }, n.prototype.option = function(t) { 6256 var e = document.createElement("li"); 6257 e.className = "select2-results__option"; 6258 var i, n = { 6259 role: "option", 6260 "aria-selected": "false" 6261 }, 6262 o = window.Element.prototype.matches || window.Element.prototype.msMatchesSelector || window.Element.prototype.webkitMatchesSelector; 6263 for (i in (null != t.element && o.call(t.element, ":disabled") || null == t.element && t.disabled) && (delete n["aria-selected"], n["aria-disabled"] = "true"), null == t.id && delete n["aria-selected"], null != t._resultId && (e.id = t._resultId), t.title && (e.title = t.title), t.children && (n.role = "group", n["aria-label"] = t.text, delete n["aria-selected"]), n) { 6264 var s = n[i]; 6265 e.setAttribute(i, s) 6266 } 6267 if (t.children) { 6268 var a = u(e), 6269 r = document.createElement("strong"); 6270 r.className = "select2-results__group", u(r), this.template(t, r); 6271 for (var l = [], c = 0; c < t.children.length; c++) { 6272 var d = t.children[c], 6273 d = this.option(d); 6274 l.push(d) 6275 } 6276 o = u("<ul></ul>", { 6277 class: "select2-results__options select2-results__options--nested" 6278 }); 6279 o.append(l), a.append(r), a.append(o) 6280 } else this.template(t, e); 6281 return h.StoreData(e, "data", t), e 6282 }, n.prototype.bind = function(e, t) { 6283 var o = this, 6284 i = e.id + "-results"; 6285 this.$results.attr("id", i), e.on("results:all", function(t) { 6286 o.clear(), o.append(t.data), e.isOpen() && (o.setClasses(), o.highlightFirstItem()) 6287 }), e.on("results:append", function(t) { 6288 o.append(t.data), e.isOpen() && o.setClasses() 6289 }), e.on("query", function(t) { 6290 o.hideMessages(), o.showLoading(t) 6291 }), e.on("select", function() { 6292 e.isOpen() && (o.setClasses(), o.options.get("scrollAfterSelect") && o.highlightFirstItem()) 6293 }), e.on("unselect", function() { 6294 e.isOpen() && (o.setClasses(), o.options.get("scrollAfterSelect") && o.highlightFirstItem()) 6295 }), e.on("open", function() { 6296 o.$results.attr("aria-expanded", "true"), o.$results.attr("aria-hidden", "false"), o.setClasses(), o.ensureHighlightVisible() 6297 }), e.on("close", function() { 6298 o.$results.attr("aria-expanded", "false"), o.$results.attr("aria-hidden", "true"), o.$results.removeAttr("aria-activedescendant") 6299 }), e.on("results:toggle", function() { 6300 var t = o.getHighlightedResults(); 6301 0 !== t.length && t.trigger("mouseup") 6302 }), e.on("results:select", function() { 6303 var t, e = o.getHighlightedResults(); 6304 0 !== e.length && (t = h.GetData(e[0], "data"), "true" == e.attr("aria-selected") ? o.trigger("close", {}) : o.trigger("select", { 6305 data: t 6306 })) 6307 }), e.on("results:previous", function() { 6308 var t, e = o.getHighlightedResults(), 6309 i = o.$results.find("[aria-selected]"), 6310 n = i.index(e); 6311 n <= 0 || (t = n - 1, 0 === e.length && (t = 0), (n = i.eq(t)).trigger("mouseenter"), e = o.$results.offset().top, i = n.offset().top, n = o.$results.scrollTop() + (i - e), 0 === t ? o.$results.scrollTop(0) : i - e < 0 && o.$results.scrollTop(n)) 6312 }), e.on("results:next", function() { 6313 var t, e = o.getHighlightedResults(), 6314 i = o.$results.find("[aria-selected]"), 6315 n = i.index(e) + 1; 6316 n >= i.length || ((t = i.eq(n)).trigger("mouseenter"), e = o.$results.offset().top + o.$results.outerHeight(!1), i = t.offset().top + t.outerHeight(!1), t = o.$results.scrollTop() + i - e, 0 === n ? o.$results.scrollTop(0) : e < i && o.$results.scrollTop(t)) 6317 }), e.on("results:focus", function(t) { 6318 t.element.addClass("select2-results__option--highlighted") 6319 }), e.on("results:message", function(t) { 6320 o.displayMessage(t) 6321 }), u.fn.mousewheel && this.$results.on("mousewheel", function(t) { 6322 var e = o.$results.scrollTop(), 6323 i = o.$results.get(0).scrollHeight - e + t.deltaY, 6324 e = 0 < t.deltaY && e - t.deltaY <= 0, 6325 i = t.deltaY < 0 && i <= o.$results.height(); 6326 e ? (o.$results.scrollTop(0), t.preventDefault(), t.stopPropagation()) : i && (o.$results.scrollTop(o.$results.get(0).scrollHeight - o.$results.height()), t.preventDefault(), t.stopPropagation()) 6327 }), this.$results.on("mouseup", ".select2-results__option[aria-selected]", function(t) { 6328 var e = u(this), 6329 i = h.GetData(this, "data"); 6330 "true" !== e.attr("aria-selected") ? o.trigger("select", { 6331 originalEvent: t, 6332 data: i 6333 }) : o.options.get("multiple") ? o.trigger("unselect", { 6334 originalEvent: t, 6335 data: i 6336 }) : o.trigger("close", {}) 6337 }), this.$results.on("mouseenter", ".select2-results__option[aria-selected]", function(t) { 6338 var e = h.GetData(this, "data"); 6339 o.getHighlightedResults().removeClass("select2-results__option--highlighted"), o.trigger("results:focus", { 6340 data: e, 6341 element: u(this) 6342 }) 6343 }) 6344 }, n.prototype.getHighlightedResults = function() { 6345 return this.$results.find(".select2-results__option--highlighted") 6346 }, n.prototype.destroy = function() { 6347 this.$results.remove() 6348 }, n.prototype.ensureHighlightVisible = function() { 6349 var t, e, i, n, o = this.getHighlightedResults(); 6350 0 !== o.length && (t = this.$results.find("[aria-selected]").index(o), n = this.$results.offset().top, e = o.offset().top, i = this.$results.scrollTop() + (e - n), n = e - n, i -= 2 * o.outerHeight(!1), t <= 2 ? this.$results.scrollTop(0) : (n > this.$results.outerHeight() || n < 0) && this.$results.scrollTop(i)) 6351 }, n.prototype.template = function(t, e) { 6352 var i = this.options.get("templateResult"), 6353 n = this.options.get("escapeMarkup"), 6354 t = i(t, e); 6355 null == t ? e.style.display = "none" : "string" == typeof t ? e.innerHTML = n(t) : u(e).append(t) 6356 }, n 6357 }), t.define("select2/keys", [], function() { 6358 return { 6359 BACKSPACE: 8, 6360 TAB: 9,
6361 ENTER: 13, 6362 SHIFT: 16, 6363 CTRL: 17, 6364 ALT: 18, 6365 ESC: 27, 6366 SPACE: 32, 6367 PAGE_UP: 33, 6368 PAGE_DOWN: 34, 6369 END: 35, 6370 HOME: 36, 6371 LEFT: 37, 6372 UP: 38, 6373 RIGHT: 39, 6374 DOWN: 40, 6375 DELETE: 46 6376 } 6377 }), t.define("select2/selection/base", ["jquery", "../utils", "../keys"], function(i, n, o) { 6378 function s(t, e) { 6379 this.$element = t, this.options = e, s.__super__.constructor.call(this) 6380 } 6381 return n.Extend(s, n.Observable), s.prototype.render = function() { 6382 var t = i('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>'); 6383 return this._tabindex = 0, null != n.GetData(this.$element[0], "old-tabindex") ? this._tabindex = n.GetData(this.$element[0], "old-tabindex") : null != this.$element.attr("tabindex") && (this._tabindex = this.$element.attr("tabindex")), t.attr("title", this.$element.attr("title")), t.attr("tabindex", this._tabindex), t.attr("aria-disabled", "false"), this.$selection = t 6384 }, s.prototype.bind = function(t, e) { 6385 var i = this, 6386 n = t.id + "-results"; 6387 this.container = t, this.$selection.on("focus", function(t) { 6388 i.trigger("focus", t) 6389 }), this.$selection.on("blur", function(t) { 6390 i._handleBlur(t) 6391 }), this.$selection.on("keydown", function(t) { 6392 i.trigger("keypress", t), t.which === o.SPACE && t.preventDefault() 6393 }), t.on("results:focus", function(t) { 6394 i.$selection.attr("aria-activedescendant", t.data._resultId) 6395 }), t.on("selection:update", function(t) { 6396 i.update(t.data) 6397 }), t.on("open", function() { 6398 i.$selection.attr("aria-expanded", "true"), i.$selection.attr("aria-owns", n), i._attachCloseHandler(t) 6399 }), t.on("close", function() { 6400 i.$selection.attr("aria-expanded", "false"), i.$selection.removeAttr("aria-activedescendant"), i.$selection.removeAttr("aria-owns"), i.$selection.trigger("focus"), i._detachCloseHandler(t) 6401 }), t.on("enable", function() { 6402 i.$selection.attr("tabindex", i._tabindex), i.$selection.attr("aria-disabled", "false") 6403 }), t.on("disable", function() { 6404 i.$selection.attr("tabindex", "-1"), i.$selection.attr("aria-disabled", "true") 6405 }) 6406 }, s.prototype._handleBlur = function(t) { 6407 var e = this; 6408 window.setTimeout(function() { 6409 document.activeElement == e.$selection[0] || i.contains(e.$selection[0], document.activeElement) || e.trigger("blur", t) 6410 }, 1) 6411 }, s.prototype._attachCloseHandler = function(t) { 6412 i(document.body).on("mousedown.select2." + t.id, function(t) { 6413 var e = i(t.target).closest(".select2"); 6414 i(".select2.select2-container--open").each(function() { 6415 this != e[0] && n.GetData(this, "element").select2("close") 6416 }) 6417 }) 6418 }, s.prototype._detachCloseHandler = function(t) { 6419 i(document.body).off("mousedown.select2." + t.id) 6420 }, s.prototype.position = function(t, e) { 6421 e.find(".selection").append(t) 6422 }, s.prototype.destroy = function() { 6423 this._detachCloseHandler(this.container) 6424 }, s.prototype.update = function(t) { 6425 throw new Error("The `update` method must be defined in child classes.") 6426 }, s 6427 }), t.define("select2/selection/single", ["jquery", "./base", "../utils", "../keys"], function(t, e, i, n) { 6428 function o() { 6429 o.__super__.constructor.apply(this, arguments) 6430 } 6431 return i.Extend(o, e), o.prototype.render = function() { 6432 var t = o.__super__.render.call(this); 6433 return t.addClass("select2-selection--single"), t.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'), t 6434 }, o.prototype.bind = function(e, t) { 6435 var i = this; 6436 o.__super__.bind.apply(this, arguments); 6437 var n = e.id + "-container"; 6438 this.$selection.find(".select2-selection__rendered").attr("id", n).attr("role", "textbox").attr("aria-readonly", "true"), this.$selection.attr("aria-labelledby", n), this.$selection.on("mousedown", function(t) { 6439 1 === t.which && i.trigger("toggle", { 6440 originalEvent: t 6441 }) 6442 }), this.$selection.on("focus", function(t) {}), this.$selection.on("blur", function(t) {}), e.on("focus", function(t) { 6443 e.isOpen() || i.$selection.trigger("focus") 6444 }) 6445 }, o.prototype.clear = function() { 6446 var t = this.$selection.find(".select2-selection__rendered"); 6447 t.empty(), t.removeAttr("title") 6448 }, o.prototype.display = function(t, e) { 6449 var i = this.options.get("templateSelection"); 6450 return this.options.get("escapeMarkup")(i(t, e)) 6451 }, o.prototype.selectionContainer = function() { 6452 return t("<span></span>") 6453 }, o.prototype.update = function(t) { 6454 var e, i; 6455 0 !== t.length ? (i = t[0], e = this.$selection.find(".select2-selection__rendered"), t = this.display(i, e), e.empty().append(t), (i = i.title || i.text) ? e.attr("title", i) : e.removeAttr("title")) : this.clear() 6456 }, o 6457 }), t.define("select2/selection/multiple", ["jquery", "./base", "../utils"], function(n, t, r) { 6458 function o(t, e) { 6459 o.__super__.constructor.apply(this, arguments) 6460 } 6461 return r.Extend(o, t), o.prototype.render = function() { 6462 var t = o.__super__.render.call(this); 6463 return t.addClass("select2-selection--multiple"), t.html('<ul class="select2-selection__rendered"></ul>'), t 6464 }, o.prototype.bind = function(t, e) { 6465 var i = this; 6466 o.__super__.bind.apply(this, arguments), this.$selection.on("click", function(t) { 6467 i.trigger("toggle", { 6468 originalEvent: t 6469 }) 6470 }), this.$selection.on("click", ".select2-selection__choice__remove", function(t) { 6471 var e; 6472 i.options.get("disabled") || (e = n(this).parent(), e = r.GetData(e[0], "data"), i.trigger("unselect", { 6473 originalEvent: t, 6474 data: e 6475 })) 6476 }) 6477 }, o.prototype.clear = function() { 6478 var t = this.$selection.find(".select2-selection__rendered"); 6479 t.empty(), t.removeAttr("title") 6480 }, o.prototype.display = function(t, e) { 6481 var i = this.options.get("templateSelection"); 6482 return this.options.get("escapeMarkup")(i(t, e)) 6483 }, o.prototype.selectionContainer = function() { 6484 return n('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>') 6485 }, o.prototype.update = function(t) { 6486 if (this.clear(), 0 !== t.length) { 6487 for (var e = [], i = 0; i < t.length; i++) { 6488 var n = t[i], 6489 o = this.selectionContainer(), 6490 s = this.display(n, o); 6491 o.append(s); 6492 s = n.title || n.text; 6493 s && o.attr("title", s), r.StoreData(o[0], "data", n), e.push(o) 6494 } 6495 var a = this.$selection.find(".select2-selection__rendered"); 6496 r.appendMany(a, e) 6497 } 6498 }, o 6499 }), t.define("select2/selection/placeholder", ["../utils"], function(t) { 6500 function e(t, e, i) { 6501 this.placeholder = this.normalizePlaceholder(i.get("placeholder")), t.call(this, e, i) 6502 } 6503 return e.prototype.normalizePlaceholder = function(t, e) { 6504 return e = "string" == typeof e ? { 6505 id: "", 6506 text: e 6507 } : e 6508 }, e.prototype.createPlaceholder = function(t, e) { 6509 var i = this.selectionContainer(); 6510 return i.html(this.display(e)), i.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"), i 6511 }, e.prototype.update = function(t, e) { 6512 var i = 1 == e.length && e[0].id != this.placeholder.id; 6513 if (1 < e.length || i) return t.call(this, e); 6514 this.clear(); 6515 e = this.createPlaceholder(this.placeholder); 6516 this.$selection.find(".select2-selection__rendered").append(e) 6517 }, e 6518 }), t.define("select2/selection/allowClear", ["jquery", "../keys", "../utils"], function(i, n, r) { 6519 function t() {} 6520 return t.prototype.bind = function(t, e, i) { 6521 var n = this; 6522 t.call(this, e, i), null == this.placeholder && this.options.get("debug") && window.console && console.error && console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."), this.$selection.on("mousedown", ".select2-selection__clear", function(t) { 6523 n._handleClear(t) 6524 }), e.on("keypress", function(t) { 6525 n._handleKeyboardClear(t, e) 6526 }) 6527 }, t.prototype._handleClear = function(t, e) { 6528 if (!this.options.get("disabled")) { 6529 var i = this.$selection.find(".select2-selection__clear"); 6530 if (0 !== i.length) { 6531 e.stopPropagation(); 6532 var n = r.GetData(i[0], "data"), 6533 o = this.$element.val(); 6534 this.$element.val(this.placeholder.id); 6535 var s = { 6536 data: n 6537 }; 6538 if (this.trigger("clear", s), s.prevented) this.$element.val(o); 6539 else { 6540 for (var a = 0; a < n.length; a++) 6541 if (s = { 6542 data: n[a] 6543 }, this.trigger("unselect", s), s.prevented) return void this.$element.val(o); 6544 this.$element.trigger("change"), this.trigger("toggle", {}) 6545 } 6546 } 6547 } 6548 }, t.prototype._handleKeyboardClear = function(t, e, i) { 6549 i.isOpen() || e.which != n.DELETE && e.which != n.BACKSPACE || this._handleClear(e) 6550 }, t.prototype.update = function(t, e) { 6551 t.call(this, e), 0 < this.$selection.find(".select2-selection__placeholder").length || 0 === e.length || (t = this.options.get("translations").get("removeAllItems"), t = i('<span class="select2-selection__clear" title="' + t() + '">×</span>'), r.StoreData(t[0], "data", e), this.$selection.find(".select2-selection__rendered").prepend(t)) 6552 }, t 6553 }), t.define("select2/selection/search", ["jquery", "../utils", "../keys"], function(i, a, r) { 6554 function t(t, e, i) { 6555 t.call(this, e, i) 6556 } 6557 return t.prototype.render = function(t) { 6558 var e = i('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="none" spellcheck="false" role="searchbox" aria-autocomplete="list" /></li>'); 6559 this.$searchContainer = e, this.$search = e.find("input"); 6560 t = t.call(this); 6561 return this._transferTabIndex(), t 6562 }, t.prototype.bind = function(t, e, i) { 6563 var n = this, 6564 o = e.id + "-results"; 6565 t.call(this, e, i), e.on("open", function() { 6566 n.$search.attr("aria-controls", o), n.$search.trigger("focus") 6567 }), e.on("close", function() { 6568 n.$search.val(""), n.$search.removeAttr("aria-controls"), n.$search.removeAttr("aria-activedescendant"), n.$search.trigger("focus") 6569 }), e.on("enable", function() { 6570 n.$search.prop("disabled", !1), n._transferTabIndex() 6571 }), e.on("disable", function() { 6572 n.$search.prop("disabled", !0) 6573 }), e.on("focus", function(t) { 6574 n.$search.trigger("focus") 6575 }), e.on("results:focus", function(t) { 6576 t.data._resultId ? n.$search.attr("aria-activedescendant", t.data._resultId) : n.$search.removeAttr("aria-activedescendant") 6577 }), this.$selection.on("focusin", ".select2-search--inline", function(t) { 6578 n.trigger("focus", t) 6579 }), this.$selection.on("focusout", ".select2-search--inline", function(t) { 6580 n._handleBlur(t) 6581 }), this.$selection.on("keydown", ".select2-search--inline", function(t) { 6582 var e; 6583 t.stopPropagation(), n.trigger("keypress", t), n._keyUpPrevented = t.isDefaultPrevented(), t.which === r.BACKSPACE && "" === n.$search.val() && 0 < (e = n.$searchContainer.prev(".select2-selection__choice")).length && (e = a.GetData(e[0], "data"), n.searchRemoveChoice(e), t.preventDefault()) 6584 }), this.$selection.on("click", ".select2-search--inline", function(t) { 6585 n.$search.val() && t.stopPropagation() 6586 }); 6587 var e = document.documentMode, 6588 s = e && e <= 11; 6589 this.$selection.on("input.searchcheck", ".select2-search--inline", function(t) { 6590 s ? n.$selection.off("input.search input.searchcheck") : n.$selection.off("keyup.search") 6591 }), this.$selection.on("keyup.search input.search", ".select2-search--inline", function(t) { 6592 var e; 6593 s && "input" === t.type ? n.$selection.off("input.search input.searchcheck") : (e = t.which) != r.SHIFT && e != r.CTRL && e != r.ALT && e != r.TAB && n.handleSearch(t) 6594 }) 6595 }, t.prototype._transferTabIndex = function(t) { 6596 this.$search.attr("tabindex", this.$selection.attr("tabindex")), this.$selection.attr("tabindex", "-1") 6597 }, t.prototype.createPlaceholder = function(t, e) { 6598 this.$search.attr("placeholder", e.text) 6599 }, t.prototype.update = function(t, e) { 6600 var i = this.$search[0] == document.activeElement; 6601 this.$search.attr("placeholder", ""), t.call(this, e), this.$selection.find(".select2-selection__rendered").append(this.$searchContainer), this.resizeSearch(), i && this.$search.trigger("focus") 6602 }, t.prototype.handleSearch = function() { 6603 var t; 6604 this.resizeSearch(), this._keyUpPrevented || (t = this.$search.val(), this.trigger("query", { 6605 term: t 6606 })), this._keyUpPrevented = !1 6607 }, t.prototype.searchRemoveChoice = function(t, e) { 6608 this.trigger("unselect", { 6609 data: e 6610 }), this.$search.val(e.text), this.handleSearch() 6611 }, t.prototype.resizeSearch = function() { 6612 this.$search.css("width", "25px"); 6613 var t = "", 6614 t = "" !== this.$search.attr("placeholder") ? this.$selection.find(".select2-selection__rendered").width() : .75 * (this.$search.val().length + 1) + "em"; 6615 this.$search.css("width", t) 6616 }, t 6617 }), t.define("select2/selection/eventRelay", ["jquery"], function(a) { 6618 function t() {} 6619 return t.prototype.bind = function(t, e, i) { 6620 var n = this, 6621 o = ["open", "opening", "close", "closing", "select", "selecting", "unselect", "unselecting", "clear", "clearing"], 6622 s = ["opening", "closing", "selecting", "unselecting", "clearing"]; 6623 t.call(this, e, i), e.on("*", function(t, e) { 6624 var i; - 1 !== a.inArray(t, o) && (i = a.Event("select2:" + t, { 6625 params: e = e || {} 6626 }), n.$element.trigger(i), -1 !== a.inArray(t, s) && (e.prevented = i.isDefaultPrevented())) 6627 }) 6628 }, t 6629 }), t.define("select2/translation", ["jquery", "require"], function(e, i) { 6630 function n(t) { 6631 this.dict = t || {} 6632 } 6633 return n.prototype.all = function() { 6634 return this.dict 6635 }, n.prototype.get = function(t) { 6636 return this.dict[t] 6637 }, n.prototype.extend = function(t) { 6638 this.dict = e.extend({}
6638, t.all(), this.dict) 6639 }, n._cache = {}, n.loadPath = function(t) { 6640 var e; 6641 return t in n._cache || (e = i(t), n._cache[t] = e), new n(n._cache[t]) 6642 }, n 6643 }), t.define("select2/diacritics", [], function() { 6644 return { 6645 "â¶": "A", 6646 "Ａ": "A", 6647 "Ã": "A", 6648 "Ã": "A", 6649 "Ã": "A", 6650 "Ầ": "A", 6651 "Ấ": "A", 6652 "Ẫ": "A", 6653 "Ẩ": "A", 6654 "Ã": "A", 6655 "Ä": "A", 6656 "Ä": "A", 6657 "Ằ": "A", 6658 "Ắ": "A", 6659 "Ẵ": "A", 6660 "Ẳ": "A", 6661 "Ȧ": "A", 6662 "Ç ": "A", 6663 "Ã": "A", 6664 "Ç": "A", 6665 "Ả": "A", 6666 "à ": "A", 6667 "Ǻ": "A", 6668 "Ç": "A", 6669 "È": "A", 6670 "È": "A", 6671 "Ạ": "A", 6672 "Ậ": "A", 6673 "Ặ": "A", 6674 "á¸": "A", 6675 "Ä": "A", 6676 "Ⱥ": "A", 6677 "Ɐ": "A", 6678 "ê²": "AA", 6679 "Ã": "AE", 6680 "Ǽ": "AE", 6681 "Ç¢": "AE", 6682 "ê´": "AO", 6683 "ê¶": "AU", 6684 "ê¸": "AV", 6685 "êº": "AV", 6686 "ê¼": "AY", 6687 "â·": "B", 6688 "ï¼¢": "B", 6689 "á¸": "B", 6690 "á¸": "B", 6691 "á¸": "B", 6692 "É": "B", 6693 "Æ": "B", 6694 "Æ": "B", 6695 "â¸": "C", 6696 "ï¼£": "C", 6697 "Ä": "C", 6698 "Ä": "C", 6699 "Ä": "C", 6700 "Ä": "C", 6701 "Ã": "C", 6702 "á¸": "C", 6703 "Æ": "C", 6704 "È»": "C", 6705 "ê¾": "C", 6706 "â¹": "D", 6707 "Ｄ": "D", 6708 "á¸": "D", 6709 "Ä": "D", 6710 "á¸": "D", 6711 "á¸": "D", 6712 "á¸": "D", 6713 "á¸": "D", 6714 "Ä": "D", 6715 "Æ": "D", 6716 "Æ": "D", 6717 "Æ": "D", 6718 "ê¹": "D", 6719 "DZ": "DZ", 6720 "Ç": "DZ", 6721 "Dz": "Dz", 6722 "Ç ": "Dz", 6723 "âº": "E", 6724 "ï¼¥": "E", 6725 "Ã": "E", 6726 "Ã": "E", 6727 "Ã": "E",
6728 "á»": "E", 6729 "Ế": "E", 6730 "á»": "E", 6731 "á»": "E", 6732 "Ẽ": "E", 6733 "Ä": "E", 6734 "á¸": "E", 6735 "á¸": "E", 6736 "Ä": "E", 6737 "Ä": "E", 6738 "Ã": "E", 6739 "Ẻ": "E", 6740 "Ä": "E", 6741 "È": "E", 6742 "È": "E", 6743 "Ẹ": "E", 6744 "á»": "E", 6745 "Ȩ": "E", 6746 "á¸": "E", 6747 "Ä": "E", 6748 "á¸": "E", 6749 "á¸": "E", 6750 "Æ": "E", 6751 "Æ": "E", 6752 "â»": "F", 6753 "Ｆ": "F", 6754 "á¸": "F", 6755 "Æ": "F", 6756 "ê»": "F", 6757 "â¼": "G", 6758 "Ｇ": "G", 6759 "Ç´": "G", 6760 "Ä": "G", 6761 "Ḡ": "G", 6762 "Ä": "G", 6763 "Ä ": "G", 6764 "Ǧ": "G", 6765 "Ä¢": "G", 6766 "Ǥ": "G", 6767 "Æ": "G", 6768 "ê ": "G", 6769 "ê½": "G", 6770 "ê¾": "G", 6771 "â½": "H", 6772 "Ｈ": "H", 6773 "Ĥ": "H", 6774 "Ḣ": "H", 6775 "Ḧ": "H", 6776 "È": "H", 6777 "Ḥ": "H", 6778 "Ḩ": "H", 6779 "Ḫ": "H", 6780 "Ħ": "H", 6781 "Ⱨ": "H", 6782 "â±µ": "H", 6783 "ê": "H", 6784 "â¾": "I", 6785 "Ｉ": "I", 6786 "Ã": "I", 6787 "Ã": "I", 6788 "Ã": "I", 6789 "Ĩ": "I", 6790 "Ī": "I", 6791 "Ĭ": "I", 6792 "Ä°": "I", 6793 "Ã": "I", 6794 "Ḯ": "I", 6795 "á»": "I", 6796 "Ç": "I", 6797 "È": "I", 6798 "È": "I", 6799 "á»": "I", 6800 "Ä®": "I", 6801 "Ḭ": "I", 6802 "Æ": "I", 6803 "â¿": "J", 6804 "Ｊ": "J", 6805 "Ä´": "J", 6806 "É": "J", 6807 "â": "K", 6808 "Ｋ": "K", 6809 "Ḱ": "K", 6810 "Ǩ": "K", 6811 "Ḳ": "K", 6812 "Ķ": "K", 6813 "Ḵ": "K", 6814 "Æ": "K", 6815 "Ⱪ": "K", 6816 "ê": "K", 6817 "ê": "K", 6818 "ê": "K", 6819 "ê¢": "K", 6820 "â": "L", 6821 "Ｌ": "L", 6822 "Ä¿": "L", 6823 "Ĺ": "L", 6824 "Ľ": "L", 6825 "Ḷ": "L", 6826 "Ḹ": "L", 6827 "Ä»": "L", 6828 "Ḽ": "L", 6829 "Ḻ": "L", 6830 "Å": "L", 6831 "Ƚ": "L", 6832 "â±¢": "L", 6833 "â± ": "L", 6834 "ê": "L", 6835 "ê": "L", 6836 "ê": "L", 6837 "Ç": "LJ", 6838 "Ç": "Lj", 6839 "â": "M", 6840 "ï¼": "M", 6841 "Ḿ": "M", 6842 "á¹": "M", 6843 "á¹": "M", 6844 "â±®": "M", 6845 "Æ": "M", 6846 "â": "N", 6847 "ï¼®": "N", 6848 "Ǹ": "N", 6849 "Å": "N", 6850 "Ã": "N", 6851 "á¹": "N", 6852 "Å": "N", 6853 "á¹": "N", 6854 "Å ": "N", 6855 "á¹": "N", 6856 "á¹": "N", 6857 "È ": "N", 6858 "Æ": "N", 6859 "ê": "N", 6860 "ê¤": "N", 6861 "Ç": "NJ", 6862 "Ç": "Nj", 6863 "â": "O", 6864 "Ｏ": "O", 6865 "Ã": "O", 6866 "Ã": "O", 6867 "Ã": "O", 6868 "á»": "O", 6869 "á»": "O", 6870 "á»": "O", 6871 "á»": "O", 6872 "Ã": "O", 6873 "á¹": "O", 6874 "Ȭ": "O", 6875 "á¹": "O", 6876 "Å": "O", 6877 "á¹": "O", 6878 "á¹": "O", 6879 "Å": "O", 6880 "È®": "O", 6881 "È°": "O", 6882 "Ã": "O", 6883 "Ȫ": "O", 6884 "á»": "O", 6885 "Å": "O", 6886 "Ç": "O", 6887 "È": "O", 6888 "È": "O", 6889 "Æ ": "O", 6890 "á»": "O", 6891 "á»": "O", 6892 "á» ": "O", 6893 "á»": "O", 6894 "Ợ": "O", 6895 "á»": "O", 6896 "á»": "O", 6897 "Ǫ": "O", 6898 "Ǭ": "O", 6899 "Ã": "O", 6900 "Ǿ": "O", 6901 "Æ": "O", 6902 "Æ": "O", 6903 "ê": "O", 6904 "ê": "O", 6905 "Å": "OE", 6906 "Æ¢": "OI", 6907 "ê": "OO", 6908 "È¢": "OU", 6909 "â ": "P", 6910 "ï¼°": "P", 6911 "á¹": "P", 6912 "á¹": "P", 6913 "Ƥ": "P", 6914 "â±£": "P", 6915 "ê": "P", 6916 "ê": "P", 6917 "ê": "P", 6918 "â": "Q", 6919 "ï¼±": "Q", 6920 "ê": "Q", 6921 "ê": "Q", 6922 "É": "Q", 6923 "â": "R", 6924 "ï¼²": "R", 6925 "Å": "R", 6926 "á¹": "R", 6927 "Å": "R", 6928 "È": "R", 6929 "È": "R", 6930 "á¹": "R", 6931 "á¹": "R", 6932 "Å": "R", 6933 "á¹": "R", 6934 "É": "R", 6935 "Ɽ": "R", 6936 "ê": "R", 6937 "ê¦": "R", 6938 "ê": "R", 6939 "â": "S", 6940 "ï¼³": "S", 6941 "áº": "S", 6942 "Å": "S", 6943 "Ṥ": "S", 6944 "Å": "S", 6945 "á¹ ": "S", 6946 "Å ": "S", 6947 "Ṧ": "S", 6948 "á¹¢": "S", 6949 "Ṩ": "S", 6950 "È": "S", 6951 "Å": "S", 6952 "â±¾": "S", 6953 "ê¨": "S", 6954 "ê": "S", 6955 "â": "T", 6956 "ï¼´": "T", 6957 "Ṫ": "T", 6958 "Ť": "T", 6959 "Ṭ": "T", 6960 "È": "T", 6961 "Å¢": "T", 6962 "á¹°": "T", 6963 "á¹®": "T", 6964 "Ŧ": "T", 6965 "Ƭ": "T", 6966 "Æ®": "T", 6967 "Ⱦ": "T", 6968 "ê": "T", 6969 "ê¨": "TZ", 6970 "â": "U", 6971 "ï¼µ": "U", 6972 "Ã": "U", 6973 "Ã": "U", 6974 "Ã": "U", 6975 "Ũ": "U", 6976 "Ṹ": "U", 6977 "Ū": "U", 6978 "Ṻ": "U", 6979 "Ŭ": "U", 6980 "Ã": "U", 6981 "Ç": "U", 6982 "Ç": "U", 6983 "Ç": "U", 6984 "Ç": "U", 6985 "Ủ": "U", 6986 "Å®": "U", 6987 "Å°": "U", 6988 "Ç": "U", 6989 "È": "U", 6990 "È": "U", 6991 "Ư": "U",
6992 "Ừ": "U", 6993 "Ứ": "U", 6994 "á»®": "U", 6995 "Ử": "U", 6996 "á»°": "U", 6997 "Ụ": "U", 6998 "á¹²": "U", 6999 "Ų": "U", 7000 "Ṷ": "U", 7001 "á¹´": "U", 7002 "É": "U", 7003 "â": "V", 7004 "Ｖ": "V", 7005 "á¹¼": "V", 7006 "á¹¾": "V", 7007 "Ʋ": "V", 7008 "ê": "V", 7009 "É ": "V", 7010 "ê ": "VY", 7011 "â": "W", 7012 "ï¼·": "W", 7013 "áº": "W", 7014 "áº": "W", 7015 "Å´": "W", 7016 "áº": "W", 7017 "áº": "W", 7018 "áº": "W", 7019 "â±²": "W", 7020 "â": "X", 7021 "Ｘ": "X", 7022 "áº": "X", 7023 "áº": "X", 7024 "â": "Y", 7025 "ï¼¹": "Y", 7026 "Ỳ": "Y", 7027 "Ã": "Y", 7028 "Ŷ": "Y", 7029 "Ỹ": "Y", 7030 "Ȳ": "Y", 7031 "áº": "Y", 7032 "Ÿ": "Y", 7033 "Ỷ": "Y", 7034 "á»´": "Y", 7035 "Ƴ": "Y", 7036 "É": "Y", 7037 "Ỿ": "Y", 7038 "â": "Z", 7039 "Ｚ": "Z", 7040 "Ź": "Z", 7041 "áº": "Z", 7042 "Å»": "Z", 7043 "Ž": "Z", 7044 "áº": "Z", 7045 "áº": "Z", 7046 "Ƶ": "Z", 7047 "Ȥ": "Z", 7048 "Ɀ": "Z", 7049 "Ⱬ": "Z", 7050 "ê¢": "Z", 7051 "â": "a", 7052 "ï½": "a", 7053 "áº": "a", 7054 "à ": "a", 7055 "á": "a", 7056 "â": "a", 7057 "ầ": "a", 7058 "ấ": "a", 7059 "ẫ": "a", 7060 "ẩ": "a", 7061 "ã": "a", 7062 "Ä": "a", 7063 "Ä": "a", 7064 "ằ": "a", 7065 "ắ": "a", 7066 "ẵ": "a", 7067 "ẳ": "a", 7068 "ȧ": "a", 7069 "Ç¡": "a", 7070 "ä": "a", 7071 "Ç": "a", 7072 "ả": "a", 7073 "Ã¥": "a", 7074 "Ç»": "a", 7075 "Ç": "a", 7076 "È": "a", 7077 "È": "a", 7078 "ạ": "a", 7079 "áº": "a", 7080 "ặ": "a", 7081 "á¸": "a", 7082 "Ä ": "a", 7083 "â±¥": "a", 7084 "É": "a", 7085 "ê³": "aa", 7086 "æ": "ae", 7087 "ǽ": "ae", 7088 "Ç£": "ae", 7089 "êµ": "ao", 7090 "ê·": "au", 7091 "ê¹": "av", 7092 "ê»": "av", 7093 "ê½": "ay", 7094 "â": "b", 7095 "ï½": "b", 7096 "á¸": "b", 7097 "Ḡ": "b", 7098 "á¸": "b", 7099 "Æ": "b", 7100 "Æ": "b", 7101 "É": "b", 7102 "â": "c", 7103 "ï½": "c", 7104 "Ä": "c", 7105 "Ä": "c", 7106 "Ä": "c", 7107 "Ä": "c", 7108 "ç": "c", 7109 "á¸": "c", 7110 "Æ": "c", 7111 "ȼ": "c", 7112 "ê¿": "c", 7113 "â": "c", 7114 "â": "d", 7115 "ï½": "d", 7116 "á¸": "d", 7117 "Ä": "d", 7118 "á¸": "d", 7119 "á¸": "d", 7120 "á¸": "d", 7121 "á¸": "d", 7122 "Ä": "d", 7123 "Æ": "d", 7124 "É": "d", 7125 "É": "d", 7126 "êº": "d", 7127 "dz": "dz", 7128 "Ç": "dz", 7129 "â": "e", 7130 "ï½ ": "e", 7131 "è": "e", 7132 "é": "e", 7133 "ê": "e", 7134 "á»": "e", 7135 "ế": "e", 7136 "á» ": "e", 7137 "á»": "e", 7138 "ẽ": "e", 7139 "Ä": "e", 7140 "á¸": "e", 7141 "á¸": "e", 7142 "Ä": "e", 7143 "Ä": "e", 7144 "ë": "e", 7145 "ẻ": "e", 7146 "Ä": "e", 7147 "È ": "e", 7148 "È": "e", 7149 "ẹ": "e", 7150 "á»": "e", 7151 "È©": "e", 7152 "á¸": "e", 7153 "Ä": "e", 7154 "á¸": "e", 7155 "á¸": "e", 7156 "É": "e", 7157 "É": "e", 7158 "Ç": "e", 7159 "â": "f", 7160 "ï½": "f", 7161 "á¸": "f", 7162 "Æ": "f", 7163 "ê¼": "f", 7164 "â": "g", 7165 "ï½": "g", 7166 "ǵ": "g", 7167 "Ä": "g", 7168 "ḡ": "g", 7169 "Ä": "g", 7170 "Ä¡": "g", 7171 "ǧ": "g", 7172 "Ä£": "g", 7173 "Ç¥": "g", 7174 "É ": "g", 7175 "ê¡": "g", 7176 "áµ¹": "g", 7177 "ê¿": "g", 7178 "â": "h", 7179 "ï½": "h", 7180 "Ä¥": "h", 7181 "ḣ": "h", 7182 "ḧ": "h", 7183 "È": "h", 7184 "ḥ": "h", 7185 "ḩ": "h", 7186 "ḫ": "h", 7187 "áº": "h", 7188 "ħ": "h", 7189 "ⱨ": "h", 7190 "ⱶ": "h", 7191 "É¥": "h", 7192 "Æ": "hv", 7193 "â": "i", 7194 "ï½": "i", 7195 "ì": "i", 7196 "Ã": "i", 7197 "î": "i", 7198 "Ä©": "i", 7199 "Ä«": "i", 7200 "Ä": "i", 7201 "ï": "i", 7202 "ḯ": "i", 7203 "á»": "i", 7204 "Ç": "i", 7205 "È": "i", 7206 "È": "i", 7207 "á»": "i", 7208 "į": "i", 7209 "á¸": "i", 7210 "ɨ": "i", 7211 "ı": "i", 7212 "â": "j", 7213 "ï½": "j", 7214 "ĵ": "j", 7215 "Ç°": "j", 7216 "É": "j", 7217 "â": "k", 7218 "ï½": "k", 7219 "ḱ": "k", 7220 "Ç©": "k", 7221 "ḳ": "k", 7222 "Ä·": "k", 7223 "ḵ": "k", 7224 "Æ": "k", 7225 "ⱪ": "k", 7226 "ê": "k", 7227 "ê": "k", 7228 "ê ": "k", 7229 "ê£": "k", 7230 "â": "l", 7231 "ï½": "l", 7232 "Å": "l", 7233 "ĺ": "l", 7234 "ľ": "l", 7235 "ḷ": "l", 7236 "ḹ": "l", 7237 "ļ": "l", 7238 "ḽ": "l", 7239 "ḻ": "l", 7240 "Å¿": "l", 7241 "Å": "l", 7242 "Æ": "l", 7243 "É«": "l", 7244 "ⱡ": "l", 7245 "ê": "l", 7246 "ê": "l", 7247 "ê": "l", 7248 "Ç": "lj", 7249 "â": "m", 7250 "ï½": "m", 7251 "ḿ": "m", 7252 "á¹": "m", 7253 "á¹": "m", 7254 "ɱ": "m", 7255 "ɯ": "m", 7256 "â": "n", 7257 "ï½": "n", 7258 "ǹ": "n", 7259 "Å": "n", 7260 "ñ": "n", 7261 "á¹ ": "n", 7262 "Å": "n", 7263 "á¹": "n", 7264 "Å": "n", 7265 "á¹": "n", 7266 "á¹": "n", 7267 "Æ": "n", 7268 "ɲ": "n", 7269 "Å": "n", 7270 "ê": "n", 7271 "ê¥": "n", 7272 "Ç": "nj", 7273 "â": "o", 7274 "ï½": "o", 7275 "ò": "o", 7276 "ó": "o", 7277 "ô": "o", 7278 "á»": "o", 7279 "á»": "o", 7280 "á»": "o", 7281 "á»": "o", 7282 "õ": "o", 7283 "á¹": "o", 7284 "È": "o", 7285 "á¹": "o", 7286 "Å": "o", 7287 "á¹": "o", 7288 "á¹": "o", 7289 "Å": "o", 7290 "ȯ": "o", 7291 "ȱ": "o", 7292 "ö": "o", 7293 "È«": "o", 7294 "á»": "o", 7295 "Å": "o", 7296 "Ç": "o", 7297 "È": "o", 7298 "È": "o", 7299 "Æ¡": "o", 7300 "á»": "o", 7301 "á»": "o", 7302 "ỡ": "o", 7303 "á»": "o", 7304 "ợ": "o", 7305 "á»": "o", 7306 "á»": "o", 7307 "Ç«": "o", 7308 "Ç": "o", 7309 "ø": "o", 7310 "Ç¿": "o", 7311 "É": "o", 7312 "ê": "o", 7313 "ê": "o", 7314 "ɵ": "o", 7315 "Å": "oe", 7316 "Æ£": "oi", 7317 "È£": "ou", 7318 "ê": "oo", 7319 "â": "p", 7320 "ï½": "p", 7321 "á¹": "p", 7322 "á¹": "p", 7323 "Æ¥": "p", 7324 "áµ½": "p", 7325 "ê": "p", 7326 "ê": "p", 7327 "ê": "p", 7328 "â ": "q", 7329 "ï½": "q", 7330 "É": "q", 7331 "ê": "q", 7332 "ê": "q", 7333 "â¡": "r", 7334 "ï½": "r", 7335 "Å": "r", 7336 "á¹": "r", 7337 "Å": "r", 7338 "È": "r", 7339 "È": "r", 7340 "á¹": "r", 7341 "á¹": "r", 7342 "Å": "r", 7343 "á¹": "r", 7344 "É": "r", 7345 "ɽ": "r", 7346 "ê": "r", 7347 "ê§": "r", 7348 "ê": "r",
7349 "â¢": "s", 7350 "ï½": "s", 7351 "Ã": "s", 7352 "Å": "s", 7353 "á¹¥": "s", 7354 "Å": "s", 7355 "ṡ": "s", 7356 "Å¡": "s", 7357 "ṧ": "s", 7358 "á¹£": "s", 7359 "ṩ": "s", 7360 "È": "s", 7361 "Å": "s", 7362 "È¿": "s", 7363 "ê©": "s", 7364 "ê ": "s", 7365 "áº": "s", 7366 "â£": "t", 7367 "ï½": "t", 7368 "ṫ": "t", 7369 "áº": "t", 7370 "Å¥": "t", 7371 "á¹": "t", 7372 "È": "t", 7373 "Å£": "t", 7374 "á¹±": "t", 7375 "ṯ": "t", 7376 "ŧ": "t", 7377 "Æ": "t", 7378 "Ê": "t", 7379 "ⱦ": "t", 7380 "ê": "t", 7381 "ê©": "tz", 7382 "â¤": "u", 7383 "ï½": "u", 7384 "ù": "u", 7385 "ú": "u", 7386 "û": "u", 7387 "Å©": "u", 7388 "á¹¹": "u", 7389 "Å«": "u", 7390 "á¹»": "u", 7391 "Å": "u", 7392 "ü": "u", 7393 "Ç": "u", 7394 "Ç": "u", 7395 "Ç": "u", 7396 "Ç": "u", 7397 "ủ": "u", 7398 "ů": "u", 7399 "ű": "u", 7400 "Ç": "u", 7401 "È": "u", 7402 "È": "u", 7403 "Æ°": "u", 7404 "ừ": "u", 7405 "ứ": "u", 7406 "ữ": "u", 7407 "á»": "u", 7408 "á»±": "u", 7409 "ụ": "u", 7410 "á¹³": "u", 7411 "ų": "u", 7412 "á¹·": "u", 7413 "á¹µ": "u", 7414 "Ê": "u", 7415 "â¥": "v", 7416 "ï½": "v", 7417 "á¹½": "v", 7418 "ṿ": "v", 7419 "Ê": "v", 7420 "ê": "v", 7421 "Ê": "v", 7422 "ê¡": "vy", 7423 "â¦": "w", 7424 "ï½": "w", 7425 "áº": "w", 7426 "áº": "w", 7427 "ŵ": "w", 7428 "áº": "w", 7429 "Ạ": "w", 7430 "áº": "w", 7431 "áº": "w", 7432 "â±³": "w", 7433 "â§": "x", 7434 "ï½": "x", 7435 "áº": "x", 7436 "áº": "x", 7437 "â¨": "y", 7438 "ï½": "y", 7439 "ỳ": "y", 7440 "ý": "y", 7441 "Å·": "y", 7442 "ỹ": "y", 7443 "ȳ": "y", 7444 "áº": "y", 7445 "ÿ": "y", 7446 "á»·": "y", 7447 "áº": "y", 7448 "ỵ": "y", 7449 "Æ´": "y", 7450 "É": "y", 7451 "ỿ": "y", 7452 "â©": "z", 7453 "ï½": "z", 7454 "ź": "z", 7455 "áº": "z", 7456 "ż": "z", 7457 "ž": "z", 7458 "áº": "z", 7459 "áº": "z", 7460 "ƶ": "z", 7461 "È¥": "z", 7462 "É": "z", 7463 "ⱬ": "z", 7464 "ê£": "z", 7465 "Î": "Î", 7466 "Î": "Î", 7467 "Î": "Î", 7468 "Î": "Î", 7469 "Ϊ": "Î", 7470 "Î": "Î", 7471 "Î": "Î¥", 7472 "Ϋ": "Î¥", 7473 "Î": "Ω", 7474 "ά": "α", 7475 "Î": "ε", 7476 "ή": "η", 7477 "ί": "ι", 7478 "Ï": "ι", 7479 "Î": "ι", 7480 "Ï": "ο", 7481 "Ï": "Ï ", 7482 "Ï": "Ï ", 7483 "ΰ": "Ï ", 7484 "Ï": "Ï", 7485 "Ï": "Ï", 7486 "â": "'" 7487 } 7488 }), t.define("select2/data/base", ["../utils"], function(i) { 7489 function n(t, e) { 7490 n.__super__.constructor.call(this) 7491 } 7492 return i.Extend(n, i.Observable), n.prototype.current = function(t) { 7493 throw new Error("The `current` method must be defined in child classes.") 7494 }, n.prototype.query = function(t, e) { 7495 throw new Error("The `query` method must be defined in child classes.") 7496 }, n.prototype.bind = function(t, e) {}, n.prototype.destroy = function() {}, n.prototype.generateResultId = function(t, e) { 7497 t = t.id + "-result-"; 7498 return t += i.generateChars(4), null != e.id ? t += "-" + e.id.toString() : t += "-" + i.generateChars(4), t 7499 }, n 7500 }), t.define("select2/data/select", ["./base", "../utils", "jquery"], function(t, a, r) { 7501 function i(t, e) { 7502 this.$element = t, this.options = e, i.__super__.constructor.call(this) 7503 } 7504 return a.Extend(i, t), i.prototype.current = function(t) { 7505 var e = [], 7506 i = this; 7507 this.$element.find(":selected").each(function() { 7508 var t = r(this), 7509 t = i.item(t); 7510 e.push(t) 7511 }), t(e) 7512 }, i.prototype.select = function(o) { 7513 var t, s = this; 7514 if (o.selected = !0, r(o.element).is("option")) return o.element.selected = !0, void this.$element.trigger("change"); 7515 this.$element.prop("multiple") ? this.current(function(t) { 7516 var e = []; 7517 (o = [o]).push.apply(o, t); 7518 for (var i = 0; i < o.length; i++) { 7519 var n = o[i].id; - 1 === r.inArray(n, e) && e.push(n) 7520 } 7521 s.$element.val(e), s.$element.trigger("change") 7522 }) : (t = o.id, this.$element.val(t), this.$element.trigger("change")) 7523 }, i.prototype.unselect = function(o) { 7524 var s = this; 7525 if (this.$element.prop("multiple")) { 7526 if (o.selected = !1, r(o.element).is("option")) return o.element.selected = !1, void this.$element.trigger("change"); 7527 this.current(function(t) { 7528 for (var e = [], i = 0; i < t.length; i++) { 7529 var n = t[i].id; 7530 n !== o.id && -1 === r.inArray(n, e) && e.push(n) 7531 } 7532 s.$element.val(e), s.$element.trigger("change") 7533 }) 7534 } 7535 }, i.prototype.bind = function(t, e) { 7536 var i = this; 7537 (this.container = t).on("select", function(t) { 7538 i.select(t.data) 7539 }), t.on("unselect", function(t) { 7540 i.unselect(t.data) 7541 }) 7542 }, i.prototype.destroy = function() { 7543 this.$element.find("*").each(function() { 7544 a.RemoveData(this) 7545 }) 7546 }, i.prototype.query = function(e, t) { 7547 var i = [], 7548 n = this; 7549 this.$element.children().each(function() { 7550 var t = r(this); 7551 (t.is("option") || t.is("optgroup")) && (t = n.item(t), null !== (t = n.matches(e, t)) && i.push(t)) 7552 }), t({ 7553 results: i 7554 }) 7555 }, i.prototype.addOptions = function(t) { 7556 a.appendMany(this.$element, t) 7557 }, i.prototype.option = function(t) { 7558 var e; 7559 t.children ? (e = document.createElement("optgroup")).label = t.text : void 0 !== (e = document.createElement("option")).textContent ? e.textContent = t.text : e.innerText = t.text, void 0 !== t.id && (e.value = t.id), t.disabled && (e.disabled = !0), t.selected && (e.selected = !0), t.title && (e.title = t.title); 7560 var i = r(e), 7561 t = this._normalizeItem(t); 7562 return t.element = e, a.StoreData(e, "data", t), i 7563 }, i.prototype.item = function(t) { 7564 var e = {}; 7565 if (null != (e = a.GetData(t[0], "data"))) return e; 7566 if (t.is("option")) e = { 7567 id: t.val(), 7568 text: t.text(), 7569 disabled: t.prop("disabled"), 7570 selected: t.prop("selected"), 7571 title: t.prop("title") 7572 }; 7573 else if (t.is("optgroup")) { 7574 for (var e = { 7575 text: t.prop("label"), 7576 children: [], 7577 title: t.prop("title") 7578 }, i = t.children("option"), n = [], o = 0; o < i.length; o++) { 7579 var s = r(i[o]), 7580 s = this.item(s); 7581 n.push(s) 7582 } 7583 e.children = n 7584 } 7585 return (e = this._normalizeItem(e)).element = t[0], a.StoreData(t[0], "data", e), e 7586 }, i.prototype._normalizeItem = function(t) { 7587 return t !== Object(t) && (t = { 7588 id: t, 7589 text: t 7590 }), null != (t = r.extend({}, { 7591 text: "" 7592 }, t)).id && (t.id = t.id.toString()), null != t.text && (t.text = t.text.toString()), null == t._resultId && t.id && null != this.container && (t._resultId = this.generateResultId(this.container, t)), r.extend({}, { 7593 selected: !1, 7594 disabled: !1 7595 }, t) 7596 }, i.prototype.matches = function(t, e) { 7597 return this.options.get("matcher")(t, e) 7598 }, i 7599 }), t.define("select2/data/array", ["./select", "../utils", "jquery"], function(t, c, d) { 7600 function n(t, e) { 7601 this._dataToConvert = e.get("data") || [], n.__super__.constructor.call(this, t, e) 7602 } 7603 return c.Extend(n, t), n.prototype.bind = function(t, e) { 7604 n.__super__.bind.call(this, t, e), this.addOptions(this.convertToOptions(this._dataToConvert)) 7605 }, n.prototype.select = function(i) { 7606 var t; 7607 0 === (t = this.$element.find("option").filter(function(t, e) { 7608 return e.value == i.id.toString() 7609 })).length && (t = this.option(i), this.addOptions(t)), n.__super__.select.call(this, i) 7610 }, n.prototype.convertToOptions = function(t) { 7611 var e = this, 7612 i = this.$element.find("option"), 7613 n = i.map(function() { 7614 return e.item(d(this)).id 7615 }).get(), 7616 o = []; 7617 for (var s = 0; s < t.length; s++) { 7618 var a, r, l = this._normalizeItem(t[s]); 7619 0 <= d.inArray(l.id, n) ? (a = i.filter(function(t) { 7620 return function() { 7621 return d(this).val() == t.id 7622 } 7623 }(l)), r = this.item(a), r = d.extend(!0, {}, l, r), r = this.option(r), a.replaceWith(r)) : (r = this.option(l), l.children && (l = this.convertToOptions(l.children), c.appendMany(r, l)), o.push(r)) 7624 } 7625 return o 7626 }, n 7627 }), t.define("select2/data/ajax", ["./array", "../utils", "jquery"], function(t, e, s) { 7628 function i(t, e) { 7629 this.ajaxOptions = this._applyDefaults(e.get("ajax")), null != this.ajaxOptions.processResults && (this.processResults = this.ajaxOptions.processResults), i.__super__.constructor.call(this, t, e) 7630 } 7631 return e.Extend(i, t), i.prototype._applyDefaults = function(t) { 7632 var e = { 7633 data: function(t) { 7634 return s.extend({}, t, { 7635 q: t.term 7636 }) 7637 }, 7638 transport: function(t, e, i) { 7639 t = s.ajax(t); 7640 return t.then(e), t.fail(i), t 7641 } 7642 }; 7643 return s.extend({}, e, t, !0) 7644 }, i.prototype.processResults = function(t) { 7645 return t 7646 }, i.prototype.query = function(e, i) { 7647 var n = this; 7648 null != this._request && (s.isFunction(this._request.abort) && this._request.abort(), this._request = null); 7649 var o = s.extend({ 7650 type: "GET" 7651 }, this.ajaxOptions); 7652 7653 function t() { 7654 var t = o.transport(o, function(t) { 7655 t = n.processResults(t, e); 7656 n.options.get("debug") && window.console && console.error && (t && t.results && s.isArray(t.results) || console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")), i(t) 7657 }, function() { 7658 "status" in t && (0 === t.status || "0" === t.status) || n.trigger("results:message", { 7659 message: "errorLoading" 7660 }) 7661 }); 7662 n._request = t 7663 } 7664 "function" == typeof o.url && (o.url = o.url.call(this.$element, e)), "function" == typeof o.data && (
vendor: 18,722 bytes, lines 7664-8066
7664o.data = o.data.call(this.$element, e)), this.ajaxOptions.delay && null != e.term ? (this._queryTimeout && window.clearTimeout(this._queryTimeout), this._queryTimeout = window.setTimeout(t, this.ajaxOptions.delay)) : t() 7665 }, i 7666 }), t.define("select2/data/tags", ["jquery"], function(r) { 7667 function t(t, e, i) { 7668 var n = i.get("tags"), 7669 o = i.get("createTag"); 7670 void 0 !== o && (this.createTag = o); 7671 o = i.get("insertTag"); 7672 if (void 0 !== o && (this.insertTag = o), t.call(this, e, i), r.isArray(n)) 7673 for (var s = 0; s < n.length; s++) { 7674 var a = n[s], 7675 a = this._normalizeItem(a), 7676 a = this.option(a); 7677 this.$element.append(a) 7678 } 7679 } 7680 return t.prototype.query = function(t, c, d) { 7681 var u = this; 7682 this._removeOldTags(), null != c.term && null == c.page ? t.call(this, c, function t(e, i) { 7683 for (var n = e.results, o = 0; o < n.length; o++) { 7684 var s = n[o], 7685 a = null != s.children && !t({ 7686 results: s.children 7687 }, !0); 7688 if ((s.text || "").toUpperCase() === (c.term || "").toUpperCase() || a) return !i && (e.data = n, void d(e)) 7689 } 7690 if (i) return !0; 7691 var r, l = u.createTag(c); 7692 null != l && ((r = u.option(l)).attr("data-select2-tag", !0), u.addOptions([r]), u.insertTag(n, l)), e.results = n, d(e) 7693 }) : t.call(this, c, d) 7694 }, t.prototype.createTag = function(t, e) { 7695 e = r.trim(e.term); 7696 return "" === e ? null : { 7697 id: e, 7698 text: e 7699 } 7700 }, t.prototype.insertTag = function(t, e, i) { 7701 e.unshift(i) 7702 }, t.prototype._removeOldTags = function(t) { 7703 this.$element.find("option[data-select2-tag]").each(function() { 7704 this.selected || r(this).remove() 7705 }) 7706 }, t 7707 }), t.define("select2/data/tokenizer", ["jquery"], function(c) { 7708 function t(t, e, i) { 7709 var n = i.get("tokenizer"); 7710 void 0 !== n && (this.tokenizer = n), t.call(this, e, i) 7711 } 7712 return t.prototype.bind = function(t, e, i) { 7713 t.call(this, e, i), this.$search = e.dropdown.$search || e.selection.$search || i.find(".select2-search__field") 7714 }, t.prototype.query = function(t, e, i) { 7715 var n = this; 7716 e.term = e.term || ""; 7717 var o = this.tokenizer(e, this.options, function(t) { 7718 var e = n._normalizeItem(t); 7719 n.$element.find("option").filter(function() { 7720 return c(this).val() === e.id 7721 }).length || ((t = n.option(e)).attr("data-select2-tag", !0), n._removeOldTags(), n.addOptions([t])), n.trigger("select", { 7722 data: e 7723 }) 7724 }); 7725 o.term !== e.term && (this.$search.length && (this.$search.val(o.term), this.$search.trigger("focus")), e.term = o.term), t.call(this, e, i) 7726 }, t.prototype.tokenizer = function(t, e, i, n) { 7727 for (var o = i.get("tokenSeparators") || [], s = e.term, a = 0, r = this.createTag || function(t) { 7728 return { 7729 id: t.term, 7730 text: t.term 7731 } 7732 }; a < s.length;) { 7733 var l = s[a]; - 1 !== c.inArray(l, o) ? (l = s.substr(0, a), null != (l = r(c.extend({}, e, { 7734 term: l 7735 }))) ? (n(l), s = s.substr(a + 1) || "", a = 0) : a++) : a++ 7736 } 7737 return { 7738 term: s 7739 } 7740 }, t 7741 }), t.define("select2/data/minimumInputLength", [], function() { 7742 function t(t, e, i) { 7743 this.minimumInputLength = i.get("minimumInputLength"), t.call(this, e, i) 7744 } 7745 return t.prototype.query = function(t, e, i) { 7746 e.term = e.term || "", e.term.length < this.minimumInputLength ? this.trigger("results:message", { 7747 message: "inputTooShort", 7748 args: { 7749 minimum: this.minimumInputLength, 7750 input: e.term, 7751 params: e 7752 } 7753 }) : t.call(this, e, i) 7754 }, t 7755 }), t.define("select2/data/maximumInputLength", [], function() { 7756 function t(t, e, i) { 7757 this.maximumInputLength = i.get("maximumInputLength"), t.call(this, e, i) 7758 } 7759 return t.prototype.query = function(t, e, i) { 7760 e.term = e.term || "", 0 < this.maximumInputLength && e.term.length > this.maximumInputLength ? this.trigger("results:message", { 7761 message: "inputTooLong", 7762 args: { 7763 maximum: this.maximumInputLength, 7764 input: e.term, 7765 params: e 7766 } 7767 }) : t.call(this, e, i) 7768 }, t 7769 }), t.define("select2/data/maximumSelectionLength", [], function() { 7770 function t(t, e, i) { 7771 this.maximumSelectionLength = i.get("maximumSelectionLength"), t.call(this, e, i) 7772 } 7773 return t.prototype.bind = function(t, e, i) { 7774 var n = this; 7775 t.call(this, e, i), e.on("select", function() { 7776 n._checkIfMaximumSelected() 7777 }) 7778 }, t.prototype.query = function(t, e, i) { 7779 var n = this; 7780 this._checkIfMaximumSelected(function() { 7781 t.call(n, e, i) 7782 }) 7783 }, t.prototype._checkIfMaximumSelected = function(t, e) { 7784 var i = this; 7785 this.current(function(t) { 7786 t = null != t ? t.length : 0; 7787 0 < i.maximumSelectionLength && t >= i.maximumSelectionLength ? i.trigger("results:message", { 7788 message: "maximumSelected", 7789 args: { 7790 maximum: i.maximumSelectionLength 7791 } 7792 }) : e && e() 7793 }) 7794 }, t 7795 }), t.define("select2/dropdown", ["jquery", "./utils"], function(e, t) { 7796 function i(t, e) { 7797 this.$element = t, this.options = e, i.__super__.constructor.call(this) 7798 } 7799 return t.Extend(i, t.Observable), i.prototype.render = function() { 7800 var t = e('<span class="select2-dropdown"><span class="select2-results"></span></span>'); 7801 return t.attr("dir", this.options.get("dir")), this.$dropdown = t 7802 }, i.prototype.bind = function() {}, i.prototype.position = function(t, e) {}, i.prototype.destroy = function() { 7803 this.$dropdown.remove() 7804 }, i 7805 }), t.define("select2/dropdown/search", ["jquery", "../utils"], function(s, t) { 7806 function e() {} 7807 return e.prototype.render = function(t) { 7808 var e = t.call(this), 7809 t = s('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="none" spellcheck="false" role="searchbox" aria-autocomplete="list" /></span>'); 7810 return this.$searchContainer = t, this.$search = t.find("input"), e.prepend(t), e 7811 }, e.prototype.bind = function(t, e, i) { 7812 var n = this, 7813 o = e.id + "-results"; 7814 t.call(this, e, i), this.$search.on("keydown", function(t) { 7815 n.trigger("keypress", t), n._keyUpPrevented = t.isDefaultPrevented() 7816 }), this.$search.on("input", function(t) { 7817 s(this).off("keyup") 7818 }), this.$search.on("keyup input", function(t) { 7819 n.handleSearch(t) 7820 }), e.on("open", function() { 7821 n.$search.attr("tabindex", 0), n.$search.attr("aria-controls", o), n.$search.trigger("focus"), window.setTimeout(function() { 7822 n.$search.trigger("focus") 7823 }, 0) 7824 }), e.on("close", function() { 7825 n.$search.attr("tabindex", -1), n.$search.removeAttr("aria-controls"), n.$search.removeAttr("aria-activedescendant"), n.$search.val(""), n.$search.trigger("blur") 7826 }), e.on("focus", function() { 7827 e.isOpen() || n.$search.trigger("focus") 7828 }), e.on("results:all", function(t) { 7829 null != t.query.term && "" !== t.query.term || (n.showSearch(t) ? n.$searchContainer.removeClass("select2-search--hide") : n.$searchContainer.addClass("select2-search--hide")) 7830 }), e.on("results:focus", function(t) { 7831 t.data._resultId ? n.$search.attr("aria-activedescendant", t.data._resultId) : n.$search.removeAttr("aria-activedescendant") 7832 }) 7833 }, e.prototype.handleSearch = function(t) { 7834 var e; 7835 this._keyUpPrevented || (e = this.$search.val(), this.trigger("query", { 7836 term: e 7837 })), this._keyUpPrevented = !1 7838 }, e.prototype.showSearch = function(t, e) { 7839 return !0 7840 }, e 7841 }), t.define("select2/dropdown/hidePlaceholder", [], function() { 7842 function t(t, e, i, n) { 7843 this.placeholder = this.normalizePlaceholder(i.get("placeholder")), t.call(this, e, i, n) 7844 } 7845 return t.prototype.append = function(t, e) { 7846 e.results = this.removePlaceholder(e.results), t.call(this, e) 7847 }, t.prototype.normalizePlaceholder = function(t, e) { 7848 return e = "string" == typeof e ? { 7849 id: "", 7850 text: e 7851 } : e 7852 }, t.prototype.removePlaceholder = function(t, e) { 7853 for (var i = e.slice(0), n = e.length - 1; 0 <= n; n--) { 7854 var o = e[n]; 7855 this.placeholder.id === o.id && i.splice(n, 1) 7856 } 7857 return i 7858 }, t 7859 }), t.define("select2/dropdown/infiniteScroll", ["jquery"], function(i) { 7860 function t(t, e, i, n) { 7861 this.lastParams = {}, t.call(this, e, i, n), this.$loadingMore = this.createLoadingMore(), this.loading = !1 7862 } 7863 return t.prototype.append = function(t, e) { 7864 this.$loadingMore.remove(), this.loading = !1, t.call(this, e), this.showLoadingMore(e) && (this.$results.append(this.$loadingMore), this.loadMoreIfNeeded()) 7865 }, t.prototype.bind = function(t, e, i) { 7866 var n = this; 7867 t.call(this, e, i), e.on("query", function(t) { 7868 n.lastParams = t, n.loading = !0 7869 }), e.on("query:append", function(t) { 7870 n.lastParams = t, n.loading = !0 7871 }), this.$results.on("scroll", this.loadMoreIfNeeded.bind(this)) 7872 }, t.prototype.loadMoreIfNeeded = function() { 7873 var t = i.contains(document.documentElement, this.$loadingMore[0]); 7874 !this.loading && t && (t = this.$results.offset().top + this.$results.outerHeight(!1), this.$loadingMore.offset().top + this.$loadingMore.outerHeight(!1) <= t + 50 && this.loadMore()) 7875 }, t.prototype.loadMore = function() { 7876 this.loading = !0; 7877 var t = i.extend({}, { 7878 page: 1 7879 }, this.lastParams); 7880 t.page++, this.trigger("query:append", t) 7881 }, t.prototype.showLoadingMore = function(t, e) { 7882 return e.pagination && e.pagination.more 7883 }, t.prototype.createLoadingMore = function() { 7884 var t = i('<li class="select2-results__option select2-results__option--load-more"role="option" aria-disabled="true"></li>'), 7885 e = this.options.get("translations").get("loadingMore"); 7886 return t.html(e(this.lastParams)), t 7887 }, t 7888 }), t.define("select2/dropdown/attachBody", ["jquery", "../utils"], function(d, a) { 7889 function t(t, e, i) { 7890 this.$dropdownParent = d(i.get("dropdownParent") || document.body), t.call(this, e, i) 7891 } 7892 return t.prototype.bind = function(t, e, i) { 7893 var n = this; 7894 t.call(this, e, i), e.on("open", function() { 7895 n._showDropdown(), n._attachPositioningHandler(e), n._bindContainerResultHandlers(e) 7896 }), e.on("close", function() { 7897 n._hideDropdown(), n._detachPositioningHandler(e) 7898 }), this.$dropdownContainer.on("mousedown", function(t) { 7899 t.stopPropagation() 7900 }) 7901 }, t.prototype.destroy = function(t) { 7902 t.call(this), this.$dropdownContainer.remove() 7903 }, t.prototype.position = function(t, e, i) { 7904 e.attr("class", i.attr("class")), e.removeClass("select2"), e.addClass("select2-container--open"), e.css({ 7905 position: "absolute", 7906 top: -999999 7907 }), this.$container = i 7908 }, t.prototype.render = function(t) { 7909 var e = d("<span></span>"), 7910 t = t.call(this); 7911 return e.append(t), this.$dropdownContainer = e 7912 }, t.prototype._hideDropdown = function(t) { 7913 this.$dropdownContainer.detach() 7914 }, t.prototype._bindContainerResultHandlers = function(t, e) { 7915 var i; 7916 this._containerResultsHandlersBound || (i = this, e.on("results:all", function() { 7917 i._positionDropdown(), i._resizeDropdown() 7918 }), e.on("results:append", function() { 7919 i._positionDropdown(), i._resizeDropdown() 7920 }), e.on("results:message", function() { 7921 i._positionDropdown(), i._resizeDropdown() 7922 }), e.on("select", function() { 7923 i._positionDropdown(), i._resizeDropdown() 7924 }), e.on("unselect", function() { 7925 i._positionDropdown(), i._resizeDropdown() 7926 }), this._containerResultsHandlersBound = !0) 7927 }, t.prototype._attachPositioningHandler = function(t, e) { 7928 var i = this, 7929 n = "scroll.select2." + e.id, 7930 o = "resize.select2." + e.id, 7931 s = "orientationchange.select2." + e.id, 7932 e = this.$container.parents().filter(a.hasScroll); 7933 e.each(function() { 7934 a.StoreData(this, "select2-scroll-position", { 7935 x: d(this).scrollLeft(), 7936 y: d(this).scrollTop() 7937 }) 7938 }), e.on(n, function(t) { 7939 var e = a.GetData(this, "select2-scroll-position"); 7940 d(this).scrollTop(e.y) 7941 }), d(window).on(n + " " + o + " " + s, function(t) { 7942 i._positionDropdown(), i._resizeDropdown() 7943 }) 7944 }, t.prototype._detachPositioningHandler = function(t, e) { 7945 var i = "scroll.select2." + e.id, 7946 n = "resize.select2." + e.id, 7947 e = "orientationchange.select2." + e.id; 7948 this.$container.parents().filter(a.hasScroll).off(i), d(window).off(i + " " + n + " " + e) 7949 }, t.prototype._positionDropdown = function() { 7950 var t = d(window), 7951 e = this.$dropdown.hasClass("select2-dropdown--above"), 7952 i = this.$dropdown.hasClass("select2-dropdown--below"), 7953 n = null, 7954 o = this.$container.offset(); 7955 o.bottom = o.top + this.$container.outerHeight(!1); 7956 var s = { 7957 height: this.$container.outerHeight(!1) 7958 }; 7959 s.top = o.top, s.bottom = o.top + s.height; 7960 var a = this.$dropdown.outerHeight(!1), 7961 r = t.scrollTop(), 7962 l = t.scrollTop() + t.height(), 7963 c = r < o.top - a, 7964 t = l > o.bottom + a, 7965 r = { 7966 left: o.left, 7967 top: s.bottom 7968 }, 7969 l = this.$dropdownParent; 7970 "static" === l.css("position") && (l = l.offsetParent()); 7971 o = { 7972 top: 0, 7973 left: 0 7974 }; 7975 (d.contains(document.body, l[0]) || l[0].isConnected) && (o = l.offset()), r.top -= o.top, r.left -= o.left, e || i || (n = "below"), t || !c || e ? !c && t && e && (n = "below") : n = "above", ("above" == n || e && "below" !== n) && (r.top = s.top - o.top - a), null != n && (this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--" + n), this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--" + n)), this.$dropdownContainer.css(r) 7976 }, t.prototype._resizeDropdown = function() { 7977 var t = { 7978 width: this.$container.outerWidth(!1) + "px" 7979 }; 7980 this.options.get("dropdownAutoWidth") && (t.minWidth = t.width, t.position = "relative", t.width = "auto"), this.$dropdown.css(t) 7981 }, t.prototype._showDropdown = function(t) { 7982 this.$dropdownContainer.appendTo(this.$dropdownParent), this._positionDropdown(), this._resizeDropdown() 7983 }, t 7984 }), t.define("select2/dropdown/minimumResultsForSearch", [], function() { 7985 function t(t, e, i, n) { 7986 this.minimumResultsForSearch = i.get("minimumResultsForSearch"), this.minimumResultsForSearch < 0 && (this.minimumResultsForSearch = 1 / 0), t.call(this, e, i, n) 7987 } 7988 return t.prototype.showSearch = function(t, e) { 7989 return !(function t(e) { 7990 for (var i = 0, n = 0; n < e.length; n++) { 7991 var o = e[n]; 7992 o.children ? i += t(o.children) : i++ 7993 } 7994 return i 7995 }(e.data.results) < this.minimumResultsForSearch) && t.call(this, e) 7996 }, t 7997 }), t.define("select2/dropdown/selectOnClose", ["../utils"], function(n) { 7998 function t() {} 7999 return t.prototype.bind = function(t, e, i) { 8000 var n = this; 8001 t.call(this, e, i), e.on("close", function(t) { 8002 n._handleSelectOnClose(t) 8003 }) 8004 }, t.prototype._handleSelectOnClose = function(t, e) { 8005 if (e && null != e.originalSelect2Event) { 8006 var i = e.originalSelect2Event; 8007 if ("select" === i._type || "unselect" === i._type) return 8008 } 8009 i = this.getHighlightedResults(); 8010 i.length < 1 || (null != (i = n.GetData(i[0], "data")).element && i.element.selected || null == i.element && i.selected || this.trigger("select", { 8011 data: i 8012 })) 8013 }, t 8014 }), t.define("select2/dropdown/closeOnSelect", [], function() { 8015 function t() {} 8016 return t.prototype.bind = function(t, e, i) { 8017 var n = this; 8018 t.call(this, e, i), e.on("select", function(t) { 8019 n._selectTriggered(t) 8020 }), e.on("unselect", function(t) { 8021 n._selectTriggered(t) 8022 }) 8023 }, t.prototype._selectTriggered = function(t, e) { 8024 var i = e.originalEvent; 8025 i && (i.ctrlKey || i.metaKey) || this.trigger("close", { 8026 originalEvent: i, 8027 originalSelect2Event: e 8028 }) 8029 }, t 8030 }), t.define("select2/i18n/en", [], function() { 8031 return { 8032 errorLoading: function() { 8033 return "The results could not be loaded." 8034 }, 8035 inputTooLong: function(t) { 8036 var e = t.input.length - t.maximum, 8037 t = "Please delete " + e + " character"; 8038 return 1 != e && (t += "s"), t 8039 }, 8040 inputTooShort: function(t) { 8041 return "Please enter " + (t.minimum - t.input.length) + " or more characters" 8042 }, 8043 loadingMore: function() { 8044 return "Loading more resultsâ¦" 8045 }, 8046 maximumSelected: function(t) { 8047 var e = "You can only select " + t.maximum + " item"; 8048 return 1 != t.maximum && (e += "s"), e 8049 }, 8050 noResults: function() { 8051 return "No results found" 8052 }, 8053 searching: function() { 8054 return "Searchingâ¦" 8055 }, 8056 removeAllItems: function() { 8057 return "Remove all items" 8058 } 8059 } 8060 }), t.define("select2/defaults", ["jquery", "require", "./results", "./selection/single", "./selection/multiple", "./selection/placeholder", "./selection/allowClear", "./selection/search", "./selection/eventRelay", "./utils", "./translation", "./diacritics", "./data/select", "./data/array", "./data/ajax", "./data/tags", "./data/tokenizer", "./data/minimumInputLength", "./data/maximumInputLength", "./data/maximumSelectionLength", "./dropdown", "./dropdown/search", "./dropdown/hidePlaceholder", "./dropdown/infiniteScroll", "./dropdown/attachBody", "./dropdown/minimumResultsForSearch", "./dropdown/selectOnClose", "./dropdown/closeOnSelect", "./i18n/en"], function(l, r, c, d, u, h, p, f, m, g, a, e, v, b, y, w, C, x, _, S, T, $, E, k, I, O, z, A, t) { 8061 function i() { 8062 this.reset() 8063 } 8064 return i.prototype.apply = function(t) { 8065 var e, i, n; 8066 null == (t = l.extend(!0, {}, this.defaults, t)).dataAdapter && (null != t.ajax ? t.dataAdapter = y : null != t.data ? t.dataAdapter = b : t.dataAdapter = v, 0 < t.minimumInputLength && (t.dataAdapter = g.Decorate(t.dataAdapter, x)), 0 < t.maximumInputLength && (t.dataAdapter = g.Decorate(t.dataAdapter, _)), 0 < t.maximumSelectionLength && (t.dataAdapter = g.Decorate(t.dataAdapter, S)), t.tags && (t.dataAdapter = g.Decorate(t.dataAdapter, w)), null == t.tokenSeparators && null == t.tokenizer || (t.dataAdapter = g.Decorate(t.dataAdapter, C
8066)), null != t.query && (e = r(t.amdBase + "compat/query"), t.dataAdapter = g.Decorate(t.dataAdapter, e)), null != t.initSelection && (i = r(t.amdBase + "compat/initSelection"), t.dataAdapter = g.Decorate(t.dataAdapter, i))), null == t.resultsAdapter && (t.resultsAdapter = c, null != t.ajax && (t.resultsAdapter = g.Decorate(t.resultsAdapter, k)), null != t.placeholder && (t.resultsAdapter = g.Decorate(t.resultsAdapter, E)), t.selectOnClose && (t.resultsAdapter = g.Decorate(t.resultsAdapter, z))), null == t.dropdownAdapter && (t.multiple ? t.dropdownAdapter = T : (i = g.Decorate(T, $), t.dropdownAdapter = i), 0 !== t.minimumResultsForSearch && (t.dropdownAdapter = g.Decorate(t.dropdownAdapter, O)), t.closeOnSelect && (t.dropdownAdapter = g.Decorate(t.dropdownAdapter, A)), null == t.dropdownCssClass && null == t.dropdownCss && null == t.adaptDropdownCssClass || (n = r(t.amdBase + "compat/dropdownCss"), t.dropdownAdapter = g.Decorate(t.dropdownAdapter, n)), t.dropdownAdapter = g.Decorate(t.dropdownAdapter, I)), null == t.selectionAdapter && (t.multiple ? t.selectionAdapter = u : t.selectionAdapter = d, null != t.placeholder && (t.selectionAdapter = g.Decorate(t.selectionAdapter, h)), t.allowClear && (t.selectionAdapter = g.Decorate(t.selectionAdapter, p)), t.multiple && (t.selectionAdapter = g.Decorate(t.selectionAdapter, f)), null == t.containerCssClass && null == t.containerCss && null == t.adaptContainerCssClass || (n = r(t.amdBase + "compat/containerCss"), t.selectionAdapter = g.Decorate(t.selectionAdapter, n)), t.selectionAdapter = g.Decorate(t.selectionAdapter, m)), t.language = this._resolveLanguage(t.language), t.language.push("en"); 8067 for (var o = [], s = 0; s < t.language.length; s++) { 8068 var a = t.language[s]; - 1 === o.indexOf(a) && o.push(a) 8069 } 8070 return t.language = o, t.translations = this._processTranslations(t.language, t.debug), t 8071 }, i.prototype.reset = function() { 8072 function r(t) {
8073 return t.replace(/[^\u0000-\u007E]/g, function(t) { 8074 return e[t] || t 8075 }) 8076 } 8077 this.defaults = { 8078 amdBase: "./", 8079 amdLanguageBase: "./i18n/", 8080 closeOnSelect: !0, 8081 debug: !1, 8082 dropdownAutoWidth: !1, 8083 escapeMarkup: g.escapeMarkup, 8084 language: {}, 8085 matcher: function t(e, i) { 8086 if ("" === l.trim(e.term)) return i; 8087 if (i.children && 0 < i.children.length) { 8088 for (var n = l.extend(!0, {}, i), o = i.children.length - 1; 0 <= o; o--) null == t(e, i.children[o]) && n.children.splice(o, 1); 8089 return 0 < n.children.length ? n : t(e, n) 8090 } 8091 var s = r(i.text).toUpperCase(), 8092 a = r(e.term).toUpperCase(); 8093 return -1 < s.indexOf(a) ? i : null 8094 }, 8095 minimumInputLength: 0, 8096 maximumInputLength: 0, 8097 maximumSelectionLength: 0, 8098 minimumResultsForSearch: 0, 8099 selectOnClose: !1, 8100 scrollAfterSelect: !1, 8101 sorter: function(t) { 8102 return t 8103 }, 8104 templateResult: function(t) { 8105 return t.text 8106 }, 8107 templateSelection: function(t) { 8108 return t.text 8109 }, 8110 theme: "default", 8111 width: "resolve" 8112 } 8113 }, i.prototype.applyFromElement = function(t, e) { 8114 var i = t.language, 8115 n = this.defaults.language, 8116 o = e.prop("lang"), 8117 e = e.closest("[lang]").prop("lang"), 8118 e = Array.prototype.concat.call(this._resolveLanguage(o), this._resolveLanguage(i), this._resolveLanguage(n), this._resolveLanguage(e)); 8119 return t.language = e, t 8120 }, i.prototype._resolveLanguage = function(t) { 8121 if (!t) return []; 8122 if (l.isEmptyObject(t)) return []; 8123 if (l.isPlainObject(t)) return [t]; 8124 for (var e, i = l.isArray(t) ? t : [t], n = [], o = 0; o < i.length; o++) n.push(i[o]), "string" == typeof i[o] && 0 < i[o].indexOf("-") && (e = i[o].split("-")[0], n.push(e)); 8125 return n 8126 }, i.prototype._processTranslations = function(t, e) { 8127 for (var i = new a, n = 0; n < t.length; n++) { 8128 var o = new a, 8129 s = t[n]; 8130 if ("string" == typeof s) try { 8131 o = a.loadPath(s) 8132 } catch (t) { 8133 try { 8134 s = this.defaults.amdLanguageBase + s, o = a.loadPath(s) 8135 } catch (t) { 8136 e && window.console && console.warn && console.warn('Select2: The language file for "' + s + '" could not be automatically loaded. A fallback will be used instead.') 8137 } 8138 } else o = l.isPlainObject(s) ? new a(s) : s; 8139 i.extend(o) 8140 } 8141 return i 8142 }, i.prototype.set = function(t, e) { 8143 var i = {}; 8144 i[l.camelCase(t)] = e; 8145 i = g._convertData(i); 8146 l.extend(!0, this.defaults, i) 8147 }, new i 8148 }), t.define("select2/options", ["require", "jquery", "./defaults", "./utils"], function(i, c, n, d) { 8149 function t(t, e) { 8150 this.options = t, null != e && this.fromElement(e), null != e && (this.options = n.applyFromElement(this.options, e)), this.options = n.apply(this.options), e && e.is("input") && (e = i(this.get("amdBase") + "compat/inputData"), this.options.dataAdapter = d.Decorate(this.options.dataAdapter, e)) 8151 } 8152 return t.prototype.fromElement = function(t) { 8153 var e = ["select2"]; 8154 null == this.options.multiple && (this.options.multiple = t.prop("multiple")), null == this.options.disabled && (this.options.disabled = t.prop("disabled")), null == this.options.dir && (t.prop("dir") ? this.options.dir = t.prop("dir") : t.closest("[dir]").prop("dir") ? this.options.dir = t.closest("[dir]").prop("dir") : this.options.dir = "ltr"), t.prop("disabled", this.options.disabled), t.prop("multiple", this.options.multiple), d.GetData(t[0], "select2Tags") && (this.options.debug && window.console && console.warn && console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'), d.StoreData(t[0], "data", d.GetData(t[0], "select2Tags")), d.StoreData(t[0], "tags", !0)), d.GetData(t[0], "ajaxUrl") && (this.options.debug && window.console && console.warn && console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."), t.attr("ajax--url", d.GetData(t[0], "ajaxUrl")), d.StoreData(t[0], "ajax-Url", d.GetData(t[0], "ajaxUrl"))); 8155 var i = {}; 8156 8157 function n(t, e) { 8158 return e.toUpperCase() 8159 } 8160 for (var o = 0; o < t[0].attributes.length; o++) { 8161 var s, a = t[0].attributes[o].name; 8162 "data-" == a.substr(0, "data-".length) && (s = a.substring("data-".length), a = d.GetData(t[0], s), i[s.replace(/-([a-z])/g, n)] = a) 8163 } 8164 c.fn.jquery && "1." == c.fn.jquery.substr(0, 2) && t[0].dataset && (i = c.extend(!0, {}, t[0].dataset, i)); 8165 var r, l = c.extend(!0, {}, d.GetData(t[0]), i); 8166 for (r in l = d._convertData(l)) - 1 < c.inArray(r, e) || (c.isPlainObject(this.options[r]) ? c.extend(this.options[r], l[r]) : this.options[r] = l[r]); 8167 return this 8168 }, t.prototype.get = function(t) { 8169 return this.options[t] 8170 }, t.prototype.set = function(t, e) { 8171 this.options[t] = e 8172 }, t 8173 }), t.define("select2/core", ["jquery", "./options", "./utils", "./keys"], function(o, s, a, n) { 8174 function r(t, e) { 8175 null != a.GetData(t[0], "select2") && a.GetData(t[0], "select2").destroy(), this.$element = t, this.id = this._generateId(t), this.options = new s(e = e || {}, t), r.__super__.constructor.call(this); 8176 var i = t.attr("tabindex") || 0; 8177 a.StoreData(t[0], "old-tabindex", i), t.attr("tabindex", "-1"), e = this.options.get("dataAdapter"), this.dataAdapter = new e(t, this.options), i = this.render(), this._placeContainer(i), e = this.options.get("selectionAdapter"), this.selection = new e(t, this.options), this.$selection = this.selection.render(), this.selection.position(this.$selection, i), e = this.options.get("dropdownAdapter"), this.dropdown = new e(t, this.options), this.$dropdown = this.dropdown.render(), this.dropdown.position(this.$dropdown, i), i = this.options.get("resultsAdapter"), this.results = new i(t, this.options, this.dataAdapter), this.$results = this.results.render(), this.results.position(this.$results, this.$dropdown); 8178 var n = this; 8179 this._bindAdapters(), this._registerDomEvents(), this._registerDataEvents(), this._registerSelectionEvents(), this._registerDropdownEvents(), this._registerResultsEvents(), this._registerEvents(), this.dataAdapter.current(function(t) { 8180 n.trigger("selection:update", { 8181 data: t 8182 }) 8183 }), t.addClass("select2-hidden-accessible"), t.attr("aria-hidden", "true"), this._syncAttributes(), a.StoreData(t[0], "select2", this), t.data("select2", this) 8184 } 8185 return a.Extend(r, a.Observable), r.prototype._generateId = function(t) { 8186 return "select2-" + (null != t.attr("id") ? t.attr("id") : null != t.attr("name") ? t.attr("name") + "-" + a.generateChars(2) : a.generateChars(4)).replace(/(:|\.|\[|\]|,)/g, "") 8187 }, r.prototype._placeContainer = function(t) { 8188 t.insertAfter(this.$element); 8189 var e = this._resolveWidth(this.$element, this.options.get("width")); 8190 null != e && t.css("width", e) 8191 }, r.prototype._resolveWidth = function(t, e) { 8192 var i = /^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i; 8193 if ("resolve" == e) { 8194 var n = this._resolveWidth(t, "style"); 8195 return null != n ? n : this._resolveWidth(t, "element") 8196 } 8197 if ("element" == e) { 8198 n = t.outerWidth(!1); 8199 return n <= 0 ? "auto" : n + "px" 8200 } 8201 if ("style" != e) return "computedstyle" != e ? e : window.getComputedStyle(t[0]).width; 8202 t = t.attr("style"); 8203 if ("string" != typeof t) return null; 8204 for (var o = t.split(";"), s = 0, a = o.length; s < a; s += 1) { 8205 var r = o[s].replace(/\s/g, "").match(i); 8206 if (null !== r && 1 <= r.length) return r[1] 8207 } 8208 return null 8209 }, r.prototype._bindAdapters = function() { 8210 this.dataAdapter.bind(this, this.$container), this.selection.bind(this, this.$container), this.dropdown.bind(this, this.$container), this.results.bind(this, this.$container) 8211 }, r.prototype._registerDomEvents = function() { 8212 var e = this; 8213 this.$element.on("change.select2", function() { 8214 e.dataAdapter.current(function(t) { 8215 e.trigger("selection:update", { 8216 data: t 8217 }) 8218 }) 8219 }), this.$element.on("focus.select2", function(t) { 8220 e.trigger("focus", t) 8221 }), this._syncA = a.bind(this._syncAttributes, this), this._syncS = a.bind(this._syncSubtree, this), this.$element[0].attachEvent && this.$element[0].attachEvent("onpropertychange", this._syncA); 8222 var t = window.MutationObserver || window.WebKitMutationObserver || window.MozMutationObserver; 8223 null != t ? (this._observer = new t(function(t) { 8224 o.each(t, e._syncA), o.each(t, e._syncS) 8225 }), this._observer.observe(this.$element[0], { 8226 attributes: !0, 8227 childList: !0, 8228 subtree: !1 8229 })) : this.$element[0].addEventListener && (this.$element[0].addEventListener("DOMAttrModified", e._syncA, !1), this.$element[0].addEventListener("DOMNodeInserted", e._syncS, !1), this.$element[0].addEventListener("DOMNodeRemoved", e._syncS, !1)) 8230 }, r.prototype._registerDataEvents = function() { 8231 var i = this; 8232 this.dataAdapter.on("*", function(t, e) { 8233 i.trigger(t, e) 8234 }) 8235 }, r.prototype._registerSelectionEvents = function() { 8236 var i = this,
vendor: 6,721 bytes, lines 8237-8355
8237 n = ["toggle", "focus"]; 8238 this.selection.on("toggle", function() { 8239 i.toggleDropdown() 8240 }), this.selection.on("focus", function(t) { 8241 i.focus(t) 8242 }), this.selection.on("*", function(t, e) { 8243 -1 === o.inArray(t, n) && i.trigger(t, e) 8244 }) 8245 }, r.prototype._registerDropdownEvents = function() { 8246 var i = this; 8247 this.dropdown.on("*", function(t, e) { 8248 i.trigger(t, e) 8249 }) 8250 }, r.prototype._registerResultsEvents = function() { 8251 var i = this; 8252 this.results.on("*", function(t, e) { 8253 i.trigger(t, e) 8254 }) 8255 }, r.prototype._registerEvents = function() { 8256 var i = this; 8257 this.on("open", function() { 8258 i.$container.addClass("select2-container--open") 8259 }), this.on("close", function() { 8260 i.$container.removeClass("select2-container--open") 8261 }), this.on("enable", function() { 8262 i.$container.removeClass("select2-container--disabled") 8263 }), this.on("disable", function() { 8264 i.$container.addClass("select2-container--disabled") 8265 }), this.on("blur", function() { 8266 i.$container.removeClass("select2-container--focus") 8267 }), this.on("query", function(e) { 8268 i.isOpen() || i.trigger("open", {}), this.dataAdapter.query(e, function(t) { 8269 i.trigger("results:all", { 8270 data: t, 8271 query: e 8272 }) 8273 }) 8274 }), this.on("query:append", function(e) { 8275 this.dataAdapter.query(e, function(t) { 8276 i.trigger("results:append", { 8277 data: t, 8278 query: e 8279 }) 8280 }) 8281 }), this.on("keypress", function(t) { 8282 var e = t.which; 8283 i.isOpen() ? e === n.ESC || e === n.TAB || e === n.UP && t.altKey ? (i.close(), t.preventDefault()) : e === n.ENTER ? (i.trigger("results:select", {}), t.preventDefault()) : e === n.SPACE && t.ctrlKey ? (i.trigger("results:toggle", {}), t.preventDefault()) : e === n.UP ? (i.trigger("results:previous", {}), t.preventDefault()) : e === n.DOWN && (i.trigger("results:next", {}), t.preventDefault()) : (e === n.ENTER || e === n.SPACE || e === n.DOWN && t.altKey) && (i.open(), t.preventDefault()) 8284 }) 8285 }, r.prototype._syncAttributes = function() { 8286 this.options.set("disabled", this.$element.prop("disabled")), this.options.get("disabled") ? (this.isOpen() && this.close(), this.trigger("disable", {})) : this.trigger("enable", {}) 8287 }, r.prototype._syncSubtree = function(t, e) { 8288 var i = !1, 8289 n = this; 8290 if (!t || !t.target || "OPTION" === t.target.nodeName || "OPTGROUP" === t.target.nodeName) { 8291 if (e) 8292 if (e.addedNodes && 0 < e.addedNodes.length) 8293 for (var o = 0; o < e.addedNodes.length; o++) e.addedNodes[o].selected && (i = !0); 8294 else e.removedNodes && 0 < e.removedNodes.length && (i = !0); 8295 else i = !0; 8296 i && this.dataAdapter.current(function(t) { 8297 n.trigger("selection:update", { 8298 data: t 8299 }) 8300 }) 8301 } 8302 }, r.prototype.trigger = function(t, e) { 8303 var i = r.__super__.trigger, 8304 n = { 8305 open: "opening", 8306 close: "closing", 8307 select: "selecting", 8308 unselect: "unselecting", 8309 clear: "clearing" 8310 }; 8311 if (void 0 === e && (e = {}), t in n) { 8312 var o = { 8313 prevented: !1, 8314 name: t, 8315 args: e 8316 }; 8317 if (i.call(this, n[t], o), o.prevented) return void(e.prevented = !0) 8318 } 8319 i.call(this, t, e) 8320 }, r.prototype.toggleDropdown = function() { 8321 this.options.get("disabled") || (this.isOpen() ? this.close() : this.open()) 8322 }, r.prototype.open = function() { 8323 this.isOpen() || this.trigger("query", {}) 8324 }, r.prototype.close = function() { 8325 this.isOpen() && this.trigger("close", {}) 8326 }, r.prototype.isOpen = function() { 8327 return this.$container.hasClass("select2-container--open") 8328 }, r.prototype.hasFocus = function() { 8329 return this.$container.hasClass("select2-container--focus") 8330 }, r.prototype.focus = function(t) { 8331 this.hasFocus() || (this.$container.addClass("select2-container--focus"), this.trigger("focus", {})) 8332 }, r.prototype.enable = function(t) { 8333 this.options.get("debug") && window.console && console.warn && console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'); 8334 t = !(t = null == t || 0 === t.length ? [!0] : t)[0]; 8335 this.$element.prop("disabled", t) 8336 }, r.prototype.data = function() { 8337 this.options.get("debug") && 0 < arguments.length && window.console && console.warn && console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.'); 8338 var e = []; 8339 return this.dataAdapter.current(function(t) { 8340 e = t 8341 }), e 8342 }, r.prototype.val = function(t) { 8343 if (this.options.get("debug") && window.console && console.warn && console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'), null == t || 0 === t.length) return this.$element.val(); 8344 t = t[0]; 8345 o.isArray(t) && (t = o.map(t, function(t) { 8346 return t.toString() 8347 })), this.$element.val(t).trigger("change") 8348 }, r.prototype.destroy = function() { 8349 this.$container.remove(), this.$element[0].detachEvent && this.$element[0].detachEvent("onpropertychange", this._syncA), null != this._observer ? (this._observer.disconnect(), this._observer = null) : this.$element[0].removeEventListener && (this.$element[0].removeEventListener("DOMAttrModified", this._syncA, !1), this.$element[0].removeEventListener("DOMNodeInserted", this._syncS, !1), this.$element[0].removeEventListener("DOMNodeRemoved", this._syncS, !1)), this._syncA = null, this._syncS = null, this.$element.off(".select2"), this.$element.attr("tabindex", a.GetData(this.$element[0], "old-tabindex")), this.$element.removeClass("select2-hidden-accessible"), this.$element.attr("aria-hidden", "false"), a.RemoveData(this.$element[0]), this.$element.removeData("select2"), this.dataAdapter.destroy(), this.selection.destroy(), this.dropdown.destroy(), this.results.destroy(), this.dataAdapter = null, this.selection = null, this.dropdown = null, this.results = null 8350 }, r.prototype.render = function() { 8351 var t = o('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>'); 8352 return t.attr("dir", this.options.get("dir")), this.$container = t, this.$container.addClass("select2-container--" + this.options.get("theme")), a.StoreData(t[0], "element", this.$element), t 8353 }, r 8354 }), t.define("select2/compat/utils", ["jquery"], function(a) { 8355 return {
vendor: 5,439 bytes, lines 8356-8472
8356 syncCssClasses: function(t, e, i) { 8357 var n, o, s = []; 8358 (n = a.trim(t.attr("class"))) && a((n = "" + n).split(/\s+/)).each(function() { 8359 0 === this.indexOf("select2-") && s.push(this) 8360 }), (n = a.trim(e.attr("class"))) && a((n = "" + n).split(/\s+/)).each(function() { 8361 0 !== this.indexOf("select2-") && null != (o = i(this)) && s.push(o) 8362 }), t.attr("class", s.join(" ")) 8363 } 8364 } 8365 }), t.define("select2/compat/containerCss", ["jquery", "./utils"], function(s, a) { 8366 function r(t) { 8367 return null 8368 } 8369 8370 function t() {} 8371 return t.prototype.render = function(t) { 8372 var e = t.call(this), 8373 i = this.options.get("containerCssClass") || ""; 8374 s.isFunction(i) && (i = i(this.$element)); 8375 var n, o = this.options.get("adaptContainerCssClass"); 8376 o = o || r, -1 !== i.indexOf(":all:") && (i = i.replace(":all:", ""), n = o, o = function(t) { 8377 var e = n(t); 8378 return null != e ? e + " " + t : t 8379 }); 8380 t = this.options.get("containerCss") || {}; 8381 return s.isFunction(t) && (t = t(this.$element)), a.syncCssClasses(e, this.$element, o), e.css(t), e.addClass(i), e 8382 }, t 8383 }), t.define("select2/compat/dropdownCss", ["jquery", "./utils"], function(s, a) { 8384 function r(t) { 8385 return null 8386 } 8387 8388 function t() {} 8389 return t.prototype.render = function(t) { 8390 var e = t.call(this), 8391 i = this.options.get("dropdownCssClass") || ""; 8392 s.isFunction(i) && (i = i(this.$element)); 8393 var n, o = this.options.get("adaptDropdownCssClass"); 8394 o = o || r, -1 !== i.indexOf(":all:") && (i = i.replace(":all:", ""), n = o, o = function(t) { 8395 var e = n(t); 8396 return null != e ? e + " " + t : t 8397 }); 8398 t = this.options.get("dropdownCss") || {}; 8399 return s.isFunction(t) && (t = t(this.$element)), a.syncCssClasses(e, this.$element, o), e.css(t), e.addClass(i), e 8400 }, t 8401 }), t.define("select2/compat/initSelection", ["jquery"], function(n) { 8402 function t(t, e, i) { 8403 i.get("debug") && window.console && console.warn && console.warn("Select2: The `initSelection` option has been deprecated in favor of a custom data adapter that overrides the `current` method. This method is now called multiple times instead of a single time when the instance is initialized. Support will be removed for the `initSelection` option in future versions of Select2"), this.initSelection = i.get("initSelection"), this._isInitialized = !1, t.call(this, e, i) 8404 } 8405 return t.prototype.current = function(t, e) { 8406 var i = this; 8407 this._isInitialized ? t.call(this, e) : this.initSelection.call(null, this.$element, function(t) { 8408 i._isInitialized = !0, n.isArray(t) || (t = [t]), e(t) 8409 }) 8410 }, t 8411 }), t.define("select2/compat/inputData", ["jquery", "../utils"], function(s, i) { 8412 function t(t, e, i) { 8413 this._currentData = [], this._valueSeparator = i.get("valueSeparator") || ",", "hidden" === e.prop("type") && i.get("debug") && console && console.warn && console.warn("Select2: Using a hidden input with Select2 is no longer supported and may stop working in the future. It is recommended to use a `<select>` element instead."), t.call(this, e, i) 8414 } 8415 return t.prototype.current = function(t, e) { 8416 for (var i = [], n = 0; n < this._currentData.length; n++) { 8417 var o = this._currentData[n]; 8418 i.push.apply(i, function t(e, i) { 8419 var n = []; 8420 return e.selected || -1 !== s.inArray(e.id, i) ? (e.selected = !0, n.push(e)) : e.selected = !1, e.children && n.push.apply(n, t(e.children, i)), n 8421 }(o, this.$element.val().split(this._valueSeparator))) 8422 } 8423 e(i) 8424 }, t.prototype.select = function(t, e) { 8425 var i; 8426 this.options.get("multiple") ? (i = this.$element.val(), i += this._valueSeparator + e.id, this.$element.val(i)) : (this.current(function(t) { 8427 s.map(t, function(t) { 8428 t.selected = !1 8429 }) 8430 }), this.$element.val(e.id)), this.$element.trigger("change") 8431 }, t.prototype.unselect = function(t, o) { 8432 var s = this; 8433 o.selected = !1, this.current(function(t) { 8434 for (var e = [], i = 0; i < t.length; i++) { 8435 var n = t[i]; 8436 o.id != n.id && e.push(n.id) 8437 } 8438 s.$element.val(e.join(s._valueSeparator)), s.$element.trigger("change") 8439 }) 8440 }, t.prototype.query = function(t, e, i) { 8441 for (var n = [], o = 0; o < this._currentData.length; o++) { 8442 var s = this._currentData[o], 8443 s = this.matches(e, s); 8444 null !== s && n.push(s) 8445 } 8446 i({ 8447 results: n 8448 }) 8449 }, t.prototype.addOptions = function(t, e) { 8450 e = s.map(e, function(t) { 8451 return i.GetData(t[0], "data") 8452 }); 8453 this._currentData.push.apply(this._currentData, e) 8454 }, t 8455 }), t.define("select2/compat/matcher", ["jquery"], function(a) { 8456 return function(s) { 8457 return function(t, e) { 8458 var i = a.extend(!0, {}, e); 8459 if (null == t.term || "" === a.trim(t.term)) return i; 8460 if (e.children) { 8461 for (var n = e.children.length - 1; 0 <= n; n--) { 8462 var o = e.children[n]; 8463 s(t.term, o.text, o) || i.children.splice(n, 1) 8464 } 8465 if (0 < i.children.length) return i 8466 } 8467 return s(t.term, e.text, e) ? i : null 8468 } 8469 } 8470 }), t.define("select2/compat/query", [], function() { 8471 function t(t, e, i) { 8472 i.get("debug") && window.console && console.warn && console.warn("Select2: The `query` option has been deprecated
8472in favor of a custom data adapter that overrides the `query` method. Support will be removed for the `query` option in future versions of Select2."), t.call(this, e, i) 8473 } 8474 return t.prototype.query = function(t, e, i) { 8475 e.callback = i, this.options.get("query").call(null, e) 8476 }, t 8477 }), t.define("select2/dropdown/attachContainer", [], function() { 8478 function t(t, e, i) { 8479 t.call(this, e, i) 8480 } 8481 return t.prototype.position = function(t, e, i) { 8482 i.find(".dropdown-wrapper").append(e), e.addClass("select2-dropdown--below"), i.addClass("select2-container--below") 8483 }, t 8484 }), t.define("select2/dropdown/stopPropagation", [], function() { 8485 function t() {} 8486 return t.prototype.bind = function(t, e, i) { 8487 t.call(this, e, i), this.$dropdown.on(["blur", "change", "click", "dblclick", "focus", "focusin", "focusout", "input", "keydown", "keyup", "keypress", "mousedown", "mouseenter", "mouseleave", "mousemove", "mouseover", "mouseup", "search", "touchend", "touchstart"].join(" "), function(t) { 8488 t.stopPropagation() 8489 }) 8490 }, t 8491 }), t.define("select2/selection/stopPropagation", [], function() { 8492 function t() {} 8493 return t.prototype.bind = function(t, e, i) { 8494 t.call(this, e, i), this.$selection.on(["blur", "change", "click", "dblclick", "focus", "focusin", "focusout", "input", "keydown", "keyup", "keypress", "mousedown", "mouseenter", "mouseleave", "mousemove", "mouseover", "mouseup", "search", "touchend", "touchstart"].join(" "), function(t) { 8495 t.stopPropagation() 8496 }) 8497 }, t 8498 }), l = function(d) { 8499 var u, h, t = ["wheel", "mousewheel", "DOMMouseScroll", "MozMousePixelScroll"], 8500 e = "onwheel" in document || 9 <= document.documentMode ? ["wheel"] : ["mousewheel", "DomMouseScroll", "MozMousePixelScroll"], 8501 p = Array.prototype.slice; 8502 if (d.event.fixHooks) 8503 for (var i = t.length; i;) d.event.fixHooks[t[--i]] = d.event.mouseHooks; 8504 var f = d.event.special.mousewheel = { 8505 version: "3.1.12", 8506 setup: function() { 8507 if (this.addEventListener) 8508 for (var t = e.length; t;) this.addEventListener(e[--t], n, !1); 8509 else this.onmousewheel = n; 8510 d.data(this, "mousewheel-line-height", f.getLineHeight(this)), d.data(this, "mousewheel-page-height", f.getPageHeight(this)) 8511 }, 8512 teardown: function() { 8513 if (this.removeEventListener) 8514 for (var t = e.length; t;) this.removeEventListener(e[--t], n, !1); 8515 else this.onmousewheel = null; 8516 d.removeData(this, "mousewheel-line-height"), d.removeData(this, "mousewheel-page-height") 8517 }, 8518 getLineHeight: function(t) { 8519 var e = d(t), 8520 t = e["offsetParent" in d.fn ? "offsetParent" : "parent"](); 8521 return t.length || (t = d("body")), parseInt(t.css("fontSize"), 10) || parseInt(e.css("fontSize"), 10) || 16 8522 }, 8523 getPageHeight: function(t) { 8524 return d(t).height() 8525 }, 8526 settings: { 8527 adjustOldDeltas: !0, 8528 normalizeOffset: !0 8529 } 8530 }; 8531 8532 function n(t) { 8533 var e, i = t || window.event, 8534 n = p.call(arguments, 1), 8535 o = 0, 8536 s = 0, 8537 a = 0, 8538 r = 0, 8539 l = 0; 8540 if ((t = d.event.fix(i)).type = "mousewheel", "detail" in i && (a = -1 * i.detail), "wheelDelta" in i && (a = i.wheelDelta), "wheelDeltaY" in i && (a = i.wheelDeltaY), "wheelDeltaX" in i && (s = -1 * i.wheelDeltaX), "axis" in i && i.axis === i.HORIZONTAL_AXIS && (s = -1 * a, a = 0), o = 0 === a ? s : a, "deltaY" in i && (o = a = -1 * i.deltaY), "deltaX" in i && (s = i.deltaX, 0 === a && (o = -1 * s)), 0 !== a || 0 !== s) { 8541 1 === i.deltaMode ? (o *= e = d.data(this, "mousewheel-line-height"), a *= e, s *= e) : 2 === i.deltaMode && (o *= c = d.data(this, "mousewheel-page-height"), a *= c, s *= c); 8542 var c = Math.max(Math.abs(a), Math.abs(s)); 8543 return (!h || c < h) && g(i, h = c) && (h /= 40), g(i, c) && (o /= 40, s /= 40, a /= 40), o = Math[1 <= o ? "floor" : "ceil"](o / h), s = Math[1 <= s ? "floor" : "ceil"](s / h), a = Math[1 <= a ? "floor" : "ceil"](a / h), f.settings.normalizeOffset && this.getBoundingClientRect && (c = this.getBoundingClientRect(), r = t.clientX - c.left, l = t.clientY - c.top), t.deltaX = s, t.deltaY = a, t.deltaFactor = h, t.offsetX = r, t.offsetY = l, t.deltaMode = 0, n.unshift(t, o, s, a), u && clearTimeout(u), u = setTimeout(m, 200), (d.event.dispatch || d.event.handle).apply(this, n) 8544 } 8545 } 8546 8547 function m() { 8548 h = null 8549 } 8550 8551 function g(t, e) { 8552 return f.settings.adjustOldDeltas && "mousewheel" === t.type && e % 120 == 0 8553 } 8554 d.fn.extend({ 8555 mousewheel: function(t) { 8556 return t ? this.bind("mousewheel", t) : this.trigger("mousewheel") 8557 }, 8558 unmousewheel: function(t) { 8559 return this.unbind("mousewheel", t) 8560 } 8561 }) 8562 }, "function" == typeof t.define && t.define.amd ? t.define("jquery-mousewheel", ["jquery"], l) : "object" == typeof exports ? module.exports = l : l(e), t.define("jquery.select2", ["jquery", "jquery-mousewheel", "./select2/core", "./select2/defaults", "./select2/utils"], function(o, t, s, e, a) { 8563 var r; 8564 return null == o.fn.select2 && (r = ["open", "close", "destroy"], o.fn.select2 = function(e) { 8565 if ("object" == typeof(e = e || {})) return this.each(function() { 8566 var t = o.extend(!0, {}, e); 8567 new s(o(this), t) 8568 }), this; 8569 if ("string" != typeof e) throw new Error("Invalid arguments for Select2: " + e); 8570 var i, n = Array.prototype.slice.call(arguments, 1); 8571 return this.each(function() { 8572 var t = a.GetData(this, "select2"); 8573 null == t && window.console && console.error && console.error("The select2('" + e + "') method was called on an element that is not using Select2."), i = t[e].apply(t, n) 8574 }
8574), -1 < o.inArray(e, r) ? this : i 8575 }), null == o.fn.select2.defaults && (o.fn.select2.defaults = e), s 8576 }), { 8577 define: t.define, 8578 require: t.require 8579 }), 8580 t = l.require("jquery.select2"); 8581 8582 function w(t, e) { 8583 return o.call(t, e) 8584 } 8585 8586 function c(t, e) { 8587 var i, n, o, s, a, r, l, c, d, u, h = e && e.split("/"), 8588 p = v.map, 8589 f = p && p["*"] || {}; 8590 if (t) { 8591 for (e = (t = t.split("/")).length - 1, v.nodeIdCompat && y.test(t[e]) && (t[e] = t[e].replace(y, "")), "." === t[0].charAt(0) && h && (t = h.slice(0, h.length - 1).concat(t)), c = 0; c < t.length; c++) 8592 if ("." === (u = t[c])) t.splice(c, 1), --c; 8593 else if (".." === u) { 8594 if (0 === c || 1 === c && ".." === t[2] || ".." === t[c - 1]) continue; 8595 0 < c && (t.splice(c - 1, 2), c -= 2) 8596 } 8597 t = t.join("/") 8598 } 8599 if ((h || f) && p) { 8600 for (c = (i = t.split("/")).length; 0 < c; --c) { 8601 if (n = i.slice(0, c).join("/"), h) 8602 for (d = h.length; 0 < d; --d) 8603 if (o = (o = p[h.slice(0, d).join("/")]) && o[n]) { 8604 s = o, a = c; 8605 break 8606 } if (s) break; 8607 !r && f && f[n] && (r = f[n], l = c) 8608 }!s && r && (s = r, a = l), s && (i.splice(0, a, s), t = i.join("/")) 8609 } 8610 return t 8611 } 8612 8613 function C(e, i) { 8614 return function() { 8615 var t = r.call(arguments, 0); 8616 return "string" != typeof t[0] && 1 === t.length && t.push(null), a.apply(h, t.concat([e, i])) 8617 } 8618 } 8619 8620 function x(t) { 8621 var e; 8622 if (w(g, t) && (e = g[t], delete g[t], b[t] = !0, s.apply(h, e)), !w(m, t) && !w(b, t)) throw new Error("No " + t); 8623 return m[t] 8624 } 8625 8626 function d(t) { 8627 var e, i = t ? t.indexOf("!") : -1; 8628 return -1 < i && (e = t.substring(0, i), t = t.substring(i + 1, t.length)), [e, t] 8629 } 8630 8631 function _(t) { 8632 return t ? d(t) : [] 8633 } 8634 return e.fn.select2.amd = l, t 8635 }), 8636 function(t) { 8637 "use strict"; 8638 "function" == typeof define && define.amd ? define(["jquery"], t) : "object" == typeof module && module.exports ? module.exports = t(require("jquery")) : t(window.jQuery) 8639 }(function(p) { 8640 "use strict"; 8641 8642 function f(t, e) { 8643 return null == t || 0 === t.length || e && "" === p.trim(t) 8644 } 8645 8646 function s(t, e) { 8647 this.$element = p(t), this.init(e), this.listen() 8648 } 8649 s.prototype = { 8650 constructor: s, 8651 init: function(t) { 8652 var i = this, 8653 e = i.$element; 8654 p.each(t, function(t, e) { 8655 i[t] = e 8656 }), i.initCache(), i.enableCache = !!i.enableCache, f(i.addCss) || e.hasClass(i.addCss) || e.addClass(i.addCss), i.$pane = e.find(".tab-pane.active"), i.$content = e.find(".tab-content"), i.$tabs = e.find(".nav-tabs"), i.isVertical = e.hasClass("tabs-left") || e.hasClass("tabs-right"), i.isVerticalSide = i.isVertical && e.hasClass("tab-sideways"), i.isVertical && i.$content.css("min-height", i.$tabs.outerHeight() + 1 + "px") 8657 }, 8658 setTitle: function(t) { 8659 var e = p.trim(t.text()), 8660 i = this.isVertical, 8661 n = f(t.data("maxTitleLength")) ? this.maxTitleLength : t.data("maxTitleLength"); 8662 i && e.length > n - 2 && f(t.attr("title")) && t.attr("title", e) 8663 }, 8664 listen: function() { 8665 var h = this, 8666 t = h.$element; 8667 t.find(".nav-tabs li.disabled").each(function() { 8668 p(this).find('[data-toggle="tab"]').removeAttr("data-toggle") 8669 }), t.find('.nav-tabs li [data-toggle="dropdown"]').each(function() { 8670 h.setTitle(p(this)) 8671 }), t.find('.nav-tabs li [data-toggle="tab"]').each(function() { 8672 var d = p(this), 8673 u = d.closest("li"); 8674 u.removeAttr("data-toggle"), h.setTitle(d), d.on("click", function(t) { 8675 var e, i, n, o, s, a, r, l, c; 8676 u.hasClass("disabled") ? t.preventDefault() : (e = p(this).attr("data-url"), i = this.hash, n = e + i, f(e) || h.enableCache && h.cache.exist(n) ? d.trigger("tabsX:click") : (t.preventDefault(), o = p(i), s = p(this), a = s, r = p(this).attr("data-loading-class") || "kv-tab-loading", t = s.closest(".dropdown"), l = h.successCallback[i] || null, c = h.errorCallback[i] || null, f(t.attr("class")) || (a = t.find(".dropdown-toggle")), e = p.extend(!0, {}, { 8677 type: "post", 8678 dataType: "json", 8679 url: e, 8680 beforeSend: function(t, e) { 8681 o.html("<br><br><br>"), a.removeClass(r).addClass(r), d.trigger("tabsX:beforeSend", [t, e]) 8682 }, 8683 success: function(t, e, i) { 8684 setTimeout(function() { 8685 o.html(t), s.tab("show"), a.removeClass(r), h.enableCache && h.cache.set(n), l && "function" == typeof l && l(t, e, i), d.trigger("tabsX:success", [t, e, i]) 8686 }, 300) 8687 }, 8688 error: function(t, e, i) { 8689 c && "function" == typeof c && c(t, e, i), d.trigger("tabsX:error", [t, e, i]) 8690 }, 8691 complete: function(t, e) {
8692 d.trigger("tabsX:click", [t, e]) 8693 } 8694 }, h.ajaxSettings), p.ajax(e))) 8695 }) 8696 }) 8697 }, 8698 initCache: function() { 8699 var e = this, 8700 i = parseFloat(e.cacheTimeout); 8701 isNaN(i) && (i = 0), e.cache = { 8702 data: {}, 8703 create: function() { 8704 return (new Date).getTime() 8705 }, 8706 exist: function(t) { 8707 return !!e.cache.data[t] && e.cache.create() - e.cache.data[t] < i 8708 }, 8709 set: function(t) { 8710 e.cache.data[t] = e.cache.create() 8711 } 8712 } 8713 }, 8714 flushCache: function(t) { 8715 var i = this; 8716 "object" != typeof(t = "string" == typeof t ? [t] : t) || f(t) ? i.cache.data = {} : Object.values(t).forEach(function(e) { 8717 Object.keys(i.cache.data).forEach(function(t) { 8718 t.endsWith(e) && delete i.cache.data[t] 8719 }) 8720 }) 8721 } 8722 }, p.fn.tabsX = function(i) { 8723 var n = Array.apply(null, arguments), 8724 o = []; 8725 switch (n.shift(), this.each(function() { 8726 var t = p(this), 8727 e = t.data("tabsX"); 8728 e || (e = new s(this, p.extend(!0, {}, p.fn.tabsX.defaults, "object" == typeof i && i, p(this).data())), t.data("tabsX", e)), "string" == typeof i && o.push(e[i].apply(e, n)) 8729 }), o.length) { 8730 case 0: 8731 return this; 8732 case 1: 8733 return o[0]; 8734 default: 8735 return o 8736 } 8737 }, p.fn.tabsX.defaults = { 8738 enableCache: !0, 8739 cacheTimeout: 3e5, 8740 maxTitleLength: 9, 8741 ajaxSettings: {}, 8742 successCallback: {}, 8743 errorCallback: {}, 8744 addCss: "tabs-krajee" 8745 }, p.fn.tabsX.Constructor = s, p(document).on("ready", function() { 8746 p(".tabs-x").tabsX({}) 8747 }) 8748 }), "function" != typeof Object.create && (Object.create = function(t) { 8749 function e() {} 8750 return e.prototype = t, new e 8751 }), 8752 function(c, n) { 8753 var i = { 8754 init: function(t, e) { 8755 var i, n, o = this; 8756 o.elem = e, o.$elem = c(e), o.options = c.extend({}, c.fn.ezPlus.options, o.responsiveConfig(t || {})), o.imageSrc = o.$elem.data(o.options.attrImageZoomSrc) ? o.$elem.data(o.options.attrImageZoomSrc) : o.$elem.attr("src"), o.options.enabled && (o.options.tint && (o.options.lensColour = "none", o.options.lensOpacity = "1"), "inner" === o.options.zoomType && (o.options.showLens = !1), -1 === o.options.zoomId && (o.options.zoomId = (n = (new Date).getTime(), "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(/[xy]/g, function(t) { 8757 var e = (n + 16 * Math.random()) % 16 | 0; 8758 return n = Math.floor(n / 16), ("x" == t ? e : 3 & e | 8).toString(16) 8759 }))), o.$elem.parent().removeAttr("title").removeAttr("alt"), o.zoomImage = o.imageSrc, o.refresh(1), (i = c(o.options.gallery ? "#" + o.options.gallery : o.options.gallerySelector)).on("click.zoom", o.options.galleryItem, function(t) { 8760 if (o.options.galleryActiveClass && (c(o.options.galleryItem, i).removeClass(o.options.galleryActiveClass), c(this).addClass(o.options.galleryActiveClass)), "A" === this.tagName && t.preventDefault(), c(this).data(o.options.attrImageZoomSrc) ? o.zoomImagePre = c(this).data(o.options.attrImageZoomSrc) : o.zoomImagePre = c(this).data("image"), o.swaptheimage(c(this).data("image"), o.zoomImagePre), "A" === this.tagName) return !1 8761 })) 8762 }, 8763 refresh: function(t) { 8764 var e = this; 8765 setTimeout(function() { 8766 e.fetch(e.imageSrc) 8767 }, t || e.options.refresh) 8768 }, 8769 fetch: function(t) { 8770 var e = this, 8771 i = new Image; 8772 i.onload = function() { 8773 e.largeWidth = i.width, e.largeHeight = i.height, e.startZoom(), e.currentImage = e.imageSrc, e.options.onZoomedImageLoaded(e.$elem) 8774 }, e.setImageSource(i, t) 8775 }, 8776 setImageSource: function(t, e) { 8777 t.src = e 8778 }, 8779 startZoom: function() { 8780 var t, i = this; 8781 i.nzWidth = i.$elem.width(), i.nzHeight = i.$elem.height(), i.isWindowActive = !1, i.isLensActive = !1, i.isTintActive = !1, i.overWindow = !1, i.options.imageCrossfade && (i.zoomWrap = i.$elem.wrap('<div style="height:' + i.nzHeight + "px;width:" + i.nzWidth + 'px;" class="zoomWrapper" />'), i.$elem.css("position", "absolute")), i.zoomLock = 1, i.scrollingLock = !1, i.changeBgSize = !1, i.currentZoomLevel = i.options.zoomLevel, i.nzOffset = i.$elem.offset(), i.widthRatio = i.largeWidth / i.currentZoomLevel / i.nzWidth, i.heightRatio = i.largeHeight / i.currentZoomLevel / i.nzHeight, "window" === i.options.zoomType && (i.zoomWindowStyle = "overflow: hidden;background-position: 0px 0px;text-align:center;background-color: " + String(i.options.zoomWindowBgColour) + ";width: " + String(i.options.zoomWindowWidth) + "px;height: " + String(i.options.zoomWindowHeight) + "px;float: left;background-size: " + i.largeWidth / i.currentZoomLevel + "px " + i.largeHeight / i.currentZoomLevel + "px;display: none;z-index:100;border: " + String(i.options.borderSize) + "px solid " + i.options.borderColour + ";background-repeat: no-repeat;position: absolute;"), "inner" === i.options.zoomType && (i.zoomWindowStyle = (t = i.$elem.css("border-left-width"), "overflow: hidden;margin-left: " + String(t) + ";margin-top: " + String(t) + ";background-position: 0px 0px;width: " + String(i.nzWidth) + "px;height: " + String(i.nzHeight) + "px;float: left;display: none;cursor:" + i.options.cursor + ";border: " + String(i.options.borderSize) + "px solid " + i.options.borderColour + ";background-repeat: no-repeat;position: absolute;")), "window" === i.options.zoomType && (i.lensStyle = (i.nzHeight < i.options.zoomWindowHeight / i.heightRatio ? i.lensHeight = i.nzHeight : i.lensHeight = String(i.options.zoomWindowHeight / i.heightRatio), i.largeWidth < i.options.zoomWindowWidth ? i.lensWidth = i.nzWidth : i.lensWidth = String(i.options.zoomWindowWidth / i.widthRatio), "background-position: 0px 0px;width: " + String(i.options.zoomWindowWidth / i.widthRatio) + "px;height: " + String(i.options.zoomWindowHeight / i.heightRatio) + "px;float: right;display: none;overflow: hidden;z-index: 999;opacity:" + i.options.lensOpacity + ";filter: alpha(opacity = " + 100 * i.options.lensOpacity + "); zoom:1;
8781width:" + i.lensWidth + "px;height:" + i.lensHeight + "px;background-color:" + i.options.lensColour + ";cursor:" + i.options.cursor + ";border: " + i.options.lensBorderSize + "px solid " + i.options.lensBorderColour + ";background-repeat: no-repeat;position: absolute;")), i.tintStyle = "display: block;position: absolute;background-color: " + i.options.tintColour + ";filter:alpha(opacity=0);opacity: 0;width: " + i.nzWidth + "px;height: " + i.nzHeight + "px;", i.lensRound = "", "lens" === i.options.zoomType && (i.lensStyle = "background-position: 0px 0px;float: left;display: none;border: " + String(i.options.borderSize) + "px solid " + i.options.borderColour + ";width:" + String(i.options.lensSize) + "px;height:" + String(i.options.lensSize) + "px;background-repeat: no-repeat;position: absolute;"), "round" === i.options.lensShape && (i.lensRound = "border-top-left-radius: " + String(i.options.lensSize / 2 + i.options.borderSize) + "px;border-top-right-radius: " + String(i.options.lensSize / 2 + i.options.borderSize) + "px;border-bottom-left-radius: " + String(i.options.lensSize / 2 + i.options.borderSize) + "px;border-bottom-right-radius: " + String(i.options.lensSize / 2 + i.options.borderSize) + "px;"), i.zoomContainer = c('<div class="zoomContainer" uuid="' + i.options.zoomId + '"style="position:absolute;left:' + i.nzOffset.left + "px;top:" + i.nzOffset.top + "px;height:" + i.nzHeight + "px;width:" + i.nzWidth + "px;z-index:" + i.options.zIndex + '"></div>'), i.$elem.attr("id") && i.zoomContainer.attr("id", i.$elem.attr("id") + "-zoomContainer"), c(i.options.zoomContainerAppendTo).append(i.zoomContainer), i.options.containLensZoom && "lens" === i.options.zoomType && i.zoomContainer.css("overflow", "hidden"), "inner" !== i.options.zoomType && (i.zoomLens = c('<div class="zoomLens" style="' + i.lensStyle + i.lensRound + '"> </div>').appendTo(i.zoomContainer).click(function() { 8782 i.$elem.trigger("click") 8783 }), i.options.tint && (i.tintContainer = c("<div/>").addClass("tintContainer"), i.zoomTint = c('<div class="zoomTint" style="' + i.tintStyle + '"></div>'), i.zoomLens.wrap(i.tintContainer), i.zoomTintcss = i.zoomLens.after(i.zoomTint), i.zoomTintImage = c('<img style="position: absolute; left: 0px; top: 0px; max-width: none; width: ' + i.nzWidth + "px; height: " + i.nzHeight + 'px;" src="' + i.imageSrc + '">').appendTo(i.zoomLens).click(function() { 8784 i.$elem.trigger("click") 8785 }))); 8786 var e = isNaN(i.options.zoomWindowPosition) ? "body" : i.zoomContainer; 8787 8788 function n(t) { 8789 i.lastX === t.clientX && i.lastY === t.clientY || (i.setPosition(t), i.currentLoc = t), i.lastX = t.clientX, i.lastY = t.clientY 8790 } 8791 i.zoomWindow = c('<div style="z-index:999;left:' + i.windowOffsetLeft + "px;top:" + i.windowOffsetTop + "px;" + i.zoomWindowStyle + '" class="zoomWindow"> </div>').appendTo(e).click(function() { 8792 i.$elem.trigger("click") 8793 }), i.zoomWindowContainer = c("<div/>").addClass("zoomWindowContainer").css("width", i.options.zoomWindowWidth), i.zoomWindow.wrap(i.zoomWindowContainer), "lens" === i.options.zoomType && i.zoomLens.css("background-image", 'url("' + i.imageSrc + '")'), "window" === i.options.zoomType && i.zoomWindow.css("background-image", 'url("' + i.imageSrc + '")'), "inner" === i.options.zoomType && i.zoomWindow.css("background-image", 'url("' + i.imageSrc + '")'), i.options.touchEnabled && (i.$elem.bind("touchmove.ezpspace", function(t) { 8794 t.preventDefault(); 8795 t = t.originalEvent.touches[0] || t.originalEvent.changedTouches[0]; 8796 i.setPosition(t) 8797 }), i.zoomContainer.bind("touchmove.ezpspace", function(t) { 8798 "inner" === i.options.zoomType && i.showHideWindow("show"), t.preventDefault(); 8799 t = t.originalEvent.touches[0] || t.originalEvent.changedTouches[0]; 8800 i.setPosition(t) 8801 }), i.zoomContainer.bind("touchend.ezpspace", function(t) { 8802 i.showHideWindow("hide"), i.options.showLens && i.showHideLens("hide"), i.options.tint && "inner" !== i.options.zoomType && i.showHideTint("hide") 8803 }), i.$elem.bind("touchend.ezpspace", function(t) { 8804 i.showHideWindow("hide"), i.options.showLens && i.showHideLens("hide"), i.options.tint && "inner" !== i.options.zoomType && i.showHideTint("hide") 8805 }), i.options.showLens && (i.zoomLens.bind("touchmove.ezpspace", function(t) { 8806 t.preventDefault(); 8807 t = t.originalEvent.touches[0] || t.originalEvent.changedTouches[0]; 8808 i.setPosition(t) 8809 }), i.zoomLens.bind("touchend.ezpspace", function(t) { 8810 i.showHideWindow("hide"), i.options.showLens && i.showHideLens("hide"), i.options.tint && "inner" !== i.options.zoomType && i.showHideTint("hide") 8811 }))), i.$elem.bind("mousemove.ezpspace", function(t) { 8812 !1 === i.overWindow && i.setElements("show"), i.lastX === t.clientX && i.lastY === t.clientY || (i.setPosition(t), i.currentLoc = t), i.lastX = t.clientX, i.lastY = t.clientY 8813 }), i.zoomContainer.bind("click.ezpspace", i.options.onImageClick), i.zoomContainer.bind("mousemove.ezpspace", function(t) { 8814 !1 === i.overWindow && i.setElements("show"), n(t) 8815 }); 8816 e = null; 8817 "inner" !== i.options.zoomType && (e = i.zoomLens), i.options.tint && "inner" !== i.options.zoomType && (e = i.zoomTint), (e = "inner" === i.options.zoomType ? i.zoomWindow : e) && e.bind("mousemove.ezpspace", n), i.zoomContainer.add(i.$elem).mouseenter(function() { 8818 !1 === i.overWindow && i.setElements("show") 8819 }).mouseleave(function() { 8820 i.scrollLock || (i.setElements("hide"), i.options.onDestroy(i.$elem)) 8821 }), "inner" !== i.options.zoomType && i.zoomWindow.mouseenter(function() { 8822 i.overWindow = !0, i.setElements("hide") 8823 }).mouseleave(function() { 8824 i.overWindow = !1 8825 }), i.options.minZoomLevel ? i.minZoomLevel = i.options.minZoomLevel : i.minZoomLevel = 2 * i.options.scrollZoomIncrement, i.options.scrollZoom && i.zoomContainer.add(i.$elem).bind("wheel DOMMouseScroll MozMousePixelScroll", function(t) { 8826 i.scrollLock = !0, clearTimeout(c.data(this, "timer")), c.data(this, "timer", setTimeout(function() { 8827 i.scrollLock = !1 8828 }, 250)); 8829 var e = t.originalEvent.deltaY || -1 * t.originalEvent.detail; 8830 return t.stopImmediatePropagation(), t.stopPropagation(), t.preventDefault(), 0 < e / 120 ? i.currentZoomLevel >= i.minZoomLevel && i.changeZoomLevel(i.currentZoomLevel - i.options.scrollZoomIncrement) : (i.fullheight || i.fullwidth) && i.options.mantainZoomAspectRatio || (!i.options.maxZoomLevel || i.currentZoomLevel <= i.options.maxZoomLevel) && i.changeZoomLevel(parseFloat(i.currentZoomLevel) + i.options.scrollZoomIncrement), !1 8831 }) 8832 }, 8833 destroy: function() { 8834 this.$elem.unbind("ezpspace"), c(this.zoomContainer).remove(), this.options.loadingIcon && this.spinner && this.spinner.length && (this.spinner.remove(), delete this.spinner) 8835 }, 8836 getIdentifier: function() { 8837 return this.options.zoomId 8838 }, 8839 setElements: function(t) { 8840 var e = this; 8841 if (!e.options.zoomEnabled) return !1; 8842 "show" === t && e.isWindowSet && ("inner" === e.options.zoomType && e.showHideWindow("show"), "window" === e.options.zoomType && e.showHideWindow("show"), e.options.showLens && e.showHideLens("show"), e.options.tint && "inner" !== e.options.zoomType && e.showHideTint("show")), "hide" === t && ("window" === e.options.zoomType && e.showHideWindow("hide"), e.options.tint || e.showHideWindow("hide"), e.options.showLens && e.showHideLens("hide"), e.options.tint && e.showHideTint("hide")) 8843 }, 8844 setPosition: function(t) { 8845 var e, i, n = this; 8846 if (!n.options.zoomEnabled) return !1; 8847 n.nzHeight = n.$elem.height(), n.nzWidth = n.$elem.width(), n.nzOffset = n.$elem.offset(), n.options.tint && "inner" !== n.options.zoomType && n.zoomTint.css({ 8848 top: 0, 8849 left: 0 8850 }), n.options.responsive && !n.options.scrollZoom && n.options.showLens && (n.nzHeight < n.options.zoomWindowWidth / n.widthRatio ? n.lensHeight = n.nzHeight : n.lensHeight = String(n.options.zoomWindowHeight / n.heightRatio), n.largeWidth < n.options.zoomWindowWidth ? n.lensWidth = n.nzWidth : n.lensWidth = n.options.zoomWindowWidth / n.widthRatio, n.widthRatio = n.largeWidth /
8850n.nzWidth, n.heightRatio = n.largeHeight / n.nzHeight, "lens" !== n.options.zoomType && (n.nzHeight < n.options.zoomWindowWidth / n.widthRatio ? n.lensHeight = n.nzHeight : n.lensHeight = String(n.options.zoomWindowHeight / n.heightRatio), n.nzWidth < n.options.zoomWindowHeight / n.heightRatio ? n.lensWidth = n.nzWidth : n.lensWidth = String(n.options.zoomWindowWidth / n.widthRatio), n.zoomLens.css({ 8851 width: n.lensWidth, 8852 height: n.lensHeight 8853 }), n.options.tint && n.zoomTintImage.css({ 8854 width: n.nzWidth, 8855 height: n.nzHeight 8856 })), "lens" === n.options.zoomType && n.zoomLens.css({ 8857 width: String(n.options.lensSize) + "px", 8858 height: String(n.options.lensSize) + "px" 8859 })), n.zoomContainer.css({ 8860 top: n.nzOffset.top, 8861 left: n.nzOffset.left, 8862 width: n.nzWidth, 8863 height: n.nzHeight 8864 }), n.mouseLeft = parseInt(t.pageX - n.nzOffset.left), n.mouseTop = parseInt(t.pageY - n.nzOffset.top), "window" === n.options.zoomType && (e = n.zoomLens.height() / 2, i = n.zoomLens.width() / 2, n.Etoppos = n.mouseTop < 0 + e, n.Eboppos = n.mouseTop > n.nzHeight - e - 2 * n.options.lensBorderSize, n.Eloppos = n.mouseLeft < 0 + i, n.Eroppos = n.mouseLeft > n.nzWidth - i - 2 * n.options.lensBorderSize), "inner" === n.options.zoomType && (n.Etoppos = n.mouseTop < n.nzHeight / 2 / n.heightRatio, n.Eboppos = n.mouseTop > n.nzHeight - n.nzHeight / 2 / n.heightRatio, n.Eloppos = n.mouseLeft < 0 + n.nzWidth / 2 / n.widthRatio, n.Eroppos = n.mouseLeft > n.nzWidth - n.nzWidth / 2 / n.widthRatio - 2 * n.options.lensBorderSize), n.mouseLeft < 0 || n.mouseTop < 0 || n.mouseLeft > n.nzWidth || n.mouseTop > n.nzHeight ? n.setElements("hide") : (n.options.showLens && (n.lensLeftPos = String(Math.floor(n.mouseLeft - n.zoomLens.width() / 2)), n.lensTopPos = String(Math.floor(n.mouseTop - n.zoomLens.height() / 2))), n.Etoppos && (n.lensTopPos = 0), n.Eloppos && (n.windowLeftPos = 0, n.lensLeftPos = 0, n.tintpos = 0), "window" === n.options.zoomType && (n.Eboppos && (n.lensTopPos = Math.max(n.nzHeight - n.zoomLens.height() - 2 * n.options.lensBorderSize, 0)), n.Eroppos && (n.lensLeftPos = n.nzWidth - n.zoomLens.width() - 2 * n.options.lensBorderSize)), "inner" === n.options.zoomType && (n.Eboppos && (n.lensTopPos = Math.max(n.nzHeight - 2 * n.options.lensBorderSize, 0)), n.Eroppos && (n.lensLeftPos = n.nzWidth - n.nzWidth - 2 * n.options.lensBorderSize)), "lens" === n.options.zoomType && (n.windowLeftPos = String(-1 * ((t.pageX - n.nzOffset.left) * n.widthRatio - n.zoomLens.width() / 2)), n.windowTopPos = String(-1 * ((t.pageY - n.nzOffset.top) * n.heightRatio - n.zoomLens.height() / 2)), n.zoomLens.css("background-position", n.windowLeftPos + "px " + n.windowTopPos + "px"), n.changeBgSize && (n.nzHeight > n.nzWidth ? ("lens" === n.options.zoomType && n.zoomLens.css("background-size", n.largeWidth / n.newvalueheight + "px " + n.largeHeight / n.newvalueheight + "px"), n.zoomWindow.css("background-size", n.largeWidth / n.newvalueheight + "px " + n.largeHeight / n.newvalueheight + "px")) : ("lens" === n.options.zoomType && n.zoomLens.css("background-size", n.largeWidth / n.newvaluewidth + "px " + n.largeHeight / n.newvaluewidth + "px"), n.zoomWindow.css("background-size", n.largeWidth / n.newvaluewidth + "px " + n.largeHeight / n.newvaluewidth + "px")), n.changeBgSize = !1), n.setWindowPosition(t)), n.options.tint && "inner" !== n.options.zoomType && n.setTintPosition(t), "window" === n.options.zoomType && n.setWindowPosition(t), "inner" === n.options.zoomType && n.setWindowPosition(t), n.options.showLens && (n.fullwidth && "lens" !== n.options.zoomType && (n.lensLeftPos = 0), n.zoomLens.css({ 8865 left: n.lensLeftPos + "px", 8866 top: n.lensTopPos + "px" 8867 }))) 8868 }, 8869 showHideZoomContainer: function(t) { 8870 "show" === t && this.zoomContainer && this.zoomContainer.show(), "hide" === t && this.zoomContainer && this.zoomContainer.hide() 8871 }, 8872 showHideWindow: function(t) { 8873 var e = this; 8874 "show" === t && !e.isWindowActive && e.zoomWindow && (e.options.onShow(e), e.options.zoomWindowFadeIn ? e.zoomWindow.stop(!0, !0, !1).fadeIn(e.options.zoomWindowFadeIn) : e.zoomWindow.show(), e.isWindowActive = !0), "hide" === t && e.isWindowActive && (e.options.zoomWindowFadeOut ? e.zoomWindow.stop(!0, !0).fadeOut(e.options.zoomWindowFadeOut, function() { 8875 e.loop && (clearInterval(e.loop), e.loop = !1) 8876 }) : e.zoomWindow.hide(), e.isWindowActive = !1) 8877 }, 8878 showHideLens: function(t) { 8879 var e = this; 8880 "show" === t && (e.isLensActive || (e.options.lensFadeIn && e.zoomLens ? e.zoomLens.stop(!0, !0, !1).fadeIn(e.options.lensFadeIn) : e.zoomLens.show(), e.isLensActive = !0)), "hide" === t && e.isLensActive && (e.options.lensFadeOut ? e.zoomLens.stop(!0, !0).fadeOut(e.options.lensFadeOut) : e.zoomLens.hide(), e.isLensActive = !1) 8881 }, 8882 showHideTint: function(t) { 8883 var e = this; 8884 "show" === t && !e.isTintActive && e.zoomTint && (e.options.zoomTintFadeIn ? e.zoomTint.css("opacity", e.options.tintOpacity).animate().stop(!0, !0).fadeIn("slow") : (e.zoomTint.css("opacity", e.options.tintOpacity).animate(), e.zoomTint.show()), e.isTintActive = !0), "hide" === t && e.isTintActive && (e.options.zoomTintFadeOut ? e.zoomTint.stop(!0, !0).fadeOut(e.options.zoomTintFadeOut) : e.zoomTint.hide(), e.isTintActive = !1) 8885 }, 8886 setLensPosition: function(t) {}, 8887 setWindowPosition: function(t) { 8888 var e, i = this; 8889 if (isNaN(i.options.zoomWindowPosition)) i.externalContainer = c(i.options.zoomWindowPosition), i.externalContainer.length || (i.externalContainer = c("#" + i.options.zoomWindowPosition)), i.externalContainerWidth = i.externalContainer.width(), i.externalContainerHeight = i.externalContainer.height(), i.externalContainerOffset = i.externalContainer.offset(), i.windowOffsetTop = i.externalContainerOffset.top, i.windowOffsetLeft = i.externalContainerOffset.left; 8890 else switch (i.options.zoomWindowPosition) { 8891 case 1: 8892 i.windowOffsetTop = i.options.zoomWindowOffsetY, i.windowOffsetLeft = +i.nzWidth; 8893 break; 8894 case 2: 8895 i.options.zoomWindowHeight > i.nzHeight ? (i.windowOffsetTop = -1 * (i.options.zoomWindowHeight / 2 - i.nzHeight / 2), i.windowOffsetLeft = i.nzWidth) : c.noop(); 8896 break; 8897 case 3: 8898 i.windowOffsetTop = i.nzHeight - i.zoomWindow.height() - 2 * i.options.borderSize, i.windowOffsetLeft = i.nzWidth; 8899 break; 8900 case 4: 8901 i.windowOffsetTop = i.nzHeight, i.windowOffsetLeft = i.nzWidth; 8902 break; 8903 case 5: 8904 i.windowOffsetTop = i.nzHeight, i.windowOffsetLeft = i.nzWidth - i.zoomWindow.width() - 2 * i.options.borderSize; 8905 break; 8906 case 6: 8907 i.options.zoomWindowHeight > i.nzHeight ? (i.windowOffsetTop = i.nzHeight, i.windowOffsetLeft = -1 * (i.options.zoomWindowWidth / 2 - i.nzWidth / 2 + 2 * i.options.borderSize)) : c.noop(); 8908 break; 8909 case 7: 8910 i.windowOffsetTop = i.nzHeight, i.windowOffsetLeft = 0; 8911 break; 8912 case 8: 8913 i.windowOffsetTop = i.nzHeight, i.windowOffsetLeft = -1 * (i.zoomWindow.width() + 2 * i.options.borderSize); 8914 break; 8915 case 9: 8916 i.windowOffsetTop = i.nzHeight - i.zoomWindow.height() - 2 * i.options.borderSize, i.windowOffsetLeft = -1 * (i.zoomWindow.width() + 2 * i.options.borderSize); 8917 break; 8918 case 10: 8919 i.options.zoomWindowHeight > i.nzHeight ? (i.windowOffsetTop = -1 * (i.options.zoomWindowHeight / 2 - i.nzHeight / 2), i.windowOffsetLeft = -1 * (i.zoomWindow.width() + 2 * i.options.borderSize)) : c.noop(); 8920 break; 8921 case 11: 8922 i.windowOffsetTop = i.options.zoomWindowOffsetY, i.windowOffsetLeft = -1 * (i.zoomWindow.width() + 2 * i.options.borderSize); 8923 break; 8924 case 12: 8925 i.windowOffsetTop = -1 * (i.zoomWindow.height() + 2 * i.options.borderSize), i.windowOffsetLeft = -1 * (i.zoomWindow.width() + 2 * i.options.borderSize); 8926 break; 8927 case 13: 8928 i.windowOffsetTop = -1 * (i.zoomWindow.height() + 2 * i.options.borderSize), i.windowOffsetLeft = 0; 8929 break; 8930 case 14: 8931 i.options.zoomWindowHeight > i.nzHeight ? (i.windowOffsetTop = -1 * (i.zoomWindow.height() + 2 * i.options.borderSize), i.windowOffsetLeft = -1 * (i.options.zoomWindowWidth / 2 - i.nzWidth / 2 + 2 * i.options.borderSize)) : c.noop(); 8932 break; 8933 case 15: 8934 i.windowOffsetTop = -1 * (i.zoomWindow.height() + 2 * i.options.borderSize), i.windowOffsetLeft = i.nzWidth - i.zoomWindow.width() - 2 * i.options.borderSize; 8935 break; 8936 case 16: 8937 i.windowOffsetTop = -1 * (i.zoomWindow.height() + 2 * i.options.borderSize), i.windowOffsetLeft = i.nzWidth; 8938 break; 8939 default: 8940 i.windowOffsetTop = i.options.zoomWindowOffsetY, i.windowOffsetLeft = i.nzWidth 8941 } 8942 i.isWindowSet = !0, i.windowOffsetTop = i.windowOffsetTop + i.options.zoomWindowOffsetY, i.windowOffsetLeft = i.windowOffsetLeft + i.options.zoomWindowOffsetX, i.zoomWindow.css({ 8943 top: i.windowOffsetTop, 8944 left: i.windowOffsetLeft 8945 }), "inner" === i.options.zoomType && i.zoomWindow.css({ 8946 top: 0, 8947 left: 0 8948 }), i.windowLeftPos = String(-1 * ((t.pageX - i.nzOffset.left) * i.widthRatio - i.zoomWindow.width() / 2)), i.windowTopPos = String(-1 * ((t.pageY - i.nzOffset.top) * i.heightRatio - i.zoomWindow.height() / 2)), i.Etoppos && (i.windowTopPos = 0), i.Eloppos && (i.windowLeftPos = 0), i.Eboppos && (i.windowTopPos = -1 * (i.largeHeight / i.currentZoomLevel - i.zoomWindow.height())), i.Eroppos && (i.windowLeftPos = -1 * (i.largeWidth / i.currentZoomLevel - i.zoomWindow.width())), i.fullheight && (i.windowTopPos = 0), i.fullwidth && (i.windowLeftPos = 0), "window" !== i.options.zoomType && "inner" !== i.options.zoomType || (1 === i.zoomLock && (i.widthRatio <= 1 && (i.windowLeftPos = 0), i.heightRatio <= 1 && (i.windowTopPos = 0)), "window" === i.options.zoomType && (i.largeHeight < i.options.zoomWindowHeight && (i.windowTopPos = 0), i.largeWidth < i.options.zoomWindowWidth && (i.windowLeftPos = 0)), i.options.easing ? (i.xp || (i.xp = 0), i.yp || (i.yp = 0), e = 16, Number.isInteger(parseInt(i.options.easing)) && (e = parseInt(i.options.easing)), i.loop || (i.loop = setInterval(function() {
8949 i.xp += (i.windowLeftPos - i.xp) / i.options.easingAmount, i.yp += (i.windowTopPos - i.yp) / i.options.easingAmount, i.scrollingLock ? (clearInterval(i.loop), i.xp = i.windowLeftPos, i.yp = i.windowTopPos, i.xp = -1 * ((t.pageX - i.nzOffset.left) * i.widthRatio - i.zoomWindow.width() / 2), i.yp = -1 * ((t.pageY - i.nzOffset.top) * i.heightRatio - i.zoomWindow.height() / 2), i.changeBgSize && (i.nzHeight > i.nzWidth ? ("lens" === i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px"), i.zoomWindow.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px")) : ("lens" !== i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvalueheight + "px"), i.zoomWindow.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvaluewidth + "px")), i.changeBgSize = !1), i.zoomWindow.css("background-position", i.windowLeftPos + "px " + i.windowTopPos + "px"), i.scrollingLock = !1, i.loop = !1) : Math.round(Math.abs(i.xp - i.windowLeftPos) + Math.abs(i.yp - i.windowTopPos)) < 1 ? (clearInterval(i.loop), i.zoomWindow.css("background-position", i.windowLeftPos + "px " + i.windowTopPos + "px"), i.loop = !1) : (i.changeBgSize && (i.nzHeight > i.nzWidth ? ("lens" === i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px"), i.zoomWindow.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px")) : ("lens" !== i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvaluewidth + "px"), i.zoomWindow.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvaluewidth + "px")), i.changeBgSize = !1), i.zoomWindow.css("background-position", i.xp + "px " + i.yp + "px")) 8950 }, e))) : (i.changeBgSize && (i.nzHeight > i.nzWidth ? ("lens" === i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px"), i.zoomWindow.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px")) : ("lens" === i.options.zoomType && i.zoomLens.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvaluewidth + "px"), i.largeHeight / i.newvaluewidth < i.options.zoomWindowHeight ? i.zoomWindow.css("background-size", i.largeWidth / i.newvaluewidth + "px " + i.largeHeight / i.newvaluewidth + "px") : i.zoomWindow.css("background-size", i.largeWidth / i.newvalueheight + "px " + i.largeHeight / i.newvalueheight + "px")), i.changeBgSize = !1), i.zoomWindow.css("background-position", i.windowLeftPos + "px " + i.windowTopPos + "px"))) 8951 }, 8952 setTintPosition: function(t) { 8953 var e = this, 8954 i = e.zoomLens.width(), 8955 n = e.zoomLens.height(); 8956 e.nzOffset = e.$elem.offset(), e.tintpos = String(-1 * (t.pageX - e.nzOffset.left - i / 2)), e.tintposy = String(-1 * (t.pageY - e.nzOffset.top - n / 2)), e.Etoppos && (e.tintposy = 0), e.Eloppos && (e.tintpos = 0), e.Eboppos && (e.tintposy = -1 * (e.nzHeight - n - 2 * e.options.lensBorderSize)), e.Eroppos && (e.tintpos = -1 * (e.nzWidth - i - 2 * e.options.lensBorderSize)), e.options.tint && (e.fullheight && (e.tintposy = 0), e.fullwidth && (e.tintpos = 0), e.zoomTintImage.css({ 8957 left: e.tintpos + "px", 8958 top: e.tintposy + "px" 8959 })) 8960 }, 8961 swaptheimage: function(t, e) { 8962 var i, n = this, 8963 o = new Image; 8964 n.options.loadingIcon && !n.spinner ? (i = "background: url('" + n.options.loadingIcon + "') no-repeat center;height:" + n.nzHeight + "px;width:" + n.nzWidth + "px;z-index: 2000;position: absolute; background-position: center center;", "inner" === n.options.zoomType && (i += "top: 0px;"), n.spinner = c('<div class="ezp-spinner" style="' + i + '"></div>'), n.$elem.after(n.spinner)) : n.spinner && n.spinner.show(), n.options.onImageSwap(n.$elem), o.onload = function() { 8965 n.largeWidth = o.width, n.largeHeight = o.height, n.zoomImage = e, n.zoomWindow.css("background-size", n.largeWidth + "px " + n.largeHeight + "px"), n.swapAction(t, e) 8966 }, n.setImageSource(o, e) 8967 }, 8968 swapAction: function(t, e) { 8969 var i, n, o, s = this, 8970 a = s.$elem.width(), 8971 r = s.$elem.height(), 8972 l = new Image; 8973 l.onload = function() { 8974 s.nzHeight = l.height, s.nzWidth = l.width, s.options.onImageSwapComplete(s.$elem), s.doneCallback() 8975 }, s.setImageSource(l, t), s.currentZoomLevel = s.options.zoomLevel, s.options.maxZoomLevel = !1, "lens" === s.options.zoomType && s.zoomLens.css("background-image", 'url("' + e + '")'), "window" === s.options.zoomType && s.zoomWindow.css("background-image", 'url("' + e + '")'), "inner" === s.options.zoomType && s.zoomWindow.css("background-image", 'url("' + e + '")'), s.currentImage = e, s.options.imageCrossfade ? (i = (n = s.$elem).clone(), s.$elem.attr("src", t), s.$elem.after(i), i.stop(!0).fadeOut(s.options.imageCrossfade, function() { 8976 c(this).remove() 8977 }), s.$elem.width("auto").removeAttr("width"), s.$elem.height("auto").removeAttr("height"), n.fadeIn(s.options.imageCrossfade), s.options.tint && "inner" !== s.options.zoomType && (n = (i = s.zoomTintImage).clone(), s.zoomTintImage.attr("src", e), s.zoomTintImage.after(n), n.stop(!0).fadeOut(s.options.imageCrossfade, function() { 8978 c(this).remove() 8979 }), i.fadeIn(s.options.imageCrossfade), s.zoomTint.css({ 8980 height: r, 8981 width: a 8982 })), s.zoomContainer.css({ 8983 height: r, 8984 width: a 8985 }), "inner" === s.options.zoomType && (s.options.constrainType || (s.zoomWrap.parent().css({ 8986 height: r, 8987 width: a 8988 }), s.zoomWindow.css({ 8989 height: r, 8990 width: a 8991 })))) : (s.$elem.attr("src", t), s.options.tint && (s.zoomTintImage.attr("src", e), s.zoomTintImage.attr("height", r), s.zoomTintImage.css("height", r), s.zoomTint.css("height", r)), s.zoomContainer.css({ 8992 height: r, 8993 width: a 8994 })), s.options.imageCrossfade && s.zoomWrap.css({ 8995 height: r, 8996 width: a 8997 }), s.options.constrainType && ("height" === s.options.constrainType && (o = { 8998 height: s.options.constrainSize, 8999 width: "auto" 9000 }, s.zoomContainer.css(o), s.options.imageCrossfade ? (s.zoomWrap.css(o), s.constwidth = s.zoomWrap.width()) : (s.$elem.css(o), s.constwidth = a), o = { 9001 height: s.options.constrainSize, 9002 width: s.constwidth 9003 }, "inner" === s.options.zoomType && (s.zoomWrap.parent().css(o), s.zoomWindow.css(o)), s.options.tint && (s.tintContainer.css(o), s.zoomTint.css(o), s.zoomTintImage.css(o))), "width" === s.options.constrainType && (o = { 9004 height: "auto", 9005 width: s.options.constrainSize 9006 }, s.zoomContainer.css(o), s.options.imageCrossfade ? (s.zoomWrap.css(o), s.constheight = s.zoomWrap.height()) : (s.$elem.css(o), s.constheight = r), r = { 9007 height: s.constheight, 9008 width: s.options.constrainSize 9009 }, "inner" === s.options.zoomType && (s.zoomWrap.parent().css(r), s.zoomWindow.css(r)), s.options.tint && (s.tintContainer.css(r), s.zoomTint.css(r), s.zoomTintImage.css(r)))) 9010 }, 9011 doneCallback: function() { 9012 var t = this; 9013 t.options.loadingIcon && t.spinner && t.spinner.length && t.spinner.hide(), t.nzOffset = t.$elem.offset(), t.nzWidth = t.$elem.width(), t.nzHeight = t.$elem.height(), t.currentZoomLevel = t.options.zoomLevel, t.widthRatio = t.largeWidth / t.nzWidth, t.heightRatio = t.largeHeight / t.nzHeight, "window" === t.options.zoomType && (t.nzHeight < t.options.zoomWindowHeight / t.heightRatio ? t.lensHeight = t.nzHeight : t.lensHeight = String(t.options.zoomWindowHeight / t.heightRatio), t.nzWidth < t.options.zoomWindowWidth ? t.lensWidth = t.nzWidth : t.lensWidth = t.options.zoomWindowWidth / t.widthRatio, t.zoomLens && t.zoomLens.css({ 9014 width: t.lensWidth, 9015 height: t.lensHeight 9016 })) 9017 }, 9018 getCurrentImage: function() { 9019 return this.zoomImage 9020 }, 9021 getGalleryList: function() { 9022 var e = this; 9023 return e.gallerylist = [], e.options.gallery ? c("#" + e.options.gallery + " a").each(function() { 9024 var t = ""; 9025 c(this).data(e.options.attrImageZoomSrc) ? t = c(this).data(e.options.attrImageZoomSrc) : c(this).data("image") && (t = c(this).data("image")), t === e.zoomImage ? e.gallerylist.unshift({ 9026 href: "" + t, 9027 title: c(this).find("img").attr("title") 9028 }) : e.gallerylist.push({ 9029 href: "" + t, 9030 title: c(this).find("img").attr("title") 9031 }) 9032 }) : e.gallerylist.push({ 9033 href: "" + e.zoomImage, 9034 title: c(this).find("img").attr("title") 9035 }), e.gallerylist 9036 }, 9037 changeZoomLevel: function(t) { 9038 var e = this; 9039 e.scrollingLock = !0, e.newvalue = parseFloat(t).toFixed(2); 9040 var i = e.newvalue, 9041 n = e.largeHeight / (e.options.zoomWindowHeight / e.nzHeight * e.nzHeight), 9042 t = e.largeWidth / (e.options.zoomWindowWidth / e.nzWidth * e.
9042nzWidth); 9043 "inner" !== e.options.zoomType && (n <= i ? (e.heightRatio = e.largeHeight / n / e.nzHeight, e.newvalueheight = n, e.fullheight = !0) : (e.heightRatio = e.largeHeight / i / e.nzHeight, e.newvalueheight = i, e.fullheight = !1), t <= i ? (e.widthRatio = e.largeWidth / t / e.nzWidth, e.newvaluewidth = t, e.fullwidth = !0) : (e.widthRatio = e.largeWidth / i / e.nzWidth, e.newvaluewidth = i, e.fullwidth = !1), "lens" === e.options.zoomType && (n <= i ? (e.fullwidth = !0, e.newvaluewidth = n) : (e.widthRatio = e.largeWidth / i / e.nzWidth, e.newvaluewidth = i, e.fullwidth = !1))), "inner" === e.options.zoomType && ((n = parseFloat(e.largeHeight / e.nzHeight).toFixed(2)) <= (i = (t = parseFloat(e.largeWidth / e.nzWidth).toFixed(2)) < (i = n < i ? n : i) ? t : i) ? (e.heightRatio = e.largeHeight / i / e.nzHeight, e.newvalueheight = n < i ? n : i, e.fullheight = !0) : (e.heightRatio = e.largeHeight / i / e.nzHeight, e.newvalueheight = n < i ? n : i, e.fullheight = !1), t <= i ? (e.widthRatio = e.largeWidth / i / e.nzWidth, e.newvaluewidth = t < i ? t : i, e.fullwidth = !0) : (e.widthRatio = e.largeWidth / i / e.nzWidth, e.newvaluewidth = i, e.fullwidth = !1)); 9044 i = !1; 9045 "inner" === e.options.zoomType && (e.nzWidth >= e.nzHeight && (e.newvaluewidth <= t ? i = !0 : (e.fullheight = !(i = !1), e.fullwidth = !0)), e.nzHeight > e.nzWidth && (e.newvaluewidth <= t ? i = !0 : (e.fullheight = !(i = !1), e.fullwidth = !0))), (i = "inner" !== e.options.zoomType ? !0 : i) && (e.zoomLock = 0, e.changeZoom = !0, e.options.zoomWindowHeight / e.heightRatio <= e.nzHeight && (e.currentZoomLevel = e.newvalueheight, "lens" !== e.options.zoomType && "inner" !== e.options.zoomType && (e.changeBgSize = !0, e.zoomLens.css("height", String(e.options.zoomWindowHeight / e.heightRatio) + "px")), "lens" !== e.options.zoomType && "inner" !== e.options.zoomType || (e.changeBgSize = !0)), e.options.zoomWindowWidth / e.widthRatio <= e.nzWidth && ("inner" !== e.options.zoomType && e.newvaluewidth > e.newvalueheight && (e.currentZoomLevel = e.newvaluewidth), "lens" !== e.options.zoomType && "inner" !== e.options.zoomType && (e.changeBgSize = !0, e.zoomLens.css("width", String(e.options.zoomWindowWidth / e.widthRatio) + "px")), "lens" !== e.options.zoomType && "inner" !== e.options.zoomType || (e.changeBgSize = !0)), "inner" === e.options.zoomType && (e.changeBgSize = !0, (e.nzWidth > e.nzHeight || e.nzHeight >= e.nzWidth) && (e.currentZoomLevel = e.newvaluewidth))), e.setPosition(e.currentLoc) 9046 }, 9047 closeAll: function() { 9048 this.zoomWindow && this.zoomWindow.hide(), this.zoomLens && this.zoomLens.hide(), this.zoomTint && this.zoomTint.hide() 9049 }, 9050 changeState: function(t) { 9051 "enable" === t && (this.options.zoomEnabled = !0), "disable" === t && (this.options.zoomEnabled = !1) 9052 }, 9053 responsiveConfig: function(t) { 9054 return t.respond && 0 < t.respond.length ? c.extend({}, t, this.configByScreenWidth(t)) : t 9055 }, 9056 configByScreenWidth: function(t) { 9057 var e = c(n).width(), 9058 i = c.grep(t.respond, function(t) { 9059 t = t.range.split("-"); 9060 return e >= t[0] && e <= t[1] 9061 }); 9062 return 0 < i.length ? i[0] : t 9063 } 9064 }; 9065 c.fn.ezPlus = function(e) { 9066 return this.each(function() { 9067 var t = Object.create(i); 9068 t.init(e, this), c.data(this, "ezPlus", t) 9069 }) 9070 }, c.fn.ezPlus.options = { 9071 attrImageZoomSrc: "zoom-image", 9072 borderColour: "#888", 9073 borderSize: 4, 9074 constrainSize: !1, 9075 constrainType: !1, 9076 containLensZoom: !1, 9077 cursor: "inherit", 9078 debug: !1, 9079 easing: !1, 9080 easingAmount: 12, 9081 enabled: !0, 9082 gallery: !1, 9083 galleryActiveClass: "zoomGalleryActive", 9084 gallerySelector: !1, 9085 galleryItem: "a", 9086 imageCrossfade: !1, 9087 lensBorderColour: "#000", 9088 lensBorderSize: 1, 9089 lensColour: "white", 9090 lensFadeIn: !1, 9091 lensFadeOut: !1, 9092 lensOpacity: .4, 9093 lensShape: "square", 9094 lensSize: 200, 9095 lenszoom: !1, 9096 loadingIcon: !1, 9097 mantainZoomAspectRatio: !1, 9098 maxZoomLevel: !1, 9099 minZoomLevel: !1, 9100 onComplete: c.noop, 9101 onDestroy: c.noop, 9102 onImageClick: c.noop, 9103 onImageSwap: c.noop, 9104 onImageSwapComplete: c.noop, 9105 onShow: c.noop, 9106 onZoomedImageLoaded: c.noop, 9107 preloading: 1, 9108 respond: [], 9109 responsive: !0, 9110 scrollZoom: !1, 9111 scrollZoomIncrement: .1, 9112 showLens: !0, 9113 tint: !1, 9114 tintColour: "#333", 9115 tintOpacity: .4, 9116 touchEnabled: !0, 9117 zoomActivation: "hover", 9118 zoomContainerAppendTo: "body", 9119 zoomId: -1, 9120 zoomLevel: 1, 9121 zoomTintFadeIn: !1, 9122 zoomTintFadeOut: !1, 9123 zoomType: "window", 9124 zoomWindowAlwaysShow: !1, 9125 zoomWindowBgColour: "#fff", 9126 zoomWindowFadeIn: !1, 9127 zoomWindowFadeOut: !1, 9128 zoomWindowHeight: 400, 9129 zoomWindowOffsetX: 0, 9130 zoomWindowOffsetY: 0, 9131 zoomWindowPosition: 1, 9132 zoomWindowWidth: 400, 9133 zoomEnabled: !0, 9134 zIndex: 999 9135 } 9136 }(jQuery, window, document), 9137 function(t, e) { 9138 "object" == typeof exports && "undefined" != typeof module ? module.exports = e(require("jquery")) : "function" == typeof define && define.amd ? define(["jquery"], e) : (t = t || self).BootstrapTable = e(t.jQuery) 9139 }(this, function(N) { 9140 "use strict"; 9141 N = N && Object.prototype.hasOwnProperty.call(N, "default") ? N.default : N; 9142 var t = "undefined" != typeof globalThis ? globalThis : "undefined" != typeof window ? window : "undefined" != typeof global ? global : "undefined" != typeof self ? self : {}; 9143 9144 function e(t, e) { 9145 return t(e = { 9146 exports: {} 9147 }, e.exports), e.exports 9148 } 9149 9150 function c(t) { 9151 try { 9152 return !!t() 9153 } catch (t) { 9154 return !0 9155 } 9156 } 9157 9158 function m(t, e) { 9159 return { 9160 enumerable: !(1 & t), 9161 configurable: !(2 & t), 9162 writable: !(4 & t), 9163 value: e 9164 } 9165 } 9166 9167 function d(t) { 9168 return C(b(t)) 9169 } 9170 9171 function n(t) { 9172 return _ ? x.createElement(t) : {} 9173 } 9174 9175 function u(e, i) { 9176 try { 9177 O(h, e, i) 9178 } catch (t) { 9179 h[e] = i 9180 } 9181 return i 9182 } 9183 var i = function(t) { 9184 return t && t.Math == Math && t 9185 }, 9186 h = i("object" == typeof globalThis && globalThis) || i("object" == typeof window && window) || i("object" == typeof self && self) || i("object" == typeof t && t) || Function("return this")(), 9187 p = !c(function() { 9188 return 7 != Object.defineProperty({}, "a", { 9189 get: function() { 9190 return 7 9191 } 9192 }).a 9193 }), 9194 o = {}.propertyIsEnumerable, 9195 s = Object.getOwnPropertyDescriptor, 9196 f = { 9197 f: s && !o.call({ 9198 1: 2 9199 }, 1) ? function(t) { 9200 t = s(this, t); 9201 return !!t && t.enumerable 9202 } : o 9203 }, 9204 a = {}.toString, 9205 r = function(t) { 9206 return a.call(t).slice(8, -1) 9207 }, 9208 l = "".split, 9209 C = c(function() { 9210 return !Object("z").propertyIsEnumerable(0) 9211 }) ? function(t) { 9212 return "String" == r(t) ? l.call(t, "") : Object(t) 9213 } : Object, 9214 b = function(t) { 9215 if (null == t) throw TypeError("Can't call method on " + t); 9216 return t 9217 }, 9218 g = function(t) { 9219 return "object" == typeof t ? null !== t : "function" == typeof t 9220 }, 9221 v = function(t, e) { 9222 if (!g(t)) return t; 9223 var i, n; 9224 if (e && "function" == typeof(i = t.toString) && !g(n = i.call(t))) return n; 9225 if ("function" == typeof(i = t.valueOf) && !g(n = i.call(t))) return n; 9226 if (!e && "function" == typeof(i = t.toString) && !g(n = i.call(t))) return n; 9227 throw TypeError("Can't convert object to primitive value") 9228 }, 9229 y = {}.hasOwnProperty, 9230 w = function(t, e) {
9231 return y.call(t, e) 9232 }, 9233 x = h.document, 9234 _ = g(x) && g(x.createElement), 9235 S = !p && !c(function() { 9236 return 7 != Object.defineProperty(n("div"), "a", { 9237 get: function() { 9238 return 7 9239 } 9240 }).a 9241 }), 9242 T = Object.getOwnPropertyDescriptor, 9243 $ = { 9244 f: p ? T : function(t, e) { 9245 if (t = d(t), e = v(e, !0), S) try { 9246 return T(t, e) 9247 } catch (t) {} 9248 if (w(t, e)) return m(!f.f.call(t, e), t[e]) 9249 } 9250 }, 9251 E = function(t) { 9252 if (!g(t)) throw TypeError(String(t) + " is not an object"); 9253 return t 9254 }, 9255 k = Object.defineProperty, 9256 I = { 9257 f: p ? k : function(t, e, i) { 9258 if (E(t), e = v(e, !0), E(i), S) try { 9259 return k(t, e, i) 9260 } catch (t) {} 9261 if ("get" in i || "set" in i) throw TypeError("Accessors not supported"); 9262 return "value" in i && (t[e] = i.value), t 9263 } 9264 }, 9265 O = p ? function(t, e, i) { 9266 return I.f(t, e, m(1, i)) 9267 } : function(t, e, i) { 9268 return t[e] = i, t 9269 }, 9270 z = "__core-js_shared__", 9271 A = h[z] || u(z, {}), 9272 P = Function.toString; 9273 "function" != typeof A.inspectSource && (A.inspectSource = function(t) { 9274 return P.call(t) 9275 }); 9276 9277 function D(t) { 9278 return "Symbol(" + String(void 0 === t ? "" : t) + ")_" + (++Y + X).toString(36) 9279 } 9280 var L, M, H, j, B, R, W, F, q = A.inspectSource, 9281 V = h.WeakMap, 9282 U = "function" == typeof V && /native code/.test(q(V)), 9283 G = e(function(t) { 9284 (t.exports = function(t, e) { 9285 return A[t] || (A[t] = void 0 !== e ? e : {}) 9286 })("versions", []).push({ 9287 version: "3.6.0", 9288 mode: "global", 9289 copyright: "© 2019 Denis Pushkarev (zloirock.ru)" 9290 }) 9291 }), 9292 Y = 0, 9293 X = Math.random(), 9294 K = G("keys"), 9295 Z = function(t) { 9296 return K[t] || (K[t] = D(t)) 9297 }, 9298 Q = {}, 9299 J = h.WeakMap; 9300 W = U ? (L = new J, M = L.get, H = L.has, j = L.set, B = function(t, e) { 9301 return j.call(L, t, e), e 9302 }, R = function(t) { 9303 return M.call(L, t) || {} 9304 }, function(t) { 9305 return H.call(L, t) 9306 }) : (F = Z("state"), Q[F] = !0, B = function(t, e) { 9307 return O(t, F, e), e 9308 }, R = function(t) { 9309 return w(t, F) ? t[F] : {} 9310 }, function(t) { 9311 return w(t, F) 9312 }); 9313 9314 function tt(t) { 9315 return "function" == typeof t ? t : void 0 9316 } 9317 9318 function et(t) { 9319 return 0 < t ? vt(gt(t), 9007199254740991) : 0 9320 } 9321 9322 function it(t, e) { 9323 return (t = gt(t)) < 0 ? bt(t + e, 0) : yt(t, e) 9324 } 9325 9326 function nt(t, e) { 9327 var i, n = d(t), 9328 o = 0, 9329 s = []; 9330 for (i in n) !w(Q, i) && w(n, i) && s.push(i); 9331 for (; e.length > o;) w(n, i = e[o++]) && (~wt(s, i) || s.push(i)); 9332 return s 9333 } 9334 9335 function ot(t, e) { 9336 for (var i = Tt(e), n = I.f, o = $.f, s = 0; s < i.length; s++) { 9337 var a = i[s]; 9338 w(t, a) || n(t, a, o(e, a)) 9339 } 9340 } 9341 9342 function st(t, e) { 9343 var i, n, o, s, a = t.target, 9344 r = t.global, 9345 l = t.stat; 9346 if (i = r ? h : l ? h[a] || u(a, {}) : (h[a] || {}).prototype) 9347 for (n in e) { 9348 if (o = e[n], s = t.noTargetGet ? (s = At(i, n)) && s.value : i[n], !zt(r ? n : a + (l ? "." : "#") + n, t.forced) && void 0 !== s) { 9349 if (typeof o == typeof s) continue; 9350 ot(o, s) 9351 }(t.sham || s && s.sham) && O(o, "sham", !0), ut(i, n, o, t) 9352 } 9353 } 9354 9355 function at(t) { 9356 return Object(b(t)) 9357 } 9358 9359 function rt() {} 9360 9361 function lt(t) { 9362 return "<script>" + t + "<\/script>" 9363 } 9364 var ct, dt = { 9365 set: B, 9366 get: R, 9367 has: W, 9368 enforce: function(t) { 9369 return W(t) ? R(t) : B(t, {}) 9370 }, 9371 getterFor: function(i) { 9372 return function(t) { 9373 var e; 9374 if (!g(t) || (e = R(t)).type !== i) throw TypeError("Incompatible receiver, " + i + " required"); 9375 return e 9376 } 9377 } 9378 }, 9379 ut = e(function(t) { 9380 var e = dt.get, 9381 a = dt.enforce, 9382 r = String(String).split("String"); 9383 (t.exports = function(t, e, i, n) { 9384 var o = !!n && !!n.unsafe, 9385 s = !!n && !!n.enumerable, 9386 n = !!n && !!n.noTargetGet; 9387 "function" == typeof i && ("string" != typeof e || w(i, "name") || O(i, "name", e), a(i).source = r.join("string" == typeof e ? e : "")), t !== h ? (o ? !n && t[e] && (s = !0) : delete t[e], s ? t[e] = i : O(t, e, i)) : s ? t[e] = i : u(e, i) 9388 })(Function.prototype, "toString", function() { 9389 return "function" == typeof this && e(this).source || q(this) 9390 }) 9391 }), 9392 ht = h, 9393 pt = function(t, e) { 9394 return arguments.length < 2 ? tt(ht[t]) || tt(h[t]) : ht[t] && ht[t][e] || h[t] && h[t][e] 9395 },
9396 ft = Math.ceil, 9397 mt = Math.floor, 9398 gt = function(t) { 9399 return isNaN(t = +t) ? 0 : (0 < t ? mt : ft)(t) 9400 }, 9401 vt = Math.min, 9402 bt = Math.max, 9403 yt = Math.min, 9404 i = function(r) { 9405 return function(t, e, i) { 9406 var n, o = d(t), 9407 s = et(o.length), 9408 a = it(i, s); 9409 if (r && e != e) { 9410 for (; a < s;) 9411 if ((n = o[a++]) != n) return !0 9412 } else 9413 for (; a < s; a++) 9414 if ((r || a in o) && o[a] === e) return r || a || 0; 9415 return !r && -1 9416 } 9417 }, 9418 t = { 9419 includes: i(!0), 9420 indexOf: i(!1) 9421 }, 9422 wt = t.indexOf, 9423 Ct = ["constructor", "hasOwnProperty", "isPrototypeOf", "propertyIsEnumerable", "toLocaleString", "toString", "valueOf"], 9424 xt = Ct.concat("length", "prototype"), 9425 _t = { 9426 f: Object.getOwnPropertyNames || function(t) { 9427 return nt(t, xt) 9428 } 9429 }, 9430 St = { 9431 f: Object.getOwnPropertySymbols 9432 }, 9433 Tt = pt("Reflect", "ownKeys") || function(t) { 9434 var e = _t.f(E(t)), 9435 i = St.f; 9436 return i ? e.concat(i(t)) : e 9437 }, 9438 $t = /#|\.prototype\./, 9439 o = function(t, e) { 9440 t = kt[Et(t)]; 9441 return t == Ot || t != It && ("function" == typeof e ? c(e) : !!e) 9442 }, 9443 Et = o.normalize = function(t) { 9444 return String(t).replace($t, ".").toLowerCase() 9445 }, 9446 kt = o.data = {}, 9447 It = o.NATIVE = "N", 9448 Ot = o.POLYFILL = "P", 9449 zt = o, 9450 At = $.f, 9451 Pt = !!Object.getOwnPropertySymbols && !c(function() { 9452 return !String(Symbol()) 9453 }), 9454 z = Pt && !Symbol.sham && "symbol" == typeof Symbol(), 9455 Dt = Array.isArray || function(t) { 9456 return "Array" == r(t) 9457 }, 9458 Lt = Object.keys || function(t) { 9459 return nt(t, Ct) 9460 }, 9461 Mt = p ? Object.defineProperties : function(t, e) { 9462 E(t); 9463 for (var i, n = Lt(e), o = n.length, s = 0; s < o;) I.f(t, i = n[s++], e[i]); 9464 return t 9465 }, 9466 Nt = pt("document", "documentElement"), 9467 Ht = Z("IE_PROTO"), 9468 jt = function() { 9469 try { 9470 ct = document.domain && new ActiveXObject("htmlfile") 9471 } catch (t) {} 9472 var t, e; 9473 jt = ct ? function(t) { 9474 t.write(lt("")), t.close(); 9475 var e = t.parentWindow.Object; 9476 return t = null, e 9477 }(ct) : ((e = n("iframe")).style.display = "none", Nt.appendChild(e), e.src = String("javascript:"), (t = e.contentWindow.document).open(), t.write(lt("document.F=Object")), t.close(), t.F); 9478 for (var i = Ct.length; i--;) delete jt.prototype[Ct[i]]; 9479 return jt() 9480 }; 9481 Q[Ht] = !0; 9482 9483 function Bt(t) { 9484 return w(te, t) || (Pt && w(ee, t) ? te[t] = ee[t] : te[t] = ie("Symbol." + t)), te[t] 9485 } 9486 9487 function Rt(t) { 9488 var e = ht.Symbol || (ht.Symbol = {}); 9489 w(e, t) || oe(e, t, { 9490 value: ne.f(t) 9491 }) 9492 } 9493 9494 function Wt(t, e, i) { 9495 t && !w(t = i ? t : t.prototype, ae) && se(t, ae, { 9496 configurable: !0, 9497 value: e 9498 }) 9499 } 9500 9501 function Ft(t) { 9502 if ("function" != typeof t) throw TypeError(String(t) + " is not a function"); 9503 return t 9504 } 9505 9506 function qt(t, e) { 9507 var i; 9508 return new(void 0 === (i = Dt(t) && ("function" == typeof(i = t.constructor) && (i === Array || Dt(i.prototype)) || g(i) && null === (i = i[re])) ? void 0 : i) ? Array : i)(0 === e ? 0 : e) 9509 } 9510 9511 function Vt(t, e) { 9512 var i = Ce[t] = Kt(me.prototype); 9513 return he(i, { 9514 type: ue, 9515 tag: t, 9516 description: e 9517 }), p || (i.description = e), i 9518 } 9519 9520 function Ut(t, e, i) { 9521 return t === fe && Ut(xe, e, i), E(t), e = v(e, !0), E(i), w(Ce, e) ? (i.enumerable ? (w(t, de) && t[de][e] && (t[de][e] = !1), i = Kt(i, { 9522 enumerable: m(0, !1) 9523 })) : (w(t, de) || be(t, de, m(1, {})), t[de][e] = !0), $e(t, e, i)) : be(t, e, i) 9524 } 9525 9526 function Gt(e, t) { 9527 E(e); 9528 var i = d(t), 9529 t = Lt(i).concat(Xt(i)); 9530 return ce(t, function(t) { 9531 p && !Yt.call(i, t) || Ut(e, t, i[t]) 9532 }), e 9533 } 9534 9535 function Yt(t) { 9536 var e = v(t, !0), 9537 t = we.call(this, e); 9538 return !(this === fe && w(Ce, e) && !w(xe, e)) && (!(t || !w(this, e) || !w(Ce, e) || w(this, de) && this[de][e]) || t) 9539 } 9540 9541 function Xt(t) { 9542 var e = t === fe, 9543 t = ye(e ? xe : d(t)), 9544 i = []; 9545 return ce(t, function(t) { 9546 !w(Ce, t) || e && !w(fe, t) || i.push(Ce[t]) 9547 }), i 9548 } 9549 var Kt = Object.create || function(t, e) { 9550 var i; 9551 return null !== t ? (rt.prototype = E(t), i = new rt, rt.prototype = null, i[Ht] = t)
9551: i = jt(), void 0 === e ? i : Mt(i, e) 9552 }, 9553 Zt = _t.f, 9554 Qt = {}.toString, 9555 Jt = "object" == typeof window && window && Object.getOwnPropertyNames ? Object.getOwnPropertyNames(window) : [], 9556 V = { 9557 f: function(t) { 9558 return Jt && "[object Window]" == Qt.call(t) ? function(t) { 9559 try { 9560 return Zt(t) 9561 } catch (t) { 9562 return Jt.slice() 9563 } 9564 }(t) : Zt(d(t)) 9565 } 9566 }, 9567 te = G("wks"), 9568 ee = h.Symbol, 9569 ie = z ? ee : D, 9570 ne = { 9571 f: Bt 9572 }, 9573 oe = I.f, 9574 se = I.f, 9575 ae = Bt("toStringTag"), 9576 re = Bt("species"), 9577 le = [].push, 9578 U = function(f) { 9579 var m = 1 == f, 9580 g = 2 == f, 9581 v = 3 == f, 9582 b = 4 == f, 9583 y = 6 == f, 9584 w = 5 == f || y; 9585 return function(t, e, i, n) { 9586 for (var o, s, a, r, l = at(t), c = C(l), d = (r = i, Ft(a = e), void 0 === r ? a : function(t, e, i) { 9587 return a.call(r, t, e, i) 9588 }), u = et(c.length), h = 0, n = n || qt, p = m ? n(t, u) : g ? n(t, 0) : void 0; h < u; h++) 9589 if ((w || h in c) && (s = d(o = c[h], h, l), f)) 9590 if (m) p[h] = s; 9591 else if (s) switch (f) { 9592 case 3: 9593 return !0; 9594 case 5: 9595 return o; 9596 case 6: 9597 return h; 9598 case 2: 9599 le.call(p, o) 9600 } else if (b) return !1; 9601 return y ? -1 : v || b ? b : p 9602 } 9603 }, 9604 J = { 9605 forEach: U(0), 9606 map: U(1), 9607 filter: U(2), 9608 some: U(3), 9609 every: U(4), 9610 find: U(5), 9611 findIndex: U(6) 9612 }, 9613 ce = J.forEach, 9614 de = Z("hidden"), 9615 ue = "Symbol", 9616 i = Bt("toPrimitive"), 9617 he = dt.set, 9618 pe = dt.getterFor(ue), 9619 fe = Object.prototype, 9620 me = h.Symbol, 9621 ge = pt("JSON", "stringify"), 9622 ve = $.f, 9623 be = I.f, 9624 ye = V.f, 9625 we = f.f, 9626 Ce = G("symbols"), 9627 xe = G("op-symbols"), 9628 _e = G("string-to-symbol-registry"), 9629 Se = G("symbol-to-string-registry"), 9630 o = G("wks"), 9631 U = h.QObject, 9632 Te = !U || !U.prototype || !U.prototype.findChild, 9633 $e = p && c(function() { 9634 return 7 != Kt(be({}, "a", { 9635 get: function() { 9636 return be(this, "a", { 9637 value: 7 9638 }).a 9639 } 9640 })).a 9641 }) ? function(t, e, i) { 9642 var n = ve(fe, e); 9643 n && delete fe[e], be(t, e, i), n && t !== fe && be(fe, e, n) 9644 } : be, 9645 Ee = Pt && "symbol" == typeof me.iterator ? function(t) { 9646 return "symbol" == typeof t 9647 } : function(t) { 9648 return Object(t) instanceof me 9649 }, 9650 G = function(t, e) { 9651 var i = d(t), 9652 t = v(e, !0); 9653 if (i !== fe || !w(Ce, t) || w(xe, t)) { 9654 e = ve(i, t); 9655 return !e || !w(Ce, t) || w(i, de) && i[de][t] || (e.enumerable = !0), e 9656 } 9657 }, 9658 U = function(t) { 9659 var t = ye(d(t)), 9660 e = []; 9661 return ce(t, function(t) { 9662 w(Ce, t) || w(Q, t) || e.push(t) 9663 }), e 9664 }; 9665 Pt || (ut((me = function() { 9666 if (this instanceof me) throw TypeError("Symbol is not a constructor"); 9667 var t = arguments.length && void 0 !== arguments[0] ? String(arguments[0]) : void 0, 9668 e = D(t), 9669 i = function(t) { 9670 this === fe && i.call(xe, t), w(this, de) && w(this[de], e) && (this[de][e] = !1), $e(this, e, m(1, t)) 9671 }; 9672 return p && Te && $e(fe, e, { 9673 configurable: !0, 9674 set: i 9675 }), Vt(e, t) 9676 }).prototype, "toString", function() { 9677 return pe(this).tag 9678 }), f.f = Yt, I.f = Ut, $.f = G, _t.f = V.f = U, St.f = Xt, p && (be(me.prototype, "description", { 9679 configurable: !0, 9680 get: function() { 9681 return pe(this).description 9682 } 9683 }), ut(fe, "propertyIsEnumerable", Yt, { 9684 unsafe: !0 9685 }))), z || (ne.f = function(t) { 9686 return Vt(Bt(t), t) 9687 }), st({ 9688 global: !0, 9689 wrap: !0, 9690 forced: !Pt, 9691 sham: !Pt 9692 }, { 9693 Symbol: me 9694 }), ce(Lt(o), function(t) { 9695 Rt(t) 9696 }), st({ 9697 target: ue, 9698 stat: !0, 9699 forced: !Pt 9700 }, { 9701 for: function(t) { 9702 var e = String(t); 9703 if (w(_e, e)) return _e[e]; 9704 t = me(e); 9705 return _e[e] = t, Se[t] = e, t 9706 }, 9707 keyFor: function(t) { 9708 if (!Ee(t)) throw TypeError(t + " is not a symbol"); 9709 if (w(Se, t)) return Se[t] 9710 }, 9711 useSetter: function() { 9712 Te = !0 9713 }, 9714 useSimple: function() { 9715 Te = !1 9716 } 9717 }), st({ 9718 target: "Object", 9719 stat: !0, 9720 forced: !Pt, 9721 sham: !p 9722 }, { 9723 create: function(t, e) { 9724 return void 0 === e ? Kt(t) : Gt(Kt(t), e) 9725 }, 9726 defineProperty: Ut, 9727 defineProperties: Gt, 9728 getOwnPropertyDescriptor: G 9729 }), st({ 9730 target: "Object", 9731 stat: !0, 9732 forced: !Pt 9733 }, { 9734 getOwnPropertyNames: U, 9735 getOwnPropertySymbols: Xt 9736 }), st({ 9737 target: "Object", 9738 stat: !0, 9739 forced: c(function() { 9740 St.f(1) 9741 }) 9742 }, { 9743 getOwnPropertySymbols: function(t) { 9744 return St.f(at(t)) 9745 } 9746 }), ge && (U = !Pt || c(function() { 9747 var t = me(); 9748 return "[null]" != ge([t]) || "{}" != ge({ 9749 a: t 9750 }) || "{}" != ge(Object(t)) 9751 }), st({ 9752 target: "JSON", 9753 stat: !0, 9754 forced: U 9755 }, { 9756 stringify: function(t, e, i) { 9757 for (var n, o = [t], s = 1; s < arguments.length;) o.push(arguments[s++]); 9758 if ((g(n = e) || void 0 !== t) && !Ee(t)) return Dt(e) || (e = function(t, e) { 9759 if ("function" == typeof n && (e = n.call(this, t, e)), !Ee(e)) return e 9760 }), o[1] = e, ge.apply(null, o) 9761 } 9762 })), me.prototype[i] || O(me.prototype, i, me.prototype.valueOf), Wt(me, ue), Q[de] = !0; 9763 var ke, Ie, Oe, ze, Ae, i = I.f, 9764 Pe = h.Symbol; 9765 !p || "function" != typeof Pe || "description" in Pe.prototype && void 0 === Pe().description || (ke = {}, ot(Ie = function() { 9766 var t = arguments.length < 1 || void 0 === arguments[0] ? void 0 : String(arguments[0]), 9767 e = this instanceof Ie ? new Pe(t) : void 0 === t ? Pe() : Pe(t); 9768 return "" === t && (ke[e] = !0), e 9769 }, Pe), (Le = Ie.prototype = Pe.prototype).constructor = Ie, Oe = Le.toString, ze = "Symbol(test)" == String(Pe("test")), Ae = /^Symbol\((.*)\)[^)]+$/, i(Le, "description", {
9770 configurable: !0, 9771 get: function() { 9772 var t = g(this) ? this.valueOf() : this, 9773 e = Oe.call(t); 9774 if (w(ke, t)) return ""; 9775 e = ze ? e.slice(7, -1) : e.replace(Ae, "$1"); 9776 return "" === e ? void 0 : e 9777 } 9778 }), st({ 9779 global: !0, 9780 forced: !0 9781 }, { 9782 Symbol: Ie 9783 })), Rt("iterator"); 9784 9785 function De(t, e, i) { 9786 (e = v(e)) in t ? I.f(t, e, m(0, i)) : t[e] = i 9787 } 9788 var i = pt("navigator", "userAgent") || "", 9789 Le = h.process, 9790 Le = Le && Le.versions, 9791 Le = Le && Le.v8; 9792 Le ? We = (Re = Le.split("."))[0] + Re[1] : i && (!(Re = i.match(/Edge\/(\d+)/)) || 74 <= Re[1]) && (Re = i.match(/Chrome\/(\d+)/)) && (We = Re[1]); 9793 var Me = We && +We, 9794 Ne = Bt("species"), 9795 Le = function(e) { 9796 return 51 <= Me || !c(function() { 9797 var t = []; 9798 return (t.constructor = {})[Ne] = function() { 9799 return { 9800 foo: 1 9801 } 9802 }, 1 !== t[e](Boolean).foo 9803 }) 9804 }, 9805 He = Bt("isConcatSpreadable"), 9806 je = 9007199254740991, 9807 Be = "Maximum allowed index exceeded", 9808 Re = 51 <= Me || !c(function() { 9809 var t = []; 9810 return t[He] = !1, t.concat()[0] !== t 9811 }), 9812 We = Le("concat"); 9813 st({ 9814 target: "Array", 9815 proto: !0, 9816 forced: !Re || !We 9817 }, { 9818 concat: function(t) { 9819 for (var e, i, n, o = at(this), s = qt(o, 0), a = 0, r = -1, l = arguments.length; r < l; r++) 9820 if (function(t) { 9821 if (!g(t)) return !1; 9822 var e = t[He]; 9823 return void 0 !== e ? !!e : Dt(t) 9824 }(n = -1 === r ? o : arguments[r])) { 9825 if (a + (i = et(n.length)) > je) throw TypeError(Be); 9826 for (e = 0; e < i; e++, a++) e in n && De(s, a, n[e]) 9827 } else { 9828 if (je <= a) throw TypeError(Be); 9829 De(s, a++, n) 9830 } return s.length = a, s 9831 } 9832 }); 9833 var Fe = J.filter, 9834 i = Le("filter"), 9835 Re = i && !c(function() { 9836 [].filter.call({ 9837 length: -1, 9838 0: 1 9839 }, function(t) { 9840 throw t 9841 }) 9842 }); 9843 st({ 9844 target: "Array", 9845 proto: !0, 9846 forced: !i || !Re 9847 }, { 9848 filter: function(t) { 9849 return Fe(this, t, 1 < arguments.length ? arguments[1] : void 0) 9850 } 9851 }); 9852 var qe = Bt("unscopables"), 9853 Ve = Array.prototype; 9854 null == Ve[qe] && I.f(Ve, qe, { 9855 configurable: !0, 9856 value: Kt(null) 9857 }); 9858 var We = function(t) { 9859 Ve[qe][t] = !0 9860 }, 9861 Ue = J.find, 9862 Ge = !0; 9863 "find" in [] && Array(1).find(function() { 9864 Ge = !1 9865 }), st({ 9866 target: "Array", 9867 proto: !0, 9868 forced: Ge 9869 }, { 9870 find: function(t) { 9871 return Ue(this, t, 1 < arguments.length ? arguments[1] : void 0) 9872 } 9873 }), We("find"); 9874 var Ye = J.findIndex, 9875 Xe = !0; 9876 "findIndex" in [] && Array(1).findIndex(function() { 9877 Xe = !1 9878 }), st({ 9879 target: "Array", 9880 proto: !0, 9881 forced: Xe 9882 }, { 9883 findIndex: function(t) { 9884 return Ye(this, t, 1 < arguments.length ? arguments[1] : void 0) 9885 } 9886 }), We("findIndex"); 9887 var Ke = t.includes; 9888 st({ 9889 target: "Array", 9890 proto: !0 9891 }, { 9892 includes: function(t) { 9893 return Ke(this, t, 1 < arguments.length ? arguments[1] : void 0) 9894 } 9895 }), We("includes"); 9896 var i = function(t, e) { 9897 var i = [][t]; 9898 return !i || !c(function() { 9899 i.call(null, e || function() { 9900 throw 1 9901 }, 1) 9902 }) 9903 }, 9904 Ze = t.indexOf, 9905 Qe = [].indexOf, 9906 Je = !!Qe && 1 / [1].indexOf(1, -0) < 0, 9907 Re = i("indexOf"); 9908 st({ 9909 target: "Array", 9910 proto: !0, 9911 forced: Je || Re 9912 }, { 9913 indexOf: function(t) { 9914 return Je ? Qe.apply(this, arguments) || 0 : Ze(this, t, 1 < arguments.length ? arguments[1] : void 0) 9915 } 9916 }); 9917 var t = !c(function() { 9918 function t() {} 9919 return t.prototype.constructor = null, Object.getPrototypeOf(new t) !== t.prototype 9920 }), 9921 ti = Z("IE_PROTO"), 9922 ei = Object.prototype, 9923 ii = t ? Object.getPrototypeOf : function(t) { 9924 return t = at(t), w(t, ti) ? t[ti] : "function" == typeof t.constructor && t instanceof t.constructor ? t.constructor.prototype : t instanceof Object ? ei : null 9925 }, 9926 Re = Bt("iterator"), 9927 Z = !1; 9928 [].keys && ("next" in (t = [].keys()) ? (t = ii(ii(t))) !== Object.prototype && (di = t) : Z = !0), w(di = null == di ? {} : di, Re) || O(di, Re, function() { 9929 return this 9930 }); 9931 9932 function ni() { 9933 return this 9934 } 9935 var Re = { 9936 IteratorPrototype: di, 9937 BUGGY_SAFARI_ITERATORS: Z 9938 }, 9939 oi = Re.IteratorPrototype, 9940 si = Object.setPrototypeOf || ("__proto__" in {} ? function() { 9941 var i, n = !1, 9942 t = {};
vendor: 5,020 bytes, lines 9943-10132
9943 try { 9944 (i = Object.getOwnPropertyDescriptor(Object.prototype, "__proto__").set).call(t, []), n = t instanceof Array 9945 } catch (i) {} 9946 return function(t, e) { 9947 return E(t), 9948 function(t) { 9949 if (!g(t) && null !== t) throw TypeError("Can't set " + String(t) + " as a prototype") 9950 }(e), n ? i.call(t, e) : t.__proto__ = e, t 9951 } 9952 }() : void 0), 9953 ai = Re.IteratorPrototype, 9954 ri = Re.BUGGY_SAFARI_ITERATORS, 9955 li = Bt("iterator"), 9956 ci = "values", 9957 di = function(t, e, i, n, o, s, a) { 9958 f = e + " Iterator", (c = i).prototype = Kt(oi, { 9959 next: m(1, n) 9960 }), Wt(c, f, !1); 9961 var r, l, n = function(t) { 9962 if (t === o && p) return p; 9963 if (!ri && t in u) return u[t]; 9964 switch (t) { 9965 case "keys": 9966 case ci: 9967 case "entries": 9968 return function() { 9969 return new i(this, t) 9970 } 9971 } 9972 return function() { 9973 return new i(this) 9974 } 9975 }, 9976 c = e + " Iterator", 9977 d = !1, 9978 u = t.prototype, 9979 h = u[li] || u["@@iterator"] || o && u[o], 9980 p = !ri && h || n(o), 9981 f = "Array" == e && u.entries || h; 9982 if (f && (t = ii(f.call(new t)), ai !== Object.prototype && t.next && (ii(t) !== ai && (si ? si(t, ai) : "function" != typeof t[li] && O(t, li, ni)), Wt(t, c, !0))), o == ci && h && h.name !== ci && (d = !0, p = function() { 9983 return h.call(this) 9984 }), u[li] !== p && O(u, li, p), o) 9985 if (r = { 9986 values: n(ci), 9987 keys: s ? p : n("keys"), 9988 entries: n("entries") 9989 }, a) 9990 for (l in r) !ri && !d && l in u || ut(u, l, r[l]); 9991 else st({ 9992 target: e, 9993 proto: !0, 9994 forced: ri || d 9995 }, r); 9996 return r 9997 }, 9998 ui = "Array Iterator", 9999 hi = dt.set, 10000 pi = dt.getterFor(ui), 10001 fi = di(Array, "Array", function(t, e) { 10002 hi(this, { 10003 type: ui, 10004 target: d(t), 10005 index: 0, 10006 kind: e 10007 }) 10008 }, function() { 10009 var t = pi(this), 10010 e = t.target, 10011 i = t.kind, 10012 n = t.index++; 10013 return !e || n >= e.length ? { 10014 value: t.target = void 0, 10015 done: !0 10016 } : "keys" == i ? { 10017 value: n, 10018 done: !1 10019 } : "values" == i ? { 10020 value: e[n], 10021 done: !1 10022 } : { 10023 value: [n, e[n]], 10024 done: !1 10025 } 10026 }, "values"); 10027 We("keys"), We("values"), We("entries"); 10028 var mi = [].join, 10029 Z = C != Object, 10030 Re = i("join", ","); 10031 st({ 10032 target: "Array", 10033 proto: !0, 10034 forced: Z || Re 10035 }, { 10036 join: function(t) { 10037 return mi.call(d(this), void 0 === t ? "," : t) 10038 } 10039 }); 10040 var gi = J.map, 10041 We = Le("map"), 10042 Z = We && !c(function() { 10043 [].map.call({ 10044 length: -1, 10045 0: 1 10046 }, function(t) { 10047 throw t 10048 }) 10049 }); 10050 st({ 10051 target: "Array", 10052 proto: !0, 10053 forced: !We || !Z 10054 }, { 10055 map: function(t) { 10056 return gi(this, t, 1 < arguments.length ? arguments[1] : void 0) 10057 } 10058 }); 10059 var vi = [].reverse, 10060 Re = [1, 2]; 10061 st({ 10062 target: "Array", 10063 proto: !0, 10064 forced: String(Re) === String(Re.reverse()) 10065 }, { 10066 reverse: function() { 10067 return Dt(this) && (this.length = this.length), vi.call(this) 10068 } 10069 }); 10070 var bi = Bt("species"), 10071 yi = [].slice, 10072 wi = Math.max; 10073 st({ 10074 target: "Array", 10075 proto: !0, 10076 forced: !Le("slice") 10077 }, { 10078 slice: function(t, e) { 10079 var i, n, o, s = d(this), 10080 a = et(s.length), 10081 r = it(t, a), 10082 l = it(void 0 === e ? a : e, a); 10083 if (Dt(s) && ((i = "function" == typeof(i = s.constructor) && (i === Array || Dt(i.prototype)) || g(i) && null === (i = i[bi]) ? void 0 : i) === Array || void 0 === i)) return yi.call(s, r, l); 10084 for (n = new(void 0 === i ? Array : i)(wi(l - r, 0)), o = 0; r < l; r++, o++) r in s && De(n, o, s[r]); 10085 return n.length = o, n 10086 } 10087 }); 10088 var Ci = [], 10089 xi = Ci.sort, 10090 We = c(function() { 10091 Ci.sort(void 0) 10092 }), 10093 Z = c(function() { 10094 Ci.sort(null) 10095 }), 10096 Re = i("sort"); 10097 st({ 10098 target: "Array", 10099 proto: !0, 10100 forced: We || !Z || Re 10101 }, { 10102 sort: function(t) { 10103 return void 0 === t ? xi.call(at(this)) : xi.call(at(this), Ft(t)) 10104 } 10105 }); 10106 var _i = Math.max, 10107 Si = Math.min; 10108 st({ 10109 target: "Array", 10110 proto: !0, 10111 forced: !Le("splice") 10112 }, { 10113 splice: function(t, e) { 10114 var i, n, o, s, a, r, l = at(this), 10115 c = et(l.length), 10116 d = it(t, c), 10117 t = arguments.length; 10118 if (0 === t ? i = n = 0 : n = 1 === t ? (i = 0, c - d) : (i = t - 2, Si(_i(gt(e), 0), c - d)), 9007199254740991 < c + i - n) throw TypeError("Maximum allowed length exceeded"); 10119 for (o = qt(l, n), s = 0; s < n; s++)(a = d + s) in l && De(o, s, l[a]); 10120 if (i < (o.length = n)) { 10121 for (s = d; s < c - n; s++) r = s + i, (a = s + n) in l ? l[r] = l[a] : delete l[r]; 10122 for (s = c; c - n + i < s; s--) delete l[s - 1] 10123 } else if (n < i) 10124 for (s = c - n; d < s; s--) r = s + i - 1, (a = s + n - 1) in l ? l[r] = l[a] : delete l[r]; 10125 for (s = 0; s < i; s++) l[s + d] = arguments[s + 2]; 10126 return l.length = c - n + i, o 10127 } 10128 }); 10129 10130 function Ti(t) { 10131 var e, i, n, o, s, a, r, l = v(t, !1); 10132 if ("string" == typeof l && 2 < l.length)
10133 if (43 === (e = (l = Ai(l)).charCodeAt(0)) || 45 === e) { 10134 if (88 === (t = l.charCodeAt(2)) || 120 === t) return NaN 10135 } else if (48 === e) { 10136 switch (l.charCodeAt(1)) { 10137 case 66: 10138 case 98: 10139 i = 2, n = 49; 10140 break; 10141 case 79: 10142 case 111: 10143 i = 8, n = 55; 10144 break; 10145 default: 10146 return +l 10147 } 10148 for (s = (o = l.slice(2)).length, a = 0; a < s; a++) 10149 if ((r = o.charCodeAt(a)) < 48 || n < r) return NaN; 10150 return parseInt(o, i) 10151 } 10152 return +l 10153 } 10154 var $i = function(t, e, i) { 10155 var n, o; 10156 return si && "function" == typeof(n = e.constructor) && n !== i && g(o = n.prototype) && o !== i.prototype && si(t, o), t 10157 }, 10158 Ei = "\t\n\v\f\r áââââââ ââââââ¯âã\u2028\u2029\ufeff", 10159 We = "[" + Ei + "]", 10160 ki = RegExp("^" + We + We + "*"), 10161 Ii = RegExp(We + We + "*$"), 10162 Z = function(e) { 10163 return function(t) { 10164 t = String(b(t)); 10165 return 1 & e && (t = t.replace(ki, "")), t = 2 & e ? t.replace(Ii, "") : t 10166 } 10167 }, 10168 Re = { 10169 start: Z(1), 10170 end: Z(2), 10171 trim: Z(3) 10172 }, 10173 Le = _t.f, 10174 Oi = $.f, 10175 zi = I.f, 10176 Ai = Re.trim, 10177 Pi = "Number", 10178 Di = h.Number, 10179 Li = Di.prototype, 10180 Mi = r(Kt(Li)) == Pi; 10181 if (zt(Pi, !Di(" 0o1") || !Di("0b1") || Di("+0x1"))) { 10182 for (var Ni, Hi = function(t) { 10183 var t = arguments.length < 1 ? 0 : t, 10184 e = this; 10185 return e instanceof Hi && (Mi ? c(function() { 10186 Li.valueOf.call(e) 10187 }) : r(e) != Pi) ? $i(new Di(Ti(t)), e, Hi) : Ti(t) 10188 }, ji = p ? Le(Di) : "MAX_VALUE,MIN_VALUE,NaN,NEGATIVE_INFINITY,POSITIVE_INFINITY,EPSILON,isFinite,isInteger,isNaN,isSafeInteger,MAX_SAFE_INTEGER,MIN_SAFE_INTEGER,parseFloat,parseInt,isInteger".split(","), Bi = 0; ji.length > Bi; Bi++) w(Di, Ni = ji[Bi]) && !w(Hi, Ni) && zi(Hi, Ni, Oi(Di, Ni)); 10189 (Hi.prototype = Li).constructor = Hi, ut(h, Pi, Hi) 10190 } 10191 var Ri = Object.assign, 10192 Wi = Object.defineProperty, 10193 We = !Ri || c(function() { 10194 if (p && 1 !== Ri({ 10195 b: 1 10196 }, Ri(Wi({}, "a", { 10197 enumerable: !0, 10198 get: function() { 10199 Wi(this, "b", { 10200 value: 3, 10201 enumerable: !1 10202 }) 10203 } 10204 }), { 10205 b: 2 10206 })).b) return 1; 10207 var t = {}, 10208 e = {}, 10209 i = Symbol(), 10210 n = "abcdefghijklmnopqrst"; 10211 return t[i] = 7, n.split("").forEach(function(t) { 10212 e[t] = t 10213 }), 7 != Ri({}, t)[i] || Lt(Ri({}, e)).join("") != n 10214 }) ? function(t, e) { 10215 for (var i = at(t), n = arguments.length, o = 1, s = St.f, a = f.f; o < n;) 10216 for (var r, l = C(arguments[o++]), c = s ? Lt(l).concat(s(l)) : Lt(l), d = c.length, u = 0; u < d;) r = c[u++], p && !a.call(l, r) || (i[r] = l[r]); 10217 return i 10218 } : Ri; 10219 st({ 10220 target: "Object", 10221 stat: !0, 10222 forced: Object.assign !== We 10223 }, { 10224 assign: We 10225 }); 10226 var Fi = f.f, 10227 Z = function(r) { 10228 return function(t) { 10229 for (var e, i = d(t), n = Lt(i), o = n.length, s = 0, a = []; s < o;) e = n[s++], p && !Fi.call(i, e) || a.push(r ? [e, i[e]] : i[e]); 10230 return a 10231 } 10232 }, 10233 qi = [Z(!0), Z(!1)][0]; 10234 st({ 10235 target: "Object", 10236 stat: !0 10237 }, { 10238 entries: function(t) { 10239 return qi(t) 10240 } 10241 }); 10242 Le = {}; 10243 Le[Bt("toStringTag")] = "z"; 10244 var We = "[object z]" === String(Le), 10245 Vi = Bt("toStringTag"), 10246 Ui = "Arguments" == r(function() { 10247 return arguments 10248 }()), 10249 Gi = We ? r : function(t) { 10250 var e; 10251 return void 0 === t ? "Undefined" : null === t ? "Null" : "string" == typeof(t = function(t, e) { 10252 try { 10253 return t[e] 10254 } catch (t) {} 10255 }(e = Object(t), Vi)) ? t : Ui ? r(e) : "Object" == (t = r(e)) && "function" == typeof e.callee ? "Arguments" : t 10256 }; 10257 We || ut(Object.prototype, "toString", We ? {}.toString : function() { 10258 return "[object " + Gi(this) + "]" 10259 }, { 10260 unsafe: !0 10261 }); 10262 var Yi = Re.trim, 10263 Xi = h.parseFloat, 10264 Z = 1 / Xi(Ei + "-0") != -1 / 0 ? function(t) { 10265 var e = Yi(String(t)), 10266 t = Xi(e); 10267 return 0 === t && "-" == e.charAt(0) ? -0 : t 10268 } : Xi; 10269 st({ 10270 global: !0, 10271 forced: parseFloat != Z 10272 }, { 10273 parseFloat: Z 10274 }); 10275 var Ki = Re.trim, 10276 Zi = h.parseInt, 10277 Qi = /^[+-]?0[Xx]/, 10278 Le = 8 !== Zi(Ei + "08") || 22 !== Zi(Ei + "0x16") ? function(t, e) { 10279 t = Ki(String(t)); 10280 return Zi(t, e >>
10280> 0 || (Qi.test(t) ? 16 : 10)) 10281 } : Zi; 10282 st({ 10283 global: !0, 10284 forced: parseInt != Le 10285 }, { 10286 parseInt: Le 10287 }); 10288 var Ji = Bt("match"), 10289 tn = function(t) { 10290 var e; 10291 return g(t) && (void 0 !== (e = t[Ji]) ? !!e : "RegExp" == r(t)) 10292 }, 10293 en = function() { 10294 var t = E(this), 10295 e = ""; 10296 return t.global && (e += "g"), t.ignoreCase && (e += "i"), t.multiline && (e += "m"), t.dotAll && (e += "s"), t.unicode && (e += "u"), t.sticky && (e += "y"), e 10297 }; 10298 10299 function nn(t, e) { 10300 return RegExp(t, e) 10301 } 10302 var We = { 10303 UNSUPPORTED_Y: c(function() { 10304 var t = nn("a", "y"); 10305 return t.lastIndex = 2, null != t.exec("abcd") 10306 }), 10307 BROKEN_CARET: c(function() { 10308 var t = nn("^r", "gy"); 10309 return t.lastIndex = 2, null != t.exec("str") 10310 }) 10311 }, 10312 Z = Bt("species"), 10313 on = I.f, 10314 Le = _t.f, 10315 sn = dt.set, 10316 an = Bt("match"), 10317 rn = h.RegExp, 10318 ln = rn.prototype, 10319 cn = /a/g, 10320 dn = /a/g, 10321 un = new rn(cn) !== cn, 10322 hn = We.UNSUPPORTED_Y; 10323 if (p && zt("RegExp", !un || hn || c(function() { 10324 return dn[an] = !1, rn(cn) != cn || rn(dn) == dn || "/a/i" != rn(cn, "i") 10325 }))) { 10326 for (var pn = function(t, e) { 10327 var i, n = this instanceof pn, 10328 o = tn(t), 10329 s = void 0 === e; 10330 if (!n && o && t.constructor === pn && s) return t; 10331 un ? o && !s && (t = t.source) : t instanceof pn && (s && (e = en.call(t)), t = t.source), hn && (i = !!e && -1 < e.indexOf("y")) && (e = e.replace(/y/g, "")); 10332 n = $i(un ? new rn(t, e) : rn(t, e), n ? this : ln, pn); 10333 return hn && i && sn(n, { 10334 sticky: i 10335 }), n 10336 }, fn = Le(rn), mn = 0; fn.length > mn;) ! function(e) { 10337 e in pn || on(pn, e, { 10338 configurable: !0, 10339 get: function() { 10340 return rn[e] 10341 }, 10342 set: function(t) { 10343 rn[e] = t 10344 } 10345 }) 10346 }(fn[mn++]); 10347 (ln.constructor = pn).prototype = ln, ut(h, "RegExp", pn) 10348 } 10349 Le = pt("RegExp"), pt = I.f, p && Le && !Le[Z] && pt(Le, Z, { 10350 configurable: !0, 10351 get: function() { 10352 return this 10353 } 10354 }); 10355 var gn = RegExp.prototype.exec, 10356 vn = String.prototype.replace, 10357 pt = gn, 10358 bn = (Le = /a/, Z = /b*/g, gn.call(Le, "a"), gn.call(Z, "a"), 0 !== Le.lastIndex || 0 !== Z.lastIndex), 10359 yn = We.UNSUPPORTED_Y || We.BROKEN_CARET, 10360 wn = void 0 !== /()??/.exec("")[1], 10361 Cn = pt = bn || wn || yn ? function(t) { 10362 var e, i, n, o, s = this, 10363 a = yn && s.sticky, 10364 r = en.call(s), 10365 l = s.source, 10366 c = 0, 10367 d = t; 10368 return a && (-1 === (r = r.replace("y", "")).indexOf("g") && (r += "g"), d = String(t).slice(s.lastIndex), 0 < s.lastIndex && (!s.multiline || s.multiline && "\n" !== t[s.lastIndex - 1]) && (l = "(?: " + l + ")", d = " " + d, c++), i = new RegExp("^(?:" + l + ")", r)), wn && (i = new RegExp("^" + l + "$(?!\\s)", r)), bn && (e = s.lastIndex), n = gn.call(a ? i : s, d), a ? n ? (n.input = n.input.slice(c), n[0] = n[0].slice(c), n.index = s.lastIndex, s.lastIndex += n[0].length) : s.lastIndex = 0 : bn && n && (s.lastIndex = s.global ? n.index + n[0].length : e), wn && n && 1 < n.length && vn.call(n[0], i, function() { 10369 for (o = 1; o < arguments.length - 2; o++) void 0 === arguments[o] && (n[o] = void 0) 10370 }), n 10371 } : pt; 10372 st({ 10373 target: "RegExp", 10374 proto: !0, 10375 forced: /./.exec !== Cn 10376 }, { 10377 exec: Cn 10378 }); 10379 var xn = RegExp.prototype, 10380 _n = xn.toString, 10381 We = c(function() { 10382 return "/a/b" != _n.call({ 10383 source: "a", 10384 flags: "b" 10385 }) 10386 }), 10387 pt = "toString" != _n.name; 10388 (We || pt) && ut(RegExp.prototype, "toString", function() { 10389 var t = E(this), 10390 e = String(t.source), 10391 i = t.flags; 10392 return "/" + e + "/" + String(void 0 === i && t instanceof RegExp && !("flags" in xn) ? en.call(t) : i) 10393 }, { 10394 unsafe: !0 10395 }); 10396 10397 function Sn(t) { 10398 if (tn(t)) throw TypeError("The method doesn't accept regular expressions"); 10399 return t 10400 } 10401 var Tn = Bt("match"), 10402 We = function(e) { 10403 var i = /./; 10404 try { 10405 "/./" [e](i) 10406 } catch (t) { 10407 try { 10408 return i[Tn] = !1, "/./" [e](i) 10409 } catch (e) {} 10410 } 10411 return !1 10412 }; 10413 st({ 10414 target: "String", 10415 proto: !0, 10416 forced: !We("includes") 10417 }, { 10418 includes: function(t) { 10419 return !!~String(b(this)).indexOf(Sn(t), 1 < arguments.length ? arguments[1] : void 0) 10420 } 10421 }); 10422 var pt = function(s) { 10423 return function(t, e) { 10424 var i, n = String(b(t)), 10425 o = gt(e), 10426 t = n.length;
10427 return o < 0 || t <= o ? s ? "" : void 0 : (e = n.charCodeAt(o)) < 55296 || 56319 < e || o + 1 === t || (i = n.charCodeAt(o + 1)) < 56320 || 57343 < i ? s ? n.charAt(o) : e : s ? n.slice(o, o + 2) : i - 56320 + (e - 55296 << 10) + 65536 10428 } 10429 }, 10430 pt = { 10431 codeAt: pt(!1), 10432 charAt: pt(!0) 10433 }, 10434 $n = pt.charAt, 10435 En = "String Iterator", 10436 kn = dt.set, 10437 In = dt.getterFor(En); 10438 di(String, "String", function(t) { 10439 kn(this, { 10440 type: En, 10441 string: String(t), 10442 index: 0 10443 }) 10444 }, function() { 10445 var t = In(this), 10446 e = t.string, 10447 i = t.index; 10448 return i >= e.length ? { 10449 value: void 0, 10450 done: !0 10451 } : (i = $n(e, i), t.index += i.length, { 10452 value: i, 10453 done: !1 10454 }) 10455 }); 10456 10457 function On(t, e, i) { 10458 return e + (i ? Mn(t, e).length : 1) 10459 } 10460 10461 function zn(t, e) { 10462 var i = t.exec; 10463 if ("function" == typeof i) { 10464 i = i.call(t, e); 10465 if ("object" != typeof i) throw TypeError("RegExp exec method returned something other than an Object or null"); 10466 return i 10467 } 10468 if ("RegExp" !== r(t)) throw TypeError("RegExp#exec called on incompatible receiver"); 10469 return Cn.call(t, e) 10470 } 10471 var An = Bt("species"), 10472 Pn = !c(function() { 10473 var t = /./; 10474 return t.exec = function() { 10475 var t = []; 10476 return t.groups = { 10477 a: "7" 10478 }, t 10479 }, "7" !== "".replace(t, "$<a>") 10480 }), 10481 Dn = "$0" === "a".replace(/./, "$0"), 10482 Ln = !c(function() { 10483 var t = /(?:)/, 10484 e = t.exec; 10485 t.exec = function() { 10486 return e.apply(this, arguments) 10487 }; 10488 t = "ab".split(t); 10489 return 2 !== t.length || "a" !== t[0] || "b" !== t[1] 10490 }), 10491 di = function(i, t, e, n) { 10492 var s, o, a = Bt(i), 10493 r = !c(function() { 10494 var t = {}; 10495 return t[a] = function() { 10496 return 7 10497 }, 7 != "" [i](t) 10498 }), 10499 l = r && !c(function() { 10500 var t = !1, 10501 e = /a/; 10502 return "split" === i && ((e = {}).constructor = {}, e.constructor[An] = function() { 10503 return e 10504 }, e.flags = "", e[a] = /./ [a]), e.exec = function() { 10505 return t = !0, null 10506 }, e[a](""), !t 10507 }); 10508 r && l && ("replace" !== i || Pn && Dn) && ("split" !== i || Ln) || (s = /./ [a], e = (l = e(a, "" [i], function(t, e, i, n, o) { 10509 return e.exec === Cn ? r && !o ? { 10510 done: !0, 10511 value: s.call(e, i, n) 10512 } : { 10513 done: !0, 10514 value: t.call(i, e, n) 10515 } : { 10516 done: !1 10517 } 10518 }, { 10519 REPLACE_KEEPS_$0: Dn 10520 }))[0], o = l[1], ut(String.prototype, i, e), ut(RegExp.prototype, a, 2 == t ? function(t, e) { 10521 return o.call(t, this, e) 10522 } : function(t) { 10523 return o.call(t, this) 10524 })), n && O(RegExp.prototype[a], "sham", !0) 10525 }, 10526 Mn = pt.charAt, 10527 Nn = Math.max, 10528 Hn = Math.min, 10529 jn = Math.floor, 10530 Bn = /\$([$&'`]|\d\d?|<[^>]*>)/g, 10531 Rn = /\$([$&'`]|\d\d?)/g; 10532 di("replace", 2, function(o, w, C, x) { 10533 return [function(t, e) { 10534 var i = b(this), 10535 n = null == t ? void 0 : t[o]; 10536 return void 0 !== n ? n.call(t, i, e) : w.call(String(i), t, e) 10537 }, function(t, e) { 10538 if (x.REPLACE_KEEPS_$0 || "string" == typeof e && -1 === e.indexOf("$0")) { 10539 var i = C(w, t, this, e); 10540 if (i.done) return i.value 10541 } 10542 var n = E(t), 10543 o = String(this), 10544 s = "function" == typeof e; 10545 s || (e = String(e)); 10546 var a, r = n.global; 10547 r && (a = n.unicode, n.lastIndex = 0); 10548 for (var l = [];;) { 10549 var c = zn(n, o); 10550 if (null === c) break; 10551 if (l.push(c), !r) break; 10552 "" === String(c[0]) && (n.lastIndex = On(o, et(n.lastIndex), a)) 10553 } 10554 for (var d, u = "", h = 0, p = 0; p < l.length; p++) { 10555 for (var c = l[p], f = String(c[0]), m = Nn(Hn(gt(c.index), o.length), 0), g = [], v = 1; v < c.length; v++) g.push(void 0 === (d = c[v]) ? d : String(d)); 10556 var b, y = c.groups, 10557 y = s ? (b = [f].concat(g, m, o), void 0 !== y && b.push(y), String(e.apply(void 0, b))) : function(s, a, r, l, c, t) { 10558 var d = r + s.length, 10559 u = l.length, 10560 e = Rn; 10561 return void 0 !== c && (c = at(c), e = Bn), w.call(t, e, function(t, e) { 10562 var i; 10563 switch (e.charAt(0)) { 10564 case "$": 10565 return "$"; 10566 case "&": 10567 return s; 10568 case "`": 10569 return a.slice(0, r);
10570 case "'": 10571 return a.slice(d); 10572 case "<": 10573 i = c[e.slice(1, -1)]; 10574 break; 10575 default: 10576 var n = +e; 10577 if (0 == n) return t; 10578 if (u < n) { 10579 var o = jn(n / 10); 10580 return 0 !== o && o <= u ? void 0 === l[o - 1] ? e.charAt(1) : l[o - 1] + e.charAt(1) : t 10581 } 10582 i = l[n - 1] 10583 } 10584 return void 0 === i ? "" : i 10585 }) 10586 }(f, o, m, g, y, e); 10587 h <= m && (u += o.slice(h, m) + y, h = m + f.length) 10588 } 10589 return u + o.slice(h) 10590 }] 10591 }); 10592 var Wn = Object.is || function(t, e) { 10593 return t === e ? 0 !== t || 1 / t == 1 / e : t != t && e != e 10594 }; 10595 di("search", 1, function(n, o, s) { 10596 return [function(t) { 10597 var e = b(this), 10598 i = null == t ? void 0 : t[n]; 10599 return void 0 !== i ? i.call(t, e) : new RegExp(t)[n](String(e)) 10600 }, function(t) { 10601 var e = s(o, t, this); 10602 if (e.done) return e.value; 10603 var i = E(t), 10604 e = String(this), 10605 t = i.lastIndex; 10606 Wn(t, 0) || (i.lastIndex = 0); 10607 e = zn(i, e); 10608 return Wn(i.lastIndex, t) || (i.lastIndex = t), null === e ? -1 : e.index 10609 }] 10610 }); 10611 var Fn = Bt("species"), 10612 qn = [].push, 10613 Vn = Math.min, 10614 Un = 4294967295, 10615 Gn = !c(function() { 10616 return !RegExp(Un, "y") 10617 }); 10618 di("split", 2, function(o, m, g) { 10619 var v = "c" == "abbc".split(/(b)*/)[1] || 4 != "test".split(/(?:)/, -1).length || 2 != "ab".split(/(?:ab)*/).length || 4 != ".".split(/(.?)(.?)/).length || 1 < ".".split(/()()/).length || "".split(/.?/).length ? function(t, e) { 10620 var i = String(b(this)), 10621 n = void 0 === e ? Un : e >>> 0; 10622 if (0 == n) return []; 10623 if (void 0 === t) return [i]; 10624 if (!tn(t)) return m.call(i, t, n); 10625 for (var o, s, a, r = [], e = (t.ignoreCase ? "i" : "") + (t.multiline ? "m" : "") + (t.unicode ? "u" : "") + (t.sticky ? "y" : ""), l = 0, c = new RegExp(t.source, e + "g"); 10626 (o = Cn.call(c, i)) && !((s = c.lastIndex) > l && (r.push(i.slice(l, o.index)), 1 < o.length && o.index < i.length && qn.apply(r, o.slice(1)), a = o[0].length, l = s, r.length >= n));) c.lastIndex === o.index && c.lastIndex++; 10627 return l === i.length ? !a && c.test("") || r.push("") : r.push(i.slice(l)), r.length > n ? r.slice(0, n) : r 10628 } : "0".split(void 0, 0).length ? function(t, e) { 10629 return void 0 === t && 0 === e ? [] : m.call(this, t, e) 10630 } : m; 10631 return [function(t, e) { 10632 var i = b(this), 10633 n = null == t ? void 0 : t[o]; 10634 return void 0 !== n ? n.call(t, i, e) : v.call(String(i), t, e) 10635 }, function(t, e) { 10636 var i = g(v, t, this, e, v !== m); 10637 if (i.done) return i.value; 10638 var n, o = E(t), 10639 s = String(this), 10640 i = (i = RegExp, void 0 === (t = E(o).constructor) || null == (n = E(t)[Fn]) ? i : Ft(n)), 10641 a = o.unicode, 10642 n = (o.ignoreCase ? "i" : "") + (o.multiline ? "m" : "") + (o.unicode ? "u" : "") + (Gn ? "y" : "g"), 10643 r = new i(Gn ? o : "^(?:" + o.source + ")", n), 10644 l = void 0 === e ? Un : e >>> 0; 10645 if (0 == l) return []; 10646 if (0 === s.length) return null === zn(r, s) ? [s] : []; 10647 for (var c = 0, d = 0, u = []; d < s.length;) { 10648 r.lastIndex = Gn ? d : 0; 10649 var h, p = zn(r, Gn ? s : s.slice(d)); 10650 if (null === p || (h = Vn(et(r.lastIndex + (Gn ? 0 : d)), s.length)) === c) d = On(s, d, a); 10651 else { 10652 if (u.push(s.slice(c, d)), u.length === l) return u; 10653 for (var f = 1; f <= p.length - 1; f++) 10654 if (u.push(p[f]), u.length === l) return u; 10655 d = c = h 10656 } 10657 } 10658 return u.push(s.slice(c)), u 10659 }] 10660 }, !Gn); 10661 var Yn, Xn = Re.trim; 10662 st({ 10663 target: "String", 10664 proto: !0, 10665 forced: (Yn = "trim", c(function() { 10666 return Ei.trim() || "â á " != "â á ".trim() || Ei.trim.name !== Yn 10667 })) 10668 }, { 10669 trim: function() { 10670 return Xn(this) 10671 } 10672 }); 10673 var Kn, Zn = { 10674 CSSRuleList: 0, 10675 CSSStyleDeclaration: 0, 10676 CSSValueList: 0, 10677 ClientRectList: 0, 10678 DOMRectList: 0, 10679 DOMStringList: 0, 10680 DOMTokenList: 1, 10681 DataTransferItemList: 0, 10682 FileList: 0, 10683 HTMLAllCollection: 0, 10684 HTMLCollection: 0, 10685 HTMLFormElement: 0, 10686 HTMLSelectElement: 0, 10687 MediaList: 0, 10688 MimeTypeArray: 0, 10689 NamedNodeMap: 0, 10690 NodeList: 1, 10691 PaintRequestList: 0, 10692 Plugin: 0, 10693 PluginArray: 0, 10694 SVGLengthList: 0, 10695 SVGNumberList: 0, 10696 SVGPathSegList: 0, 10697 SVGPointList: 0, 10698 SVGStringList: 0, 10699 SVGTransformList: 0, 10700 SourceBufferList: 0, 10701 StyleSheetList: 0, 10702 TextTrackCueList: 0, 10703 TextTrackList: 0, 10704 TouchList: 0 10705 }, 10706 Qn = J.forEach,
10707 Jn = i("forEach") ? function(t) { 10708 return Qn(this, t, 1 < arguments.length ? arguments[1] : void 0) 10709 } : [].forEach; 10710 for (Kn in Zn) { 10711 var to = h[Kn], 10712 to = to && to.prototype; 10713 if (to && to.forEach !== Jn) try { 10714 O(to, "forEach", Jn) 10715 } catch (N) { 10716 to.forEach = Jn 10717 } 10718 } 10719 var eo, io = Bt("iterator"), 10720 no = Bt("toStringTag"), 10721 oo = fi.values; 10722 for (eo in Zn) { 10723 var so = h[eo], 10724 ao = so && so.prototype; 10725 if (ao) { 10726 if (ao[io] !== oo) try { 10727 O(ao, io, oo) 10728 } catch (N) { 10729 ao[io] = oo 10730 } 10731 if (ao[no] || O(ao, no, eo), Zn[eo]) 10732 for (var ro in fi) 10733 if (ao[ro] !== fi[ro]) try { 10734 O(ao, ro, fi[ro]) 10735 } catch (N) { 10736 ao[ro] = fi[ro] 10737 } 10738 } 10739 } 10740 10741 function lo(t) { 10742 return (lo = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function(t) { 10743 return typeof t 10744 } : function(t) { 10745 return t && "function" == typeof Symbol && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t 10746 })(t) 10747 } 10748 10749 function co(t, e) { 10750 if (!(t instanceof e)) throw new TypeError("Cannot call a class as a function") 10751 } 10752 10753 function uo(t, e) { 10754 for (var i = 0; i < e.length; i++) { 10755 var n = e[i]; 10756 n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n) 10757 } 10758 } 10759 10760 function ho(t, e, i) { 10761 return e && uo(t.prototype, e), i && uo(t, i), t 10762 } 10763 10764 function po(t, e) { 10765 return function(t) { 10766 if (Array.isArray(t)) return t 10767 }(t) || function(t, e) { 10768 if (Symbol.iterator in Object(t) || "[object Arguments]" === Object.prototype.toString.call(t)) { 10769 var i = [], 10770 n = !0, 10771 o = !1, 10772 s = void 0; 10773 try { 10774 for (var a, r = t[Symbol.iterator](); !(n = (a = r.next()).done) && (i.push(a.value), !e || i.length !== e); n = !0); 10775 } catch (t) { 10776 o = !0, s = t 10777 } finally { 10778 try { 10779 n || null == r.return || r.return() 10780 } finally { 10781 if (o) throw s 10782 } 10783 } 10784 return i 10785 } 10786 }(t, e) || function() { 10787 throw new TypeError("Invalid attempt to destructure non-iterable instance") 10788 }() 10789 } 10790 10791 function fo(t) { 10792 return function(t) { 10793 if (Array.isArray(t)) { 10794 for (var e = 0, i = new Array(t.length); e < t.length; e++) i[e] = t[e]; 10795 return i 10796 } 10797 }(t) || function(t) { 10798 if (Symbol.iterator in Object(t) || "[object Arguments]" === Object.prototype.toString.call(t)) return Array.from(t) 10799 }(t) || function() { 10800 throw new TypeError("Invalid attempt to spread non-iterable instance") 10801 }() 10802 } 10803 J = 4; 10804 try { 10805 var mo = N.fn.dropdown.Constructor.VERSION; 10806 void 0 !== mo && (J = parseInt(mo, 10)) 10807 } catch (N) {} 10808 try { 10809 var go = bootstrap.Tooltip.VERSION; 10810 void 0 !== go && (J = parseInt(go, 10)) 10811 } catch (N) {} 10812 mo = { 10813 3: { 10814 iconsPrefix: "glyphicon", 10815 icons: { 10816 paginationSwitchDown: "glyphicon-collapse-down icon-chevron-down", 10817 paginationSwitchUp: "glyphicon-collapse-up icon-chevron-up", 10818 refresh: "glyphicon-refresh icon-refresh", 10819 toggleOff: "glyphicon-list-alt icon-list-alt", 10820 toggleOn: "glyphicon-list-alt icon-list-alt", 10821 columns: "glyphicon-th icon-th", 10822 detailOpen: "glyphicon-plus icon-plus", 10823 detailClose: "glyphicon-minus icon-minus", 10824 fullscreen: "glyphicon-fullscreen", 10825 search: "glyphicon-search", 10826 clearSearch: "glyphicon-trash" 10827 }, 10828 classes: { 10829 buttonsPrefix: "btn", 10830 buttons: "default", 10831 buttonsGroup: "btn-group", 10832 buttonsDropdown: "btn-group", 10833 pull: "pull", 10834 inputGroup: "input-group", 10835 inputPrefix: "input-", 10836 input: "form-control", 10837 paginationDropdown: "btn-group dropdown", 10838 dropup: "dropup", 10839 dropdownActive: "active", 10840 paginationActive: "active", 10841 buttonActive: "active" 10842 }, 10843 html: { 10844 toolbarDropdown: ['<ul class="dropdown-menu" role="menu">', "</ul>"], 10845 toolbarDropdownItem: '<li class="dropdown-item-marker" role="menuitem"><label>%s</label></li>', 10846 toolbarDropdownSeparator: '<li class="divider"></li>', 10847 pageDropdown: ['<ul class="dropdown-menu" role="menu">', "</ul>"], 10848 pageDropdownItem: '<li role="menuitem" class="%s"><a href="#">%s</a></li>', 10849 dropdownCaret: '<span class="caret"></span>', 10850 pagination: ['<ul class="pagination%s">', "</ul>"], 10851 paginationItem: '<li class="page-item%s"><a class="page-link" aria-label="%s" href="javascript:void(0)">%s</a></li>', 10852 icon: '<i class="%s %s"></i>', 10853 inputGroup: '<div class="input-group">%s<span class="input-group-btn">%s</span></div>', 10854 searchInput: '<input class="%s%s" type="text" placeholder="%s">', 10855 searchButton: '<button class="%s" type="button" name="search" title="%s">%s %s</button>', 10856 searchClearButton: '<button class="%s" type="button" name="clearSearch" title="%s">%s %s</button>' 10857 } 10858 }, 10859 4: { 10860 iconsPrefix: "fa", 10861 icons: { 10862 paginationSwitchDown: "fa-caret-square-down", 10863 paginationSwitchUp: "fa-caret-square-up", 10864 refresh: "fa-sync", 10865 toggleOff: "fa-toggle-off", 10866 toggleOn: "fa-toggle-on", 10867 columns: "fa-th-list", 10868 detailOpen: "fa-plus", 10869 detailClose: "fa-minus", 10870 fullscreen: "fa-arrows-alt", 10871 search: "fa-search",
10872 clearSearch: "fa-trash" 10873 }, 10874 classes: { 10875 buttonsPrefix: "btn", 10876 buttons: "secondary", 10877 buttonsGroup: "btn-group", 10878 buttonsDropdown: "btn-group", 10879 pull: "float", 10880 inputGroup: "btn-group", 10881 inputPrefix: "form-control-", 10882 input: "form-control", 10883 paginationDropdown: "btn-group dropdown", 10884 dropup: "dropup", 10885 dropdownActive: "active", 10886 paginationActive: "active", 10887 buttonActive: "active" 10888 }, 10889 html: { 10890 toolbarDropdown: ['<div class="dropdown-menu dropdown-menu-right">', "</div>"], 10891 toolbarDropdownItem: '<label class="dropdown-item dropdown-item-marker">%s</label>', 10892 pageDropdown: ['<div class="dropdown-menu">', "</div>"], 10893 pageDropdownItem: '<a class="dropdown-item %s" href="#">%s</a>', 10894 toolbarDropdownSeparator: '<div class="dropdown-divider"></div>', 10895 dropdownCaret: '<span class="caret"></span>', 10896 pagination: ['<ul class="pagination%s">', "</ul>"], 10897 paginationItem: '<li class="page-item%s"><a class="page-link" aria-label="%s" href="javascript:void(0)">%s</a></li>', 10898 icon: '<i class="%s %s"></i>', 10899 inputGroup: '<div class="input-group">%s<div class="input-group-append">%s</div></div>', 10900 searchInput: '<input class="%s%s" type="text" placeholder="%s">', 10901 searchButton: '<button class="%s" type="button" name="search" title="%s">%s %s</button>', 10902 searchClearButton: '<button class="%s" type="button" name="clearSearch" title="%s">%s %s</button>' 10903 } 10904 }, 10905 5: { 10906 iconsPrefix: "fa", 10907 icons: { 10908 paginationSwitchDown: "fa-caret-square-down", 10909 paginationSwitchUp: "fa-caret-square-up", 10910 refresh: "fa-sync", 10911 toggleOff: "fa-toggle-off", 10912 toggleOn: "fa-toggle-on", 10913 columns: "fa-th-list", 10914 detailOpen: "fa-plus", 10915 detailClose: "fa-minus", 10916 fullscreen: "fa-arrows-alt", 10917 search: "fa-search", 10918 clearSearch: "fa-trash" 10919 }, 10920 classes: { 10921 buttonsPrefix: "btn", 10922 buttons: "secondary", 10923 buttonsGroup: "btn-group", 10924 buttonsDropdown: "btn-group", 10925 pull: "float", 10926 inputGroup: "btn-group", 10927 inputPrefix: "form-control-", 10928 input: "form-control", 10929 paginationDropdown: "btn-group dropdown", 10930 dropup: "dropup", 10931 dropdownActive: "active", 10932 paginationActive: "active", 10933 buttonActive: "active" 10934 }, 10935 html: { 10936 toolbarDropdown: ['<div class="dropdown-menu dropdown-menu-right">', "</div>"], 10937 toolbarDropdownItem: '<label class="dropdown-item dropdown-item-marker">%s</label>', 10938 pageDropdown: ['<div class="dropdown-menu">', "</div>"], 10939 pageDropdownItem: '<a class="dropdown-item %s" href="#">%s</a>', 10940 toolbarDropdownSeparator: '<div class="dropdown-divider"></div>', 10941 dropdownCaret: '<span class="caret"></span>', 10942 pagination: ['<ul class="pagination%s">', "</ul>"], 10943 paginationItem: '<li class="page-item%s"><a class="page-link" aria-label="%s" href="javascript:void(0)">%s</a></li>', 10944 icon: '<i class="%s %s"></i>', 10945 inputGroup: '<div class="input-group">%s<div class="input-group-append">%s</div></div>', 10946 searchInput: '<input class="%s%s" type="text" placeholder="%s">', 10947 searchButton: '<button class="%s" type="button" name="search" title="%s">%s %s</button>', 10948 searchClearButton: '<button class="%s" type="button" name="clearSearch" title="%s">%s %s</button>' 10949 } 10950 } 10951 } [J], i = { 10952 height: void 0, 10953 classes: "table table-bordered table-hover", 10954 buttons: {}, 10955 theadClasses: "", 10956 headerStyle: function(t) { 10957 return {} 10958 }, 10959 rowStyle: function(t, e) { 10960 return {} 10961 }, 10962 rowAttributes: function(t, e) { 10963 return {} 10964 }, 10965 undefinedText: "-", 10966 locale: void 0, 10967 virtualScroll: !1, 10968 virtualScrollItemHeight: void 0, 10969 sortable: !0, 10970 sortClass: void 0, 10971 silentSort: !0, 10972 sortName: void 0, 10973 sortOrder: void 0, 10974 sortReset: !1, 10975 sortStable: !1, 10976 rememberOrder: !1, 10977 serverSort: !0, 10978 customSort: void 0, 10979 columns: [ 10980 [] 10981 ], 10982 data: [], 10983 url: void 0, 10984 method: "get", 10985 cache: !0,
10986 contentType: "application/json", 10987 dataType: "json", 10988 ajax: void 0, 10989 ajaxOptions: {}, 10990 queryParams: function(t) { 10991 return t 10992 }, 10993 queryParamsType: "limit", 10994 responseHandler: function(t) { 10995 return t 10996 }, 10997 totalField: "total", 10998 totalNotFilteredField: "totalNotFiltered", 10999 dataField: "rows", 11000 footerField: "footer", 11001 pagination: !1, 11002 paginationParts: ["pageInfo", "pageSize", "pageList"], 11003 showExtendedPagination: !1, 11004 paginationLoop: !0, 11005 sidePagination: "client", 11006 totalRows: 0, 11007 totalNotFiltered: 0, 11008 pageNumber: 1, 11009 pageSize: 10, 11010 pageList: [10, 25, 50, 100], 11011 paginationHAlign: "right", 11012 paginationVAlign: "bottom", 11013 paginationDetailHAlign: "left", 11014 paginationPreText: "‹", 11015 paginationNextText: "›", 11016 paginationSuccessivelySize: 5, 11017 paginationPagesBySide: 1, 11018 paginationUseIntermediate: !1, 11019 search: !1, 11020 searchHighlight: !1, 11021 searchOnEnterKey: !1, 11022 strictSearch: !1, 11023 searchSelector: !1, 11024 visibleSearch: !1, 11025 showButtonIcons: !0, 11026 showButtonText: !1, 11027 showSearchButton: !1, 11028 showSearchClearButton: !1, 11029 trimOnSearch: !0, 11030 searchAlign: "right", 11031 searchTimeOut: 500, 11032 searchText: "", 11033 customSearch: void 0, 11034 showHeader: !0, 11035 showFooter: !1, 11036 footerStyle: function(t) { 11037 return {} 11038 }, 11039 searchAccentNeutralise: !1, 11040 showColumns: !1, 11041 showColumnsToggleAll: !1, 11042 showColumnsSearch: !1, 11043 minimumCountColumns: 1, 11044 showPaginationSwitch: !1, 11045 showRefresh: !1, 11046 showToggle: !1, 11047 showFullscreen: !1, 11048 smartDisplay: !0, 11049 escape: !1, 11050 filterOptions: { 11051 filterAlgorithm: "and" 11052 }, 11053 idField: void 0, 11054 selectItemName: "btSelectItem", 11055 clickToSelect: !1, 11056 ignoreClickToSelectOn: function(t) { 11057 t = t.tagName; 11058 return ["A", "BUTTON"].includes(t) 11059 }, 11060 singleSelect: !1, 11061 checkboxHeader: !0, 11062 maintainMetaData: !1, 11063 multipleSelectRow: !1, 11064 uniqueId: void 0, 11065 cardView: !1, 11066 detailView: !1, 11067 detailViewIcon: !0, 11068 detailViewByClick: !1, 11069 detailViewAlign: "left", 11070 detailFormatter: function(t, e) { 11071 return "" 11072 }, 11073 detailFilter: function(t, e) { 11074 return !0 11075 }, 11076 toolbar: void 0, 11077 toolbarAlign: "left", 11078 buttonsToolbar: void 0, 11079 buttonsAlign: "right", 11080 buttonsOrder: ["paginationSwitch", "refresh", "toggle", "fullscreen", "columns"], 11081 buttonsPrefix: mo.classes.buttonsPrefix, 11082 buttonsClass: mo.classes.buttons, 11083 icons: mo.icons, 11084 iconSize: void 0, 11085 iconsPrefix: mo.iconsPrefix, 11086 loadingFontSize: "auto", 11087 loadingTemplate: function(t) { 11088 return '<span class="loading-wrap">
11088\n <span class="loading-text">'.concat(t, '</span>\n <span class="animation-wrap"><span class="animation-dot"></span></span>\n </span>\n ') 11089 }, 11090 onAll: function(t, e) { 11091 return !1 11092 }, 11093 onClickCell: function(t, e, i, n) { 11094 return !1 11095 }, 11096 onDblClickCell: function(t, e, i, n) { 11097 return !1 11098 }, 11099 onClickRow: function(t, e) { 11100 return !1 11101 }, 11102 onDblClickRow: function(t, e) { 11103 return !1 11104 }, 11105 onSort: function(t, e) { 11106 return !1 11107 }, 11108 onCheck: function(t) { 11109 return !1 11110 }, 11111 onUncheck: function(t) { 11112 return !1 11113 }, 11114 onCheckAll: function(t) { 11115 return !1 11116 }, 11117 onUncheckAll: function(t) { 11118 return !1 11119 }, 11120 onCheckSome: function(t) { 11121 return !1 11122 }, 11123 onUncheckSome: function(t) { 11124 return !1 11125 }, 11126 onLoadSuccess: function(t) { 11127 return !1 11128 }, 11129 onLoadError: function(t) { 11130 return !1 11131 }, 11132 onColumnSwitch: function(t, e) { 11133 return !1 11134 }, 11135 onPageChange: function(t, e) { 11136 return !1 11137 }, 11138 onSearch: function(t) { 11139 return !1 11140 }, 11141 onToggle: function(t) { 11142 return !1 11143 }, 11144 onPreBody: function(t) { 11145 return !1 11146 }, 11147 onPostBody: function() { 11148 return !1 11149 }, 11150 onPostHeader: function() { 11151 return !1 11152 }, 11153 onPostFooter: function() { 11154 return !1 11155 }, 11156 onExpandRow: function(t, e, i) { 11157 return !1 11158 }, 11159 onCollapseRow: function(t, e) { 11160 return !1 11161 }, 11162 onRefreshOptions: function(t) { 11163 return !1 11164 }, 11165 onRefresh: function(t) { 11166 return !1 11167 }, 11168 onResetView: function() { 11169 return !1 11170 }, 11171 onScrollBody: function() { 11172 return !1 11173 } 11174 }, go = { 11175 formatLoadingMessage: function() { 11176 return "Loading, please wait" 11177 }, 11178 formatRecordsPerPage: function(t) { 11179 return "".concat(t, " rows per page") 11180 }, 11181 formatShowingRows: function(t, e, i, n) { 11182 return void 0 !== n && 0 < n && i < n ? "Showing ".concat(t, " to ").concat(e, " of ").concat(i, " rows (filtered from ").concat(n, " total rows)") : "Showing ".concat(t, " to ").concat(e, " of ").concat(i, " rows") 11183 }, 11184 formatSRPaginationPreText: function() { 11185 return "previous page" 11186 }, 11187 formatSRPaginationPageText: function(t) { 11188 return "to page ".concat(t) 11189 }, 11190 formatSRPaginationNextText: function() { 11191 return "next page" 11192 }, 11193 formatDetailPagination: function(t) { 11194 return "Showing ".concat(t, " rows") 11195 }, 11196 formatSearch: function() { 11197 return "Search" 11198 }, 11199 formatClearSearch: function() { 11200 return "Clear Search" 11201 }, 11202 formatNoMatches: function() { 11203 return "No matching records found" 11204 }, 11205 formatPaginationSwitch: function() { 11206 return "Hide/Show pagination" 11207 }, 11208 formatPaginationSwitchDown: function() { 11209 return "Show pagination" 11210 }, 11211 formatPaginationSwitchUp: function() { 11212 return "Hide pagination" 11213 }, 11214 formatRefresh: function() { 11215 return "Refresh" 11216 }, 11217 formatToggle: function() { 11218 return "Toggle" 11219 }, 11220 formatToggleOn: function() { 11221 return "Show card view" 11222 }, 11223 formatToggleOff: function() { 11224 return "Hide card view" 11225 }, 11226 formatColumns: function() { 11227 return "Columns" 11228 }, 11229 formatColumnsToggleAll: function() { 11230 return "Toggle all" 11231 }, 11232 formatFullscreen: function() { 11233 return "Fullscreen" 11234 }, 11235 formatAllRows: function() { 11236 return "All" 11237 } 11238 }; 11239 Object.assign(i, go); 11240 var vo = { 11241 VERSION: "1.18.0", 11242 THEME: "bootstrap".concat(J), 11243 CONSTANTS: mo, 11244 DEFAULTS: i, 11245 COLUMN_DEFAULTS: { 11246 field: void 0, 11247 title: void 0, 11248 titleTooltip: void 0, 11249 class: void 0, 11250 width: void 0, 11251 widthUnit: "px", 11252 rowspan: void 0, 11253 colspan: void 0,
11254 align: void 0, 11255 halign: void 0, 11256 falign: void 0, 11257 valign: void 0, 11258 cellStyle: void 0, 11259 radio: !1, 11260 checkbox: !1, 11261 checkboxEnabled: !0, 11262 clickToSelect: !0, 11263 showSelectTitle: !1, 11264 sortable: !1, 11265 sortName: void 0, 11266 order: "asc", 11267 sorter: void 0, 11268 visible: !0, 11269 switchable: !0, 11270 cardVisible: !0, 11271 searchable: !0, 11272 formatter: void 0, 11273 footerFormatter: void 0, 11274 detailFormatter: void 0, 11275 searchFormatter: !0, 11276 searchHighlightFormatter: !1, 11277 escape: !1, 11278 events: void 0 11279 }, 11280 METHODS: ["getOptions", "refreshOptions", "getData", "getSelections", "load", "append", "prepend", "remove", "removeAll", "insertRow", "updateRow", "getRowByUniqueId", "updateByUniqueId", "removeByUniqueId", "updateCell", "updateCellByUniqueId", "showRow", "hideRow", "getHiddenRows", "showColumn", "hideColumn", "getVisibleColumns", "getHiddenColumns", "showAllColumns", "hideAllColumns", "mergeCells", "checkAll", "uncheckAll", "checkInvert", "check", "uncheck", "checkBy", "uncheckBy", "refresh", "destroy", "resetView", "showLoading", "hideLoading", "togglePagination", "toggleFullscreen", "toggleView", "resetSearch", "filterBy", "scrollTo", "getScrollPosition", "selectPage", "prevPage", "nextPage", "toggleDetailView", "expandRow", "collapseRow", "expandRowByUniqueId", "collapseRowByUniqueId", "expandAllRows", "collapseAllRows", "updateColumnTitle", "updateFormatText"], 11281 EVENTS: { 11282 "all.bs.table": "onAll", 11283 "click-row.bs.table": "onClickRow", 11284 "dbl-click-row.bs.table": "onDblClickRow", 11285 "click-cell.bs.table": "onClickCell", 11286 "dbl-click-cell.bs.table": "onDblClickCell", 11287 "sort.bs.table": "onSort", 11288 "check.bs.table": "onCheck", 11289 "uncheck.bs.table": "onUncheck", 11290 "check-all.bs.table": "onCheckAll", 11291 "uncheck-all.bs.table": "onUncheckAll", 11292 "check-some.bs.table": "onCheckSome", 11293 "uncheck-some.bs.table": "onUncheckSome", 11294 "load-success.bs.table": "onLoadSuccess", 11295 "load-error.bs.table": "onLoadError", 11296 "column-switch.bs.table": "onColumnSwitch", 11297 "page-change.bs.table": "onPageChange", 11298 "search.bs.table": "onSearch", 11299 "toggle.bs.table": "onToggle", 11300 "pre-body.bs.table": "onPreBody", 11301 "post-body.bs.table": "onPostBody", 11302 "post-header.bs.table": "onPostHeader", 11303 "post-footer.bs.table": "onPostFooter", 11304 "expand-row.bs.table": "onExpandRow", 11305 "collapse-row.bs.table": "onCollapseRow", 11306 "refresh-options.bs.table": "onRefreshOptions", 11307 "reset-view.bs.table": "onResetView", 11308 "refresh.bs.table": "onRefresh", 11309 "scroll-body.bs.table": "onScrollBody" 11310 }, 11311 LOCALES: { 11312 en: go, 11313 "en-US": go 11314 } 11315 }, 11316 i = c(function() { 11317 Lt(1) 11318 }); 11319 st({ 11320 target: "Object", 11321 stat: !0, 11322 forced: i 11323 }, { 11324 keys: function(t) { 11325 return Lt(at(t)) 11326 } 11327 }); 11328 var go = $.f, 11329 bo = "".endsWith, 11330 yo = Math.min, 11331 i = We("endsWith"), 11332 wo = !(i || (!(wo = go(String.prototype, "endsWith")) || wo.writable)); 11333 st({ 11334 target: "String", 11335 proto: !0, 11336 forced: !wo && !i 11337 }, { 11338 endsWith: function(t) { 11339 var e = String(b(this)); 11340 Sn(t); 11341 var i = 1 < arguments.length ? arguments[1] : void 0, 11342 n = et(e.length), 11343 n = void 0 === i ? n : yo(et(i), n), 11344 t = String(t); 11345 return bo ? bo.call(e, t, n) : e.slice(n - t.length, n) === t 11346 } 11347 }); 11348 var Co, i = $.f, 11349 xo = "".startsWith, 11350 _o = Math.min, 11351 We = We("startsWith"), 11352 Co = !(We || (!(Co = i(String.prototype, "startsWith")) || Co.writable)); 11353 st({ 11354 target: "String", 11355 proto: !0, 11356 forced: !Co && !We 11357 }, { 11358 startsWith: function(t) { 11359 var e = String(b(this)); 11360 Sn(t); 11361 var i = et(_o(1 < arguments.length ? arguments[1] : void 0, e.length)), 11362 t = String(t); 11363 return xo ? xo.call(e, t, i) : e.slice(i, i + t.length) === t 11364 } 11365 }); 11366 var So = { 11367 getSearchInput: function(t) { 11368 return "string" == typeof t.options.searchSelector ? N(t.options.searchSelector) : t.$toolbar.find(".search input") 11369 }, 11370 sprintf: function(t) { 11371 for (var e = arguments.length, i = new Array(1 < e ? e - 1 : 0), n = 1; n < e; n++) i[n - 1] = arguments[n]; 11372 var o = !0, 11373 s = 0, 11374 t = t.replace(/%s/g, function() { 11375 var t = i[s++]; 11376 return void 0 === t ? (o = !1, "") : t 11377 }); 11378 return o ? t : "" 11379 }, 11380 isObject: function(t) { 11381 return t instanceof Object && !Array.isArray(t) 11382 }, 11383 isEmptyObject: function() { 11384 var t = 0 < arguments.length && void 0 !== arguments[0] ? arguments[0] : {}; 11385 return 0 === Object.entries(t).length && t.constructor === Object 11386 }, 11387 isNumeric: function(t) { 11388 return !isNaN(parseFloat(t)) && isFinite(t) 11389 }, 11390 getFieldTitle: function(t, e) { 11391 var i = !0, 11392 n = !1, 11393 o = void 0; 11394 try { 11395 for (var s, a = t[Symbol.iterator](); !(i = (s = a.next()).done); i = !0) { 11396 var r = s.value; 11397 if (r.field === e) return r.title 11398 } 11399 } catch (t) { 11400 n = !0, o = t 11401 } finally { 11402 try { 11403 i || null == a.return || a.return() 11404 } finally { 11405 if (n) throw o 11406 } 11407 } 11408 return "" 11409 }, 11410 setFieldIndex: function(t) { 11411 var e = 0, 11412 i = [], 11413 n = !0, 11414 o = !1, 11415 s = void 0; 11416 try { 11417 for (var a, r = t[0][Symbol.iterator](); !(n = (a = r.next()).done); n = !0) e += a.value.colspan || 1 11418 } catch (t) { 11419 o = !0, s = t 11420 } finally { 11421 try { 11422 n || null == r.return || r.return() 11423 } finally { 11424 if (o) throw s 11425 } 11426 } 11427 for (var l = 0; l < t.length; l++) { 11428 i[l] = []; 11429 for (var c = 0; c < e; c++) i[l][c] = !1 11430 } 11431 for (var d = 0; d < t.length; d++) { 11432 var u = !0, 11433 h = !1, 11434 p = void 0; 11435 try { 11436 for (var f, m = t[d][Symbol.iterator](); !(u = (f = m.next()).done); u = !0) { 11437 var g = f.value, 11438 v = g.rowspan || 1, 11439 b = g.colspan || 1, 11440 y = i[d].indexOf(!1); 11441 g.colspanIndex = y, 1 === b ? (g.fieldIndex = y, void 0 === g.field && (g.field = y)) : g.colspanGroup = g.colspan; 11442 for (var w = 0; w < v; w++) 11443 for (var C = 0; C < b; C++) i[d + w][y + C] = !0 11444 } 11445 } catch (t) { 11446 h = !0, p = t 11447 } finally { 11448 try { 11449 u || null == m.return || m.return() 11450 } finally { 11451 if (h) throw p 11452 } 11453 } 11454 } 11455 }, 11456 normalizeAccent: function(t) { 11457 return "string" != typeof t ? t : t.normalize("NFD").replace(/[\u0300-\u036f]/g, "") 11458 }, 11459 updateFieldGroup: function(t) {
11460 var i = (o = []).concat.apply(o, fo(t)), 11461 e = !0, 11462 n = !1, 11463 o = void 0; 11464 try { 11465 for (var s, a = t[Symbol.iterator](); !(e = (s = a.next()).done); e = !0) { 11466 var r = s.value, 11467 l = !0, 11468 c = !1, 11469 d = void 0; 11470 try { 11471 for (var u, h = r[Symbol.iterator](); !(l = (u = h.next()).done); l = !0) { 11472 var p = u.value; 11473 if (1 < p.colspanGroup) { 11474 for (var f = 0, m = p.colspanIndex; m < p.colspanIndex + p.colspanGroup; m++) ! function(e) { 11475 i.find(function(t) { 11476 return t.fieldIndex === e 11477 }).visible && f++ 11478 }(m); 11479 p.colspan = f, p.visible = 0 < f 11480 } 11481 } 11482 } catch (t) { 11483 c = !0, d = t 11484 } finally { 11485 try { 11486 l || null == h.return || h.return() 11487 } finally { 11488 if (c) throw d 11489 } 11490 } 11491 } 11492 } catch (t) { 11493 n = !0, o = t 11494 } finally { 11495 try { 11496 e || null == a.return || a.return() 11497 } finally { 11498 if (n) throw o 11499 } 11500 } 11501 }, 11502 getScrollBarWidth: function() { 11503 var t, e, i; 11504 return void 0 === this.cachedWidth && (i = N("<div/>").addClass("fixed-table-scroll-inner"), (t = N("<div/>").addClass("fixed-table-scroll-outer")).append(i), N("body").append(t), e = i[0].offsetWidth, t.css("overflow", "scroll"), e === (i = i[0].offsetWidth) && (i = t[0].clientWidth), t.remove(), this.cachedWidth = e - i), this.cachedWidth 11505 }, 11506 calculateObjectValue: function(t, e) { 11507 var i = 2 < arguments.length && void 0 !== arguments[2] ? arguments[2] : [], 11508 n = 3 < arguments.length ? arguments[3] : void 0, 11509 o = e; 11510 if ("string" == typeof e) { 11511 var s = e.split("."); 11512 if (1 < s.length) { 11513 o = window; 11514 var a = !0, 11515 r = !1, 11516 l = void 0; 11517 try { 11518 for (var c, d = s[Symbol.iterator](); !(a = (c = d.next()).done); a = !0) o = o[c.value] 11519 } catch (t) { 11520 r = !0, l = t 11521 } finally { 11522 try { 11523 a || null == d.return || d.return() 11524 } finally { 11525 if (r) throw l 11526 } 11527 } 11528 } else o = window[e] 11529 } 11530 return null !== o && "object" === lo(o) ? o : "function" == typeof o ? o.apply(t, i || []) : !o && "string" == typeof e && this.sprintf.apply(this, [e].concat(fo(i))) ? this.sprintf.apply(this, [e].concat(fo(i))) : n 11531 }, 11532 compareObjects: function(t, e, i) { 11533 var n = Object.keys(t), 11534 o = Object.keys(e); 11535 if (i && n.length !== o.length) return !1; 11536 for (var s = 0, a = n; s < a.length; s++) { 11537 var r = a[s]; 11538 if (o.includes(r) && t[r] !== e[r]) return !1 11539 } 11540 return !0 11541 }, 11542 escapeHTML: function(t) { 11543 return "string" == typeof t ? t.replace(/&/g, "&").replace(/</g, "<").replace(/>/g, ">").replace(/"/g, """).replace(/'/g, "'").replace(/`/g, "`") : t 11544 }, 11545 unescapeHTML: function(t) { 11546 return "string" == typeof t ? t.replace(/&/g, "&").replace(/</g, "<").replace(/>/g, ">").replace(/"/g, '"').replace(/'/g, "'").replace(/`/g, "`") : t 11547 }, 11548 getRealDataAttr: function(t) { 11549 for (var e = 0, i = Object.entries(t); e < i.length; e++) { 11550 var n = po(i[e], 2), 11551 o = n[0], 11552 s = n[1], 11553 n = o.split(/(?=[A-Z])/).join("-").toLowerCase(); 11554 n !== o && (t[n] = s, delete t[o]) 11555 } 11556 return t 11557 }, 11558 getItemField: function(t, e, i) { 11559 var n = t; 11560 if ("string" != typeof e || t.hasOwnProperty(e)) return i ? this.escapeHTML(t[e]) : t[e]; 11561 var o = e.split("."), 11562 s = !0, 11563 a = !1, 11564 e = void 0; 11565 try { 11566 for (var r, l = o[Symbol.iterator](); !(s = (r = l.next()).done); s = !0) var c = r.value, 11567 n = n && n[c] 11568 } catch (t) { 11569 a = !0, e = t 11570 } finally { 11571 try { 11572 s || null == l.return || l.return() 11573 } finally { 11574 if (a) throw e 11575 } 11576 } 11577 return i ? this.escapeHTML(n) : n 11578 }, 11579 isIEBrowser: function() { 11580 return navigator.userAgent.includes("MSIE ") || /Trident.*rv:11\./.test(navigator.userAgent) 11581 }, 11582 findIndex: function(t, e) { 11583 var i = !0, 11584 n = !1, 11585 o = void 0; 11586 try { 11587 for (var s, a = t[Symbol.iterator](); !(i = (s = a.next()).done); i = !0) { 11588 var r = s.value; 11589 if (JSON.stringify(r) === JSON.stringify(e)) return t.indexOf(r) 11590 } 11591 } catch (t) { 11592 n = !0, o = t 11593 } finally { 11594 try { 11595 i || null == a.return || a.return() 11596 } finally { 11597 if (n) throw o 11598 } 11599 } 11600 return -1 11601 }, 11602 trToData: function(c, t) { 11603 var d = this, 11604 e = [], 11605 u = []; 11606 return t.each(function(r, t) { 11607 var t = N(t), 11608 l = {}; 11609 l._id = t.attr("id"), l._class = t.attr("class"), l._data = d.getRealDataAttr(t.data()), l._style = t.attr("style"), t.find(">td,>th").each(function(t, e) { 11610 for (var e = N(e), i = +e.attr("colspan") || 1, n = +e.attr("rowspan") || 1, o = t; u[r] && u[r][o]; o++); 11611 for (var s = o; s < o + i; s++) 11612 for (var a = r; a < r + n; a++) u[a] || (u[a] = []), u[a][s] = !0; 11613 t = c[o].field; 11614 l[t] = e.html().trim(), l["_".concat(t, "_id")] = e.attr("id"), l["_".concat(t, "_class")] = e.attr("class"), l["_".concat(t, "_rowspan")] = e.attr("rowspan"), l["_".concat(t, "_colspan")] = e.attr("colspan"), l["_".concat(t, "_title")] = e.attr("title"), l["_".concat(t, "_data")] = d.getRealDataAttr(e.data()), l["_".concat(t, "_style")] = e.attr("style") 11615 }), e.push(l) 11616 }), e 11617 }, 11618 sort: function(t, e, i, n, o, s) { 11619 return null == t && (t = ""), null == e && (e = ""), n && t === e && (t = o, e = s), this.isNumeric(t) && this.isNumeric(e) ? (t = parseFloat(t)) < (e = parseFloat(e)) ? -1 * i : e < t ? i : 0 : t === e ? 0 : -1 === (t = "string" != typeof t ? t.toString() : t).localeCompare(e) ? -1 * i : i 11620 }, 11621 getEventName: function(t) { 11622 var e = (e = 1 < arguments.length && void 0 !== arguments[1] ? arguments[1] : "") || "".concat(+new Date).concat(~~(1e6 * Math.random())); 11623 return "".concat(t, "-").concat(e) 11624 },
11625 hasDetailViewIcon: function(t) { 11626 return t.detailView && t.detailViewIcon && !t.cardView 11627 }, 11628 getDetailViewIndexOffset: function(t) { 11629 return this.hasDetailViewIcon(t) && "right" !== t.detailViewAlign ? 1 : 0 11630 }, 11631 checkAutoMergeCells: function(t) { 11632 var e = !0, 11633 i = !1, 11634 n = void 0; 11635 try { 11636 for (var o, s = t[Symbol.iterator](); !(e = (o = s.next()).done); e = !0) 11637 for (var a = o.value, r = 0, l = Object.keys(a); r < l.length; r++) { 11638 var c = l[r]; 11639 if (c.startsWith("_") && (c.endsWith("_rowspan") || c.endsWith("_colspan"))) return !0 11640 } 11641 } catch (t) { 11642 i = !0, n = t 11643 } finally { 11644 try { 11645 e || null == s.return || s.return() 11646 } finally { 11647 if (i) throw n 11648 } 11649 } 11650 return !1 11651 }, 11652 deepCopy: function(t) { 11653 return void 0 === t ? t : N.extend(!0, Array.isArray(t) ? [] : {}, t) 11654 } 11655 }, 11656 To = (ho(ko, [{ 11657 key: "initDOM", 11658 value: function(t, e) { 11659 void 0 === this.clusterHeight && (this.cache.scrollTop = this.scrollEl.scrollTop, this.cache.data = this.contentEl.innerHTML = t[0] + t[0] + t[0], this.getRowsHeight(t)); 11660 var i = this.initData(t, this.getNum(e)), 11661 n = i.rows.join(""), 11662 o = this.checkChanges("data", n), 11663 s = this.checkChanges("top", i.topOffset), 11664 a = this.checkChanges("bottom", i.bottomOffset), 11665 t = []; 11666 o && s ? (i.topOffset && t.push(this.getExtra("top", i.topOffset)), t.push(n), i.bottomOffset && t.push(this.getExtra("bottom", i.bottomOffset)), this.contentEl.innerHTML = t.join(""), e && (this.contentEl.scrollTop = this.cache.scrollTop)) : a && (this.contentEl.lastChild.style.height = "".concat(i.bottomOffset, "px")) 11667 } 11668 }, { 11669 key: "getRowsHeight", 11670 value: function() { 11671 var t; 11672 void 0 === this.itemHeight && (t = (t = this.contentEl.children)[Math.floor(t.length / 2)], this.itemHeight = t.offsetHeight), this.blockHeight = 50 * this.itemHeight, this.clusterRows = 200, this.clusterHeight = 4 * this.blockHeight 11673 } 11674 }, { 11675 key: "getNum", 11676 value: function(t) { 11677 return this.scrollTop = (t ? this.cache : this.scrollEl).scrollTop, Math.floor(this.scrollTop / (this.clusterHeight - this.blockHeight)) || 0 11678 } 11679 }, { 11680 key: "initData", 11681 value: function(t, e) { 11682 if (t.length < 50) return { 11683 topOffset: 0, 11684 bottomOffset: 0, 11685 rowsAbove: 0, 11686 rows: t 11687 }; 11688 var i = Math.max((this.clusterRows - 50) * e, 0), 11689 n = i + this.clusterRows, 11690 o = Math.max(i * this.itemHeight, 0), 11691 s = Math.max((t.length - n) * this.itemHeight, 0), 11692 a = [], 11693 e = i; 11694 o < 1 && e++; 11695 for (var r = i; r < n; r++) t[r] && a.push(t[r]); 11696 return { 11697 topOffset: o, 11698 bottomOffset: s, 11699 rowsAbove: e, 11700 rows: a 11701 } 11702 } 11703 }, { 11704 key: "checkChanges", 11705 value: function(t, e) { 11706 var i = e !== this.cache[t]; 11707 return this.cache[t] = e, i 11708 } 11709 }, { 11710 key: "getExtra", 11711 value: function(t, e) { 11712 var i = document.createElement("tr"); 11713 return i.className = "virtual-scroll-".concat(t), e && (i.style.height = "".concat(e, "px")), i.outerHTML 11714 } 11715 }]), ko), 11716 $o = (ho(Eo, [{ 11717 key: "init", 11718 value: function() { 11719 this.initConstants(), this.initLocale(), this.initContainer(), this.initTable(), this.initHeader(), this.initData(), this.initHiddenRows(), this.initToolbar(), this.initPagination(), this.initBody(), this.initSearchText(), this.initServer() 11720 } 11721 }, { 11722 key: "initConstants", 11723 value: function() { 11724 var t = this.options; 11725 this.constants = vo.CONSTANTS, this.constants.theme = N.fn.bootstrapTable.theme; 11726 var e = t.buttonsPrefix ? "".concat(t.buttonsPrefix, "-") : ""; 11727 this.constants.buttonsClass = [t.buttonsPrefix, e + t.buttonsClass, So.sprintf("".concat(e, "%s"), t.iconSize)].join(" ").trim(), this.buttons = So.calculateObjectValue(this, t.buttons, [], []) 11728 } 11729 }, { 11730 key: "initLocale", 11731 value: function() { 11732 var t, e; 11733 this.options.locale && (t = N.fn.bootstrapTable.locales, (e = this.options.locale.split(/-|_/))[0] = e[0].toLowerCase(), e[1] && (e[1] = e[1].toUpperCase()), t[this.options.locale] ? N.extend(this.options, t[this.options.locale]) : t[e.join("-")] ? N.extend(this.options, t[e.join("-")]) : t[e[0]] && N.extend(this.options, t[e[0]])) 11734 } 11735 }, { 11736 key: "initContainer", 11737 value: function() { 11738 var t = ["top", "both"].includes(this.options.paginationVAlign) ? '<div class="fixed-table-pagination clearfix"></div>' : "", 11739 e = ["bottom", "both"].includes(this.options.paginationVAlign) ? '<div class="fixed-table-pagination"></div>' : "", 11740 i = So.calculateObjectValue(this.options, this.options.loadingTemplate, [this.options.formatLoadingMessage()]); 11741 this.$container = N('\n <div class="bootstrap-table '.concat(this.constants.theme, '">\n <div class="fixed-table-toolbar"></div>\n ').concat(t, '\n <div class="fixed-table-container">\n <div class="fixed-table-header"><table></table></div>\n <div class="fixed-table-body">\n <div class="fixed-table-loading">\n ').concat(i, '\n </div>\n </div>\n <div class="fixed-table-footer"><table><thead><tr></tr></thead></table></div>\n </div>\n ').concat(e, "\n </div>\n ")), this.$container.insertAfter(this.$el), this.$tableContainer = this.$container.find(".fixed-table-container"), this.$tableHeader = this.$container.find(".fixed-table-header"), this.$tableBody = this.$container.find(".fixed-table-body"), this.$tableLoading = this.$container.find(".fixed-table-loading"), this.$tableFooter = this.$el.find("tfoot"), this.options.buttonsToolbar ? this.$toolbar = N("body").find(this.options.buttonsToolbar) : this.$toolbar = this.$container.find(".fixed-table-toolbar"), this.$pagination = this.$container.find(".fixed-table-pagination"), this.$tableBody.append(this.$el), this.$container.after('<div class="clearfix"></div>'), this.$el.addClass(this.options.classes), this.$tableLoading.addClass(this.options.classes), this.options.height && (this.$tableContainer.addClass("fixed-height"), this.options.showFooter && this.$tableContainer.addClass("has-footer"), this.options.classes.split(" ").includes("table-bordered") && (this.$tableBody.append('<div class="fixed-table-border"></div>'), this.$tableBorder = this.$tableBody.find(".fixed-table-border"), this.$tableLoading.addClass("fixed-table-border")), this.$tableFooter = this.$container.find(".fixed-table-footer")) 11742 } 11743 }, { 11744 key: "initTable", 11745 value: function() { 11746 var t, n = this, 11747 o = []; 11748 this.$header = this.$el.find(">thead"), this.$header.length ? this.options.theadClasses && this.$header.addClass(this.options.theadClasses) : this.$header = N('<thead class="'.concat(this.options.theadClasses, '"></thead>')).appendTo(this.$el), this._headerTrClasses = [], this._headerTrStyles = [], this.$header.find("tr").each(function(t, e) { 11749 var e = N(e), 11750 i = []; 11751 e.find("th").each(function(t, e) { 11752 e = N(e); 11753 void 0 !== e.data("field") && e.data("field", "".concat(e.data("field"))), i.push(N.extend({}, { 11754 title: e.html(), 11755 class: e.attr("class"), 11756 titleTooltip: e.attr("title"), 11757 rowspan: e.attr("rowspan") ? +e.attr("rowspan") : void 0, 11758 colspan: e.attr("colspan") ? +e.attr("colspan") : void 0 11759 }, e.data())) 11760 }), o.push(i), e.attr("class") && n._headerTrClasses.push(e.attr("class")), e.attr("style") && n._headerTrStyles.push(e.attr("style")) 11761 }), Array.isArray(this.options.columns[0]) || (this.options.columns = [this.options.columns]), this.options.columns = N.extend(!0, [], o, this.options.columns), this.columns = [], this.fieldsColumnsIndex = [], So.setFieldIndex(this.options.columns), this.options.columns.forEach(function(t, i) { 11762 t.forEach(function(t, e) { 11763 t = N.extend({}, Eo.COLUMN_DEFAULTS, t);
11764 void 0 !== t.fieldIndex && (n.columns[t.fieldIndex] = t, n.fieldsColumnsIndex[t.field] = t.fieldIndex), n.options.columns[i][e] = t 11765 }) 11766 }), this.options.data.length || (t = So.trToData(this.columns, this.$el.find(">tbody>tr"))).length && (this.options.data = t, this.fromHtml = !0), this.options.pagination && "server" !== this.options.sidePagination || (this.footerData = So.trToData(this.columns, this.$el.find(">tfoot>tr"))), this.footerData && this.$el.find("tfoot").html("<tr></tr>"), !this.options.showFooter || this.options.cardView ? this.$tableFooter.hide() : this.$tableFooter.show() 11767 } 11768 }, { 11769 key: "initHeader", 11770 value: function() { 11771 var f = this, 11772 m = {}, 11773 g = []; 11774 this.header = { 11775 fields: [], 11776 styles: [], 11777 classes: [], 11778 formatters: [], 11779 detailFormatters: [], 11780 events: [], 11781 sorters: [], 11782 sortNames: [], 11783 cellStyles: [], 11784 searchables: [] 11785 }, So.updateFieldGroup(this.options.columns), this.options.columns.forEach(function(t, p) { 11786 g.push("<tr".concat(So.sprintf(' class="%s"', f._headerTrClasses[p]), " ").concat(So.sprintf(' style="%s"', f._headerTrStyles[p]), ">")); 11787 var e = ""; 11788 (e = 0 === p && So.hasDetailViewIcon(f.options) ? '<th class="detail" rowspan="'.concat(f.options.columns.length, '">\n <div class="fht-cell"></div>\n </th>') : e) && "right" !== f.options.detailViewAlign && g.push(e), t.forEach(function(t, e) { 11789 var i = So.sprintf(' class="%s"', t.class), 11790 n = t.widthUnit, 11791 o = parseFloat(t.width), 11792 s = So.sprintf("text-align: %s; ", t.halign || t.align), 11793 a = So.sprintf("text-align: %s; ", t.align), 11794 r = So.sprintf("vertical-align: %s; ", t.valign); 11795 if (r += So.sprintf("width: %s; ", !t.checkbox && !t.radio || o ? o ? o + n : void 0 : t.showSelectTitle ? void 0 : "36px"), void 0 !== t.fieldIndex || t.visible) { 11796 var o = So.calculateObjectValue(null, f.options.headerStyle, [t]), 11797 l = [], 11798 n = ""; 11799 if (o && o.css) 11800 for (var c = 0, d = Object.entries(o.css); c < d.length; c++) { 11801 var u = po(d[c], 2), 11802 h = u[0], 11803 u = u[1]; 11804 l.push("".concat(h, ": ").concat(u)) 11805 } 11806 if (o && o.classes && (n = So.sprintf(' class="%s"', t.class ? [t.class, o.classes].join(" ") : o.classes)), void 0 !== t.fieldIndex) { 11807 if (f.header.fields[t.fieldIndex] = t.field, f.header.styles[t.fieldIndex] = a + r, f.header.classes[t.fieldIndex] = i, f.header.formatters[t.fieldIndex] = t.formatter, f.header.detailFormatters[t.fieldIndex] = t.detailFormatter, f.header.events[t.fieldIndex] = t.events, f.header.sorters[t.fieldIndex] = t.sorter, f.header.sortNames[t.fieldIndex] = t.sortName, f.header.cellStyles[t.fieldIndex] = t.cellStyle, f.header.searchables[t.fieldIndex] = t.searchable, !t.visible) return; 11808 if (f.options.cardView && !t.cardVisible) return; 11809 m[t.field] = t 11810 } 11811 g.push("<th".concat(So.sprintf(' title="%s"', t.titleTooltip)), t.checkbox || t.radio ? So.sprintf(' class="bs-checkbox %s"', t.class || "") : n || i, So.sprintf(' style="%s"', s + r + l.join("; ")), So.sprintf(' rowspan="%s"', t.rowspan), So.sprintf(' colspan="%s"', t.colspan), So.sprintf(' data-field="%s"', t.field), 0 === e && 0 < p ? " data-not-first-th" : "", ">"), g.push(So.sprintf('<div class="th-inner %s">', f.options.sortable && t.sortable ? "sortable both" : "")); 11812 r = f.options.escape ? So.escapeHTML(t.title) : t.title, e = r; 11813 t.checkbox && (r = "", !f.options.singleSelect && f.options.checkboxHeader && (r = '<label><input name="btSelectAll" type="checkbox" /><span></span></label>'), f.header.stateField = t.field), t.radio && (r = "", f.header.stateField = t.field), !r && t.showSelectTitle && (r += e), g.push(r), g.push("</div>"), g.push('<div class="fht-cell"></div>'), g.push("</div>"), g.push("</th>") 11814 } 11815 }), e && "right" === f.options.detailViewAlign && g.push(e), g.push("</tr>") 11816 }), this.$header.html(g.join("")), this.$header.find("th[data-field]").each(function(t, e) { 11817 N(e).data(m[N(e).data("field")]) 11818 }), this.$container.off("click", ".th-inner").on("click", ".th-inner", function(t) { 11819 var e = N(t.currentTarget);
11820 if (f.options.detailView && !e.parent().hasClass("bs-checkbox") && e.closest(".bootstrap-table")[0] !== f.$container[0]) return !1; 11821 f.options.sortable && e.parent().data().sortable && f.onSort(t) 11822 }), this.$header.children().children().off("keypress").on("keypress", function(t) { 11823 f.options.sortable && N(t.currentTarget).data().sortable && 13 === (t.keyCode || t.which) && f.onSort(t) 11824 }); 11825 var t = So.getEventName("resize.bootstrap-table", this.$el.attr("id")); 11826 N(window).off(t), !this.options.showHeader || this.options.cardView ? (this.$header.hide(), this.$tableHeader.hide(), this.$tableLoading.css("top", 0)) : (this.$header.show(), this.$tableHeader.show(), this.$tableLoading.css("top", this.$header.outerHeight() + 1), this.getCaret(), N(window).on(t, function() { 11827 return f.resetView() 11828 })), this.$selectAll = this.$header.find('[name="btSelectAll"]'), this.$selectAll.off("click").on("click", function(t) { 11829 t.stopPropagation(); 11830 t = N(t.currentTarget).prop("checked"); 11831 f[t ? "checkAll" : "uncheckAll"](), f.updateSelected() 11832 }) 11833 } 11834 }, { 11835 key: "initData", 11836 value: function(t, e) { 11837 "append" === e ? this.options.data = this.options.data.concat(t) : "prepend" === e ? this.options.data = [].concat(t).concat(this.options.data) : (t = t || So.deepCopy(this.options.data), this.options.data = Array.isArray(t) ? t : t[this.options.dataField]), this.data = fo(this.options.data), this.options.sortReset && (this.unsortedData = fo(this.data)), "server" !== this.options.sidePagination && this.initSort() 11838 } 11839 }, { 11840 key: "initSort", 11841 value: function() { 11842 var s = this, 11843 a = this.options.sortName, 11844 r = "desc" === this.options.sortOrder ? -1 : 1, 11845 l = this.header.fields.indexOf(this.options.sortName); - 1 !== l ? (this.options.sortStable && this.data.forEach(function(t, e) { 11846 t.hasOwnProperty("_position") || (t._position = e) 11847 }), this.options.customSort ? So.calculateObjectValue(this.options, this.options.customSort, [this.options.sortName, this.options.sortOrder, this.data]) : this.data.sort(function(t, e) { 11848 s.header.sortNames[l] && (a = s.header.sortNames[l]); 11849 var i = So.getItemField(t, a, s.options.escape), 11850 n = So.getItemField(e, a, s.options.escape), 11851 o = So.calculateObjectValue(s.header, s.header.sorters[l], [i, n, t, e]); 11852 return void 0 !== o ? s.options.sortStable && 0 === o ? r * (t._position - e._position) : r * o : So.sort(i, n, r, s.options.sortStable, t._position, e._position) 11853 }), void 0 !== this.options.sortClass && (clearTimeout(0), setTimeout(function() { 11854 s.$el.removeClass(s.options.sortClass); 11855 var t = s.$header.find('[data-field="'.concat(s.options.sortName, '"]')).index(); 11856 s.$el.find("tr td:nth-child(".concat(t + 1, ")")).addClass(s.options.sortClass) 11857 }, 250))) : this.options.sortReset && (this.data = fo(this.unsortedData)) 11858 } 11859 }, { 11860 key: "onSort", 11861 value: function(t) { 11862 var e = t.type, 11863 i = t.currentTarget, 11864 t = "keypress" === e ? N(i) : N(i).parent(), 11865 e = this.$header.find("th").eq(t.index()); 11866 if (this.$header.add(this.$header_).find("span.order").remove(), this.options.sortName === t.data("field") ? (void 0 === (i = this.options.sortOrder) ? this.options.sortOrder = "asc" : "asc" === i ? this.options.sortOrder = "desc" : "desc" === this.options.sortOrder && (this.options.sortOrder = this.options.sortReset ? void 0 : "asc"), void 0 === this.options.sortOrder && (this.options.sortName = void 0)) : (this.options.sortName = t.data("field"), this.options.rememberOrder ? this.options.sortOrder = "asc" === t.data("order") ? "desc" : "asc" : this.options.sortOrder = this.columns[this.fieldsColumnsIndex[t.data("field")]].sortOrder || this.columns[this.fieldsColumnsIndex[t.data("field")]].order), this.trigger("sort", this.options.sortName, this.options.sortOrder), t.add(e).data("order", this.options.sortOrder), this.getCaret(), "server" === this.options.sidePagination && this.options.serverSort) return this.options.pageNumber = 1, void this.initServer(this.options.silentSort); 11867 this.initSort(), this.initBody() 11868 } 11869 }, { 11870 key: "initToolbar", 11871 value: function() { 11872 var a = this, 11873 r = this.options, 11874 t = [], 11875 i = 0, 11876 l = 0; 11877 this.$toolbar.find(".bs-bars").children().length && N("body").append(N(r.toolbar)), this.$toolbar.html(""), "string" != typeof r.toolbar && "object" !== lo(r.toolbar) || N(So.sprintf('<div class="bs-bars %s-%s"></div>', this.constants.classes.pull, r.toolbarAlign)).appendTo(this.$toolbar).append(N(r.toolbar)), t = ['<div class="'.concat(["columns", "columns-".concat(r.buttonsAlign), this.constants.classes.buttonsGroup, "".concat(this.constants.classes.pull, "-").concat(r.buttonsAlign)].join(" "), '">')], "string" == typeof r.icons && (r.icons = So.calculateObjectValue(null, r.icons)), "string" == typeof r.buttonsOrder && (r.buttonsOrder = r.buttonsOrder.replace(/\[|\]| |'/g, "").toLowerCase().split(",")), this.buttons = Object.assign(this.buttons, { 11878 paginationSwitch: { 11879 text: r.pagination ? r.formatPaginationSwitchUp() : r.formatPaginationSwitchDown(), 11880 icon: r.pagination ? r.icons.paginationSwitchDown : r.icons.paginationSwitchUp, 11881 render: !1, 11882 event: this.togglePagination, 11883 attributes: { 11884 "aria-label": r.formatPaginationSwitch(), 11885 title: r.formatPaginationSwitch() 11886 } 11887 }, 11888 refresh: { 11889 text: r.formatRefresh(), 11890 icon: r.icons.refresh, 11891 render: !1, 11892 event: this.refresh, 11893 attributes: { 11894 "aria-label": r.formatRefresh(), 11895 title: r.formatRefresh() 11896 } 11897 }, 11898 toggle: { 11899 text: r.formatToggle(), 11900 icon: r.icons.toggleOff, 11901 render: !1, 11902 event: this.toggleView, 11903 attributes: { 11904 "aria-label": r.formatToggleOn(), 11905 title: r.formatToggleOn() 11906 } 11907 }, 11908 fullscreen: { 11909 text: r.formatFullscreen(), 11910 icon: r.icons.fullscreen, 11911 render: !1, 11912 event: this.toggleFullscreen, 11913 attributes: { 11914 "aria-label": r.formatFullscreen(), 11915 title: r.formatFullscreen() 11916 } 11917 }, 11918 columns: { 11919 render: !1, 11920 html: function() { 11921 var t, o = []; 11922 o.push('<div class="keep-open '.concat(a.constants.classes.buttonsDropdown, '" title="').concat(r.formatColumns(), '">\n <button class="').concat(a.constants.buttonsClass, ' dropdown-toggle" type="button" data-toggle="dropdown"\n aria-label="Columns" title="').concat(r.formatColumns(), '">\n ').concat(r.showButtonIcons ? So.sprintf(a.constants.html.icon, r.iconsPrefix, r.icons.columns) : "", "\n ").concat(r.showButtonText ? r.formatColumns() : "", "\n ").concat(a.constants.html.dropdownCaret, "\n </button>\n ").concat(a.constants.html.toolbarDropdown[0])), r.showColumnsSearch && (o.push(So.sprintf(a.constants.html.toolbarDropdownItem, So.sprintf('<input type="text" class="%s" name="columnsSearch" placeholder="%s" autocomplete="off">', a.constants.classes.input, r.formatSearch()))), o.push(a.constants.html.toolbarDropdownSeparator)), r.showColumnsToggleAll && (t = a.getVisibleColumns().length === a.columns.filter(function(t) { 11923 return !a.isSelectionColumn(t) 11924 }).length, o.push(So.sprintf(a.constants.html.toolbarDropdownItem, So.sprintf('<input type="checkbox" class="toggle-all" %s> <span>%s</span>', t ? 'checked="checked"' : "", r.formatColumnsToggleAll()))), o.push(a.constants.html.toolbarDropdownSeparator)); 11925 var s = 0; 11926 return a.columns.forEach(function(t, e) { 11927 t.visible && s++ 11928 }), a.columns.forEach(function(t, e) { 11929 var i, n; 11930 a.isSelectionColumn(t) || r.cardView && !t.cardVisible || (i = t.visible ? ' checked="checked"' : "", n = s <= r.minimumCountColumns && i ? ' disabled="disabled"' : "", t.switchable && (o.push(So.sprintf(a.constants.html.toolbarDropdownItem, So.sprintf('<input type="checkbox" data-field="%s" value="%s"%s%s> <span>%s</span>', t.field, e, i, n, t.title))), l++)) 11931 }), o.push(a.constants.html.toolbarDropdown[1], "</div>"), o.join("") 11932 } 11933 } 11934 }); 11935 for (var e = {}, n = 0, o = Object.entries(this.buttons); n < o.length; n++) { 11936 var s = po(o[n], 2), 11937 c = s[0], 11938 d = s[1], 11939 u = void 0;
11940 if (d.hasOwnProperty("html")) u = So.calculateObjectValue(r, d.html); 11941 else { 11942 if (u = '<button class="'.concat(this.constants.buttonsClass, '" type="button" name="').concat(c, '"'), d.hasOwnProperty("attributes")) 11943 for (var h = 0, p = Object.entries(d.attributes); h < p.length; h++) { 11944 var f = po(p[h], 2), 11945 m = f[0], 11946 f = f[1]; 11947 u += " ".concat(m, '="').concat(So.calculateObjectValue(r, f), '"') 11948 } 11949 u += ">", r.showButtonIcons && d.hasOwnProperty("icon") && (g = So.calculateObjectValue(r, d.icon), u += So.sprintf(this.constants.html.icon, r.iconsPrefix, g) + " "), r.showButtonText && d.hasOwnProperty("text") && (u += So.calculateObjectValue(r, d.text)), u += "</button>" 11950 } 11951 e[c] = u; 11952 var s = "show".concat(c.charAt(0).toUpperCase()).concat(c.substring(1)), 11953 g = r[s]; 11954 !(!d.hasOwnProperty("render") || d.hasOwnProperty("render") && d.render) || void 0 !== g && !0 !== g || (r[s] = !0), r.buttonsOrder.includes(c) || r.buttonsOrder.push(c) 11955 } 11956 var v = !0, 11957 b = !1, 11958 y = void 0; 11959 try { 11960 for (var w, C = r.buttonsOrder[Symbol.iterator](); !(v = (w = C.next()).done); v = !0) { 11961 var x = w.value; 11962 r["show".concat(x.charAt(0).toUpperCase()).concat(x.substring(1))] && t.push(e[x]) 11963 } 11964 } catch (t) { 11965 b = !0, y = t 11966 } finally { 11967 try { 11968 v || null == C.return || C.return() 11969 } finally { 11970 if (b) throw y 11971 } 11972 } 11973 t.push("</div>"), (this.showToolbar || 2 < t.length) && this.$toolbar.append(t.join("")); 11974 for (var _, S, T, $ = 0, E = Object.entries(this.buttons); $ < E.length; $++) { 11975 var k = po(E[$], 2), 11976 I = k[0], 11977 O = k[1]; 11978 if (O.hasOwnProperty("event") && ("function" != typeof O.event && "string" != typeof O.event || "continue" !== function() { 11979 var t = "string" == typeof O.event ? window[O.event] : O.event; 11980 return a.$toolbar.find('button[name="'.concat(I, '"]')).off("click").on("click", function() { 11981 return t.call(a) 11982 }), "continue" 11983 }())) 11984 for (var z = 0, A = Object.entries(O.event); z < A.length; z++) ! function() { 11985 var t = po(A[z], 2), 11986 e = t[0], 11987 t = t[1], 11988 i = "string" == typeof t ? window[t] : t; 11989 a.$toolbar.find('button[name="'.concat(I, '"]')).off(e).on(e, function() { 11990 return i.call(a) 11991 }) 11992 }() 11993 } 11994 r.showColumns && (_ = (D = this.$toolbar.find(".keep-open")).find('input[type="checkbox"]:not(".toggle-all")'), S = D.find('input[type="checkbox"].toggle-all'), l <= r.minimumCountColumns && D.find("input").prop("disabled", !0), D.find("li, label").off("click").on("click", function(t) { 11995 t.stopImmediatePropagation() 11996 }), _.off("click").on("click", function(t) { 11997 t = t.currentTarget, t = N(t); 11998 a._toggleColumn(t.val(), t.prop("checked"), !1), a.trigger("column-switch", t.data("field"), t.prop("checked")), S.prop("checked", _.filter(":checked").length === a.columns.filter(function(t) { 11999 return !a.isSelectionColumn(t) 12000 }).length) 12001 }), S.off("click").on("click", function(t) { 12002 t = t.currentTarget; 12003 a._toggleAllColumns(N(t).prop("checked")) 12004 }), r.showColumnsSearch && (L = D.find('[name="columnsSearch"]'), T = D.find(".dropdown-item-marker"), L.on("keyup paste change", function(t) { 12005 var t = t.currentTarget, 12006 i = N(t).val().toLowerCase(); 12007 T.show(), _.each(function(t, e) { 12008 e = N(e).parents(".dropdown-item-marker"); 12009 e.text().toLowerCase().includes(i) || e.hide() 12010 }) 12011 }))); 12012 12013 function P(t) { 12014 var e = "keyup drop blur mouseup"; 12015 t.off(e).on(e, function(t) { 12016 r.searchOnEnterKey && 13 !== t.keyCode || [37, 38, 39, 40].includes(t.keyCode) || (clearTimeout(i), i = setTimeout(function() { 12017 a.onSearch({ 12018 currentTarget: t.currentTarget 12019 }) 12020 }, r.searchTimeOut)) 12021 }) 12022 } 12023 var D, L, M; 12024 (r.search || this.showSearchClearButton) && "string" != typeof r.searchSelector ? (t = [], b = So.sprintf(this.constants.html.searchButton, this.constants.buttonsClass, r.formatSearch(), r.showButtonIcons ? So.sprintf(this.constants.html.icon, r.iconsPrefix, r.icons.search) : "", r.showButtonText ? r.formatSearch() : ""), y = So.sprintf(this.constants.html.searchClearButton, this.constants.buttonsClass, r.formatClearSearch(), r.showButtonIcons ? So.sprintf(this.constants.html.icon, r.iconsPrefix, r.icons.clearSearch) : "", r.showButtonText ? r.formatClearSearch() : ""), L = D = '<input class="'.concat(this.constants.classes.input, "\n ").concat(So.sprintf(" %s%s", this.constants.classes.inputPrefix, r.iconSize), '\n search-input" type="search" placeholder="').concat(r.formatSearch(), '" autocomplete="off">'), (r.showSearchButton || r.showSearchClearButton) && (y = (r.showSearchButton ? b : "") + (r.showSearchClearButton ? y : ""), L = r.search ? So.sprintf(this.constants.html.inputGroup, D, y) : y), t.push(So.sprintf('\n <div class="'.concat(this.constants.classes.pull, "-").concat(r.searchAlign, " search ").concat(this.constants.classes.inputGroup, '">\n %s\n </div>\n '), L)), this.$toolbar.append(t.join("")), M = So.getSearchInput(this), r.showSearchButton ? (this.$toolbar.find(".search button[name=search]").off("
12024click").on("click", function(t) { 12025 clearTimeout(i), i = setTimeout(function() { 12026 a.onSearch({ 12027 currentTarget: M 12028 }) 12029 }, r.searchTimeOut) 12030 }), r.searchOnEnterKey && P(M)) : P(M), r.showSearchClearButton && this.$toolbar.find(".search button[name=clearSearch]").click(function() { 12031 a.resetSearch() 12032 })) : "string" == typeof r.searchSelector && P(So.getSearchInput(this)) 12033 } 12034 }, { 12035 key: "onSearch", 12036 value: function() { 12037 var t = 0 < arguments.length && void 0 !== arguments[0] ? arguments[0] : {}, 12038 e = t.currentTarget, 12039 i = t.firedByInitSearchText, 12040 t = !(1 < arguments.length && void 0 !== arguments[1]) || arguments[1]; 12041 if (void 0 !== e && N(e).length && t) { 12042 t = N(e).val().trim(); 12043 if (this.options.trimOnSearch && N(e).val() !== t && N(e).val(t), this.searchText === t) return; 12044 e !== So.getSearchInput(this)[0] && !N(e).hasClass("search-input") || (this.searchText = t, this.options.searchText = t) 12045 } 12046 i || (this.options.pageNumber = 1), this.initSearch(), i && "client" !== this.options.sidePagination || this.updatePagination(), this.trigger("search", this.searchText) 12047 } 12048 }, { 12049 key: "initSearch", 12050 value: function() { 12051 var u = this; 12052 if (this.filterOptions = this.filterOptions || this.options.filterOptions, "server" !== this.options.sidePagination) { 12053 if (this.options.customSearch) return this.data = So.calculateObjectValue(this.options, this.options.customSearch, [this.options.data, this.searchText, this.filterColumns]), void(this.options.sortReset && (this.unsortedData = fo(this.data))); 12054 var h = this.searchText && (this.fromHtml ? So.escapeHTML(this.searchText) : this.searchText).toLowerCase(), 12055 a = So.isEmptyObject(this.filterColumns) ? null : this.filterColumns; 12056 "function" == typeof this.filterOptions.filterAlgorithm ? this.data = this.options.data.filter(function(t, e) { 12057 return u.filterOptions.filterAlgorithm.apply(null, [t, a]) 12058 }) : "string" == typeof this.filterOptions.filterAlgorithm && (this.data = a ? this.options.data.filter(function(t, e) { 12059 var i = u.filterOptions.filterAlgorithm; 12060 if ("and" === i) { 12061 for (var n in a) 12062 if (Array.isArray(a[n]) && !a[n].includes(t[n]) || !Array.isArray(a[n]) && t[n] !== a[n]) return !1 12063 } else if ("or" === i) { 12064 var o, s = !1; 12065 for (o in a)(Array.isArray(a[o]) && a[o].includes(t[o]) || !Array.isArray(a[o]) && t[o] === a[o]) && (s = !0); 12066 return s 12067 } 12068 return !0 12069 }) : fo(this.options.data)); 12070 var p = this.getVisibleFields(); 12071 this.data = h ? this.data.filter(function(t, e) { 12072 for (var i = 0; i < u.header.fields.length; i++) 12073 if (u.header.searchables[i] && (!u.options.visibleSearch || -1 !== p.indexOf(u.header.fields[i]))) { 12074 var n = So.isNumeric(u.header.fields[i]) ? parseInt(u.header.fields[i], 10) : u.header.fields[i], 12075 o = u.columns[u.fieldsColumnsIndex[n]], 12076 s = void 0; 12077 if ("string" == typeof n) 12078 for (var s = t, a = n.split("."), r = 0; r < a.length; r++) null !== s[a[r]] && (s = s[a[r]]); 12079 else s = t[n]; 12080 if (u.options.searchAccentNeutralise && (s = So.normalizeAccent(s)), "string" == typeof(s = o && o.searchFormatter ? So.calculateObjectValue(o, u.header.formatters[i], [s, t, e, o.field], s) : s) || "number" == typeof s) 12081 if (u.options.strictSearch) { 12082 if ("".concat(s).toLowerCase() === h) return !0 12083 } else { 12084 var n = /(?:(<=|=>|=<|>=|>|<)(?:\s+)?(\d+)?|(\d+)?(\s+)?(<=|=>|=<|>=|>|<))/gm.exec(h), 12085 l = !1; 12086 if (n) { 12087 var o = n[1] || "".concat(n[5], "l"), 12088 n = n[2] || n[3], 12089 c = parseInt(s, 10), 12090 d = parseInt(n, 10); 12091 switch (o) { 12092 case ">": 12093 case "<l": 12094 l = d < c; 12095 break; 12096 case "<": 12097 case ">l": 12098 l = c < d; 12099 break; 12100 case "<=": 12101 case "=<": 12102 case ">=l": 12103 case "=>l": 12104 l = c <= d; 12105 break; 12106 case ">=": 12107 case "=>": 12108 case "<=l": 12109 case "=<l": 12110 l = d <= c 12111 } 12112 } 12113 if (l || "".concat(s).toLowerCase().includes(h)) return !0 12114 } 12115 } return !1 12116 }) : this.data, this.options.sortReset && (this.unsortedData = fo(this.data)), this.initSort() 12117 } 12118 } 12119 }, { 12120 key: "initPagination", 12121 value: function() { 12122 var i = this, 12123 n = this.options; 12124 if (n.pagination) { 12125 this.$pagination.show(); 12126 var t, e, o, s, a = [], 12127 r = !1, 12128 l = this.getData({ 12129 includeHiddenRows: !1 12130 }), 12131 c = (c = "string" == typeof(c = n.pageList) ? c.replace(/\[|\]| /g, "").toLowerCase().split(",") : c).map(function(t) { 12132 return "string" == typeof t ? t.toLowerCase() === n.formatAllRows().toLowerCase() || ["all", "unlimited"].includes(t.toLowerCase()) ? n.formatAllRows() : +t : t 12133 }); 12134 if (this.paginationParts = n.paginationParts, "string" == typeof this.paginationParts && (this.paginationParts = this.paginationParts.replace(/\[|\]| |'/g, "").split(",")), "server" !== n.sidePagination && (n.totalRows = l.length), this.totalPages = 0, n.totalRows && (n.pageSize === n.formatAllRows() && (n.pageSize = n.totalRows, r = !0), this.totalPages = 1 + ~~((n.totalRows - 1) / n.pageSize), n.totalPages = this.totalPages), 0 < this.totalPages && n.pageNumber > this.totalPages && (n.pageNumber = this.totalPages), this.pageFrom = (n.pageNumber - 1) * n.pageSize + 1, this.pageTo = n.pageNumber * n.pageSize, this.pageTo > n.totalRows && (this.pageTo = n.totalRows), this.options.pagination && "server" !== this.options.sidePagination && (this.options.totalNotFiltered = this.options.data.length), this.options.showExtendedPagination || (this.options.totalNotFiltered = void 0), (this.paginationParts.includes("pageInfo") || this.paginationParts.includes("pageInfoShort") || this.paginationParts.includes("pageSize")) && a.push('<div class="'.concat(this.constants.classes.pull, "-").concat(n.paginationDetailHAlign, ' pagination-detail">')), (this.paginationParts.includes("pageInfo") || this.paginationParts.includes("pageInfoShort")) && (f = this.paginationParts.includes("pageInfoShort") ? n.formatDetailPagination(n.totalRows) : n.formatShowingRows(this.pageFrom, this.pageTo, n.totalRows, n.totalNotFiltered), a.push('<span class="pagination-info">\n '.concat(f, "\n </span>"))), this.paginationParts.includes("pageSize") && (a.push('<span class="page-list">'), s = ['<span class="'.concat(this.constants.classes.paginationDropdown, '">\n <button class="').concat(this.constants.buttonsClass, ' dropdown-toggle" type="button" data-toggle="dropdown">
12134\n <span class="page-size">\n ').concat(r ? n.formatAllRows() : n.pageSize, "\n </span>\n ").concat(this.constants.html.dropdownCaret, "\n </button>\n ").concat(this.constants.html.pageDropdown[0])], c.forEach(function(t, e) { 12135 (!n.smartDisplay || 0 === e || c[e - 1] < n.totalRows) && (e = r ? t === n.formatAllRows() ? i.constants.classes.dropdownActive : "" : t === n.pageSize ? i.constants.classes.dropdownActive : "", s.push(So.sprintf(i.constants.html.pageDropdownItem, e, t))) 12136 }), s.push("".concat(this.constants.html.pageDropdown[1], "</span>")), a.push(n.formatRecordsPerPage(s.join("")))), (this.paginationParts.includes("pageInfo") || this.paginationParts.includes("pageInfoShort") || this.paginationParts.includes("pageSize")) && a.push("</span></div>"), this.paginationParts.includes("pageList")) { 12137 a.push('<div class="'.concat(this.constants.classes.pull, "-").concat(n.paginationHAlign, ' pagination">'), So.sprintf(this.constants.html.pagination[0], So.sprintf(" pagination-%s", n.iconSize)), So.sprintf(this.constants.html.paginationItem, " page-pre", n.formatSRPaginationPreText(), n.paginationPreText)), e = this.totalPages < n.paginationSuccessivelySize ? (o = 1, this.totalPages) : (o = n.pageNumber - n.paginationPagesBySide) + 2 * n.paginationPagesBySide, n.pageNumber < n.paginationSuccessivelySize - 1 && (e = n.paginationSuccessivelySize), (o = n.paginationSuccessivelySize > this.totalPages - o ? o - (n.paginationSuccessivelySize - (this.totalPages - o)) + 1 : o) < 1 && (o = 1), e > this.totalPages && (e = this.totalPages); 12138 var d = Math.round(n.paginationPagesBySide / 2), 12139 u = function(t) { 12140 return So.sprintf(i.constants.html.paginationItem, (1 < arguments.length && void 0 !== arguments[1] ? arguments[1] : "") + (t === n.pageNumber ? " ".concat(i.constants.classes.paginationActive) : ""), n.formatSRPaginationPageText(t), t) 12141 }; 12142 if (1 < o) { 12143 var h = n.paginationPagesBySide; 12144 for (o <= h && (h = o - 1), t = 1; t <= h; t++) a.push(u(t)); 12145 o - 1 === h + 1 ? a.push(u(t = o - 1)) : h < o - 1 && (o - 2 * n.paginationPagesBySide > n.paginationPagesBySide && n.paginationUseIntermediate ? (t = Math.round((o - d) / 2 + d), a.push(u(t, " page-intermediate"))) : a.push(So.sprintf(this.constants.html.paginationItem, " page-first-separator disabled", "", "..."))) 12146 } 12147 for (t = o; t <= e; t++) a.push(u(t)); 12148 if (this.totalPages > e) { 12149 var p = this.totalPages - (n.paginationPagesBySide - 1); 12150 for (e + 1 === (p = p <= e ? e + 1 : p) - 1 ? a.push(u(t = e + 1)) : e + 1 < p && (this.totalPages - e > 2 * n.paginationPagesBySide && n.paginationUseIntermediate ? (t = Math.round((this.totalPages - d - e) / 2 + e), a.push(u(t, " page-intermediate"))) : a.push(So.sprintf(this.constants.html.paginationItem, " page-last-separator disabled", "", "..."))), t = p; t <= this.totalPages; t++) a.push(u(t)) 12151 } 12152 a.push(So.sprintf(this.constants.html.paginationItem, " page-next", n.formatSRPaginationNextText(), n.paginationNextText)), a.push(this.constants.html.pagination[1], "</div>") 12153 } 12154 this.$pagination.html(a.join("")); 12155 var f = ["bottom", "both"].includes(n.paginationVAlign) ? " ".concat(this.constants.classes.dropup) : ""; 12156 this.$pagination.last().find(".page-list > span").addClass(f), n.onlyInfoPagination || (o = this.$pagination.find(".page-list a"), d = this.$pagination.find(".page-pre"), p = this.$pagination.find(".page-next"), f = this.$pagination.find(".page-item").not(".page-next, .page-pre, .page-last-separator, .page-first-separator"), this.totalPages <= 1 && this.$pagination.find("div.pagination").hide(), n.smartDisplay && (c.length < 2 || n.totalRows <= c[0]) && this.$pagination.find("span.page-list").hide(), this.$pagination[this.getData().length ? "show" : "hide"](), n.paginationLoop || (1 === n.pageNumber && d.addClass("disabled"), n.pageNumber === this.totalPages && p.addClass("disabled")), r && (n.pageSize = n.formatAllRows()), o.off("click").on("click", function(t) { 12157 return i.onPageListChange(t) 12158 }
12158), d.off("click").on("click", function(t) { 12159 return i.onPagePre(t) 12160 }), p.off("click").on("click", function(t) { 12161 return i.onPageNext(t) 12162 }), f.off("click").on("click", function(t) { 12163 return i.onPageNumber(t) 12164 })) 12165 } else this.$pagination.hide() 12166 } 12167 }, { 12168 key: "updatePagination", 12169 value: function(t) { 12170 t && N(t.currentTarget).hasClass("disabled") || (this.options.maintainMetaData || this.resetRows(), this.initPagination(), this.trigger("page-change", this.options.pageNumber, this.options.pageSize), "server" === this.options.sidePagination ? this.initServer() : this.initBody()) 12171 } 12172 }, { 12173 key: "onPageListChange", 12174 value: function(t) { 12175 t.preventDefault(); 12176 var e = N(t.currentTarget); 12177 return e.parent().addClass(this.constants.classes.dropdownActive).siblings().removeClass(this.constants.classes.dropdownActive), this.options.pageSize = e.text().toUpperCase() === this.options.formatAllRows().toUpperCase() ? this.options.formatAllRows() : +e.text(), this.$toolbar.find(".page-size").text(this.options.pageSize), this.updatePagination(t), !1 12178 } 12179 }, { 12180 key: "onPagePre", 12181 value: function(t) { 12182 return t.preventDefault(), this.options.pageNumber - 1 == 0 ? this.options.pageNumber = this.options.totalPages : this.options.pageNumber--, this.updatePagination(t), !1 12183 } 12184 }, { 12185 key: "onPageNext", 12186 value: function(t) { 12187 return t.preventDefault(), this.options.pageNumber + 1 > this.options.totalPages ? this.options.pageNumber = 1 : this.options.pageNumber++, this.updatePagination(t), !1 12188 } 12189 }, { 12190 key: "onPageNumber", 12191 value: function(t) { 12192 if (t.preventDefault(), this.options.pageNumber !== +N(t.currentTarget).text()) return this.options.pageNumber = +N(t.currentTarget).text(), this.updatePagination(t), !1 12193 } 12194 }, { 12195 key: "initRow", 12196 value: function(T, $, t, e) { 12197 var E = this, 12198 k = [], 12199 i = {}, 12200 I = [], 12201 n = "", 12202 o = {}, 12203 s = []; 12204 if (!(-1 < So.findIndex(this.hiddenRows, T))) { 12205 if ((i = So.calculateObjectValue(this.options, this.options.rowStyle, [T, $], i)) && i.css) 12206 for (var a = 0, r = Object.entries(i.css); a < r.length; a++) { 12207 var l = po(r[a], 2), 12208 c = l[0], 12209 l = l[1]; 12210 I.push("".concat(c, ": ").concat(l)) 12211 } 12212 if (o = So.calculateObjectValue(this.options, this.options.rowAttributes, [T, $], o)) 12213 for (var d = 0, u = Object.entries(o); d < u.length; d++) { 12214 var h = po(u[d], 2), 12215 p = h[0], 12216 h = h[1]; 12217 s.push("".concat(p, '="').concat(So.escapeHTML(h), '"')) 12218 } 12219 if (T._data && !So.isEmptyObject(T._data)) 12220 for (var f = 0, m = Object.entries(T._data); f < m.length; f++) { 12221 var g = po(m[f], 2), 12222 v = g[0], 12223 g = g[1]; 12224 if ("index" === v) return; 12225 n += " data-".concat(v, "='").concat("object" === lo(g) ? JSON.stringify(g) : g, "'") 12226 } 12227 k.push("<tr", So.sprintf(" %s", s.length ? s.join(" ") : void 0), So.sprintf(' id="%s"', Array.isArray(T) ? void 0 : T._id), So.sprintf(' class="%s"', i.classes || (Array.isArray(T) ? void 0 : T._class)), So.sprintf(' style="%s"', Array.isArray(T) ? void 0 : T._style), ' data-index="'.concat($, '"'), So.sprintf(' data-uniqueid="%s"', So.getItemField(T, this.options.uniqueId, !1)), So.sprintf(' data-has-detail-view="%s"', this.options.detailView && So.calculateObjectValue(null, this.options.detailFilter, [$, T]) ? "true" : void 0), So.sprintf("%s", n), ">"), this.options.cardView && k.push('<td colspan="'.concat(this.header.fields.length, '"><div class="card-views">')); 12228 i = ""; 12229 return So.hasDetailViewIcon(this.options) && (i = "<td>", So.calculateObjectValue(null, this.options.detailFilter, [$, T]) && (i += '\n <a class="detail-icon" href="#">\n '.concat(So.sprintf(this.constants.html.icon, this.options.iconsPrefix, this.options.icons.detailOpen), "\n </a>\n ")), i += "</td>"), i && "right" !== this.options.detailViewAlign && k.push(i), this.header.fields.forEach(function(t, e) { 12230 var i = "", 12231 n = So.getItemField(T, t, E.options.escape), 12232 o = "", 12233 s = "", 12234 a = {}, 12235 r = "", 12236 l = E.header.classes[e], 12237 c = "", 12238 d = "", 12239 u = "", 12240 h = "", 12241 p = "", 12242 f = "", 12243 m = E.columns[e]; 12244 if ((!E.fromHtml && !E.autoMergeCells || void 0 !== n || m.checkbox || m.radio) && m.visible && (!E.options.cardView || m.cardVisible)) { 12245 if (m.escape && (n = So.escapeHTML(n)), I.concat([E.header.styles[e]]).length && (d += "".concat(I.concat([E.header.styles[e]]).join("; "))), T["_".concat(t, "_style")] && (d += "".concat(T["_".concat(t, "_style")])), d && (c = ' style="'.concat(d, '"')), T["_".concat(t, "_id")] && (r = So.sprintf(' id="%s"', T["_".concat(t, "_id")])), T["_".concat(t, "_class")] && (l = So.sprintf(' class="%s"', T["_".concat(t, "_class")]
12245)), T["_".concat(t, "_rowspan")] && (h = So.sprintf(' rowspan="%s"', T["_".concat(t, "_rowspan")])), T["_".concat(t, "_colspan")] && (p = So.sprintf(' colspan="%s"', T["_".concat(t, "_colspan")])), T["_".concat(t, "_title")] && (f = So.sprintf(' title="%s"', T["_".concat(t, "_title")])), (a = So.calculateObjectValue(E.header, E.header.cellStyles[e], [n, T, $, t], a)).classes && (l = ' class="'.concat(a.classes, '"')), a.css) { 12246 for (var g = [], v = 0, b = Object.entries(a.css); v < b.length; v++) { 12247 var y = po(b[v], 2), 12248 w = y[0], 12249 y = y[1]; 12250 g.push("".concat(w, ": ").concat(y)) 12251 } 12252 c = ' style="'.concat(g.concat(E.header.styles[e]).join("; "), '"') 12253 } 12254 if (o = So.calculateObjectValue(m, E.header.formatters[e], [n, T, $, t], n), "" !== E.searchText && E.options.searchHighlight && (o = So.calculateObjectValue(m, m.searchHighlightFormatter, [o, E.searchText], o.replace(new RegExp("(" + E.searchText + ")", "gim"), "<mark>$1</mark>"))), T["_".concat(t, "_data")] && !So.isEmptyObject(T["_".concat(t, "_data")])) 12255 for (var C = 0, x = Object.entries(T["_".concat(t, "_data")]); C < x.length; C++) { 12256 var _ = po(x[C], 2), 12257 S = _[0], 12258 _ = _[1]; 12259 if ("index" === S) return; 12260 u += " data-".concat(S, '="').concat(_, '"') 12261 } 12262 m.checkbox || m.radio ? (s = m.checkbox ? "checkbox" : s, s = m.radio ? "radio" : s, d = m.class || "", a = So.isObject(o) && o.hasOwnProperty("checked") ? o.checked : (!0 === o || n) && !1 !== o, m = !m.checkboxEnabled || o && o.disabled, i = [E.options.cardView ? '<div class="card-view '.concat(d, '">') : '<td class="bs-checkbox '.concat(d, '"').concat(l).concat(c, ">"), '<label>\n <input\n data-index="'.concat($, '"\n name="').concat(E.options.selectItemName, '"\n type="').concat(s, '"\n ').concat(So.sprintf('value="%s"', T[E.options.idField]), "\n ").concat(So.sprintf('checked="%s"', a ? "checked" : void 0), "\n ").concat(So.sprintf('disabled="%s"', m ? "disabled" : void 0), " />\n <span></span>\n </label>"), E.header.formatters[e] && "string" == typeof o ? o : "", E.options.cardView ? "</div>" : "</td>"].join(""), T[E.header.stateField] = !0 === o || !!n || o && o.checked) : (o = null == o ? E.options.undefinedText : o, E.options.cardView ? (t = E.options.showHeader ? '<span class="card-view-title"'.concat(c, ">").concat(So.getFieldTitle(E.columns, t), "</span>") : "", i = '<div class="card-view">'.concat(t, '<span class="card-view-value">').concat(o, "</span></div>"), E.options.smartDisplay && "" === o && (i = '<div class="card-view"></div>')) : i = "<td".concat(r).concat(l).concat(c).concat(u).concat(h).concat(p).concat(f, ">").concat(o, "</td>")), k.push(i) 12263 } 12264 }), i && "right" === this.options.detailViewAlign && k.push(i), this.options.cardView && k.push("</div></td>"), k.push("</tr>"), k.join("") 12265 } 12266 } 12267 }, { 12268 key: "initBody", 12269 value: function(t) { 12270 var e = this, 12271 i = this.getData(); 12272 this.trigger("pre-body", i), this.$body = this.$el.find(">tbody"), this.$body.length || (this.$body = N("<tbody></tbody>").appendTo(this.$el)), this.options.pagination && "server" !== this.options.sidePagination || (this.pageFrom = 1, this.pageTo = i.length); 12273 var n = [], 12274 o = N(document.createDocumentFragment()), 12275 s = !1; 12276 this.autoMergeCells = So.checkAutoMergeCells(i.slice(this.pageFrom - 1, this.pageTo)); 12277 for (var a = this.pageFrom - 1; a < this.pageTo; a++) { 12278 var r = i[a], 12279 r = this.initRow(r, a, i, o), 12280 s = s || !!r; 12281 r && "string" == typeof r && (this.options.virtualScroll ? n.push(r) : o.append(r)) 12282 } 12283 s ? this.options.virtualScroll ? (this.virtualScroll && this.virtualScroll.destroy(), this.virtualScroll = new To({ 12284 rows: n, 12285 fixedScroll: t, 12286 scrollEl: this.$tableBody[0], 12287 contentEl: this.$body[0], 12288 itemHeight: this.options.virtualScrollItemHeight, 12289 callback: function() { 12290 e.fitHeader(), e.initBodyEvent() 12291 } 12292 })) : this.$body.html(o) : this.$body.html('<tr class="no-records-found">'.concat(So.sprintf('<td colspan="%s">%s</td>
12292', this.getVisibleFields().length + So.getDetailViewIndexOffset(this.options), this.options.formatNoMatches()), "</tr>")), t || this.scrollTo(0), this.initBodyEvent(), this.updateSelected(), this.initFooter(), this.resetView(), "server" !== this.options.sidePagination && (this.options.totalRows = i.length), this.trigger("post-body", i) 12293 } 12294 }, { 12295 key: "initBodyEvent", 12296 value: function() { 12297 var c = this; 12298 this.$body.find("> tr[data-index] > td").off("click dblclick").on("click dblclick", function(t) { 12299 var e, i = N(t.currentTarget), 12300 n = i.parent(), 12301 o = N(t.target).parents(".card-views").children(), 12302 s = N(t.target).parents(".card-view"), 12303 a = n.data("index"), 12304 r = c.data[a], 12305 l = c.options.cardView ? o.index(s) : i[0].cellIndex, 12306 o = c.getVisibleFields()[l - So.getDetailViewIndexOffset(c.options)], 12307 s = c.columns[c.fieldsColumnsIndex[o]], 12308 l = So.getItemField(r, o, c.options.escape); 12309 i.find(".detail-icon").length || (c.trigger("click" === t.type ? "click-cell" : "dbl-click-cell", o, l, r, i), c.trigger("click" === t.type ? "click-row" : "dbl-click-row", r, n, o), "click" === t.type && c.options.clickToSelect && s.clickToSelect && !So.calculateObjectValue(c.options, c.options.ignoreClickToSelectOn, [t.target]) && (e = n.find(So.sprintf('[name="%s"]', c.options.selectItemName))).length && e[0].click(), "click" === t.type && c.options.detailViewByClick && c.toggleDetailView(a, c.header.detailFormatters[c.fieldsColumnsIndex[o]])) 12310 }).off("mousedown").on("mousedown", function(t) { 12311 c.multipleSelectRowCtrlKey = t.ctrlKey || t.metaKey, c.multipleSelectRowShiftKey = t.shiftKey 12312 }), this.$body.find("> tr[data-index] > td > .detail-icon").off("click").on("click", function(t) { 12313 return t.preventDefault(), c.toggleDetailView(N(t.currentTarget).parent().parent().data("index")), !1 12314 }), this.$selectItem = this.$body.find(So.sprintf('[name="%s"]', this.options.selectItemName)), this.$selectItem.off("click").on("click", function(t) { 12315 t.stopImmediatePropagation(); 12316 t = N(t.currentTarget); 12317 c._toggleCheck(t.prop("checked"), t.data("index")) 12318 }), this.header.events.forEach(function(t, e) { 12319 var i = t; 12320 if (i) { 12321 "string" == typeof i && (i = So.calculateObjectValue(null, i)); 12322 var r = c.header.fields[e], 12323 l = c.getVisibleFields().indexOf(r); 12324 if (-1 !== l) { 12325 l += So.getDetailViewIndexOffset(c.options); 12326 for (var n in i) ! function(s) { 12327 if (!i.hasOwnProperty(s)) return; 12328 var a = i[s]; 12329 c.$body.find(">tr:not(.no-records-found)").each(function(t, e) { 12330 var o = N(e), 12331 i = o.find(c.options.cardView ? ".card-views>.card-view" : ">td").eq(l), 12332 n = s.indexOf(" "), 12333 e = s.substring(0, n), 12334 n = s.substring(n + 1); 12335 i.find(n).off(e).on(e, function(t) { 12336 var e = o.data("index"), 12337 i = c.data[e], 12338 n = i[r]; 12339 a.apply(c, [t, n, i, e]) 12340 }) 12341 }) 12342 }(n) 12343 } 12344 } 12345 }) 12346 } 12347 }, { 12348 key: "initServer", 12349 value: function(n, t, e) { 12350 var o = this, 12351 i = {}, 12352 s = this.header.fields.indexOf(this.options.sortName), 12353 a = { 12354 searchText: this.searchText, 12355 sortName: this.options.sortName, 12356 sortOrder: this.options.sortOrder 12357 }; 12358 if (this.header.sortNames[s] && (a.sortName = this.header.sortNames[s]), this.options.pagination && "server" === this.options.sidePagination && (a.pageSize = this.options.pageSize === this.options.formatAllRows() ? this.options.totalRows : this.options.pageSize, a.pageNumber = this.options.pageNumber), e || this.options.url || this.options.ajax) { 12359 if ("limit" === this.options.queryParamsType && (a = { 12360 search: a.searchText, 12361 sort: a.sortName, 12362 order: a.sortOrder 12363 }, this.options.pagination && "server" === this.options.sidePagination && (a.offset = this.options.pageSize === this.options.formatAllRows() ? 0 : this.options.pageSize * (this.options.pageNumber - 1), a.limit = this.options.pageSize === this.options.formatAllRows() ? this.options.totalRows : this.options.pageSize, 0 === a.limit && delete a.limit)), this.options.search && "server" === this.options.sidePagination && this.columns.filter(function(t) { 12364 return !t.searchable 12365 }).length) { 12366 var r = !0, 12367 l = !(a.searchable = []), 12368 s = void 0; 12369 try { 12370 for (var c, d = this.columns[Symbol.iterator](); !(r = (c = d.next()).done); r = !0) { 12371 var u = c.value; 12372 !u.checkbox && u.searchable && (this.options.visibleSearch && u.visible || !this.options.visibleSearch) && a.searchable.push(u.field) 12373 } 12374 } catch (t) { 12375 l = !0, s = t 12376 } finally { 12377 try { 12378 r || null == d.return || d.return() 12379 } finally { 12380 if (l) throw s 12381 } 12382 } 12383 } 12384 if (So.isEmptyObject(this.filterColumnsPartial) || (a.filter = JSON.stringify(this.filterColumnsPartial, null)), N.extend(a, t || {}), !1 !== (i = So.calculateObjectValue(this.options, this.options.queryParams, [a], i))) { 12385 n || this.showLoading(); 12386 e = N.extend({}, So.calculateObjectValue(null, this.options.ajaxOptions), { 12387 type: this.options.method, 12388 url: e || this.options.url, 12389 data: "application/json" === this.options.contentType && "post" === this.options.method ? JSON.stringify(i) : i, 12390 cache: this.options.cache, 12391 contentType: this.options.contentType, 12392 dataType: this.options.dataType, 12393 success: function(t, e, i) { 12394 t = So.calculateObjectValue(o.options, o.options.responseHandler, [t, i], t); 12395 o.load(t), o.trigger("load-success", t, i && i.status, i), n || o.hideLoading(), "server" === o.options.sidePagination && 0 < t[o.options.totalField] && !t[o.options.dataField].length && o.updatePagination() 12396 }, 12397 error: function(t) { 12398 var e = []; 12399 "server" === o.options.sidePagination && ((e = {})[o.options.totalField] = 0, e[o.options.dataField] = []), o.load(e), o.trigger("load-error", t && t.status, t), n || o.$tableLoading.hide() 12400 } 12401 }); 12402 return this.options.ajax ? So.calculateObjectValue(this, this.options.ajax, [e], null) : (this._xhr && 4 !== this._xhr.readyState && this._xhr.abort(), this._xhr = N.ajax(e)), i 12403 } 12404 } 12405 } 12406 }, { 12407 key: "initSearchText", 12408 value: function() { 12409 var t; 12410 this.options.search && (this.searchText = "") !== this.options.searchText && ((t = So.getSearchInput(this)).val(this.options.searchText), this.onSearch({ 12411 currentTarget: t, 12412 firedByInitSearchText: !0 12413 })) 12414 } 12415 }, { 12416 key: "getCaret", 12417 value: function() { 12418 var i = this; 12419 this.$header.find("th").each(function(t, e) { 12420 N(e).find(".sortable").removeClass("desc asc").addClass(N(e).data("field") === i.options.sortName ? i.options.sortOrder : "both") 12421 }) 12422 } 12423 }, { 12424 key: "updateSelected", 12425 value: function() { 12426 var t = this.$selectItem.filter(":enabled").length && this.$selectItem.filter(":enabled").length === this.$selectItem.filter(":enabled").filter(":checked").length; 12427 this.$selectAll.add(this.$selectAll_).prop("checked", t), this.$selectItem.each(function(t, e) { 12428 N(e).closest("tr")[N(e).prop("checked") ? "addClass" : "removeClass"]("selected") 12429 }) 12430 } 12431 }, { 12432 key: "updateRows", 12433 value: function() { 12434 var i = this; 12435 this.$selectItem.each(function(t, e) { 12436 i.data[N(e).data("index")][i.header.stateField] = N(e).prop("checked") 12437 }) 12438 } 12439 }, { 12440 key: "resetRows", 12441 value: function() { 12442 var t = !0, 12443 e = !1, 12444 i = void 0; 12445 try { 12446 for (var n, o = this.data[Symbol.iterator](); !(t = (n = o.next()).done); t = !0) { 12447 var s = n.value; 12448 this.$selectAll.prop("checked", !1), this.$selectItem.prop("checked", !1), this.header.stateField && (s[this.header.stateField] = !1) 12449 } 12450 } catch (t) { 12451 e = !0, i = t 12452 } finally { 12453 try { 12454 t || null == o.return || o.return() 12455 } finally { 12456 if (e) throw i 12457 } 12458 } 12459 this.initHiddenRows() 12460 } 12461 }, { 12462 key: "trigger", 12463 value: function(t) { 12464 for (var e = "".concat(t, ".bs.table"), i = arguments.length, n = new Array(1 < i ? i - 1 : 0), o = 1; o < i; o++) n[o - 1] = arguments[o]; 12465 (t = this.options)[Eo.EVENTS[e]].apply(t, [].concat(n, [this])), this.$el.trigger(N.Event(e, { 12466 sender: this 12467 }), n), (t = this.options).onAll.apply(t, [e].concat([].concat(n, [this]))), this.$el.trigger(N.Event("all.bs.table", { 12468 sender: this 12469 }), [e, n]) 12470 } 12471 }, { 12472 key: "resetHeader", 12473 value: function() { 12474 var t = this; 12475 clearTimeout(this.timeoutId_), this.timeoutId_ = setTimeout(function() { 12476 return t.fitHeader() 12477 }, this.$el.is(":hidden") ? 100 : 0) 12478 } 12479 }, { 12480 key: "fitHeader", 12481 value: function() { 12482 var o = this; 12483 if (this.$el.is(":hidden")) this.timeoutId_ = setTimeout(function() { 12484 return o.fitHeader() 12485 }, 100); 12486 else { 12487 var t = this.$tableBody.get(0), 12488 e = t.scrollWidth > t.clientWidth && t.scrollHeight > t.clientHeight + this.$header.outerHeight() ? So.getScrollBarWidth() : 0; 12489 this.$el.css("margin-top", -this.$header.outerHeight()); 12490 t = N(":focus"); 12491 0 < t.length && (0 < (t = t.parents("th")).length && (void 0 === (t = t.attr("data-field")) || 0 < (t = this.$header.find("[data-field='".concat(t, "']"))).length && t.find(":input").addClass("focus-temp"))), this.$header_ = this.$header.clone(!0, !0), this.$selectAll_ = this.$header_.find('[name="btSelectAll"]'), this.$tableHeader.css("margin-right", e).find("table").css("width", this.$el.outerWidth()).html("").attr("class", this.$el.attr("class")).append(this.$header_), this.$tableLoading.css("width", this.$el.outerWidth()); 12492 e = N(".focus-temp:visible:eq(0)"); 12493 0 < e.length && (e.focus(), this.$header.find(".focus-temp").removeClass("focus-temp")), this.$header.find("th[data-field]").each(function(t, e) { 12494 o.$header_.find(So.sprintf('th[data-field="%s"]', N(e).data("field"))).data(N(e).data()) 12495 }); 12496 for (var s = this.getVisibleFields(), a = this.$header_.find("th"), i = this.$body.find(">
12496tr:not(.no-records-found,.virtual-scroll-top)").eq(0); i.length && i.find('>td[colspan]:not([colspan="1"])').length;) i = i.next(); 12497 var r = i.find("> *").length; 12498 i.find("> *").each(function(t, e) { 12499 var i, n = N(e); 12500 So.hasDetailViewIcon(o.options) && (0 === t && "right" !== o.options.detailViewAlign || t === r - 1 && "right" === o.options.detailViewAlign) ? (i = (e = a.filter(".detail")).innerWidth() - e.find(".fht-cell").width(), e.find(".fht-cell").width(n.innerWidth() - i)) : (i = t - So.getDetailViewIndexOffset(o.options), i = (t = 1 < (t = o.$header_.find(So.sprintf('th[data-field="%s"]', s[i]))).length ? N(a[n[0].cellIndex]) : t).innerWidth() - t.find(".fht-cell").width(), t.find(".fht-cell").width(n.innerWidth() - i)) 12501 }), this.horizontalScroll(), this.trigger("post-header") 12502 } 12503 } 12504 }, { 12505 key: "initFooter", 12506 value: function() { 12507 if (this.options.showFooter && !this.options.cardView) { 12508 var t = this.getData(), 12509 e = [], 12510 i = ""; 12511 (i = So.hasDetailViewIcon(this.options) ? '<th class="detail"><div class="th-inner"></div><div class="fht-cell"></div></th>' : i) && "right" !== this.options.detailViewAlign && e.push(i); 12512 var n = !0, 12513 o = !1, 12514 s = void 0; 12515 try { 12516 for (var a, r = this.columns[Symbol.iterator](); !(n = (a = r.next()).done); n = !0) { 12517 var l, c, d = a.value, 12518 u = [], 12519 h = {}, 12520 p = So.sprintf(' class="%s"', d.class); 12521 if (d.visible && (!(this.footerData && 0 < this.footerData.length) || d.field in this.footerData[0])) { 12522 if (this.options.cardView && !d.cardVisible) return; 12523 if (l = So.sprintf("text-align: %s; ", d.falign || d.align), c = So.sprintf("vertical-align: %s; ", d.valign), (h = So.calculateObjectValue(null, this.options.footerStyle, [d])) && h.css) 12524 for (var f = 0, m = Object.entries(h.css); f < m.length; f++) { 12525 var g = po(m[f], 2), 12526 v = g[0], 12527 b = g[1]; 12528 u.push("".concat(v, ": ").concat(b)) 12529 } 12530 h && h.classes && (p = So.sprintf(' class="%s"', d.class ? [d.class, h.classes].join(" ") : h.classes)), e.push("<th", p, So.sprintf(' style="%s"', l + c + u.concat().join("; "))); 12531 var y = 0; 12532 (y = this.footerData && 0 < this.footerData.length ? this.footerData[0]["_" + d.field + "_colspan"] || 0 : y) && e.push(' colspan="'.concat(y, '" ')), e.push(">"), e.push('<div class="th-inner">'); 12533 var w = ""; 12534 this.footerData && 0 < this.footerData.length && (w = this.footerData[0][d.field] || ""), e.push(So.calculateObjectValue(d, d.footerFormatter, [t, w], w)), e.push("</div>"), e.push('<div class="fht-cell"></div>'), e.push("</div>"), e.push("</th>") 12535 } 12536 } 12537 } catch (t) { 12538 o = !0, s = t 12539 } finally { 12540 try { 12541 n || null == r.return || r.return() 12542 } finally { 12543 if (o) throw s 12544 } 12545 } 12546 i && "right" === this.options.detailViewAlign && e.push(i), this.options.height || this.$tableFooter.length || (this.$el.append("<tfoot><tr></tr></tfoot>"), this.$tableFooter = this.$el.find("tfoot")), this.$tableFooter.find("tr").html(e.join("")), this.trigger("post-footer", this.$tableFooter) 12547 } 12548 } 12549 }, { 12550 key: "fitFooter", 12551 value: function() { 12552 var o = this; 12553 if (this.$el.is(":hidden")) setTimeout(function() { 12554 return o.fitFooter() 12555 }, 100); 12556 else { 12557 var t = this.$tableBody.get(0), 12558 t = t.scrollWidth > t.clientWidth && t.scrollHeight > t.clientHeight + this.$header.outerHeight() ? So.getScrollBarWidth() : 0; 12559 this.$tableFooter.css("margin-right", t).find("table").css("width", this.$el.outerWidth()).attr("class", this.$el.attr("class")), this.getVisibleFields(); 12560 var s = this.$tableFooter.find("th"), 12561 e = this.$body.find(">tr:first-child:not(.no-records-found)"); 12562 for (s.find(".fht-cell").width("auto"); e.length && e.find('>td[colspan]:not([colspan="1"])').length;) e = e.next(); 12563 var a = e.find("> *").length; 12564 e.find("> *").each(function(t, e) { 12565 var i, n = N(e);
12566 So.hasDetailViewIcon(o.options) && (0 === t && "left" === o.options.detailViewAlign || t === a - 1 && "right" === o.options.detailViewAlign) ? (i = (e = s.filter(".detail")).innerWidth() - e.find(".fht-cell").width(), e.find(".fht-cell").width(n.innerWidth() - i)) : (t = (i = s.eq(t)).innerWidth() - i.find(".fht-cell").width(), i.find(".fht-cell").width(n.innerWidth() - t)) 12567 }), this.horizontalScroll() 12568 } 12569 } 12570 }, { 12571 key: "horizontalScroll", 12572 value: function() { 12573 var e = this; 12574 this.$tableBody.off("scroll").on("scroll", function() { 12575 var t = e.$tableBody.scrollLeft(); 12576 e.options.showHeader && e.options.height && e.$tableHeader.scrollLeft(t), e.options.showFooter && !e.options.cardView && e.$tableFooter.scrollLeft(t), e.trigger("scroll-body", e.$tableBody) 12577 }) 12578 } 12579 }, { 12580 key: "getVisibleFields", 12581 value: function() { 12582 var t = [], 12583 e = !0, 12584 i = !1, 12585 n = void 0; 12586 try { 12587 for (var o, s = this.header.fields[Symbol.iterator](); !(e = (o = s.next()).done); e = !0) { 12588 var a = o.value, 12589 r = this.columns[this.fieldsColumnsIndex[a]]; 12590 r && r.visible && t.push(a) 12591 } 12592 } catch (t) { 12593 i = !0, n = t 12594 } finally { 12595 try { 12596 e || null == s.return || s.return() 12597 } finally { 12598 if (i) throw n 12599 } 12600 } 12601 return t 12602 } 12603 }, { 12604 key: "initHiddenRows", 12605 value: function() { 12606 this.hiddenRows = [] 12607 } 12608 }, { 12609 key: "getOptions", 12610 value: function() { 12611 var t = N.extend({}, this.options); 12612 return delete t.data, N.extend(!0, {}, t) 12613 } 12614 }, { 12615 key: "refreshOptions", 12616 value: function(t) { 12617 So.compareObjects(this.options, t, !0) || (this.options = N.extend(this.options, t), this.trigger("refresh-options", this.options), this.destroy(), this.init()) 12618 } 12619 }, { 12620 key: "getData", 12621 value: function(t) { 12622 var e, a = this, 12623 i = this.options.data; 12624 return !this.searchText && !this.options.customSearch && void 0 === this.options.sortName && So.isEmptyObject(this.filterColumns) && So.isEmptyObject(this.filterColumnsPartial) || t && t.unfiltered || (i = this.data), t && t.useCurrentPage && (i = i.slice(this.pageFrom - 1, this.pageTo)), t && !t.includeHiddenRows && (e = this.getHiddenRows(), i = i.filter(function(t) { 12625 return -1 === So.findIndex(e, t) 12626 })), t && t.formatted && i.forEach(function(t) { 12627 for (var e = 0, i = Object.entries(t); e < i.length; e++) { 12628 var n = po(i[e], 2), 12629 o = n[0], 12630 s = n[1], 12631 n = a.columns[a.fieldsColumnsIndex[o]]; 12632 if (!n) return; 12633 t[o] = So.calculateObjectValue(n, a.header.formatters[n.fieldIndex], [s, t, t.index, n.field], s) 12634 } 12635 }), i 12636 } 12637 }, { 12638 key: "getSelections", 12639 value: function() { 12640 var e = this; 12641 return this.options.data.filter(function(t) { 12642 return !0 === t[e.header.stateField] 12643 }) 12644 } 12645 }, { 12646 key: "load", 12647 value: function(t) { 12648 var e = t; 12649 this.options.pagination && "server" === this.options.sidePagination && (this.options.totalRows = e[this.options.totalField], this.options.totalNotFiltered = e[this.options.totalNotFilteredField], this.footerData = e[this.options.footerField] ? [e[this.options.footerField]] : void 0), t = e.fixedScroll, e = Array.isArray(e) ? e : e[this.options.dataField], this.initData(e), this.initSearch(), this.initPagination(), this.initBody(t) 12650 } 12651 }, { 12652 key: "append", 12653 value: function(t) { 12654 this.initData(t, "append"), this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0) 12655 } 12656 }, { 12657 key: "prepend", 12658 value: function(t) { 12659 this.initData(t, "prepend"), this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0) 12660 } 12661 }, { 12662 key: "remove", 12663 value: function(t) { 12664 var e, i, n = this.options.data.length; 12665 if (t.hasOwnProperty("field") && t.hasOwnProperty("values")) { 12666 for (e = n - 1; 0 <= e; e--)((i = this.options.data[e]).hasOwnProperty(t.field) || "$index" === t.field) && (i.hasOwnProperty(t.field) || "$index" !== t.field ? t.values.includes(i[t.field]) : t.values.includes(e)) && (this.options.data.splice(e, 1), "server" === this.options.sidePagination && --this.options.totalRows); 12667 n !== this.options.data.length && (this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0)) 12668 } 12669 } 12670 }, { 12671 key: "removeAll", 12672 value: function() { 12673 0 < this.options.data.length && (this.options.data.splice(0, this.options.data.length), this.initSearch(), this.initPagination(), this.initBody(!0)) 12674 } 12675 }, { 12676 key: "insertRow", 12677 value: function(t) { 12678 t.hasOwnProperty("index") && t.hasOwnProperty("row") && (this.options.data.splice(t.index, 0, t.row), this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0)) 12679 } 12680 }, { 12681 key: "updateRow", 12682 value: function(e) { 12683 var t = Array.isArray(e) ? e : [e], 12684 i = !0, 12685 n = !1, 12686 e = void 0; 12687 try { 12688 for (var o, s = t[Symbol.iterator](); !(i = (o = s.next()).done); i = !0) { 12689 var a = o.value; 12690 a.hasOwnProperty("index") && a.hasOwnProperty("row") && (a.hasOwnProperty("replace") && a.replace ? this.options.data[a.index] = a.row : N.extend(this.options.data[a.index], a.row)) 12691 } 12692 } catch (t) { 12693 n = !0, e = t 12694 } finally { 12695 try { 12696 i || null == s.return || s.return() 12697 } finally { 12698 if (n) throw e 12699 } 12700 } 12701 this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0) 12702 } 12703 }, { 12704 key: "getRowByUniqueId", 12705 value: function(t) { 12706 for (var e, i, n = this.options.uniqueId, o = t, s = null, a = this.options.data.length - 1; 0 <= a; a--) { 12707 if ((e = this.options.data[a]).hasOwnProperty(n)) i = e[n]; 12708 else { 12709 if (!e._data || !e._data.hasOwnProperty(n)) continue; 12710 i = e._data[n] 12711 } 12712 if ("string" == typeof i ? o = o.toString() : "number" == typeof i && (Number(i) === i && i % 1 == 0 ? o = parseInt(o) : i === Number(i) && 0 !== i && (o = parseFloat(o))), i === o) { 12713 s = e; 12714 break 12715 } 12716 } 12717 return s 12718 } 12719 }, { 12720 key: "updateByUniqueId", 12721 value: function(e) { 12722 var t = Array.isArray(e) ? e : [e], 12723 i = !0, 12724 n = !1, 12725 e = void 0; 12726 try { 12727 for (var o, s = t[Symbol.iterator](); !(i = (o = s.next()).done); i = !0) { 12728 var a, r = o.value; 12729 r.hasOwnProperty("id") && r.hasOwnProperty("row") && (-1 !== (a = this.options.data.indexOf(this.getRowByUniqueId(r.i
12729d))) && (r.hasOwnProperty("replace") && r.replace ? this.options.data[a] = r.row : N.extend(this.options.data[a], r.row))) 12730 } 12731 } catch (t) { 12732 n = !0, e = t 12733 } finally { 12734 try { 12735 i || null == s.return || s.return() 12736 } finally { 12737 if (n) throw e 12738 } 12739 } 12740 this.initSearch(), this.initPagination(), this.initSort(), this.initBody(!0) 12741 } 12742 }, { 12743 key: "removeByUniqueId", 12744 value: function(t) { 12745 var e = this.options.data.length, 12746 t = this.getRowByUniqueId(t); 12747 t && this.options.data.splice(this.options.data.indexOf(t), 1), e !== this.options.data.length && (this.initSearch(), this.initPagination(), this.initBody(!0)) 12748 } 12749 }, { 12750 key: "updateCell", 12751 value: function(t) { 12752 t.hasOwnProperty("index") && t.hasOwnProperty("field") && t.hasOwnProperty("value") && (this.data[t.index][t.field] = t.value, !1 !== t.reinit && (this.initSort(), this.initBody(!0))) 12753 } 12754 }, { 12755 key: "updateCellByUniqueId", 12756 value: function(t) { 12757 var n = this; 12758 (Array.isArray(t) ? t : [t]).forEach(function(t) { 12759 var e = t.id, 12760 i = t.field, 12761 t = t.value, 12762 e = n.options.data.indexOf(n.getRowByUniqueId(e)); - 1 !== e && (n.options.data[e][i] = t) 12763 }), !1 !== t.reinit && (this.initSort(), this.initBody(!0)) 12764 } 12765 }, { 12766 key: "showRow", 12767 value: function(t) { 12768 this._toggleRow(t, !0) 12769 } 12770 }, { 12771 key: "hideRow", 12772 value: function(t) { 12773 this._toggleRow(t, !1) 12774 } 12775 }, { 12776 key: "_toggleRow", 12777 value: function(t, e) { 12778 var i; 12779 t.hasOwnProperty("index") ? i = this.getData()[t.index] : t.hasOwnProperty("uniqueId") && (i = this.getRowByUniqueId(t.uniqueId)), i && (t = So.findIndex(this.hiddenRows, i), e || -1 !== t ? e && -1 < t && this.hiddenRows.splice(t, 1) : this.hiddenRows.push(i), this.initBody(!0), this.initPagination()) 12780 } 12781 }, { 12782 key: "getHiddenRows", 12783 value: function(t) { 12784 if (t) return this.initHiddenRows(), this.initBody(!0), void this.initPagination(); 12785 var e = this.getData(), 12786 i = [], 12787 n = !0, 12788 o = !1, 12789 s = void 0; 12790 try { 12791 for (var a, r = e[Symbol.iterator](); !(n = (a = r.next()).done); n = !0) { 12792 var l = a.value; 12793 this.hiddenRows.includes(l) && i.push(l) 12794 } 12795 } catch (t) { 12796 o = !0, s = t 12797 } finally { 12798 try { 12799 n || null == r.return || r.return() 12800 } finally { 12801 if (o) throw s 12802 } 12803 } 12804 return this.hiddenRows = i 12805 } 12806 }, { 12807 key: "showColumn", 12808 value: function(t) { 12809 var e = this; 12810 (Array.isArray(t) ? t : [t]).forEach(function(t) { 12811 e._toggleColumn(e.fieldsColumnsIndex[t], !0, !0) 12812 }) 12813 } 12814 }, { 12815 key: "hideColumn", 12816 value: function(t) { 12817 var e = this; 12818 (Array.isArray(t) ? t : [t]).forEach(function(t) { 12819 e._toggleColumn(e.fieldsColumnsIndex[t], !1, !0) 12820 }) 12821 } 12822 }, { 12823 key: "_toggleColumn", 12824 value: function(t, e, i) { 12825 var n; - 1 !== t && this.columns[t].visible !== e && (this.columns[t].visible = e, this.initHeader(), this.initSearch(), this.initPagination(), this.initBody(), this.options.showColumns) && (n = this.$toolbar.find('.keep-open input:not(".toggle-all")').prop("disabled", !1), i && n.filter(So.sprintf('[value="%s"]', t)).prop("checked", e), n.filter(":checked").length <= this.options.minimumCountColumns && n.filter(":checked").prop("disabled", !0)) 12826 } 12827 }, { 12828 key: "getVisibleColumns", 12829 value: function() { 12830 var e = this; 12831 return this.columns.filter(function(t) { 12832 return t.visible && !e.isSelectionColumn(t) 12833 }) 12834 } 12835 }, { 12836 key: "getHiddenColumns", 12837 value: function() { 12838 return this.columns.filter(function(t) { 12839 return !t.visible 12840 }) 12841 } 12842 }, { 12843 key: "isSelectionColumn", 12844 value: function(t) { 12845 return t.radio || t.checkbox 12846 } 12847 }, { 12848 key: "showAllColumns", 12849 value: function() { 12850 this._toggleAllColumns(!0) 12851 } 12852 }, { 12853 key: "hideAllColumns", 12854 value: function() { 12855 this._toggleAllColumns(!1) 12856 } 12857 }, { 12858 key: "_toggleAllColumns", 12859 value: function(e) { 12860 var i, n = this, 12861 t = !0, 12862 o = !1, 12863 s = void 0; 12864 try { 12865 for (var a, r = this.columns.slice().reverse()[Symbol.iterator](); !(t = (a = r.next()).done); t = !0) { 12866 var l = a.value; 12867 l.switchable && (!e && this.options.showColumns && this.getVisibleColumns().length === this.options.minimumCountColumns || (l.visible = e)) 12868 } 12869 } catch (t) { 12870 o = !0, s = t 12871 } finally { 12872 try { 12873 t || null == r.return || r.return() 12874 } finally { 12875 if (o) throw s 12876 } 12877 } 12878 this.initHeader(), this.initSearch(), this.initPagination(), this.initBody(), this.options.showColumns && (i = this.$toolbar.find('.keep-open input[type="checkbox"]:not(".toggle-all")').prop("disabled", !1), e ? i.prop("checked", e) : i.get().reverse().forEac
12878h(function(t) { 12879 i.filter(":checked").length > n.options.minimumCountColumns && N(t).prop("checked", e) 12880 }), i.filter(":checked").length <= this.options.minimumCountColumns && i.filter(":checked").prop("disabled", !0)) 12881 } 12882 }, { 12883 key: "mergeCells", 12884 value: function(t) { 12885 var e, i, n = t.index, 12886 o = this.getVisibleFields().indexOf(t.field), 12887 s = t.rowspan || 1, 12888 a = t.colspan || 1, 12889 r = this.$body.find(">tr"); 12890 o += So.getDetailViewIndexOffset(this.options); 12891 t = r.eq(n).find(">td").eq(o); 12892 if (!(n < 0 || o < 0 || n >= this.data.length)) { 12893 for (e = n; e < n + s; e++) 12894 for (i = o; i < o + a; i++) r.eq(e).find(">td").eq(i).hide(); 12895 t.attr("rowspan", s).attr("colspan", a).show() 12896 } 12897 } 12898 }, { 12899 key: "checkAll", 12900 value: function() { 12901 this._toggleCheckAll(!0) 12902 } 12903 }, { 12904 key: "uncheckAll", 12905 value: function() { 12906 this._toggleCheckAll(!1) 12907 } 12908 }, { 12909 key: "_toggleCheckAll", 12910 value: function(t) { 12911 var e = this.getSelections(); 12912 this.$selectAll.add(this.$selectAll_).prop("checked", t), this.$selectItem.filter(":enabled").prop("checked", t), this.updateRows(), this.updateSelected(); 12913 var i = this.getSelections(); 12914 t ? this.trigger("check-all", i, e) : this.trigger("uncheck-all", i, e) 12915 } 12916 }, { 12917 key: "checkInvert", 12918 value: function() { 12919 var t = this.$selectItem.filter(":enabled"), 12920 e = t.filter(":checked"); 12921 t.each(function(t, e) { 12922 N(e).prop("checked", !N(e).prop("checked")) 12923 }), this.updateRows(), this.updateSelected(), this.trigger("uncheck-some", e), e = this.getSelections(), this.trigger("check-some", e) 12924 } 12925 }, { 12926 key: "check", 12927 value: function(t) { 12928 this._toggleCheck(!0, t) 12929 } 12930 }, { 12931 key: "uncheck", 12932 value: function(t) { 12933 this._toggleCheck(!1, t) 12934 } 12935 }, { 12936 key: "_toggleCheck", 12937 value: function(t, e) { 12938 var i = this.$selectItem.filter('[data-index="'.concat(e, '"]')), 12939 n = this.options.data[e]; 12940 if (i.is(":radio") || this.options.singleSelect || this.options.multipleSelectRow && !this.multipleSelectRowCtrlKey && !this.multipleSelectRowShiftKey) { 12941 var o = !0, 12942 s = !1, 12943 a = void 0; 12944 try { 12945 for (var r, l = this.options.data[Symbol.iterator](); !(o = (r = l.next()).done); o = !0) r.value[this.header.stateField] = !1 12946 } catch (t) { 12947 s = !0, a = t 12948 } finally { 12949 try { 12950 o || null == l.return || l.return() 12951 } finally { 12952 if (s) throw a 12953 } 12954 } 12955 this.$selectItem.filter(":checked").not(i).prop("checked", !1) 12956 } 12957 if (n[this.header.stateField] = t, this.options.multipleSelectRow) { 12958 if (this.multipleSelectRowShiftKey && 0 <= this.multipleSelectRowLastSelectedIndex) 12959 for (var c = [this.multipleSelectRowLastSelectedIndex, e].sort(), d = c[0] + 1; d < c[1]; d++) this.data[d][this.header.stateField] = !0, this.$selectItem.filter('[data-index="'.concat(d, '"]')).prop("checked", !0); 12960 this.multipleSelectRowCtrlKey = !1, this.multipleSelectRowShiftKey = !1, this.multipleSelectRowLastSelectedIndex = t ? e : -1 12961 } 12962 i.prop("checked", t), this.updateSelected(), this.trigger(t ? "check" : "uncheck", this.data[e], i) 12963 } 12964 }, { 12965 key: "checkBy", 12966 value: function(t) { 12967 this._toggleCheckBy(!0, t) 12968 } 12969 }, { 12970 key: "uncheckBy", 12971 value: function(t) { 12972 this._toggleCheckBy(!1, t) 12973 } 12974 }, { 12975 key: "_toggleCheckBy", 12976 value: function(i, n) { 12977 var o, s = this; 12978 n.hasOwnProperty("field") && n.hasOwnProperty("values") && (o = [], this.data.forEach(function(t, e) { 12979 return !!t.hasOwnProperty(n.field) && void(n.values.includes(t[n.field]) && (e = s.$selectItem.filter(":enabled").filter(So.sprintf('[data-index="%s"]', e)), (e = i ? e.not(":checked") : e.filter(":checked")).length && (e.prop("checked", i), t[s.header.stateField] = i, o.push(t), s.trigger(i ? "check" : "uncheck", t, e)))) 12980 }), this.updateSelected(), this.trigger(i ? "check-some" : "uncheck-some", o)) 12981 } 12982 }, { 12983 key: "refresh", 12984 value: function(t) { 12985 t && t.url && (this.options.url = t.url), t && t.pageNumber && (this.options.pageNumber = t.pageNumber), t && t.pageSize && (this.options.pageSize = t.pageSize), this.trigger("refresh", this.initServer(t && t.silent, t && t.query, t && t.url)) 12986 } 12987 }, {
12988 key: "destroy", 12989 value: function() { 12990 this.$el.insertBefore(this.$container), N(this.options.toolbar).insertBefore(this.$el), this.$container.next().remove(), this.$container.remove(), this.$el.html(this.$el_.html()).css("margin-top", "0").attr("class", this.$el_.attr("class") || "") 12991 } 12992 }, { 12993 key: "resetView", 12994 value: function(t) { 12995 var e, i, n = 0; 12996 t && t.height && (this.options.height = t.height), this.$selectAll.prop("checked", 0 < this.$selectItem.length && this.$selectItem.length === this.$selectItem.filter(":checked").length), this.$tableContainer.toggleClass("has-card-view", this.options.cardView), !this.options.cardView && this.options.showHeader && this.options.height ? (this.$tableHeader.show(), this.resetHeader(), n += this.$header.outerHeight(!0) + 1) : (this.$tableHeader.hide(), this.trigger("post-header")), !this.options.cardView && this.options.showFooter && (this.$tableFooter.show(), this.fitFooter(), this.options.height && (n += this.$tableFooter.outerHeight(!0))), this.$container.hasClass("fullscreen") ? (this.$tableContainer.css("height", ""), this.$tableContainer.css("width", "")) : this.options.height && (this.$tableBorder && (this.$tableBorder.css("width", ""), this.$tableBorder.css("height", "")), e = this.$toolbar.outerHeight(!0), i = this.$pagination.outerHeight(!0), t = this.options.height - e - i, i = (e = this.$tableBody.find(">table")).outerHeight(), this.$tableContainer.css("height", "".concat(t, "px")), this.$tableBorder && e.is(":visible") && (i = t - i - 2, this.$tableBody[0].scrollWidth - this.$tableBody.innerWidth() && (i -= So.getScrollBarWidth()), this.$tableBorder.css("width", "".concat(e.outerWidth(), "px")), this.$tableBorder.css("height", "".concat(i, "px")))), this.options.cardView ? (this.$el.css("margin-top", "0"), this.$tableContainer.css("padding-bottom", "0"), this.$tableFooter.hide()) : (this.getCaret(), this.$tableContainer.css("padding-bottom", "".concat(n, "px"))), this.trigger("reset-view") 12997 } 12998 }, { 12999 key: "showLoading", 13000 value: function() { 13001 this.$tableLoading.toggleClass("open", !0); 13002 var t = this.options.loadingFontSize; 13003 "auto" === this.options.loadingFontSize && (t = .04 * this.$tableLoading.width(), t = Math.max(12, t), t = Math.min(32, t), t = "".concat(t, "px")), this.$tableLoading.find(".loading-text").css("font-size", t) 13004 } 13005 }, { 13006 key: "hideLoading", 13007 value: function() { 13008 this.$tableLoading.toggleClass("open", !1) 13009 } 13010 }, { 13011 key: "togglePagination", 13012 value: function() { 13013 this.options.pagination = !this.options.pagination; 13014 var t = this.options.showButtonIcons ? this.options.pagination ? this.options.icons.paginationSwitchDown : this.options.icons.paginationSwitchUp : "", 13015 e = this.options.showButtonText ? this.options.pagination ? this.options.formatPaginationSwitchUp() : this.options.formatPaginationSwitchDown() : ""; 13016 this.$toolbar.find('button[name="paginationSwitch"]').html(So.sprintf(this.constants.html.icon, this.options.iconsPrefix, t) + " " + e), this.updatePagination() 13017 } 13018 }, { 13019 key: "toggleFullscreen", 13020 value: function() { 13021 this.$el.closest(".bootstrap-table").toggleClass("fullscreen"), this.resetView() 13022 } 13023 }, { 13024 key: "toggleView", 13025 value: function() { 13026 this.options.cardView = !this.options.cardView, this.initHeader(); 13027 var t = this.options.showButtonIcons ? this.options.cardView ? this.options.icons.toggleOn : this.options.icons.toggleOff : "", 13028 e = this.options.showButtonText ? this.options.cardView ? this.options.formatToggleOff() : this.options.formatToggleOn() : ""; 13029 this.$toolbar.find('button[name="toggle"]').html(So.sprintf(this.constants.html.icon, this.options.iconsPrefix, t) + " " + e), this.initBody(), this.trigger("toggle", this.options.cardView) 13030 } 13031 }, { 13032 key: "resetSearch", 13033 value: function(t) { 13034 var e = So.getSearchInput(this); 13035 e.val(t || ""), this.onSearch({ 13036 currentTarget: e 13037 }) 13038 } 13039 }, { 13040 key: "filterBy", 13041 value: function(t, e) { 13042 this.filterOptions = So.isEmptyObject(e) ? this.options.filterOptions : N.extend(this.options.filterOptions, e), this.filterColumns = So.isEmptyObject(t) ? {} : t, this.options.pageNumber = 1, this.initSearch(), this.updatePagination() 13043 } 13044 }, { 13045 key: "scrollTo", 13046 value: function(t) { 13047 var e = { 13048 unit: "px", 13049 value: 0 13050 }; 13051 "object" === lo(t) ? e = Object.assign(e, t) : "string" == typeof t && "bottom" === t ? e.value = this.$tableBody[0].scrollHeight : "string" != typeof t && "number" != typeof t || (e.value = t); 13052 var i = e.value; 13053 "rows" === e.unit && (i = 0, this.$body.find("> tr:lt(".concat(e.value, ")")).each(function(t, e) { 13054 i += N(e).outerHeight(!0) 13055 })), this.$tableBody.scrollTop(i) 13056 } 13057 }, { 13058 key: "getScrollPosition", 13059 value: function() { 13060 return this.$tableBody.scrollTop() 13061 } 13062 }, { 13063 key: "selectPage", 13064 value: function(t) { 13065 0 < t && t <= this.options.totalPages && (this.options.pageNumber = t, this.updatePagination()) 13066 } 13067 }, { 13068 key: "prevPage", 13069 value: function() { 13070 1 < this.options.pageNumber && (this.options.pageNumber--, this.updatePagination()) 13071 } 13072 }, { 13073 key: "nextPage", 13074 value: function() { 13075 this.options.pageNumber < this.options.totalPages && (this.options.pageNumber++, this.updatePagination()) 13076 } 13077 }, {
13078 key: "toggleDetailView", 13079 value: function(t, e) { 13080 this.$body.find(So.sprintf('> tr[data-index="%s"]', t)).next().is("tr.detail-view") ? this.collapseRow(t) : this.expandRow(t, e), this.resetView() 13081 } 13082 }, { 13083 key: "expandRow", 13084 value: function(t, e) { 13085 var i = this.data[t], 13086 n = this.$body.find(So.sprintf('> tr[data-index="%s"][data-has-detail-view]', t)); 13087 n.next().is("tr.detail-view") || (this.options.detailViewIcon && n.find("a.detail-icon").html(So.sprintf(this.constants.html.icon, this.options.iconsPrefix, this.options.icons.detailClose)), n.after(So.sprintf('<tr class="detail-view"><td colspan="%s"></td></tr>', n.children("td").length)), n = n.next().find("td"), e = e || this.options.detailFormatter, e = So.calculateObjectValue(this.options, e, [t, i, n], ""), 1 === n.length && n.append(e), this.trigger("expand-row", t, i, n)) 13088 } 13089 }, { 13090 key: "expandRowByUniqueId", 13091 value: function(t) { 13092 t = this.getRowByUniqueId(t); 13093 t && this.expandRow(this.data.indexOf(t)) 13094 } 13095 }, { 13096 key: "collapseRow", 13097 value: function(t) { 13098 var e = this.data[t], 13099 i = this.$body.find(So.sprintf('> tr[data-index="%s"][data-has-detail-view]', t)); 13100 i.next().is("tr.detail-view") && (this.options.detailViewIcon && i.find("a.detail-icon").html(So.sprintf(this.constants.html.icon, this.options.iconsPrefix, this.options.icons.detailOpen)), this.trigger("collapse-row", t, e, i.next()), i.next().remove()) 13101 } 13102 }, { 13103 key: "collapseRowByUniqueId", 13104 value: function(t) { 13105 t = this.getRowByUniqueId(t); 13106 t && this.collapseRow(this.data.indexOf(t)) 13107 } 13108 }, { 13109 key: "expandAllRows", 13110 value: function() { 13111 for (var t = this.$body.find("> tr[data-index][data-has-detail-view]"), e = 0; e < t.length; e++) this.expandRow(N(t[e]).data("index")) 13112 } 13113 }, { 13114 key: "collapseAllRows", 13115 value: function() { 13116 for (var t = this.$body.find("> tr[data-index][data-has-detail-view]"), e = 0; e < t.length; e++) this.collapseRow(N(t[e]).data("index")) 13117 } 13118 }, { 13119 key: "updateColumnTitle", 13120 value: function(i) { 13121 i.hasOwnProperty("field") && i.hasOwnProperty("title") && (this.columns[this.fieldsColumnsIndex[i.field]].title = this.options.escape ? So.escapeHTML(i.title) : i.title, this.columns[this.fieldsColumnsIndex[i.field]].visible && (void 0 !== this.options.height ? this.$tableHeader : this.$header).find("th[data-field]").each(function(t, e) { 13122 if (N(e).data("field") === i.field) return N(N(e).find(".th-inner")[0]).text(i.title), !1 13123 })) 13124 } 13125 }, { 13126 key: "updateFormatText", 13127 value: function(t, e) { 13128 /^format/.test(t) && this.options[t] && ("string" == typeof e ? this.options[t] = function() { 13129 return e 13130 } : "function" == typeof e && (this.options[t] = e), this.initToolbar(), this.initPagination(), this.initBody()) 13131 } 13132 }]), Eo); 13133 13134 function Eo(t, e) { 13135 co(this, Eo), this.options = e, this.$el = N(t), this.$el_ = this.$el.clone(), this.timeoutId_ = 0, this.timeoutFooter_ = 0 13136 } 13137 13138 function ko(t) { 13139 var e = this; 13140 co(this, ko), this.rows = t.rows, this.scrollEl = t.scrollEl, this.contentEl = t.contentEl, this.callback = t.callback, this.itemHeight = t.itemHeight, this.cache = {}, this.scrollTop = this.scrollEl.scrollTop, this.initDOM(this.rows, t.fixedScroll), this.scrollEl.scrollTop = this.scrollTop, this.lastCluster = 0; 13141 13142 function i() { 13143 e.lastCluster !== (e.lastCluster = e.getNum()) && (e.initDOM(e.rows), e.callback()) 13144 } 13145 this.scrollEl.addEventListener("scroll", i, !1), this.destroy = function() { 13146 e.contentEl.innerHtml = "", e.scrollEl.removeEventListener("scroll", i, !1) 13147 } 13148 } 13149 return $o.VERSION = vo.VERSION, $o.DEFAULTS = vo.DEFAULTS, $o.LOCALES = vo.LOCALES, $o.COLUMN_DEFAULTS = vo.COLUMN_DEFAULTS, $o.METHODS = vo.METHODS, $o.EVENTS = vo.EVENTS, N.BootstrapTable = $o, N.fn.bootstrapTable = function(o) { 13150 for (var s, t = arguments.length, a = new Array(1 < t ? t - 1 : 0), e = 1; e < t; e++) a[e - 1] = arguments[e]; 13151 return this.each(function(t, e) { 13152 var i = N(e).data("bootstrap.table"),
13153 n = N.extend({}, $o.DEFAULTS, N(e).data(), "object" === lo(o) && o); 13154 if ("string" == typeof o) { 13155 if (!vo.METHODS.includes(o)) throw new Error("Unknown method: ".concat(o)); 13156 if (!i) return; 13157 s = i[o].apply(i, a), "destroy" === o && N(e).removeData("bootstrap.table") 13158 } 13159 i || (i = new N.BootstrapTable(e, n), N(e).data("bootstrap.table", i), i.init()) 13160 }), void 0 === s ? this : s 13161 }, N.fn.bootstrapTable.Constructor = $o, N.fn.bootstrapTable.theme = vo.THEME, N.fn.bootstrapTable.VERSION = vo.VERSION, N.fn.bootstrapTable.defaults = $o.DEFAULTS, N.fn.bootstrapTable.columnDefaults = $o.COLUMN_DEFAULTS, N.fn.bootstrapTable.events = $o.EVENTS, N.fn.bootstrapTable.locales = $o.LOCALES, N.fn.bootstrapTable.methods = $o.METHODS, N.fn.bootstrapTable.utils = So, N(function() { 13162 N('[data-toggle="table"]').bootstrapTable() 13163 }), $o 13164 }), 13165 function() { 13166 "use strict"; 13167 13168 function t(p) { 13169 p.fn._fadeIn = p.fn.fadeIn; 13170 var f = p.noop || function() {}, 13171 m = /MSIE/.test(navigator.userAgent), 13172 g = /MSIE 6.0/.test(navigator.userAgent) && !/MSIE 8.0/.test(navigator.userAgent), 13173 v = (document.documentMode, p.isFunction(document.createElement("div").style.setExpression)); 13174 p.blockUI = function(t) { 13175 i(window, t) 13176 }, p.unblockUI = function(t) { 13177 w(window, t) 13178 }, p.growlUI = function(t, e, i, n) { 13179 var o = p('<div class="growlUI"></div>'); 13180 t && o.append("<h1>" + t + "</h1>"), e && o.append("<h2>" + e + "</h2>"), void 0 === i && (i = 3e3); 13181 13182 function s(t) { 13183 p.blockUI({ 13184 message: o, 13185 fadeIn: void 0 !== (t = t || {}).fadeIn ? t.fadeIn : 700, 13186 fadeOut: void 0 !== t.fadeOut ? t.fadeOut : 1e3, 13187 timeout: void 0 !== t.timeout ? t.timeout : i, 13188 centerY: !1, 13189 showOverlay: !1, 13190 onUnblock: n, 13191 css: p.blockUI.defaults.growlCSS 13192 }) 13193 } 13194 s(); 13195 o.css("opacity"); 13196 o.mouseover(function() { 13197 s({ 13198 fadeIn: 0, 13199 timeout: 3e4 13200 }); 13201 var t = p(".blockMsg"); 13202 t.stop(), t.fadeTo(300, 1) 13203 }).mouseout(function() { 13204 p(".blockMsg").fadeOut(1e3) 13205 }) 13206 }, p.fn.block = function(t) { 13207 if (this[0] === window) return p.blockUI(t), this; 13208 var e = p.extend({}, p.blockUI.defaults, t || {}); 13209 return this.each(function() { 13210 var t = p(this); 13211 e.ignoreIfBlocked && t.data("blockUI.isBlocked") || t.unblock({ 13212 fadeOut: 0 13213 }) 13214 }), this.each(function() { 13215 "static" == p.css(this, "position") && (this.style.position = "relative", p(this).data("blockUI.static", !0)), this.style.zoom = 1, i(this, t) 13216 }) 13217 }, p.fn.unblock = function(t) { 13218 return this[0] === window ? (p.unblockUI(t), this) : this.each(function() { 13219 w(this, t) 13220 }) 13221 }, p.blockUI.version = 2.7, p.blockUI.defaults = { 13222 message: "<h1>Please wait...</h1>", 13223 title: null, 13224 draggable: !0, 13225 theme: !1, 13226 css: { 13227 padding: 0, 13228 margin: 0, 13229 width: "30%", 13230 top: "40%", 13231 left: "35%", 13232 textAlign: "center", 13233 color: "#000", 13234 border: "3px solid #aaa", 13235 backgroundColor: "#fff", 13236 cursor: "wait" 13237 }, 13238 themedCSS: { 13239 width: "30%", 13240 top: "40%", 13241 left: "35%" 13242 }, 13243 overlayCSS: { 13244 backgroundColor: "#000", 13245 opacity: .6, 13246 cursor: "wait" 13247 }, 13248 cursorReset: "default", 13249 growlCSS: { 13250 width: "350px", 13251 top: "10px", 13252 left: "", 13253 right: "10px", 13254 border: "none", 13255 padding: "5px", 13256 opacity: .6, 13257 cursor: "default", 13258 color: "#fff", 13259 backgroundColor: "#000", 13260 "-webkit-border-radius": "10px", 13261 "-moz-border-radius": "10px", 13262 "border-radius": "10px" 13263 }, 13264 iframeSrc: /^https/i.test(window.location.href || "") ? "javascript:false" : "about:blank", 13265 forceIframe: !1, 13266 baseZ: 1e3, 13267 centerX: !0, 13268 centerY: !0, 13269 allowBodyStretch: !0, 13270 bindEvents: !0, 13271 constrainTabKey: !0, 13272 fadeIn: 200, 13273 fadeOut: 400, 13274 timeout: 0, 13275 showOverlay: !0, 13276 focusInput: !0, 13277 focusableElements: ":input:enabled:visible", 13278 onBlock: null, 13279 onUnblock: null, 13280 onOverlayClick: null, 13281 quirksmodeOffsetHack: 4, 13282 blockMsgClass: "blockMsg", 13283 ignoreIfBlocked: !1 13284 }; 13285 var b = null, 13286 y = []; 13287 13288 function i(t, i) { 13289 var e, n, o, s, a, r, l, c, d, u = t == window, 13290 h = i && void 0 !== i.message ? i.message : void 0; 13291 (i = p.extend({}, p.blockUI.defaults, i || {})).ignoreIfBlocked && p(t).data("blockUI.isBlocked") || (i.overlayCSS = p.extend({}, p.blockUI.defaults.overlayCSS, i.overlayCSS || {}), o = p.extend({}, p.blockUI.defaults.css, i.css || {}), i.onOverlayClick && (i.overlayCSS.cursor = "pointer"), s = p.extend({}, p.blockUI.defaults.themedCSS, i.themedCSS || {}), h = void 0 === h ? i.message : h, u && b && w(window, { 13292 fadeOut: 0 13293 }), h && "string" != typeof h && (h.parentNode || h.jquery) && (e = h.jquery ? h[0] : h, l = {}, p(t).data("blockUI.history", l), l.el = e, l.parent = e.parentNode, l.display = e.style.display, l.position = e.style.position, l.parent && l.parent.removeChild(e)), p(t).data("blockUI.onUnblock", i.onUnblock), d = i.baseZ, l = m || i.forceIframe ? p('<iframe class="blockUI" style="z-index:' + d++ + ';display:none;border:none;margin:0;padding:0;position:absolute;width:100%;height:100%;top:0;left:0" src="' + i.iframeSrc + '"></iframe>') : p('<div class="blockUI" style="display:none"></div>'), e = i.theme ? p('<div class="blockUI blockOverlay ui-widget-overlay" style="z-index:' + d++ + ';display:none"></div>') : p('<div class="blockUI blockOverlay" style="z-index:' + d++ + ';display:none;border:none;margin:0;padding:0;width:100%;height:100%;top:0;left:0"></div>'), i.theme && u ? (c = '<div class="blockUI ' + i.blockMsgClass + ' blockPage ui-dialog ui-widget ui-corner-all" style="z-index:' + (d + 10) + ';display:none;position:fixed">', i.title && (c += '<div class="ui-widget-header ui-dialog-titlebar ui-corner-all blockTitle">' + (i.title || " ") + "</div>"), c += '<div class="ui-widget-content ui-dialog-content"></div>', c += "</div>") : i.theme ? (c = '<div class="blockUI ' + i.blockMsgClass + ' blockElement ui-dialog ui-widget ui-corner-all" style="z-index:' + (d + 10) + ';display:none;position:absolute">', i.title && (c += '<div class="ui-widget-header ui-dialog-titlebar ui-corner-all blockTitle">' + (i.title || " ") + "</div>"), c += '<div class="ui-widget-content ui-dialog-content"></div>', c += "</div>") : c = u ? '<div class="blockUI ' + i.blockMsgClass + ' blockPage" style="z-index:' + (d + 10) + ';display:none;position:fixed"></div>' : '<div class="blockUI ' + i.blockMsgClass + ' blockElement" style="z-index:' + (d + 10) + ';display:none;position:absolute"></div>', d = p(c), h && (i.theme ? (d.css(s), d.addClass("ui-widget-content")) : d.css(o)), i.theme || e.css(i.overlayCSS), e.css("position", u ? "fixed" : "absolute"), (m || i.forceIframe) && l.css("opacity", 0), c = [l, e, d], n = p(u ? "body" : t), p.each(c, function() { 13294 this.appendTo(n) 13295 }), i.theme && i.draggable && p.fn.draggable && d.draggable({ 13296 handle: ".ui-dialog-titlebar", 13297 cancel: "li" 13298 }), s = v && (!p.support.boxModel || 0 < p("object,embed", u ? null : t).length), (g || s) && (u && i.allowBodyStretch && p.support.boxModel && p("html,body").css("height", "100%"), !g && p.support.boxModel || u || (o = _(t, "borderTopWidth"), s = _(t, "borderLeftWidth"), a = o ? "(0 - " + o + ")" : 0, r = s ? "(0 - " + s + ")" : 0), p.each(c, function(t, e) { 13299 e = e[0].style; 13300 e.position = "absolute", t < 2 ? (u ? e.setExpression("height", "Math.max(document.body.scrollHeight, document.body.offsetHeight) - (jQuery.support.boxModel?0:" + i.quirksmodeOffsetHack + ') + "px"') : e.setExpression("height", 'this.parentNode.offsetHeight + "px"'), u ? e.setExpression("width", 'jQuery.support.boxModel && document.documentElement.clientWidth || document.body.clientWidth + "px"') : e.setExpression("width", 'this.parentNode.offsetWidth + "px"'), r && e.setExpression("left", r), a && e.setExpression("top", a)) : i.centerY ? (u && e.setExpression("top", '(document.documentElement.clientHeight || document.body.clientHeight) / 2 - (this.offsetHeight / 2) + (blah = document.documentElement.scrollTop ? document.documentElement.scrollTop : document.body.scrollTop) + "px"'), e.marginTop = 0) : !i.centerY && u && (t = i.css && i.css.top ? parseInt(i.css.top, 10) : 0, e.setExpression("top", "((document.documentElement.scrollTop ? document.documentElement.scrollTop : document.body.scrollTop) + " + t + ') + "px"')) 13301 })), h && ((i.theme ? d.find(".ui-widget-content") : d).append(h), (h.jquery || h.nodeType) && p(h).show()), (m || i.forceIframe) && i.showOverlay && l.show(), i.fadeIn ? (c = i.onBlock || f, l = i.showOverlay && !h ? c : f,
13301c = h ? c : f, i.showOverlay && e._fadeIn(i.fadeIn, l), h && d._fadeIn(i.fadeIn, c)) : (i.showOverlay && e.show(), h && d.show(), i.onBlock && i.onBlock.bind(d)()), C(1, t, i), u ? (b = d[0], y = p(i.focusableElements, b), i.focusInput && setTimeout(x, 20)) : function(t, e, i) { 13302 var n = t.parentNode, 13303 o = t.style, 13304 s = (n.offsetWidth - t.offsetWidth) / 2 - _(n, "borderLeftWidth"), 13305 n = (n.offsetHeight - t.offsetHeight) / 2 - _(n, "borderTopWidth"); 13306 e && (o.left = 0 < s ? s + "px" : "0"); 13307 i && (o.top = 0 < n ? n + "px" : "0") 13308 }(d[0], i.centerX, i.centerY), i.timeout && (d = setTimeout(function() { 13309 u ? p.unblockUI(i) : p(t).unblock(i) 13310 }, i.timeout), p(t).data("blockUI.timeout", d))) 13311 } 13312 13313 function w(t, e) { 13314 var i, n, o = t == window, 13315 s = p(t), 13316 a = s.data("blockUI.history"), 13317 r = s.data("blockUI.timeout"); 13318 r && (clearTimeout(r), s.removeData("blockUI.timeout")), e = p.extend({}, p.blockUI.defaults, e || {}), C(0, t, e), null === e.onUnblock && (e.onUnblock = s.data("blockUI.onUnblock"), s.removeData("blockUI.onUnblock")), n = o ? p("body").children().filter(".blockUI").add("body > .blockUI") : s.find(">.blockUI"), e.cursorReset && (1 < n.length && (n[1].style.cursor = e.cursorReset), 2 < n.length && (n[2].style.cursor = e.cursorReset)), o && (b = y = null), e.fadeOut ? (i = n.length, n.stop().fadeOut(e.fadeOut, function() { 13319 0 == --i && l(n, a, e, t) 13320 })) : l(n, a, e, t) 13321 } 13322 13323 function l(t, e, i, n) { 13324 var o = p(n); 13325 o.data("blockUI.isBlocked") || (t.each(function(t, e) { 13326 this.parentNode && this.parentNode.removeChild(this) 13327 }), e && e.el && (e.el.style.display = e.display, e.el.style.position = e.position, e.el.style.cursor = "default", e.parent && e.parent.appendChild(e.el), o.removeData("blockUI.history")), o.data("blockUI.static") && o.css("position", "static"), "function" == typeof i.onUnblock && i.onUnblock(n, i), n = (o = p(document.body)).width(), i = o[0].style.width, o.width(n - 1).width(n), o[0].style.width = i) 13328 } 13329 13330 function C(t, e, i) { 13331 var n = e == window, 13332 e = p(e); 13333 !t && (n && !b || !n && !e.data("blockUI.isBlocked")) || (e.data("blockUI.isBlocked", t), n && i.bindEvents && (!t || i.showOverlay) && (n = "mousedown mouseup keydown keypress keyup touchstart touchend touchmove", t ? p(document).bind(n, i, o) : p(document).unbind(n, o))) 13334 } 13335 13336 function o(t) { 13337 if ("keydown" === t.type && t.keyCode && 9 == t.keyCode && b && t.data.constrainTabKey) { 13338 var e = y, 13339 i = !t.shiftKey && t.target === e[e.length - 1], 13340 n = t.shiftKey && t.target === e[0]; 13341 if (i || n) return setTimeout(function() { 13342 x(n) 13343 }, 10), !1 13344 } 13345 e = t.data, i = p(t.target); 13346 return i.hasClass("blockOverlay") && e.onOverlayClick && e.onOverlayClick(t), 0 < i.parents("div." + e.blockMsgClass).length || 0 === i.parents().children().filter("div.blockUI").length 13347 } 13348 13349 function x(t) { 13350 !y || (t = y[!0 === t ? y.length - 1 : 0]) && t.focus() 13351 } 13352 13353 function _(t, e) { 13354 return parseInt(p.css(t, e), 10) || 0 13355 } 13356 } 13357 "function" == typeof define && define.amd && define.amd.jQuery ? define(["jquery"], t) : t(jQuery) 13358 }(), 13359 function(t, e) { 13360 "object" == typeof exports && "undefined" != typeof module ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : (t = t || self).Sweetalert2 = e() 13361 }(this, function() { 13362 "use strict"; 13363 13364 function c(t) { 13365 return (c = "function" == typeof Symbol && "symbol" == typeof Symbol.iterator ? function(t) { 13366 return typeof t 13367 } : function(t) { 13368 return t && "function" == typeof Symbol && t.constructor === Symbol && t !== Symbol.prototype ? "symbol" : typeof t 13369 })(t) 13370 } 13371 13372 function n(t, e) { 13373 if (!(t instanceof e)) throw new TypeError("Cannot call a class as a function") 13374 } 13375 13376 function o(t, e) { 13377 for (var i = 0; i < e.length; i++) { 13378 var n = e[i]; 13379 n.enumerable = n.enumerable || !1, n.configurable = !0, "value" in n && (n.writable = !0), Object.defineProperty(t, n.key, n) 13380 } 13381 } 13382 13383 function t(t, e, i) { 13384 return e && o(t.prototype, e), i && o(t, i), t 13385 } 13386 13387 function l() { 13388 return (l = Object.assign || function(t) { 13389 for (var e = 1; e < arguments.length; e++) { 13390 var i, n = arguments[e]; 13391 for (i in n) Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]) 13392 } 13393 return t 13394 }).apply(this, arguments) 13395 } 13396 13397 function s(t) { 13398 return (s = Object.setPrototypeOf ? Object.getPrototypeOf : function(t) { 13399 return t.__proto__ || Object.getPrototypeOf(t) 13400 })(t) 13401 } 13402 13403 function a(t, e) { 13404 return (a = Object.setPrototypeOf || function(t, e) { 13405 return t.__proto__ = e, t 13406 })(t, e) 13407 } 13408 13409 function r(t, e, i) { 13410 return (r = function() { 13411 if ("undefined" != typeof Reflect && Reflect.construct && !Reflect.construct.sham) { 13412 if ("function" == typeof Proxy) return 1; 13413 try { 13414 return Date.prototype.toString.call(Reflect.construct(Date, [], function() {})), 1 13415 } catch (t) { 13416 return 13417 } 13418 } 13419 }() ? Reflect.construct : function(t, e, i) {
13420 var n = [null]; 13421 n.push.apply(n, e); 13422 n = new(Function.bind.apply(t, n)); 13423 return i && a(n, i.prototype), n 13424 }).apply(null, arguments) 13425 } 13426 13427 function d(t, e, i) { 13428 return (d = "undefined" != typeof Reflect && Reflect.get ? Reflect.get : function(t, e, i) { 13429 t = function(t, e) { 13430 for (; !Object.prototype.hasOwnProperty.call(t, e) && null !== (t = s(t));); 13431 return t 13432 }(t, e); 13433 if (t) { 13434 e = Object.getOwnPropertyDescriptor(t, e); 13435 return e.get ? e.get.call(i) : e.value 13436 } 13437 })(t, e, i || t) 13438 } 13439 13440 function u(e) { 13441 return Object.keys(e).map(function(t) { 13442 return e[t] 13443 }) 13444 } 13445 13446 function h(t) { 13447 return Array.prototype.slice.call(t) 13448 } 13449 13450 function p(t) { 13451 console.error("".concat(M, " ").concat(t)) 13452 } 13453 13454 function f(t) { 13455 return t && Promise.resolve(t) === t 13456 } 13457 13458 function m(t) { 13459 return t instanceof Element || "object" === c(t = t) && t.jquery 13460 } 13461 13462 function e(t) { 13463 var e, i = {}; 13464 for (e in t) i[t[e]] = "swal2-" + t[e]; 13465 return i 13466 } 13467 13468 function g(t) { 13469 var e = F(); 13470 return e ? e.querySelector(t) : null 13471 } 13472 13473 function i(t) { 13474 return g(".".concat(t)) 13475 } 13476 13477 function v() { 13478 return h(q().querySelectorAll(".".concat(R.icon))) 13479 } 13480 13481 function b() { 13482 var t = v().filter(function(t) { 13483 return dt(t) 13484 }); 13485 return t.length ? t[0] : null 13486 } 13487 13488 function y() { 13489 return i(R.title) 13490 } 13491 13492 function w() { 13493 return i(R.content) 13494 } 13495 13496 function C() { 13497 return i(R.image) 13498 } 13499 13500 function x() { 13501 return i(R["progress-steps"]) 13502 } 13503 13504 function _() { 13505 return i(R["validation-message"]) 13506 } 13507 13508 function S() { 13509 return g(".".concat(R.actions, " .").concat(R.confirm)) 13510 } 13511 13512 function T() { 13513 return g(".".concat(R.actions, " .").concat(R.cancel)) 13514 } 13515 13516 function $() { 13517 return i(R.actions) 13518 } 13519 13520 function E() { 13521 return i(R.header) 13522 } 13523 13524 function k() { 13525 return i(R.footer) 13526 } 13527 13528 function I() { 13529 return i(R["timer-progress-bar"]) 13530 } 13531 13532 function O() { 13533 return i(R.close) 13534 } 13535 13536 function z() { 13537 var t = h(q().querySelectorAll('[tabindex]:not([tabindex="-1"]):not([tabindex="0"])')).sort(function(t, e) { 13538 return t = parseInt(t.getAttribute("tabindex")), (e = parseInt(e.getAttribute("tabindex"))) < t ? 1 : t < e ? -1 : 0 13539 }), 13540 e = h(q().querySelectorAll('\n a[href],\n area[href],\n input:not([disabled]),\n select:not([disabled]),\n textarea:not([disabled]),\n button:not([disabled]),\n iframe,\n object,\n embed,\n [tabindex="0"],\n [contenteditable],\n audio[controls],\n video[controls],\n summary\n')).filter(function(t) { 13541 return "-1" !== t.getAttribute("tabindex") 13542 }); 13543 return function(t) { 13544 for (var e = [], i = 0; i < t.length; i++) - 1 === e.indexOf(t[i]) && e.push(t[i]); 13545 return e 13546 }(t.concat(e)).filter(function(t) { 13547 return dt(t) 13548 }) 13549 } 13550 13551 function A() { 13552 return !V() && !document.body.classList.contains(R["no-backdrop"]) 13553 } 13554 13555 function P(e, t) { 13556 e.textContent = "", t && (h((t = (new DOMParser).parseFromString(t, "text/html")).querySelector("head").childNodes).forEach(function(t) { 13557 e.appendChild(t) 13558 }), h(t.querySelector("body").childNodes).forEach(function(t) { 13559 e.appendChild(t) 13560 })) 13561 } 13562 13563 function D(t, e) { 13564 if (e) { 13565 for (var i = e.split(/\s+/), n = 0; n < i.length; n++) 13566 if (!t.classList.contains(i[n])) return; 13567 return 1 13568 } 13569 } 13570 13571 function L(t, e, i) { 13572 var n, o = e; 13573 if (h((n = t).classList).forEach(function(t) { 13574 -1 === u(R).indexOf(t) && -1 === u(W).indexOf(t) && -1 === u(o.showClass).indexOf(t) && n.classList.remove(t) 13575 }), e.customClass && e.customClass[i]) { 13576 if ("string" != typeof e.customClass[i] && !e.customClass[i].forEach) return N("Invalid type of customClass.".concat(i, '! Expected string or iterable object, got "').concat(c(e.customClass[i]), '"')); 13577 rt(t, e.customClass[i]) 13578 } 13579 } 13580 var M = "SweetAlert2:", 13581 N = function(t) { 13582 console.warn("".concat(M, " ").concat(t)) 13583 }, 13584 H = [], 13585 j = function(t) { 13586 return "function" == typeof t ? t() : t 13587 }, 13588 B = Object.freeze({ 13589 cancel: "cancel", 13590 backdrop: "backdrop", 13591 close: "close", 13592 esc: "esc", 13593 timer: "timer" 13594 }), 13595 R = e(["container", "shown", "height-auto", "iosfix", "popup", "modal", "no-backdrop", "no-transition", "toast", "toast-shown", "toast-column", "show", "hide", "close", "title", "header", "content", "html-container", "actions", "confirm", "cancel", "footer", "icon", "icon-content", "image", "input", "file", "range", "select", "radio", "checkbox", "label", "textarea", "inputerror", "validation-message", "progress-steps", "active-progress-step", "progress-step", "progress-step-line", "loading", "styled", "top", "top-start", "top-end", "top-left", "top-right", "center", "center-start", "center-end", "center-left", "center-right", "bottom", "bottom-start", "bottom-end", "bottom-left", "bottom-right", "grow-row", "grow-column", "grow-fullscreen", "rtl", "timer-progress-bar", "timer-progress-bar-container", "scrollbar-measure", "icon-success", "icon-warning", "icon-info", "icon-question", "icon-error"]), 13596 W = e(["success", "warning", "info", "question", "error"]), 13597 F = function() { 13598 return document.body.querySelector(".".concat(R.container)) 13599 }, 13600 q = function() { 13601 return i(R.popup) 13602 }, 13603 V = function() { 13604 return document.body.classList.contains(R["toast-shown"]) 13605 }, 13606 U = { 13607 previousBodyPadding: null 13608 }; 13609 13610 function G(t, e) { 13611 if (!e) return null; 13612 switch (e) { 13613 case "select": 13614 case "textarea":
13615 case "file": 13616 return ct(t, R[e]); 13617 case "checkbox": 13618 return t.querySelector(".".concat(R.checkbox, " input")); 13619 case "radio": 13620 return t.querySelector(".".concat(R.radio, " input:checked")) || t.querySelector(".".concat(R.radio, " input:first-child")); 13621 case "range": 13622 return t.querySelector(".".concat(R.range, " input")); 13623 default: 13624 return ct(t, R.input) 13625 } 13626 } 13627 13628 function Y(t) { 13629 var e; 13630 t.focus(), "file" !== t.type && (e = t.value, t.value = "", t.value = e) 13631 } 13632 13633 function X(t, e, i) { 13634 t && e && (e = "string" == typeof e ? e.split(/\s+/).filter(Boolean) : e).forEach(function(e) { 13635 t.forEach ? t.forEach(function(t) { 13636 i ? t.classList.add(e) : t.classList.remove(e) 13637 }) : i ? t.classList.add(e) : t.classList.remove(e) 13638 }) 13639 } 13640 13641 function K(t, e, i) { 13642 i || 0 === parseInt(i) ? t.style[e] = "number" == typeof i ? "".concat(i, "px") : i : t.style.removeProperty(e) 13643 } 13644 13645 function Z(t, e) { 13646 e = 1 < arguments.length && void 0 !== e ? e : "flex"; 13647 t.style.opacity = "", t.style.display = e 13648 } 13649 13650 function Q(t) { 13651 t.style.opacity = "", t.style.display = "none" 13652 } 13653 13654 function J(t, e, i) { 13655 e ? Z(t, i) : Q(t) 13656 } 13657 13658 function tt(t) { 13659 var e = window.getComputedStyle(t), 13660 t = parseFloat(e.getPropertyValue("animation-duration") || "0"), 13661 e = parseFloat(e.getPropertyValue("transition-duration") || "0"); 13662 return 0 < t || 0 < e 13663 } 13664 13665 function et(t, e) { 13666 var e = 1 < arguments.length && void 0 !== e && e, 13667 i = I(); 13668 dt(i) && (e && (i.style.transition = "none", i.style.width = "100%"), setTimeout(function() { 13669 i.style.transition = "width ".concat(t / 1e3, "s linear"), i.style.width = "0%" 13670 }, 10)) 13671 } 13672 13673 function it() { 13674 return "undefined" == typeof window || "undefined" == typeof document 13675 } 13676 13677 function nt(t) { 13678 Ie.isVisible() && at !== t.target.value && Ie.resetValidationMessage(), at = t.target.value 13679 } 13680 13681 function ot(t, e) { 13682 t instanceof HTMLElement ? e.appendChild(t) : "object" === c(t) ? ht(t, e) : t && P(e, t) 13683 } 13684 13685 function st(t, e) { 13686 var i = $(), 13687 n = S(), 13688 o = T(); 13689 e.showConfirmButton || e.showCancelButton || Q(i), L(i, e, "actions"), ft(n, "confirm", e), ft(o, "cancel", e), e.buttonsStyling ? function(t, e, i) { 13690 rt([t, e], R.styled), i.confirmButtonColor && (t.style.backgroundColor = i.confirmButtonColor), i.cancelButtonColor && (e.style.backgroundColor = i.cancelButtonColor); 13691 i = window.getComputedStyle(t).getPropertyValue("background-color"); 13692 t.style.borderLeftColor = i, t.style.borderRightColor = i 13693 }(n, o, e) : (lt([n, o], R.styled), n.style.backgroundColor = n.style.borderLeftColor = n.style.borderRightColor = "", o.style.backgroundColor = o.style.borderLeftColor = o.style.borderRightColor = ""), e.reverseButtons && n.parentNode.insertBefore(o, n) 13694 } 13695 var at, rt = function(t, e) { 13696 X(t, e, !0) 13697 }, 13698 lt = function(t, e) { 13699 X(t, e, !1) 13700 }, 13701 ct = function(t, e) { 13702 for (var i = 0; i < t.childNodes.length; i++) 13703 if (D(t.childNodes[i], e)) return t.childNodes[i] 13704 }, 13705 dt = function(t) { 13706 return !(!t || !(t.offsetWidth || t.offsetHeight || t.getClientRects().length)) 13707 }, 13708 ut = '\n <div aria-labelledby="'.concat(R.title, '" aria-describedby="').concat(R.content, '" class="').concat(R.popup, '" tabindex="-1">\n <div class="').concat(R.header, '">\n <ul class="').concat(R["progress-steps"], '"></ul>\n <div class="').concat(R.icon, " ").concat(W.error, '"></div>\n <div class="').concat(R.icon, " ").concat(W.question, '"></div>\n <div class="').concat(R.icon, " ").concat(W.warning, '"></div>\n <div class="').concat(R.icon, " ").concat(W.info, '"></div>\n <div class="').concat(R.icon, " ").concat(W.success, '"></div>\n <img class="').concat(R.image, '" />\n <h2 class="').concat(R.title, '" id="').concat(R.title, '"></h2>\n <button type="button" class="').concat(R.close, '"></button>\n </div>\n <div class="').concat(R.content, '">\n <div id="').concat(R.content, '" class="').concat(R["html-container"], '"></div>\n <input class="').concat(R.input, '" />\n <input type="file" class="').concat(R.file, '" />\n <div class="').concat(R.range, '">\n <input type="range" />\n <output></output>\n </div>\n <select class="').concat(R.select, '"></select>\n <div class="').concat(R.radio, '"></div>
13708\n <label for="').concat(R.checkbox, '" class="').concat(R.checkbox, '">\n <input type="checkbox" />\n <span class="').concat(R.label, '"></span>\n </label>\n <textarea class="').concat(R.textarea, '"></textarea>\n <div class="').concat(R["validation-message"], '" id="').concat(R["validation-message"], '"></div>\n </div>\n <div class="').concat(R.actions, '">\n <button type="button" class="').concat(R.confirm, '">OK</button>\n <button type="button" class="').concat(R.cancel, '">Cancel</button>\n </div>\n <div class="').concat(R.footer, '"></div>\n <div class="').concat(R["timer-progress-bar-container"], '">\n <div class="').concat(R["timer-progress-bar"], '"></div>\n </div>\n </div>\n').replace(/(^|\n)\s*/g, ""), 13709 ht = function(t, e) { 13710 t.jquery ? function(t, e) { 13711 if (t.textContent = "", 0 in e) 13712 for (var i = 0; i in e; i++) t.appendChild(e[i].cloneNode(!0)); 13713 else t.appendChild(e.cloneNode(!0)) 13714 }(e, t) : P(e, t.toString()) 13715 }, 13716 pt = function() { 13717 if (it()) return !1; 13718 var t, e = document.createElement("div"), 13719 i = { 13720 WebkitAnimation: "webkitAnimationEnd", 13721 OAnimation: "oAnimationEnd oanimationend", 13722 animation: "animationend" 13723 }; 13724 for (t in i) 13725 if (Object.prototype.hasOwnProperty.call(i, t) && void 0 !== e.style[t]) return i[t]; 13726 return !1 13727 }(); 13728 13729 function ft(t, e, i) { 13730 var n; 13731 J(t, i["show".concat((n = e).charAt(0).toUpperCase() + n.slice(1), "Button")], "inline-block"), P(t, i["".concat(e, "ButtonText")]), t.setAttribute("aria-label", i["".concat(e, "ButtonAriaLabel")]), t.className = R[e], L(t, i, "".concat(e, "Button")), rt(t, i["".concat(e, "ButtonClass")]) 13732 } 13733 13734 function mt(t, e) { 13735 t.placeholder && !e.inputPlaceholder || (t.placeholder = e.inputPlaceholder) 13736 } 13737 13738 function gt(t) { 13739 return t = R[t] || R.input, ct(w(), t) 13740 } 13741 var vt = { 13742 promise: new WeakMap, 13743 innerParams: new WeakMap, 13744 domCache: new WeakMap 13745 }, 13746 bt = ["input", "file", "range", "select", "radio", "checkbox", "textarea"], 13747 yt = function(t) { 13748 if (!xt[t.input]) return p('Unexpected type of input! Expected "text", "email", "password", "number", "tel", "select", "radio", "checkbox", "textarea", "file" or "url", got "'.concat(t.input, '"')); 13749 var e = gt(t.input), 13750 i = xt[t.input](e, t); 13751 Z(i), setTimeout(function() { 13752 Y(i) 13753 }) 13754 }, 13755 wt = function(t, e) { 13756 var i = G(w(), t); 13757 if (i) 13758 for (var n in function(t) { 13759 for (var e = 0; e < t.attributes.length; e++) { 13760 var i = t.attributes[e].name; - 1 === ["type", "value", "style"].indexOf(i) && t.removeAttribute(i) 13761 } 13762 }(i), e) "range" === t && "placeholder" === n || i.setAttribute(n, e[n]) 13763 }, 13764 Ct = function(t) { 13765 var e = gt(t.input); 13766 t.customClass && rt(e, t.customClass.input) 13767 }, 13768 xt = {}; 13769 13770 function _t() { 13771 return F().getAttribute("data-queue-step") 13772 } 13773 13774 function St(t, e) { 13775 var i; 13776 L(E(), e, "header"), 13777 function(o) { 13778 var s = x(); 13779 if (!o.progressSteps || 0 === o.progressSteps.length) return Q(s); 13780 Z(s), s.textContent = ""; 13781 var a = parseInt(void 0 === o.currentProgressStep ? _t() : o.currentProgressStep); 13782 a >= o.progressSteps.length && N("Invalid currentProgressStep parameter, it should be less than progressSteps.length (currentProgressStep like JS arrays starts from 0)"), o.progressSteps.forEach(function(t, e) { 13783 var i, n = (i = t, n = document.createElement("li"), rt(n, R["progress-step"]), P(n, i), n); 13784 s.appendChild(n), e === a && rt(n, R["active-progress-step"]), e !== o.progressSteps.length - 1 && (e = t, t = document.createElement("li"), rt(t, R["progress-step-line"]), e.progressStepsDistance && (t.style.width = e.progressStepsDistance), t = t, s.appendChild(t)) 13785 }) 13786 }(e), i = e, (t = vt.innerParams.get(t)) && i.icon === t.icon && b() ? L(b(), i, "icon") : (kt(), i.icon && (-1 !== Object.keys(W).indexOf(i.icon) ? (Z(t = g(".".concat(R.icon, ".").concat(W[i.icon]))), Ot(t, i), It(), L(t, i, "icon"), rt(t, i.showClass.icon)) : p('Unknown icon! Expected "success", "error", "warning", "info" or "question", got "'.concat(i.icon, '"')))), 13787 function(t) { 13788 var e = C(); 13789 if (!t.imageUrl) return Q(e); 13790 Z(e), e.setAttribute("src", t.imageUrl), e.setAttribute("alt", t.imageAlt), K(e, "width", t.imageWidth), K(e, "height", t.imageHeight), e.className = R.image, L(e, t, "image") 13791 }(e), t = e, J(i = y(), t.title || t.titleText), t.title && ot(t.title, i), t.titleText && (i.innerText = t.titleText), L(i, t, "title"), t = e, P(e = O(), t.closeButtonHtml), L(e, t, "closeButton"), J(e, t.showCloseButton), e.setAttribute("aria-label", t.closeButtonAriaLabel) 13792 } 13793 13794 function Tt(t, e) { 13795 var n, o, s, i, a, r = e,
13796 l = q(); 13797 K(l, "width", r.width), K(l, "padding", r.padding), r.background && (l.style.background = r.background), a = r, (i = l).className = "".concat(R.popup, " ").concat(dt(i) ? a.showClass.popup : ""), a.toast ? (rt([document.documentElement, document.body], R["toast-shown"]), rt(i, R.toast)) : rt(i, R.modal), L(i, a, "popup"), "string" == typeof a.customClass && rt(i, a.customClass), a.icon && rt(i, R["icon-".concat(a.icon)]), r = e, (l = F()) && ("string" == typeof(i = r.backdrop) ? l.style.background = i : i || rt([document.documentElement, document.body], R["no-backdrop"]), !r.backdrop && r.allowOutsideClick && N('"allowOutsideClick" parameter requires `backdrop` parameter to be set to `true`'), a = l, (i = r.position) in R ? rt(a, R[i]) : (N('The "position" parameter is not valid, defaulting to "center"'), rt(a, R.center)), i = l, !(a = r.grow) || "string" != typeof a || (a = "grow-".concat(a)) in R && rt(i, R[a]), L(l, r, "container"), (r = document.body.getAttribute("data-swal2-queue-step")) && (l.setAttribute("data-queue-step", r), document.body.removeAttribute("data-swal2-queue-step"))), St(t, e), l = t, r = e, t = w().querySelector("#".concat(R.content)), r.html ? (ot(r.html, t), Z(t, "block")) : r.text ? (t.textContent = r.text, Z(t, "block")) : Q(t), l = l, n = r, o = w(), l = vt.innerParams.get(l), s = !l || n.input !== l.input, bt.forEach(function(t) { 13798 var e = R[t], 13799 i = ct(o, e); 13800 wt(t, n.inputAttributes), i.className = e, s && Q(i) 13801 }), n.input && (s && yt(n), Ct(n)), L(w(), r, "content"), st(0, e), l = e, J(r = k(), l.footer), l.footer && ot(l.footer, r), L(r, l, "footer"), "function" == typeof e.onRender && e.onRender(q()) 13802 } 13803 13804 function $t() { 13805 return S() && S().click() 13806 } 13807 xt.text = xt.email = xt.password = xt.number = xt.tel = xt.url = function(t, e) { 13808 return "string" == typeof e.inputValue || "number" == typeof e.inputValue ? t.value = e.inputValue : f(e.inputValue) || N('Unexpected type of inputValue! Expected "string", "number" or "Promise", got "'.concat(c(e.inputValue), '"')), mt(t, e), t.type = e.input, t 13809 }, xt.file = function(t, e) { 13810 return mt(t, e), t 13811 }, xt.range = function(t, e) { 13812 var i = t.querySelector("input"), 13813 n = t.querySelector("output"); 13814 return i.value = e.inputValue, i.type = e.input, n.value = e.inputValue, t 13815 }, xt.select = function(t, e) { 13816 var i; 13817 return t.textContent = "", e.inputPlaceholder && (P(i = document.createElement("option"), e.inputPlaceholder), i.value = "", i.disabled = !0, i.selected = !0, t.appendChild(i)), t 13818 }, xt.radio = function(t) { 13819 return t.textContent = "", t 13820 }, xt.checkbox = function(t, e) { 13821 var i = G(w(), "checkbox"); 13822 return i.value = 1, i.id = R.checkbox, i.checked = Boolean(e.inputValue), P(t.querySelector("span"), e.inputPlaceholder), t 13823 }, xt.textarea = function(e, t) { 13824 var i, n; 13825 return e.value = t.inputValue, mt(e, t), "MutationObserver" in window && (i = parseInt(window.getComputedStyle(q()).width), n = parseInt(window.getComputedStyle(q()).paddingLeft) + parseInt(window.getComputedStyle(q()).paddingRight), new MutationObserver(function() { 13826 var t = e.offsetWidth + n; 13827 q().style.width = i < t ? "".concat(t, "px") : null 13828 }).observe(e, { 13829 attributes: !0, 13830 attributeFilter: ["style"] 13831 })), e 13832 }; 13833 13834 function Et(t) { 13835 return '<div class="'.concat(R["icon-content"], '">').concat(t, "</div>") 13836 } 13837 var kt = function() { 13838 for (var t = v(), e = 0; e < t.length; e++) Q(t[e]) 13839 }, 13840 It = function() { 13841 for (var t = q(), e = window.getComputedStyle(t).getPropertyValue("background-color"), i = t.querySelectorAll("[class^=swal2-success-circular-line], .swal2-success-fix"), n = 0; n < i.length; n++) i[n].style.backgroundColor = e 13842 }, 13843 Ot = function(t, e) { 13844 t.textContent = "", e.iconHtml ? P(t, Et(e.iconHtml)) : "success" === e.icon ? P(t, '\n <div class="swal2-success-circular-line-left"></div>
13844\n <span class="swal2-success-line-tip"></span> <span class="swal2-success-line-long"></span>\n <div class="swal2-success-ring"></div> <div class="swal2-success-fix"></div>\n <div class="swal2-success-circular-line-right"></div>\n ') : "error" === e.icon ? P(t, '\n <span class="swal2-x-mark">\n <span class="swal2-x-mark-line-left"></span>\n <span class="swal2-x-mark-line-right"></span>\n </span>\n ') : P(t, Et({ 13845 question: "?", 13846 warning: "!", 13847 info: "i" 13848 } [e.icon])) 13849 }, 13850 zt = []; 13851 13852 function At() { 13853 (t = q()) || Ie.fire(); 13854 var t = q(), 13855 e = $(), 13856 i = S(); 13857 Z(e), Z(i, "inline-block"), rt([t, e], R.loading), i.disabled = !0, t.setAttribute("data-loading", !0), t.setAttribute("aria-busy", !0), t.focus() 13858 } 13859 13860 function Pt() { 13861 if (Nt.timeout) return function() { 13862 var t = I(), 13863 e = parseInt(window.getComputedStyle(t).width); 13864 t.style.removeProperty("transition"), t.style.width = "100%"; 13865 var i = parseInt(window.getComputedStyle(t).width), 13866 i = parseInt(e / i * 100); 13867 t.style.removeProperty("transition"), t.style.width = "".concat(i, "%") 13868 }(), Nt.timeout.stop() 13869 } 13870 13871 function Dt() { 13872 if (Nt.timeout) { 13873 var t = Nt.timeout.start(); 13874 return et(t), t 13875 } 13876 } 13877 13878 function Lt(t) { 13879 return Object.prototype.hasOwnProperty.call(Ht, t) 13880 } 13881 13882 function Mt(t) { 13883 return Bt[t] 13884 } 13885 var Nt = {}, 13886 Ht = { 13887 title: "", 13888 titleText: "", 13889 text: "", 13890 html: "", 13891 footer: "", 13892 icon: void 0, 13893 iconHtml: void 0, 13894 toast: !1, 13895 animation: !0, 13896 showClass: { 13897 popup: "swal2-show", 13898 backdrop: "swal2-backdrop-show", 13899 icon: "swal2-icon-show" 13900 }, 13901 hideClass: { 13902 popup: "swal2-hide", 13903 backdrop: "swal2-backdrop-hide", 13904 icon: "swal2-icon-hide" 13905 }, 13906 customClass: void 0, 13907 target: "body", 13908 backdrop: !0, 13909 heightAuto: !0, 13910 allowOutsideClick: !0, 13911 allowEscapeKey: !0, 13912 allowEnterKey: !0, 13913 stopKeydownPropagation: !0, 13914 keydownListenerCapture: !1, 13915 showConfirmButton: !0, 13916 showCancelButton: !1, 13917 preConfirm: void 0, 13918 confirmButtonText: "OK", 13919 confirmButtonAriaLabel: "", 13920 confirmButtonColor: void 0, 13921 cancelButtonText: "Cancel", 13922 cancelButtonAriaLabel: "", 13923 cancelButtonColor: void 0, 13924 buttonsStyling: !0, 13925 reverseButtons: !1, 13926 focusConfirm: !0, 13927 focusCancel: !1, 13928 showCloseButton: !1, 13929 closeButtonHtml: "×", 13930 closeButtonAriaLabel: "Close this dialog", 13931 showLoaderOnConfirm: !1, 13932 imageUrl: void 0, 13933 imageWidth: void 0, 13934 imageHeight: void 0, 13935 imageAlt: "", 13936 timer: void 0, 13937 timerProgressBar: !1, 13938 width: void 0, 13939 padding: void 0, 13940 background: void 0, 13941 input: void 0, 13942 inputPlaceholder: "", 13943 inputValue: "", 13944 inputOptions: {}, 13945 inputAutoTrim: !0, 13946 inputAttributes: {}, 13947 inputValidator: void 0, 13948 validationMessage: void 0, 13949 grow: !1, 13950 position: "center", 13951 progressSteps: [], 13952 currentProgressStep: void 0, 13953 progressStepsDistance: void 0, 13954 onBeforeOpen: void 0, 13955 onOpen: void 0, 13956 onRender: void 0, 13957 onClose: void 0, 13958 onAfterClose: void 0, 13959 onDestroy: void 0, 13960 scrollbarPadding: !0 13961 }, 13962 jt = ["title", "titleText", "text", "html", "icon", "hideClass", "customClass", "allowOutsideClick", "allowEscapeKey", "showConfirmButton", "showCancelButton", "confirmButtonText", "confirmButtonAriaLabel", "confirmButtonColor", "cancelButtonText", "cancelButtonAriaLabel", "cancelButtonColor", "buttonsStyling", "reverseButtons", "imageUrl", "imageWidth", "imageHeight", "imageAlt", "progressSteps", "currentProgressStep"], 13963 Bt = { 13964 animation: 'showClass" and "hideClass' 13965 }, 13966 Rt = ["allowOutsideClick", "allowEnterKey", "backdrop", "focusConfirm", "focusCancel", "heightAuto", "keydownListenerCapture"], 13967 Wt = Object.freeze({ 13968 isValidParameter: Lt, 13969 isUpdatableParameter: function(t) { 13970 return -1 !== jt.indexOf(t) 13971 }, 13972 isDeprecatedParameter: Mt, 13973 argsToParams: function(i) { 13974 var n = {}; 13975 return "object" !== c(i[0]) || m(i[0]) ? ["title", "html", "icon"].forEach(function(t, e) { 13976 e = i[e]; 13977 "string" == typeof e || m(e) ? n[t] = e : void 0 !== e && p("Unexpected type of ".concat(t, '! Expected "string" or "Element", got ').concat(c(e))) 13978 }) : l(n, i[0]), n 13979 }, 13980 isVisible: function() { 13981 return dt(q()) 13982 }, 13983 clickConfirm: $t, 13984 clickCancel: function() { 13985 return T() && T().click() 13986 }, 13987 getContainer: F, 13988 getPopup: q, 13989 getTitle: y, 13990 getContent: w, 13991 getHtmlContainer: function() { 13992 return i(R["html-container"]) 13993 }, 13994 getImage: C, 13995 getIcon: b, 13996 getIcons: v, 13997 getCloseButton: O, 13998 getActions: $, 13999 getConfirmButton: S, 14000 getCancelButton: T, 14001 getHeader: E, 14002 getFooter: k, 14003 getTimerProgressBar: I, 14004 getFocusableElements: z, 14005 getValidationMessage: _, 14006 isLoading: function() { 14007 return q().hasAttribute("data-loading") 14008 }, 14009 fire: function() { 14010 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 14011 return r(this, e) 14012 }, 14013 mixin: function(e) { 14014 return function(t, e) { 14015 if ("function" != typeof e && null !== e) throw new TypeError("Super expression must either be null or a function"); 14016 t.prototype = Object.create(e && e.prototype, { 14017 constructor: { 14018 value: t, 14019 writable: !0, 14020 configurable: !0 14021 } 14022 }), e && a(t, e) 14023 }(i, this), t(i, [{ 14024 key: "_main", 14025 value: function(t) { 14026 return d(s(i.prototype), "_main", this).call(this, l({}, e, t)) 14027 } 14028 }]), i; 14029 14030 function i() { 14031 return n(this, i), t = this, !(e = s(i).apply(this, arguments)) || "object" != typeof e && "function" != typeof e ? function(t) { 14032 if (void 0 === t) throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); 14033 return t 14034 }(t) : e; 14035 var t, e 14036 } 14037 }, 14038 queue: function(t) { 14039 var s = this; 14040 14041 function a(t, e) { 14042 zt = [], t(e) 14043 } 14044 zt = t; 14045 var r = []; 14046 return new Promise(function(o) { 14047 ! function e(i, n) { 14048 i < zt.length ? (document.body.setAttribute("data-swal2-queue-step", i), s.fire(zt[i]).then(function(t) { 14049 void 0 !== t.value ? (r.push(t.value), e(i + 1, n)) : a(o, { 14050 dismiss: t.dismiss 14051 }) 14052 })) : a(o, { 14053 value: r 14054 }) 14055 }(0) 14056 }) 14057 }, 14058 getQueueStep: _t, 14059 insertQueueStep: function(t, e) { 14060 return e && e < zt.length ? zt.splice(e, 0, t) : zt.push(t) 14061 }, 14062 deleteQueueStep: function(t) { 14063 void 0 !== zt[t] && zt.splice(t, 1) 14064 }, 14065 showLoading: At, 14066 enableLoading: At, 14067 getTimerLeft: function() { 14068 return Nt.timeout && Nt.timeout.getTimerLeft() 14069 }, 14070 stopTimer: Pt, 14071 resumeTimer: Dt, 14072 toggleTimer: function() { 14073 var t = Nt.timeout; 14074 return t && (t.running ? Pt : Dt)() 14075 }, 14076 increaseTimer: function(t) { 14077 if (Nt.timeout) { 14078 t = Nt.timeout.increase(t); 14079 return et(t, !0), t 14080 } 14081 }, 14082 isTimerRunning: function() { 14083 return Nt.timeout && Nt.timeout.isRunning() 14084 } 14085 }); 14086 14087 function Ft() { 14088 var t, e = vt.innerParams.get(this); 14089 e && (t = vt.domCache.get(this), e.showConfirmButton || (Q(t.confirmButton), e.showCancelButton || Q(t.actions)), lt([t.popup, t.actions], R.loading), t.popup.removeAttribute("aria-busy"), t.popup.removeAttribute("data-loading"), t.confirmButton.disabled = !1, t.cancelButton.disabled = !1) 14090 } 14091 14092 function qt() { 14093 return window.MSInputMethodContext && document.documentMode 14094 } 14095 14096 function Vt() { 14097 var t = F(),
14098 e = q(); 14099 t.style.removeProperty("align-items"), e.offsetTop < 0 && (t.style.alignItems = "flex-start") 14100 } 14101 var Ut = function() { 14102 var e, i = F(); 14103 i.ontouchstart = function(t) { 14104 e = t.target === i || !(i.scrollHeight > i.clientHeight) && "INPUT" !== t.target.tagName 14105 }, i.ontouchmove = function(t) { 14106 e && (t.preventDefault(), t.stopPropagation()) 14107 } 14108 }, 14109 Gt = { 14110 swalPromiseResolve: new WeakMap 14111 }; 14112 14113 function Yt(t, e, i, n) { 14114 i ? Kt(t, n) : (new Promise(function(t) { 14115 var e = window.scrollX, 14116 i = window.scrollY; 14117 Nt.restoreFocusTimeout = setTimeout(function() { 14118 Nt.previousActiveElement && Nt.previousActiveElement.focus ? (Nt.previousActiveElement.focus(), Nt.previousActiveElement = null) : document.body && document.body.focus(), t() 14119 }, 100), void 0 !== e && void 0 !== i && window.scrollTo(e, i) 14120 }).then(function() { 14121 return Kt(t, n) 14122 }), Nt.keydownTarget.removeEventListener("keydown", Nt.keydownHandler, { 14123 capture: Nt.keydownListenerCapture 14124 }), Nt.keydownHandlerAdded = !1), e.parentNode && !document.body.getAttribute("data-swal2-queue-step") && e.parentNode.removeChild(e), A() && (null !== U.previousBodyPadding && (document.body.style.paddingRight = "".concat(U.previousBodyPadding, "px"), U.previousBodyPadding = null), D(document.body, R.iosfix) && (e = parseInt(document.body.style.top, 10), lt(document.body, R.iosfix), document.body.style.top = "", document.body.scrollTop = -1 * e), "undefined" != typeof window && qt() && window.removeEventListener("resize", Vt), h(document.body.children).forEach(function(t) { 14125 t.hasAttribute("data-previous-aria-hidden") ? (t.setAttribute("aria-hidden", t.getAttribute("data-previous-aria-hidden")), t.removeAttribute("data-previous-aria-hidden")) : t.removeAttribute("aria-hidden") 14126 })), lt([document.documentElement, document.body], [R.shown, R["height-auto"], R["no-backdrop"], R["toast-shown"], R["toast-column"]]) 14127 } 14128 14129 function Xt(t) { 14130 var e, i, n, o, s, a, r, l = q(); 14131 !l || (r = vt.innerParams.get(this)) && !D(l, r.hideClass.popup) && (e = Gt.swalPromiseResolve.get(this), lt(l, r.showClass.popup), rt(l, r.hideClass.popup), a = F(), lt(a, r.showClass.backdrop), rt(a, r.hideClass.backdrop), i = this, n = l, o = r, a = F(), l = pt && tt(n), r = o.onClose, o = o.onAfterClose, null !== r && "function" == typeof r && r(n), l ? (s = n, n = o, Nt.swalCloseEventFinishedCallback = Yt.bind(null, i, a, V(), n), s.addEventListener(pt, function(t) { 14132 t.target === s && (Nt.swalCloseEventFinishedCallback(), delete Nt.swalCloseEventFinishedCallback) 14133 })) : Yt(i, a, V(), o), e(t || {})) 14134 } 14135 var Kt = function(t, e) { 14136 setTimeout(function() { 14137 "function" == typeof e && e(), t._destroy() 14138 }) 14139 }; 14140 14141 function Zt(t, e, i) { 14142 var n = vt.domCache.get(t); 14143 e.forEach(function(t) { 14144 n[t].disabled = i 14145 }) 14146 } 14147 14148 function Qt(t, e) { 14149 if (!t) return !1; 14150 if ("radio" === t.type) 14151 for (var i = t.parentNode.parentNode.querySelectorAll("input"), n = 0; n < i.length; n++) i[n].disabled = e; 14152 else t.disabled = e 14153 } 14154 var Jt = (t(ee, [{ 14155 key: "start", 14156 value: function() { 14157 return this.running || (this.running = !0, this.started = new Date, this.id = setTimeout(this.callback, this.remaining)), this.remaining 14158 } 14159 }, { 14160 key: "stop", 14161 value: function() { 14162 return this.running && (this.running = !1, clearTimeout(this.id), this.remaining -= new Date - this.started), this.remaining 14163 } 14164 }, { 14165 key: "increase", 14166 value: function(t) { 14167 var e = this.running; 14168 return e && this.stop(), this.remaining += t, e && this.start(), this.remaining 14169 } 14170 }, { 14171 key: "getTimerLeft", 14172 value: function() { 14173 return this.running && (this.stop(), this.start()), this.remaining 14174 } 14175 }, { 14176 key: "isRunning", 14177 value: function() { 14178 return this.running 14179 } 14180 }]), ee), 14181 te = { 14182 email: function(t, e) { 14183 return /^[a-zA-Z0-9.+_-]+@[a-zA-Z0-9.-]+\.[a-zA-Z0-9-]{2,24}$/.test(t) ? Promise.resolve() : Promise.resolve(e || "Invalid email address") 14184 }, 14185 url: function(t, e) { 14186 return /^https?:\/\/(www\.)?[-a-zA-Z0-9@:%._+~#=]{2,256}\.[a-z]{2,63}\b([-a-zA-Z0-9@:%_+.~#?&/=]*)$/.test(t) ? Promise.resolve() : Promise.resolve(e || "Invalid URL") 14187 } 14188 }; 14189 14190 function ee(t, e) { 14191 n(this, ee), this.callback = t, this.remaining = e, this.running = !1, this.start() 14192 } 14193 14194 function ie(t) { 14195 var e, i, n, o, s, a, r; 14196 (e = t).inputValidator || Object.keys(te).forEach(function(t) { 14197 e.input === t && (e.inputValidator = te[t]) 14198 }), t.showLoaderOnConfirm && !t.preConfirm && N("showLoaderOnConfirm is set to true, but preConfirm is not defined.\nshowLoaderOnConfirm should be used together with preConfirm, see usage example:\nhttps://sweetalert2.github.io/#ajax-request"), t.animation = j(t.animation), (s = t).target && ("string" != typeof s.target || document.querySelector(s.target)) && ("string" == typeof s.target || s.target.appendChild) || (N('Target parameter is not val
14198id, defaulting to "body"'), s.target = "body"), "string" == typeof t.title && (t.title = t.title.split("\n").join("<br />")), i = t, r = !!(a = F()) && (a.parentNode.removeChild(a), lt([document.documentElement, document.body], [R["no-backdrop"], R["toast-shown"], R["has-column"]]), !0), it() ? p("SweetAlert2 requires document to initialize") : ((s = document.createElement("div")).className = R.container, r && rt(s, R["no-transition"]), P(s, ut), (a = "string" == typeof(t = i.target) ? document.querySelector(t) : t).appendChild(s), r = i, (t = q()).setAttribute("role", r.toast ? "alert" : "dialog"), t.setAttribute("aria-live", r.toast ? "polite" : "assertive"), r.toast || t.setAttribute("aria-modal", "true"), "rtl" === window.getComputedStyle(a).direction && rt(F(), R.rtl), s = w(), i = ct(s, R.input), r = ct(s, R.file), n = s.querySelector(".".concat(R.range, " input")), o = s.querySelector(".".concat(R.range, " output")), t = ct(s, R.select), a = s.querySelector(".".concat(R.checkbox, " input")), s = ct(s, R.textarea), i.oninput = nt, r.onchange = nt, t.onchange = nt, a.onchange = nt, s.oninput = nt, n.oninput = function(t) { 14199 nt(t), o.value = n.value 14200 }, n.onchange = function(t) { 14201 nt(t), n.nextSibling.value = n.value 14202 }) 14203 } 14204 14205 function ne(t) { 14206 var e, i, n, o = F(), 14207 s = q(); 14208 "function" == typeof t.onBeforeOpen && t.onBeforeOpen(s), i = s, rt(o, (n = t).showClass.backdrop), Z(i), rt(i, n.showClass.popup), rt([document.documentElement, document.body], R.shown), n.heightAuto && n.backdrop && !n.toast && rt([document.documentElement, document.body], R["height-auto"]), i = o, n = s, pt && tt(n) ? (i.style.overflowY = "hidden", n.addEventListener(pt, oe)) : i.style.overflowY = "auto", A() && (e = o, i = t.scrollbarPadding, function() { 14209 var t; 14210 (/iPad|iPhone|iPod/.test(navigator.userAgent) && !window.MSStream || "MacIntel" === navigator.platform && 1 < navigator.maxTouchPoints) && !D(document.body, R.iosfix) && (t = document.body.scrollTop, document.body.style.top = "".concat(-1 * t, "px"), rt(document.body, R.iosfix), Ut()) 14211 }(), "undefined" != typeof window && qt() && (Vt(), window.addEventListener("resize", Vt)), h(document.body.children).forEach(function(t) { 14212 var e, i; 14213 t === F() || (e = t, i = F(), "function" == typeof e.contains && e.contains(i)) || (t.hasAttribute("aria-hidden") && t.setAttribute("data-previous-aria-hidden", t.getAttribute("aria-hidden")), t.setAttribute("aria-hidden", "true")) 14214 }), !i || null === U.previousBodyPadding && document.body.scrollHeight > window.innerHeight && (U.previousBodyPadding = parseInt(window.getComputedStyle(document.body).getPropertyValue("padding-right")), document.body.style.paddingRight = "".concat(U.previousBodyPadding + function() { 14215 var t = document.createElement("div"); 14216 t.className = R["scrollbar-measure"], document.body.appendChild(t); 14217 var e = t.getBoundingClientRect().width - t.clientWidth; 14218 return document.body.removeChild(t), e 14219 }(), "px")), setTimeout(function() { 14220 e.scrollTop = 0 14221 })), V() || Nt.previousActiveElement || (Nt.previousActiveElement = document.activeElement), "function" == typeof t.onOpen && setTimeout(function() { 14222 return t.onOpen(s) 14223 }), lt(o, R["no-transition"]) 14224 } 14225 14226 function oe(t) { 14227 var e = q(); 14228 t.target === e && (t = F(), e.removeEventListener(pt, oe), t.style.overflowY = "auto") 14229 } 14230 14231 function se(t, e) { 14232 var i, n, o, s, a, r; 14233 14234 function l(t) { 14235 return ve[a.input](r, be(t), a) 14236 } 14237 "select" === e.input || "radio" === e.input ? (s = t, a = e, r = w(), f(a.inputOptions) ? (At(), a.inputOptions.then(function(t) { 14238 s.hideLoading(), l(t) 14239 })) : "object" === c(a.inputOptions) ? l(a.inputOptions) : p("Unexpected type of inputOptions! Expected object, Map or Promise, got ".concat(c(a.inputOptions)))) : -1 !== ["text", "email", "number", "tel", "textarea"].indexOf(e.input) && f(e.inputValue) && (n = e, Q(o = (i = t).getInput()), n.inputValue.then(function(t) { 14240 o.value = "number" === n.input ? parseFloat(t) || 0 : "".concat(t), Z(o), o.focus(), i.hideLoading() 14241 }).catch(function(t) { 14242 p("Error in inputValue promise: ".concat(t)), o.value = "", Z(o), o.focus(), i.hideLoading() 14243 })) 14244 } 14245 14246 function ae(t, e) { 14247 var i, n, o; 14248 t.disableButtons(), e.input ? (i = t, o = function(t) { 14249 var e = i.getInput(); 14250 if (!e) return null; 14251 switch (t.input) { 14252 case "checkbox": 14253 return fe(e); 14254 case "radio": 14255 return me(e); 14256 case "file": 14257 return ge(e); 14258 default: 14259 return t.inputAutoTrim ? e.value.trim() : e.value 14260 } 14261 }(n = e), n.inputValidator ? (i.disableInput(), Promise.resolve().then(function() { 14262 return n.inputValidator(o, n.validationMessage) 14263 }).then(function(t) { 14264 i.enableButtons(), i.enableInput(), t ? i.showValidationMessage(t) : ye(i, n, o) 14265 })) : i.getInput().checkValidity() ? ye(i, n, o) : (i.enableButtons(), i.showValidationMessage(n.validationMessage))) : ye(t, e, !0) 14266 } 14267 14268 function re(t, e) { 14269 t.closePopup({ 14270 value: e 14271 }) 14272 } 14273 14274 function le(o, t, e, s) { 14275 t.keydownTarget && t.keydownHandlerAdded && (t.keydownTarget.removeEventListener("keydown", t.keydownHandler, { 14276 capture: t.keydownListenerCapture 14277 }), t.keydownHandlerAdded = !1), e.toast || (t.keydownHandler = function(t) { 14278 return e = o, i = t, n = s, (t = vt.innerParams.get(e)).stopKeydownPropagation && i.stopPropagation(), void("Enter" === i.key ? xe(e, i, t) : "Tab" === i.key ? _e(i, t) : -1 !== we.indexOf(i.key) ? Se() : -1 !== Ce.indexOf(i.key) && Te(i, t, n)); 14279 var e, i, n 14280 }, t.keydownTarget = e.keydownListenerCapture ? window : q(), t.keydownListenerCapture = e.keydownListenerCapture, t.keydownTarget.addEventListener("keydown", t.keydownHandler, { 14281 capture: t.keydownListenerCapture 14282 }), t.keydownHandlerAdded = !0) 14283 } 14284 14285 function ce(t, e, i) { 14286 var n = z(); 14287 if (0 < n.length) return (e += i) === n.length ? e = 0 : -1 === e && (e = n.length - 1), n[e].focus(); 14288 q().focus() 14289 } 14290 14291 function de(t, e, i) { 14292 var n, o, s, a, r, l, c; 14293 vt.innerParams.get(t).toast ? (l = t, c = i, e.popup.onclick = function() { 14294 var t = vt.innerParams.get(l); 14295 t.showConfirmButton || t.showCancelButton || t.showCloseButton || t.input || c(B.close) 14296 }) : ((r = e).popup.onmousedown = function() { 14297 r.container.onmouseup = function(t) { 14298 r.container.onmouseup = void 0, t.target === r.container && ($e = !0) 14299 } 14300 }, (a = e).container.onmousedown = function() { 14301 a.popup.onmouseup = function(t) { 14302 a.popup.onmouseup = void 0, t.target !== a.popup && !a.popup.contains(t.target) || ($e = !0) 14303 } 14304 }, n = t, s = i, (o = e).container.onclick = function(t) { 14305 var e = vt.innerParams.get(n); 14306 $e ? $e = !1 : t.target === o.container && j(e.allowOutsideClick) && s(B.backdrop) 14307 }) 14308 } 14309 14310 function ue(t, e) { 14311 return !e.toast && (j(e.allowEnterKey) ? e.focusCancel && dt(t.cancelButton) ? t.cancelButton.focus() : e.focusConfirm && dt(t.confirmButton) ? t.confirmButton.focus() : void ce(0, -1, 1) : void(document.activeElement && "function" == typeof document.activeElement.blur && document.activeElement.blur())) 14312 } 14313 14314 function he(t) { 14315 for (var e in t) t[e] = new WeakMap 14316 } 14317 var pe, fe = function(t) { 14318 return t.checked ? 1 : 0 14319 }, 14320 me = function(t) { 14321 return t.checked ? t.value : null 14322 }, 14323 ge = function(t) { 14324 return t.files.length ? null !== t.getAttribute("multiple") ? t.files : t.files[0] : null 14325 }, 14326 ve = { 14327 select: function(t, e, n) { 14328 var o = ct(t, R.select); 14329 e.forEach(function(t) { 14330 var e = t[0], 14331 i = t[1], 14332 t = document.createElement("option"); 14333 t.value = e, P(t, i), n.inputValue.toString() === e.toString() && (t.selected = !0), o.appendChild(t) 14334 }), o.focus() 14335 }, 14336 radio: function(t, e, o) { 14337 var s = ct(t, R.radio); 14338 e.forEach(function(t) { 14339 var e = t[0], 14340 i = t[1], 14341 n = document.createElement("input"), 14342 t = document.createElement("label"); 14343 n.type = "radio", n.name = R.radio, n.value = e, o.inputValue.toString() === e.toString() && (n.checked = !0); 14344 e = document.createElement("span"); 14345 P(e, i), e.className = R.label, t.appendChild(n), t.appendChild(e), s.appendChild(t) 14346 }); 14347 e = s.querySelectorAll("input"); 14348 e.length && e[0].focus() 14349 } 14350 }, 14351 be = function(e) { 14352 var i = []; 14353 return "undefined" != typeof Map && e instanceof Map ? e.forEach(function(t, e) { 14354 i.push([e, t]) 14355 }) : Object.keys(e).forEach(function(t) { 14356 i.push([t, e[t]]) 14357 }), i 14358 }, 14359 ye = function(e, t, i) { 14360 t.showLoaderOnConfirm && At(), t.preConfirm ? (e.resetValidationMessage(), Promise.resolve().then(function() { 14361 return t.preConfirm(i, t.validationMessage) 14362 }).then(function(t) { 14363 dt(_()) || !1 === t ? e.hideLoading() : re(e, void 0 === t ? i : t) 14364 })) : re(e, i) 14365 }, 14366 we = ["ArrowLeft", "ArrowRight", "ArrowUp", "ArrowDown", "Left", "Right", "Up", "Down"], 14367 Ce = ["Escape", "Esc"], 14368 xe = function(t, e, i) { 14369 !e.isComposing && e.target && t.getInput() && e.target.outerHTML === t.getInput().outerHTML && -1 === ["textarea", "file"].indexOf(i.input) && ($t(), e.preventDefault()) 14370 }, 14371 _e = function(t) {
14372 for (var e = t.target, i = z(), n = -1, o = 0; o < i.length; o++) 14373 if (e === i[o]) { 14374 n = o; 14375 break 14376 } t.shiftKey ? ce(0, n, -1) : ce(0, n, 1), t.stopPropagation(), t.preventDefault() 14377 }, 14378 Se = function() { 14379 var t = S(), 14380 e = T(); 14381 document.activeElement === t && dt(e) ? e.focus() : document.activeElement === e && dt(t) && t.focus() 14382 }, 14383 Te = function(t, e, i) { 14384 j(e.allowEscapeKey) && (t.preventDefault(), i(B.esc)) 14385 }, 14386 $e = !1, 14387 Ee = Object.freeze({ 14388 hideLoading: Ft, 14389 disableLoading: Ft, 14390 getInput: function(t) { 14391 var e = vt.innerParams.get(t || this), 14392 t = vt.domCache.get(t || this); 14393 return t ? G(t.content, e.input) : null 14394 }, 14395 close: Xt, 14396 closePopup: Xt, 14397 closeModal: Xt, 14398 closeToast: Xt, 14399 enableButtons: function() { 14400 Zt(this, ["confirmButton", "cancelButton"], !1) 14401 }, 14402 disableButtons: function() { 14403 Zt(this, ["confirmButton", "cancelButton"], !0) 14404 }, 14405 enableInput: function() { 14406 return Qt(this.getInput(), !1) 14407 }, 14408 disableInput: function() { 14409 return Qt(this.getInput(), !0) 14410 }, 14411 showValidationMessage: function(t) { 14412 var e = vt.domCache.get(this); 14413 P(e.validationMessage, t); 14414 t = window.getComputedStyle(e.popup); 14415 e.validationMessage.style.marginLeft = "-".concat(t.getPropertyValue("padding-left")), e.validationMessage.style.marginRight = "-".concat(t.getPropertyValue("padding-right")), Z(e.validationMessage); 14416 e = this.getInput(); 14417 e && (e.setAttribute("aria-invalid", !0), e.setAttribute("aria-describedBy", R["validation-message"]), Y(e), rt(e, R.inputerror)) 14418 }, 14419 resetValidationMessage: function() { 14420 var t = vt.domCache.get(this); 14421 t.validationMessage && Q(t.validationMessage); 14422 t = this.getInput(); 14423 t && (t.removeAttribute("aria-invalid"), t.removeAttribute("aria-describedBy"), lt(t, R.inputerror)) 14424 }, 14425 getProgressSteps: function() { 14426 return vt.domCache.get(this).progressSteps 14427 }, 14428 _main: function(t) { 14429 ! function(t) { 14430 for (var e in t) Lt(n = e) || N('Unknown parameter "'.concat(n, '"')), t.toast && (i = e, -1 !== Rt.indexOf(i) && N('The parameter "'.concat(i, '" is incompatible with toasts'))), Mt(i = e) && (e = i, i = Bt[i], i = '"'.concat(e, '" is deprecated and will be removed in the next major release. Please use "').concat(i, '" instead.'), -1 === H.indexOf(i) && (H.push(i), N(i))); 14431 var i, n 14432 }(t), Nt.currentInstance && Nt.currentInstance._destroy(), Nt.currentInstance = this; 14433 var e, i, i = (e = l({}, Ht.showClass, (n = t).showClass), i = l({}, Ht.hideClass, n.hideClass), (t = l({}, Ht, n)).showClass = e, t.hideClass = i, !1 === n.animation && (t.showClass = { 14434 popup: "swal2-noanimation", 14435 backdrop: "swal2-noanimation" 14436 }, t.hideClass = {}), t); 14437 ie(i), Object.freeze(i), Nt.timeout && (Nt.timeout.stop(), delete Nt.timeout), clearTimeout(Nt.restoreFocusTimeout); 14438 var n, s, a, r, t = (n = this, t = { 14439 popup: q(), 14440 container: F(), 14441 content: w(), 14442 actions: $(), 14443 confirmButton: S(), 14444 cancelButton: T(), 14445 closeButton: O(), 14446 validationMessage: _(), 14447 progressSteps: x() 14448 }, vt.domCache.set(n, t), t); 14449 return Tt(this, i), vt.innerParams.set(this, i), s = this, a = t, r = i, new Promise(function(t) { 14450 function e(t) { 14451 s.closePopup({ 14452 dismiss: t 14453 }) 14454 } 14455 var i, n, o; 14456 Gt.swalPromiseResolve.set(s, t), a.confirmButton.onclick = function() { 14457 return ae(s, r) 14458 }, a.cancelButton.onclick = function() { 14459 return t = e, s.disableButtons(), void t(B.cancel); 14460 var t 14461 }, a.closeButton.onclick = function() { 14462 return e(B.close) 14463 }, de(s, a, e), le(s, Nt, r, e), (r.toast && (r.input || r.footer || r.showCloseButton) ? rt : lt)(document.body, R["toast-column"]), se(s, r), ne(r), i = Nt, n = r, o = e, Q(t = I()), n.timer && (i.timeout = new Jt(function() { 14464 o("timer"), delete i.timeout 14465 }, n.timer), n.timerProgressBar && (Z(t), setTimeout(function() { 14466 i.timeout.running && et(n.timer) 14467 }))), ue(a, r), a.container.scrollTop = 0 14468 }) 14469 }, 14470 update: function(e) { 14471 var t = q(), 14472 i = vt.innerParams.get(this); 14473 if (!t || D(t, i.hideClass.popup)) return N("You're trying to update the closed or closing popup, that won't work. Use the update() method in preConfirm parameter or show a new popup."); 14474 var n = {}; 14475 Object.keys(e).forEach(function(t) { 14476 Ie.isUpdatableParameter(t) ? n[t] = e[t] : N('Invalid parameter to update: "'.concat(t, '". Updatable params are listed here: https://github.com/sweetalert2/sweetalert2/blob/master/src/utils/params.js')) 14477 }); 14478 i = l({}, i, n); 14479 Tt(this, i), vt.innerParams.set(this, i), Object.defineProperties(this, { 14480 params: { 14481 value: l({}, this.params, e), 14482 writable: !1, 14483 enumerable: !0 14484 } 14485 }) 14486 }, 14487 _destroy: function() { 14488 var t = vt.domCache.get(this), 14489 e = vt.innerParams.get(this); 14490 e && (t.popup && Nt.swalCloseEventFinishedCallback && (Nt.swalCloseEventFinishedCallback(), delete Nt.swalCloseEventFinishedCallback), Nt.deferDisposalTimer && (clearTimeout(Nt.deferDisposalTimer), delete Nt.deferDisposalTimer), "function" == typeof e.onDestroy && e.onDestroy(), delete this.params, delete Nt.keydownHandler, delete Nt.keydownTarget, he(vt), he(Gt)) 14491 } 14492 }); 14493 14494 function ke() { 14495 if ("undefined" != typeof window) { 14496 "undefined" == typeof Promise && p("This package requires a Promise library, please include a shim to enable it in this browser (See: https://github.com/sweetalert2/sweetalert2/wiki/Migration-from-SweetAlert-to-SweetAlert2#1-ie-support)"), pe = this; 14497 for (var t = arguments.length, e = new Array(t), i = 0; i < t; i++) e[i] = arguments[i]; 14498 var n = Object.freeze(this.constructor.argsToParams(e)); 14499 Object.defineProperties(this, { 14500 params: { 14501 value: n, 14502 writable: !1, 14503 enumerable: !0, 14504 configurable: !0 14505 } 14506 }); 14507 n = this._main(this.params); 14508 vt.promise.set(this, n) 14509 } 14510 } 14511 ke.prototype.then = function(t) { 14512 return vt.promise.get(this).then(t) 14513 }, ke.prototype.finally = function(t) { 14514 return vt.promise.get(this).finally(t) 14515 }, l(ke.prototype, Ee), l(ke, Wt), Object.keys(Ee).forEach(function(t) { 14516 ke[t] = function() { 14517 if (pe) return pe[t].apply(pe, arguments) 14518 } 14519 }), ke.DismissReason = B, ke.version = "9.10.8"; 14520 var Ie = ke; 14521 return Ie.default = Ie 14522 }), void 0 !== this && this.Sweetalert2 && (this.swal = this.sweetAlert = this.Swal = this.SweetAlert = this.Sweetalert2), 14523 function(h, d, p) { 14524 function r(t, e) { 14525 return typeof t === e 14526 } 14527 14528 function f(t) { 14529 return "function" != typeof d.createElement ? d.createElement(t) : w ? d.createElementNS.call(
14529d, "http://www.w3.org/2000/svg", t) : d.createElement.apply(d, arguments) 14530 } 14531 14532 function l(t, e, i) { 14533 var n, o; 14534 for (o in t) 14535 if (t[o] in e) return !1 === i ? t[o] : (n = e[t[o]], r(n, "function") ? function(t, e) { 14536 return function() { 14537 return t.apply(e, arguments) 14538 } 14539 }(n, i || e) : n); 14540 return !1 14541 } 14542 14543 function m(t) { 14544 return t.replace(/([A-Z])/g, function(t, e) { 14545 return "-" + e.toLowerCase() 14546 }).replace(/^ms-/, "-ms-") 14547 } 14548 14549 function g(t, e, i, n) { 14550 var o, s, a, r = "modernizr", 14551 l = f("div"), 14552 c = ((a = d.body) || ((a = f(w ? "svg" : "body")).fake = !0), a); 14553 if (parseInt(i, 10)) 14554 for (; i--;)(o = f("div")).id = n ? n[i] : r + (i + 1), l.appendChild(o); 14555 return (a = f("style")).type = "text/css", a.id = "s" + r, (c.fake ? c : l).appendChild(a), c.appendChild(l), a.styleSheet ? a.styleSheet.cssText = t : a.appendChild(d.createTextNode(t)), l.id = r, c.fake && (c.style.background = "", c.style.overflow = "hidden", s = y.style.overflow, y.style.overflow = "hidden", y.appendChild(c)), t = e(l, t), c.fake ? (c.parentNode.removeChild(c), y.style.overflow = s, y.offsetHeight) : l.parentNode.removeChild(l), !!t 14556 } 14557 14558 function c(t, e, i, n) { 14559 function o() { 14560 a && (delete T.style, delete T.modElem) 14561 } 14562 if (n = void 0 !== n && n, void 0 !== i) { 14563 var s = function(t, e) { 14564 var i = t.length; 14565 if ("CSS" in h && "supports" in h.CSS) { 14566 for (; i--;) 14567 if (h.CSS.supports(m(t[i]), e)) return !0; 14568 return !1 14569 } 14570 if ("CSSSupportsRule" in h) { 14571 for (var n = []; i--;) n.push("(" + m(t[i]) + ":" + e + ")"); 14572 return g("@supports (" + (n = n.join(" or ")) + ") { #modernizr { position: absolute; } }", function(t) { 14573 return "absolute" == getComputedStyle(t, null).position 14574 }) 14575 } 14576 return p 14577 }(t, i); 14578 if (void 0 !== s) return s 14579 } 14580 for (var a, r, l, c, d, u = ["modernizr", "tspan", "samp"]; !T.style && u.length;) a = !0, T.modElem = f(u.shift()), T.style = T.modElem.style; 14581 for (l = t.length, r = 0; r < l; r++) 14582 if (c = t[r], d = T.style[c], ~("" + c).indexOf("-") && (c = c.replace(/([a-z])-([a-z])/g, function(t, e, i) { 14583 return e + i.toUpperCase() 14584 }).replace(/^-/, "")), T.style[c] !== p) { 14585 if (n || void 0 === i) return o(), "pfx" != e || c; 14586 try { 14587 T.style[c] = i 14588 } catch (t) {} 14589 if (T.style[c] != d) return o(), "pfx" != e || c 14590 } return o(), !1 14591 } 14592 14593 function n(t, e, i, n, o) { 14594 var s = t.charAt(0).toUpperCase() + t.slice(1), 14595 a = (t + " " + C.join(s + " ") + s).split(" "); 14596 return r(e, "string") || void 0 === e ? c(a, e, n, o) : l(a = (t + " " + x.join(s + " ") + s).split(" "), e, i) 14597 } 14598 14599 function t(t, e, i) { 14600 return n(t, p, p, e, i) 14601 } 14602 var u = [], 14603 v = [], 14604 e = { 14605 _version: "3.3.1", 14606 _config: { 14607 classPrefix: "", 14608 enableClasses: !0, 14609 enableJSClass: !0, 14610 usePrefixes: !0 14611 }, 14612 _q: [], 14613 on: function(t, e) { 14614 var i = this; 14615 setTimeout(function() { 14616 e(i[t]) 14617 }, 0) 14618 }, 14619 addTest: function(t, e, i) { 14620 v.push({ 14621 name: t, 14622 fn: e, 14623 options: i 14624 }) 14625 }, 14626 addAsyncTest: function(t) { 14627 v.push({ 14628 name: null, 14629 fn: t 14630 }) 14631 } 14632 }; 14633 (b = function() {}).prototype = e; 14634 var b = new b, 14635 y = d.documentElement, 14636 w = "svg" === y.nodeName.toLowerCase(), 14637 i = "Moz O ms Webkit", 14638 C = e._config.usePrefixes ? i.split(" ") : []; 14639 e._cssomPrefixes = C; 14640 var x = e._config.usePrefixes ? i.toLowerCase().split(" ") : []; 14641 e._domPrefixes = x; 14642 var o = { 14643 elem: f("modernizr") 14644 }; 14645 b._q.push(function() { 14646 delete o.elem 14647 }); 14648 var s, a, _, S, T = { 14649 style: o.elem.style 14650 }; 14651 b._q.unshift(function() { 14652 delete T.style 14653 }), e.testAllProps = n, e.testAllProps = t, b.addTest("csstransitions", t("transition", "all", !0)), 14654 function() { 14655 var t, e, i, n, o, s, a; 14656 for (a in v) 14657 if (v.hasOwnProperty(a)) { 14658 if (t = [], (e = v[a]).name && (t.push(e.name.toLowerCase()), e.options && e.options.aliases && e.options.aliases.length)) 14659 for (i = 0; i < e.options.aliases.length; i++) t.push(e.options.aliases[i].toLowerCase()); 14660 for (n = r(e.fn, "function") ? e.fn() : e.fn, o = 0; o < t.length; o++) 1 === (s = t[o].split(".")).length ? b[s[0]] = n : (!b[s[0]] || b[s[0]] instanceof Boolean || (b[s[0]] = new Boolean(b[s[0]])), b[s[0]][s[1]] = n), u.push((n ? "" : "no-") + s.join("-")) 14661 } 14662 }(), s = u, _ = y.className, S = b._config.classPrefix || "", w && (_ = _.baseVal), b._config.enableJSClass && (a = new RegExp("(^|\\s)" + S + "no-js(\\s|$)"), _ = _.replace(a, "$1" + S + "js$2")), b._config.enableClasses && (_ += " " + S + s.join(" " + S), w ? y.className.baseVal = _ : y.className = _), delete e.addTest, delete e.addAsyncTest; 14663 for (var $ = 0; $ < b._q.length; $++) b._q[$](); 14664 h.Modernizr = b 14665 }(window, document), 14666 function(t, e) { 14667 "object" == typeof exports && "undefined" != typeof module ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : (t = t || self).LazyLoad = e() 14668 }(this, function() { 14669 "use strict"; 14670 14671 function e() { 14672 return (e = Object.assign || function(t) { 14673 for (var e = 1; e < arguments.length; e++) { 14674 var i, n = arguments[e]; 14675 for (i in n) Object.prototype.hasOwnProperty.call(n, i) && (t[i] = n[i]) 14676 } 14677 return t 14678 }).apply(this, arguments) 14679 } 14680 14681 function a(t) { 14682 return e({}, I, t) 14683 } 14684 14685 function o(t, e) { 14686 var i, e = new t(e); 14687 try { 14688 i = new CustomEvent("LazyLoad::Initialized", { 14689 detail: { 14690 instance: e 14691 } 14692 }) 14693 } catch (t) { 14694 (i = document.createEvent("CustomEvent")).initCustomEvent("LazyLoad::Initialized", !1, !1, { 14695 instance: e 14696 }) 14697 } 14698 window.dispatchEvent(i) 14699 } 14700 14701 function r(t) { 14702 return "native" === A(t) 14703 } 14704 14705 function l(t, e) { 14706 t && (t.toLoadCount = e) 14707 } 14708 14709 function i(t) { 14710 for (var e, i = [], n = 0; e = t.children[n]; n += 1) "SOURCE" === e.tagName && i.push(e); 14711 return i 14712 } 14713 14714 function n(t, e, i) { 14715 i && t.setAttribute(e, i) 14716 } 14717 14718 function s(t, e) { 14719 t.removeAttribute(e) 14720 } 14721 14722 function c(t) { 14723 return !!t.llOriginalAttrs 14724 } 14725 14726 function d(t) { 14727 var e; 14728 c(t) || ((e = {}).src = t.getAttribute("src"), e.srcset = t.getAttribute("srcset"), e.sizes = t.getAttribute("sizes"), t.llOriginalAttrs = e) 14729 } 14730 14731 function u(t, e) { 14732 n(t, "sizes", O(t, e.data_sizes)), n(t, "srcset", O(t, e.data_srcset)), n(t, "src", O(t, e.data_src)) 14733 } 14734 14735 function h(t, e) { 14736 i(t).forEach(e) 14737 } 14738 14739 function p(t, e) { 14740 var i = U[t.tagName]; 14741 i && i(t, e) 14742 } 14743 14744 function f(t, e) { 14745 var i = Y[t.tagName]; 14746 i ? i(t, e) : (z(t = t, (e = e).data_bg, null), z(t, e.data_bg_hidpi, null)) 14747 } 14748 14749 function m(t, e) { 14750 !e || 0 < e.loadingCount || 0 < e.toLoadCount || N(t.callback_finish, e) 14751 } 14752 14753 function g(t, e, i) { 14754 t.addEventListener(e, i), t.llEvLisnrs[e] = i 14755 } 14756 14757 function v(t, e, i) { 14758 delete t.llTempImage, W(i, -1), i && --i.toLoadCount, j(t, e.class_loading), e.unobserve_completed && R(t, i) 14759 } 14760 14761 function b(t) { 14762 return t.use_native && "loading" in HTMLImageElement.prototype 14763 } 14764 14765 function y(t, c, d) { 14766 t.forEach(function(t) { 14767 return t.isIntersecting || 0 < t.intersectionRatio ? (s = t.target, a = t, r = c, l = d, P(s, "entered"), r.unobserve_entered && R(s, l), N(r.callback_enter, s, a, l), void(0 <= M.indexOf(A(s)) || et(s, r, l))) : (e = t.target, i = t, n = c, o = d, void(L(e) || (a = e, s = i, r = o, (l = n).cancel_on_exit && "loading" === A(a) && "IMG" === a.tagName && (J(a), V(t = a, function(t) { 14768 q(t) 14769 }), q(t), V(t = a, function(t) { 14770 F(t) 14771 }), F(t), j(a, l.class_loading), W(r, -1), D(a), N(l.callback_cancel, a, s, r)), N(n.callback_exit, e, i, o)))); 14772 var e, i, n, o, s, a, r, l 14773 }) 14774 } 14775 14776 function w(t) { 14777 return Array.prototype.slice.call(t) 14778 } 14779 14780 function C(t) { 14781 return t.container.querySelectorAll(t.elements_selector) 14782 } 14783 14784 function x(t) { 14785 return "error" === A(t) 14786 } 14787 14788 function _(t, e) { 14789 return e = t || C(e), w(e).filter(L) 14790 } 14791 14792 function t(t, e) { 14793 var n, o, i, s, t = a(t); 14794 this._settings = t, this.loadingCount = 0, i = t, s = this, $ && !b(i) && (s._observer = new IntersectionObserver(function(t) { 14795 y(t, i, s) 14796 }, { 14797 root: i.container === document ? null : i.container, 14798 rootMargin: i.thresholds || i.threshold + "px" 14799 })), n = t, o = this, S && window.addEventListener("online", function() { 14800 var e, t, i;
14801 t = o, i = C(e = n), w(i).filter(x).forEach(function(t) { 14802 j(t, e.class_error), D(t) 14803 }), t.update() 14804 }), this.update(e) 14805 } 14806 var S = "undefined" != typeof window, 14807 T = S && !("onscroll" in window) || "undefined" != typeof navigator && /(gle|ing|ro)bot|crawl|spider/i.test(navigator.userAgent), 14808 $ = S && "IntersectionObserver" in window, 14809 E = S && "classList" in document.createElement("p"), 14810 k = S && 1 < window.devicePixelRatio, 14811 I = { 14812 elements_selector: ".lazy", 14813 container: T || S ? document : null, 14814 threshold: 300, 14815 thresholds: null, 14816 data_src: "src", 14817 data_srcset: "srcset", 14818 data_sizes: "sizes", 14819 data_bg: "bg", 14820 data_bg_hidpi: "bg-hidpi", 14821 data_bg_multi: "bg-multi", 14822 data_bg_multi_hidpi: "bg-multi-hidpi", 14823 data_poster: "poster", 14824 class_applied: "applied", 14825 class_loading: "loading", 14826 class_loaded: "loaded", 14827 class_error: "error", 14828 unobserve_completed: !0, 14829 unobserve_entered: !1, 14830 cancel_on_exit: !0, 14831 callback_enter: null, 14832 callback_exit: null, 14833 callback_applied: null, 14834 callback_loading: null, 14835 callback_loaded: null, 14836 callback_error: null, 14837 callback_finish: null, 14838 callback_cancel: null, 14839 use_native: !1 14840 }, 14841 O = function(t, e) { 14842 return t.getAttribute("data-" + e) 14843 }, 14844 z = function(t, e, i) { 14845 e = "data-" + e; 14846 null !== i ? t.setAttribute(e, i) : t.removeAttribute(e) 14847 }, 14848 A = function(t) { 14849 return O(t, "ll-status") 14850 }, 14851 P = function(t, e) { 14852 return z(t, "ll-status", e) 14853 }, 14854 D = function(t) { 14855 return P(t, null) 14856 }, 14857 L = function(t) { 14858 return null === A(t) 14859 }, 14860 M = ["loading", "loaded", "applied", "error"], 14861 N = function(t, e, i, n) { 14862 t && (void 0 === n ? void 0 === i ? t(e) : t(e, i) : t(e, i, n)) 14863 }, 14864 H = function(t, e) { 14865 E ? t.classList.add(e) : t.className += (t.className ? " " : "") + e 14866 }, 14867 j = function(t, e) { 14868 E ? t.classList.remove(e) : t.className = t.className.replace(new RegExp("(^|\\s+)" + e + "(\\s+|$)"), " ").replace(/^\s+/, "").replace(/\s+$/, "") 14869 }, 14870 B = function(t) { 14871 return t.llTempImage 14872 }, 14873 R = function(t, e) { 14874 !e || (e = e._observer) && e.unobserve(t) 14875 }, 14876 W = function(t, e) { 14877 t && (t.loadingCount += e) 14878 }, 14879 F = function(t) { 14880 var e; 14881 c(t) && (e = t.llOriginalAttrs, n(t, "src", e.src), n(t, "srcset", e.srcset), n(t, "sizes", e.sizes)) 14882 }, 14883 q = function(t) { 14884 s(t, "src"), s(t, "srcset"), s(t, "sizes") 14885 }, 14886 V = function(t, e) { 14887 t = t.parentNode; 14888 t && "PICTURE" === t.tagName && i(t).forEach(e) 14889 }, 14890 U = { 14891 IMG: function(t, e) { 14892 V(t, function(t) { 14893 d(t), u(t, e) 14894 }), d(t), u(t, e) 14895 }, 14896 IFRAME: function(t, e) { 14897 n(t, "src", O(t, e.data_src)) 14898 }, 14899 VIDEO: function(t, e) { 14900 h(t, function(t) { 14901 n(t, "src", O(t, e.data_src)) 14902 }), n(t, "poster", O(t, e.data_poster)), n(t, "src", O(t, e.data_src)), t.load() 14903 } 14904 }, 14905 G = function(t, e, i) { 14906 W(i, 1), H(t, e.class_loading), P(t, "loading"), N(e.callback_loading, t, i) 14907 }, 14908 Y = { 14909 IMG: function(t, e) { 14910 z(t, e.data_src, null), z(t, e.data_srcset, null), z(t, e.data_sizes, null), V(t, function(t) { 14911 z(t, e.data_srcset, null), z(t, e.data_sizes, null) 14912 }) 14913 }, 14914 IFRAME: function(t, e) { 14915 z(t, e.data_src, null) 14916 }, 14917 VIDEO: function(t, e) { 14918 z(t, e.data_src, null), z(t, e.data_poster, null), h(t, function(t) { 14919 z(t, e.data_src, null) 14920 }) 14921 } 14922 }, 14923 X = function(t, e) { 14924 z(t, e.data_bg_multi, null), z(t, e.data_bg_multi_hidpi, null) 14925 }, 14926 K = ["IMG", "IFRAME", "VIDEO"], 14927 Z = function(t, e, i) { 14928 t.removeEventListener(e, i) 14929 }, 14930 Q = function(t) { 14931 return !!t.llEvLisnrs 14932 }, 14933 J = function(t) { 14934 if (Q(t)) { 14935 var e, i = t.llEvLisnrs; 14936 for (e in i) { 14937 var n = i[e]; 14938 Z(t, e, n) 14939 } 14940 delete t.llEvLisnrs 14941 } 14942 }, 14943 tt = function(i, n, o) { 14944 var s = B(i) || i; 14945 Q(s) || function(t) { 14946 Q(t) || (t.llEvLisnrs = {}); 14947 var e = "VIDEO" === t.tagName ? "loadeddata" : "load"; 14948 g(t, e, function(t) { 14949 ! function(t, e, i, n) { 14950 var o = r(e); 14951 v(e, i, n), H(e, i.class_loaded), P(e, "loaded"), f(e, i), N(i.callback_loaded, e, n), o || m(i, n) 14952 }(0, i, n, o), J(s) 14953 }), g(t, "error", function(t) { 14954 ! function(t, e, i, n) { 14955 var o = r(e); 14956 v(e, i, n), H(e, i.class_error), P(e, "error"), N(i.callback_error, e, n), o || m(i, n) 14957 }(0, i, n, o), J(s) 14958 }) 14959 }(s) 14960 }, 14961 et = function(t, e, i) { 14962 var n, o, s, a, r; - 1 < K.indexOf(t.tagName) ? (tt(n = t, r = e, a = i), p(n, r), G(n, r, a)) : (o = e, s = i, (n = t).llTempImage = document.createElement("IMG"), tt(n, o, s), r = s, i = O(a = n, (e = o).data_bg), t = O(a, e.data_bg_hidpi), (i = k && t ? t : i) && (a.style.backgroundImage = 'url("'.concat(i, '")'), B(a).setAttribute("src", i), G(a, e, r)), e = s, n = O(r = n, (s = o).data_bg_multi), o = O(r, s.data_bg_multi_hidpi), (n = k && o ? o : n) && (r.style.backgroundImage = n, e = e, H(r = r, (s = s).class_applied), P(r, "applied"), X(r, s), s.unobserve_completed && R(r, s), N(s.callback_applied, r, e))) 14963 }, 14964 it = ["IMG", "IFRAME"]; 14965 return t.prototype = { 14966 update: function(t) { 14967 var e, i, n, o = this._settings, 14968 s = _(t, o); 14969 l(this, s.length), !T && $ ? b(o) ? (i = o, n = this, s.forEac
14969h(function(t) { 14970 var e; - 1 !== it.indexOf(t.tagName) && (t.setAttribute("loading", "lazy"), tt(e = t, t = i, n), p(e, t), f(e, t), P(e, "native")) 14971 }), l(n, 0)) : (t = s, (o = this._observer).disconnect(), e = o, t.forEach(function(t) { 14972 e.observe(t) 14973 })) : this.loadAll(s) 14974 }, 14975 destroy: function() { 14976 this._observer && this._observer.disconnect(), C(this._settings).forEach(function(t) { 14977 delete t.llOriginalAttrs 14978 }), delete this._observer, delete this._settings, delete this.loadingCount, delete this.toLoadCount 14979 }, 14980 loadAll: function(t) { 14981 var e = this, 14982 i = this._settings; 14983 _(t, i).forEach(function(t) { 14984 R(t, e), et(t, i, e) 14985 }) 14986 } 14987 }, t.load = function(t, e) { 14988 e = a(e); 14989 et(t, e) 14990 }, t.resetStatus = function(t) { 14991 D(t) 14992 }, S && function(t, e) { 14993 if (e) 14994 if (e.length) 14995 for (var i, n = 0; i = e[n]; n += 1) o(t, i); 14996 else o(t, e) 14997 }(t, window.lazyLoadOptions), t 14998 }), 14999 function(e) { 15000 "function" == typeof define && define.amd ? define(["jquery"], function(t) { 15001 e(t, window, document) 15002 }) : "object" == typeof module && module.exports ? module.exports = e(require("jquery"), window, document) : e(jQuery, window, document) 15003 }(function(a, s, t, r) { 15004 "use strict"; 15005 var l = "intlTelInput", 15006 i = 1, 15007 n = { 15008 allowDropdown: !0, 15009 autoHideDialCode: !0, 15010 autoPlaceholder: !0, 15011 customPlaceholder: null, 15012 dropdownContainer: "", 15013 excludeCountries: [], 15014 formatOnInit: !0, 15015 geoIpLookup: null, 15016 initialCountry: "", 15017 nationalMode: !0, 15018 numberType: "MOBILE", 15019 onlyCountries: [], 15020 preferredCountries: ["us", "gb"], 15021 separateDialCode: !1, 15022 utilsScript: "" 15023 }, 15024 c = 38, 15025 d = 40, 15026 u = 13, 15027 h = 27, 15028 e = 43, 15029 p = 65, 15030 f = 90, 15031 m = 32, 15032 o = 9; 15033 15034 function g(t, e) { 15035 this.telInput = a(t), this.options = a.extend({}, n, e), this.ns = "." + l + i++, this.isGoodBrowser = Boolean(t.setSelectionRange), this.hadInitialPlaceholder = Boolean(a(t).attr("placeholder")) 15036 } 15037 a(s).on("load", function() { 15038 a.fn[l].windowLoaded = !0 15039 }), g.prototype = { 15040 _init: function() { 15041 return this.options.nationalMode && (this.options.autoHideDialCode = !1), this.options.separateDialCode && (this.options.autoHideDialCode = this.options.nationalMode = !1, this.options.allowDropdown = !0), this.isMobile = /Android.+Mobile|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), this.isMobile && (a("body").addClass("iti-mobile"), this.options.dropdownContainer || (this.options.dropdownContainer = "body")), this.autoCountryDeferred = new a.Deferred, this.utilsScriptDeferred = new a.Deferred, this._processCountryData(), this._generateMarkup(), this._setInitialState(), this._initListeners(), this._initRequests(), [this.autoCountryDeferred, this.utilsScriptDeferred] 15042 }, 15043 _processCountryData: function() { 15044 this._processAllCountries(), this._processCountryCodes(), this._processPreferredCountries() 15045 }, 15046 _addCountryCode: function(t, e, i) { 15047 e in this.countryCodes || (this.countryCodes[e] = []), this.countryCodes[e][i || 0] = t 15048 }, 15049 _filterCountries: function(t, e) { 15050 for (var i = 0; i < t.length; i++) t[i] = t[i].toLowerCase(); 15051 for (this.countries = [], i = 0; i < v.length; i++) e(a.inArray(v[i].iso2, t)) && this.countries.push(v[i]) 15052 }, 15053 _processAllCountries: function() { 15054 this.options.onlyCountries.length ? this._filterCountries(this.options.onlyCountries, function(t) { 15055 return -1 != t 15056 }) : this.options.excludeCountries.length ? this._filterCountries(this.options.excludeCountries, function(t) { 15057 return -1 == t 15058 }) : this.countries = v 15059 }, 15060 _processCountryCodes: function() { 15061 this.countryCodes = {}; 15062 for (var t = 0; t < this.countries.length; t++) { 15063 var e = this.countries[t]; 15064 if (this._addCountryCode(e.iso2, e.dialCode, e.priority), e.areaCodes) 15065 for (var i = 0; i < e.areaCodes.length; i++) this._addCountryCode(e.iso2, e.dialCode + e.areaCodes[i]) 15066 } 15067 }, 15068 _processPreferredCountries: function() { 15069 this.preferredCountries = []; 15070 for (var t = 0; t < this.options.preferredCountries.length; t++) { 15071 var e = this.options.preferredCountries[t].toLowerCase(), 15072 e = this._getCountryData(e, !1, !0); 15073 e && this.preferredCountries.push(e) 15074 } 15075 }, 15076 _generateMarkup: function() { 15077 this.telInput.attr("autocomplete", "off"); 15078 var t = "intl-tel-input"; 15079 this.options.allowDropdown && (t += " allow-dropdown"), this.options.separateDialCode && (t += " separate-dial-code"), this.telInput.wrap(a("<div>", { 15080 class: t 15081 })), this.flagsContainer = a("<div>", { 15082 class: "flag-container" 15083 }).insertBefore(this.telInput); 15084 t = a("<div>", { 15085 class: "selected-flag" 15086 }); 15087 t.appendTo(this.flagsContainer), this.selectedFlagInner = a("<div>", { 15088 class: "iti-flag" 15089 }).appendTo(t), this.options.separateDialCode && (this.selectedDialCode = a("<div>", { 15090 class: "selected-dial-code" 15091 }).appendTo(t)), this.options.allowDropdown ? (t.attr("tabindex", "0"), a("<div>", { 15092 class: "iti-arrow" 15093 }).appendTo(t), this.countryList = a("<ul>", { 15094 class: "country-list hide" 15095 }), this.preferredCountries.length && (this._appendListItems(this.preferredCountries, "preferred"), a("<li>", { 15096 class: "divider" 15097 }).appendTo(this.countryList)), this._appendListItems(this.countries, ""), this.countryListItems = this.countryList.children(".country"), this.options.dropdownContainer ? this.dropdown = a("<div>", { 15098 class: "intl-tel-input iti-container" 15099 }).append(this.countryList) : this.countryList.appendTo(this.flagsContainer)) : this.countryListItems = a() 15100 }, 15101 _appendListItems: function(t, e) { 15102 for (var i = "", n = 0; n < t.length; n++) { 15103 var o = t[n]; 15104 i += "<li class='country " + e + "' data-dial-code='" + o.dialCode + "' data-country-code='" + o.iso2 + "'>", i += "<div class='flag-box'><div class='iti-flag " + o.iso2 + "'></div></div>", i += "<span class='country-name'>" + o.name + "</span>", i += "<span class='dial-code'>+" + o.dialCode + "</span>", i += "</li>" 15105 } 15106 this.countryList.append(i) 15107 }, 15108 _setInitialState: function() { 15109 var t = this.telInput.val(); 15110 this._getDialCode(t) ? this._updateFlagFromNumber(t, !0) : "auto" !== this.options.initialCountry && (this.options.initialCountry ? this._setFlag(this.options.initialCountry, !0) : (this.defaultCountry = (this.preferredCountries.length ? this.preferredCountries : this.countries)[0].iso2, t || this._setFlag(this.defaultCountry, !0)), t || this.options.nationalMode || this.options.autoHideDialCode || this.options.separateDialCode || this.telInput.val("+" + this.selectedCountryData.dialCode)), t && this._updateV
15110alFromNumber(t, this.options.formatOnInit) 15111 }, 15112 _initListeners: function() { 15113 this._initKeyListeners(), this.options.autoHideDialCode && this._initFocusListeners(), this.options.allowDropdown && this._initDropdownListeners() 15114 }, 15115 _initDropdownListeners: function() { 15116 var e = this, 15117 t = this.telInput.closest("label"); 15118 t.length && t.on("click" + this.ns, function(t) { 15119 e.countryList.hasClass("hide") ? e.telInput.focus() : t.preventDefault() 15120 }), this.selectedFlagInner.parent().on("click" + this.ns, function(t) { 15121 !e.countryList.hasClass("hide") || e.telInput.prop("disabled") || e.telInput.prop("readonly") || e._showDropdown() 15122 }), this.flagsContainer.on("keydown" + e.ns, function(t) { 15123 !e.countryList.hasClass("hide") || t.which != c && t.which != d && t.which != m && t.which != u || (t.preventDefault(), t.stopPropagation(), e._showDropdown()), t.which == o && e._closeDropdown() 15124 }) 15125 }, 15126 _initRequests: function() { 15127 var t = this; 15128 this.options.utilsScript ? a.fn[l].windowLoaded ? a.fn[l].loadUtils(this.options.utilsScript, this.utilsScriptDeferred) : a(s).on("load", function() { 15129 a.fn[l].loadUtils(t.options.utilsScript, t.utilsScriptDeferred) 15130 }) : this.utilsScriptDeferred.resolve(), "auto" === this.options.initialCountry ? this._loadAutoCountry() : this.autoCountryDeferred.resolve() 15131 }, 15132 _loadAutoCountry: function() { 15133 var t = s.Cookies ? Cookies.get("itiAutoCountry") : ""; 15134 t && (a.fn[l].autoCountry = t), a.fn[l].autoCountry ? this.handleAutoCountry() : a.fn[l].startedLoadingAutoCountry || (a.fn[l].startedLoadingAutoCountry = !0, "function" == typeof this.options.geoIpLookup && this.options.geoIpLookup(function(t) { 15135 a.fn[l].autoCountry = t.toLowerCase(), s.Cookies && Cookies.set("itiAutoCountry", a.fn[l].autoCountry, { 15136 path: "/" 15137 }), setTimeout(function() { 15138 a(".intl-tel-input input").intlTelInput("handleAutoCountry") 15139 }) 15140 })) 15141 }, 15142 _initKeyListeners: function() { 15143 var t = this; 15144 this.telInput.on("keyup" + this.ns, function() { 15145 t._updateFlagFromNumber(t.telInput.val()) 15146 }), this.telInput.on("cut" + this.ns + " paste" + this.ns + " keyup" + this.ns, function() { 15147 setTimeout(function() { 15148 t._updateFlagFromNumber(t.telInput.val()) 15149 }) 15150 }) 15151 }, 15152 _cap: function(t) { 15153 var e = this.telInput.attr("maxlength"); 15154 return e && t.length > e ? t.substr(0, e) : t 15155 }, 15156 _initFocusListeners: function() { 15157 var i = this; 15158 this.telInput.on("mousedown" + this.ns, function(t) { 15159 i.telInput.is(":focus") || i.telInput.val() || (t.preventDefault(), i.telInput.focus()) 15160 }), this.telInput.on("focus" + this.ns, function(t) { 15161 i.telInput.val() || i.telInput.prop("readonly") || !i.selectedCountryData.dialCode || (i.telInput.val("+" + i.selectedCountryData.dialCode), i.telInput.one("keypress.plus" + i.ns, function(t) { 15162 t.which == e && i.telInput.val("") 15163 }), setTimeout(function() { 15164 var t, e = i.telInput[0]; 15165 i.isGoodBrowser && (t = i.telInput.val().length, e.setSelectionRange(t, t)) 15166 })) 15167 }), this.telInput.on("blur" + this.ns, function() { 15168 var t = i.telInput.val(); 15169 "+" == t.charAt(0) && ((t = i._getNumeric(t)) && i.selectedCountryData.dialCode != t || i.telInput.val("")), i.telInput.off("keypress.plus" + i.ns) 15170 }) 15171 }, 15172 _getNumeric: function(t) { 15173 return t.replace(/\D/g, "") 15174 }, 15175 _showDropdown: function() { 15176 this._setDropdownPosition(); 15177 var t = this.countryList.children(".active"); 15178 t.length && (this._highlightListItem(t), this._scrollTo(t)), this._bindDropdownListeners(), this.selectedFlagInner.children(".iti-arrow").addClass("up") 15179 }, 15180 _setDropdownPosition: function() { 15181 var t, e, i, n, o = this; 15182 this.options.dropdownContainer && this.dropdown.appendTo(this.options.dropdownContainer), this.dropdownHeight = this.countryList.removeClass("hide").outerHeight(), this.isMobile || (e = (t = this.telInput.offset()).top, n = a(s).scrollTop(), i = e + this.telInput.outerHeight() + this.dropdownHeight < n + a(s).height(), n = e - this.dropdownHeight > n, this.countryList.toggleClass("dropup", !i && n), this.options.dropdownContainer && (n = !i && n ? 0 : this.telInput.innerHe
15182ight(), this.dropdown.css({ 15183 top: e + n, 15184 left: t.left 15185 }), a(s).on("scroll" + this.ns, function() { 15186 o._closeDropdown() 15187 }))) 15188 }, 15189 _bindDropdownListeners: function() { 15190 var e = this; 15191 this.countryList.on("mouseover" + this.ns, ".country", function(t) { 15192 e._highlightListItem(a(this)) 15193 }), this.countryList.on("click" + this.ns, ".country", function(t) { 15194 e._selectListItem(a(this)) 15195 }); 15196 var i = !0; 15197 a("html").on("click" + this.ns, function(t) { 15198 i || e._closeDropdown(), i = !1 15199 }); 15200 var n = "", 15201 o = null; 15202 a(t).on("keydown" + this.ns, function(t) { 15203 t.preventDefault(), t.which == c || t.which == d ? e._handleUpDownKey(t.which) : t.which == u ? e._handleEnterKey() : t.which == h ? e._closeDropdown() : (t.which >= p && t.which <= f || t.which == m) && (o && clearTimeout(o), n += String.fromCharCode(t.which), e._searchForCountry(n), o = setTimeout(function() { 15204 n = "" 15205 }, 1e3)) 15206 }) 15207 }, 15208 _handleUpDownKey: function(t) { 15209 var e = this.countryList.children(".highlight").first(), 15210 e = t == c ? e.prev() : e.next(); 15211 e.length && (e.hasClass("divider") && (e = t == c ? e.prev() : e.next()), this._highlightListItem(e), this._scrollTo(e)) 15212 }, 15213 _handleEnterKey: function() { 15214 var t = this.countryList.children(".highlight").first(); 15215 t.length && this._selectListItem(t) 15216 }, 15217 _searchForCountry: function(t) { 15218 for (var e = 0; e < this.countries.length; e++) 15219 if (this._startsWith(this.countries[e].name, t)) { 15220 var i = this.countryList.children("[data-country-code=" + this.countries[e].iso2 + "]").not(".preferred"); 15221 this._highlightListItem(i), this._scrollTo(i, !0); 15222 break 15223 } 15224 }, 15225 _startsWith: function(t, e) { 15226 return t.substr(0, e.length).toUpperCase() == e 15227 }, 15228 _updateValFromNumber: function(t, e, i) { 15229 e && s.intlTelInputUtils && this.selectedCountryData && (a.isNumeric(i) || (i = this.options.nationalMode || "+" != t.charAt(0) ? intlTelInputUtils.numberFormat.NATIONAL : intlTelInputUtils.numberFormat.INTERNATIONAL), t = intlTelInputUtils.formatNumber(t, this.selectedCountryData.iso2, i)), t = this._beforeSetNumber(t), this.telInput.val(t) 15230 }, 15231 _updateFlagFromNumber: function(t, e) { 15232 t && this.options.nationalMode && this.selectedCountryData && "1" == this.selectedCountryData.dialCode && "+" != t.charAt(0) && (t = "+" + (t = "1" != t.charAt(0) ? "1" + t : t)); 15233 var i = this._getDialCode(t), 15234 n = null; 15235 if (i) { 15236 var o = this.countryCodes[this._getNumeric(i)]; 15237 if (!(this.selectedCountryData && -1 != a.inArray(this.selectedCountryData.iso2, o)) || this._isUnknownNanp(t, i)) 15238 for (var s = 0; s < o.length; s++) 15239 if (o[s]) { 15240 n = o[s]; 15241 break 15242 } 15243 } else "+" == t.charAt(0) && this._getNumeric(t).length ? n = "" : t && "+" != t || (n = this.defaultCountry); 15244 null !== n && this._setFlag(n, e) 15245 }, 15246 _isUnknownNanp: function(t, e) { 15247 return "+1" == e && 4 <= this._getNumeric(t).length 15248 }, 15249 _highlightListItem: function(t) { 15250 this.countryListItems.removeClass("highlight"), t.addClass("highlight") 15251 }, 15252 _getCountryData: function(t, e, i) { 15253 for (var n = e ? v : this.countries, o = 0; o < n.length; o++) 15254 if (n[o].iso2 == t) return n[o]; 15255 if (i) return null; 15256 throw new Error("No country data for '" + t + "'") 15257 }, 15258 _setFlag: function(t, e) { 15259 var i = this.selectedCountryData && this.selectedCountryData.iso2 ? this.selectedCountryData : {}; 15260 this.selectedCountryData = t ? this._getCountryData(t, !1, !1) : {}, this.selectedCountryData.iso2 && (this.defaultCountry = this.selectedCountryData.iso2), this.selectedFlagInner.attr("class", "iti-flag " + t); 15261 var n, o = t ? this.selectedCountryData.name + ": +" + this.selectedCountryData.dialCode : "Unknown"; 15262 this.selectedFlagInner.parent().attr("title", o), this.options.separateDialCode && (n = this.selectedCountryData.dialCode ? "+" + this.selectedCountryData.dialCode : "", o = this.telInput.parent(), i.dialCode && o.removeClass("iti-sdc-" + (i.dialCode.length + 1)), n && o.addClass("iti-sdc-" + n.length), this.selectedDialCode.text(n)), this._updatePlaceholder(), this.countryListItems.removeClass("active"), t && this.countryListItems.find(".iti-flag." + t).first().closest(".country").addClass("active"), e || i.iso2 === t || this.telInput.trigger("countrychange", this.selectedCountryData) 15263 }, 15264 _updatePlaceholder: function() { 15265 var t; 15266 s.intlTelInputUtils && !this.hadInitialPlaceholder && this.options.autoPlaceholder && this.selectedCountryData && (t = intlTelInputUtils.numberType[this.options.numberType], t = this.selectedCountryData.iso2 ? intlTelInputUtils.getExampleNumber(this.selectedCountryData.iso2, this.options.nationalMode, t) : "", t = this._beforeSetNumber(t), "function" == typeof this.options.customPlaceholder && (t = this.options.customPlaceholder(t, this.selectedCountryData)), this.telInput.attr("placeholder", t)) 15267 }, 15268 _selectListItem: function(t) { 15269 this._setFlag(t.attr("data-country-code")), this._closeDropdown(), this._updateDialCode(t.attr("data-dial-code"), !0), this.telInput.focus(), this.isGoodBrowser && (t = this.telInput.val().length, this.telInput[0].setSelectionRange(t, t)) 15270 }, 15271 _closeDropdown: function() { 15272 this.countryList.addClass("hide"), this.selectedFlagInner.children(".iti-arrow").removeClass("up"), a(t).off(this.ns), a("html").off(this.ns), this.countryList.off(this.ns), this.options.dropdownContainer && (this.isMobile || a(s).off("scroll" + this.ns), this.dropdown.detach()) 15273 }, 15274 _scrollTo: function(t, e) { 15275 var i = this.countryList, 15276 n = i.height(), 15277 o = i.offset().top, 15278 s = o + n, 15279 a = t.outerHeight(), 15280 r = t.offset().top, 15281 l = r + a, 15282 c = r - o + i.scrollTop(), 15283 t = n / 2 - a / 2; 15284 r < o ? (e && (c -= t), i.scrollTop(c)) : s < l && (e && (c += t), i.scrollTop(c - (n - a))) 15285 }, 15286 _updateDialCode: function(t, e) { 15287 var i = this.telInput.val(); 15288 if (t = "+" + t, "+" == i.charAt(0)) var n = this._getDialCode(i), 15289 n = n ? i.replace(n, t) : t; 15290 else { 15291 if (this.options.nationalMode || this.options.separateDialCode) return; 15292 if (i) n = t + i; 15293 else { 15294 if (!e && this.options.autoHideDialCode) return; 15295 n = t 15296 } 15297 } 15298 this.telInput.val(n) 15299 }, 15300 _getDialCode: function(t) { 15301 var e = ""; 15302 if ("+" == t.charAt(0)) 15303 for (var i = "", n = 0; n < t.length; n++) { 15304 var o = t.charAt(n); 15305 if (a.isNumeric(o) && (i += o, this.countryCodes[i] && (e = t.substr(0, n + 1)), 4 == i.length)) break 15306 } 15307 return e 15308 }, 15309 _getFullNumber: function() { 15310 return (this.options.separateDialCode ? "+" + this.selectedCountryData.dialCode : "") + this.telInput.val() 15311 }, 15312 _beforeSetNumber: function(t) { 15313 var e; 15314 return !this.options.separateDialCode || (e = this._getDialCode(t)) && (e = " " === t[(e = null !== this.selectedCountryData.areaCodes ? "+" + this.selectedCountryData.dialCode : e).length] || "-" === t[e.length] ? e.length + 1 : e.length, t = t.substr(e)), this._cap(t) 15315 }, 15316 handleAutoCountry: function() { 15317 "auto" === this.options.initialCountry && (this.defaultCountry = a.fn[l].autoCountry, this.telInput.val() || this.setCountry(this.defaultCountry), this.autoCountryDeferred.resolve()) 15318 }, 15319 destroy: function() { 15320 this.allowDropdown && (this._closeDropdown(), this.selectedFlagInner.parent().off(this.ns), this.telInput.closest("label").off(this.ns)), this.telInput.off(this.ns), this.telInput.parent().before(this.telInput).remove() 15321 }, 15322 getExtension: function() { 15323 return s.intlTelInputUtils ? intlTelInputUtils.getExtension(this._getFullNumber(), this.selectedCountryData.iso2) : "" 15324 }, 15325 getNumber: function(t) { 15326 return s.intlTelInputUtils ? intlTelInputUtils.formatNumber(this._getFullNumber(), this.selectedCountryData.iso2, t) : "" 15327 }, 15328 getNumberType: function() { 15329 return s.intlTelInputUtils ? intlTelInputUtils.getNumberType(this._getFullNumber(), this.selectedCountryData.iso2) : -99 15330 }, 15331 getSelectedCountryData: function() { 15332 return this.selectedCountryData || {} 15333 }, 15334 getValidationError: function() { 15335 return s.intlTelInputUtils ? intlTelInputUtils.getValidationError(this._getFullNumber(), this.selectedCountryData.iso2) : -99 15336 }, 15337 isValidNumber: function() { 15338 var t = a.trim(this._getFullNumber()), 15339 e = this.options.nationalMode ? this.selectedCountryData.iso2 : ""; 15340 return s.intlTelInputUtils ? intlTelInputUtils.isValidNumber(t, e) : null 15341 }, 15342 setCountry: function(t) { 15343 t = t.toLowerCase(), this.selectedFlagInner.hasClass(t) || (this._setFlag(t), this._updateDialCode(this.selectedCountryData.dialCode, !1)) 15344 }, 15345 setNumber: function(t, e) {
15346 this._updateFlagFromNumber(t), this._updateValFromNumber(t, a.isNumeric(e), e) 15347 }, 15348 handleUtils: function() { 15349 s.intlTelInputUtils && (this.telInput.val() && this._updateValFromNumber(this.telInput.val(), this.options.formatOnInit), this._updatePlaceholder()), this.utilsScriptDeferred.resolve() 15350 } 15351 }, a.fn[l] = function(i) { 15352 var e, n = arguments; 15353 if (i === r || "object" == typeof i) { 15354 var o = []; 15355 return this.each(function() { 15356 var t, e; 15357 a.data(this, "plugin_" + l) || (e = (t = new g(this, i))._init(), o.push(e[0]), o.push(e[1]), a.data(this, "plugin_" + l, t)) 15358 }), a.when.apply(null, o) 15359 } 15360 if ("string" == typeof i && "_" !== i[0]) return this.each(function() { 15361 var t = a.data(this, "plugin_" + l); 15362 t instanceof g && "function" == typeof t[i] && (e = t[i].apply(t, Array.prototype.slice.call(n, 1))), "destroy" === i && a.data(this, "plugin_" + l, null) 15363 }), e !== r ? e : this 15364 }, a.fn[l].getCountryData = function() { 15365 return v 15366 }, a.fn[l].loadUtils = function(t, e) { 15367 a.fn[l].loadedUtilsScript ? e && e.resolve() : (a.fn[l].loadedUtilsScript = !0, a.ajax({ 15368 url: t, 15369 complete: function() { 15370 a(".intl-tel-input input").intlTelInput("handleUtils") 15371 }, 15372 dataType: "script", 15373 cache: !0 15374 })) 15375 }, a.fn[l].version = "8.4.7"; 15376 for (var v = [ 15377 ["Afghanistan (â«Ø§ÙغاÙستاÙâ¬â)", "af", "93"], 15378 ["Albania (Shqipëri)", "al", "355"], 15379 ["Algeria (â«Ø§Ùجزائرâ¬â)", "dz", "213"], 15380 ["American Samoa", "as", "1684"], 15381 ["Andorra", "ad", "376"], 15382 ["Angola", "ao", "244"], 15383 ["Anguilla", "ai", "1264"], 15384 ["Antigua and Barbuda", "ag", "1268"], 15385 ["Argentina", "ar", "54"], 15386 ["Armenia (ÕÕ¡ÕµÕ¡Õ½Õ¿Õ¡Õ¶)", "am", "374"], 15387 ["Aruba", "aw", "297"], 15388 ["Australia", "au", "61", 0], 15389 ["Austria (Ãsterreich)", "at", "43"], 15390 ["Azerbaijan (AzÉrbaycan)", "az", "994"], 15391 ["Bahamas", "bs", "1242"], 15392 ["Bahrain (â«Ø§ÙبØرÙÙâ¬â)", "bh", "973"], 15393 ["Bangladesh (বাà¦à¦²à¦¾à¦¦à§à¦¶)", "bd", "880"], 15394 ["Barbados", "bb", "1246"], 15395 ["Belarus (ÐелаÑÑÑÑ)", "by", "375"], 15396 ["Belgium (België)", "be", "32"], 15397 ["Belize", "bz", "501"], 15398 ["Benin (Bénin)", "bj", "229"], 15399 ["Bermuda", "bm", "1441"], 15400 ["Bhutan (འà½à¾²à½´à½)", "bt", "975"], 15401 ["Bolivia", "bo", "591"], 15402 ["Bosnia and Herzegovina (ÐоÑна и ХеÑÑеговина)", "ba", "387"], 15403 ["Botswana", "bw", "267"], 15404 ["Brazil (Brasil)", "br", "55"], 15405 ["British Indian Ocean Territory", "io", "246"], 15406 ["British Virgin Islands", "vg", "1284"], 15407 ["Brunei", "bn", "673"], 15408 ["Bulgaria (ÐÑлгаÑиÑ)", "bg", "359"], 15409 ["Burkina Faso", "bf", "226"], 15410 ["Burundi (Uburundi)", "bi", "257"], 15411 ["Cambodia (ááááá»áá¶)", "kh", "855"], 15412 ["Cameroon (Cameroun)", "cm", "237"], 15413 ["Canada", "ca", "1", 1, ["204", "226", "236", "249", "250", "289", "306", "343", "365", "387", "403", "416", "418", "431", "437", "438", "450", "506", "514", "519", "548", "579", "581", "587", "604", "613", "639", "647", "672", "705", "709", "742", "778", "780", "782", "807", "819", "825", "867", "873", "902", "905"]], 15414 ["Cape Verde (Kabu Verdi)", "cv", "238"], 15415 ["Caribbean Netherlands", "bq", "599", 1], 15416 ["Cayman Islands", "ky", "1345"], 15417 ["Central African Republic (République centrafricaine)", "cf", "236"], 15418 ["Chad (Tchad)", "td", "235"], 15419 ["Chile", "cl", "56"], 15420 ["China (ä¸å½)", "cn", "86"], 15421 ["Christmas Island", "cx", "61", 2], 15422 ["Cocos (Keeling) Islands", "cc", "61", 1], 15423 ["Colombia", "co", "57"], 15424 ["Comoros (â«Ø¬Ø²Ø± اÙÙ٠رâ¬â)", "km", "269"], 15425 ["Congo (DRC) (Jamhuri ya Kidemokrasia ya Kongo)", "cd", "243"], 15426 ["Congo (Republic) (Congo-Brazzaville)", "cg", "242"], 15427 ["Cook Islands", "ck", "682"], 15428 ["Costa Rica", "cr", "506"], 15429 ["Côte dâIvoire", "ci", "225"], 15430 ["Croatia (Hrvatska)", "hr", "385"], 15431 ["Cuba", "cu", "53"], 15432 ["Curaçao", "cw", "599", 0], 15433 ["Cyprus (ÎÏÏÏοÏ)", "cy", "357"], 15434 ["Czech Republic (Äeská republika)", "cz", "420"], 15435 ["Denmark (Danmark)", "dk", "45"], 15436 ["Djibouti", "dj", "253"], 15437 ["Dominica", "dm", "1767"], 15438 ["Dominican Republic (República Dominicana)", "do", "1", 2, ["809", "829", "849"]], 15439 ["Ecuador", "ec", "593"], 15440 ["Egypt (â«Ù صرâ¬â)", "eg", "20"], 15441 ["El Salvador", "sv", "503"], 15442 ["Equatorial Guinea (Guinea Ecuatorial)", "gq", "240"], 15443 ["Eritrea", "er", "291"], 15444 ["Estonia (Eesti)", "ee", "372"], 15445 ["Ethiopia", "et", "251"], 15446 ["Falkland Islands (Islas Malvinas)", "fk", "500"], 15447 ["Faroe Islands (Føroyar)", "fo", "298"], 15448 ["Fiji", "fj", "679"], 15449 ["Finland (Suomi)", "fi", "358", 0], 15450 ["France", "fr", "33"], 15451 ["French Guiana (Guyane française)", "gf", "594"], 15452 ["French Polynesia (Polynésie française)", "pf", "689"], 15453 ["Gabon", "ga", "241"], 15454 ["Gambia", "gm", "220"], 15455 ["Georgia (á¡áá¥áá ááááá)", "ge", "995"], 15456 ["Germany (Deutschland)", "de", "49"], 15457 ["Ghana (Gaana)", "gh", "233"], 15458 ["Gibraltar", "gi", "350"], 15459 ["Greece (Îλλάδα)", "gr", "30"],
15460 ["Greenland (Kalaallit Nunaat)", "gl", "299"], 15461 ["Grenada", "gd", "1473"], 15462 ["Guadeloupe", "gp", "590", 0], 15463 ["Guam", "gu", "1671"], 15464 ["Guatemala", "gt", "502"], 15465 ["Guernsey", "gg", "44", 1], 15466 ["Guinea (Guinée)", "gn", "224"], 15467 ["Guinea-Bissau (Guiné Bissau)", "gw", "245"], 15468 ["Guyana", "gy", "592"], 15469 ["Haiti", "ht", "509"], 15470 ["Honduras", "hn", "504"], 15471 ["Hong Kong (é¦æ¸¯)", "hk", "852"], 15472 ["Hungary (Magyarország)", "hu", "36"], 15473 ["Iceland (Ãsland)", "is", "354"], 15474 ["India (à¤à¤¾à¤°à¤¤)", "in", "91"], 15475 ["Indonesia", "id", "62"], 15476 ["Iran (â«Ø§ÛراÙâ¬â)", "ir", "98"], 15477 ["Iraq (â«Ø§ÙعراÙâ¬â)", "iq", "964"], 15478 ["Ireland", "ie", "353"], 15479 ["Isle of Man", "im", "44", 2], 15480 ["Israel (â«×שר××â¬â)", "il", "972"], 15481 ["Italy (Italia)", "it", "39", 0], 15482 ["Jamaica", "jm", "1876"], 15483 ["Japan (æ¥æ¬)", "jp", "81"], 15484 ["Jersey", "je", "44", 3], 15485 ["Jordan (â«Ø§ÙأردÙâ¬â)", "jo", "962"], 15486 ["Kazakhstan (ÐÐ°Ð·Ð°Ñ ÑÑан)", "kz", "7", 1], 15487 ["Kenya", "ke", "254"], 15488 ["Kiribati", "ki", "686"], 15489 ["Kuwait (â«Ø§ÙÙÙÙتâ¬â)", "kw", "965"], 15490 ["Kyrgyzstan (ÐÑÑгÑзÑÑан)", "kg", "996"], 15491 ["Laos (ລາວ)", "la", "856"], 15492 ["Latvia (Latvija)", "lv", "371"], 15493 ["Lebanon (â«ÙبÙاÙâ¬â)", "lb", "961"], 15494 ["Lesotho", "ls", "266"], 15495 ["Liberia", "lr", "231"], 15496 ["Libya (â«ÙÙبÙاâ¬â)", "ly", "218"], 15497 ["Liechtenstein", "li", "423"], 15498 ["Lithuania (Lietuva)", "lt", "370"], 15499 ["Luxembourg", "lu", "352"], 15500 ["Macau (æ¾³é)", "mo", "853"], 15501 ["Macedonia (FYROM) (ÐакедониÑа)", "mk", "389"], 15502 ["Madagascar (Madagasikara)", "mg", "261"], 15503 ["Malawi", "mw", "265"], 15504 ["Malaysia", "my", "60"], 15505 ["Maldives", "mv", "960"], 15506 ["Mali", "ml", "223"], 15507 ["Malta", "mt", "356"], 15508 ["Marshall Islands", "mh", "692"], 15509 ["Martinique", "mq", "596"], 15510 ["Mauritania (â«Ù ÙرÙتاÙÙاâ¬â)", "mr", "222"], 15511 ["Mauritius (Moris)", "mu", "230"], 15512 ["Mayotte", "yt", "262", 1], 15513 ["Mexico (México)", "mx", "52"], 15514 ["Micronesia", "fm", "691"], 15515 ["Moldova (Republica Moldova)", "md", "373"], 15516 ["Monaco", "mc", "377"], 15517 ["Mongolia (Ðонгол)", "mn", "976"], 15518 ["Montenegro (Crna Gora)", "me", "382"], 15519 ["Montserrat", "ms", "1664"], 15520 ["Morocco (â«Ø§Ù٠غربâ¬â)", "ma", "212", 0], 15521 ["Mozambique (Moçambique)", "mz", "258"], 15522 ["Myanmar (Burma) (áá¼ááºáá¬)", "mm", "95"], 15523 ["Namibia (Namibië)", "na", "264"], 15524 ["Nauru", "nr", "674"], 15525 ["Nepal (नà¥à¤ªà¤¾à¤²)", "np", "977"], 15526 ["Netherlands (Nederland)", "nl", "31"], 15527 ["New Caledonia (Nouvelle-Calédonie)", "nc", "687"], 15528 ["New Zealand", "nz", "64"], 15529 ["Nicaragua", "ni", "505"], 15530 ["Niger (Nijar)", "ne", "227"], 15531 ["Nigeria", "ng", "234"], 15532 ["Niue", "nu", "683"], 15533 ["Norfolk Island", "nf", "672"], 15534 ["North Korea (ì¡°ì 민주주ì ì¸ë¯¼ ê³µíêµ)", "kp", "850"], 15535 ["Northern Mariana Islands", "mp", "1670"], 15536 ["Norway (Norge)", "no", "47", 0], 15537 ["Oman (â«Ø¹Ù٠اÙâ¬â)", "om", "968"], 15538 ["Pakistan (â«Ù¾Ø§Ú©Ø³ØªØ§Ùâ¬â)", "pk", "92"], 15539 ["Palau", "pw", "680"], 15540 ["Palestine (â«ÙÙسطÙÙâ¬â)", "ps", "970"], 15541 ["Panama (Panamá)", "pa", "507"], 15542 ["Papua New Guinea", "pg", "675"], 15543 ["Paraguay", "py", "595"], 15544 ["Peru (Perú)", "pe", "51"], 15545 ["Philippines", "ph", "63"], 15546 ["Poland (Polska)", "pl", "48"], 15547 ["Portugal", "pt", "351"], 15548 ["Puerto Rico", "pr", "1", 3, ["787", "939"]], 15549 ["Qatar (â«Ùطرâ¬â)", "qa", "974"], 15550 ["Réunion (La Réunion)", "re", "262", 0], 15551 ["Romania (România)", "ro", "40"], 15552 ["Russia (РоÑÑиÑ)", "ru", "7", 0], 15553 ["Rwanda", "rw", "250"], 15554 ["Saint Barthélemy (Saint-Barthélemy)", "bl", "590", 1], 15555 ["Saint Helena", "sh", "290"], 15556 ["Saint Kitts and Nevis", "kn", "1869"], 15557 ["Saint Lucia", "lc", "1758"], 15558 ["Saint Martin (Saint-Martin (partie française))", "mf", "590", 2], 15559 ["Saint Pierre and Miquelon (Saint-Pierre-et-Miquelon)", "pm", "508"], 15560 ["Saint Vincent and the Grenadines", "vc", "1784"], 15561 ["Samoa", "ws", "685"], 15562 ["San Marino", "sm", "378"], 15563 ["São Tomé and PrÃncipe (São Tomé e PrÃncipe)", "st", "239"], 15564 ["Saudi Arabia (â«Ø§ÙÙ Ù ÙÙØ© اÙعربÙØ© اÙسعÙدÙØ©â¬â)", "sa", "966"], 15565 ["Senegal (Sénégal)", "sn", "221"], 15566 ["Serbia (СÑбиÑа)", "rs", "381"], 15567 ["Seychelles", "sc", "248"],
15568 ["Sierra Leone", "sl", "232"], 15569 ["Singapore", "sg", "65"], 15570 ["Sint Maarten", "sx", "1721"], 15571 ["Slovakia (Slovensko)", "sk", "421"], 15572 ["Slovenia (Slovenija)", "si", "386"], 15573 ["Solomon Islands", "sb", "677"], 15574 ["Somalia (Soomaaliya)", "so", "252"], 15575 ["South Africa", "za", "27"], 15576 ["South Korea (ëí민êµ)", "kr", "82"], 15577 ["South Sudan (â«Ø¬ÙÙب اÙسÙداÙâ¬â)", "ss", "211"], 15578 ["Spain (España)", "es", "34"], 15579 ["Sri Lanka (à·à·âර෠ලà¶à¶à·à·)", "lk", "94"], 15580 ["Sudan (â«Ø§ÙسÙداÙâ¬â)", "sd", "249"], 15581 ["Suriname", "sr", "597"], 15582 ["Svalbard and Jan Mayen", "sj", "47", 1], 15583 ["Swaziland", "sz", "268"], 15584 ["Sweden (Sverige)", "se", "46"], 15585 ["Switzerland (Schweiz)", "ch", "41"], 15586 ["Syria (â«Ø³ÙرÙاâ¬â)", "sy", "963"], 15587 ["Taiwan (å°ç£)", "tw", "886"], 15588 ["Tajikistan", "tj", "992"], 15589 ["Tanzania", "tz", "255"], 15590 ["Thailand (à¹à¸à¸¢)", "th", "66"], 15591 ["Timor-Leste", "tl", "670"], 15592 ["Togo", "tg", "228"], 15593 ["Tokelau", "tk", "690"], 15594 ["Tonga", "to", "676"], 15595 ["Trinidad and Tobago", "tt", "1868"], 15596 ["Tunisia (â«ØªÙÙسâ¬â)", "tn", "216"], 15597 ["Turkey (Türkiye)", "tr", "90"], 15598 ["Turkmenistan", "tm", "993"], 15599 ["Turks and Caicos Islands", "tc", "1649"], 15600 ["Tuvalu", "tv", "688"], 15601 ["U.S. Virgin Islands", "vi", "1340"], 15602 ["Uganda", "ug", "256"], 15603 ["Ukraine (УкÑаÑна)", "ua", "380"], 15604 ["United Arab Emirates (â«Ø§Ùإ٠ارات اÙعربÙØ© اÙ٠تØدةâ¬â)", "ae", "971"], 15605 ["United Kingdom", "gb", "44", 0], 15606 ["United States", "us", "1", 0], 15607 ["Uruguay", "uy", "598"], 15608 ["Uzbekistan (OÊ»zbekiston)", "uz", "998"], 15609 ["Vanuatu", "vu", "678"], 15610 ["Vatican City (Città del Vaticano)", "va", "39", 1], 15611 ["Venezuela", "ve", "58"], 15612 ["Vietnam (Viá»t Nam)", "vn", "84"], 15613 ["Wallis and Futuna", "wf", "681"], 15614 ["Western Sahara (â«Ø§ÙصØراء اÙغربÙØ©â¬â)", "eh", "212", 1], 15615 ["Yemen (â«Ø§ÙÙÙ Ùâ¬â)", "ye", "967"], 15616 ["Zambia", "zm", "260"], 15617 ["Zimbabwe", "zw", "263"], 15618 ["à land Islands", "ax", "358", 1] 15619 ], b = 0; b < v.length; b++) { 15620 var y = v[b]; 15621 v[b] = { 15622 name: y[0], 15623 iso2: y[1], 15624 dialCode: y[2], 15625 priority: y[3] || 0, 15626 areaCodes: y[4] || null 15627 } 15628 } 15629 }), 15630 function(t, e) { 15631 "function" == typeof define && define.amd ? define(["jquery"], e) : "object" == typeof exports ? module.exports = e(require("jquery")) : t.lightbox = e(t.jQuery) 15632 }(this, function(d) { 15633 function t(t) { 15634 this.album = [], this.currentImageIndex = void 0, this.init(), this.options = d.extend({}, this.constructor.defaults), this.option(t) 15635 } 15636 return t.defaults = { 15637 albumLabel: "Image %1 of %2", 15638 alwaysShowNavOnTouchDevices: !1, 15639 fadeDuration: 600, 15640 fitImagesInViewport: !0, 15641 imageFadeDuration: 600, 15642 positionFromTop: 50, 15643 resizeDuration: 700, 15644 showImageNumberLabel: !0, 15645 wrapAround: !1, 15646 disableScrolling: !1, 15647 sanitizeTitle: !1 15648 }, t.prototype.option = function(t) { 15649 d.extend(this.options, t) 15650 }, t.prototype.imageCountLabel = function(t, e) { 15651 return this.options.albumLabel.replace(/%1/g, t).replace(/%2/g, e) 15652 }, t.prototype.init = function() { 15653 var t = this; 15654 d(document).ready(function() { 15655 t.enable(), t.build() 15656 }) 15657 }, t.prototype.enable = function() { 15658 var e = this; 15659 d("body").on("click", "a[rel^=lightbox], area[rel^=lightbox], a[data-lightbox], area[data-lightbox]", function(t) { 15660 return e.start(d(t.currentTarget)), !1 15661 }) 15662 }, t.prototype.build = function() { 15663 var e; 15664 0 < d("#lightbox").length || (e = this, d('<div id="lightboxOverlay" tabindex="-1" class="lightboxOverlay"></div><div id="lightbox" tabindex="-1" class="lightbox"><div class="lb-outerContainer"><div class="lb-container"><img class="lb-image" src="data:image/gif;base64,R0lGODlhAQABAIAAAP///wAAACH5BAEAAAAALAAAAAABAAEAAAICRAEAOw==" alt=""/><div class="lb-nav"><a class="lb-prev" aria-label="Previous image" href="" ></a><a class="lb-next" aria-label="Next image" href="" ></a></div><div class="lb-loader"><a class="lb-cancel"></a></div></div></div><div class="lb-dataContainer"><div class="lb-data"><div class="lb-details"><span class="lb-caption"></span><span class="lb-number"></span></div><div class="lb-closeContainer"><a class="lb-close"></a></div></div></div></div>').appendTo(d("body")), this.$lightbox = d("#lightbox"), this.$overlay
15664= d("#lightboxOverlay"), this.$outerContainer = this.$lightbox.find(".lb-outerContainer"), this.$container = this.$lightbox.find(".lb-container"), this.$image = this.$lightbox.find(".lb-image"), this.$nav = this.$lightbox.find(".lb-nav"), this.containerPadding = { 15665 top: parseInt(this.$container.css("padding-top"), 10), 15666 right: parseInt(this.$container.css("padding-right"), 10), 15667 bottom: parseInt(this.$container.css("padding-bottom"), 10), 15668 left: parseInt(this.$container.css("padding-left"), 10) 15669 }, this.imageBorderWidth = { 15670 top: parseInt(this.$image.css("border-top-width"), 10), 15671 right: parseInt(this.$image.css("border-right-width"), 10), 15672 bottom: parseInt(this.$image.css("border-bottom-width"), 10), 15673 left: parseInt(this.$image.css("border-left-width"), 10) 15674 }, this.$overlay.hide().on("click", function() { 15675 return e.end(), !1 15676 }), this.$lightbox.hide().on("click", function(t) { 15677 "lightbox" === d(t.target).attr("id") && e.end() 15678 }), this.$outerContainer.on("click", function(t) { 15679 return "lightbox" === d(t.target).attr("id") && e.end(), !1 15680 }), this.$lightbox.find(".lb-prev").on("click", function() { 15681 return 0 === e.currentImageIndex ? e.changeImage(e.album.length - 1) : e.changeImage(e.currentImageIndex - 1), !1 15682 }), this.$lightbox.find(".lb-next").on("click", function() { 15683 return e.currentImageIndex === e.album.length - 1 ? e.changeImage(0) : e.changeImage(e.currentImageIndex + 1), !1 15684 }), this.$nav.on("mousedown", function(t) { 15685 3 === t.which && (e.$nav.css("pointer-events", "none"), e.$lightbox.one("contextmenu", function() { 15686 setTimeout(function() { 15687 this.$nav.css("pointer-events", "auto") 15688 }.bind(e), 0) 15689 })) 15690 }), this.$lightbox.find(".lb-loader, .lb-close").on("click", function() { 15691 return e.end(), !1 15692 })) 15693 }, t.prototype.start = function(t) { 15694 var e = this, 15695 i = d(window); 15696 i.on("resize", d.proxy(this.sizeOverlay, this)), this.sizeOverlay(), this.album = []; 15697 var n = 0; 15698 15699 function o(t) { 15700 e.album.push({ 15701 alt: t.attr("data-alt"), 15702 link: t.attr("href"), 15703 title: t.attr("data-title") || t.attr("title") 15704 }) 15705 } 15706 var s = t.attr("data-lightbox"); 15707 if (s) 15708 for (var a = d(t.prop("tagName") + '[data-lightbox="' + s + '"]'), r = 0; r < a.length; r = ++r) o(d(a[r])), a[r] === t[0] && (n = r); 15709 else if ("lightbox" === t.attr("rel")) o(t); 15710 else { 15711 a = d(t.prop("tagName") + '[rel="' + t.attr("rel") + '"]'); 15712 for (var l = 0; l < a.length; l = ++l) o(d(a[l])), a[l] === t[0] && (n = l) 15713 } 15714 s = i.scrollTop() + this.options.positionFromTop, i = i.scrollLeft(); 15715 this.$lightbox.css({ 15716 top: s + "px", 15717 left: i + "px" 15718 }).fadeIn(this.options.fadeDuration), this.options.disableScrolling && d("body").addClass("lb-disable-scrolling"), this.changeImage(n) 15719 }, t.prototype.changeImage = function(o) { 15720 var s = this, 15721 a = this.album[o].link, 15722 r = a.split(".").slice(-1)[0], 15723 l = this.$lightbox.find(".lb-image"); 15724 this.disableKeyboardNav(), this.$overlay.fadeIn(this.options.fadeDuration), d(".lb-loader").fadeIn("slow"), this.$lightbox.find(".lb-image, .lb-nav, .lb-prev, .lb-next, .lb-dataContainer, .lb-numbers, .lb-caption").hide(), this.$outerContainer.addClass("animating"); 15725 var c = new Image; 15726 c.onload = function() { 15727 var t, e, i, n; 15728 l.attr({ 15729 alt: s.album[o].alt, 15730 src: a 15731 }), d(c), l.width(c.width), l.height(c.height), n = d(window).width(), i = d(window).height(), n = n - s.containerPadding.left - s.containerPadding.right - s.imageBorderWidth.left - s.imageBorderWidth.right - 20, i = i - s.containerPadding.top - s.containerPadding.bottom - s.imageBorderWidth.top - s.imageBorderWidth.bottom - s.options.positionFromTop - 70, "svg" === r && (l.width(n), l.height(i)), s.options.fitImagesInViewport ? (s.options.maxWidth && s.options.maxWidth < n && (n = s.options.maxWidth), s.options.maxHeight && s.options.maxHeight < i && (i = s.options.maxHeight)) : (n = s.options.maxWidth || c.width || n, i = s.options.maxHeight || c.height || i), (c.width > n || c.height > i) && (c.width / n > c.height / i ? (e = n, t = parseInt(c.height / (c.width / e), 10)) : (t = i, e = parseInt(c.width / (c.height / t), 10)), l.width(e), l.height(t)), s.sizeContainer(l.width(), l.height()) 15732 }
15732, c.src = this.album[o].link, this.currentImageIndex = o 15733 }, t.prototype.sizeOverlay = function() { 15734 var t = this; 15735 setTimeout(function() { 15736 t.$overlay.width(d(document).width()).height(d(document).height()) 15737 }, 0) 15738 }, t.prototype.sizeContainer = function(t, e) { 15739 var i = this, 15740 n = this.$outerContainer.outerWidth(), 15741 o = this.$outerContainer.outerHeight(), 15742 s = t + this.containerPadding.left + this.containerPadding.right + this.imageBorderWidth.left + this.imageBorderWidth.right, 15743 a = e + this.containerPadding.top + this.containerPadding.bottom + this.imageBorderWidth.top + this.imageBorderWidth.bottom; 15744 15745 function r() { 15746 i.$lightbox.find(".lb-dataContainer").width(s), i.$lightbox.find(".lb-prevLink").height(a), i.$lightbox.find(".lb-nextLink").height(a), i.$overlay.focus(), i.showImage() 15747 } 15748 n !== s || o !== a ? this.$outerContainer.animate({ 15749 width: s, 15750 height: a 15751 }, this.options.resizeDuration, "swing", function() { 15752 r() 15753 }) : r() 15754 }, t.prototype.showImage = function() { 15755 this.$lightbox.find(".lb-loader").stop(!0).hide(), this.$lightbox.find(".lb-image").fadeIn(this.options.imageFadeDuration), this.updateNav(), this.updateDetails(), this.preloadNeighboringImages(), this.enableKeyboardNav() 15756 }, t.prototype.updateNav = function() { 15757 var t = !1; 15758 try { 15759 document.createEvent("TouchEvent"), t = !!this.options.alwaysShowNavOnTouchDevices 15760 } catch (t) {} 15761 this.$lightbox.find(".lb-nav").show(), 1 < this.album.length && (this.options.wrapAround ? (t && this.$lightbox.find(".lb-prev, .lb-next").css("opacity", "1"), this.$lightbox.find(".lb-prev, .lb-next").show()) : (0 < this.currentImageIndex && (this.$lightbox.find(".lb-prev").show(), t && this.$lightbox.find(".lb-prev").css("opacity", "1")), this.currentImageIndex < this.album.length - 1 && (this.$lightbox.find(".lb-next").show(), t && this.$lightbox.find(".lb-next").css("opacity", "1")))) 15762 }, t.prototype.updateDetails = function() { 15763 var t, e = this; 15764 void 0 !== this.album[this.currentImageIndex].title && "" !== this.album[this.currentImageIndex].title && (t = this.$lightbox.find(".lb-caption"), this.options.sanitizeTitle ? t.text(this.album[this.currentImageIndex].title) : t.html(this.album[this.currentImageIndex].title), t.fadeIn("fast")), 1 < this.album.length && this.options.showImageNumberLabel ? (t = this.imageCountLabel(this.currentImageIndex + 1, this.album.length), this.$lightbox.find(".lb-number").text(t).fadeIn("fast")) : this.$lightbox.find(".lb-number").hide(), this.$outerContainer.removeClass("animating"), this.$lightbox.find(".lb-dataContainer").fadeIn(this.options.resizeDuration, function() { 15765 return e.sizeOverlay() 15766 }) 15767 }, t.prototype.preloadNeighboringImages = function() { 15768 this.album.length > this.currentImageIndex + 1 && ((new Image).src = this.album[this.currentImageIndex + 1].link), 0 < this.currentImageIndex && ((new Image).src = this.album[this.currentImageIndex - 1].link) 15769 }, t.prototype.enableKeyboardNav = function() { 15770 this.$lightbox.on("keyup.keyboard", d.proxy(this.keyboardAction, this)), this.$overlay.on("keyup.keyboard", d.proxy(this.keyboardAction, this)) 15771 }, t.prototype.disableKeyboardNav = function() { 15772 this.$lightbox.off(".keyboard"), this.$overlay.off(".keyboard") 15773 }, t.prototype.keyboardAction = function(t) { 15774 var e = t.keyCode; 15775 27 === e ? (t.stopPropagation(), this.end()) : 37 === e ? 0 !== this.currentImageIndex ? this.changeImage(this.currentImageIndex - 1) : this.options.wrapAround && 1 < this.album.length && this.changeImage(this.album.length - 1) : 39 === e && (this.currentImageIndex !== this.album.length - 1 ? this.changeImage(this.currentImageIndex + 1) : this.options.wrapAround && 1 < this.album.length && this.changeImage(0)) 15776 }, t.prototype.end = function() { 15777 this.disableKeyboardNav(), d(window).off("resize", this.sizeOverlay), this.$lightbox.fadeOut(this.options.fadeDuration), this.$overlay.fadeOut(this.options.fadeDuration), this.options.disableScrolling && d("body").removeClass("lb-disable-scrolling") 15778 }, new t 15779 }); 15780var quickViewgalleryThumbs, mobile_image_swiper, quickViewgalleryTop, custom_url = location.href, 15781 is_rtl = $("#body").data("is-rtl"), 15782 mode = 1 == is_rtl ? "right" : "left"; 15783const Toast = Swal.mixin({ 15784 toast: !0, 15785 position: "top-end", 15786 showConfirmButton: !1, 15787 timer: 3e3, 15788 timerProgressBar: !0 15789}); 15790 15791function queryParams(t) { 15792 return { 15793 limit: t.limit, 15794 sort: t.sort, 15795 order: t.order, 15796 offset: t.offset, 15797 search: t.search 15798 } 15799} 15800 15801function onSignInSubmit(t) { 15802 var e; 15803 t.preventDefault(), isPhoneNumberValid() && ($("#send-otp-button").html("Please Wait..."), e = is_user_exist(), updateSignInButtonUI(), 1 == e.error ? ($("#is-user-exist-error").html(e.message), $("#send-otp-button").html("Send OTP")) : (window.signingIn = !0, t = getPhoneNumberFromUserInput(), e = window.recaptchaVerifier, firebase.auth().signInWithPhoneNumber(t, e).then(function(n) { 15804 $("#send-otp-button").html("Send OTP"), $(".send-otp-form").unblock(), window.signingIn = !1, updateSignInButtonUI(), resetRecaptcha(), $("#send-otp-form").hide(), $("#otp_div").show(), $("#verify-otp-form").removeClass("d-none"), $(document).on("submit", "#verify-otp-form", function(t) { 15805 t.preventDefault(), $("#registration-error").html(""); 15806 var t = $("#otp").val(), 15807 e = new FormData(this), 15808 i = $(this).attr("action"); 15809 $("#register_submit_btn").html("Please Wait...").attr("disabled", !0), n.confirm(t).then(function(t) { 15810 e.append(csrfName, csrfHash), e.append("mobile", $("#phone-number").val()), e.append("country_code", $(".selected-dial-code").text()), $.ajax({ 15811 type: "POST", 15812 url: i, 15813 data: e, 15814 processData: !1, 15815 contentType: !1, 15816 cache: !1, 15817 dataType: "json", 15818 beforeSend: function() { 15819 $("#register_submit_btn").html("Please Wait...").attr("disabled", !0) 15820 }, 15821 success: function(t) { 15822 csrfName = t.csrfName, csrfHash = t.csrfHash, $("#register_submit_btn").html("Submit").attr("disabled", !1), $("#registration-error").html(t.message).show() 15823 } 15824 }) 15825 }).catch(function(t) { 15826 $("#register_submit_btn").html("Please Wait...").attr("disabled", !0), $("#registration-error").html("Invalid OTP. Please Enter Valid OTP").show() 15827 }) 15828 }) 15829 }).catch(function(t) { 15830 window.signingIn = !1, $("#is-user-exist-error").html(t.message).show(), $("#send-otp-button").html("Send OTP"), updateSignInButtonUI(), resetRecaptcha() 15831 }))) 15832} 15833 15834function getPhoneNumberFromUserInput() { 15835 return $(".selected-dial-code").html() + $("#phone-number").val() 15836} 15837 15838function isPhoneNumberValid() { 15839 return -1 !== getPhoneNumberFromUserInput().search(/^\+[0-9\s\-\(\)]+$/) 15840} 15841 15842function resetRecaptcha() { 15843 return window.recaptchaVerifier.render().then(function(t) { 15844 grecaptcha.reset(t) 15845 }) 15846} 15847 15848function updateSignInButtonUI() {} 15849 15850function is_user_exist(t = "") { 15851 var e; 15852 return t = "" == t ? $("#phone-number").val() : t, $.ajax({ 15853 type: "POST", 15854 async: !1, 15855 url: base_url + "auth/verify_user", 15856 data: { 15857 mobile: t, 15858 [csrfName]: csrfHash 15859 }, 15860 dataType: "json", 15861 success: function(t) { 15862 15863 console.log(t); 15864 $('.v_otp').val(t.data); 15865 $('#otp_verify').val(t.data); 15866 csrfName = t.csrfName, csrfHash = t.csrfHash, e = t 15867 15868 15869 } 15870 }), e 15871} 15872 15873function formatRepo(t) { 15874 if (t.loading) return t.text; 15875 var e = "<div class='select2-result-repository clearfix'><div class='select2-result-repository__avatar'><img src='" + t.image_sm + "' /></div><div class='select2-result-repository__meta'><div class='select2-result-repository__title'>" + t.name + "</div>"; 15876 return t.category_name && (e += "<div class='select2-result-repository__description'> In " + t.category_name + "</div>"), e 15877} 15878 15879function formatRepoSelection(t) { 15880 return t.name || t.text 15881} 15882$(document).on("submit", ".form-submit-event", function(t) { 15883 t.preventDefault(); 15884 var e = new FormData(this), 15885 i = $("#error_box", this), 15886 n = $(this).find(".submit_btn"), 15887 o = $(this).find(".submit_btn").html(), 15888 t = $(this).find(".submit_btn").val(), 15889 s = "" != o || "undefined" != o ? o : t; 15890 e.append(csrfName, csrfHash), $.ajax({ 15891 type: "POST", 15892 url: $(this).attr("action"), 15893 data: e, 15894 beforeSend: function() { 15895 n.html("Please Wait.."), n.attr("disabled", !0) 15896 }, 15897 cache: !1, 15898 contentType: !1, 15899 processData: !1, 15900 dataType: "json", 15901 success: function(t) { 15902 csrfName = t.csrfName, csrfHash = t.csrfHash, 1 == t.error ? (i.addClass("rounded p-3 alert alert-danger").removeClass("d-none alert-success"), i.show().delay(5e3).fadeOut(), i.html(t.message), n.html(s), n.attr("disabled", !1)) : (i.addClass("rounded p-3 alert alert-success").removeClass("d-none alert-danger"), i.show().delay(3e3).fadeOut(), i.html(t.message), n.html(s), n.attr("disabled", !1), $(".form-submit-event")[0].reset(), setTimeout(function() { 15903 location.reload() 15904 }, 600)) 15905 } 15906 }) 15907}), window.onload = function() { 15908 document.getElementById("send-otp-form").addEventListener("submit", onSignInSubmit), document.getElementById("phone-number").addEventListener("keyup", updateSignInButtonUI), document.getElementById("phone-number").addEventListener("change", updateSignInButtonUI) 15909}, $(document).on("click", "#resend-otp", function(t) { 15910 t.preventDefault() 15911}), $(document).on("submit", ".sign-up-form", function(t) { 15912 t.preventDefault(); 15913 t = $(".selected-dial-code").html(); 15914 $phonenumber = $("#phone-number").val(), $username = $('input[name="username"]').val(), $email = $('input[name="email"]').val(), $passwd = $('input[name="password"]').val(), $.ajax({ 15915 type: "POST", 15916 url: base_url + "auth/register_user", 15917 data: { 15918 country_code: t, 15919 mobile: $phonenumber, 15920 name: $username, 15921 email: $email, 15922 password: $passwd, 15923 [csrfName]: csrfHash 15924 }, 15925 dataType: "json", 15926 success: function(t) { 15927 1 == t.error && $("#sign-up-error").html('<span class="text-danger" >' + response.message + "</span>") 15928 } 15929 }) 15930}); 15931var search_products = $(".search_product").select2({ 15932 ajax: { 15933 url: base_url + "home/get_products", 15934 dataType: "json", 15935 delay: 250, 15936 data: function(t) { 15937 return { 15938 search: t.term, 15939 page: t.page 15940 } 15941 }, 15942 processResults: function(t, e) { 15943 return e.page = e.page || 1, { 15944 results: t.data, 15945 pagination: { 15946 more: 30 * e.page < t.total 15947 } 15948 } 15949 }, 15950 cache: !0 15951 }, 15952 escapeMarkup: function(t) { 15953 return t 15954 }, 15955 minimumInputLength: 1, 15956 templateResult: formatRepo, 15957 templateSelection: formatRepoSelection, 15958 theme: "adwitt", 15959 placeholder: "Search for products" 15960}); 15961search_products.on("select2:select", function(t) { 15962 t = t.params.data; 15963 null != t.link && null != t.link && (window.location.href = t.link) 15964 }), $("#leftside-navigation .sub-menu > a").click(function(t) { 15965 $("#leftside-navigation ul ul").slideUp(), $("#leftside-navigation .sub-menu > a").next().is(":visible") || $("#leftside-navigation .sub-menu > a").find(".arrow").removeClass("fa-angle-down").addClass("fa-angle-left"), $(this).find(".arrow").hasClass("fa-angle-left") ? $(this).find(".arrow").removeClass("fa-angle-left").addClass("fa-angle-down") : $(this).find(".arrow").removeClass("fa-angle-down").addClass("fa-angle-left"), $(this).next().is(":visible") || $(this).next().slideDown(), t.stopPropagation() 15966 }), $("li.has-ul").click(function() { 15967 $(this).children(".sub-ul").slideToggle(500), $(this).toggleClass("active"), event.preventDefault() 15968 }), $(".add-to-fav-btn").on("click", function(t) { 15969 t.preventDefault(); 15970 var e = new FormData, 15971 t = $(this).data("product-id"), 15972 i = $(this); 15973 e.append(csrfName, csrfHash), e.append("product_id", t), $.ajax({ 15974 type: "POST", 15975 url: base_url + "my-account/manage-favorites", 15976 data: e, 15977 cache: !1,
15978 contentType: !1, 15979 processData: !1, 15980 dataType: "json", 15981 success: function(t) { 15982 csrfName = t.csrfName, csrfHash = t.csrfHash, 1 == t.error ? Toast.fire({ 15983 icon: "error", 15984 title: t.message 15985 }) : i.hasClass("fas") ? i.removeClass("fas").addClass("fas text-danger") : (i.removeClass("fas text-danger").addClass("far"), i.css("color", "#d7d1d1")) 15986 } 15987 }) 15988 }), $(document).on("click", "#add_to_favorite_btn", function(t) { 15989 t.preventDefault(); 15990 var e = new FormData, 15991 t = $(this).data("product-id"), 15992 i = $(this), 15993 n = $(this).html(); 15994 e.append(csrfName, csrfHash), e.append("product_id", t), $.ajax({ 15995 type: "POST", 15996 url: base_url + "my-account/manage-favorites", 15997 data: e, 15998 cache: !1, 15999 contentType: !1, 16000 processData: !1, 16001 dataType: "json", 16002 beforeSend: function() { 16003 i.attr("disabled", !0), i.find("span").text("Please wait") 16004 }, 16005 success: function(t) { 16006 csrfName = t.csrfName, csrfHash = t.csrfHash, i.attr("disabled", !1), i.html(n), 1 == t.error ? Toast.fire({ 16007 icon: "error", 16008 title: t.message 16009 }) : i.hasClass("add-fav") ? (i.removeClass("add-fav").addClass("remove-fav"), i.find("span").text("Remove from Favorite")) : (i.removeClass("remove-fav").addClass("add-fav"), i.find("span").text("Add to Favorite")) 16010 } 16011 }) 16012 }), $(function() { 16013 var t, o, l; 16014 16015 function s(t, s, a, r = "#user_image_data") { 16016 $("#review-image-title").data("review-offset", a + s), $.getJSON(base_url + "products/get_rating?product_id=" + t + "&has_images=1&limit=" + s + "&offset=" + a, function(t) { 16017 $("#review-image-title").data("review-offset", a + s), l = ""; 16018 if (0 == t.error) 16019 for (var e = 0; e < t.data.product_rating.length; e++) 16020 for (var i = t.data.product_rating[e], n = 0; n < i.images.length; n++) { 16021 var o = i.images; 16022 l += "<div class='review-box '><a href='" + o[n] + "' data-lightbox='review-images-12345' data-title='<font >" + i.rating + " ★</font></br>" + i.user_name + "<br>" + i.comment + "'><img src='" + o[n] + "' alt='Review Image'></a></div>" 16023 } else $("#review-image-title").data("reached-end", "true"); 16024 $(r).append(l) 16025 }) 16026 } 16027 $(".auth-modal").iziModal({ 16028 overlayClose: !1, 16029 overlayColor: "rgba(0, 0, 0, 0.6)" 16030 }), $("#user-review-images").length && (t = "", t = $("#review-image-title").data("review-title"), o = $("#review-image-title").data("product-id"), l = "", $("#user-review-images").iziModal({ 16031 overlayClose: !1, 16032 overlayColor: "rgba(0, 0, 0, 0.6)", 16033 title: t, 16034 headerColor: "#f44336c4", 16035 arrowKeys: !1, 16036 fullscreen: !0, 16037 onOpening: function(t) { 16038 t.startLoading(); 16039 var e = $("#review-image-title").data("review-limit"), 16040 i = $("#review-image-title").data("review-offset"), 16041 n = $("#review-image-title").data("reached-end"); 16042 $("#load_more_div").html('<div id="load_more"></div>'), 0 == n && s(o, e, i), t.stopLoading() 16043 }, 16044 onOpened: function() { 16045 $("div").bind("wheel", function(t) { 16046 var e, i, n; 16047 $("#load_more").length && $(this).scrollTop() + $(this).innerHeight() >= $(this)[0].scrollHeight && (e = $("#review-image-title").data("product-id"), i = $("#review-image-title").data("review-limit"), n = $("#review-image-title").data("review-offset"), 0 == $("#review-image-title").data("reached-end") && s(e, i, n)) 16048 }) 16049 } 16050 })), $("#seller_info").length && $("#seller_info").iziModal({ 16051 overlayClose: !0, 16052 overlayColor: "rgba(0, 0, 0, 0.6)", 16053 title: "Sold By", 16054 headerColor: "#f44336c4", 16055 arrowKeys: !1, 16056 fullscreen: !0, 16057 onOpening: function(t) { 16058 t.startLoading(), t.stopLoading() 16059 } 16060 }), $("#quick-view").iziModal({ 16061 overlayClose: !1, 16062 overlayColor: "rgba(0, 0, 0, 0.6)", 16063 width: 1e3, 16064 onOpening: function(d) { 16065 d.startLoading(), $("#modal-product-tags").html(""), $.getJSON(base_url + "products/get-details/" + d.$element.data("dataProductId"), function(i) { 16066 var n = 0; 16067 $("#modal-add-to-cart-button").attr("data-product-id", i.id), "simple_product" == i.type ? $("#modal-add-to-cart-button").attr("data-product-variant-id", i.variants[0].id) : $("#modal-add-to-cart-button").attr("data-product-variant-id", ""), 1 != i.minimum_order_quantity && "" != i.minimum_order_quantity && "undefined" != i.minimum_order_quantity ? ($(".in-num").attr({ 16068 "data-min": i.minimum_order_quantity 16069 }), $(".minus").attr({ 16070 "data-min": i.minimum_order_quantity 16071 }
16071), $("#modal-add-to-cart-button").attr({ 16072 "data-min": i.minimum_order_quantity 16073 })) : ($(".in-num").attr({ 16074 "data-min": 1 16075 }), $(".minus").attr({ 16076 "data-min": 1 16077 }), $("#modal-add-to-cart-button").attr({ 16078 "data-min": 1 16079 })), 1 != i.quantity_step_size && "" != i.quantity_step_size && "undefined" != i.quantity_step_size ? ($(".in-num").attr({ 16080 "data-step": i.quantity_step_size 16081 }), $(".minus").attr({ 16082 "data-step": i.quantity_step_size 16083 }), $(".plus").attr({ 16084 "data-step": i.quantity_step_size 16085 }), $("#modal-add-to-cart-button").attr({ 16086 "data-step": i.quantity_step_size 16087 })) : ($(".in-num").attr({ 16088 "data-step": 1 16089 }), $(".minus").attr({ 16090 "data-step": 1 16091 }), $(".plus").attr({ 16092 "data-step": 1 16093 }), $("#modal-add-to-cart-button").attr({ 16094 "data-step": 1 16095 })), "" != i.total_allowed_quantity && "undefined" != i.total_allowed_quantity && null != i.total_allowed_quantity ? ($(".in-num").attr({ 16096 "data-max": i.total_allowed_quantity 16097 }), $(".plus").attr({ 16098 "data-max": i.total_allowed_quantity 16099 }), $("#modal-add-to-cart-button").attr({ 16100 "data-max": i.total_allowed_quantity 16101 })) : ($(".in-num").attr({ 16102 "data-max": 1 16103 }), $(".plus").attr({ 16104 "data-max": 1 16105 }), $("#modal-add-to-cart-button").attr({ 16106 "data-max": 1 16107 })), $("#modal-product-quantity").val(i.minimum_order_quantity), $("#modal-product-title").text(i.name), $("#modal-product-short-description").text(i.short_description), $("#modal-product-rating").rating("update", i.rating); 16108 var t = i.get_price.range; 16109 $("#modal-product-price").html(t), quickViewgalleryThumbs = new Swiper(".gallery-thumbs", { 16110 spaceBetween: 10, 16111 slidesPerView: 4, 16112 freeMode: !0, 16113 watchSlidesVisibility: !0, 16114 watchSlidesProgress: !0 16115 }), quickViewgalleryTop = new Swiper(".gallery-top", { 16116 spaceBetween: 10, 16117 navigation: { 16118 nextEl: ".swiper-button-next", 16119 prevEl: ".swiper-button-prev" 16120 }, 16121 thumbs: { 16122 swiper: quickViewgalleryThumbs 16123 }, 16124 clickable: !0 16125 }), mobile_image_swiper = new Swiper(".mobile-image-swiper", { 16126 pagination: { 16127 el: ".mobile-image-swiper-pagination" 16128 }, 16129 clickable: !0 16130 }), quickViewgalleryThumbs.removeAllSlides(), quickViewgalleryTop.removeAllSlides(), mobile_image_swiper.removeAllSlides(); 16131 var o = '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + i.image_md + '" data-zoom-image=""></div></div></div></div>', 16132 s = '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + i.image_md + '"></div></div></div></div>', 16133 a = '<div class="swiper-slide text-center"><img src="' + i.image_md + '"></div>', 16134 e = i.variants.map(function(t, e) { 16135 return t.images_md 16136 }); 16137 $.each(e, function(t, e) { 16138 null != e && "" != e && $.each(e, function(t, e) { 16139 o += '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + e + '" data-zoom-image=""></div></div></div></div>', s += '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + e + '"></div></div></div></div>', a += '<div class="swiper-slide text-center"><img src="' + e + '"></div>' 16140 }) 16141 }), $.each(i.other_images_md, function(t, e) { 16142 n++, o += '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + e + '" data-zoom-image=""></div></div></div></div>', s += '<div class="swiper-slide text-center"><div class="product-view-grid"><div class="product-view-image"><div class="product-view-image-container"><img src="' + e + '"></div></div></div></div>', a += '<div class="swiper-slide text-center"><img src="' + e + '"></div>' 16143 }), quickViewgalleryThumbs.addSlide(1, o), quickViewgalleryTop.addSlide(1, s), mobile_image_swiper.addSlide(1, a); 16144 var r = ""; 16145 $.each(i.variant_attributes, function(t, n) { 16146 var e = n.ids.split(","), 16147 o = n.values.split(","), 16148 s = n.swatche_type.split(","), 16149 a = n.swatche_value.split(","); 16150 r += "<h4>" + n.attr_name + '</h4><div class="btn-group btn-group-toggle" data-toggle="buttons">', $.each(e, function(t, e) { 16151 var i; 16152 "1" == s[t] ? (i = 'style="background-color:' + a[t] + '";', r += '<style> .product-page-details .btn-group>.active { border: 1px solid black;}</style><button class="btn fullCircle" ' + i + '><input type="radio" name="' + n.attr_name + '" value="' + e + '" class="modal-product-attributes" autocomplete="off"><br></button>') : "2" == s[t] ? r += '<style> .product-page-details .btn-group>.active { color: #000000; border: 1px solid black;}</style><label class="btn text-center bg-transparent"><img class="swatche-image" src="' + a[t] + '"><input type="radio" name="' + n.attr_name + '" value="' + e + '" class="modal-product-attributes" autocomplete="off"><br></label>' : r += '<style> .product-page-details .btn-group>.active { background-color: var(--primary-color);color: white!important;}</style><label class="btn btn-default text-center"><input type="radio" name="' + n.attr_name + '" value="' + e + '" class="modal-product-attributes" autocomplete="off">' + o[t] + "<br></label>" 16153 }), r += "</div>" 16154 }); 16155 t = 0 == i.is_deliverable ? "danger" : "success", e = 0 == i.is_deliverable ? "not" : "", e = "" != i.zipcode && void 0 !== i.zipcode ? '<b class="text-' + t + '">Product is ' + e + " delivarable on " " + i.zipcode + " " </b>" : ""; 16156 r += '<form class="mt-2 validate_zipcode_quick_view" method="post" ><div class="d-flex"><div class=" col-md-6"><input type="hidden" name="product_id" value="' + i.id + '"><input type="hidden" name="' + csrfName + '" value="' + csrfHash + '"><input type="text" class="form-control" id="zipcode" placeholder="Zipcode" name="zipcode" required value="' + i.zipcode + '"></div><button type="submit" class="button button-primary-outline m-0" data-product_id="' + i.id + '" data-zipcode="' + i.zipcode + '" id="validate_zipcode">Check Availability</button></div><div class="mt-2" id="error_box1">' + e + " </div> </form>
16156", $("#modal-product-variant-attributes").html(r), 0 == i.is_deliverable && "" != i.zipcode && void 0 !== i.zipcode ? $("#modal-add-to-cart-button").attr("disabled", "true") : $("#modal-add-to-cart-button").removeAttr("disabled"); 16157 var l, c = "", 16158 n = 1; 16159 $.each(i.variants, function(t, e) { 16160 c += '<input type="hidden" class="modal-product-variants" data-image-index="' + n + '" name="variants_ids" data-name="' + i.name + '" value="' + e.variant_ids + '" data-id="' + e.id + '" data-price="' + e.price + '" data-special_price="' + e.special_price + '">', n += e.images.length 16161 }), $("#modal-product-variants-div").html(c), $("#add_to_favorite_btn").attr("data-product-id", i.id), 1 == i.is_favorite ? ($("#add_to_favorite_btn").addClass("remove-fav"), $("#add_to_favorite_btn").find("span").text("Remove From Favorite")) : ($("#add_to_favorite_btn").addClass("add-fav"), $("#add_to_favorite_btn").find("span").text("Add to Favorite")), $("#modal-product-no-of-ratings").text(i.no_of_ratings), $.isEmptyObject(i.tags) || (l = "Tags ", $.each(i.tags, function(t, e) { 16162 l += '<a href="' + base_url + "products/tags/" + e + '" target="_blank"><span class="badge badge-secondary p-1 mr-1">' + e + "</span></a>" 16163 }), $("#modal-product-tags").html(l)); 16164 e = ""; 16165 i.seller_name && (e = '<p> <span class="text-secondary"> Sold by </span> <a class="text text-primary" target="_blank" href="' + base_url + "products?seller=" + i.seller_slug + '">' + i.seller_name + '</a> <span class="badge badge-success ">' + i.seller_rating + ' <i class="fa fa-star"></i></span> <small class="text-muted"> Out of</small> <b> ' + i.seller_no_of_ratings + " </b></p>", $("#modal-product-sellers").html(e)), d.stopLoading() 16166 }) 16167 } 16168 }), $(document).on("change", ".modal-product-attributes", function(t) { 16169 t.preventDefault(); 16170 var e, n, o = [], 16171 s = "", 16172 a = !1, 16173 i = [], 16174 r = [], 16175 l = [], 16176 c = [], 16177 d = [], 16178 u = []; 16179 $(".modal-product-variants").each(function() { 16180 r = { 16181 price: $(this).data("price"), 16182 special_price: $(this).data("special_price") 16183 }, d.push($(this).data("id")), l.push(r), i = $(this).val().split(","), c.push(i), u.push($(this).data("image-index")) 16184 }), e = i.length, $(".modal-product-attributes").each(function() { 16185 var i; 16186 $(this).prop("checked") && (o.push($(this).val()), o.length == e && (r = [], i = "", $.each(c, function(t, e) { 16187 arrays_equal(o, e) && (a = !0, r.push(l[t]), i = d[t], n = u[t]) 16188 }), a ? (quickViewgalleryTop.slideTo(n, 500, !1), mobile_image_swiper.slideTo(n, 500, !1), r[0].special_price < r[0].price && 0 != r[0].special_price ? (s = r[0].special_price, $("#modal-product-price").text(currency + " " + s), $("#modal-product-special-price").text(currency + " " + r[0].price), $("#modal-add-to-cart-button").attr("data-product-variant-id", i), $("#modal-product-special-price-div").show()) : (s = r[0].price, $("#modal-product-price").html(currency + " " + s), $("#modal-product-special-price-div").hide(), $("#modal-add-to-cart-button").attr("data-product-variant-id", i))) : $("#modal-product-special-price-div").hide())) 16189 }) 16190 }), $("#modal-add-to-cart-button").on("click", function(t) { 16191 t.preventDefault(), $("#quick-view").data("data-product-id", $(this).data("productId")); 16192 var t = $(this).attr("data-product-variant-id"), 16193 s = $(this).attr("data-min"), 16194 a = $(this).attr("data-max"), 16195 r = $(this).attr("data-step"), 16196 e = $(this), 16197 i = $(this).html(); 16198 $.ajax({ 16199 type: "POST", 16200 url: base_url + "cart/manage", 16201 data: { 16202 product_variant_id: t, 16203 qty: $("#modal-product-quantity").val(), 16204 is_saved_for_later: !1, 16205 [csrfName]: csrfHash 16206 }, 16207 dataType: "json", 16208 beforeSend: function() { 16209 e.html("Please Wait").text("Please Wait").attr("disabled", !0) 16210 }, 16211 success: function(t) { 16212 var o; 16213 csrfName = t.csrfName, csrfHash = t.csrfHash, e.html(i).attr("disabled", !1), 0 == t.error ? (Toast.fire({ 16214 icon: "success", 16215 title: t.message 16216 }), $("#cart-count").text(t.data.cart_count), o = "", $.each(t.data.items, function(t, e) { 16217 var i = void 0 !== e.product_variants.variant_values && null != e.product_variants.variant_values ? e.product_variants.variant_values : "", 16218 n = e.special_price < e.price && 0 != e.special_price ? e.special_price : e.price; 16219 o += '<div class="row"><div class="cart-product product-sm col-md-12"><div class="product-image"><img class="pic-1" src="' + base_url + e.image + '" alt="Not Found"></div><div class="product-details"><div class="product-title">' + e.name + "</div><span>" + i + '</span><p class="product-descriptions">' + e.short_description + '</p></div><div class="product-pricing d-flex py-2 px-1 w-100"><div class="product-price align-self-center">' + currency + " " + n + '</div><div class="product-sm-quantity px-1"><input type="number" class="form-input" value="' + e.qty + '" data-id="' + e.product_variant_id + '" data-price="' + e.price + '" min="' + s + '" max="' + a + '" step="' + r + '" ></div><div class="product-sm-removal align-self-center"><button class="remove-product button button-danger" data-id="' + e.product_variant_id + '">
16219<i class="fa fa-trash"></i></button></div><div class="product-line-price align-self-center px-1">' + currency + " " + (e.qty * n).toLocaleString(void 0, { 16220 minimumFractionDigits: 2 16221 }) + "</div></div></div></div>" 16222 }), $("#cart-item-sidebar").html(o)) : Toast.fire({ 16223 icon: "error", 16224 title: t.message 16225 }) 16226 } 16227 }) 16228 }), $(".auth-modal").on("click", "header a", function(t) { 16229 t.preventDefault(), window.signingIn = !0; 16230 t = $(this).index(); 16231 $(this).addClass("active").siblings("a").removeClass("active"), $(this).parents("div").find("section").eq(t).removeClass("hide").siblings("section").addClass("hide"), 0 === $(this).index() ? $(".auth-modal .iziModal-content .icon-close").css("background", "#ddd") : $(".auth-modal .iziModal-content .icon-close").attr("style", "") 16232 }), $(document).on("opening", ".auth-modal", function(t) { 16233 $(this).removeClass("d-none"), t.preventDefault(), closeNav(), $(".send-otp-form")[0].reset(), $(".send-otp-form").show(), $(".sign-up-form")[0].reset(), $(".sign-up-form").hide(), $("#is-user-exist-error").html(""), $("#sign-up-error").html(""), $("#recaptcha-container").html(""); 16234 window.recaptchaVerifier = new firebase.auth.RecaptchaVerifier("recaptcha-container"), window.recaptchaVerifier.render().then(function(t) { 16235 grecaptcha.reset(t) 16236 }); 16237 var e = $("#phone-number"), 16238 i = $("#error-msg"), 16239 n = $("#valid-msg"); 16240 e.intlTelInput({ 16241 allowExtensions: !0, 16242 formatOnDisplay: !0, 16243 autoFormat: !0, 16244 autoHideDialCode: !0, 16245 autoPlaceholder: !0, 16246 defaultCountry: "in", 16247 ipinfoToken: "yolo", 16248 nationalMode: !1, 16249 numberType: "MOBILE", 16250 preferredCountries: ["in", "ae", "qa", "om", "bh", "kw", "ma"], 16251 preventInvalidNumbers: !0, 16252 separateDialCode: !0, 16253 initialCountry: "auto", 16254 geoIpLookup: function(e) { 16255 $.get("https://ipinfo.io", function() {}, "jsonp").always(function(t) { 16256 t = t && t.country ? t.country : ""; 16257 e(t) 16258 }) 16259 }, 16260 utilsScript: "https://cdnjs.cloudflare.com/ajax/libs/intl-tel-input/11.0.9/js/utils.js" 16261 }); 16262 16263 function o() { 16264 e.removeClass("error"), i.addClass("hide"), n.addClass("hide") 16265 } 16266 e.blur(function() { 16267 o(), $.trim(e.val()) && (e.intlTelInput("isValidNumber") ? n.removeClass("hide") : (e.addClass("error"), i.removeClass("hide"))) 16268 }), e.on("keyup change", o) 16269 }), $("#quick-view").on("click", ".submit", function(t) { 16270 t.preventDefault(); 16271 var e = "wobble", 16272 i = $(this).closest(".iziModal"); 16273 i.hasClass(e) || (i.addClass(e), setTimeout(function() { 16274 i.removeClass(e) 16275 }, 1500)) 16276 }), $("#quick-view").on("click", "header a", function(t) { 16277 t.preventDefault(); 16278 t = $(this).index(); 16279 $(this).addClass("active").siblings("a").removeClass("active"), $(this).parents("div").find("section").eq(t).removeClass("hide").siblings("section").addClass("hide"), 0 === $(this).index() ? $("#quick-view .iziModal-content .icon-close").css("background", "#ddd") : $("#quick-view .iziModal-content .icon-close").attr("style", "") 16280 }), $("#quick-view").on("click", ".submit", function(t) { 16281 t.preventDefault(); 16282 var e = "wobble", 16283 i = $(this).closest(".iziModal"); 16284 i.hasClass(e) || (i.addClass(e), setTimeout(function() { 16285 i.removeClass(e) 16286 }, 1500)) 16287 }), $("#quick-view").on("click", "header a", function(t) { 16288 t.preventDefault(); 16289 t = $(this).index(); 16290 $(this).addClass("active").siblings("a").removeClass("active"), $(this).parents("div").find("section").eq(t).removeClass("hide").siblings("section").addClass("hide"), 0 === $(this).index() ? $("#quick-view .iziModal-content .icon-close").css("background", "#ddd") : $("#quick-view .iziModal-content .icon-close").attr("style", "") 16291 }) 16292 }), new LazyLoad({ 16293 threshold: 0, 16294 callback_enter: function(t) {}, 16295 callback_exit: function(t) {}, 16296 callback_cancel: function(t) {}, 16297 callback_loading: function(t) {}, 16298 callback_loaded: function(t) {}, 16299 callback_error: function(t) {}, 16300 callback_finish: function() {} 16301 }), 16302 function() { 16303 var n, o, t = document.querySelector(".range-slider"); 16304 t && (n = t.querySelectorAll("input[type=range]"), o = t.querySelectorAll("input[type=number]"), n.forEac
16304h(function(t) { 16305 t.oninput = function() { 16306 var t = parseFloat(n[0].value), 16307 e = parseFloat(n[1].value); 16308 e < t && ([t, e] = [e, t]), o[0].value = t, o[1].value = e, custom_url = setUrlParameter(location.href, "min-price", t), custom_url = setUrlParameter(custom_url, "max-price", e) 16309 } 16310 }), o.forEach(function(t) { 16311 t.oninput = function() { 16312 var t, e = parseFloat(o[0].value), 16313 i = parseFloat(o[1].value); 16314 i < e && (t = e, o[0].value = i, o[1].value = t), n[0].value = e, n[1].value = i 16315 } 16316 })) 16317 }(), $(document).on("change", "input.in-num", function(t) { 16318 t.preventDefault(); 16319 t = $(this); 16320 null != t.val() && "string" != typeof t.val() || $.isNumeric(t.val()) && "0" != t.val() || t.val(1) 16321 }), $(document).on("focusout", ".in-num", function(t) { 16322 t.preventDefault(); 16323 var e = $(this).val(), 16324 i = $(this).data("min"), 16325 t = ($(this).data("step"), $(this).data("max")); 16326 e < i ? ($(this).val(i), Toast.fire({ 16327 icon: "error", 16328 title: "Minimum allowed quantity is " + i 16329 })) : t < e && ($(this).val(t), Toast.fire({ 16330 icon: "error", 16331 title: "Maximum allowed quantity is " + t 16332 })) 16333 }), $(document).on("click", ".num-block .num-in span", function(t) { 16334 t.preventDefault(); 16335 var e, i, n, t = $(this).parents(".num-block").find("input.in-num"); 16336 return null == t.val() && t.val(1), $(this).hasClass("minus") ? (e = $(this).data("step"), n = parseFloat(t.val()) - e, (i = $(this).data("min")) <= n ? t.val(n) : (t.val(i), Toast.fire({ 16337 icon: "error", 16338 title: "Minimum allowed quantity is " + i 16339 }))) : (e = $(this).data("step"), i = $(this).data("max"), n = parseFloat(t.val()) + e, 0 != i ? n <= i ? (t.val(n), 1 < n && $(this).parents(".num-block").find(".minus").removeClass("dis")) : (t.val(i), Toast.fire({ 16340 icon: "error", 16341 title: "Maximum allowed quantity is " + i 16342 })) : t.val(n)), t.change(), !1 16343 }), $(document).ready(function() { 16344 $(".kv-fa").rating({ 16345 theme: "krajee-fa", 16346 filledStar: '<i class="fas fa-star"></i>', 16347 emptyStar: '<i class="far fa-star"></i>', 16348 showClear: !1, 16349 showCaption: !1, 16350 size: "md" 16351 }); 16352 var o = .05, 16353 s = 15, 16354 a = 300; 16355 16356 function r() { 16357 var t = 0; 16358 $(".product").each(function() { 16359 t += parseFloat($(this).children(".product-line-price").text()) 16360 }); 16361 var e = t * o, 16362 i = 0 < t ? s : 0, 16363 n = t + e + i; 16364 $(".totals-value").fadeOut(a, function() { 16365 $("#cart-subtotal").html(t.toFixed(2)), $("#cart-tax").html(e.toFixed(2)), $("#cart-shipping").html(i.toFixed(2)), $("#cart-total").html(n.toFixed(2)), 0 == n ? $(".checkout").fadeOut(a) : $(".checkout").fadeIn(a), $(".totals-value").fadeIn(a) 16366 }) 16367 } 16368 $(document).on("change", ".product-quantity input,.product-sm-quantity input", function(t) { 16369 t.preventDefault(); 16370 var e = $(this).data("id"), 16371 i = $(this).data("price"), 16372 t = $(this).val(), 16373 n = $(this); 16374 $.ajax({ 16375 url: base_url + "cart/manage", 16376 type: "POST", 16377 data: { 16378 product_variant_id: e, 16379 qty: t, 16380 [csrfName]: csrfHash 16381 }, 16382 dataType: "json", 16383 success: function(t) { 16384 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? function(t, e) { 16385 { 16386 var i; 16387 i = "cart" == t.data("page") ? $(t).parent().parent().parent().siblings(".total-price") : $(t).parent().parent() 16388 } 16389 var t = $(t).val(), 16390 n = e * t; 16391 i.children(".product-line-price").each(function() { 16392 $(this).fadeOut(a, function() { 16393 $(this).text(currency + " " + n.toFixed(2)), r(), $(this).fadeIn(a) 16394 }) 16395 }) 16396 }(n, i) : Toast.fire({ 16397 icon: "error", 16398 title: t.message 16399 }) 16400 } 16401 }) 16402 }), $(document).on("click", ".product-removal button,.product-removal i,.product-sm-removal button", function(t) { 16403 t.preventDefault(); 16404 var e = $(this).data("id"), 16405 t = void 0 !== $(this).data("is-save-for-later") && 1 == $(this).data("is-save-for-later") ? "1" : "0", 16406 n = $(this).parent().parent().parent(); 16407 confirm("Are you sure want to remove this?") && $.ajax({ 16408 url: base_url + "cart/remove", 16409 type: "POST", 16410 data: { 16411 product_variant_id: e, 16412 is_save_for_later: t, 16413 [csrfName]: csrfHash 16414 }, 16415 dataType: "json", 16416 success: function(t) { 16417 var e, i; 16418 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (e = $("#cart
16418-count").text(), e--, $("#cart-count").text(e), (i = $(n)).slideUp(a, function() { 16419 i.remove(), r() 16420 })) : Toast.fire({ 16421 icon: "error", 16422 title: t.message 16423 }) 16424 } 16425 }) 16426 }) 16427 }), $(".js-menu").on("click", () => { 16428 $(".js-menu").toggleClass("active"), $(".js-filter-nav").toggleClass("open"), $(".js-filter-nav__list").toggleClass("show"), "hidden" == $("body").css("overflow").toLowerCase() ? $("body").css("overflow", "scroll") : $("body").css("overflow", "hidden") 16429 }), jQuery(document).ready(function(n) { 16430 function t(t) { 16431 this.element = t, this.mainNavigation = this.element.find(".main-nav"), this.mainNavigationItems = this.mainNavigation.find(".has-dropdown"), this.dropdownList = this.element.find(".dropdown-list"), this.dropdownWrappers = this.dropdownList.find(".dropdown"), this.dropdownItems = this.dropdownList.find(".content"), this.dropdownBg = this.dropdownList.find(".bg-layer"), this.mq = this.checkMq(), this.bindEvents() 16432 } 16433 t.prototype.checkMq = function() { 16434 return window.getComputedStyle(this.element.get(0), "::before").getPropertyValue("content").replace(/'/g, "").replace(/"/g, "").split(", ") 16435 }, t.prototype.bindEvents = function() { 16436 var i = this; 16437 this.mainNavigationItems.mouseenter(function(t) { 16438 i.showDropdown(n(this)) 16439 }).mouseleave(function() { 16440 setTimeout(function() { 16441 0 == i.mainNavigation.find(".has-dropdown:hover").length && 0 == i.element.find(".dropdown-list:hover").length && i.hideDropdown() 16442 }, 50) 16443 }), this.dropdownList.mouseleave(function() { 16444 setTimeout(function() { 16445 0 == i.mainNavigation.find(".has-dropdown:hover").length && 0 == i.element.find(".dropdown-list:hover").length && i.hideDropdown() 16446 }, 50) 16447 }), this.mainNavigationItems.on("touchstart", function(t) { 16448 var e = i.dropdownList.find("#" + n(this).data("content")); 16449 i.element.hasClass("is-dropdown-visible") && e.hasClass("active") || (t.preventDefault(), i.showDropdown(n(this))) 16450 }) 16451 }, t.prototype.showDropdown = function(t) { 16452 var e, i, n, o, s, a; 16453 this.mq = this.checkMq(), "desktop" == this.mq && (n = (i = (e = this).dropdownList.find("#" + t.data("content"))).innerHeight() + 18, 540 < (a = 180 * i.children(".content").children("ul").children("li").length) && (a = 540), o = parseInt(a), s = t.offset().left + t.innerWidth() / 2 - o / 2, a = t[0].offsetParent.offsetLeft, this.updateDropdown(i, parseInt(n), o, parseInt(s)), this.element.find(".active").removeClass("active"), this.element.find(".morph-dropdown-wrapper").css({ 16454 "-moz-transform": "translateX(-" + a + "px)", 16455 "-webkit-transform": "translateX(-" + a + "px)", 16456 "-ms-transform": "translateX(-" + a + "px)", 16457 "-o-transform": "translateX(-" + a + "px)", 16458 transform: "translateX(-" + a + "px)" 16459 }), i.addClass("active").removeClass("move-left move-right").prevAll().addClass("move-left").end().nextAll().addClass("move-right"), t.addClass("active"), this.element.hasClass("is-dropdown-visible") || setTimeout(function() { 16460 e.element.addClass("is-dropdown-visible") 16461 }, 10)) 16462 }, t.prototype.updateDropdown = function(t, e, i, n) { 16463 this.dropdownList.css({ 16464 "-moz-transform": "translateX(" + n + "px)", 16465 "-webkit-transform": "translateX(" + n + "px)", 16466 "-ms-transform": "translateX(" + n + "px)", 16467 "-o-transform": "translateX(" + n + "px)", 16468 transform: "translateX(" + n + "px)", 16469 width: i + "px", 16470 height: e + "px" 16471 }), this.dropdownBg.css({ 16472 "-moz-transform": "scaleX(" + i + ") scaleY(" + e + ")", 16473 "-webkit-transform": "scaleX(" + i + ") scaleY(" + e + ")", 16474 "-ms-transform": "scaleX(" + i + ") scaleY(" + e + ")", 16475 "-o-transform": "scaleX(" + i + ") scaleY(" + e + ")", 16476 transform: "scaleX(" + i + ") scaleY(" + e + ")" 16477 }) 16478 }, t.prototype.hideDropdown = function() { 16479 this.mq = this.checkMq(), "desktop" == this.mq && this.element.removeClass("is-dropdown-visible").find(".active").removeClass("active").end().find(".move-left").removeClass("move-left").end().find(".move-right").removeClass("move-right") 16480 }, t.prototype.resetDropdown = function() { 16481 this.mq = this.checkMq(), "mobile" == this.mq && this.dropdownList.removeAttr("style") 16482 }; 16483 var e, i = []; 16484 16485 function o() {
16486 i.forEach(function(t) { 16487 t.resetDropdown() 16488 }), e = !1 16489 } 16490 0 < n(".cd-morph-dropdown").length && (n(".cd-morph-dropdown").each(function() { 16491 i.push(new t(n(this))) 16492 }), e = !1, o(), n(window).on("resize", function() { 16493 e || (e = !0, window.requestAnimationFrame ? window.requestAnimationFrame(o) : setTimeout(o, 300)) 16494 })) 16495 }), $(".navbar-top-search-box input").on("focus", function() { 16496 $(".navbar-top-search-box .input-group-text").css("border-color", "#0e7dd1") 16497 }), $(".navbar-top-search-box input").on("blur", function() { 16498 $(".navbar-top-search-box .input-group-text").css("border", "1px solid #ced4da") 16499 }); 16500var swiper = new Swiper(".swiper1", { 16501 loop: !0, 16502 preloadImages: !1, 16503 lazy: !0, 16504 autoplay: { 16505 delay: 6e3, 16506 disableOnInteraction: !1 16507 }, 16508 pagination: { 16509 el: ".swiper1-pagination", 16510 clickable: !0 16511 }, 16512 navigation: { 16513 nextEl: ".swiper-button-next", 16514 prevEl: ".swiper-button-prev" 16515 } 16516 }), 16517 swiperheader = new Swiper(".imageSliderHeader", { 16518 autoplay: { 16519 delay: 6e3, 16520 disableOnInteraction: !1 16521 }, 16522 pagination: { 16523 el: ".imageSliderHeader-pagination", 16524 clickable: !0 16525 }, 16526 loop: !0, 16527 grabCursor: !0 16528 }), 16529 swiperF = new Swiper(".preview-image-swiper", { 16530 pagination: { 16531 el: ".preview-image-swiper-pagination" 16532 } 16533 }), 16534 swiperV = new Swiper(".banner-swiper", { 16535 preloadImages: !1, 16536 lazy: !0, 16537 pagination: { 16538 el: ".banner-swiper-pagination" 16539 }, 16540 loop: !0, 16541 navigation: { 16542 nextEl: ".swiper-button-next", 16543 prevEl: ".swiper-button-prev" 16544 } 16545 }), 16546 swiperS = new Swiper(".category-swiper", { 16547 slidesPerView: 5, 16548 preloadImages: !1, 16549 lazyLoading: !0, 16550 updateOnImagesReady: !1, 16551 lazyLoadingInPrevNextAmount: 0, 16552 pagination: { 16553 el: ".category-swiper-pagination", 16554 clickable: !0 16555 }, 16556 breakpoints: { 16557 350: { 16558 slidesPerView: 4, 16559 spaceBetweenSlides: 10 16560 }, 16561 400: { 16562 slidesPerView: 4, 16563 spaceBetweenSlides: 10 16564 }, 16565 499: { 16566 slidesPerView: 4, 16567 spaceBetweenSlides: 10 16568 }, 16569 550: { 16570 slidesPerView: 1, 16571 spaceBetweenSlides: 10 16572 }, 16573 600: { 16574 slidesPerView: 2, 16575 spaceBetweenSlides: 10 16576 }, 16577 700: { 16578 slidesPerView: 3, 16579 spaceBetweenSlides: 10 16580 }, 16581 800: { 16582 slidesPerView: 4, 16583 spaceBetweenSlides: 10 16584 }, 16585 999: { 16586 slidesPerView: 5, 16587 spaceBetweenSlides: 10 16588 }, 16589 1900: { 16590 slidesPerView: 6, 16591 spaceBetweenSlides: 10 16592 } 16593 } 16594 }); 16595document.querySelectorAll(".product-image-swiper").forEach(function(t) { 16596 new Swiper(t, { 16597 grabCursor: !0, 16598 preloadImages: !1, 16599 lazyLoading: !0, 16600 updateOnImagesReady: !1, 16601 lazyLoadingInPrevNextAmount: 1, 16602 navigation: { 16603 nextEl: t.nextElementSibling, 16604 prevEl: t.nextElementSibling.nextElementSibling 16605 }, 16606 breakpoints: { 16607 350: { 16608 slidesPerView: 1, 16609 spaceBetweenSlides: 10 16610 }, 16611 400: { 16612 slidesPerView: 1, 16613 spaceBetweenSlides: 10 16614 }, 16615 499: { 16616 slidesPerView: 1, 16617 spaceBetweenSlides: 10 16618 }, 16619 550: { 16620 slidesPerView: 1, 16621 spaceBetweenSlides: 10 16622 }, 16623 600: { 16624 slidesPerView: 2, 16625 spaceBetweenSlides: 10 16626 }, 16627 700: { 16628 slidesPerView: 3, 16629 spaceBetweenSlides: 10 16630 }, 16631 800: { 16632 slidesPerView: 4, 16633 spaceBetweenSlides: 10 16634 }, 16635 999: { 16636 slidesPerView: 5, 16637 spaceBetweenSlides: 10 16638 }, 16639 1900: { 16640 slidesPerView: 6, 16641 spaceBetweenSlides: 10 16642 } 16643 } 16644 }) 16645}); 16646var timer, swiperH = new Swiper(".swiper2", { 16647 slidesPerView: "auto", 16648 grabCursor: !0, 16649 spaceBetween: 20, 16650 pagination: { 16651 el: ".swiper2-pagination", 16652 clickable: !0 16653 } 16654 }), 16655 galleryThumbs = new Swiper(".gallery-thumbs-1", { 16656 spaceBetween: 10, 16657 slidesPerView: 4, 16658 freeMode: !0, 16659 watchSlidesVisibility: !0, 16660 watchSlidesProgress: !0 16661 }), 16662 galleryTop = new Swiper(".gallery-top-1", { 16663 spaceBetween: 10, 16664 navigation: { 16665 nextEl: ".swiper-button-next", 16666 prevEl: ".swiper-button-prev" 16667 }, 16668 thumbs: { 16669 swiper: galleryThumbs 16670 } 16671 }); 16672 16673function openNav() { 16674 $(".block-div").css("width", "100%"), $("body").css("overflow", "hidden"), $("#mySidenav").removeClass("is-closed-left") 16675} 16676 16677function openCartSidebar() { 16678 $(".block-div").css("width", "100%"), $("body").css("overflow", "hidden"), $(".shopping-cart-sidebar").removeClass("is-closed-right") 16679} 16680 16681function closeNav() { 16682 $(".block-div").css("width", "0%"), $("body").css("overflow", "unset"), $(".shopping-cart-sidebar").addClass("is-closed-right"), $("#mySidenav").addClass("is-closed-left") 16683} 16684$(document).ready(function() { 16685 var t = $("img#img_01"); 16686 t.ezPlus(), t.bind("click", function(t) { 16687 $("#img_01").data("ezPlus"); 16688 return !1 16689 }) 16690 }), $(document).ready(function() { 16691 jQuery(document).ready(function() { 16692 jQuery("#jquery-accordion-menu").jqueryAccordionMenu(), jQuery(".colors a").click(function() {
16693 "default" != $(this).attr("class") ? ($("#jquery-accordion-menu").removeClass(), $("#jquery-accordion-menu").addClass("jquery-accordion-menu").addClass($(this).attr("class"))) : ($("#jquery-accordion-menu").removeClass(), $("#jquery-accordion-menu").addClass("jquery-accordion-menu")) 16694 }) 16695 }) 16696 }), 16697 function(o, e) { 16698 var i = "jqueryAccordionMenu", 16699 n = { 16700 speed: 300, 16701 showDelay: 0, 16702 hideDelay: 0, 16703 singleOpen: !0, 16704 clickEffect: !0 16705 }; 16706 16707 function s(t, e) { 16708 this.element = t, this.settings = o.extend({}, n, e), this._defaults = n, this._name = i, this.init() 16709 } 16710 o.extend(s.prototype, { 16711 init: function() { 16712 this.openSubmenu(), this.submenuIndicators(), n.clickEffect && this.addClickEffect() 16713 }, 16714 openSubmenu: function() { 16715 o(this.element).children("ul").find("li").bind("click touchstart", function(t) { 16716 if (t.stopPropagation(), t.preventDefault(), 0 < o(this).children(".submenu").length) { 16717 if ("none" == o(this).children(".submenu").css("display")) return o(this).children(".submenu").show(n.speed), o(this).children(".submenu").siblings("a").addClass("submenu-indicator-minus"), n.singleOpen && (o(this).siblings().children(".submenu").hide(n.speed), o(this).siblings().children(".submenu").siblings("a").removeClass("submenu-indicator-minus")), !1; 16718 o(this).children(".submenu").delay(n.hideDelay).hide(n.speed), o(this).children(".submenu").siblings("a").hasClass("submenu-indicator-minus") && o(this).children(".submenu").siblings("a").removeClass("submenu-indicator-minus") 16719 } 16720 e.location.href = o(this).children("a").attr("href") 16721 }) 16722 }, 16723 submenuIndicators: function() { 16724 0 < o(this.element).find(".submenu").length && o(this.element).find(".submenu").siblings("a").append("<span class='submenu-indicator'>+</span>") 16725 }, 16726 addClickEffect: function() { 16727 var e, i, n; 16728 o(this.element).find("a > .submenu-indicator").on("click touchstart", function(t) { 16729 o(".ink").remove(), 0 === o(this).children(".ink").length && o(this).prepend("<span class='ink'></span>"), (e = o(this).find(".ink")).removeClass("animate-ink"), e.height() || e.width() || (n = Math.max(o(this).outerWidth(), o(this).outerHeight()), e.css({ 16730 height: n, 16731 width: n 16732 })), i = t.pageX - o(this).offset().left - e.width() / 2, n = t.pageY - o(this).offset().top - e.height() / 2, e.css({ 16733 top: n + "px", 16734 left: i + "px" 16735 }).addClass("animate-ink") 16736 }) 16737 } 16738 }), o.fn[i] = function(t) { 16739 return this.each(function() { 16740 o.data(this, "plugin_" + i) || o.data(this, "plugin_" + i, new s(this, t)) 16741 }), this 16742 } 16743 }(jQuery, window, document), document.addEventListener("DOMContentLoaded", function(t) { 16744 const e = document.querySelectorAll(".cart-button"); 16745 16746 function i() { 16747 this.classList.add("clicked") 16748 } 16749 e.forEach(t => { 16750 t.addEventListener("click", i) 16751 }) 16752 }); 16753var compareDate = new Date; 16754 16755function timeBetweenDates(t) { 16756 var e = t, 16757 i = new Date, 16758 n = e.getTime() - i.getTime(); 16759 n <= 0 ? clearInterval(timer) : (t = Math.floor(n / 1e3), e = Math.floor(t / 60), i = Math.floor(e / 60), n = Math.floor(i / 24), i %= 24, e %= 60, t %= 60, $("#days").text(n), $("#hours").text(i), $("#minutes").text(e), $("#seconds").text(t)) 16760} 16761compareDate.setDate(compareDate.getDate() + 7), timer = setInterval(function() { 16762 timeBetweenDates(compareDate) 16763}, 1e3), $(window).scroll(function() { 16764 50 < $(this).scrollTop() ? $(".back-to-top:hidden").stop(!0, !0).fadeIn() : $(".back-to-top").stop(!0, !0).fadeOut() 16765}), $(function() { 16766 $(".scroll").click(function() { 16767 return $("html,body").animate({ 16768 scrollTop: $(".sidenav").offset().top 16769 }, "1000"), !1 16770 }) 16771}), $("#newsletter-modal").on("show.bs.modal", function(t) { 16772 $(t.relatedTarget).data("whatever") 16773}); 16774swiper = new Swiper(".swiper-container-client", { 16775 loop: !0, 16776 loopedSlides: 10, 16777 autoheight: !0, 16778 slidesPerView: 2, 16779 spaceBetween: 30, 16780 autoplay: { 16781 delay: 6e3, 16782 disableOnInteraction: !1 16783 }, 16784 breakpoints: { 16785 600: { 16786 slidesPerView: 6, 16787 spaceBetween: 20 16788 } 16789 }, 16790 pagination: { 16791 el: ".swiper-pagination", 16792 clickable: !0 16793 } 16794}); 16795 16796function buildUrlParameterValue(t, e, i, n = "") { 16797 return t = "" != n ? getUrlParameter(t, n) : getUrlParameter(t), "add" == i ? (null == t ? t = e : t += "|" + e, t) : "remove" == i ? null != t ? ((t = t.split("|")).splice($.inArray(e, t), 1), t.join("|")) : "" : void 0 16798} 16799 16800function getUrlParameter(t, e = "") { 16801 if (t = t.replace(/\s+/g, "-"), "" != e) { 16802 if (!(-1 < e.indexOf("?"))) return; 16803 var i = e.substring(e.indexOf("?") + 1) 16804 } else i = window.location.search.substring(1); 16805 for (var n, o = i.split("&"), s = 0; s < o.length; s++) 16806 if ((n = o[s].split("="))[0] === t) return void 0 === n[1] || decodeURIComponent(n[1]) 16807} 16808 16809function checkUrlHasParam(t = "") { 16810 if (-1 < (t = "" == t ? window.location.href : t).indexOf("?")) return !0 16811} 16812 16813function setUrlParameter(t, e, i) { 16814 if (e = e.replace(/\s+/g, "-"), null == i || "" == i) return t.replace(new RegExp("[?&]" + e + "=[^&#]*(#.*)?$"), "$1").replace(new RegExp("([?&])" + e + "=[^&]*&"), "$1"); 16815 var n = new RegExp("\\b(" + e + "=).*?(&|#|$)"); 16816 return 0 <= t.search(n) ? t.replace(n, "$1" + i + "$2") : (t = t.replace(/[?#]$/, "")) + (0 < t.indexOf("?") ? "&" : "?") + e + "=" + i 16817} 16818jQuery(document).ready(function(e) { 16819 e("ul.color-style .default").click(function() { 16820 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/default.css"), !1 16821 }), e("ul.color-style .peach").click(function() { 16822 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/peach.css"), !1 16823 }), e("ul.color-style .yellow").click(function() { 16824 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/yellow.
16824css"), !1 16825 }), e("ul.color-style .green").click(function() { 16826 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/green.css"), !1 16827 }), e("ul.color-style .purple").click(function() { 16828 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/purple.css"), !1 16829 }), e("ul.color-style .red").click(function() { 16830 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/red.css"), !1 16831 }), e("ul.color-style .dark-blue").click(function() { 16832 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/dark-blue.css"), !1 16833 }), e("ul.color-style .orange").click(function() { 16834 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/orange.css"), !1 16835 }), e("ul.color-style .cyan-dark").click(function() { 16836 return e("#color-switcher").attr("href", base_url + "assets/front_end/classic/css/colors/cyan-dark.css"), !1 16837 }), e("ul.color-style li a").click(function(t) { 16838 t.preventDefault(), e(this).parent().parent().find("a").removeClass("active"), e(this).addClass("active") 16839 }), e("#colors-switcher .color-bottom a.settings").click(function(t) { 16840 t.preventDefault(), "-189px" === e("#colors-switcher").css(mode) ? e("#colors-switcher").animate({ 16841 [mode]: "0px" 16842 }) : e("#colors-switcher").animate({ 16843 [mode]: "-189px" 16844 }) 16845 }), e("#colors-switcher").animate({ 16846 [mode]: "-189px" 16847 }) 16848}
16848), $("#back_to_top").on("click", function() { 16849 $("html, body").animate({ 16850 scrollTop: 0 16851 }, "slow") 16852}), $("#per_page_products a").on("click", function(t) { 16853 t.preventDefault(); 16854 t = $(this).data("value"); 16855 $(this).parent().siblings("a.dropdown-toggle").text($(this).text()), location.href = setUrlParameter(location.href, "per-page", t) 16856}), $("#per_page_sellers a").on("click", function(t) { 16857 t.preventDefault(); 16858 t = $(this).data("value"); 16859 $(this).parent().siblings("a.dropdown-toggle").text($(this).text()), location.href = setUrlParameter(location.href, "per-page", t) 16860}), $("#product_sort_by").on("change", function(t) { 16861 t.preventDefault(); 16862 t = $(this).val(); 16863 location.href = setUrlParameter(location.href, "sort", t) 16864}), $("#seller_search").on("keyup", function(t) { 16865 t.preventDefault(); 16866 t = $(this).val(); 16867 location.href = setUrlParameter(location.href, "seller_search", t) 16868}), $(".sub-category").on("click", function(t) { 16869 t.preventDefault(); 16870 t = $(this).data("value"); 16871 custom_url = setUrlParameter(custom_url, "category", t), location.href = custom_url 16872}), $(document).on("change", ".product_attributes", function(t) { 16873 t.preventDefault(); 16874 getUrlParameter(e = "filter-" + (e = $(this).data("attribute"))); 16875 var e, t = $(this).val(); 16876 t = this.checked ? buildUrlParameterValue(e, t, "add", custom_url) : buildUrlParameterValue(e, t, "remove", custom_url), custom_url = setUrlParameter(custom_url, e, t) 16877}), $(".product_filter_btn").on("click", function(t) { 16878 t.preventDefault(), location.href = custom_url 16879}); 16880var filters, type_url = ""; 16881 16882function arrays_equal(t, e) { 16883 if (!Array.isArray(t) || !Array.isArray(e) || t.length !== e.length) return !1; 16884 var i = t.concat().sort(), 16885 n = e.concat().sort(); 16886 for (let t = 0; t < i.length; t++) 16887 if (i[t] !== n[t]) return !1; 16888 return !0 16889} 16890 16891function transaction_query_params(t) { 16892 return { 16893 transaction_type: "transaction", 16894 user_id: $("#transaction_user_id").val(), 16895 limit: t.limit, 16896 sort: t.sort, 16897 order: t.order, 16898 offset: t.offset, 16899 search: t.search 16900 } 16901} 16902 16903function customer_wallet_query_params(t) { 16904 return { 16905 transaction_type: "wallet", 16906 limit: t.limit, 16907 sort: t.sort, 16908 order: t.order, 16909 offset: t.offset, 16910 search: t.search 16911 } 16912} 16913 16914function print_filters(t, i = "", e) { 16915 var n, o, s, a, r, l, c = ""; 16916 "" != t && $.each(JSON.parse(t), function(t, e) { 16917 l = e.name.replace(" ", "-").toLowerCase(), l = decodeURIComponent(l), o = getUrlParameter("filter-" + l), s = null == o ? " " : "show", a = null != o ? o.split("|") : "", c += '<div class="card-custom"><div class="card-header-custom" id="h' + t + '"><h2 class="clearfix mb-0"><a class="collapse-arrow btn btn-link collapsed" data-toggle="collapse" data-target="#' + i + t + '" aria-expanded="true" aria-controls="#' + i + t + '">' + e.name + '<i class="fa fa-angle-down rotate"></i></a></h2></div><div id="' + i + t + '" class="collapse ' + s + '" aria-labelledby="h' + t + '" data-parent="#accordionExample"><div class="card-body-custom">', e.attribute_values_id.split(","), s = e.attribute_values.split(","), $.each(s, function(t, e) { 16918 r = -1 !== $.inArray(e, a) ? "checked" : "", c += '<div class="input-container d-flex"><input type="checkbox" name="' + e + '" value="' + e + '" class="toggle-input product_attributes" id="' + i + (n = l + " " + e) + '" data-attribute="' + l + '" ' + r + '><label class="toggle checkbox" for="' + i + n + '"><div class="toggle-inner"></div></label><label for="' + i + n + '" class="text-label">' + e + "</label></div>" 16919 }), c += "</div></div></div>" 16920 }), $(e).html(c) 16921} 16922type_url = setUrlParameter(custom_url, "type", null), $("#product_grid_view_btn").attr("href", type_url), type_url = setUrlParameter(custom_url, "type", "list"), $("#product_list_view_btn").attr("href", type_url), ("list" == getUrlParameter("type") ? $("#product_list_view_btn") : $("#product_grid_view_btn")).addClass("active"), $(".auth_model").on("click", function(t) { 16923 t.preventDefault(); 16924 t = $(this).data("value"); 16925 $("#forgot_password_div").addClass("hide"), "login" == t ? ($("#login_div").removeClass("hide"), $("#login").addClass("active"), $("#register_div").addClass("hide"), $("#register").removeClass("active")) : "register" == t && ($("#login_div").addClass("hide"), $("#login").removeClass("active"), $("#register_div").removeClass("hide"), $("#register").addClass("active")) 16926}), $(".attributes").on("change", function(t) { 16927 t.preventDefault(); 16928 var n, o, s = [], 16929 a = "", 16930 r = !1, 16931 e = [], 16932 l = [], 16933 c = [], 16934 d = [], 16935 u = [], 16936 h = []; 16937 $(".variants").each(function() { 16938 l = { 16939 price: $(this).data("price"), 16940 special_price: $(this).data("special_price") 16941 }, u.push($(this).data("id")), c.push(l), e = $(this).val().split(","), d.push(e), h.push($(this).data("image-index")) 16942 }), n = e.length, $(".attributes").each(function(t, e) { 16943 var i; 16944 $(this).prop("checked") && (s.push($(this).val()), s.length == n && (l = [], i = "", $.each(d, function(t, e) { 16945 arrays_equal(s, e) && (r = !0, l.push(c[t]), i = u[t], o = h[t]) 16946 }), r ? ($("#add_cart").attr("data-product-variant-id", i), galleryTop.slideTo(o, 500, !1), swiperF.slideTo(o, 500, !1), l[0].special_price < l[0].price && 0 != l[0].special_price ? (a = l[0].special_price, $("#price").html(currency + " " + a), $("#striped-price").html(currency + " " + l[0].price), $("#striped-price-div").show()) : (a = l[0].price, $("#price").html(currency + " " + a), $("#striped-price-div").hide()), $("#add_cart").removeAttr("disabled")) : (a = '<small class="text-danger h5">No Variant available!</small>', $("#price").html(a), $("#striped-price-div").hide(), $("#striped-price").html(""), $("#add_cart").attr("disabled", "true")))) 16947 }), d = "" 16948}), $(".add_to_cart").on("click", function(t) { 16949 t.preventDefault(); 16950 var e = $('[name="qty"]').val(); 16951 $("#quick-view").data("data-product-id", $(this).data("productId")); 16952 var i = $(this).attr("data-product-variant-id"), 16953 s = $(this).attr("data-min"), 16954 a = $(this).attr("data-max"), 16955 r = $(this).attr("data-step"), 16956 n = $(this), 16957 l = $(this).html(), 16958 t = $(this).attr("data-izimodal-open"); 16959 "" != t && null != t || $.ajax({ 16960 type: "POST", 16961 url: base_url + "cart/manage", 16962 data: { 16963 product_variant_id: i, 16964 qty: e, 16965 is_saved_for_later: !1, 16966 [csrfName]: csrfHash 16967 }, 16968 dataType: "json", 16969 beforeSend: function() { 16970 n.html("").text("").attr("disabled", !0) 16971 }, 16972 success: function(t) { 16973 var o; 16974 csrfName = t.csrfName, csrfHash = t.csrfHash, n.html(l).attr("disabled", !1), 0 == t.error ? (Toast.fire({ 16975 icon: "success", 16976 title: t.message 16977 }
16977), $("#cart-count").text(t.data.cart_count), o = "", $.each(t.data.items, function(t, e) { 16978 var i = void 0 !== e.product_variants.variant_values && null != e.product_variants.variant_values ? e.product_variants.variant_values : "", 16979 n = e.special_price < e.price && 0 != e.special_price ? e.special_price : e.price; 16980 o += '<div class="row"><div class="cart-product product-sm col-md-12"><div class="product-image"><img class="pic-1" src="' + base_url + e.image + '" alt="Not Found"></div><div class="product-details"><div class="product-title">' + e.name + "</div><span>" + i + '</span><p class="product-descriptions">' + e.short_description + '</p></div><div class="product-pricing d-flex py-2 px-1 w-100"><div class="product-price align-self-center">' + currency + " " + n + '</div><div class="product-sm-quantity px-1"><input type="number" class="form-input" value="' + e.qty + '" data-id="' + e.product_variant_id + '" data-price="' + n + '" min="' + s + '" max="' + a + '" step="' + r + '" ></div><div class="product-sm-removal align-self-center"><button class="remove-product button button-danger" data-id="' + e.product_variant_id + '"><i class="fa fa-trash"></i></button></div><div class="product-line-price align-self-center px-1">' + currency + " " + (e.qty * n).toLocaleString(void 0, { 16981 minimumFractionDigits: 2 16982 }) + "</div></div></div></div>" 16983 }), $("#cart-item-sidebar").html(o)) : Toast.fire({ 16984 icon: "error", 16985 title: t.message 16986 }) 16987 } 16988 }) 16989}), $(document).ready(function() { 16990 $(document).on("click", "#clear_cart", function() { 16991 confirm("Are you sure want to Clear Cart?") && $.ajax({ 16992 type: "POST", 16993 data: { 16994 [csrfName]: csrfHash 16995 }, 16996 url: base_url + "cart/clear", 16997 success: function(t) { 16998 csrfName = t.csrfName, csrfHash = t.csrfHash, location.reload() 16999 } 17000 }) 17001 }), $(document).on("click", "#checkout", function(t) { 17002 confirm("Are You Sure want to Checkout?") || t.preventDefault() 17003 }) 17004}), $(".quick-view-btn").on("click", function() { 17005 $("#quick-view").data("data-product-id", $(this).data("productId")) 17006}), $(".save-for-later").on("click", function(t) { 17007 t.preventDefault(); 17008 var e = new FormData, 17009 i = $(this).data("id"), 17010 t = $(this).parent().siblings(".item-quantity").find(".itemQty").val(); 17011 $(this); 17012 e.append(csrfName, csrfHash), e.append("product_variant_id", i), e.append("is_saved_for_later", 1), e.append("qty", t), $.ajax({ 17013 type: "POST", 17014 url: base_url + "cart/manage", 17015 data: e, 17016 cache: !1, 17017 contentType: !1, 17018 processData: !1, 17019 dataType: "json", 17020 success: function(t) { 17021 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? window.location.reload() : Toast.fire({ 17022 icon: "error", 17023 title: t.message 17024 }) 17025 } 17026 }) 17027}), $(".move-to-cart").on("click", function(t) { 17028 t.preventDefault(); 17029 var e = new FormData, 17030 i = $(this).data("id"), 17031 t = $(this).parent().parent().siblings(".itemQty").text(); 17032 $(this); 17033 e.append(csrfName, csrfHash), e.append("product_variant_id", i), e.append("is_saved_for_later", 0), e.append("qty", t), $.ajax({ 17034 type: "POST", 17035 url: base_url + "cart/manage", 17036 data: e, 17037 cache: !1, 17038 contentType: !1, 17039 processData: !1, 17040 dataType: "json", 17041 success: function(t) { 17042 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? window.location.reload() : Toast.fire({ 17043 icon: "error", 17044 title: t.message 17045 }) 17046 } 17047 }) 17048}), $(".update-order-item").on("click", function(t) { 17049 t.preventDefault(); 17050 var e = new FormData, 17051 i = $(this).data("item-id"), 17052 t = $(this).data("status"), 17053 n = $(this), 17054 o = n.text(); 17055 e.append(csrfName, csrfHash), e.append("order_item_id", i), e.append("status", t), $.ajax({ 17056 type: "POST", 17057 url: base_url + "my-account/update-order-item-status", 17058 data: e, 17059 cache: !1, 17060 contentType: !1, 17061 processData: !1, 17062 dataType: "json", 17063 beforeSend: function() { 17064 n.html("Please Wait").attr("disabled", !0) 17065 }, 17066 success: function(t) { 17067 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (Toast.fire({ 17068 icon: "success", 17069 title: t.message 17070 }), setTimeout(function() { 17071 window.location.reload() 17072 }, 3e3)) : Toast.fire({ 17073 icon: "error", 17074 title: t.message 17075 }), n.html(o).attr("disabled", !1) 17076 } 17077 }) 17078}), $(".update-order").on("click", function(t) { 17079 t.preventDefault(); 17080 var e, i, n = new FormData, 17081 o = $(this).data("order-id"), 17082 s = $(this).data("status"), 17083 t = "", 17084 t = "cancelled" == s ? "Cancel" : "Return"; 17085 confirm("Are you sure you want to " + t + " this order ?") && (e = $(this), i = e.text(), n.append(csrfName, csrfHash), n.append("order_id", o), n.append("status", s), $.ajax({ 17086 type: "POST", 17087 url: base_url + "my-account/update-order", 17088 data: n, 17089 cache: !1, 17090 contentType: !1, 17091 processData: !1, 17092 dataType: "json", 17093 beforeSend: function() { 17094 e.html("Please Wait").attr("disabled", !0) 17095 }, 17096 success: function(t) { 17097 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (Toast.fire({ 17098 icon: "success", 17099 title: t.message 17100 }), setTimeout(function() { 17101 window.location.reload() 17102 }, 3e3)) : Toast.fire({ 17103 icon: "error", 17104 title: t.message 17105 }), e.html(i).attr("disabled", !1) 17106 } 17107 })) 17108}), $("#add-address-form").on("submit", function(t) { 17109 t.preventDefault(); 17110 t = new FormData(this); 17111 t.append(csrfName, csrfHash), $.ajax({ 17112 type: "POST", 17113 data: t, 17114 url: $(this).attr("action"), 17115 dataType: "json", 17116 cache: !1, 17117 contentType: !1, 17118 processData: !1, 17119 beforeSend: function() { 17120 $("#save-address-submit-btn").val("Please Wait...").attr("disabled", !0) 17121 }, 17122 success: function(t) { 17123 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? ($("#save-address-result").html("<div class='alert alert-success'>" + t.message + "</div>").delay(1500).fadeOut(), $("#add-address-form")[0].reset(), $("#address_list_table").bootstrapTable("refresh")) : $("#save-address-result").html("<div class='alert alert-danger'>" + t.message + "</div>").delay(1500).fadeOut(), $("#save-address-submit-btn").val("Save").attr("disabled", !1) 17124 } 17125 }) 17126}), $("#city").on("change", function(t) { 17127 t.preventDefault(), $.ajax({ 17128 type: "POST", 17129 data: { 17130 city_id: $(this).val(), 17131 [csrfName]: csrfHash 17132 }, 17133 url: base_url + "my-account/get-areas", 17134 dataType: "json", 17135 success: function(t) { 17136 var i; 17137 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (i = "", i += '<option value="">--Select Area--</option>', $.each(t.data, function(t, e) { 17138 i += "<option value=" + e.id + ">" + e.name + "</option>" 17139 }), $("#area").html(i)) : (Toast.fire({ 17140 icon: "error", 17141 title: t.message 17142 }), $("#area").html("")) 17143 } 17144 }) 17145}), $("#area").on("change", function(t) { 17146 t.preventDefault(), $.ajax({ 17147 type: "POST", 17148 data: { 17149 area_id: $(this).val(), 17150 [csrfName]: csrfHash 17151 }, 17152 url: base_url + "my-account/get-zipcode", 17153 dataType: "json", 17154 success: function(t) { 17155 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? $("#pincode").val(t.data[0].zipcode) : Toast.fire({ 17156 icon: "error", 17157 title: t.message 17158 }) 17159 } 17160 }) 17161}
17161), $("#edit-address-form").on("submit", function(t) { 17162 t.preventDefault(); 17163 t = new FormData(this); 17164 t.append(csrfName, csrfHash), $.ajax({ 17165 type: "POST", 17166 data: t, 17167 url: $(this).attr("action"), 17168 dataType: "json", 17169 cache: !1, 17170 contentType: !1, 17171 processData: !1, 17172 beforeSend: function() { 17173 $("#edit-address-submit-btn").val("Please Wait...").attr("disabled", !0) 17174 }, 17175 success: function(t) { 17176 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? ($("#edit-address-result").html("<div class='alert alert-success'>" + t.message + "</div>").delay(1500).fadeOut(), $("#edit-address-form")[0].reset(), $("#address_list_table").bootstrapTable("refresh"), setTimeout(function() { 17177 $("#address-modal").modal("hide") 17178 }, 2e3)) : $("#edit-address-result").html("<div class='alert alert-danger'>" + t.message + "</div>").delay(1500).fadeOut(), $("#edit-address-submit-btn").val("Save").attr("disabled", !1) 17179 } 17180 }) 17181}), $(document).on("click", ".delete-address", function(t) { 17182 t.preventDefault(), confirm("Are you sure ? You want to delete this address?") && $.ajax({ 17183 type: "POST", 17184 data: { 17185 id: $(this).data("id"), 17186 [csrfName]: csrfHash 17187 }, 17188 url: base_url + "my-account/delete-address", 17189 dataType: "json", 17190 success: function(t) { 17191 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? $("#address_list_table").bootstrapTable("refresh") : Toast.fire({ 17192 icon: "error", 17193 title: t.message 17194 }) 17195 } 17196 }) 17197}), $(document).on("click", ".default-address", function(t) { 17198 t.preventDefault(), confirm("Are you sure ? You want to set this address as default?") && $.ajax({ 17199 type: "POST", 17200 data: { 17201 id: $(this).data("id"), 17202 [csrfName]: csrfHash 17203 }, 17204 url: base_url + "my-account/set-default-address", 17205 dataType: "json", 17206 success: function(t) { 17207 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? ($("#address_list_table").bootstrapTable("refresh"), Toast.fire({ 17208 icon: "success", 17209 title: t.message 17210 })) : Toast.fire({ 17211 icon: "error", 17212 title: t.message 17213 }) 17214 } 17215 }) 17216}), $(document).on("click", "#forgot_password_link", function(t) { 17217 t.preventDefault(), $(".auth-modal").find("header a").removeClass("active"), $("#forgot_password_div").removeClass("hide").siblings("section").addClass("hide"), $("#recaptcha-container-2").html(""), window.recaptchaVerifier = new firebase.auth.RecaptchaVerifier("recaptcha-container-2"), window.recaptchaVerifier.render().then(function(t) { 17218 grecaptcha.reset(t) 17219 }), $("#forgot_password_number").intlTelInput({ 17220 allowExtensions: !0, 17221 formatOnDisplay: !0, 17222 autoFormat: !0, 17223 autoHideDialCode: !0, 17224 autoPlaceholder: !0, 17225 defaultCountry: "in", 17226 ipinfoToken: "yolo", 17227 nationalMode: !1, 17228 numberType: "MOBILE", 17229 preferredCountries: ["in", "ae", "qa", "om", "bh", "kw", "ma"], 17230 preventInvalidNumbers: !0, 17231 separateDialCode: !0, 17232 initialCountry: "auto", 17233 geoIpLookup: function(e) { 17234 $.get("https://ipinfo.io", function() {}, "jsonp").always(function(t) { 17235 t = t && t.country ? t.country : ""; 17236 e(t) 17237 }) 17238 }, 17239 utilsScript: "https://cdnjs.cloudflare.com/ajax/libs/intl-tel-input/11.0.9/js/utils.js" 17240 }) 17241}), $(document).on("submit", "#send_forgot_password_otp_form", function(t) { 17242 t.preventDefault(); 17243 var e = $("#forgot_password_send_otp_btn").html(); 17244 $("#forgot_password_send_otp_btn").html("Please Wait...").attr("disabled", !0); 17245 var i = $(".selected-dial-code").html() + $("#forgot_password_number").val(), 17246 n = is_user_exist($("#forgot_password_number").val()); 17247 0 == n.error ? ($("#forgot_pass_error_box").html("You have not registered using this number."), $("#forgot_password_send_otp_btn").html(e).attr("disabled", !1)) : (t = window.recaptchaVerifier, firebase.auth().signInWithPhoneNumber(i, t).then(function(o) { 17248 resetRecaptcha(), $("#verify_forgot_password_otp_form").removeClass("d-none"), $("#send_forgot_password_otp_form").hide(), $("#forgot_pass_error_box").html(n.message), $("#forgot_password_send_otp_btn").html(e).attr("disabled", !1), $(document).on("submit", "#verify_forgot_password_otp_form", function(t) { 17249 t.preventDefault(); 17250 var e = $("#reset_password_submit_btn").html(), 17251 t = $("#forgot_password_otp").val(), 17252 i = new FormData(this), 17253 n = base_url + "home/reset-password"; 17254 $("#reset_password_submit_btn").html("Please Wait...").attr("disabled", !0), o.confirm(t).then(function(t) { 17255 i.append(csrfName, csrfHash), i.append("mobile", $("#forgot_password_number").val()), $.ajax({ 17256 type: "POST", 17257 url: n, 17258 data: i, 17259 processData: !1, 17260 contentType: !1, 17261 cache: !1, 17262 dataType: "json", 17263 beforeSend: function() { 17264 $("#reset_password_submit_btn").html("Please Wait...").attr("disabled", !0) 17265 }, 17266 success: function(t) { 17267 csrfName = t.csrfName, csrfHash = t.csrfHash, $("#reset_password_submit_btn").html(e).attr("disabled", !1), $("#set_password_error_box").html(t.message).show(), 0 == t.error && setTimeout(function() { 17268 window.location.reload() 17269 }, 2e3) 17270 } 17271 }) 17272 }).catch(function(t) { 17273 $("#reset_password_submit_btn").html(e).attr("disabled", !1), $("#set_password_error_box").html("Invalid OTP. Please Enter Valid OTP").show() 17274 }) 17275 }) 17276 }).catch(function(t) { 17277 $("#forgot_pass_error_box").html(t.message).show(), $("#forgot_password_send_otp_btn").html(e).attr("disabled", !1), resetRecaptcha() 17278 })) 17279}), $("#contact-us-form").on("submit", function(t) { 17280 t.preventDefault(); 17281 var e = $("#contact-us-submit-btn").html(), 17282 t = new FormData(this); 17283 t.append(csrfName, csrfHash), $.ajax({ 17284 type: "POST", 17285 data: t, 17286 url: $(this).attr("action"), 17287 dataType: "json", 17288 cache: !1, 17289 contentType: !1, 17290 processData: !1, 17291 beforeSend: function() { 17292 $("#contact-us-submit-btn").html("Please Wait...").attr("disabled", !0) 17293 }, 17294 success: function(t) { 17295 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (Toast.fire({ 17296 icon: "success", 17297 title: t.message 17298 }), $("#contact-us-form")[0].reset()) : Toast.fire({ 17299 icon: "error", 17300 title: t.message 17301 }), $("#contact-us-submit-btn").html(e).attr("disabled", !1) 17302 } 17303 }) 17304}), $("#product-rating-form").on("submit", function(t) { 17305 t.preventDefault(); 17306 var e = $("#rating-submit-btn").html(), 17307 t = new FormData(this); 17308 t.append(csrfName, csrfHash), $.ajax({ 17309 type: "POST", 17310 data: t, 17311 url: $(this).attr("action"), 17312 dataType: "json", 17313 cache: !1, 17314 contentType: !1, 17315 processData: !1, 17316 beforeSend: function() { 17317 $("#rating-submit-btn").html("Please Wait...").attr("disabled", !0) 17318 }, 17319 success: function(t) { 17320 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (Toast.fire({ 17321 icon: "success", 17322 title: t.message 17323 }), $("#product-rating-form")[0].reset(), window.location.reload()) : Toast.fire({ 17324 icon: "error", 17325 title: t.message 17326 }), $("#rating-submit-btn").html(e).attr("disabled", !1) 17327 } 17328 }) 17329}), $("#delete_rating").on("click", function(t) { 17330 t.preventDefault(), confirm("Are you sure want to Delete Rating ?") && (t = $(this).data("rating-id"), $.ajax({ 17331 type: "POST", 17332 data: { 17333 [csrfName]: csrfHash, 17334 rating_id: t 17335 }, 17336 url: $(this).attr("href"), 17337 dataType: "json", 17338 success: function(t) { 17339 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (Toast.fire({ 17340 icon: "success", 17341 title: t.message 17342 }), $("#delete_rating").parent().parent().parent().remove(), $("#no_ratings").text(t.data.rating[0].no_of_rating)) : Toast.fire({ 17343 icon: "error", 17344 title: t.message 17345 }) 17346 } 17347 })) 17348}), $("#edit_link").on("click", function(t) { 17349 t.preventDefault(), $("#rating-box").removeClass("d-none") 17350}
17350), $("#load-user-ratings").on("click", function(t) { 17351 t.preventDefault(); 17352 var e = $(this).attr("data-limit"), 17353 i = $(this).attr("data-offset"), 17354 t = $(this).attr("data-product"), 17355 n = $(this).html(), 17356 o = $(this), 17357 s = ""; 17358 $.ajax({ 17359 type: "GET", 17360 data: { 17361 limit: e, 17362 offset: i, 17363 product_id: t 17364 }, 17365 url: base_url + "products/get-rating", 17366 dataType: "json", 17367 beforeSend: function() { 17368 $(this).html("Please wait..").attr("disabled", !0) 17369 }, 17370 success: function(t) { 17371 $(this).html(n).attr("disabled", !1), 0 == t.error ? ($.each(t.data.product_rating, function(t, e) { 17372 s += '<li class="review-container"><div class="review-image"><img src="' + base_url + 'assets/front_end/modern/images/user.png" alt="" width="65" height="65"></div><div class="review-comment"><div class="rating-list"><div class="product-rating"><input type="text" class="kv-fa" value="' + e.rating + '" data-size="xs" title="" readonly></div></div><div class="review-info"><h4 class="reviewer-name">' + e.user_name + '</h4> <span class="review-date text-muted">' + e.data_added + '</span></div><div class="review-text"><p class="text-muted">' + e.comment + '</p></div><div class="row reviews">', $.each(e.images, function(t, e) { 17373 s += '<div class="col-md-2"><div class="review-box"><a href="' + e + '" data-lightbox="review-images"><img src="' + e + '" alt="' + e + '"></a></div></div>' 17374 }), s += "</div></div></li>" 17375 }), i += e, $("#review-list").append(s), $(".kv-fa").rating("create", { 17376 filledStar: '<i class="fas fa-star"></i>', 17377 emptyStar: '<i class="far fa-star"></i>', 17378 size: "xs", 17379 showCaption: !1 17380 }), o.attr("data-offset", i)) : Toast.fire({ 17381 icon: "error", 17382 title: t.message 17383 }) 17384 } 17385 }) 17386}), $("#edit_city").on("change", function(t, o) { 17387 t.preventDefault(); 17388 var s = $(this).val(); 17389 $.ajax({ 17390 type: "POST", 17391 data: { 17392 city_id: $(this).val(), 17393 [csrfName]: csrfHash 17394 }, 17395 url: base_url + "my-account/get-areas", 17396 dataType: "json", 17397 success: function(t) { 17398 var n; 17399 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? (n = "", $.each(t.data, function(t, e) { 17400 var i = e.city_id == s && e.id == o ? "selected" : ""; 17401 n += "<option value=" + e.id + " " + i + ">" + e.name + "</option>" 17402 }), $("#edit_area").html(n)) : (Toast.fire({ 17403 icon: "error", 17404 title: t.message 17405 }), $("#edit_area").html("")) 17406 } 17407 }) 17408}), $("#edit_area").on("change", function(t, e) { 17409 t.preventDefault(); 17410 e = "" == e || "undefined" == e ? $(this).val() : e; 17411 $.ajax({ 17412 type: "POST", 17413 data: { 17414 area_id: e, 17415 [csrfName]: csrfHash 17416 }, 17417 url: base_url + "my-account/get-zipcode", 17418 dataType: "json", 17419 success: function(t) { 17420 csrfName = t.csrfName, csrfHash = t.csrfHash, 0 == t.error ? $("#edit_pincode").val(t.data[0].zipcode) : Toast.fire({ 17421 icon: "error", 17422 title: t.message 17423 }) 17424 } 17425 }) 17426}), $("#product-filters").length && (checkUrlHasParam() && null != sessionStorage.getItem($("#product-filters").data("key")) || sessionStorage.setItem($("#product-filters").data("key"), $("#product-filters").val()), print_filters(filters = (filters = sessionStorage.getItem($("#product-filters").data("key"))).replace(/\\/g, ""), "Desktop", "#product-filters-desktop"), print_filters(filters, "Mobile", "#product-filters-mobile")), $(document).on("closed", "#quick-view", function(t) { 17427 $("#modal-product-special-price").html("") 17428}), window.addEventListener("load", addDarkmodeWidget); 17429const options = { 17430 time: "0.5s", 17431 mixColor: "#fff", 17432 backgroundColor: "#fff", 17433 buttonColorDark: "#100f2c", 17434 buttonColorLight: "#fff", 17435 label: "ð", 17436 autoMatchOsTheme: !1 17437}; 17438 17439function addDarkmodeWidget() { 17440 new Darkmode(options).showWidget() 17441} 17442$(document).ready(function() { 17443 navigator.geolocation && navigator.geolocation.getCurrentPosition(function(t) { 17444 var e = t.coords.latitude, 17445 t = t.coords.longitude; 17446 sessionStorage.setItem("latitude", e), sessionStorage.setItem("longitude", t) 17447 }, function(t) { 17448 switch (t.code) { 17449 case t.PERMISSION_DENIED: 17450 null !== sessionStorage.getItem("latitude") && sessionStorage.removeItem("latitude"), null !== sessionStorage.getItem("longitude") && sessionStorage.removeItem("longitude"); 17451 break; 17452 case t.POSITION_UNAVAILABLE: 17453 console.log("Location information is unavailable."); 17454 break; 17455 case t.TIMEOUT: 17456 console.log("The request to get user location timed out."); 17457 break; 17458 case t.UNKNOWN_ERROR: 17459 console.log("An unknown error occurred.") 17460 } 17461 }) 17462}), $("#send_bank_receipt_form").on("submit", function(t) { 17463 t.preventDefault(); 17464 t = new FormData(this); 17465 t.append(csrfName, csrfHash), $.ajax({ 17466 type: "POST", 17467 url: $(this).attr("action"), 17468 data: t, 17469 beforeSend: function() { 17470 $("#submit_btn").html("Please Wait..").attr("disabled", !0) 17471 }, 17472 cache: !1, 17473 contentType: !1, 17474 processData: !1, 17475 dataType: "json", 17476 success: function(t) { 17477 csrfHash = t.csrfHash, $("#submit_btn").html("Send").attr("disabled", !1), 0 == t.error ? ($("table").bootstrapTable("refresh"), Toast.fire({ 17478 icon: "success", 17479 title: t.message 17480 }), window.location.reload()) : Toast.fire({ 17481 icon: "error", 17482 title: t.message 17483 }) 17484 } 17485 }) 17486}), $(document).ready(function() { 17487 $(".hrDiv").length && ($(".hrDiv p").addClass("hrDiv"), $("div").css({ 17488 "font-size": "", 17489 font: "" 17490 })) 17491}), $("#validate-zipcode-form").on("submit", function(t) { 17492 t.preventDefault(); 17493 t = new FormData(this); 17494 t.append(csrfName, csrfHash), $.ajax({ 17495 type: "POST", 17496 url: base_url + "products/check_zipcode", 17497 data: t, 17498 beforeSend: function() { 17499 $("#validate_zipcode").html("Please Wait..").attr("disabled", !0) 17500 }, 17501 cache: !1, 17502 contentType: !1, 17503 processData: !1, 17504 dataType: "json", 17505 success: function(t) { 17506 csrfHash = t.csrfHash, $("#validate_zipcode").html("Check Availability").attr("disabled", !1), 0 == t.error ? $("#add_cart").removeAttr("disabled") : $("#add_cart").attr("disabled", "true"), $("#error_box").html(t.message) 17507 } 17508 }) 17509}), $(document).on("submit", ".validate_zipcode_quick_view", function(t) { 17510 t.preventDefault(); 17511 t = new FormData(this); 17512 t.append(csrfName, csrfHash), $.ajax({ 17513 type: "post", 17514 url: base_url + "products/check-zipcode", 17515 data: t, 17516 beforeSend: function() { 17517 $("#validate_zipcode").html("Please Wait..").attr("disabled", !0) 17518 }, 17519 cache: !1, 17520 contentType: !1, 17521 processData: !1, 17522 dataType: "json", 17523 success: function(t) { 17524 csrfHash = t.csrfHash, $("#validate_zipcode").html("Check Availability").attr("disabled", !1), 0 == t.error ? $("#modal
17524-add-to-cart-button").removeAttr("disabled") : $("#modal-add-to-cart-button").attr("disabled", "true"), $("#error_box1").html(t.message) 17525 } 17526 }) 17527});
Line numbers count LF bytes from the start of the resource, as the search results do. Vendor segments are library code the classifier recognised; they are stored but not indexed. Bytes are shown as Latin1 characters, one per byte.