1jQuery(document).ready(function($) { 2"use strict"; 3 4 // Fly-Out Navigation 5 $(".mvp-fly-but-click").on('click', function(){ 6 $("#mvp-fly-wrap").toggleClass("mvp-fly-menu"); 7 $("#mvp-fly-wrap").toggleClass("mvp-fly-shadow"); 8 $(".mvp-fly-but-wrap").toggleClass("mvp-fly-open"); 9 $(".mvp-fly-fade").toggleClass("mvp-fly-fade-trans"); 10 }); 11 12 // Back to Top Button 13 var duration = 500; 14 $('.back-to-top').on('click', function(event) { 15 event.preventDefault(); 16 $('html, body').animate({scrollTop: 0}, duration); 17 return false; 18 }); 19 20 // Search Toggle 21 $(".mvp-search-click").on('click', function(){ 22 $("#mvp-search-wrap").toggleClass("mvp-search-toggle"); 23 }); 24 25 // Mobile Social Toggle 26 $(".mvp-mob-soc-click").on('click', function(){ 27 $(".mvp-mob-soc-list").toggleClass("mvp-mob-soc-tog"); 28 }); 29 30 // Trending Toggle 31 $(".mvp-post-trend-but-click").on('click', function(){ 32 $("#mvp-post-trend-wrap").toggleClass("mvp-post-trend-tog"); 33 }); 34 35 // Comments Toggle 36 $(".mvp-com-click").on('click', function(){ 37 $("#comments").show(); 38 $("#disqus_thread").show(); 39 $("#mvp-comments-button").hide(); 40 }); 41 42 // Continue Reading Toggle 43 $(".mvp-ad-rel-click").on('click', function(){ 44 $("#mvp-content-main").css('max-height','none'); 45 $('#mvp-ad-rel-wrap').css('margin-top','20px'); 46 $("#mvp-ad-rel-top").hide(); 47 }); 48 49 // Columns Toggle 50 $('.mvp-feat1-right-wrap').each(function() { 51 $(this).find(".mvp-tab-col-cont").hide(); //Hide all content 52 $(this).find("ul.mvp-feat1-list-buts li.mvp-feat-col-tab").addClass("active").show(); //Activate first tab 53 $(this).find(".mvp-tab-col-cont:first").show(); //Show first tab content 54 }); 55 56 $("ul.mvp-feat1-list-buts li").on('click', function(e) { 57 $(this).parents('.mvp-feat1-right-wrap').find("ul.mvp-feat1-list-buts li").removeClass("active"); //Remove any "active" class 58 $(this).addClass("active"); //Add "active" class to selected tab 59 $(this).parents('.mvp-feat1-right-wrap').find(".mvp-tab-col-cont").hide(); //Hide all tab content 60 61 var activeTab = $(this).find("a").attr("href"); //Find the href attribute value to identify the active tab + content 62 $(this).parents('.mvp-feat1-right-wrap').find(activeTab).fadeIn(); //Fade in the active ID content 63 64 e.preventDefault(); 65 }); 66 67 $("ul.mvp-feat1-list-buts li a").on('click', function(e) { 68 e.preventDefault(); 69 }); 70 71 // Widget Columns Toggle 72 $('.mvp-widget-tab-wrap').each(function() { 73 $(this).find(".mvp-tab-col-cont").hide(); //Hide all content 74 $(this).find("ul.mvp-feat1-list-buts li.mvp-feat-col-tab").addClass("active").show(); //Activate first tab 75 $(this).find(".mvp-tab-col-cont:first").show(); //Show first tab content 76 }); 77 78 $("ul.mvp-feat1-list-buts li").on('click', function(e) { 79 $(this).parents('.mvp-widget-tab-wrap').find("ul.mvp-feat1-list-buts li").removeClass("active"); //Remove any "active" class 80 $(this).addClass("active"); //Add "active" class to selected tab 81 $(this).parents('.mvp-widget-tab-wrap').find(".mvp-tab-col-cont").hide(); //Hide all tab content 82 83 var activeTab = $(this).find("a").attr("href"); //Find the href attribute value to identify the active tab + content 84 $(this).parents('.mvp-widget-tab-wrap').find(activeTab).fadeIn(); //Fade in the active ID content 85 86 e.preventDefault(); 87 }); 88 89 $("ul.mvp-feat1-list-buts li a").on('click', function(e) { 90 e.preventDefault(); 91 }); 92 93}); 94 95 96 // Scoreboard 97 98(function( window, $, undefined ) { 99 100 $.fn.touchwipe = function(settings) { 101 102 var config = { 103 min_move_x: 20, 104 min_move_y: 20, 105 wipeLeft: function() { }, 106 wipeRight: function() { }, 107 wipeUp: function() { }, 108 wipeDown: function() { }, 109 preventDefaultEvents: true 110 }; 111 112 if (settings) $.extend(config, settings); 113 114 this.each(function() { 115 var startX; 116 var startY; 117 var isMoving = false; 118 119 function cancelTouch() { 120 this.removeEventListener('touchmove', onTouchMove); 121 startX = null; 122 isMoving = false; 123 } 124 125 function onTouchMove(e) { 126 if(config.preventDefaultEvents) { 127 e.preventDefault(); 128 } 129 if(isMoving) { 130 var x = e.touches[0].pageX; 131 var y = e.touches[0].pageY; 132 var dx = startX - x; 133 var dy = startY - y; 134 if(Math.abs(dx) >= config.min_move_x) { 135 cancelTouch(); 136 if(dx > 0) { 137 config.wipeLeft(); 138 } 139 else { 140 config.wipeRight(); 141 } 142 } 143 else if(Math.abs(dy) >= config.min_move_y) { 144 cancelTouch(); 145 if(dy > 0) { 146 config.wipeDown(); 147 } 148 else { 149 config.wipeUp(); 150 } 151 } 152 } 153 } 154 155 function onTouchStart(e) 156 { 157 if (e.touches.length == 1) { 158 startX = e.touches[0].pageX; 159 startY = e.touches[0].pageY; 160 isMoving = true; 161 this.addEventListener('touchmove', onTouchMove, false); 162 } 163 } 164 if ('ontouchstart' in document.documentElement) { 165 this.addEventListener('touchstart', onTouchStart, false); 166 } 167 }); 168 169 return this; 170 }; 171 172 $.elastislide = function( options, element ) { 173 this.$el = $( element ); 174 this._init( options ); 175 }; 176 177 $.elastislide.defaults = { 178 speed : 450, // animation speed 179 easing : '', // animation easing effect 180 imageW : 190, // the images width 181 margin : 0, // image margin right 182 border : 0, // image border 183 minItems : 1, // the minimum number of items to show. 184 // when we resize the window, this will make sure minItems are always shown 185 // (unless of course minItems is higher than the total number of elements) 186 current : 0, // index of the current item 187 // when we resize the window, the carousel will make sure this item is visible 188 onClick : function() { return false; } // click item callback 189 }; 190 191 $.elastislide.prototype = { 192 _init : function( options ) { 193 194 this.options = $.extend( true, {}, $.elastislide.defaults, options ); 195 196 // <ul> 197 this.$slider = this.$el.find('ul'); 198 199 // <li> 200 this.$items = this.$slider.children('li'); 201 202 // total number of elements / images 203 this.itemsCount = this.$items.length; 204 205 // cache the <ul>'s parent, since we will eventually need to recalculate its width on window resize 206 this.$esCarousel = this.$slider.parent(); 207 208 // validate options
209 this._validateOptions(); 210 211 // set sizes and initialize some vars... 212 this._configure(); 213 214 // add navigation buttons 215 this._addControls(); 216 217 // initialize the events 218 this._initEvents(); 219 220 // show the <ul> 221 this.$slider.show(); 222 223 // slide to current's position 224 this._slideToCurrent( false ); 225 226 }, 227 _validateOptions : function() { 228 229 if( this.options.speed < 0 ) 230 this.options.speed = 450; 231 if( this.options.margin < 0 ) 232 this.options.margin = 4; 233 if( this.options.border < 0 ) 234 this.options.border = 1; 235 if( this.options.minItems < 1 || this.options.minItems > this.itemsCount ) 236 this.options.minItems = 1; 237 if( this.options.current > this.itemsCount - 1 ) 238 this.options.current = 0; 239 240 }, 241 _configure : function() { 242 243 // current item's index 244 this.current = this.options.current; 245 246 // the ul's parent's (div.es-carousel) width is the "visible" width 247 this.visibleWidth = this.$esCarousel.width(); 248 249 // test to see if we need to initially resize the items 250 if( this.visibleWidth < this.options.minItems * ( this.options.imageW + 2 * this.options.border ) + ( this.options.minItems - 1 ) * this.options.margin ) { 251 this._setDim( ( this.visibleWidth - ( this.options.minItems - 1 ) * this.options.margin ) / this.options.minItems ); 252 this._setCurrentValues();
253 // how many items fit with the current width 254 this.fitCount = this.options.minItems; 255 } 256 else { 257 this._setDim(); 258 this._setCurrentValues(); 259 } 260 261 // set the <ul> width 262 this.$slider.css({ 263 width : this.sliderW 264 }); 265 266 }, 267 _setDim : function( elW ) { 268 269 // <li> style 270 this.$items.css({ 271 marginRight : this.options.margin, 272 width : ( elW ) ? elW : this.options.imageW + 2 * this.options.border 273 }).children('a').css({ // <a> style 274 borderWidth : this.options.border 275 }); 276 277 }, 278 _setCurrentValues : function() { 279 280 // the total space occupied by one item 281 this.itemW = this.$items.outerWidth(true); 282 283 // total width of the slider / <ul> 284 // this will eventually change on window resize 285 this.sliderW = this.itemW * this.itemsCount; 286 287 // the ul parent's (div.es-carousel) width is the "visible" width 288 this.visibleWidth = this.$esCarousel.width(); 289 290 // how many items fit with the current width 291 this.fitCount = Math.floor( this.visibleWidth / this.itemW ); 292 293 }, 294 _addControls : function() { 295 296 this.$navNext = $('<span class="es-nav-next"><a>></a></span>'); 297 this.$navPrev = $('<span class="es-nav-prev"><a><</a></span>'); 298 $('<div class="es-nav"/>') 299 .append( this.$navPrev ) 300 .append( this.$navNext ) 301 .appendTo( this.$el ); 302 303 //this._toggleControls(); 304 305 }, 306 _toggleControls : function( dir, status ) { 307 308 // show / hide navigation buttons 309 if( dir && status ) { 310 if( status === 1 ) 311 ( dir === 'right' ) ? this.$navNext.show() : this.$navPrev.show(); 312 else 313 ( dir === 'right' ) ? this.$navNext.hide() : this.$navPrev.hide(); 314 } 315 else if( this.current === this.itemsCount - 1 || this.fitCount >= this.itemsCount ) 316 this.$navNext.hide(); 317 318 }, 319 _initEvents : function() { 320 321 var instance = this; 322 323 // window resize 324 $(window).bind('resize.elastislide', function( event ) { 325 326 // set values again 327 instance._setCurrentValues();
328 329 // need to resize items 330 if( instance.visibleWidth < instance.options.minItems * ( instance.options.imageW + 2 * instance.options.border ) + ( instance.options.minItems - 1 ) * instance.options.margin ) { 331 instance._setDim( ( instance.visibleWidth - ( instance.options.minItems - 1 ) * instance.options.margin ) / instance.options.minItems ); 332 instance._setCurrentValues(); 333 instance.fitCount = instance.options.minItems; 334 } 335 else{ 336 instance._setDim(); 337 instance._setCurrentValues(); 338 } 339 340 instance.$slider.css({ 341 width : instance.sliderW + 10 // TODO: +10px seems to solve a firefox "bug" :S 342 }); 343 344 // slide to the current element 345 clearTimeout( instance.resetTimeout ); 346 instance.resetTimeout = setTimeout(function() { 347 instance._slideToCurrent(); 348 }, 200); 349 350 }); 351 352 // navigation buttons events 353 this.$navNext.bind('click.elastislide', function( event ) { 354 instance._slide('right'); 355 }); 356 357 this.$navPrev.bind('click.elastislide', function( event ) { 358 instance._slide('left'); 359 }); 360 361 // item click event 362 this.$items.bind('click.elastislide', function( event ) { 363 instance.options.onClick( $(this) ); 364 //return false; 365 }); 366 367 // touch events 368 instance.$slider.touchwipe({ 369 wipeLeft : function() { 370 instance._slide('right'); 371 }, 372 wipeRight : function() { 373 instance._slide('left'); 374 } 375 }); 376 377 }, 378 _slide : function( dir, val, anim, callback ) { 379 380 // if animating return 381 if( this.$slider.is(':animated') ) 382 return false; 383 384 // current margin left 385 var ml = parseFloat( this.$slider.css('margin-left') ); 386 387 // val is just passed when we want an exact value for the margin left (used in the _slideToCurrent function) 388 if( val === undefined ) { 389 390 // how much to slide? 391 var amount = this.fitCount * this.itemW, val; 392 393 if( amount < 0 ) return false; 394 395 // make sure not to leave a space between the last item / first item and the end / beggining of the slider available width 396 if( dir === 'right' && this.sliderW - ( Math.abs( ml ) + amount ) < this.visibleWidth ) { 397 amount = this.sliderW - ( Math.abs( ml ) + this.visibleWidth ) - this.options.margin; // decrease the margin left 398 // show / hide navigation buttons 399 this._toggleControls( 'right', -1 ); 400 this._toggleControls( 'left', 1 ); 401 } 402 else if( dir === 'left' && Math.abs( ml ) - amount < 0 ) { 403 amount = Math.abs( ml ); 404 // show / hide navigation buttons 405 this._toggleControls( 'left', -1 ); 406 this._toggleControls( 'right', 1 ); 407 } 408 else { 409 var fml; // future margin left 410 ( dir === 'right' ) 411 ? fml = Math.abs( ml ) + this.options.margin + Math.abs( amount ) 412 : fml = Math.abs( ml ) - this.options.margin - Math.abs( amount ); 413 414 // show / hide navigation buttons 415 if( fml > 0 ) 416 this._toggleControls( 'left', 1 ); 417 else 418 this._toggleControls( 'left', -1 ); 419 420 if( fml < this.sliderW - this.visibleWidth ) 421 this._toggleControls( 'right', 1 ); 422 else 423 this._toggleControls( 'right', -1 ); 424 425 } 426 427 ( dir === 'right' ) ? val = '-=' + amount : val = '+=' + amount 428 429 } 430 else { 431 var fml = Math.abs( val ); // future margin left 432 433 if( Math.max( this.sliderW, this.visibleWidth ) - fml < this.visibleWidth ) { 434 val = - ( Math.max( this.sliderW, this.visibleWidth ) - this.visibleWidth ); 435 if( val !== 0 ) 436 val += this.options.margin; // decrease the margin left if not on the first position 437 438 // show / hide navigation buttons 439 this._toggleControls( 'right', -1 ); 440 fml = Math.abs( val ); 441 } 442 443 // show / hide navigation buttons 444 if( fml > 0 ) 445 this._toggleControls( 'left', 1 ); 446 else 447 this._toggleControls( 'left', -1 ); 448 449 if( Math.max( this.sliderW, this.visibleWidth ) - this.visibleWidth > fml + this.options.margin ) 450 this._toggleControls( 'right', 1 ); 451 else 452 this._toggleControls( 'right', -1 ); 453 454 } 455 456 $.fn.applyStyle = ( anim === undefined ) ? $.fn.animate : $.fn.css; 457 458 var sliderCSS = { marginLeft : val }; 459 460 var instance = this; 461 462 this.$slider.applyStyle( sliderCSS, $.extend( true, [], { duration : this.options.speed, easing : this.options.easing, complete : function() { 463 if( callback ) callback.call(); 464 } } ) ); 465 466 }, 467 _slideToCurrent : function( anim ) { 468 469 // how much to slide? 470 var amount = this.current * this.itemW; 471 this._slide('', -amount, anim ); 472 473 },
474 add : function( $newelems, callback ) { 475 476 // adds new items to the carousel 477 this.$items = this.$items.add( $newelems ); 478 this.itemsCount = this.$items.length; 479 this._setDim(); 480 this._setCurrentValues(); 481 this.$slider.css({ 482 width : this.sliderW 483 }); 484 this._slideToCurrent(); 485 486 if ( callback ) callback.call( $newelems ); 487 488 }, 489 destroy : function( callback ) { 490 this._destroy( callback ); 491 }, 492 _destroy : function( callback ) { 493 this.$el.unbind('.elastislide').removeData('elastislide'); 494 $(window).unbind('.elastislide'); 495 if ( callback ) callback.call(); 496 } 497 }; 498 499 var logError = function( message ) { 500 if ( this.console ) { 501 console.error( message ); 502 } 503 }; 504 505 $.fn.elastislide = function( options ) { 506 if ( typeof options === 'string' ) { 507 var args = Array.prototype.slice.call( arguments, 1 ); 508 509 this.each(function() { 510 var instance = $.data( this, 'elastislide' ); 511 if ( !instance ) { 512 logError( "cannot call methods on elastislide prior to initialization; " + 513 "attempted to call method '" + options + "'" ); 514 return; 515 } 516 if ( !$.isFunction( instance[options] ) || options.charAt(0) === "_" ) { 517 logError( "no such method '" + options + "' for elastislide instance" ); 518 return; 519 } 520 instance[ options ].apply( instance, args ); 521 }); 522 } 523 else { 524 this.each(function() { 525 var instance = $.data( this, 'elastislide' ); 526 if ( !instance ) { 527 $.data( this, 'elastislide', new $.elastislide( options, this ) ); 528 } 529 }); 530 } 531 return this; 532 }; 533 534})( window, jQuery ); 535 536 537 // Nicescroll 538 539(function(jQuery){ 540 541 // globals 542 var domfocus = false; 543 var mousefocus = false; 544 var zoomactive = false; 545 var tabindexcounter = 5000; 546 var ascrailcounter = 2000; 547 var globalmaxzindex = 0; 548 549 var $ = jQuery; // sandbox 550 551 // http://stackoverflow.com/questions/2161159/get-script-path 552 function getScriptPath() { 553 var scripts=document.getElementsByTagName('script'); 554 var path=scripts[scripts.length-1].src.split('?')[0]; 555 return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : ''; 556 } 557 var scriptpath = getScriptPath(); 558 559 var vendors = ['ms','moz','webkit','o']; 560 561 var setAnimationFrame = window.requestAnimationFrame||false; 562 var clearAnimationFrame = window.cancelAnimationFrame||false; 563 564 if (!setAnimationFrame) { 565 for(var vx in vendors) { 566 var v = vendors[vx]; 567 if (!setAnimationFrame) setAnimationFrame = window[v+'RequestAnimationFrame']; 568 if (!clearAnimationFrame) clearAnimationFrame = window[v+'CancelAnimationFrame']||window[v+'CancelRequestAnimationFrame']; 569 } 570 } 571 572 var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false; 573 574 var _globaloptions = { 575 zindex:"auto", 576 cursoropacitymin:0, 577 cursoropacitymax:1, 578 cursorcolor:"#424242", 579 cursorwidth:"5px", 580 cursorborder:"1px solid #fff", 581 cursorborderradius:"5px", 582 scrollspeed:60, 583 mousescrollstep:8*3, 584 touchbehavior:false, 585 hwacceleration:true, 586 usetransition:true, 587 boxzoom:false, 588 dblclickzoom:true, 589 gesturezoom:true, 590 grabcursorenabled:true, 591 autohidemode:true, 592 background:"", 593 iframeautoresize:true, 594 cursorminheight:32, 595 preservenativescrolling:true, 596 railoffset:false, 597 bouncescroll:true, 598 spacebarenabled:true, 599 railpadding:{top:0,right:0,left:0,bottom:0}, 600 disableoutline:true, 601 horizrailenabled:true, 602 railalign:"right", 603 railvalign:"bottom", 604 enabletranslate3d:true, 605 enablemousewheel:true, 606 enablekeyboard:true, 607 smoothscroll:true, 608 sensitiverail:true, 609 enablemouselockapi:true, 610// cursormaxheight:false, 611 cursorfixedheight:false, 612 directionlockdeadzone:6, 613 hidecursordelay:400, 614 nativeparentscrolling:true, 615 enablescrollonselection:true, 616 overflowx:true, 617 overflowy:true, 618 cursordragspeed:0.3, 619 rtlmode:false, 620 cursordragontouch:false, 621 oneaxismousemode:"auto" 622 } 623 624 var browserdetected = false; 625 626 var getBrowserDetection = function() { 627 628 if (browserdetected) return browserdetected; 629 630 var domtest = document.createElement('DIV'); 631 632 var d = {}; 633 634 d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document; 635 636 d.isopera = ("opera" in window); 637 d.isopera12 = (d.isopera&&("getUserMedia" in navigator)); 638 d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]"); 639 640 d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera); 641 d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older 642 d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(
642document.documentMode==7)); 643 d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8); 644 d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9); 645 d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10); 646 647 d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango 648 if (d.isie9mobile) d.isie9 = false; 649 d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0 650 651 d.ismozilla = ("MozAppearance" in domtest.style); 652 653 d.iswebkit = ("WebkitAppearance" in domtest.style); 654 655 d.ischrome = ("chrome" in window); 656 d.ischrome22 = (d.ischrome&&d.haspointerlock); 657 d.ischrome26 = (d.ischrome&&("transition" in domtest.style)); // issue with transform detection (maintain prefix) 658 659 d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window); // detection for Chrome Touch Emulation 660 d.hasmstouch = (window.navigator.msPointerEnabled||false); // IE10+ pointer events 661 662 d.ismac = /^mac$/i.test(navigator.platform); 663 664 d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform)); 665 d.isios4 = ((d.isios)&&!("seal" in Object)); 666 667 d.isandroid = (/android/i.test(navigator.userAgent)); 668 669 d.trstyle = false; 670 d.hastransform = false; 671 d.hastranslate3d = false; 672 d.transitionstyle = false; 673 d.hastransition = false; 674 d.transitionend = false; 675 676 var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform']; 677 for(var a=0;a<check.length;a++){ 678 if (typeof domtest.style[check[a]] != "undefined") { 679 d.trstyle = check[a]; 680 break; 681 } 682 } 683 d.hastransform = (d.trstyle != false); 684 if (d.hastransform) { 685 domtest.style[d.trstyle] = "translate3d(1px,2px,3px)"; 686 d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]); 687 } 688 689 d.transitionstyle = false; 690 d.prefixstyle = ''; 691 d.transitionend = false; 692 var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition']; 693 var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-']; 694 var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd']; 695 for(var a=0;a<check.length;a++) { 696 if (check[a] in domtest.style) { 697 d.transitionstyle = check[a]; 698 d.prefixstyle = prefix[a]; 699 d.transitionend = evs[a]; 700 break; 701 } 702 } 703 if (d.ischrome26) { // use always prefix 704 d.prefixstyle = prefix[1]; 705 } 706 707 d.hastransition = (d.transitionstyle); 708 709 function detectCursorGrab() { 710 var lst = ['-moz-grab','-webkit-grab','grab']; 711 if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[]; // force setting for IE returns false positive and chrome cursor bug 712 for(var a=0;a<lst.length;a++) { 713 var p = lst[a]; 714 domtest.style['cursor']=p; 715 if (domtest.style['cursor']==p) return p; 716 } 717 return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; // thank you google for custom cursor! 718 } 719 d.cursorgrabvalue = detectCursorGrab(); 720 721 d.hasmousecapture = ("setCapture" in domtest); 722 723 d.hasMutationObserver = (clsMutationObserver !== false); 724 725 domtest = null; //memory released 726 727 browserdetected = d; 728 729 return d; 730 } 731 732 var NiceScrollClass = function(myopt,me) { 733 734 var self = this; 735 736 this.version = '3.5.0 BETA5'; 737 this.name = 'nicescroll'; 738 739 this.me = me; 740 741 this.opt = { 742 doc:$("body"), 743 win:false 744 }; 745 746 $.extend(this.opt,_globaloptions); 747 748// Options for internal use 749 this.opt.snapbackspeed = 80; 750 751 if (myopt||false) { 752 for(var a in self.opt) { 753 if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a]; 754 } 755 } 756 757 this.doc = self.opt.doc; 758 this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':''; 759 this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName); 760 this.haswrapper = (self.opt.win!==false); 761 this.win = self.opt.win||(this.ispage?$(window):this.doc);
762 this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win; 763 this.body = $("body"); 764 this.viewport = false; 765 766 this.isfixed = false; 767 768 this.iframe = false; 769 this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); 770 771 this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); 772 773 this.forcescreen = false; //force to use screen position on events 774 775 this.canshowonmouseevent = (self.opt.autohidemode!="scroll"); 776 777// Events jump table 778 this.onmousedown = false; 779 this.onmouseup = false; 780 this.onmousemove = false; 781 this.onmousewheel = false; 782 this.onkeypress = false; 783 this.ongesturezoom = false; 784 this.onclick = false; 785 786// Nicescroll custom events 787 this.onscrollstart = false; 788 this.onscrollend = false; 789 this.onscrollcancel = false; 790 791 this.onzoomin = false; 792 this.onzoomout = false; 793 794// Let's start! 795 this.view = false; 796 this.page = false; 797 798 this.scroll = {x:0,y:0}; 799 this.scrollratio = {x:0,y:0}; 800 this.cursorheight = 20; 801 this.scrollvaluemax = 0; 802 803 this.checkrtlmode = false; 804 805 this.scrollrunning = false; 806 807 this.scrollmom = false; 808 809 this.observer = false; 810 this.observerremover = false; // observer on parent for remove detection 811 812 do { 813 this.id = "ascrail"+(ascrailcounter++); 814 } while (document.getElementById(this.id)); 815 816 this.rail = false; 817 this.cursor = false; 818 this.cursorfreezed = false; 819 this.selectiondrag = false; 820 821 this.zoom = false; 822 this.zoomactive = false; 823 824 this.hasfocus = false; 825 this.hasmousefocus = false; 826 827 this.visibility = true; 828 this.locked = false; 829 this.hidden = false; // rails always hidden 830 this.cursoractive = true; // user can interact with cursors 831 832 this.overflowx = self.opt.overflowx; 833 this.overflowy = self.opt.overflowy; 834 835 this.nativescrollingarea = false; 836 this.checkarea = 0; 837 838 this.events = []; // event list for unbind 839 840 this.saved = {}; 841 842 this.delaylist = {}; 843 this.synclist = {}; 844 845 this.lastdeltax = 0; 846 this.lastdeltay = 0; 847 848 this.detected = getBrowserDetection(); 849 850 var cap = $.extend({},this.detected); 851 852 this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration); 853 this.ishwscroll = (this.canhwscroll&&self.haswrapper); 854 855 this.istouchcapable = false; // desktop devices with touch screen support 856 857//## Check Chrome desktop with touch support 858 if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) { 859 this.istouchcapable = true; 860 cap.cantouch = false; // parse normal desktop events 861 } 862 863//## Firefox 18 nightly build (desktop) false positive (or desktop with touch support) 864 if (cap.cantouch&&cap.ismozilla&&!cap.isios&&!cap.isandroid) { 865 this.istouchcapable = true; 866 cap.cantouch = false; // parse normal desktop events 867 } 868 869//## disable MouseLock API on user request 870 871 if (!self.opt.enablemouselockapi) { 872 cap.hasmousecapture = false; 873 cap.haspointerlock = false; 874 } 875 876 this.delayed = function(name,fn,tm,lazy) { 877 var dd = self.delaylist[name]; 878 var nw = (new Date()).getTime(); 879 if (!lazy&&dd&&dd.tt) return false; 880 if (dd&&dd.tt) clearTimeout(dd.tt); 881 if (dd&&dd.last+tm>nw&&!dd.tt) { 882 self.delaylist[name] = { 883 last:nw+tm, 884 tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm) 885 } 886 } 887 else if (!dd||!dd.tt) { 888 self.delaylist[name] = { 889 last:nw, 890 tt:0 891 } 892 setTimeout(function(){fn.call();},0); 893 } 894 }; 895 896 this.debounced = function(name,fn,tm) { 897 var dd = self.delaylist[name]; 898 var nw = (new Date()).getTime(); 899 self.delaylist[name] = fn; 900 if (!dd) { 901 setTimeout(function(){var fn=self.delaylist[name];self.delaylist[name]=false;fn.call();},tm); 902 } 903 } 904 905 this.synched = function(name,fn) { 906 907 function requestSync() { 908 if (self.onsync) return; 909 setAnimationFrame(function(){ 910 self.onsync = false; 911 for(name in self.synclist){ 912 var fn = self.synclist[name]; 913 if (fn) fn.call(self); 914 self.synclist[name] = false; 915 } 916 }); 917 self.onsync = true; 918 }; 919 920 self.synclist[name] = fn; 921 requestSync(); 922 return name; 923 }; 924 925 this.unsynched = function(name) { 926 if (self.synclist[name]) self.synclist[name] = false; 927 } 928 929 this.css = function(el,pars) { // save & set 930 for(var n in pars) { 931 self.saved.css.push([el,n,el.css(n)]); 932 el.css(n,pars[n]); 933 } 934 }; 935 936 this.scrollTop = function(val) { 937 return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val); 938 }; 939 940 this.scrollLeft = function(val) { 941 return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val); 942 }; 943 944// derived by by Dan Pupius www.pupius.net 945 BezierClass = function(st,ed,spd,p1,p2,p3,p4) { 946 this.st = st; 947 this.ed = ed; 948 this.spd = spd; 949 950 this.p1 = p1||0; 951 this.p2 = p2||1; 952 this.p3 = p3||0; 953 this.p4 = p4||1; 954
955 this.ts = (new Date()).getTime(); 956 this.df = this.ed-this.st; 957 }; 958 BezierClass.prototype = { 959 B2:function(t){ return 3*t*t*(1-t) }, 960 B3:function(t){ return 3*t*(1-t)*(1-t) }, 961 B4:function(t){ return (1-t)*(1-t)*(1-t) }, 962 getNow:function(){ 963 var nw = (new Date()).getTime(); 964 var pc = 1-((nw-this.ts)/this.spd); 965 var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); 966 return (pc<0) ? this.ed : this.st+Math.round(this.df*bz); 967 }, 968 update:function(ed,spd){ 969 this.st = this.getNow(); 970 this.ed = ed; 971 this.spd = spd; 972 this.ts = (new Date()).getTime(); 973 this.df = this.ed-this.st; 974 return this; 975 } 976 }; 977 978 if (this.ishwscroll) { 979 // hw accelerated scroll 980 this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"}; 981 982 //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ 983 if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ 984 985 //derived from http://stackoverflow.com/questions/11236090/ 986 function getMatrixValues() { 987 var tr = self.doc.css(cap.trstyle); 988 if (tr&&(tr.substr(0,6)=="matrix")) { 989 return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/); 990 } 991 return false; 992 } 993
994 this.getScrollTop = function(last) { 995 if (!last) { 996 var mtx = getMatrixValues(); 997 if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 998 if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow(); 999 } 1000 return self.doc.translate.y; 1001 }; 1002 1003 this.getScrollLeft = function(last) { 1004 if (!last) { 1005 var mtx = getMatrixValues(); 1006 if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 1007 if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow(); 1008 } 1009 return self.doc.translate.x; 1010 }; 1011 1012 if (document.createEvent) { 1013 this.notifyScrollEvent = function(el) { 1014 var e = document.createEvent("UIEvents"); 1015 e.initUIEvent("scroll", false, true, window, 1); 1016 el.dispatchEvent(e); 1017 }; 1018 } 1019 else if (document.fireEvent) { 1020 this.notifyScrollEvent = function(el) { 1021 var e = document.createEventObject(); 1022 el.fireEvent("onscroll"); 1023 e.cancelBubble = true; 1024 }; 1025 } 1026 else { 1027 this.notifyScrollEvent = function(el,add) {}; //NOPE 1028 } 1029 1030 if (cap.hastranslate3d&&self.opt.enabletranslate3d) { 1031 this.setScrollTop = function(val,silent) { 1032 self.doc.translate.y = val; 1033 self.doc.translate.ty = (val*-1)+"px"; 1034 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 1035 if (!silent) self.notifyScrollEvent(self.win[0]); 1036 }; 1037 this.setScrollLeft = function(val,silent) { 1038 self.doc.translate.x = val; 1039 self.doc.translate.tx = (val*-1)+"px"; 1040 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 1041 if (!silent) self.notifyScrollEvent(self.win[0]); 1042 }; 1043 } else { 1044 this.setScrollTop = function(val,silent) { 1045 self.doc.translate.y = val; 1046 self.doc.translate.ty = (val*-1)+"px"; 1047 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 1048 if (!silent) self.notifyScrollEvent(self.win[0]); 1049 }; 1050 this.setScrollLeft = function(val,silent) { 1051 self.doc.translate.x = val; 1052 self.doc.translate.tx = (val*-1)+"px"; 1053 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 1054 if (!silent) self.notifyScrollEvent(self.win[0]); 1055 }; 1056 } 1057 } else { 1058 // native scroll
1059 this.getScrollTop = function() { 1060 return self.docscroll.scrollTop(); 1061 }; 1062 this.setScrollTop = function(val) { 1063 return self.docscroll.scrollTop(val); 1064 }; 1065 this.getScrollLeft = function() { 1066 return self.docscroll.scrollLeft(); 1067 }; 1068 this.setScrollLeft = function(val) { 1069 return self.docscroll.scrollLeft(val); 1070 }; 1071 } 1072 1073 this.getTarget = function(e) { 1074 if (!e) return false; 1075 if (e.target) return e.target; 1076 if (e.srcElement) return e.srcElement; 1077 return false; 1078 }; 1079 1080 this.hasParent = function(e,id) { 1081 if (!e) return false; 1082 var el = e.target||e.srcElement||e||false; 1083 while (el && el.id != id) { 1084 el = el.parentNode||false; 1085 } 1086 return (el!==false); 1087 }; 1088 1089 function getZIndex() { 1090 var dom = self.win; 1091 if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available 1092 while (dom.length>0) { 1093 if (dom[0].nodeType==9) return false; 1094 var zi = dom.css('zIndex'); 1095 if (!isNaN(zi)&&zi!=0) return parseInt(zi); 1096 dom = dom.parent(); 1097 } 1098 return false; 1099 }; 1100 1101//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie 1102 var _convertBorderWidth = {"thin":1,"medium":3,"thick":5}; 1103 function getWidthToPixel(dom,prop,chkheight) { 1104 var wd = dom.css(prop); 1105 var px = parseFloat(wd); 1106 if (isNaN(px)) { 1107 px = _convertBorderWidth[wd]||0; 1108 var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS 1109 if (self.isie8&&px) px+=1; 1110 return (brd) ? px : 0; 1111 } 1112 return px; 1113 }; 1114 1115 this.getOffset = function() { 1116 if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))}; 1117 if (!self.viewport) return self.win.offset(); 1118 var ww = self.win.offset(); 1119 var vp = self.viewport.offset(); 1120 return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()}; 1121 }; 1122 1123 this.updateScrollBar = function(len) { 1124 if (self.ishwscroll) { 1125 self.rail.css({height:self.win.innerHeight()}); 1126 if (self.railh) self.railh.css({width:self.win.innerWidth()}); 1127 } else { 1128 var wpos = self.getOffset(); 1129 var pos = {top:wpos.top,left:wpos.left}; 1130 pos.top+= getWidthToPixel(self.win,'border-top-width',true); 1131 var brd = (self.win.outerWidth() - self.win.innerWidth())/2; 1132 pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width'); 1133 1134 var off = self.opt.railoffset; 1135 if (off) { 1136 if (off.top) pos.top+=off.top; 1137 if (self.rail.align&&off.left) pos.left+=off.left; 1138 } 1139 1140 if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()}); 1141 1142 if (self.zoom) { 1143 self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4}); 1144 } 1145 1146 if (self.railh&&!self.locked) { 1147 var pos = {top:wpos.top,left:wpos.left}; 1148 var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true); 1149 var x = pos.left + getWidthToPixel(self.win,'border-left-width'); 1150 self.railh.css({top:y,left:x,width:self.railh.width}); 1151 } 1152 1153 1154 } 1155 }; 1156 1157 this.doRailClick = function(e,dbl,hr) { 1158 1159 var fn,pg,cur,pos; 1160 1161// if (self.rail.drag&&self.rail.drag.pt!=1) return; 1162 if (self.locked) return; 1163// if (self.rail.drag) return; 1164 1165// self.cancelScroll(); 1166 1167 self.cancelEvent(e); 1168 1169 if (dbl) { 1170 fn = (hr) ? self.doScrollLeft : self.doScrollTop; 1171 cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) *
1171self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y); 1172 fn(cur); 1173 } else { 1174// console.log(e.pageY); 1175 fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; 1176 cur = (hr) ? self.scroll.x : self.scroll.y; 1177 pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; 1178 pg = (hr) ? self.view.w : self.view.h; 1179 (cur>=pos) ? fn(pg) : fn(-pg); 1180 } 1181 1182 } 1183 1184 self.hasanimationframe = (setAnimationFrame); 1185 self.hascancelanimationframe = (clearAnimationFrame); 1186 1187 if (!self.hasanimationframe) { 1188 setAnimationFrame=function(fn){return setTimeout(fn,15-Math.floor((+new Date)/1000)%16)}; // 1000/60)}; 1189 clearAnimationFrame=clearInterval; 1190 } 1191 else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true}; 1192 1193 this.init = function() { 1194 1195 self.saved.css = []; 1196 1197 if (cap.isie7mobile) return true; // SORRY, DO NOT WORK! 1198 if (cap.isoperamini) return true; // SORRY, DO NOT WORK! 1199 1200 if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'}); 1201 1202 self.zindex = "auto"; 1203 if (!self.ispage&&self.opt.zindex=="auto") { 1204 self.zindex = getZIndex()||"auto"; 1205 } else { 1206 self.zindex = self.opt.zindex; 1207 } 1208 1209 if (!self.ispage&&self.zindex!="auto") { 1210 if (self.zindex>globalmaxzindex) globalmaxzindex=self.zindex; 1211 } 1212 1213 if (self.isie&&self.zindex==0&&self.opt.zindex=="auto") { // fix IE auto == 0 1214 self.zindex="auto"; 1215 } 1216 1217/* 1218 self.ispage = true; 1219 self.haswrapper = true; 1220// self.win = $(window); 1221 self.docscroll = $("body"); 1222// self.doc = $("body"); 1223*/ 1224 1225 if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { 1226 1227 var cont = self.docscroll; 1228 if (self.ispage) cont = (self.haswrapper)?self.win:self.doc; 1229 1230 if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'}); 1231 1232 if (self.ispage&&cap.isie7) { 1233 if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 1234 else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 1235 } 1236 1237 if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"}); //force hw acceleration 1238 1239 var cursor = $(document.createElement('div')); 1240 cursor.css({ 1241 position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px", 1242 'background-color':self.opt.cursorcolor, 1243 border:self.opt.cursorborder, 1244 'background-clip':'padding-box', 1245 '-webkit-border-radius':self.opt.cursorborderradius, 1246 '-moz-border-radius':self.opt.cursorborderradius, 1247 'border-radius':self.opt.cursorborderradius 1248 }); 1249 1250 cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHe
1250ight()); 1251 self.cursor = cursor; 1252 1253 var rail = $(document.createElement('div')); 1254 rail.attr('id',self.id); 1255 rail.addClass('nicescroll-rails'); 1256 1257 var v,a,kp = ["left","right"]; //"top","bottom" 1258 for(var n in kp) { 1259 a=kp[n]; 1260 v = self.opt.railpadding[a]; 1261 (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0; 1262 } 1263 1264 rail.append(cursor); 1265 1266 rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right']; 1267 rail.css({width:rail.width+"px",'zIndex':self.zindex,"background":self.opt.background,cursor:"default"}); 1268 1269 rail.visibility = true; 1270 rail.scrollable = true; 1271 1272 rail.align = (self.opt.railalign=="left") ? 0 : 1; 1273 1274 self.rail = rail; 1275 1276 self.rail.drag = false; 1277 1278 var zoom = false; 1279 if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) { 1280 zoom = document.createElement('div'); 1281 self.bind(zoom,"click",self.doZoom); 1282 self.zoom = $(zoom); 1283 self.zoom.css({"cursor":"pointer",'z-index':self.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'}); 1284 if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom); 1285 if (cap.cantouch&&self.opt.gesturezoom) { 1286 self.ongesturezoom = function(e) { 1287 if (e.scale>1.5) self.doZoomIn(e); 1288 if (e.scale<0.8) self.doZoomOut(e); 1289 return self.cancelEvent(e); 1290 }; 1291 self.bind(self.win,"gestureend",self.ongesturezoom); 1292 } 1293 } 1294 1295// init HORIZ 1296 1297 self.railh = false; 1298 1299 if (self.opt.horizrailenabled) { 1300 1301 self.css(cont,{'overflow-x':'hidden'}); 1302 1303 var cursor = $(document.createElement('div')); 1304 cursor.css({ 1305 position:"relative",top:0,height:self.opt.cursorwidth,width:"0px", 1306 'background-color':self.opt.cursorcolor, 1307 border:self.opt.cursorborder, 1308 'background-clip':'padding-box', 1309 '-webkit-border-radius':self.opt.cursorborderradius, 1310 '-moz-border-radius':self.opt.cursorborderradius, 1311 'border-radius':self.opt.cursorborderradius 1312 }); 1313 1314 cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()); 1315 self.cursorh = cursor; 1316 1317 var railh = $(document.createElement('div')); 1318 railh.attr('id',self.id+'-hr'); 1319 railh.addClass('nicescroll-rails'); 1320 railh.height = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight()); 1321 railh.css({height:railh.height+"px",'zIndex':self.zindex,"background":self.opt.background}); 1322 1323 railh.append(cursor); 1324 1325 railh.visibility = true; 1326 railh.scrollable = true; 1327 1328 railh.align = (self.opt.railvalign=="top") ? 0 : 1; 1329 1330 self.railh = railh; 1331 1332 self.railh.drag = false; 1333 1334 } 1335 1336// 1337 1338 if (self.ispage) { 1339 rail.css({position:"fixed",top:"0px",height:"100%"}); 1340 (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"}); 1341 self.body.append(rail); 1342 if (self.railh) { 1343 railh.css({position:"fixed",left:"0px",width:"100%"}); 1344 (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"}); 1345 self.body.append(railh); 1346 } 1347 } else { 1348 if (self.ishwscroll) { 1349 if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'}); 1350 var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; 1351 if (self.zoom) { 1352 self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4}); 1353 bd.append(self.zoom); 1354 } 1355 rail.css({position:"absolute",top:0}); 1356 (rail.align) ? rail.css({right:0}) : rail.css({left:0}); 1357 bd.append(rail); 1358 if (railh) { 1359 railh.css({position:"absolute",left:0,bottom:0}); 1360 (railh.align) ? railh.css({bottom:0}) : railh.css({top:0}); 1361 bd.append(railh); 1362 } 1363 } else { 1364 self.isfixed = (self.win.css("position")=="fixed"); 1365 var rlpos = (self.isfixed) ? "fixed" : "absolute"; 1366 1367 if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); 1368 if (self.viewport) { 1369 self.body = self.viewport; 1370 if ((/relative|absolute/.test(self.viewport.css("position")))==false) self.css(self.viewport,{"position":"relative"}); 1371 } 1372 1373 rail.css({position:rlpos}); 1374 if (self.zoom) self.zoom.css({position:rlpos}); 1375 self.updateScrollBar(); 1376 self.body.append(rail); 1377 if (self.zoom) self.body.append(self.zoom); 1378 if (self.railh) { 1379 railh.css({position:rlpos}); 1380 self.body.append(railh); 1381 } 1382 } 1383 1384 if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'}); // prevent grey layer on click 1385 1386 if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true"); // IE, prevent dotted rectangle on focused div 1387 if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"}); 1388// if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera to test [TODO] 1389 1390 } 1391 1392 if (self.opt.autohidemode===false) { 1393 self.autohidedom = false; 1394 self.rail.css({opacity:self.opt.cursoropacitymax}); 1395 if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax}); 1396 } 1397 else if (self.opt.autohidemode===true) { 1398 self.autohidedom = $().add(self.rail); 1399 if (cap.isie8) self.autohidedom=self.autohidedom.add(self.cursor); 1400 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 1401 if (self.railh&&cap.isie8) self.autohidedom=self.autohidedom.add(self.cursorh); 1402 } 1403 else if (self.opt.autohidemode=="scroll") { 1404 self.autohidedom = $().add(self.rail); 1405 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 1406 } 1407 else if (self.opt.autohidemode=="cursor") { 1408 self.autohidedom = $().add(self.cursor); 1409 if (self.railh) self.autohidedom=self.autohidedom.add(self.cursorh); 1410 } 1411 else if (self.opt.autohidemode=="hidden") { 1412 self.autohidedom = false; 1413 self.hide(); 1414 self.locked = false; 1415 } 1416 1417 if (cap.isie9mobile) { 1418 1419 self.scrollmom = new ScrollMomentumClass2D(self); 1420 1421 /* 1422 var trace = function(msg) { 1423 var db = $("#debug"); 1424 if (isNaN(msg)&&(typeof msg != "string")) { 1425 var x = []; 1426 for(var a in msg) { 1427 x.push(a+":"+msg[a]); 1428 } 1429 msg ="{"+x.join(",")+"}"; 1430 } 1431 if (db.children().length>0) { 1432 db.children().eq(0).before("<div>"+msg+"</div>"); 1433 } else { 1434 db.append("<div>"+msg+"</div>"); 1435 } 1436 } 1437 window.onerror = function(msg,url,ln) { 1438 trace("ERR: "+msg+" at "+ln); 1439 } 1440*/ 1441 1442 self.onmangotouch = function(e) { 1443 var py = self.getScrollTop(); 1444 var px = self.getScrollLeft(); 1445 1446 if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true; 1447// $("#debug").html('DRAG:'+py); 1448 1449 var dfy = py-self.mangotouch.sy; 1450 var dfx = px-self.mangotouch.sx; 1451 var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2))); 1452 if (df==0) return; 1453 1454 var dry = (dfy<0)?-1:1; 1455 var drx = (dfx<0)?-1:1; 1456 1457 var tm = +new Date(); 1458 if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy); 1459 1460 if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) { 1461// trace('RESET+'+(tm-self.mangotouch.tm)); 1462 self.scrollmom.stop(); 1463 self.scrollmom.reset(px,py); 1464 self.mangotouch.sy = py; 1465 self.mangotouch.ly = py; 1466 self.mangotouch.sx = px;
1467 self.mangotouch.lx = px; 1468 self.mangotouch.dry = dry; 1469 self.mangotouch.drx = drx; 1470 self.mangotouch.tm = tm; 1471 } else { 1472 1473 self.scrollmom.stop(); 1474 self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy); 1475 var gap = tm - self.mangotouch.tm; 1476 self.mangotouch.tm = tm; 1477 1478// trace('MOVE:'+df+" - "+gap); 1479 1480 var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px)); 1481 self.mangotouch.ly = py; 1482 self.mangotouch.lx = px; 1483 1484 if (ds>2) { 1485 self.mangotouch.lazy = setTimeout(function(){ 1486// trace('END:'+ds+'+'+gap); 1487 self.mangotouch.lazy = false; 1488 self.mangotouch.dry = 0; 1489 self.mangotouch.drx = 0; 1490 self.mangotouch.tm = 0; 1491 self.scrollmom.doMomentum(30); 1492 },100); 1493 } 1494 } 1495 } 1496 1497 var top = self.getScrollTop(); 1498 var lef = self.getScrollLeft(); 1499 self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0}; 1500 1501 self.bind(self.docscroll,"scroll",self.onmangotouch); 1502 1503 } else { 1504 1505 if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) { 1506 1507 self.scrollmom = new ScrollMomentumClass2D(self); 1508 1509 self.ontouchstart = function(e) { 1510 if (e.pointerType&&e.pointerType!=2) return false; 1511 1512 if (!self.locked) { 1513 1514 if (cap.hasmstouch) { 1515 var tg = (e.target) ? e.target : false; 1516 while (tg) { 1517 var nc = $(tg).getNiceScroll(); 1518 if ((nc.length>0)&&(nc[0].me == self.me)) break; 1519 if (nc.length>0) return false; 1520 if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break; 1521 tg = (tg.parentNode) ? tg.parentNode : false; 1522 } 1523 } 1524 1525 self.cancelScroll(); 1526 1527 var tg = self.getTarget(e); 1528 1529 if (tg) { 1530 var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type)); 1531 if (skp) return self.stopPropagation(e); 1532 } 1533 1534 if (!("clientX" in e) && ("changedTouches" in e)) { 1535 e.clientX = e.changedTouches[0].clientX; 1536 e.clientY = e.changedTouches[0].clientY; 1537 } 1538 1539 if (self.forcescreen) { 1540 var le = e; 1541 var e = {"original":(e.original)?e.original:e}; 1542 e.clientX = le.screenX; 1543 e.clientY = le.screenY; 1544 } 1545 1546 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2,dl:false}; 1547 1548 if (self.ispage||!self.opt.directionlockdeadzone) { 1549 self.rail.drag.dl = "f"; 1550 } else { 1551 1552 var view = { 1553 w:$(window).width(), 1554 h:$(window).height() 1555 }; 1556 1557 var page = { 1558 w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), 1559 h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) 1560 } 1561 1562 var maxh = Math.max(0,page.h - view.h); 1563 var maxw = Math.max(0,page.w - view.w); 1564 1565 if (!self.rail.scrollable&&self.railh.scrollable) self.rail.drag.ck = (maxh>0) ? "v" : false; 1566 else if (self.rail.scrollable&&!self.railh.scrollable) self.rail.drag.ck = (maxw>0) ? "h" : false; 1567 else self.rail.drag.ck = false; 1568 if (!self.rail.drag.ck) self.rail.drag.dl = "f"; 1569 } 1570 1571 if (self.opt.touchbehavior&&self.isiframe&&cap.isie) { 1572 var wp = self.win.position(); 1573 self.rail.drag.x+=wp.left; 1574 self.rail.drag.y+=wp.top; 1575 } 1576 1577 self.hasmoving = false; 1578 self.lastmouseup = false; 1579 self.scrollmom.reset(e.clientX,e.clientY); 1580 if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) { 1581 1582 var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false; 1583 if (!ip) { 1584 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 1585// return self.cancelEvent(e); 1586 return (self.opt.touchbehavior) ? self.cancelEvent(e) : self.stopPropagation(e); 1587 } 1588 if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { 1589 pc = {"tg":tg,"click":false}; 1590 self.preventclick = pc; 1591 } 1592 1593 } 1594 } 1595 1596 }; 1597 1598 self.ontouchend = function(e) { 1599 if (e.pointerType&&e.pointerType!=2) return false; 1600 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1601 self.scrollmom.doMomentum(); 1602 self.rail.drag = false; 1603 if (self.hasmoving) { 1604 self.hasmoving = false; 1605 self.lastmouseup = true; 1606 self.hideCursor(); 1607 if (cap.hasmousecapture) document.releaseCapture(); 1608 if (!cap.cantouch) return self.cancelEvent(e); 1609 } 1610 } 1611 1612 }; 1613 1614 var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture); 1615 1616 self.ontouchmove = function(e,byiframe) { 1617 1618 if (e.pointerType&&e.pointerType!=2) return false; 1619 1620 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1621 if (cap.cantouch&&(typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements 1622 1623 self.hasmoving = true; 1624 1625 if (self.preventclick&&!self.preventclick.click) { 1626 self.preventclick.click = self.preventclick.tg.oncl
1626ick||false; 1627 self.preventclick.tg.onclick = self.onpreventclick; 1628 } 1629 1630 var ev = $.extend({"original":e},e); 1631 e = ev; 1632 1633 if (("changedTouches" in e)) { 1634 e.clientX = e.changedTouches[0].clientX; 1635 e.clientY = e.changedTouches[0].clientY; 1636 } 1637 1638 if (self.forcescreen) { 1639 var le = e; 1640 var e = {"original":(e.original)?e.original:e}; 1641 e.clientX = le.screenX; 1642 e.clientY = le.screenY; 1643 } 1644 1645 var ofx = ofy = 0; 1646 1647 if (moveneedoffset&&!byiframe) { 1648 var wp = self.win.position(); 1649 ofx=-wp.left; 1650 ofy=-wp.top; 1651 } 1652 1653 var fy = e.clientY + ofy; 1654 var my = (fy-self.rail.drag.y); 1655 var fx = e.clientX + ofx; 1656 var mx = (fx-self.rail.drag.x); 1657 1658 var ny = self.rail.drag.st-my; 1659 1660 if (self.ishwscroll&&self.opt.bouncescroll) { 1661 if (ny<0) { 1662 ny = Math.round(ny/2); 1663// fy = 0; 1664 } 1665 else if (ny>self.page.maxh) { 1666 ny = self.page.maxh+Math.round((ny-self.page.maxh)/2); 1667// fy = 0; 1668 } 1669 } else { 1670 if (ny<0) {ny=0;fy=0} 1671 if (ny>self.page.maxh) {ny=self.page.maxh;fy=0} 1672 } 1673 1674 if (self.railh&&self.railh.scrollable) { 1675 var nx = self.rail.drag.sl-mx; 1676 1677 if (self.ishwscroll&&self.opt.bouncescroll) { 1678 if (nx<0) { 1679 nx = Math.round(nx/2); 1680// fx = 0; 1681 } 1682 else if (nx>self.page.maxw) { 1683 nx = self.page.maxw+Math.round((nx-self.page.maxw)/2); 1684// fx = 0; 1685 } 1686 } else { 1687 if (nx<0) {nx=0;fx=0} 1688 if (nx>self.page.maxw) {nx=self.page.maxw;fx=0} 1689 } 1690 1691 } 1692 1693 var grabbed = false; 1694 if (self.rail.drag.dl) { 1695 grabbed = true; 1696 if (self.rail.drag.dl=="v") nx = self.rail.drag.sl; 1697 else if (self.rail.drag.dl=="h") ny = self.rail.drag.st; 1698 } else { 1699 var ay = Math.abs(my); 1700 var ax = Math.abs(mx); 1701 var dz = self.opt.directionlockdeadzone; 1702 if (self.rail.drag.ck=="v") { 1703 if (ay>dz&&(ax<=(ay*0.3))) { 1704 self.rail.drag = false; 1705 return true; 1706 } 1707 else if (ax>dz) { 1708 self.rail.drag.dl="f"; 1709 $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked) 1710 } 1711 } 1712 else if (self.rail.drag.ck=="h") { 1713 if (ax>dz&&(ay<=(ax*0.3))) { 1714 self.rail.drag = false; 1715 return true; 1716 } 1717 else if (ay>dz) { 1718 self.rail.drag.dl="f"; 1719 $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked) 1720 } 1721 } 1722 } 1723 1724 self.synched("touchmove",function(){ 1725 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1726 if (self.prepareTransition) self.prepareTransition(0); 1727 if (self.rail.scrollable) self.setScrollTop(ny); 1728 self.scrollmom.update(fx,fy); 1729 if (self.railh&&self.railh.scrollable) { 1730 self.setScrollLeft(nx); 1731 self.showCursor(ny,nx); 1732 } else { 1733 self.showCursor(ny); 1734 } 1735 if (cap.isie10) document.selection.clear(); 1736 } 1737 }); 1738 1739 if (cap.ischrome&&self.istouchcapable) grabbed=false; //chrome touch emulation doesn't like! 1740 if (grabbed) return self.cancelEvent(e); 1741 } 1742 1743 }; 1744 1745 } 1746
1747 self.onmousedown = function(e,hronly) { 1748 if (self.rail.drag&&self.rail.drag.pt!=1) return; 1749 if (self.locked) return self.cancelEvent(e); 1750 self.cancelScroll(); 1751 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)}; 1752 var tg = self.getTarget(e); 1753 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 1754 if (self.isiframe&&!cap.hasmousecapture) { 1755 self.saved["csspointerevents"] = self.doc.css("pointer-events"); 1756 self.css(self.doc,{"pointer-events":"none"}); 1757 } 1758 return self.cancelEvent(e); 1759 }; 1760 1761 self.onmouseup = function(e) { 1762 if (self.rail.drag) { 1763 if (cap.hasmousecapture) document.releaseCapture(); 1764 if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]); 1765 if(self.rail.drag.pt!=1)return; 1766 self.rail.drag = false; 1767 //if (!self.rail.active) self.hideCursor(); 1768 return self.cancelEvent(e); 1769 } 1770 }; 1771 1772 self.onmousemove = function(e) { 1773 if (self.rail.drag) { 1774 if(self.rail.drag.pt!=1)return; 1775 1776 if (cap.ischrome&&e.which==0) return self.onmouseup(e); 1777 1778 self.cursorfreezed = true; 1779 1780 if (self.rail.drag.hr) { 1781 self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x); 1782 if (self.scroll.x<0) self.scroll.x=0; 1783 var mw = self.scrollvaluemaxw; 1784 if (self.scroll.x>mw) self.scroll.x=mw; 1785 } else { 1786 self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y); 1787 if (self.scroll.y<0) self.scroll.y=0; 1788 var my = self.scrollvaluemax; 1789 if (self.scroll.y>my) self.scroll.y=my; 1790 } 1791 1792 self.synched('mousemove',function(){ 1793 if (self.rail.drag&&(self.rail.drag.pt==1)) { 1794 self.showCursor(); 1795 if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x),self.opt.cursordragspeed); 1796 else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y),self.opt.cursordragspeed); 1797 } 1798 }); 1799 1800 return self.cancelEvent(e); 1801 } 1802/* 1803 else { 1804 self.checkarea = true; 1805 } 1806*/ 1807 }; 1808 1809 if (cap.cantouch||self.opt.touchbehavior) { 1810 1811 self.onpreventclick = function(e) { 1812 if (self.preventclick) { 1813 self.preventclick.tg.onclick = self.preventclick.click; 1814 self.preventclick = false; 1815 return self.cancelEvent(e); 1816 } 1817 } 1818 1819// self.onmousedown = self.ontouchstart; 1820// self.onmouseup = self.ontouchend; 1821// self.onmousemove = self.ontouchmove; 1822 1823 self.bind(self.win,"mousedown",self.ontouchstart); // control content dragging 1824 1825 self.onclick = (cap.isios) ? false : function(e) { 1826 if (self.lastmouseup) { 1827 self.lastmouseup = false; 1828 return self.cancelEvent(e); 1829 } else { 1830 return true; 1831 } 1832 }; 1833 1834 if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) { 1835 self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue}); 1836 self.css(self.rail,{'cursor':cap.cursorgrabvalue}); 1837 } 1838 1839 } else { 1840 1841 function checkSelectionScroll(e) { 1842 if (!self.selectiondrag) return; 1843 1844 if (e) { 1845 var ww = self.win.outerHeight(); 1846 var df = (e.pageY - self.selectiondrag.top); 1847 if (df>0&&df<ww) df=0; 1848 if (df>=ww) df-=ww; 1849 self.selectiondrag.df = df; 1850 } 1851 if (self.selectiondrag.df==0) return; 1852 1853 var rt = -Math.floor(self.selectiondrag.df/6)*2; 1854// self.doScrollTop(self.getScrollTop(true)+rt); 1855 self.doScrollBy(rt); 1856 1857 self.debounced("doselectionscroll",function(){checkSelectionScroll()},50); 1858 } 1859 1860 if ("getSelection" in document) { // A grade - Major browsers 1861 self.hasTextSelected = function() { 1862 return (document.getSelection().rangeCount>0); 1863 } 1864 } 1865 else if ("selection" in document) { //IE9- 1866 self.hasTextSelected = function() { 1867 return (document.selection.type != "None"); 1868 } 1869 } 1870 else { 1871 self.hasTextSelected = function() { // no support 1872 return false; 1873 } 1874 } 1875 1876 self.onselectionstart = function(e) { 1877 if (self.ispage) return; 1878 self.selectiondrag = self.win.offset(); 1879 } 1880 self.onselectionend = function(e) { 1881 self.selectiondrag = false; 1882 } 1883 self.onselectiondrag = function(e) { 1884 if (!self.selectiondrag) return; 1885 if (self.hasTextSelected()) self.debounced("selectionscroll",function(){checkSelectionScroll(e)},250); 1886 } 1887 1888 1889 } 1890 1891 if (cap.hasmstouch) { 1892 self.css(self.rail,{'-ms-touch-action':'none'}); 1893 self.css(self.cursor,{'-ms-touch-action':'none'}); 1894 1895 self.bind(self.win,"MSPointerDown",self.ontouchstart); 1896 self.bind(document,"MSPointerUp",self.ontouchend); 1897 self.bind(document,"MSPointerMove",self.ontouchmove); 1898 self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault()}); 1899 self.bind(self.cursor,"contextmenu",function(e){e.preventDefault()}); 1900 } 1901 1902 if (this.istouchcapable) { //desktop with screen touch enabled 1903 self.bind(self.win,"touchstart",self.ontouchstart); 1904 self.bind(document,"touchend",self.ontouchend); 1905 self.bind(document,"touchcancel",self.ontouchend); 1906 self.bind(document,"touchmove",self.ontouchmove); 1907 } 1908 1909 self.bind(self.cursor,"mousedown",self.onmousedown);
1910 self.bind(self.cursor,"mouseup",self.onmouseup); 1911 1912 if (self.railh) { 1913 self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)}); 1914 self.bind(self.cursorh,"mouseup",function(e){ 1915 if (self.rail.drag&&self.rail.drag.pt==2) return; 1916 self.rail.drag = false; 1917 self.hasmoving = false; 1918 self.hideCursor(); 1919 if (cap.hasmousecapture) document.releaseCapture(); 1920 return self.cancelEvent(e); 1921 }); 1922 } 1923 1924 if (self.opt.cursordragontouch||!cap.cantouch&&!self.opt.touchbehavior) { 1925 1926 self.rail.css({"cursor":"default"}); 1927 self.railh&&self.railh.css({"cursor":"default"}); 1928 1929 self.jqbind(self.rail,"mouseenter",function() { 1930 if (self.canshowonmouseevent) self.showCursor(); 1931 self.rail.active = true; 1932 }); 1933 self.jqbind(self.rail,"mouseleave",function() { 1934 self.rail.active = false; 1935 if (!self.rail.drag) self.hideCursor(); 1936 }); 1937 1938 if (self.opt.sensitiverail) { 1939 self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)}); 1940 self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)}); 1941 self.bind(self.cursor,"click",function(e){self.cancelEvent(e)}); 1942 self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)}); 1943 } 1944 1945 if (self.railh) { 1946 self.jqbind(self.railh,"mouseenter",function() { 1947 if (self.canshowonmouseevent) self.showCursor(); 1948 self.rail.active = true; 1949 }); 1950 self.jqbind(self.railh,"mouseleave",function() { 1951 self.rail.active = false; 1952 if (!self.rail.drag) self.hideCursor(); 1953 }); 1954 1955 if (self.opt.sensitiverail) { 1956 self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)}); 1957 self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) }); 1958 self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) }); 1959 self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) }); 1960 } 1961 1962 } 1963 1964 } 1965 1966 if (!cap.cantouch&&!self.opt.touchbehavior) { 1967 1968 self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.onmouseup); 1969 self.bind(document,"mousemove",self.onmousemove); 1970 if (self.onclick) self.bind(document,"click",self.onclick); 1971 1972 if (!self.ispage&&self.opt.enablescrollonselection) { 1973 self.bind(self.win[0],"mousedown",self.onselectionstart); 1974 self.bind(document,"mouseup",self.onselectionend); 1975 self.bind(self.cursor,"mouseup",self.onselectionend); 1976 if (self.cursorh) self.bind(self.cursorh,"mouseup",self.onselectionend); 1977 self.bind(document,"mousemove",self.onselectiondrag); 1978 } 1979 1980 if (self.zoom) { 1981 self.jqbind(self.zoom,"mouseenter",function() { 1982 if (self.canshowonmouseevent) self.showCursor(); 1983 self.rail.active = true; 1984 }); 1985 self.jqbind(self.zoom,"mouseleave",function() { 1986 self.rail.active = false; 1987 if (!self.rail.drag) self.hideCursor(); 1988 }); 1989 } 1990 1991 } else { 1992 1993 self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.ontouchend); 1994 self.bind(document,"mousemove",self.ontouchmove); 1995 if (self.onclick) self.bind(document,"click",self.onclick); 1996 1997 if (self.opt.cursordragontouch) { 1998 self.bind(self.cursor,"mousedown",self.onmousedown); 1999 self.bind(self.cursor,"mousemove",self.onmousemove); 2000 self.cursorh&&self.bind(self.cursorh,"mousedown",self.onmousedown); 2001 self.cursorh&&self.bind(self.cursorh,"mousemove",self.onmousemove); 2002 } 2003 2004 } 2005 2006 if (self.opt.enablemousewheel) { 2007 if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.win /*self.docscroll*/ ,"mousewheel",self.onmousewheel); 2008 self.bind(self.rail,"mousewheel",self.onmousewheel); 2009 if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr); 2010 } 2011 2012 if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) { 2013 if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++}); 2014 2015 self.jqbind(self.win,"focus",function(e) { 2016 domfocus = (self.getTarget(e)).id||true; 2017 self.hasfocus = true; 2018 if (self.canshowonmouseevent) self.noticeCursor(); 2019 }); 2020 self.jqbind(self.win,"blur",function(e) { 2021 domfocus = false; 2022 self.hasfocus = false; 2023 }); 2024 2025 self.jqbind(self.win,"mouseenter",function(e) { 2026 mousefocus = (self.getTarget(e)).id||true; 2027 self.hasmousefocus = true; 2028 if (self.canshowonmouseevent) self.noticeCursor(); 2029 }); 2030 self.jqbind(self.win,"mouseleave",function() { 2031 mousefocus = false; 2032 self.hasmousefocus = false; 2033 }); 2034 2035 }; 2036 2037 } // !ie9mobile 2038 2039 //Thanks to http://www.quirksmode.org !! 2040 self.onkeypress = function(e) { 2041 if (self.locked&&self.page.maxh==0) return true; 2042 2043 e = (e) ? e : window.e; 2044 var tg = self.getTarget(e); 2045 if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { 2046 var tp = tg.getAttribute('type')||tg.type||false; 2047 if ((!tp)||!(/submit|button|cancel/i.tp)) return true; 2048 } 2049 2050 if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) { 2051 var key = e.keyCode; 2052 2053 if (self.locked&&key!=27) return self.cancelEvent(e); 2054 2055 var ctrl = e.ctrlKey||false; 2056 var shift = e.shiftKey || false; 2057 2058 var ret = false; 2059 switch (key) { 2060 case 38: 2061 case 63233: //safari 2062 self.doScrollBy(24*3); 2063 ret = true; 2064 break; 2065 case 40: 2066 case 63235: //safari 2067 self.doScrollBy(-24*3); 2068 ret = true; 2069 break; 2070 case 37: 2071 case 63232: //safari 2072 if (self.railh) { 2073 (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3); 2074 ret = true; 2075 } 2076 break; 2077 case 39: 2078 case 63234: //safari 2079 if (self.railh) { 2080 (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3); 2081 ret = true; 2082 } 2083 break; 2084 case 33: 2085 case 63276: // safari 2086 self.doScrollBy(self.view.h); 2087 ret = true; 2088 break; 2089 case 34: 2090 case 63277: // safari 2091 self.doScrollBy(-self.view.h); 2092 ret = true; 2093 break; 2094 case 36: 2095 case 63273: // safari 2096 (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0); 2097 ret = true; 2098 break; 2099 case 35: 2100 case 63275: // safari 2101 (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh); 2102 ret = true; 2103 break; 2104 case 32: 2105 if (self.opt.spacebarenabled) { 2106 (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h); 2107 ret = true; 2108 } 2109 break; 2110 case 27: // ESC 2111 if (self.zoomactive) { 2112 self.doZoom(); 2113 ret = true; 2114 } 2115 break; 2116 } 2117 if (ret) return self.cancelEvent(e); 2118 } 2119 }; 2120 2121 if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress); 2122 2123 self.bind(window,'resize',self.lazyResize); 2124 self.bind(window,'orientationchange',self.lazyResize); 2125 2126 self.bind(window,"load",self.lazyResize); 2127 2128 if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 2129 var tmp=self.win.attr("style"); 2130 var ww = parseFloat(self.win.css("width"))+1; 2131 self.win.css('width',ww); 2132 self.synched("chromefix",function(){self.win.attr("style",tmp)}); 2133 } 2134 2135 2136// Trying a cross-browser implementation - good luck! 2137 2138 self.onAttributeChange = function(e) { 2139 self.lazyResize(250); 2140 } 2141 2142 if (!self.ispage&&!self.haswrapper) { 2143 // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content 2144 if (clsMutationObserver !== false) { 2145 self.observer = new clsMutationObserver(function(mutations) { 2146 mutations.forEach(self.onAttributeChange); 2147 }); 2148 self.observer.observe(self.win[0],{childList: true, characterData: false, attributes: true, subtree: false}); 2149 2150 self.observerremover = new clsMutationObserver(function(mutations) { 2151 mutations.forEach(function(mo){ 2152 if (mo.removedNodes.length>0) {
2153 for (var dd in mo.removedNodes) { 2154 if (mo.removedNodes[dd]==self.win[0]) return self.remove(); 2155 } 2156 } 2157 }); 2158 }); 2159 self.observerremover.observe(self.win[0].parentNode,{childList: true, characterData: false, attributes: false, subtree: false}); 2160 2161 } else { 2162 self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange); 2163 if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug 2164 self.bind(self.win,"DOMNodeRemoved",function(e){ 2165 if (e.target==self.win[0]) self.remove(); 2166 }); 2167 } 2168 } 2169 2170// 2171 2172 if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom); 2173 if (self.istextarea) self.bind(self.win,"mouseup",self.lazyResize); 2174 2175 self.checkrtlmode = true; 2176 self.lazyResize(30); 2177 2178 } 2179 2180 if (this.doc[0].nodeName == 'IFRAME') { 2181 function oniframeload(e) { 2182 self.iframexd = false; 2183 try { 2184 var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document; 2185 var a = doc.domain; 2186 } catch(e){self.iframexd = true;doc=false}; 2187 2188 if (self.iframexd) { 2189 if ("console" in window) console.log('NiceScroll error: policy restriced iframe'); 2190 return true; //cross-domain - I can't manage this 2191 } 2192 2193 self.forcescreen = true; 2194 2195 if (self.isiframe) { 2196 self.iframe = { 2197 "doc":$(doc), 2198 "html":self.doc.contents().find('html')[0], 2199 "body":self.doc.contents().find('body')[0] 2200 }; 2201 self.getContentSize = function(){ 2202 return { 2203 w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth), 2204 h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight) 2205 } 2206 } 2207 self.docscroll = $(self.iframe.body);//$(this.contentWindow); 2208 } 2209 2210 if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) { 2211 self.win.scrollTop(0); // reset position 2212 self.doc.height(""); //reset height to fix browser bug 2213 var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight); 2214 self.doc.height(hh); 2215 } 2216 self.lazyResize(30); 2217 2218 if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'}); 2219 //self.css($(doc.body),{'overflow-y':'hidden'}); 2220 self.css($(self.iframe.body),{'overflow-y':'hidden'}); 2221 2222 if (cap.isios&&self.haswrapper) { 2223 self.css($(doc.body),{'-webkit-transform':'translate3d(0,0,0)'}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ 2224 2225 console.log(1); 2226 2227 } 2228 2229 if ('contentWindow' in this) { 2230 self.bind(this.contentWindow,"scroll",self.onscroll); //IE8 & minor 2231 } else { 2232 self.bind(doc,"scroll",self.onscroll); 2233 } 2234 2235 if (self.opt.enablemousewheel) { 2236 self.bind(doc,"mousewheel",self.onmousewheel); 2237 } 2238 2239 if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress); 2240 2241 if (cap.cantouch||self.opt.touchbehavior) { 2242 self.bind(doc,"mousedown",self.ontouchstart); 2243 self.bind(doc,"mousemove",function(e){self.ontouchmove(e,true)}); 2244 if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue}); 2245 } 2246 2247 self.bind(doc,"mouseup",self.ontouchend); 2248 2249 if (self.zoom) { 2250 if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom); 2251 if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom); 2252 } 2253 }; 2254 2255 if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){ 2256 setTimeout(function(){oniframeload.call(self.doc[0],false)},500); 2257 } 2258 self.bind(this.doc,"load",oniframeload); 2259 2260 } 2261 2262 }; 2263 2264 this.showCursor = function(py,px) { 2265 if (self.cursortimeout) { 2266 clearTimeout(self.cursortimeout); 2267 self.cursortimeout = 0; 2268 } 2269 if (!self.rail) return; 2270 if (self.autohidedom) { 2271 self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax}); 2272 self.cursoractive = true; 2273 } 2274 2275 if (!self.rail.drag||self.rail.drag.pt!=1) { 2276 if ((typeof py != "undefined")&&(py!==false)) { 2277 self.scroll.y = Math.round(py * 1/self.scrollratio.y); 2278 } 2279 if (typeof px != "undefined") { 2280 self.scroll.x = Math.round(px * 1/self.scrollratio.x); 2281 } 2282 } 2283 2284 self.cursor.css({height:self.cursorheight,top:self.scroll.y}); 2285 if (self.cursorh) { 2286 (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x}); 2287 self.cursoractive = true; 2288 } 2289 2290 if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax}); 2291 }; 2292 2293 this.hideCursor = function(tm) { 2294 if (self.cursortimeout) return; 2295 if (!self.rail) return; 2296 if (!self.autohidedom) return; 2297 self.cursortimeout = setTimeout(function() { 2298 if (!self.rail.active||!self.showonmouseevent) { 2299 self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin}); 2300 if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin}); 2301 self.cursoractive = false; 2302 } 2303 self.cursortimeout = 0; 2304 }
2304,tm||self.opt.hidecursordelay); 2305 }; 2306 2307 this.noticeCursor = function(tm,py,px) { 2308 self.showCursor(py,px); 2309 if (!self.rail.active) self.hideCursor(tm); 2310 }; 2311 2312 this.getContentSize = 2313 (self.ispage) ? 2314 function(){ 2315 return { 2316 w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), 2317 h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) 2318 } 2319 } 2320 : (self.haswrapper) ? 2321 function(){ 2322 return { 2323 w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')), 2324 h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom')) 2325 } 2326 } 2327 : function() { 2328 return { 2329 w:self.docscroll[0].scrollWidth, 2330 h:self.docscroll[0].scrollHeight 2331 } 2332 }; 2333 2334 this.onResize = function(e,page) { 2335 2336 if (!self.win) return false; 2337 2338 if (!self.haswrapper&&!self.ispage) { 2339 if (self.win.css('display')=='none') { 2340 if (self.visibility) self.hideRail().hideRailHr(); 2341 return false; 2342 } else { 2343 if (!self.hidden&&!self.visibility) self.showRail().showRailHr(); 2344 } 2345 } 2346 2347 var premaxh = self.page.maxh;
2348 var premaxw = self.page.maxw; 2349 2350 var preview = {h:self.view.h,w:self.view.w}; 2351 2352 self.view = { 2353 w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth), 2354 h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight) 2355 }; 2356 2357 self.page = (page) ? page : self.getContentSize(); 2358 2359 self.page.maxh = Math.max(0,self.page.h - self.view.h); 2360 self.page.maxw = Math.max(0,self.page.w - self.view.w); 2361 2362 if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) { 2363 // test position 2364 if (!self.ispage) { 2365 var pos = self.win.offset(); 2366 if (self.lastposition) { 2367 var lst = self.lastposition; 2368 if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do 2369 } 2370 self.lastposition = pos; 2371 } else { 2372 return self; //nothing to do 2373 } 2374 } 2375 2376 if (self.page.maxh==0) { 2377 self.hideRail(); 2378 self.scrollvaluemax = 0; 2379 self.scroll.y = 0; 2380 self.scrollratio.y = 0; 2381 self.cursorheight = 0; 2382 self.setScrollTop(0); 2383 self.rail.scrollable = false; 2384 } else { 2385 self.rail.scrollable = true; 2386 } 2387 2388 if (self.page.maxw==0) { 2389 self.hideRailHr(); 2390 self.scrollvaluemaxw = 0; 2391 self.scroll.x = 0; 2392 self.scrollratio.x = 0; 2393 self.cursorwidth = 0; 2394 self.setScrollLeft(0); 2395 self.railh.scrollable = false; 2396 } else { 2397 self.railh.scrollable = true; 2398 } 2399 2400 self.locked = (self.page.maxh==0)&&(self.page.maxw==0); 2401 if (self.locked) { 2402 if (!self.ispage) self.updateScrollBar(self.view); 2403 return false; 2404 } 2405 2406 if (!self.hidden&&!self.visibility) { 2407 self.showRail().showRailHr(); 2408 } 2409 else if (!self.hidden&&!self.railh.visibility) self.showRailHr(); 2410 2411 if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20; 2412 2413 self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h))); 2414 self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight); 2415 2416 self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w))); 2417 self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth); 2418 2419 self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder; 2420 2421 if (self.railh) { 2422 self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w; 2423 self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder; 2424 } 2425 2426 if (self.checkrtlmode&&self.railh) { 2427 self.checkrtlmode = false; 2428 if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw); 2429 } 2430 2431 if (!self.ispage) self.updateScrollBar(self.view); 2432 2433 self.scrollratio = { 2434 x:(self.page.maxw/self.scrollvaluemaxw), 2435 y:(self.page.maxh/self.scrollvaluemax) 2436 }; 2437 2438 var sy = self.getScrollTop(); 2439 if (sy>self.page.maxh) { 2440 self.doScrollTop(self.page.maxh); 2441 } else { 2442 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 2443 self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 2444 if (self.cursoractive) self.noticeCursor(); 2445 } 2446 2447 if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y)); 2448 2449 return self; 2450 }; 2451 2452 this.resize = self.onResize; 2453 2454 this.lazyResize = function(tm) { // event debounce 2455 tm = (isNaN(tm)) ? 30 : tm; 2456 self.delayed('resize',self.resize,tm); 2457 return self; 2458 } 2459 2460// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel 2461 function _modernWheelEvent(dom,name,fn,bubble) { 2462 self._bind(dom,name,function(e){
2463 var e = (e) ? e : window.event; 2464 var event = { 2465 original: e, 2466 target: e.target || e.srcElement, 2467 type: "wheel", 2468 deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, 2469 deltaX: 0, 2470 deltaZ: 0, 2471 preventDefault: function() { 2472 e.preventDefault ? e.preventDefault() : e.returnValue = false; 2473 return false; 2474 }, 2475 stopImmediatePropagation: function() { 2476 (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true; 2477 } 2478 }; 2479 2480 if (name=="mousewheel") { 2481 event.deltaY = - 1/40 * e.wheelDelta; 2482 e.wheelDeltaX && (event.deltaX = - 1/40 * e.wheelDeltaX); 2483 } else { 2484 event.deltaY = e.detail; 2485 } 2486 2487 return fn.call(dom,event); 2488 },bubble); 2489 }; 2490 2491 this._bind = function(el,name,fn,bubble) { // primitive bind 2492 self.events.push({e:el,n:name,f:fn,b:bubble,q:false}); 2493 if (el.addEventListener) { 2494 el.addEventListener(name,fn,bubble||false); 2495 } 2496 else if (el.attachEvent) { 2497 el.attachEvent("on"+name,fn); 2498 } 2499 else { 2500 el["on"+name] = fn; 2501 } 2502 }; 2503 2504 this.jqbind = function(dom,name,fn) { // use jquery bind for non-native events (mouseenter/mouseleave) 2505 self.events.push({e:dom,n:name,f:fn,q:true}); 2506 $(dom).bind(name,fn); 2507 } 2508 2509 this.bind = function(dom,name,fn,bubble) { // touch-oriented & fixing jquery bind 2510 var el = ("jquery" in dom) ? dom[0] : dom; 2511 2512 if (name=='mousewheel') { 2513 if ("onwheel" in self.win) { 2514 self._bind(el,"wheel",fn,bubble||false); 2515 } else { 2516 var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox 2517 _modernWheelEvent(el,wname,fn,bubble||false); 2518 if (wname=="DOMMouseScroll") _modernWheelEvent(el,"MozMousePixelScroll",fn,bubble||false); // Firefox legacy 2519 } 2520 } 2521 else if (el.addEventListener) { 2522 if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support 2523 var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove'; 2524 self._bind(el,tt,function(e){ 2525 if (e.touches) { 2526 if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);} 2527 } 2528 else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);} //blackberry 2529 },bubble||false); 2530 } 2531 self._bind(el,name,fn,bubble||false); 2532 if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false); 2533 } 2534 else { 2535 self._bind(el,name,function(e) { 2536 e = e||window.event||false; 2537 if (e) { 2538 if (e.srcElement) e.target=e.srcElement; 2539 } 2540 if (!("pageY" in e)) { 2541 e.pageX = e.clientX + document.documentElement.scrollLeft; 2542 e.pageY = e.clientY + document.documentElement.scrollTop; 2543 } 2544 return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true; 2545 }); 2546 } 2547 }; 2548 2549 this._unbind = function(el,name,fn,bub) { // primitive unbind 2550 if (el.removeEventListener) { 2551 el.removeEventListener(name,fn,bub); 2552 } 2553 else if (el.detachEvent) { 2554 el.detachEvent('on'+name,fn); 2555 } else { 2556 el['on'+name] = false; 2557 } 2558 }; 2559 2560 this.unbindAll = function() { 2561 for(var a=0;a<self.events.length;a++) { 2562 var r = self.events[a]; 2563 (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b); 2564 } 2565 }; 2566 2567 // Thanks to http://www.switchonthecode.com !! 2568 this.cancelEvent = function(e) { 2569 var e = (e.original) ? e.original : (e) ? e : window.event||false; 2570 if (!e) return false; 2571 if(e.preventDefault) e.preventDefault(); 2572 if(e.stopPropagation) e.stopPropagation(); 2573 if(e.preventManipulation) e.preventManipulation(); //IE10 2574 e.cancelBubble = true; 2575 e.cancel = true; 2576 e.returnValue = false; 2577 return false; 2578 }; 2579 2580 this.stopPropagation = function(e) { 2581 var e = (e.original) ? e.original : (e) ? e : window.event||false; 2582 if (!e) return false; 2583 if (e.stopPropagation) return e.stopPropagation(); 2584 if (e.cancelBubble) e.cancelBubble=true; 2585 return false; 2586 } 2587 2588 this.showRail = function() { 2589 if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) { 2590 self.visibility = true; 2591 self.rail.visibility = true; 2592 self.rail.css('display','block'); 2593 } 2594 return self; 2595 }; 2596 2597 this.showRailHr = function() { 2598 if (!self.railh) return self; 2599 if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) { 2600 self.railh.visibility = true; 2601 self.railh.css('display','block'); 2602 } 2603 return self; 2604 }; 2605 2606 this.hideRail = function() { 2607 self.visibility = false; 2608 self.rail.visibility = false; 2609 self.rail.css('display','none'); 2610 return self; 2611 }; 2612 2613 this.hideRailHr = function() { 2614 if (!self.railh) return self; 2615 self.railh.visibility = false; 2616 self.railh.css('display','none'); 2617 return self; 2618 }; 2619 2620 this.show = function() { 2621 self.hidden = false; 2622 self.locked = false; 2623 return self.showRail().showRailHr(); 2624 }; 2625 2626 this.hide = function() { 2627 self.hidden = true; 2628 self.locked = true; 2629 return self.hideRail().hideRailHr(); 2630 }; 2631 2632 this.toggle = function() { 2633 return (self.hidden) ? self.show() : self.hide(); 2634 }; 2635 2636 this.remove = function() { 2637 self.stop(); 2638 if (self.cursortimeout) clearTimeout(self.cursortimeout); 2639 self.doZoomOut(); 2640 self.unbindAll(); 2641 2642 if (cap.isie9) self.win[0].detachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug 2643 2644 if (self.observer !== false) self.observer.disconnect(); 2645 if (self.observerremover !== false) self.observerremover.disconnect(); 2646 2647 self.events = null; 2648 2649 if (self.cursor) { 2650 self.cursor.remove(); 2651 } 2652 if (self.cursorh) { 2653 self.cursorh.remove(); 2654 } 2655 if (self.rail) { 2656 self.rail.remove(); 2657 } 2658 if (self.railh) { 2659 self.railh.remove(); 2660 } 2661 if (self.zoom) { 2662 self.zoom.remove(); 2663 } 2664 for(var a=0;a<self.saved.css.length;a++) { 2665 var d=self.saved.css[a]; 2666 d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]); 2667 } 2668 self.saved = false; 2669 self.me.data('__nicescroll',''); //erase all traces 2670 2671 // memory leak fixed by GianlucaGuarini - thanks a lot! 2672 // remove the current nicescroll from the $.nicescroll array & normalize array 2673 var lst = $.nicescroll; 2674 lst.each(function(i){ 2675 if (!this) return; 2676 if(this.id === self.id) { 2677 delete lst[i]; 2678 for(var b=++i;b<lst.length;b++,i++) lst[i]=lst[b]; 2679 lst.length--; 2680 if (lst.length) delete lst[lst.length]; 2681 } 2682 }); 2683 2684 for (var i in self) { 2685 self[i] = null; 2686 delete self[i]; 2687 } 2688 2689 self = null; 2690 2691 }; 2692 2693 this.scrollstart = function(fn) { 2694 this.onscrollstart = fn; 2695 return self; 2696 } 2697 this.scrollend = function(fn) { 2698 this.onscrollend = fn; 2699 return self; 2700 } 2701 this.scrollcancel = function(fn) { 2702 this.onscrollcancel = fn; 2703 return self; 2704 } 2705 2706 this.zoomin = function(fn) { 2707 this.onzoomin = fn; 2708 return self; 2709 } 2710 this.zoomout = function(fn) { 2711 this.onzoomout = fn; 2712 return self; 2713 } 2714 2715 this.isScrollable = function(e) { 2716 var dom = (e.target) ? e.target : e; 2717 if (dom.nodeName == 'OPTION') return true; 2718 while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { 2719 var dd = $(dom); 2720 var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; 2721 if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight); 2722 dom = (dom.parentNode) ? dom.parentNode : false; 2723 } 2724 return false; 2725 }; 2726 2727 this.getViewport = function(me) { 2728 var dom = (me&&me.parentNode) ? me.parentNode : false; 2729 while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { 2730 var dd = $(dom); 2731 var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; 2732 if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd; 2733 if (dd.getNiceScroll().length>0) return dd; 2734 dom = (dom.parentNode) ? dom.parentNode : false; 2735 } 2736 return false; 2737 }; 2738 2739 function execScrollWheel(e,hr,chkscroll) { 2740 var px,py; 2741 var rt = 1; 2742 2743 if (e.deltaMode==0) { // PIXEL 2744 px = -Math.floor(e.deltaX*(self.opt.mousescrollstep/(18*3))); 2745 py = -Math.floor(e.deltaY*(self.opt.mousescrollstep/(18*3))); 2746 } 2747 else if (e.deltaMode==1) { // LINE 2748 px = -Math.floor(e.deltaX*self.opt.mousescrollstep); 2749 py = -Math.floor(e.deltaY*self.opt.mousescrollstep); 2750 } 2751 2752 if (hr&&self.opt.oneaxismousemode&&(px==0)&&py) { // classic vertical-only mousewheel + browser with x/y support 2753 px = py; 2754 py = 0; 2755 } 2756 2757 if (px) { 2758 if (self.scrollmom) {self.scrollmom.stop()} 2759 self.lastdeltax+=px; 2760 self.debounced("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}},120); 2761 } 2762 if (py) { 2763 if (self.opt.nativeparentscrolling&&chkscroll&&!self.ispage&&!self.zoomactive) { 2764 if (py<0) { 2765 if (self.getScrollTop()>=self.page.maxh) return true; 2766 } else { 2767 if (self.getScrollTop()<=0) return true; 2768 } 2769 } 2770 if (self.scrollmom) {self.scrollmom.stop()} 2771 self.lastdeltay+=py; 2772 self.debounced("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}},120); 2773 } 2774 2775 e.stopImmediatePropagation(); 2776 return e.preventDefault(); 2777// return self.cancelEvent(e); 2778 }; 2779 2780 this.onmousewheel = function(e) { 2781 if (self.locked) { 2782 self.debounced("checkunlock",self.resize,250); 2783 return true; 2784 } 2785 if (self.rail.drag) return self.cancelEvent(e); 2786 2787 if (self.opt.oneaxismousemode=="auto"&&e.deltaX!=0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) 2788 2789 if (self.opt.oneaxismousemode&&e.deltaX==0) { 2790 if (!self.rail.scrollable) { 2791 if (self.railh&&self.railh.scrollable) { 2792 return self.onmousewheelhr(e); 2793 } else { 2794 return true; 2795 } 2796 } 2797 } 2798 2799 var nw = +(new Date()); 2800 var chk = false; 2801 if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { 2802// self.checkarea = false; 2803 self.nativescrollingarea = self.isScrollable(e); 2804 chk = true; 2805 } 2806 self.checkarea = nw; 2807 if (self.nativescrollingarea) return true; // this isn't my business 2808// if (self.locked) return self.cancelEvent(e); 2809 var ret = execScrollWheel(e,false,chk); 2810 if (ret) self.checkarea = 0; 2811 return ret; 2812 }; 2813 2814 this.onmousewheelhr = function(e) { 2815 if (self.locked||!self.railh.scrollable) return true; 2816 if (self.rail.drag) return self.cancelEvent(e); 2817 2818 var nw = +(new Date()); 2819 var chk = false; 2820 if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { 2821// self.checkarea = false; 2822 self.nativescrollingarea = self.isScrollable(e); 2823 chk = true; 2824 } 2825 self.checkarea = nw; 2826 if (self.nativescrollingarea) return true; // this isn't my business 2827 if (self.locked) return self.cancelEvent(e); 2828 2829 return execScrollWheel(e,true,chk); 2830 }; 2831 2832 this.stop = function() { 2833 self.cancelScroll(); 2834 if (self.scrollmon) self.scrollmon.stop(); 2835 self.cursorfreezed = false; 2836 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 2837 self.noticeCursor(); 2838 return self; 2839 }; 2840 2841 this.getTransitionSpeed = function(dif) { 2842 var sp = Math.round(self.opt.scrollspeed*10); 2843 var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed)); 2844 return (ex>
284420) ? ex : 0; 2845 } 2846 2847 if (!self.opt.smoothscroll) { 2848 this.doScrollLeft = function(x,spd) { //direct 2849 var y = self.getScrollTop(); 2850 self.doScrollPos(x,y,spd); 2851 } 2852 this.doScrollTop = function(y,spd) { //direct 2853 var x = self.getScrollLeft(); 2854 self.doScrollPos(x,y,spd); 2855 } 2856 this.doScrollPos = function(x,y,spd) { //direct 2857 var nx = (x>self.page.maxw) ? self.page.maxw : x; 2858 if (nx<0) nx=0; 2859 var ny = (y>self.page.maxh) ? self.page.maxh : y; 2860 if (ny<0) ny=0; 2861 self.synched('scroll',function(){ 2862 self.setScrollTop(ny); 2863 self.setScrollLeft(nx); 2864 }); 2865 } 2866 this.cancelScroll = function() {}; // direct 2867 } 2868 else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) { 2869 this.prepareTransition = function(dif,istime) { 2870 var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif); 2871 var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : ''; 2872 if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) { 2873 self.lasttransitionstyle = trans; 2874 self.doc.css(cap.transitionstyle,trans); 2875 } 2876 return ex; 2877 }; 2878 2879 this.doScrollLeft = function(x,spd) { //trans 2880 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 2881 self.doScrollPos(x,y,spd); 2882 } 2883 2884 this.doScrollTop = function(y,spd) { //trans 2885 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 2886 self.doScrollPos(x,y,spd); 2887 } 2888 2889 this.doScrollPos = function(x,y,spd) { //trans 2890 2891 var py = self.getScrollTop(); 2892 var px = self.getScrollLeft(); 2893 2894 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 2895 2896 if (self.opt.bouncescroll==false) { 2897 if (y<0) y=0; 2898 else if (y>self.page.maxh) y=self.page.maxh;
2899 if (x<0) x=0; 2900 else if (x>self.page.maxw) x=self.page.maxw; 2901 } 2902 2903 if (self.scrollrunning&&x==self.newscrollx&&y==self.newscrolly) return false; 2904 2905 self.newscrolly = y; 2906 self.newscrollx = x; 2907 2908 self.newscrollspeed = spd||false; 2909 2910 if (self.timer) return false; 2911 2912 self.timer = setTimeout(function(){ 2913 2914 var top = self.getScrollTop(); 2915 var lft = self.getScrollLeft(); 2916 2917 var dst = {}; 2918 dst.x = x-lft; 2919 dst.y = y-top; 2920 dst.px = lft; 2921 dst.py = top; 2922 2923 var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2))); 2924 2925// var df = (self.newscrollspeed) ? self.newscrollspeed : dd; 2926 2927 var ms = (self.newscrollspeed && self.newscrollspeed>1) ? self.newscrollspeed : self.getTransitionSpeed(dd); 2928 if (self.newscrollspeed&&self.newscrollspeed<=1) ms*=self.newscrollspeed; 2929 2930 self.prepareTransition(ms,true); 2931 2932 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 2933 2934 if (ms>0) { 2935 2936 if (!self.scrollrunning&&self.onscrollstart) { 2937 var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 2938 self.onscrollstart.call(self,info); 2939 } 2940 2941 if (cap.transitionend) { 2942 if (!self.scrollendtrapped) { 2943 self.scrollendtrapped = true; 2944 self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!! 2945 } 2946 } else { 2947 if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); 2948 self.scrollendtrapped = setTimeout(self.onScrollEnd,ms); // simulate transitionend event 2949 } 2950 2951 var py = top; 2952 var px = lft; 2953 self.timerscroll = { 2954 bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1), 2955 bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1) 2956 }; 2957 if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60); 2958 2959 } 2960 2961 self.synched("doScroll-set",function(){ 2962 self.timer = 0; 2963 if (self.scrollendtrapped) self.scrollrunning = true; 2964 self.setScrollTop(self.newscrolly); 2965 self.setScrollLeft(self.newscrollx); 2966 if (!self.scrollendtrapped) self.onScrollEnd(); 2967 }); 2968 2969 2970 },50); 2971 2972 }; 2973 2974 this.cancelScroll = function() { 2975 if (!self.scrollendtrapped) return true; 2976 var py = self.getScrollTop(); 2977 var px = self.getScrollLeft(); 2978 self.scrollrunning = false; 2979 if (!cap.transitionend) clearTimeout(cap.transitionend); 2980 self.scrollendtrapped = false; 2981 self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 2982 self.prepareTransition(0); 2983 self.setScrollTop(py); // fire event onscroll 2984 if (self.railh) self.setScrollLeft(px); 2985 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 2986 self.timerscroll = false; 2987 2988 self.cursorfreezed = false; 2989 2990 //self.noticeCursor(false,py,px); 2991 self.showCursor(py,px); 2992 return self; 2993 }; 2994 this.onScrollEnd = function() { 2995 if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 2996 self.scrollendtrapped = false; 2997 self.prepareTransition(0); 2998 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 2999 self.timerscroll = false; 3000 var py = self.getScrollTop(); 3001 var px = self.getScrollLeft(); 3002 self.setScrollTop(py); // fire event onscroll 3003 if (self.railh) self.setScrollLeft(px); // fire event onscroll left 3004 3005 self.noticeCursor(false,py,px); 3006 3007 self.cursorfreezed = false; 3008 3009 if (py<0) py=0 3010 else if (py>self.page.maxh) py=self.page.maxh;
3011 if (px<0) px=0 3012 else if (px>self.page.maxw) px=self.page.maxw; 3013 if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed); 3014 3015 if (self.onscrollend&&self.scrollrunning) { 3016 var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 3017 self.onscrollend.call(self,info); 3018 } 3019 self.scrollrunning = false; 3020 3021 }; 3022 3023 } else { 3024 3025 this.doScrollLeft = function(x,spd) { //no-trans 3026 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 3027 self.doScrollPos(x,y,spd); 3028 } 3029 3030 this.doScrollTop = function(y,spd) { //no-trans 3031 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 3032 self.doScrollPos(x,y,spd); 3033 } 3034 3035 this.doScrollPos = function(x,y,spd) { //no-trans 3036 var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y; 3037 3038 if ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true; 3039 3040 if (self.timer) clearAnimationFrame(self.timer); 3041 self.timer = 0; 3042 3043 var py = self.getScrollTop(); 3044 var px = self.getScrollLeft(); 3045 3046 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 3047 3048 self.newscrolly = y; 3049 self.newscrollx = x; 3050 3051 if (!self.bouncescroll||!self.rail.visibility) { 3052 if (self.newscrolly<0) { 3053 self.newscrolly = 0; 3054 } 3055 else if (self.newscrolly>self.page.maxh) { 3056 self.newscrolly = self.page.maxh;
3057 } 3058 } 3059 if (!self.bouncescroll||!self.railh.visibility) { 3060 if (self.newscrollx<0) { 3061 self.newscrollx = 0; 3062 } 3063 else if (self.newscrollx>self.page.maxw) { 3064 self.newscrollx = self.page.maxw; 3065 } 3066 } 3067 3068 self.dst = {}; 3069 self.dst.x = x-px; 3070 self.dst.y = y-py; 3071 self.dst.px = px; 3072 self.dst.py = py; 3073 3074 var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2))); 3075 3076 self.dst.ax = self.dst.x / dst; 3077 self.dst.ay = self.dst.y / dst; 3078 3079 var pa = 0; 3080 var pe = dst; 3081 3082 if (self.dst.x==0) { 3083 pa = py; 3084 pe = y; 3085 self.dst.ay = 1; 3086 self.dst.py = 0; 3087 } else if (self.dst.y==0) { 3088 pa = px; 3089 pe = x; 3090 self.dst.ax = 1; 3091 self.dst.px = 0; 3092 } 3093 3094 var ms = self.getTransitionSpeed(dst); 3095 if (spd&&spd<=1) ms*=spd; 3096 if (ms>0) { 3097 self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1); 3098 } else { 3099 self.bzscroll = false; 3100 } 3101 3102 if (self.timer) return; 3103 3104 if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize(); 3105 3106 var sync = 1; 3107 3108 function scrolling() { 3109 if (self.cancelAnimationFrame) return true; 3110 3111 self.scrollrunning = true; 3112 3113 sync = 1-sync; 3114 if (sync) return (self.timer = setAnimationFrame(scrolling)||1); 3115 3116 var done = 0; 3117 3118 var sc = sy = self.getScrollTop(); 3119 if (self.dst.ay) { 3120 sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly; 3121 var dr=sc-sy; 3122 if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly; 3123 self.setScrollTop(sc); 3124 if (sc == self.newscrolly) done=1; 3125 } else { 3126 done=1; 3127 } 3128 3129 var scx = sx = self.getScrollLeft(); 3130 if (self.dst.ax) { 3131 scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx; 3132 var dr=scx-sx; 3133 if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx; 3134 self.setScrollLeft(scx); 3135 if (scx == self.newscrollx) done+=1; 3136 } else { 3137 done+=1; 3138 } 3139 3140 if (done==2) { 3141 self.timer = 0; 3142 self.cursorfreezed = false; 3143 self.bzscroll = false; 3144 self.scrollrunning = false; 3145 if (sc<0) sc=0; 3146 else if (sc>self.page.maxh) sc=self.page.maxh;
3147 if (scx<0) scx=0; 3148 else if (scx>self.page.maxw) scx=self.page.maxw; 3149 if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc); 3150 else { 3151 if (self.onscrollend) { 3152 var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 3153 self.onscrollend.call(self,info); 3154 } 3155 } 3156 } else { 3157 self.timer = setAnimationFrame(scrolling)||1; 3158 } 3159 }; 3160 self.cancelAnimationFrame=false; 3161 self.timer = 1; 3162 3163 if (self.onscrollstart&&!self.scrollrunning) { 3164 var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 3165 self.onscrollstart.call(self,info); 3166 } 3167 3168 scrolling(); 3169 3170 if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize(); 3171 3172 self.noticeCursor(); 3173 }; 3174 3175 this.cancelScroll = function() { 3176 if (self.timer) clearAnimationFrame(self.timer); 3177 self.timer = 0; 3178 self.bzscroll = false; 3179 self.scrollrunning = false; 3180 return self; 3181 }; 3182 3183 } 3184 3185 this.doScrollBy = function(stp,relative) { 3186 var ny = 0; 3187 if (relative) { 3188 ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y) 3189 } else { 3190 var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true); 3191 ny = sy-stp; 3192 } 3193 if (self.bouncescroll) { 3194 var haf = Math.round(self.view.h/2); 3195 if (ny<-haf) ny=-haf 3196 else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf); 3197 } 3198 self.cursorfreezed = false; 3199 3200 py = self.getScrollTop(true); 3201 if (ny<0&&py<=0) return self.noticeCursor(); 3202 else if (ny>self.page.maxh&&py>=self.page.maxh) { 3203 self.checkContentSize(); 3204 return self.noticeCursor(); 3205 } 3206 3207 self.doScrollTop(ny); 3208 }; 3209 3210 this.doScrollLeftBy = function(stp,relative) { 3211 var nx = 0; 3212 if (relative) { 3213 nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x) 3214 } else { 3215 var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true); 3216 nx = sx-stp; 3217 } 3218 if (self.bouncescroll) { 3219 var haf = Math.round(self.view.w/2); 3220 if (nx<-haf) nx=-haf 3221 else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf); 3222 } 3223 self.cursorfreezed = false; 3224 3225 px = self.getScrollLeft(true); 3226 if (nx<0&&px<=0) return self.noticeCursor(); 3227 else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor(); 3228 3229 self.doScrollLeft(nx); 3230 }; 3231 3232 this.doScrollTo = function(pos,relative) { 3233 var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos; 3234 if (ny<0) ny=0 3235 else if (ny>self.page.maxh) ny = self.page.maxh;
3236 self.cursorfreezed = false; 3237 self.doScrollTop(pos); 3238 }; 3239 3240 this.checkContentSize = function() { 3241 var pg = self.getContentSize(); 3242 if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg); 3243 }; 3244 3245 self.onscroll = function(e) { 3246 if (self.rail.drag) return; 3247 if (!self.cursorfreezed) { 3248 self.synched('scroll',function(){ 3249 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 3250 if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 3251 self.noticeCursor(); 3252 }); 3253 } 3254 }; 3255 self.bind(self.docscroll,"scroll",self.onscroll); 3256 3257 this.doZoomIn = function(e) { 3258 if (self.zoomactive) return; 3259 self.zoomactive = true; 3260 3261 self.zoomrestore = { 3262 style:{} 3263 }; 3264 var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight']; 3265 var win = self.win[0].style; 3266 for(var a in lst) { 3267 var pp = lst[a]; 3268 self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : ''; 3269 } 3270 3271 self.zoomrestore.style.width = self.win.css('width'); 3272 self.zoomrestore.style.height = self.win.css('height'); 3273 3274 self.zoomrestore.padding = { 3275 w:self.win.outerWidth()-self.win.width(), 3276 h:self.win.outerHeight()-self.win.height() 3277 }; 3278 3279 if (cap.isios4) { 3280 self.zoomrestore.scrollTop = $(window).scrollTop(); 3281 $(window).scrollTop(0); 3282 } 3283 3284 self.win.css({ 3285 "position":(cap.isios4)?"absolute":"fixed", 3286 "top":0, 3287 "left":0, 3288 "z-index":globalmaxzindex+100, 3289 "margin":"0px" 3290 }); 3291 var bkg = self.win.css("backgroundColor"); 3292 if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff"); 3293 self.rail.css({"z-index":globalmaxzindex+101}); 3294 self.zoom.css({"z-index":globalmaxzindex+102}); 3295 self.zoom.css('backgroundPosition','0px -18px'); 3296 self.resizeZoom(); 3297 3298 if (self.onzoomin) self.onzoomin.call(self); 3299 3300 return self.cancelEvent(e); 3301 }; 3302 3303 this.doZoomOut = function(e) { 3304 if (!self.zoomactive) return; 3305 self.zoomactive = false; 3306 3307 self.win.css("margin",""); 3308 self.win.css(self.zoomrestore.style); 3309 3310 if (cap.isios4) { 3311 $(window).scrollTop(self.zoomrestore.scrollTop); 3312 } 3313 3314 self.rail.css({"z-index":self.zindex}); 3315 self.zoom.css({"z-index":self.zindex}); 3316 self.zoomrestore = false; 3317 self.zoom.css('backgroundPosition','0px 0px'); 3318 self.onResize(); 3319 3320 if (self.onzoomout) self.onzoomout.call(self); 3321 3322 return self.cancelEvent(e); 3323 }; 3324 3325 this.doZoom = function(e) { 3326 return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); 3327 }; 3328 3329 this.resizeZoom = function() { 3330 if (!self.zoomactive) return; 3331 3332 var py = self.getScrollTop(); //preserve scrolling position 3333 self.win.css({ 3334 width:$(window).width()-self.zoomrestore.padding.w+"px", 3335 height:$(window).height()-self.zoomrestore.padding.h+"px" 3336 }); 3337 self.onResize(); 3338 3339 self.setScrollTop(Math.min(self.page.maxh,py)); 3340 }; 3341 3342 this.init(); 3343 3344 $.nicescroll.push(this); 3345 3346 }; 3347 3348// Inspired by the work of Kin Blas 3349// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js 3350 3351 3352 var ScrollMomentumClass2D = function(nc) { 3353 var self = this; 3354 this.nc = nc; 3355 3356 this.lastx = 0; 3357 this.lasty = 0; 3358 this.speedx = 0; 3359 this.speedy = 0; 3360 this.lasttime = 0; 3361 this.steptime = 0; 3362 this.snapx = false; 3363 this.snapy = false; 3364 this.demulx = 0; 3365 this.demuly = 0; 3366 3367 this.lastscrollx = -1; 3368 this.lastscrolly = -1; 3369 3370 this.chkx = 0; 3371 this.chky = 0; 3372 3373 this.timer = 0; 3374 3375 this.time = function() { 3376 return +new Date();//beautifull hack 3377 }; 3378 3379 this.reset = function(px,py) { 3380 self.stop(); 3381 var now = self.time(); 3382 self.steptime = 0; 3383 self.lasttime = now; 3384 self.speedx = 0; 3385 self.speedy = 0; 3386 self.lastx = px; 3387 self.lasty = py; 3388 self.lastscrollx = -1; 3389 self.lastscrolly = -1; 3390 }; 3391 3392 this.update = function(px,py) { 3393 var now = self.time();
vendor: 1,665 bytes, lines 3394-3457
3394 self.steptime = now - self.lasttime; 3395 self.lasttime = now; 3396 var dy = py - self.lasty; 3397 var dx = px - self.lastx; 3398 var sy = self.nc.getScrollTop(); 3399 var sx = self.nc.getScrollLeft(); 3400 var newy = sy + dy; 3401 var newx = sx + dx; 3402 self.snapx = (newx<0)||(newx>self.nc.page.maxw); 3403 self.snapy = (newy<0)||(newy>self.nc.page.maxh); 3404 self.speedx = dx; 3405 self.speedy = dy; 3406 self.lastx = px; 3407 self.lasty = py; 3408 }; 3409 3410 this.stop = function() { 3411 self.nc.unsynched("domomentum2d"); 3412 if (self.timer) clearTimeout(self.timer); 3413 self.timer = 0; 3414 self.lastscrollx = -1; 3415 self.lastscrolly = -1; 3416 }; 3417 3418 this.doSnapy = function(nx,ny) { 3419 var snap = false; 3420 3421 if (ny<0) { 3422 ny=0; 3423 snap=true; 3424 } 3425 else if (ny>self.nc.page.maxh) { 3426 ny=self.nc.page.maxh; 3427 snap=true; 3428 } 3429 3430 if (nx<0) { 3431 nx=0; 3432 snap=true; 3433 } 3434 else if (nx>self.nc.page.maxw) { 3435 nx=self.nc.page.maxw; 3436 snap=true; 3437 } 3438 3439 if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed); 3440 }; 3441 3442 this.doMomentum = function(gp) { 3443 var t = self.time(); 3444 var l = (gp) ? t+gp : self.lasttime; 3445 3446 var sl = self.nc.getScrollLeft(); 3447 var st = self.nc.getScrollTop(); 3448 3449 var pageh = self.nc.page.maxh; 3450 var pagew = self.nc.page.maxw; 3451 3452 self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0; 3453 self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0; 3454 3455 var chk = l && (t - l) <= 60; 3456 3457 if ((st<0)||(st>pageh)||(sl<0)||(sl>
3457pagew)) chk = false; 3458 3459 var sy = (self.speedy && chk) ? self.speedy : false; 3460 var sx = (self.speedx && chk) ? self.speedx : false; 3461 3462 if (sy||sx) { 3463 var tm = Math.max(16,self.steptime); //timeout granularity 3464 3465 if (tm>50) { // do smooth 3466 var xm = tm/50; 3467 self.speedx*=xm; 3468 self.speedy*=xm; 3469 tm = 50; 3470 } 3471 3472 self.demulxy = 0; 3473 3474 self.lastscrollx = self.nc.getScrollLeft(); 3475 self.chkx = self.lastscrollx; 3476 self.lastscrolly = self.nc.getScrollTop(); 3477 self.chky = self.lastscrolly; 3478 3479 var nx = self.lastscrollx; 3480 var ny = self.lastscrolly; 3481 3482 var onscroll = function(){ 3483 var df = ((self.time()-t)>600) ? 0.04 : 0.02; 3484 3485 if (self.speedx) { 3486 nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy))); 3487 self.lastscrollx = nx; 3488 if ((nx<0)||(nx>pagew)) df=0.10; 3489 } 3490 3491 if (self.speedy) { 3492 ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy))); 3493 self.lastscrolly = ny; 3494 if ((ny<0)||(ny>pageh)) df=0.10; 3495 } 3496 3497 self.demulxy = Math.min(1,self.demulxy+df); 3498 3499 self.nc.synched("domomentum2d",function(){ 3500 3501 if (self.speedx) { 3502 var scx = self.nc.getScrollLeft(); 3503 if (scx!=self.chkx) self.stop(); 3504 self.chkx=nx; 3505 self.nc.setScrollLeft(nx); 3506 } 3507 3508 if (self.speedy) { 3509 var scy = self.nc.getScrollTop(); 3510 if (scy!=self.chky) self.stop(); 3511 self.chky=ny; 3512 self.nc.setScrollTop(ny); 3513 } 3514 3515 if(!self.timer) { 3516 self.nc.hideCursor(); 3517 self.doSnapy(nx,ny); 3518 } 3519 3520 }); 3521 3522 if (self.demulxy<1) { 3523 self.timer = setTimeout(onscroll,tm); 3524 } else { 3525 self.stop(); 3526 self.nc.hideCursor(); 3527 self.doSnapy(nx,ny); 3528 } 3529 }; 3530 3531 onscroll(); 3532 3533 } else { 3534 self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop()); 3535 } 3536 3537 } 3538 3539 }; 3540 3541 3542// override jQuery scrollTop 3543 3544 var _scrollTop = jQuery.fn.scrollTop; // preserve original function 3545 3546 jQuery.cssHooks["pageYOffset"] = { 3547 get: function(elem,computed,extra) { 3548 var nice = $.data(elem,'__nicescroll')||false; 3549 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); 3550 }, 3551 set: function(elem,value) { 3552 var nice = $.data(elem,'__nicescroll')||false; 3553 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value); 3554 return this; 3555 } 3556 }; 3557 3558/* 3559 $.fx.step["scrollTop"] = function(fx){ 3560 $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); 3561 }; 3562*/ 3563 3564 jQuery.fn.scrollTop = function(value) { 3565 if (typeof value == "undefined") { 3566 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; 3567 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); 3568 } else { 3569 return this.each(function() { 3570 var nice = $.data(this,'__nicescroll')||false; 3571 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value); 3572 }); 3573 } 3574 } 3575 3576// override jQuery scrollLeft 3577 3578 var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function 3579 3580 $.cssHooks.pageXOffset = { 3581 get: function(elem,computed,extra) { 3582 var nice = $.data(elem,'__nicescroll')||false; 3583 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); 3584 }, 3585 set: function(elem,value) { 3586 var nice = $.data(elem,'__nicescroll')||false; 3587 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value); 3588 return this; 3589 } 3590 }; 3591 3592/* 3593 $.fx.step["scrollLeft"] = function(fx){ 3594 $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); 3595 }; 3596*/ 3597 3598 jQuery.fn.scrollLeft = function(value) { 3599 if (typeof value == "undefined") { 3600 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; 3601 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); 3602 } else { 3603 return this.each(function() { 3604 var nice = $.data(this,'__nicescroll')||false; 3605 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value); 3606 }); 3607 } 3608 } 3609 3610 var NiceScrollArray = function(doms) { 3611 var self = this; 3612 this.length = 0; 3613 this.name = "nicescrollarray"; 3614 3615 this.each = function(fn) { 3616 for(var a=0,i=0;a<self.length;a++) fn.call(self[a],i++); 3617 return self; 3618 }; 3619 3620 this.push = function(nice) { 3621 self[self.length]=nice; 3622 self.length++; 3623 }; 3624 3625 this.eq = function(idx) { 3626 return self[idx]; 3627 }; 3628 3629 if (doms) { 3630 for(a=0;a<doms.length;a++) { 3631 var nice = $.data(doms[a],'__nicescroll')||false; 3632 if (nice) { 3633 this[this.length]=nice; 3634 this.length++; 3635 } 3636 }; 3637 } 3638 3639 return this; 3640 }; 3641 3642 function mplex(el,lst,fn) { 3643 for(var a=0;a<lst.length;a++) fn(el,lst[a]); 3644 }; 3645 mplex( 3646 NiceScrollArray.prototype, 3647 ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'], 3648 function(e,n) { 3649 e[n] = function(){ 3650 var args = arguments; 3651 return this.each(function(){ 3652 this[n].apply(this,args); 3653 }); 3654 }; 3655 } 3656 ); 3657 3658 jQuery.fn.getNiceScroll = function(index) { 3659 if (typeof index == "undefined") { 3660 return new NiceScrollArray(this); 3661 } else { 3662 var nice = this[index]&&$.data(this[index],'__nicescroll')||false; 3663 return nice; 3664 } 3665 }; 3666 3667 jQuery.extend(jQuery.expr[':'], { 3668 nicescroll: function(a) { 3669 return ($.data(a,'__nicescroll'))?true:false; 3670 } 3671 }); 3672 3673 $.fn.niceScroll = function(wrapper,opt) { 3674 if (typeof opt=="undefined") { 3675 if ((typeof wrapper=="object")&&!("jquery" in wrapper)) { 3676 opt = wrapper; 3677 wrapper = false; 3678 } 3679 } 3680 var ret = new NiceScrollArray(); 3681 if (typeof opt=="undefined") opt = {}; 3682 3683 if (wrapper||false) { 3684 opt.doc = $(wrapper); 3685 opt.win = $(this); 3686 } 3687 var docundef = !("doc" in opt); 3688 if (!docundef&&!("win" in opt)) opt.win = $(this); 3689 3690 this.each(function() { 3691 var nice = $(this).data('__nicescroll')||false; 3692 if (!nice) { 3693 opt.doc = (docundef) ? $(this) : opt.doc; 3694 nice = new NiceScrollClass(opt,$(this)); 3695 $(this).data('__nicescroll',nice); 3696 }
3697 ret.push(nice); 3698 }); 3699 return (ret.length==1) ? ret[0] : ret; 3700 }; 3701 3702 window.NiceScroll = { 3703 getjQuery:function(){return jQuery} 3704 }; 3705 3706 if (!$.nicescroll) { 3707 $.nicescroll = new NiceScrollArray(); 3708 $.nicescroll.options = _globaloptions; 3709 } 3710 3711})( jQuery );
Line numbers count LF bytes from the start of the resource, as the search results do. Vendor segments are library code the classifier recognised; they are stored but not indexed. Bytes are shown as Latin1 characters, one per byte.