1jQuery(document).ready(function($) { 2"use strict"; 3 4 5$(".btn-lang").click(function(){ 6 $(".block_menu_lang").addClass("active_menu_lang"); 7}) 8$(".btn-close_menu_lang").click(function(){ 9 $(".block_menu_lang").removeClass("active_menu_lang"); 10}) 11 12if (/Android|webOS|iPhone|iPad|iPod|BlackBerry/i.test(navigator.userAgent) || 13 (/Android|webOS|iPhone|iPad|iPod|BlackBerry/i.test(navigator.platform))) { 14 $(".ismobile").show(); 15 $(".isdesktop").hide(); 16 } else{ 17 $(".ismobile").hide(); 18 $(".isdesktop").show(); 19 } 20 21/* 22if ($(".horaires-prieres tr.active").length) { 23 $('html, body').animate({ 24 scrollTop: $(".horaires-prieres tr.active").offset().top - 250 25 }, 2000); 26}*/ 27 28 29if ($(".selectjs").length) { 30 $('.selectjs').select2(); 31} 32$('.links').showMoreItems({ 33 startNum: 30, 34 afterNum: 30, 35 moreText: 'Afficher plus', 36 noMoreText: '', 37 responsive: [ 38 { 39 breakpoint: 1280, 40 settings: { 41 startNum: 50, 42 afterNum: 20 43 } 44 }, 45 { 46 breakpoint: 600, 47 settings: { 48 startNum: 40, 49 afterNum: 30 50 } 51 } 52 ] 53}); 54 55 56 57 58/* 59 $('.getdata').on('change', function() { 60 var currentUrl = window.location.href; 61 var baseUrl = currentUrl.replace('/horaires-de-prieres/', ''); // Remove only the specific part 62 var arr = []; 63 if (document.foramadan.VilleTunisie.value) { 64 arr.push('horaires-de-priere-' + document.foramadan.VilleTunisie.value); 65 } 66 if (document.foramadan.mois.value) { 67 arr.push(document.foramadan.mois.value); 68 } 69 var params = arr.join('/'); 70 var newUrl = baseUrl + '/' + params; // Construct new URL 71 document.location.href = newUrl; // Redirect to the new URL 72 }); 73 74 $('.getdata-mois').on('change', function() { 75 var currentUrl = window.location.href; 76 var baseUrl = currentUrl.replace('/horaires-de-prieres/', ''); // Remove only the specific part 77 var arr = []; 78 79 if (document.foramadan.mois.value) { 80 arr.push(document.foramadan.mois.value); 81 } 82 var params = arr.join('/'); 83 var newUrl = baseUrl + '/' + params; // Construct new URL 84 document.location.href = newUrl; // Redirect to the new URL 85 }); 86 */ 87 88 89 if($(".wpcf7-form input").length){ 90 $(".form-group label").on("click", function (e) { 91 $(this).parent().addClass("focusInput"); 92 $(this).parent().find("input").focus(); 93 }); 94 95 96 $(".wpcf7-form input").on("focus", function (e) { 97 e.preventDefault(); 98 99 $(this).closest(".box_form ").removeClass("text-danger"); 100 $(this).closest(".box_form ").addClass("focusInput"); 101 102 }); 103 104 $(".wpcf7-form input").on("focusout", function (e) { 105 e.preventDefault(); 106 107 if ($(this).val() == "") { 108 $(this).closest(".box_form ").addClass("text-danger"); 109 $(this).closest(".box_form ").removeClass("focusInput"); 110 } 111 }); 112 113 } 114 115 if($(".wpcf7-form textarea").length){ 116 $(".form-group label").on("click", function (e) { 117 $(this).parent().addClass("focusInput"); 118 $(this).parent().find("textarea").focus(); 119 }); 120 121 122 $(".wpcf7-form textarea").on("focus", function (e) { 123 e.preventDefault(); 124 125 $(this).closest(".box_form ").removeClass("text-danger"); 126 $(this).closest(".box_form ").addClass("focusInput"); 127 128 }); 129 130 $(".wpcf7-form textarea").on("focusout", function (e) { 131 e.preventDefault(); 132 133 if ($(this).val() == "") { 134 $(this).closest(".box_form ").addClass("text-danger"); 135 $(this).closest(".box_form ").removeClass("focusInput"); 136 } 137 }); 138 } 139 140 141 142 143 144 145 146 // Sticky Navigation 147 148 $(window).load(function(){ 149 var aboveHeight = $('#head-main-top').outerHeight(); 150 $(window).scroll(function(){ 151 if ($(window).scrollTop() > aboveHeight){ 152 $('#main-nav-wrap').addClass('fixed').css('top','0'); 153 $('.nav-logo-fade').addClass('nav-logo-show'); 154 $('.nav-logo-out').addClass('nav-logo-out-fade'); 155 $('.nav-logo-in').addClass('nav-logo-in-fade'); 156 $('.nav-left-wrap').addClass('nav-left-width'); 157 $('#wallpaper').addClass('wall-fixed'); 158 $('.col-tabs-wrap').addClass('fixed-col').css('top','60px'); 159 $('#body-main-wrap').addClass('tabs-top-marg'); 160 $('#body-main-wrap').addClass('body-top-pad'); 161 $('.fly-to-top').addClass('to-top-trans'); 162 } else { 163 $('#main-nav-wrap').removeClass('fixed'); 164 $('.nav-logo-fade').removeClass('nav-logo-show'); 165 $('.nav-logo-out').removeClass('nav-logo-out-fade'); 166 $('.nav-logo-in').removeClass('nav-logo-in-fade'); 167 $('.nav-left-wrap').removeClass('nav-left-width'); 168 $('#wallpaper').removeClass('wall-fixed'); 169 $('.col-tabs-wrap').removeClass('fixed-col').css('top','0'); 170 $('#body-main-wrap').removeClass('tabs-top-marg'); 171 $('#body-main-wrap').removeClass('body-top-pad'); 172 $('.fly-to-top').removeClass('to-top-trans'); 173 } 174 }); 175 }); 176 177 178 // Fly-Out Navigation 179 180 $(".fly-but-wrap").on('click', function(){ 181 $("#fly-wrap").toggleClass("fly-menu"); 182 $("#head-main-top").toggleClass("fly-content"); 183 $("#wallpaper").toggleClass("fly-content"); 184 $(".col-tabs-wrap").toggleClass("fly-content"); 185 $("#main-nav-wrap").toggleClass("main-nav-over"); 186 $("#soc-nav-wrap").toggleClass("fly-content"); 187 $("#body-main-wrap").toggleClass("fly-content"); 188 $(".fly-but-wrap").toggleClass("fly-open"); 189 $(".fly-fade").toggleClass("fly-fade-trans"); 190 }); 191 192 // Back to Top Button 193 var duration = 500; 194 $('.back-to-top').on('click', function(event) { 195 event.preventDefault(); 196 $('html, body').animate({scrollTop: 0}, duration); 197 return false;
198 }); 199 200 // Search Toggle 201 $(".nav-search-but").on('click', function(){ 202 $(".search-fly-wrap").slideToggle(); 203 }); 204 205 // Columns Toggle 206 207 $('#site-wrap').each(function() { 208 209 $(this).find("ul.col-tabs li.latest-col-tab").addClass("active").show(); //Activate first tab 210 211 }); 212 213 214 $("ul.col-tabs li").on('click', function(e) { 215 $(this).parents('#site-wrap').find("ul.col-tabs li").removeClass("active"); //Remove any "active" class 216 $(this).addClass("active"); //Add "active" class to selected tab 217 $(this).parents('#site-wrap').find(".tab-col-cont").hide(); //Hide all tab content 218 219 var activeTab = $(this).find("a").attr("href"); //Find the href attribute value to identify the active tab + content 220 $(this).parents('#site-wrap').find(activeTab).fadeIn(); //Fade in the active ID content 221 222 $('html, body').animate({scrollTop: 0}, duration); 223 return false; 224 225 e.preventDefault(); 226 }); 227 228 $("ul.col-tabs li a").on('click', function(e) { 229 e.preventDefault(); 230 }) 231 232 $(".non-feat-tab").on('click', function(e) { 233 $("#feat-top-wrap").hide(); 234 $("#feat-wide-wrap").hide(); 235 }); 236 237 $(".feat-col-tab").on('click', function(e) { 238 $("#feat-top-wrap").fadeIn(); 239 $("#feat-wide-wrap").fadeIn(); 240 }); 241 242 $("ul.col-tabs li.latest-col-tab").trigger('click'); 243 244}); 245 246 247 // Scoreboard 248 249(function( window, $, undefined ) { 250 251 $.fn.touchwipe = function(settings) { 252 253 var config = { 254 min_move_x: 20, 255 min_move_y: 20, 256 wipeLeft: function() { }, 257 wipeRight: function() { }, 258 wipeUp: function() { }, 259 wipeDown: function() { }, 260 preventDefaultEvents: true 261 }; 262 263 if (settings) $.extend(config, settings); 264 265 this.each(function() { 266 var startX; 267 var startY; 268 var isMoving = false; 269 270 function cancelTouch() { 271 this.removeEventListener('touchmove', onTouchMove); 272 startX = null; 273 isMoving = false; 274 } 275 276 function onTouchMove(e) { 277 if(config.preventDefaultEvents) { 278 e.preventDefault(); 279 } 280 if(isMoving) { 281 var x = e.touches[0].pageX; 282 var y = e.touches[0].pageY; 283 var dx = startX - x; 284 var dy = startY - y; 285 if(Math.abs(dx) >= config.min_move_x) { 286 cancelTouch(); 287 if(dx > 0) { 288 config.wipeLeft(); 289 } 290 else { 291 config.wipeRight(); 292 } 293 } 294 else if(Math.abs(dy) >= config.min_move_y) { 295 cancelTouch(); 296 if(dy > 0) { 297 config.wipeDown(); 298 } 299 else { 300 config.wipeUp(); 301 } 302 } 303 } 304 } 305 306 function onTouchStart(e) 307 { 308 if (e.touches.length == 1) { 309 startX = e.touches[0].pageX; 310 startY = e.touches[0].pageY; 311 isMoving = true; 312 this.addEventListener('touchmove', onTouchMove, false); 313 } 314 } 315 if ('ontouchstart' in document.documentElement) { 316 this.addEventListener('touchstart', onTouchStart, false); 317 } 318 }); 319 320 return this; 321 }; 322 323 $.elastislide = function( options, element ) { 324 this.$el = $( element ); 325 this._init( options ); 326 }; 327 328 $.elastislide.defaults = { 329 speed : 450, // animation speed 330 easing : '', // animation easing effect 331 imageW : 190, // the images width 332 margin : 0, // image margin right 333 border : 0, // image border 334 minItems : 1, // the minimum number of items to show. 335 // when we resize the window, this will make sure minItems are always shown 336 // (unless of course minItems is higher than the total number of elements) 337 current : 0, // index of the current item 338 // when we resize the window, the carousel will make sure this item is visible 339 onClick : function() { return false; } // click item callback 340 }; 341 342 $.elastislide.prototype = { 343 _init : function( options ) { 344 345 this.options = $.extend( true, {}, $.elastislide.defaults, options ); 346 347 // <ul> 348 this.$slider = this.$el.find('ul'); 349 350 // <li> 351 this.$items = this.$slider.children('li'); 352 353 // total number of elements / images 354 this.itemsCount = this.$items.length; 355 356 // cache the <ul>'s parent, since we will eventually need to recalculate its width on window resize 357 this.$esCarousel = this.$slider.parent(); 358 359 // validate options 360 this._validateOptions(); 361 362 // set sizes and initialize some vars... 363 this._configure(); 364 365 // add navigation buttons
366 this._addControls(); 367 368 // initialize the events 369 this._initEvents(); 370 371 // show the <ul> 372 this.$slider.show(); 373 374 // slide to current's position 375 this._slideToCurrent( false ); 376 377 }, 378 _validateOptions : function() { 379 380 if( this.options.speed < 0 ) 381 this.options.speed = 450; 382 if( this.options.margin < 0 ) 383 this.options.margin = 4; 384 if( this.options.border < 0 ) 385 this.options.border = 1; 386 if( this.options.minItems < 1 || this.options.minItems > this.itemsCount ) 387 this.options.minItems = 1; 388 if( this.options.current > this.itemsCount - 1 ) 389 this.options.current = 0; 390 391 }, 392 _configure : function() { 393 394 // current item's index 395 this.current = this.options.current; 396 397 // the ul's parent's (div.es-carousel) width is the "visible" width 398 this.visibleWidth = this.$esCarousel.width(); 399 400 // test to see if we need to initially resize the items 401 if( this.visibleWidth < this.options.minItems * ( this.options.imageW + 2 * this.options.border ) + ( this.options.minItems - 1 ) * this.options.margin ) { 402 this._setDim( ( this.visibleWidth - ( this.options.minItems - 1 ) * this.options.margin ) / this.options.minItems ); 403 this._setCurrentValues(); 404 // how many items fit with the current width 405 this.fitCount = this.options.minItems; 406 } 407 else { 408 this._setDim(); 409 this._setCurrentValues(); 410 } 411 412 // set the <ul> width 413 this.$slider.css({ 414 width : this.sliderW 415 }); 416 417 }, 418 _setDim : function( elW ) { 419 420 // <li> style 421 this.$items.css({ 422 marginRight : this.options.margin, 423 width : ( elW ) ? elW : this.options.imageW + 2 * this.options.border 424 }).children('a').css({ // <a> style 425 borderWidth : this.options.border 426 }); 427 428 }, 429 _setCurrentValues : function() { 430 431 // the total space occupied by one item 432 this.itemW = this.$items.outerWidth(true); 433 434 // total width of the slider / <ul> 435 // this will eventually change on window resize 436 this.sliderW = this.itemW * this.itemsCount; 437 438 // the ul parent's (div.es-carousel) width is the "visible" width 439 this.visibleWidth = this.$esCarousel.width(); 440 441 // how many items fit with the current width 442 this.fitCount = Math.floor( this.visibleWidth / this.itemW ); 443 444 }, 445 _addControls : function() { 446 447 this.$navNext = $('<span class="es-nav-next"><a>></a></span>'); 448 this.$navPrev = $('<span class="es-nav-prev"><a><</a></span>'); 449 $('<div class="es-nav"/>') 450 .append( this.$navPrev ) 451 .append( this.$navNext ) 452 .appendTo( this.$el ); 453 454 //this._toggleControls(); 455 456 }, 457 _toggleControls : function( dir, status ) { 458 459 // show / hide navigation buttons 460 if( dir && status ) { 461 if( status === 1 ) 462 ( dir === 'right' ) ? this.$navNext.show() : this.$navPrev.show(); 463 else 464 ( dir === 'right' ) ? this.$navNext.hide() : this.$navPrev.hide(); 465 } 466 else if( this.current === this.itemsCount - 1 || this.fitCount >= this.itemsCount ) 467 this.$navNext.hide(); 468 469 }, 470 _initEvents : function() { 471 472 var instance = this; 473 474 // window resize 475 $(window).bind('resize.elastislide', function( event ) { 476 477 // set values again 478 instance._setCurrentValues(); 479 480 // need to resize items 481 if( instance.visibleWidth < instance.options.minItems * ( instance.options.imageW + 2 * instance.options.border ) + ( instance.options.minItems - 1 ) * instance.options.margin ) { 482 instance._setDim( ( instance.visibleWidth - ( instance.options.minItems - 1 ) * instance.options.margin ) / instance.options.minItems ); 483 instance._setCurrentValues(); 484 instance.fitCount = instance.options.minItems; 485 } 486 else{ 487 instance._setDim(); 488 instance._setCurrentValues(); 489 } 490 491 instance.$slider.css({ 492 width : instance.sliderW + 10 // TODO: +10px seems to solve a firefox "bug" :S 493 }); 494 495 // slide to the current element 496 clearTimeout( instance.resetTimeout ); 497 instance.resetTimeout = setTimeout(function() { 498 instance._slideToCurrent(); 499 }, 200); 500 501 }); 502 503 // navigation buttons events 504 this.$navNext.bind('click.elastislide', function( event ) { 505 instance._slide('right'); 506 }); 507 508 this.$navPrev.bind('click.elastislide', function( event ) { 509 instance._slide('left'); 510 }); 511 512 // item click event 513 this.$items.bind('click.elastislide', function( event ) { 514 instance.options.onClick( $(this) ); 515 //return false;
516 }); 517 518 // touch events 519 instance.$slider.touchwipe({ 520 wipeLeft : function() { 521 instance._slide('right'); 522 }, 523 wipeRight : function() { 524 instance._slide('left'); 525 } 526 }); 527 528 }, 529 _slide : function( dir, val, anim, callback ) { 530 531 // if animating return 532 if( this.$slider.is(':animated') ) 533 return false; 534 535 // current margin left 536 var ml = parseFloat( this.$slider.css('margin-left') ); 537 538 // val is just passed when we want an exact value for the margin left (used in the _slideToCurrent function) 539 if( val === undefined ) { 540 541 // how much to slide? 542 var amount = this.fitCount * this.itemW, val; 543 544 if( amount < 0 ) return false; 545 546 // make sure not to leave a space between the last item / first item and the end / beggining of the slider available width 547 if( dir === 'right' && this.sliderW - ( Math.abs( ml ) + amount ) < this.visibleWidth ) { 548 amount = this.sliderW - ( Math.abs( ml ) + this.visibleWidth ) - this.options.margin; // decrease the margin left 549 // show / hide navigation buttons 550 this._toggleControls( 'right', -1 ); 551 this._toggleControls( 'left', 1 ); 552 } 553 else if( dir === 'left' && Math.abs( ml ) - amount < 0 ) { 554 amount = Math.abs( ml ); 555 // show / hide navigation buttons 556 this._toggleControls( 'left', -1 ); 557 this._toggleControls( 'right', 1 ); 558 } 559 else { 560 var fml; // future margin left 561 ( dir === 'right' ) 562 ? fml = Math.abs( ml ) + this.options.margin + Math.abs( amount ) 563 : fml = Math.abs( ml ) - this.options.margin - Math.abs( amount ); 564 565 // show / hide navigation buttons 566 if( fml > 0 ) 567 this._toggleControls( 'left', 1 ); 568 else 569 this._toggleControls( 'left', -1 ); 570 571 if( fml < this.sliderW - this.visibleWidth ) 572 this._toggleControls( 'right', 1 ); 573 else 574 this._toggleControls( 'right', -1 ); 575 576 } 577 578 ( dir === 'right' ) ? val = '-=' + amount : val = '+=' + amount 579 580 } 581 else { 582 var fml = Math.abs( val ); // future margin left 583 584 if( Math.max( this.sliderW, this.visibleWidth ) - fml < this.visibleWidth ) { 585 val = - ( Math.max( this.sliderW, this.visibleWidth ) - this.visibleWidth ); 586 if( val !== 0 ) 587 val += this.options.margin; // decrease the margin left if not on the first position 588 589 // show / hide navigation buttons 590 this._toggleControls( 'right', -1 ); 591 fml = Math.abs( val ); 592 } 593 594 // show / hide navigation buttons 595 if( fml > 0 ) 596 this._toggleControls( 'left', 1 ); 597 else 598 this._toggleControls( 'left', -1 ); 599 600 if( Math.max( this.sliderW, this.visibleWidth ) - this.visibleWidth > fml + this.options.margin ) 601 this._toggleControls( 'right', 1 ); 602 else 603 this._toggleControls( 'right', -1 ); 604 605 } 606 607 $.fn.applyStyle = ( anim === undefined ) ? $.fn.animate : $.fn.css; 608 609 var sliderCSS = { marginLeft : val }; 610 611 var instance = this; 612 613 this.$slider.applyStyle( sliderCSS, $.extend( true, [], { duration : this.options.speed, easing : this.options.easing, complete : function() { 614 if( callback ) callback.call(); 615 } } ) ); 616 617 }, 618 _slideToCurrent : function( anim ) { 619 620 // how much to slide? 621 var amount = this.current * this.itemW; 622 this._slide('', -amount, anim ); 623 624 }, 625 add : function( $newelems, callback ) { 626 627 // adds new items to the carousel 628 this.$items = this.$items.add( $newelems ); 629 this.itemsCount = this.$items.length; 630 this._setDim(); 631 this._setCurrentValues(); 632 this.$slider.css({ 633 width : this.sliderW 634 }); 635 this._slideToCurrent(); 636 637 if ( callback ) callback.call( $newelems ); 638 639 }, 640 destroy : function( callback ) { 641 this._destroy( callback ); 642 }, 643 _destroy : function( callback ) { 644 this.$el.unbind('.elastislide').removeData('elastislide'); 645 $(window).unbind('.elastislide'); 646 if ( callback ) callback.call(); 647 } 648 }; 649 650 var logError = function( message ) { 651 if ( this.console ) { 652 console.error( message ); 653 } 654 }; 655 656 $.fn.elastislide = function( options ) { 657 if ( typeof options === 'string' ) { 658 var args = Array.prototype.slice.call( arguments, 1 ); 659 660 this.each(function() { 661 var instance = $.data( this, 'elastislide' ); 662 if ( !instance ) { 663 logError( "cannot call methods on elastislide prior to initialization; " + 664 "attempted to call method '" + options + "'" ); 665 return; 666 } 667 if ( !$.isFunction( instance[options] ) || options.charAt(0) === "_" ) { 668 logError( "no such method '" + options + "' for elastislide instance" ); 669 return; 670 } 671 instance[ options ].apply( instance, args ); 672 }); 673 } 674 else { 675 this.each(function() { 676 var instance = $.data( this, 'elastislide' ); 677 if ( !instance ) { 678 $.data( this, 'elastislide', new $.elastislide( options, this ) ); 679 } 680 }); 681 } 682 return this; 683 }; 684 685})( window, jQuery ); 686 687 // Nicescroll 688 689(function(jQuery){ 690 691 // globals 692 var domfocus = false;
693 var mousefocus = false; 694 var zoomactive = false; 695 var tabindexcounter = 5000; 696 var ascrailcounter = 2000; 697 var globalmaxzindex = 0; 698 699 var $ = jQuery; // sandbox 700 701 // http://stackoverflow.com/questions/2161159/get-script-path 702 function getScriptPath() { 703 var scripts=document.getElementsByTagName('script'); 704 var path=scripts[scripts.length-1].src.split('?')[0]; 705 return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : ''; 706 } 707 var scriptpath = getScriptPath(); 708 709 var vendors = ['ms','moz','webkit','o']; 710 711 var setAnimationFrame = window.requestAnimationFrame||false; 712 var clearAnimationFrame = window.cancelAnimationFrame||false; 713 714 if (!setAnimationFrame) { 715 for(var vx in vendors) { 716 var v = vendors[vx]; 717 if (!setAnimationFrame) setAnimationFrame = window[v+'RequestAnimationFrame']; 718 if (!clearAnimationFrame) clearAnimationFrame = window[v+'CancelAnimationFrame']||window[v+'CancelRequestAnimationFrame']; 719 } 720 } 721 722 var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false; 723 724 var _globaloptions = { 725 zindex:"auto", 726 cursoropacitymin:0, 727 cursoropacitymax:1, 728 cursorcolor:"#424242", 729 cursorwidth:"5px", 730 cursorborder:"1px solid #fff", 731 cursorborderradius:"5px", 732 scrollspeed:60, 733 mousescrollstep:8*3, 734 touchbehavior:false, 735 hwacceleration:true, 736 usetransition:true, 737 boxzoom:false, 738 dblclickzoom:true, 739 gesturezoom:true, 740 grabcursorenabled:true, 741 autohidemode:true, 742 background:"", 743 iframeautoresize:true, 744 cursorminheight:32, 745 preservenativescrolling:true, 746 railoffset:false, 747 bouncescroll:true, 748 spacebarenabled:true, 749 railpadding:{top:0,right:0,left:0,bottom:0}, 750 disableoutline:true, 751 horizrailenabled:true, 752 railalign:"right", 753 railvalign:"bottom", 754 enabletranslate3d:true, 755 enablemousewheel:true, 756 enablekeyboard:true, 757 smoothscroll:true, 758 sensitiverail:true, 759 enablemouselockapi:true, 760// cursormaxheight:false, 761 cursorfixedheight:false, 762 directionlockdeadzone:6, 763 hidecursordelay:400, 764 nativeparentscrolling:true, 765 enablescrollonselection:true, 766 overflowx:true, 767 overflowy:true, 768 cursordragspeed:0.3, 769 rtlmode:false, 770 cursordragontouch:false, 771 oneaxismousemode:"auto" 772 } 773 774 var browserdetected = false; 775 776 var getBrowserDetection = function() { 777 778 if (browserdetected) return browserdetected; 779 780 var domtest = document.createElement('DIV'); 781 782 var d = {}; 783 784 d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document; 785 786 d.isopera = ("opera" in window); 787 d.isopera12 = (d.isopera&&("getUserMedia" in navigator)); 788 d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]"); 789 790 d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera); 791 d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older 792 d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7)); 793 d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8); 794 d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9); 795 d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10); 796 797 d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango 798 if (d.isie9mobile) d.isie9 = false; 799 d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0 800 801 d.ismozilla = ("MozAppearance" in domtest.style); 802 803 d.iswebkit = ("WebkitAppearance" in domtest.style); 804 805 d.ischrome = ("chrome" in window); 806 d.ischrome22 = (d.ischrome&&d.haspointerlock); 807 d.ischrome26 = (d.ischrome&&("transition" in domtest.style)); // issue with transform detection (maintain prefix) 808 809 d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window); // detection for Chrome Touch Emulation 810 d.hasmstouch = (window.navigator.msPointerEnabled||false); // IE10+ pointer events 811 812 d.ismac = /^mac$/i.test(navigator.platform); 813 814 d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform)); 815 d.isios4 = ((d.isios)&&!("seal" in Object)); 816 817 d.isandroid = (/android/i.test(navigator.userAgent)); 818 819 d.trstyle = false;
820 d.hastransform = false; 821 d.hastranslate3d = false; 822 d.transitionstyle = false; 823 d.hastransition = false; 824 d.transitionend = false; 825 826 var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform']; 827 for(var a=0;a<check.length;a++){ 828 if (typeof domtest.style[check[a]] != "undefined") { 829 d.trstyle = check[a]; 830 break; 831 } 832 } 833 d.hastransform = (d.trstyle != false); 834 if (d.hastransform) { 835 domtest.style[d.trstyle] = "translate3d(1px,2px,3px)"; 836 d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]); 837 } 838 839 d.transitionstyle = false; 840 d.prefixstyle = ''; 841 d.transitionend = false; 842 var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition']; 843 var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-']; 844 var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd']; 845 for(var a=0;a<check.length;a++) { 846 if (check[a] in domtest.style) { 847 d.transitionstyle = check[a]; 848 d.prefixstyle = prefix[a]; 849 d.transitionend = evs[a]; 850 break; 851 } 852 } 853 if (d.ischrome26) { // use always prefix 854 d.prefixstyle = prefix[1]; 855 } 856 857 d.hastransition = (d.transitionstyle); 858 859 function detectCursorGrab() { 860 var lst = ['-moz-grab','-webkit-grab','grab']; 861 if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[]; // force setting for IE returns false positive and chrome cursor bug 862 for(var a=0;a<lst.length;a++) { 863 var p = lst[a]; 864 domtest.style['cursor']=p; 865 if (domtest.style['cursor']==p) return p; 866 } 867 return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; // thank you google for custom cursor! 868 } 869 d.cursorgrabvalue = detectCursorGrab(); 870 871 d.hasmousecapture = ("setCapture" in domtest); 872 873 d.hasMutationObserver = (clsMutationObserver !== false); 874 875 domtest = null; //memory released 876 877 browserdetected = d; 878 879 return d; 880 } 881 882 var NiceScrollClass = function(myopt,me) { 883 884 var self = this; 885 886 this.version = '3.5.0 BETA5'; 887 this.name = 'nicescroll'; 888 889 this.me = me; 890 891 this.opt = { 892 doc:$("body"), 893 win:false 894 }; 895 896 $.extend(this.opt,_globaloptions); 897 898// Options for internal use 899 this.opt.snapbackspeed = 80; 900 901 if (myopt||false) { 902 for(var a in self.opt) { 903 if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a]; 904 } 905 } 906 907 this.doc = self.opt.doc; 908 this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':''; 909 this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName); 910 this.haswrapper = (self.opt.win!==false); 911 this.win = self.opt.win||(this.ispage?$(window):this.doc); 912 this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win; 913 this.body = $("body"); 914 this.viewport = false; 915 916 this.isfixed = false; 917 918 this.iframe = false; 919 this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); 920 921 this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); 922 923 this.forcescreen = false; //force to use screen position on events 924 925 this.canshowonmouseevent = (self.opt.autohidemode!="scroll"); 926 927// Events jump table 928 this.onmousedown = false; 929 this.onmouseup = false; 930 this.onmousemove = false; 931 this.onmousewheel = false; 932 this.onkeypress = false; 933 this.ongesturezoom = false; 934 this.onclick = false; 935 936// Nicescroll custom events 937 this.onscrollstart = false;
938 this.onscrollend = false; 939 this.onscrollcancel = false; 940 941 this.onzoomin = false; 942 this.onzoomout = false; 943 944// Let's start! 945 this.view = false; 946 this.page = false; 947 948 this.scroll = {x:0,y:0}; 949 this.scrollratio = {x:0,y:0}; 950 this.cursorheight = 20; 951 this.scrollvaluemax = 0; 952 953 this.checkrtlmode = false; 954 955 this.scrollrunning = false; 956 957 this.scrollmom = false; 958 959 this.observer = false; 960 this.observerremover = false; // observer on parent for remove detection 961 962 do { 963 this.id = "ascrail"+(ascrailcounter++); 964 } while (document.getElementById(this.id)); 965 966 this.rail = false; 967 this.cursor = false; 968 this.cursorfreezed = false; 969 this.selectiondrag = false; 970 971 this.zoom = false; 972 this.zoomactive = false; 973 974 this.hasfocus = false; 975 this.hasmousefocus = false; 976 977 this.visibility = true; 978 this.locked = false; 979 this.hidden = false; // rails always hidden 980 this.cursoractive = true; // user can interact with cursors 981 982 this.overflowx = self.opt.overflowx; 983 this.overflowy = self.opt.overflowy; 984 985 this.nativescrollingarea = false; 986 this.checkarea = 0; 987 988 this.events = []; // event list for unbind 989 990 this.saved = {}; 991 992 this.delaylist = {}; 993 this.synclist = {}; 994 995 this.lastdeltax = 0; 996 this.lastdeltay = 0; 997 998 this.detected = getBrowserDetection(); 999 1000 var cap = $.extend({},this.detected); 1001 1002 this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration); 1003 this.ishwscroll = (this.canhwscroll&&self.haswrapper); 1004 1005 this.istouchcapable = false; // desktop devices with touch screen support 1006 1007//## Check Chrome desktop with touch support 1008 if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) { 1009 this.istouchcapable = true; 1010 cap.cantouch = false; // parse normal desktop events 1011 } 1012 1013//## Firefox 18 nightly build (desktop) false positive (or desktop with touch support) 1014 if (cap.cantouch&&cap.ismozilla&&!cap.isios&&!cap.isandroid) { 1015 this.istouchcapable = true; 1016 cap.cantouch = false; // parse normal desktop events 1017 } 1018 1019//## disable MouseLock API on user request 1020 1021 if (!self.opt.enablemouselockapi) { 1022 cap.hasmousecapture = false; 1023 cap.haspointerlock = false; 1024 } 1025 1026 this.delayed = function(name,fn,tm,lazy) { 1027 var dd = self.delaylist[name]; 1028 var nw = (new Date()).getTime(); 1029 if (!lazy&&dd&&dd.tt) return false; 1030 if (dd&&dd.tt) clearTimeout(dd.tt); 1031 if (dd&&dd.last+tm>nw&&!dd.tt) { 1032 self.delaylist[name] = { 1033 last:nw+tm, 1034 tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm) 1035 } 1036 } 1037 else if (!dd||!dd.tt) { 1038 self.delaylist[name] = { 1039 last:nw, 1040 tt:0 1041 } 1042 setTimeout(function(){fn.call();},0); 1043 } 1044 }; 1045 1046 this.debounced = function(name,fn,tm) { 1047 var dd = self.delaylist[name]; 1048 var nw = (new Date()).getTime(); 1049 self.delaylist[name] = fn; 1050 if (!dd) { 1051 setTimeout(function(){var fn=self.delaylist[name];self.delaylist[name]=false;fn.call();},tm); 1052 } 1053 } 1054 1055 this.synched = function(name,fn) { 1056 1057 function requestSync() { 1058 if (self.onsync) return; 1059 setAnimationFrame(function(){ 1060 self.onsync = false; 1061 for(name in self.synclist){ 1062 var fn = self.synclist[name]; 1063 if (fn) fn.call(self); 1064 self.synclist[name] = false; 1065 } 1066 }); 1067 self.onsync = true; 1068 }; 1069 1070 self.synclist[name] = fn; 1071 requestSync(); 1072 return name; 1073 }; 1074 1075 this.unsynched = function(name) { 1076 if (self.synclist[name]) self.synclist[name] = false; 1077 } 1078 1079 this.css = function(el,pars) { // save & set 1080 for(var n in pars) { 1081 self.saved.css.push([el,n,el.css(n)]); 1082 el.css(n,pars[n]); 1083 } 1084 }; 1085 1086 this.scrollTop = function(val) { 1087 return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val); 1088 }; 1089 1090 this.scrollLeft = function(val) { 1091 return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val); 1092 }; 1093 1094// derived by by Dan Pupius www.pupius.net 1095 BezierClass = function(st,ed,spd,p1,p2,p3,p4) { 1096 this.st = st; 1097 this.ed = ed; 1098 this.spd = spd; 1099 1100 this.p1 = p1||0; 1101 this.p2 = p2||1; 1102 this.p3 = p3||0; 1103 this.p4 = p4||1; 1104
1105 this.ts = (new Date()).getTime(); 1106 this.df = this.ed-this.st; 1107 }; 1108 BezierClass.prototype = { 1109 B2:function(t){ return 3*t*t*(1-t) }, 1110 B3:function(t){ return 3*t*(1-t)*(1-t) }, 1111 B4:function(t){ return (1-t)*(1-t)*(1-t) }, 1112 getNow:function(){ 1113 var nw = (new Date()).getTime(); 1114 var pc = 1-((nw-this.ts)/this.spd); 1115 var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); 1116 return (pc<0) ? this.ed : this.st+Math.round(this.df*bz); 1117 }, 1118 update:function(ed,spd){ 1119 this.st = this.getNow(); 1120 this.ed = ed; 1121 this.spd = spd; 1122 this.ts = (new Date()).getTime(); 1123 this.df = this.ed-this.st; 1124 return this; 1125 } 1126 }; 1127 1128 if (this.ishwscroll) { 1129 // hw accelerated scroll 1130 this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"}; 1131 1132 //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ 1133 if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ 1134 1135 //derived from http://stackoverflow.com/questions/11236090/ 1136 function getMatrixValues() { 1137 var tr = self.doc.css(cap.trstyle); 1138 if (tr&&(tr.substr(0,6)=="matrix")) { 1139 return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/); 1140 } 1141 return false; 1142 } 1143
1144 this.getScrollTop = function(last) { 1145 if (!last) { 1146 var mtx = getMatrixValues(); 1147 if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 1148 if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow(); 1149 } 1150 return self.doc.translate.y; 1151 }; 1152 1153 this.getScrollLeft = function(last) { 1154 if (!last) { 1155 var mtx = getMatrixValues(); 1156 if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 1157 if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow(); 1158 } 1159 return self.doc.translate.x; 1160 }; 1161 1162 if (document.createEvent) { 1163 this.notifyScrollEvent = function(el) { 1164 var e = document.createEvent("UIEvents"); 1165 e.initUIEvent("scroll", false, true, window, 1); 1166 el.dispatchEvent(e); 1167 }; 1168 } 1169 else if (document.fireEvent) { 1170 this.notifyScrollEvent = function(el) { 1171 var e = document.createEventObject(); 1172 el.fireEvent("onscroll"); 1173 e.cancelBubble = true; 1174 }; 1175 } 1176 else { 1177 this.notifyScrollEvent = function(el,add) {}; //NOPE 1178 } 1179 1180 if (cap.hastranslate3d&&self.opt.enabletranslate3d) { 1181 this.setScrollTop = function(val,silent) { 1182 self.doc.translate.y = val; 1183 self.doc.translate.ty = (val*-1)+"px"; 1184 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 1185 if (!silent) self.notifyScrollEvent(self.win[0]); 1186 }; 1187 this.setScrollLeft = function(val,silent) { 1188 self.doc.translate.x = val; 1189 self.doc.translate.tx = (val*-1)+"px"; 1190 self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)"); 1191 if (!silent) self.notifyScrollEvent(self.win[0]); 1192 }; 1193 } else { 1194 this.setScrollTop = function(val,silent) { 1195 self.doc.translate.y = val; 1196 self.doc.translate.ty = (val*-1)+"px"; 1197 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 1198 if (!silent) self.notifyScrollEvent(self.win[0]); 1199 }; 1200 this.setScrollLeft = function(val,silent) { 1201 self.doc.translate.x = val; 1202 self.doc.translate.tx = (val*-1)+"px"; 1203 self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")"); 1204 if (!silent) self.notifyScrollEvent(self.win[0]); 1205 }; 1206 } 1207 } else { 1208 // native scroll
1209 this.getScrollTop = function() { 1210 return self.docscroll.scrollTop(); 1211 }; 1212 this.setScrollTop = function(val) { 1213 return self.docscroll.scrollTop(val); 1214 }; 1215 this.getScrollLeft = function() { 1216 return self.docscroll.scrollLeft(); 1217 }; 1218 this.setScrollLeft = function(val) { 1219 return self.docscroll.scrollLeft(val); 1220 }; 1221 } 1222 1223 this.getTarget = function(e) { 1224 if (!e) return false; 1225 if (e.target) return e.target; 1226 if (e.srcElement) return e.srcElement; 1227 return false; 1228 }; 1229 1230 this.hasParent = function(e,id) { 1231 if (!e) return false; 1232 var el = e.target||e.srcElement||e||false; 1233 while (el && el.id != id) { 1234 el = el.parentNode||false; 1235 } 1236 return (el!==false); 1237 }; 1238 1239 function getZIndex() { 1240 var dom = self.win; 1241 if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available 1242 while (dom.length>0) { 1243 if (dom[0].nodeType==9) return false; 1244 var zi = dom.css('zIndex'); 1245 if (!isNaN(zi)&&zi!=0) return parseInt(zi); 1246 dom = dom.parent(); 1247 } 1248 return false; 1249 }; 1250 1251//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie 1252 var _convertBorderWidth = {"thin":1,"medium":3,"thick":5}; 1253 function getWidthToPixel(dom,prop,chkheight) { 1254 var wd = dom.css(prop); 1255 var px = parseFloat(wd); 1256 if (isNaN(px)) { 1257 px = _convertBorderWidth[wd]||0; 1258 var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS 1259 if (self.isie8&&px) px+=1; 1260 return (brd) ? px : 0; 1261 } 1262 return px; 1263 }; 1264 1265 this.getOffset = function() { 1266 if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))}; 1267 if (!self.viewport) return self.win.offset(); 1268 var ww = self.win.offset(); 1269 var vp = self.viewport.offset(); 1270 return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()}; 1271 }; 1272 1273 this.updateScrollBar = function(len) { 1274 if (self.ishwscroll) { 1275 self.rail.css({height:self.win.innerHeight()}); 1276 if (self.railh) self.railh.css({width:self.win.innerWidth()}); 1277 } else { 1278 var wpos = self.getOffset(); 1279 var pos = {top:wpos.top,left:wpos.left}; 1280 pos.top+= getWidthToPixel(self.win,'border-top-width',true); 1281 var brd = (self.win.outerWidth() - self.win.innerWidth())/2; 1282 pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width'); 1283 1284 var off = self.opt.railoffset; 1285 if (off) { 1286 if (off.top) pos.top+=off.top; 1287 if (self.rail.align&&off.left) pos.left+=off.left; 1288 } 1289 1290 if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()}); 1291 1292 if (self.zoom) { 1293 self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4}); 1294 } 1295 1296 if (self.railh&&!self.locked) { 1297 var pos = {top:wpos.top,left:wpos.left}; 1298 var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true); 1299 var x = pos.left + getWidthToPixel(self.win,'border-left-width'); 1300 self.railh.css({top:y,left:x,width:self.railh.width}); 1301 } 1302 1303 1304 } 1305 }; 1306 1307 this.doRailClick = function(e,dbl,hr) { 1308 1309 var fn,pg,cur,pos; 1310 1311// if (self.rail.drag&&self.rail.drag.pt!=1) return; 1312 if (self.locked) return; 1313// if (self.rail.drag) return; 1314 1315// self.cancelScroll(); 1316 1317 self.cancelEvent(e); 1318 1319 if (dbl) { 1320 fn = (hr) ? self.doScrollLeft : self.doScrollTop; 1321 cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y); 1322 fn(cur); 1323 } else { 1324// console.log(e.pageY); 1325 fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; 1326 cur = (hr) ? self.scroll.x : self.scroll.y; 1327 pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; 1328 pg = (hr) ? self.view.w : self.view.h; 1329 (cur>=pos) ? fn(pg) : fn(-pg); 1330 } 1331 1332 } 1333 1334 self.hasanimationframe = (setAnimationFrame); 1335 self.hascancelanimationframe = (clearAnimationFrame); 1336 1337 if (!self.hasanimationframe) { 1338 setAnimationFrame=function(fn){return setTimeout(fn,15-Math.floor((+new Date)/1000)%16)}; // 1000/60)}; 1339 clearAnimationFrame=clearInterval; 1340 } 1341 else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true}; 1342 1343 this.init = function() { 1344 1345 self.saved.css = []; 1346 1347 if (cap.isie7mobile) return true; // SORRY, DO NOT WORK! 1348 if (cap.isoperamini) return true; // SORRY, DO NOT WORK! 1349 1350 if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'}); 1351 1352 self.zindex = "auto"; 1353 if (!self.ispage&&self.opt.zindex=="auto") { 1354 self.zindex = getZIndex()||"auto"; 1355 } else { 1356 self.zindex = self.opt.zindex; 1357 } 1358 1359 if (!self.ispage&&self.zindex!="auto") { 1360 if (self.zindex>globalmaxzindex) globalmaxzindex=self.zindex; 1361 } 1362 1363 if (self.isie&&self.zindex==0&&self.opt.zindex=="auto") { // fix IE auto == 0 1364 self.zindex="auto"; 1365 } 1366 1367/* 1368 self.ispage = true; 1369 self.haswrapper = true; 1370// self.win = $(window); 1371 self.docscroll = $("body"); 1372// self.doc = $("body"); 1373*/ 1374 1375 if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { 1376 1377 var cont = self.docscroll; 1378 if (self.ispage) cont = (self.haswrapper)?self.win:self.doc; 1379 1380 if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'}); 1381 1382 if (self.ispage&&cap.isie7) { 1383 if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 1384 else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue 1385 } 1386 1387 if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"}); //force hw acceleration 1388 1389 var cursor = $(document.createElement('div')); 1390 cursor.css({ 1391 position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px", 1392 'background-color':self.opt.cursorcolor, 1393 border:self.opt.cursorborder, 1394 'background-clip':'padding-box',
1395 '-webkit-border-radius':self.opt.cursorborderradius, 1396 '-moz-border-radius':self.opt.cursorborderradius, 1397 'border-radius':self.opt.cursorborderradius 1398 }); 1399 1400 cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight()); 1401 self.cursor = cursor; 1402 1403 var rail = $(document.createElement('div')); 1404 rail.attr('id',self.id); 1405 rail.addClass('nicescroll-rails'); 1406 1407 var v,a,kp = ["left","right"]; //"top","bottom" 1408 for(var n in kp) { 1409 a=kp[n]; 1410 v = self.opt.railpadding[a]; 1411 (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0; 1412 } 1413 1414 rail.append(cursor); 1415 1416 rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right']; 1417 rail.css({width:rail.width+"px",'zIndex':self.zindex,"background":self.opt.background,cursor:"default"}); 1418 1419 rail.visibility = true; 1420 rail.scrollable = true; 1421 1422 rail.align = (self.opt.railalign=="left") ? 0 : 1; 1423 1424 self.rail = rail; 1425 1426 self.rail.drag = false; 1427 1428 var zoom = false; 1429 if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) { 1430 zoom = document.createElement('div'); 1431 self.bind(zoom,"click",self.doZoom); 1432 self.zoom = $(zoom); 1433 self.zoom.css({"cursor":"pointer",'z-index':self.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'}); 1434 if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom); 1435 if (cap.cantouch&&self.opt.gesturezoom) { 1436 self.ongesturezoom = function(e) { 1437 if (e.scale>1.5) self.doZoomIn(e); 1438 if (e.scale<0.8) self.doZoomOut(e); 1439 return self.cancelEvent(e); 1440 }; 1441 self.bind(self.win,"gestureend",self.ongesturezoom); 1442 } 1443 } 1444 1445// init HORIZ 1446 1447 self.railh = false; 1448 1449 if (self.opt.horizrailenabled) { 1450 1451 self.css(cont,{'overflow-x':'hidden'}); 1452 1453 var cursor = $(document.createElement('div')); 1454 cursor.css({ 1455 position:"relative",top:0,height:self.opt.cursorwidth,width:"0px", 1456 'background-color':self.opt.cursorcolor, 1457 border:self.opt.cursorborder, 1458 'background-clip':'padding-box', 1459 '-webkit-border-radius':self.opt.cursorborderradius, 1460 '-moz-border-radius':self.opt.cursorborderradius, 1461 'border-radius':self.opt.cursorborderradius 1462 }); 1463 1464 cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()); 1465 self.cursorh = cursor; 1466 1467 var railh = $(document.createElement('div')); 1468 railh.attr('id',self.id+'-hr'); 1469 railh.addClass('nicescroll-rails'); 1470 railh.height = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight()); 1471 railh.css({height:railh.height+"px",'zIndex':self.zindex,"background":self.opt.background}); 1472 1473 railh.append(cursor); 1474 1475 railh.visibility = true; 1476 railh.scrollable = true; 1477 1478 railh.align = (self.opt.railvalign=="top") ? 0 : 1; 1479 1480 self.railh = railh; 1481 1482 self.railh.drag = false; 1483 1484 } 1485 1486// 1487 1488 if (self.ispage) { 1489 rail.css({position:"fixed",top:"0px",height:"100%"}); 1490 (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"}); 1491 self.body.append(rail); 1492 if (self.railh) { 1493 railh.css({position:"fixed",left:"0px",width:"100%"}); 1494 (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"}); 1495 self.body.append(railh); 1496 } 1497 } else { 1498 if (self.ishwscroll) { 1499 if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'}); 1500 var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; 1501 if (self.zoom) { 1502 self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4}); 1503 bd.append(self.zoom); 1504 } 1505 rail.css({position:"absolute",top:0}); 1506 (rail.align) ? rail.css({right:0}) : rail.css({left:0}); 1507 bd.append(rail); 1508 if (railh) { 1509 railh.css({position:"absolute",left:0,bottom:0}); 1510 (railh.align) ? railh.css({bottom:0}) : railh.css({top:0}); 1511 bd.append(railh); 1512 } 1513 } else { 1514 self.isfixed = (self.win.css("position")=="fixed"); 1515 var rlpos = (self.isfixed) ? "fixed" : "absolute"; 1516 1517 if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); 1518 if (self.viewport) { 1519 self.body = self.viewport; 1520 if ((/relative|absolute/.test(self.viewport.css("position")))==false) self.css(self.viewport,{"position":"relative"}); 1521 } 1522 1523 rail.css({position:rlpos}); 1524 if (self.zoom) self.zoom.css({position:rlpos}); 1525 self.updateScrollBar(); 1526 self.body.append(rail); 1527 if (self.zoom) self.body.append(self.zoom); 1528 if (self.railh) { 1529 railh.css({position:rlpos}); 1530 self.body.append(railh); 1531 } 1532 } 1533 1534 if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'}); // prevent grey layer on click 1535 1536 if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true"); // IE, prevent dotted rectangle on focused div 1537 if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"}); 1538// if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera to test [TODO] 1539 1540 } 1541 1542 if (self.opt.autohidemode===false) { 1543 self.autohidedom = false;
1544 self.rail.css({opacity:self.opt.cursoropacitymax}); 1545 if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax}); 1546 } 1547 else if (self.opt.autohidemode===true) { 1548 self.autohidedom = $().add(self.rail); 1549 if (cap.isie8) self.autohidedom=self.autohidedom.add(self.cursor); 1550 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 1551 if (self.railh&&cap.isie8) self.autohidedom=self.autohidedom.add(self.cursorh); 1552 } 1553 else if (self.opt.autohidemode=="scroll") { 1554 self.autohidedom = $().add(self.rail); 1555 if (self.railh) self.autohidedom=self.autohidedom.add(self.railh); 1556 } 1557 else if (self.opt.autohidemode=="cursor") { 1558 self.autohidedom = $().add(self.cursor); 1559 if (self.railh) self.autohidedom=self.autohidedom.add(self.cursorh); 1560 } 1561 else if (self.opt.autohidemode=="hidden") { 1562 self.autohidedom = false; 1563 self.hide(); 1564 self.locked = false; 1565 } 1566 1567 if (cap.isie9mobile) { 1568 1569 self.scrollmom = new ScrollMomentumClass2D(self); 1570 1571 /* 1572 var trace = function(msg) { 1573 var db = $("#debug"); 1574 if (isNaN(msg)&&(typeof msg != "string")) { 1575 var x = []; 1576 for(var a in msg) { 1577 x.push(a+":"+msg[a]); 1578 } 1579 msg ="{"+x.join(",")+"}"; 1580 } 1581 if (db.children().length>0) { 1582 db.children().eq(0).before("<div>"+msg+"</div>"); 1583 } else { 1584 db.append("<div>"+msg+"</div>"); 1585 } 1586 } 1587 window.onerror = function(msg,url,ln) { 1588 trace("ERR: "+msg+" at "+ln); 1589 } 1590*/ 1591 1592 self.onmangotouch = function(e) { 1593 var py = self.getScrollTop(); 1594 var px = self.getScrollLeft(); 1595 1596 if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true; 1597// $("#debug").html('DRAG:'+py); 1598 1599 var dfy = py-self.mangotouch.sy; 1600 var dfx = px-self.mangotouch.sx; 1601 var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2))); 1602 if (df==0) return; 1603 1604 var dry = (dfy<0)?-1:1; 1605 var drx = (dfx<0)?-1:1; 1606 1607 var tm = +new Date(); 1608 if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy); 1609 1610 if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) { 1611// trace('RESET+'+(tm-self.mangotouch.tm)); 1612 self.scrollmom.stop(); 1613 self.scrollmom.reset(px,py); 1614 self.mangotouch.sy = py; 1615 self.mangotouch.ly = py; 1616 self.mangotouch.sx = px; 1617 self.mangotouch.lx = px; 1618 self.mangotouch.dry = dry; 1619 self.mangotouch.drx = drx; 1620 self.mangotouch.tm = tm; 1621 } else { 1622 1623 self.scrollmom.stop(); 1624 self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy); 1625 var gap = tm - self.mangotouch.tm; 1626 self.mangotouch.tm = tm; 1627 1628// trace('MOVE:'+df+" - "+gap); 1629 1630 var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px)); 1631 self.mangotouch.ly = py; 1632 self.mangotouch.lx = px; 1633 1634 if (ds>2) { 1635 self.mangotouch.lazy = setTimeout(function(){ 1636// trace('END:'+ds+'+'+gap); 1637 self.mangotouch.lazy = false; 1638 self.mangotouch.dry = 0; 1639 self.mangotouch.drx = 0; 1640 self.mangotouch.tm = 0; 1641 self.scrollmom.doMomentum(30); 1642 },100); 1643 } 1644 } 1645 } 1646 1647 var top = self.getScrollTop(); 1648 var lef = self.getScrollLeft(); 1649 self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0}; 1650 1651 self.bind(self.docscroll,"scroll",self.onmangotouch); 1652 1653 } else { 1654 1655 if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) { 1656 1657 self.scrollmom = new ScrollMomentumClass2D(self); 1658 1659 self.ontouchstart = function(e) { 1660 if (e.pointerType&&e.pointerType!=2) return false;
1661 1662 if (!self.locked) { 1663 1664 if (cap.hasmstouch) { 1665 var tg = (e.target) ? e.target : false; 1666 while (tg) { 1667 var nc = $(tg).getNiceScroll(); 1668 if ((nc.length>0)&&(nc[0].me == self.me)) break; 1669 if (nc.length>0) return false; 1670 if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break; 1671 tg = (tg.parentNode) ? tg.parentNode : false; 1672 } 1673 } 1674 1675 self.cancelScroll(); 1676 1677 var tg = self.getTarget(e); 1678 1679 if (tg) { 1680 var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type)); 1681 if (skp) return self.stopPropagation(e); 1682 } 1683 1684 if (!("clientX" in e) && ("changedTouches" in e)) { 1685 e.clientX = e.changedTouches[0].clientX; 1686 e.clientY = e.changedTouches[0].clientY; 1687 } 1688 1689 if (self.forcescreen) { 1690 var le = e; 1691 var e = {"original":(e.original)?e.original:e}; 1692 e.clientX = le.screenX; 1693 e.clientY = le.screenY; 1694 } 1695 1696 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2,dl:false}; 1697 1698 if (self.ispage||!self.opt.directionlockdeadzone) { 1699 self.rail.drag.dl = "f"; 1700 } else { 1701 1702 var view = { 1703 w:$(window).width(), 1704 h:$(window).height() 1705 }; 1706 1707 var page = { 1708 w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), 1709 h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) 1710 } 1711 1712 var maxh = Math.max(0,page.h - view.h); 1713 var maxw = Math.max(0,page.w - view.w); 1714 1715 if (!self.rail.scrollable&&self.railh.scrollable) self.rail.drag.ck = (maxh>0) ? "v" : false; 1716 else if (self.rail.scrollable&&!self.railh.scrollable) self.rail.drag.ck = (maxw>0) ? "h" : false; 1717 else self.rail.drag.ck = false; 1718 if (!self.rail.drag.ck) self.rail.drag.dl = "f"; 1719 } 1720 1721 if (self.opt.touchbehavior&&self.isiframe&&cap.isie) { 1722 var wp = self.win.position(); 1723 self.rail.drag.x+=wp.left; 1724 self.rail.drag.y+=wp.top; 1725 } 1726 1727 self.hasmoving = false; 1728 self.lastmouseup = false; 1729 self.scrollmom.reset(e.clientX,e.clientY); 1730 if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) { 1731 1732 var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false; 1733 if (!ip) { 1734 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 1735// return self.cancelEvent(e); 1736 return (self.opt.touchbehavior) ? self.cancelEvent(e) : self.stopPropagation(e); 1737 } 1738 if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { 1739 pc = {"tg":tg,"click":false}; 1740 self.preventclick = pc; 1741 } 1742 1743 } 1744 } 1745 1746 }; 1747 1748 self.ontouchend = function(e) { 1749 if (e.pointerType&&e.pointerType!=2) return false; 1750 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1751 self.scrollmom.doMomentum(); 1752 self.rail.drag = false; 1753 if (self.hasmoving) { 1754 self.hasmoving = false; 1755 self.lastmouseup = true; 1756 self.hideCursor(); 1757 if (cap.hasmousecapture) document.releaseCapture(); 1758 if (!cap.cantouch) return self.cancelEvent(e); 1759 } 1760 } 1761 1762 }; 1763 1764 var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture); 1765 1766 self.ontouchmove = function(e,byiframe) { 1767 1768 if (e.pointerType&&e.pointerType!=2) return false;
1769 1770 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1771 if (cap.cantouch&&(typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements 1772 1773 self.hasmoving = true; 1774 1775 if (self.preventclick&&!self.preventclick.click) { 1776 self.preventclick.click = self.preventclick.tg.onclick||false; 1777 self.preventclick.tg.onclick = self.onpreventclick; 1778 } 1779 1780 var ev = $.extend({"original":e},e); 1781 e = ev; 1782 1783 if (("changedTouches" in e)) { 1784 e.clientX = e.changedTouches[0].clientX; 1785 e.clientY = e.changedTouches[0].clientY; 1786 } 1787 1788 if (self.forcescreen) { 1789 var le = e; 1790 var e = {"original":(e.original)?e.original:e}; 1791 e.clientX = le.screenX; 1792 e.clientY = le.screenY; 1793 } 1794 1795 var ofx = ofy = 0; 1796 1797 if (moveneedoffset&&!byiframe) { 1798 var wp = self.win.position(); 1799 ofx=-wp.left; 1800 ofy=-wp.top; 1801 } 1802 1803 var fy = e.clientY + ofy; 1804 var my = (fy-self.rail.drag.y); 1805 var fx = e.clientX + ofx; 1806 var mx = (fx-self.rail.drag.x); 1807 1808 var ny = self.rail.drag.st-my; 1809 1810 if (self.ishwscroll&&self.opt.bouncescroll) { 1811 if (ny<0) { 1812 ny = Math.round(ny/2); 1813// fy = 0; 1814 } 1815 else if (ny>self.page.maxh) { 1816 ny = self.page.maxh+Math.round((ny-self.page.maxh)/2); 1817// fy = 0; 1818 } 1819 } else { 1820 if (ny<0) {ny=0;fy=0} 1821 if (ny>self.page.maxh) {ny=self.page.maxh;fy=0} 1822 } 1823 1824 if (self.railh&&self.railh.scrollable) { 1825 var nx = self.rail.drag.sl-mx; 1826 1827 if (self.ishwscroll&&self.opt.bouncescroll) { 1828 if (nx<0) { 1829 nx = Math.round(nx/2); 1830// fx = 0; 1831 } 1832 else if (nx>self.page.maxw) { 1833 nx = self.page.maxw+Math.round((nx-self.page.maxw)/2); 1834// fx = 0; 1835 } 1836 } else { 1837 if (nx<0) {nx=0;fx=0} 1838 if (nx>self.page.maxw) {nx=self.page.maxw;fx=0} 1839 } 1840 1841 } 1842 1843 var grabbed = false; 1844 if (self.rail.drag.dl) { 1845 grabbed = true; 1846 if (self.rail.drag.dl=="v") nx = self.rail.drag.sl; 1847 else if (self.rail.drag.dl=="h") ny = self.rail.drag.st; 1848 } else { 1849 var ay = Math.abs(my); 1850 var ax = Math.abs(mx); 1851 var dz = self.opt.directionlockdeadzone; 1852 if (self.rail.drag.ck=="v") { 1853 if (ay>dz&&(ax<=(ay*0.3))) { 1854 self.rail.drag = false; 1855 return true; 1856 } 1857 else if (ax>dz) { 1858 self.rail.drag.dl="f"; 1859 $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked) 1860 } 1861 } 1862 else if (self.rail.drag.ck=="h") { 1863 if (ax>dz&&(ay<=(ax*0.3))) { 1864 self.rail.drag = false; 1865 return true; 1866 } 1867 else if (ay>dz) { 1868 self.rail.drag.dl="f"; 1869 $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked) 1870 } 1871 } 1872 } 1873 1874 self.synched("touchmove",function(){ 1875 if (self.rail.drag&&(self.rail.drag.pt==2)) { 1876 if (self.prepareTransition) self.prepareTransition(0); 1877 if (self.rail.scrollable) self.setScrollTop(ny); 1878 self.scrollmom.update(fx,fy); 1879 if (self.railh&&self.railh.scrollable) { 1880 self.setScrollLeft(nx); 1881 self.showCursor(ny,nx); 1882 } else { 1883 self.showCursor(ny); 1884 } 1885 if (cap.isie10) document.selection.clear(); 1886 } 1887 }); 1888 1889 if (cap.ischrome&&self.istouchcapable) grabbed=false; //chrome touch emulation doesn't like! 1890 if (grabbed) return self.cancelEvent(e); 1891 } 1892 1893 }; 1894 1895 } 1896
1897 self.onmousedown = function(e,hronly) { 1898 if (self.rail.drag&&self.rail.drag.pt!=1) return; 1899 if (self.locked) return self.cancelEvent(e); 1900 self.cancelScroll(); 1901 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)}; 1902 var tg = self.getTarget(e); 1903 if (!self.ispage&&cap.hasmousecapture) tg.setCapture(); 1904 if (self.isiframe&&!cap.hasmousecapture) { 1905 self.saved["csspointerevents"] = self.doc.css("pointer-events"); 1906 self.css(self.doc,{"pointer-events":"none"}); 1907 } 1908 return self.cancelEvent(e); 1909 }; 1910 1911 self.onmouseup = function(e) { 1912 if (self.rail.drag) { 1913 if (cap.hasmousecapture) document.releaseCapture(); 1914 if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]); 1915 if(self.rail.drag.pt!=1)return; 1916 self.rail.drag = false; 1917 //if (!self.rail.active) self.hideCursor(); 1918 return self.cancelEvent(e); 1919 } 1920 }; 1921 1922 self.onmousemove = function(e) { 1923 if (self.rail.drag) { 1924 if(self.rail.drag.pt!=1)return; 1925 1926 if (cap.ischrome&&e.which==0) return self.onmouseup(e); 1927 1928 self.cursorfreezed = true; 1929 1930 if (self.rail.drag.hr) { 1931 self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x); 1932 if (self.scroll.x<0) self.scroll.x=0; 1933 var mw = self.scrollvaluemaxw; 1934 if (self.scroll.x>mw) self.scroll.x=mw; 1935 } else { 1936 self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y); 1937 if (self.scroll.y<0) self.scroll.y=0; 1938 var my = self.scrollvaluemax; 1939 if (self.scroll.y>my) self.scroll.y=my; 1940 } 1941 1942 self.synched('mousemove',function(){ 1943 if (self.rail.drag&&(self.rail.drag.pt==1)) { 1944 self.showCursor(); 1945 if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x),self.opt.cursordragspeed); 1946 else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y),self.opt.cursordragspeed); 1947 } 1948 }); 1949 1950 return self.cancelEvent(e); 1951 } 1952/* 1953 else { 1954 self.checkarea = true; 1955 } 1956*/ 1957 }; 1958 1959 if (cap.cantouch||self.opt.touchbehavior) { 1960 1961 self.onpreventclick = function(e) { 1962 if (self.preventclick) { 1963 self.preventclick.tg.onclick = self.preventclick.click; 1964 self.preventclick = false; 1965 return self.cancelEvent(e); 1966 } 1967 } 1968 1969// self.onmousedown = self.ontouchstart; 1970// self.onmouseup = self.ontouchend; 1971// self.onmousemove = self.ontouchmove; 1972 1973 self.bind(self.win,"mousedown",self.ontouchstart); // control content dragging 1974 1975 self.onclick = (cap.isios) ? false : function(e) { 1976 if (self.lastmouseup) { 1977 self.lastmouseup = false; 1978 return self.cancelEvent(e); 1979 } else { 1980 return true; 1981 } 1982 }; 1983 1984 if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) { 1985 self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue}); 1986 self.css(self.rail,{'cursor':cap.cursorgrabvalue}); 1987 } 1988 1989 } else { 1990 1991 function checkSelectionScroll(e) { 1992 if (!self.selectiondrag) return; 1993 1994 if (e) { 1995 var ww = self.win.outerHeight(); 1996 var df = (e.pageY - self.selectiondrag.top); 1997 if (df>0&&df<ww) df=0; 1998 if (df>=ww) df-=ww; 1999 self.selectiondrag.df = df; 2000 } 2001 if (self.selectiondrag.df==0) return; 2002 2003 var rt = -Math.floor(self.selectiondrag.df/6)*2; 2004// self.doScrollTop(self.getScrollTop(true)+rt); 2005 self.doScrollBy(rt); 2006 2007 self.debounced("doselectionscroll",function(){checkSelectionScroll()},50); 2008 } 2009 2010 if ("getSelection" in document) { // A grade - Major browsers 2011 self.hasTextSelected = function() { 2012 return (document.getSelection().rangeCount>0); 2013 } 2014 } 2015 else if ("selection" in document) { //IE9- 2016 self.hasTextSelected = function() { 2017 return (document.selection.type != "None"); 2018 } 2019 } 2020 else { 2021 self.hasTextSelected = function() { // no support 2022 return false;
2023 } 2024 } 2025 2026 self.onselectionstart = function(e) { 2027 if (self.ispage) return; 2028 self.selectiondrag = self.win.offset(); 2029 } 2030 self.onselectionend = function(e) { 2031 self.selectiondrag = false; 2032 } 2033 self.onselectiondrag = function(e) { 2034 if (!self.selectiondrag) return; 2035 if (self.hasTextSelected()) self.debounced("selectionscroll",function(){checkSelectionScroll(e)},250); 2036 } 2037 2038 2039 } 2040 2041 if (cap.hasmstouch) { 2042 self.css(self.rail,{'-ms-touch-action':'none'}); 2043 self.css(self.cursor,{'-ms-touch-action':'none'}); 2044 2045 self.bind(self.win,"MSPointerDown",self.ontouchstart); 2046 self.bind(document,"MSPointerUp",self.ontouchend); 2047 self.bind(document,"MSPointerMove",self.ontouchmove); 2048 self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault()}); 2049 self.bind(self.cursor,"contextmenu",function(e){e.preventDefault()}); 2050 } 2051 2052 if (this.istouchcapable) { //desktop with screen touch enabled 2053 self.bind(self.win,"touchstart",self.ontouchstart); 2054 self.bind(document,"touchend",self.ontouchend); 2055 self.bind(document,"touchcancel",self.ontouchend); 2056 self.bind(document,"touchmove",self.ontouchmove); 2057 } 2058 2059 self.bind(self.cursor,"mousedown",self.onmousedown); 2060 self.bind(self.cursor,"mouseup",self.onmouseup); 2061 2062 if (self.railh) { 2063 self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)}); 2064 self.bind(self.cursorh,"mouseup",function(e){ 2065 if (self.rail.drag&&self.rail.drag.pt==2) return; 2066 self.rail.drag = false; 2067 self.hasmoving = false; 2068 self.hideCursor(); 2069 if (cap.hasmousecapture) document.releaseCapture(); 2070 return self.cancelEvent(e); 2071 }); 2072 } 2073 2074 if (self.opt.cursordragontouch||!cap.cantouch&&!self.opt.touchbehavior) { 2075 2076 self.rail.css({"cursor":"default"}); 2077 self.railh&&self.railh.css({"cursor":"default"}); 2078 2079 self.jqbind(self.rail,"mouseenter",function() { 2080 if (self.canshowonmouseevent) self.showCursor(); 2081 self.rail.active = true; 2082 }); 2083 self.jqbind(self.rail,"mouseleave",function() { 2084 self.rail.active = false; 2085 if (!self.rail.drag) self.hideCursor(); 2086 }); 2087 2088 if (self.opt.sensitiverail) { 2089 self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)}); 2090 self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)}); 2091 self.bind(self.cursor,"click",function(e){self.cancelEvent(e)}); 2092 self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)}); 2093 } 2094 2095 if (self.railh) { 2096 self.jqbind(self.railh,"mouseenter",function() { 2097 if (self.canshowonmouseevent) self.showCursor(); 2098 self.rail.active = true; 2099 }); 2100 self.jqbind(self.railh,"mouseleave",function() { 2101 self.rail.active = false; 2102 if (!self.rail.drag) self.hideCursor(); 2103 }); 2104 2105 if (self.opt.sensitiverail) { 2106 self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)}); 2107 self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) }); 2108 self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) }); 2109 self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) }); 2110 } 2111 2112 } 2113 2114 } 2115 2116 if (!cap.cantouch&&!self.opt.touchbehavior) { 2117 2118 self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.onmouseup); 2119 self.bind(document,"mousemove",self.onmousemove); 2120 if (self.onclick) self.bind(document,"click",self.onclick); 2121 2122 if (!self.ispage&&self.opt.enablescrollonselection) { 2123 self.bind(self.win[0],"mousedown",self.onselectionstart); 2124 self.bind(document,"mouseup",self.onselectionend); 2125 self.bind(self.cursor,"mouseup",self.onselectionend); 2126 if (self.cursorh) self.bind(self.cursorh,"mouseup",self.onselectionend); 2127 self.bind(document,"mousemove",self.onselectiondrag); 2128 } 2129 2130 if (self.zoom) { 2131 self.jqbind(self.zoom,"mouseenter",function() { 2132 if (self.canshowonmouseevent) self.showCursor(); 2133 self.rail.active = true; 2134 }); 2135 self.jqbind(self.zoom,"mouseleave",function() { 2136 self.rail.active = false;
2137 if (!self.rail.drag) self.hideCursor(); 2138 }); 2139 } 2140 2141 } else { 2142 2143 self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.ontouchend); 2144 self.bind(document,"mousemove",self.ontouchmove); 2145 if (self.onclick) self.bind(document,"click",self.onclick); 2146 2147 if (self.opt.cursordragontouch) { 2148 self.bind(self.cursor,"mousedown",self.onmousedown); 2149 self.bind(self.cursor,"mousemove",self.onmousemove); 2150 self.cursorh&&self.bind(self.cursorh,"mousedown",self.onmousedown); 2151 self.cursorh&&self.bind(self.cursorh,"mousemove",self.onmousemove); 2152 } 2153 2154 } 2155 2156 if (self.opt.enablemousewheel) { 2157 if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.win /*self.docscroll*/ ,"mousewheel",self.onmousewheel); 2158 self.bind(self.rail,"mousewheel",self.onmousewheel); 2159 if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr); 2160 } 2161 2162 if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) { 2163 if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++}); 2164 2165 self.jqbind(self.win,"focus",function(e) { 2166 domfocus = (self.getTarget(e)).id||true; 2167 self.hasfocus = true; 2168 if (self.canshowonmouseevent) self.noticeCursor(); 2169 }); 2170 self.jqbind(self.win,"blur",function(e) { 2171 domfocus = false; 2172 self.hasfocus = false; 2173 }); 2174 2175 self.jqbind(self.win,"mouseenter",function(e) { 2176 mousefocus = (self.getTarget(e)).id||true; 2177 self.hasmousefocus = true; 2178 if (self.canshowonmouseevent) self.noticeCursor(); 2179 }); 2180 self.jqbind(self.win,"mouseleave",function() { 2181 mousefocus = false; 2182 self.hasmousefocus = false; 2183 }); 2184 2185 }; 2186 2187 } // !ie9mobile 2188 2189 //Thanks to http://www.quirksmode.org !! 2190 self.onkeypress = function(e) { 2191 if (self.locked&&self.page.maxh==0) return true; 2192 2193 e = (e) ? e : window.e; 2194 var tg = self.getTarget(e); 2195 if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { 2196 var tp = tg.getAttribute('type')||tg.type||false; 2197 if ((!tp)||!(/submit|button|cancel/i.tp)) return true; 2198 } 2199 2200 if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) { 2201 var key = e.keyCode; 2202 2203 if (self.locked&&key!=27) return self.cancelEvent(e); 2204 2205 var ctrl = e.ctrlKey||false; 2206 var shift = e.shiftKey || false; 2207 2208 var ret = false;
2209 switch (key) { 2210 case 38: 2211 case 63233: //safari 2212 self.doScrollBy(24*3); 2213 ret = true; 2214 break; 2215 case 40: 2216 case 63235: //safari 2217 self.doScrollBy(-24*3); 2218 ret = true; 2219 break; 2220 case 37: 2221 case 63232: //safari 2222 if (self.railh) { 2223 (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3); 2224 ret = true; 2225 } 2226 break; 2227 case 39: 2228 case 63234: //safari 2229 if (self.railh) { 2230 (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3); 2231 ret = true; 2232 } 2233 break; 2234 case 33: 2235 case 63276: // safari 2236 self.doScrollBy(self.view.h); 2237 ret = true; 2238 break; 2239 case 34: 2240 case 63277: // safari 2241 self.doScrollBy(-self.view.h); 2242 ret = true; 2243 break; 2244 case 36: 2245 case 63273: // safari 2246 (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0); 2247 ret = true; 2248 break; 2249 case 35: 2250 case 63275: // safari 2251 (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh); 2252 ret = true; 2253 break; 2254 case 32: 2255 if (self.opt.spacebarenabled) { 2256 (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h); 2257 ret = true; 2258 } 2259 break; 2260 case 27: // ESC 2261 if (self.zoomactive) { 2262 self.doZoom(); 2263 ret = true; 2264 } 2265 break; 2266 } 2267 if (ret) return self.cancelEvent(e); 2268 } 2269 }; 2270 2271 if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress); 2272 2273 self.bind(window,'resize',self.lazyResize); 2274 self.bind(window,'orientationchange',self.lazyResize); 2275 2276 self.bind(window,"load",self.lazyResize); 2277 2278 if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 2279 var tmp=self.win.attr("style"); 2280 var ww = parseFloat(self.win.css("width"))+1; 2281 self.win.css('width',ww); 2282 self.synched("chromefix",function(){self.win.attr("style",tmp)}); 2283 } 2284 2285 2286// Trying a cross-browser implementation - good luck! 2287 2288 self.onAttributeChange = function(e) { 2289 self.lazyResize(250); 2290 } 2291 2292 if (!self.ispage&&!self.haswrapper) { 2293 // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content 2294 if (clsMutationObserver !== false) { 2295 self.observer = new clsMutationObserver(function(mutations) { 2296 mutations.forEach(self.onAttributeChange); 2297 }); 2298 self.observer.observe(self.win[0],{childList: true, characterData: false, attributes: true, subtree: false}); 2299 2300 self.observerremover = new clsMutationObserver(function(mutations) { 2301 mutations.forEach(function(mo){ 2302 if (mo.removedNodes.length>0) { 2303 for (var dd in mo.removedNodes) { 2304 if (mo.removedNodes[dd]==self.win[0]) return self.remove(); 2305 } 2306 } 2307 }); 2308 }); 2309 self.observerremover.observe(self.win[0].parentNode,{childList: true, characterData: false, attributes: false, subtree: false}); 2310 2311 } else { 2312 self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange); 2313 if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug 2314 self.bind(self.win,"DOMNodeRemoved",function(e){ 2315 if (e.target==self.win[0]) self.remove(); 2316 }); 2317 } 2318 } 2319 2320// 2321 2322 if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom); 2323 if (self.istextarea) self.bind(self.win,"mouseup",self.lazyResize); 2324 2325 self.checkrtlmode = true; 2326 self.lazyResize(30); 2327 2328 } 2329 2330 if (this.doc[0].nodeName == 'IFRAME') { 2331 function oniframeload(e) { 2332 self.iframexd = false;
2333 try { 2334 var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document; 2335 var a = doc.domain; 2336 } catch(e){self.iframexd = true;doc=false}; 2337 2338 if (self.iframexd) { 2339 if ("console" in window) console.log('NiceScroll error: policy restriced iframe'); 2340 return true; //cross-domain - I can't manage this 2341 } 2342 2343 self.forcescreen = true; 2344 2345 if (self.isiframe) { 2346 self.iframe = { 2347 "doc":$(doc), 2348 "html":self.doc.contents().find('html')[0], 2349 "body":self.doc.contents().find('body')[0] 2350 }; 2351 self.getContentSize = function(){ 2352 return { 2353 w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth), 2354 h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight) 2355 } 2356 } 2357 self.docscroll = $(self.iframe.body);//$(this.contentWindow); 2358 } 2359 2360 if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) { 2361 self.win.scrollTop(0); // reset position 2362 self.doc.height(""); //reset height to fix browser bug 2363 var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight); 2364 self.doc.height(hh); 2365 } 2366 self.lazyResize(30); 2367 2368 if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'}); 2369 //self.css($(doc.body),{'overflow-y':'hidden'}); 2370 self.css($(self.iframe.body),{'overflow-y':'hidden'}); 2371 2372 if (cap.isios&&self.haswrapper) { 2373 self.css($(doc.body),{'-webkit-transform':'translate3d(0,0,0)'}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ 2374 2375 console.log(1); 2376 2377 } 2378 2379 if ('contentWindow' in this) { 2380 self.bind(this.contentWindow,"scroll",self.onscroll); //IE8 & minor 2381 } else { 2382 self.bind(doc,"scroll",self.onscroll); 2383 } 2384 2385 if (self.opt.enablemousewheel) { 2386 self.bind(doc,"mousewheel",self.onmousewheel); 2387 } 2388 2389 if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress); 2390 2391 if (cap.cantouch||self.opt.touchbehavior) { 2392 self.bind(doc,"mousedown",self.ontouchstart); 2393 self.bind(doc,"mousemove",function(e){self.ontouchmove(e,true)}); 2394 if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue}); 2395 } 2396 2397 self.bind(doc,"mouseup",self.ontouchend); 2398 2399 if (self.zoom) { 2400 if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom); 2401 if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom); 2402 } 2403 }; 2404 2405 if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){ 2406 setTimeout(function(){oniframeload.call(self.doc[0],false)},500); 2407 } 2408 self.bind(this.doc,"load",oniframeload); 2409 2410 } 2411 2412 }; 2413 2414 this.showCursor = function(py,px) { 2415 if (self.cursortimeout) { 2416 clearTimeout(self.cursortimeout); 2417 self.cursortimeout = 0; 2418 } 2419 if (!self.rail) return; 2420 if (self.autohidedom) { 2421 self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax}); 2422 self.cursoractive = true; 2423 } 2424 2425 if (!self.rail.drag||self.rail.drag.pt!=1) { 2426 if ((typeof py != "undefined")&&(py!==false)) { 2427 self.scroll.y = Math.round(py * 1/self.scrollratio.y); 2428 } 2429 if (typeof px != "undefined") { 2430 self.scroll.x = Math.round(px * 1/self.scrollratio.x); 2431 } 2432 } 2433 2434 self.cursor.css({height:self.cursorheight,top:self.scroll.y}); 2435 if (self.cursorh) { 2436 (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x}); 2437 self.cursoractive = true; 2438 } 2439 2440 if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax}); 2441 }; 2442 2443 this.hideCursor = function(tm) { 2444 if (self.cursortimeout) return; 2445 if (!self.rail) return; 2446 if (!self.autohidedom) return; 2447 self.cursortimeout = setTimeout(function() { 2448 if (!self.rail.active||!self.showonmouseevent) { 2449 self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin}); 2450 if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin}); 2451 self.cursoractive = false;
2452 } 2453 self.cursortimeout = 0; 2454 },tm||self.opt.hidecursordelay); 2455 }; 2456 2457 this.noticeCursor = function(tm,py,px) { 2458 self.showCursor(py,px); 2459 if (!self.rail.active) self.hideCursor(tm); 2460 }; 2461 2462 this.getContentSize = 2463 (self.ispage) ? 2464 function(){ 2465 return { 2466 w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth), 2467 h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight) 2468 } 2469 } 2470 : (self.haswrapper) ? 2471 function(){ 2472 return { 2473 w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')), 2474 h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom')) 2475 } 2476 } 2477 : function() { 2478 return { 2479 w:self.docscroll[0].scrollWidth, 2480 h:self.docscroll[0].scrollHeight 2481 } 2482 }; 2483 2484 this.onResize = function(e,page) { 2485 2486 if (!self.win) return false; 2487 2488 if (!self.haswrapper&&!self.ispage) { 2489 if (self.win.css('display')=='none') { 2490 if (self.visibility) self.hideRail().hideRailHr(); 2491 return false; 2492 } else { 2493 if (!self.hidden&&!self.visibility) self.showRail().showRailHr(); 2494 } 2495 } 2496 2497 var premaxh = self.page.maxh; 2498 var premaxw = self.page.maxw; 2499 2500 var preview = {h:self.view.h,w:self.view.w}; 2501 2502 self.view = { 2503 w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth), 2504 h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight) 2505 }; 2506 2507 self.page = (page) ? page : self.getContentSize(); 2508 2509 self.page.maxh = Math.max(0,self.page.h - self.view.h); 2510 self.page.maxw = Math.max(0,self.page.w - self.view.w); 2511 2512 if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) { 2513 // test position 2514 if (!self.ispage) { 2515 var pos = self.win.offset(); 2516 if (self.lastposition) { 2517 var lst = self.lastposition; 2518 if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do 2519 } 2520 self.lastposition = pos; 2521 } else { 2522 return self; //nothing to do 2523 } 2524 } 2525 2526 if (self.page.maxh==0) { 2527 self.hideRail(); 2528 self.scrollvaluemax = 0; 2529 self.scroll.y = 0; 2530 self.scrollratio.y = 0; 2531 self.cursorheight = 0; 2532 self.setScrollTop(0); 2533 self.rail.scrollable = false; 2534 } else { 2535 self.rail.scrollable = true; 2536 } 2537 2538 if (self.page.maxw==0) { 2539 self.hideRailHr(); 2540 self.scrollvaluemaxw = 0; 2541 self.scroll.x = 0; 2542 self.scrollratio.x = 0; 2543 self.cursorwidth = 0; 2544 self.setScrollLeft(0); 2545 self.railh.scrollable = false; 2546 } else { 2547 self.railh.scrollable = true; 2548 } 2549 2550 self.locked = (self.page.maxh==0)&&(self.page.maxw==0); 2551 if (self.locked) { 2552 if (!self.ispage) self.updateScrollBar(self.view); 2553 return false; 2554 } 2555 2556 if (!self.hidden&&!self.visibility) { 2557 self.showRail().showRailHr(); 2558 } 2559 else if (!self.hidden&&!self.railh.visibility) self.showRailHr(); 2560 2561 if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20; 2562 2563 self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h))); 2564 self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight); 2565 2566 self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w))); 2567 self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth); 2568 2569 self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder; 2570 2571 if (self.railh) { 2572 self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w; 2573 self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder; 2574 } 2575 2576 if (self.checkrtlmode&&self.railh) { 2577 self.checkrtlmode = false;
2578 if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw); 2579 } 2580 2581 if (!self.ispage) self.updateScrollBar(self.view); 2582 2583 self.scrollratio = { 2584 x:(self.page.maxw/self.scrollvaluemaxw), 2585 y:(self.page.maxh/self.scrollvaluemax) 2586 }; 2587 2588 var sy = self.getScrollTop(); 2589 if (sy>self.page.maxh) { 2590 self.doScrollTop(self.page.maxh); 2591 } else { 2592 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 2593 self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 2594 if (self.cursoractive) self.noticeCursor(); 2595 } 2596 2597 if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y)); 2598 2599 return self; 2600 }; 2601 2602 this.resize = self.onResize; 2603 2604 this.lazyResize = function(tm) { // event debounce 2605 tm = (isNaN(tm)) ? 30 : tm; 2606 self.delayed('resize',self.resize,tm); 2607 return self; 2608 } 2609 2610// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel 2611 function _modernWheelEvent(dom,name,fn,bubble) { 2612 self._bind(dom,name,function(e){ 2613 var e = (e) ? e : window.event; 2614 var event = { 2615 original: e, 2616 target: e.target || e.srcElement, 2617 type: "wheel", 2618 deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, 2619 deltaX: 0, 2620 deltaZ: 0, 2621 preventDefault: function() { 2622 e.preventDefault ? e.preventDefault() : e.returnValue = false; 2623 return false; 2624 }, 2625 stopImmediatePropagation: function() { 2626 (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true; 2627 } 2628 }; 2629 2630 if (name=="mousewheel") { 2631 event.deltaY = - 1/40 * e.wheelDelta; 2632 e.wheelDeltaX && (event.deltaX = - 1/40 * e.wheelDeltaX); 2633 } else { 2634 event.deltaY = e.detail; 2635 } 2636 2637 return fn.call(dom,event); 2638 },bubble); 2639 }; 2640 2641 this._bind = function(el,name,fn,bubble) { // primitive bind 2642 self.events.push({e:el,n:name,f:fn,b:bubble,q:false}); 2643 if (el.addEventListener) { 2644 el.addEventListener(name,fn,bubble||false); 2645 } 2646 else if (el.attachEvent) { 2647 el.attachEvent("on"+name,fn); 2648 } 2649 else { 2650 el["on"+name] = fn; 2651 } 2652 }; 2653 2654 this.jqbind = function(dom,name,fn) { // use jquery bind for non-native events (mouseenter/mouseleave) 2655 self.events.push({e:dom,n:name,f:fn,q:true}); 2656 $(dom).bind(name,fn); 2657 } 2658 2659 this.bind = function(dom,name,fn,bubble) { // touch-oriented & fixing jquery bind 2660 var el = ("jquery" in dom) ? dom[0] : dom; 2661 2662 if (name=='mousewheel') { 2663 if ("onwheel" in self.win) { 2664 self._bind(el,"wheel",fn,bubble||false); 2665 } else { 2666 var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox 2667 _modernWheelEvent(el,wname,fn,bubble||false); 2668 if (wname=="DOMMouseScroll") _modernWheelEvent(el,"MozMousePixelScroll",fn,bubble||false); // Firefox legacy 2669 } 2670 } 2671 else if (el.addEventListener) { 2672 if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support 2673 var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove'; 2674 self._bind(el,tt,function(e){ 2675 if (e.touches) { 2676 if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);} 2677 } 2678 else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);} //blackberry 2679 },bubble||false); 2680 } 2681 self._bind(el,name,fn,bubble||false); 2682 if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false); 2683 } 2684 else { 2685 self._bind(el,name,function(e) { 2686 e = e||window.event||false; 2687 if (e) { 2688 if (e.srcElement) e.target=e.srcElement; 2689 } 2690 if (!("pageY" in e)) { 2691 e.pageX = e.clientX + document.documentElement.scrollLeft; 2692 e.pageY = e.clientY + document.documentElement.scrollTop; 2693 } 2694 return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true; 2695 }); 2696 } 2697 }; 2698 2699 this._unbind = function(el,name,fn,bub) { // primitive unbind 2700 if (el.removeEventListener) { 2701 el.removeEventListener(name,fn,bub); 2702 } 2703 else if (el.detachEvent) { 2704 el.detachEvent('on'+name,fn); 2705 } else { 2706 el['on'+name] = false;
2707 } 2708 }; 2709 2710 this.unbindAll = function() { 2711 for(var a=0;a<self.events.length;a++) { 2712 var r = self.events[a]; 2713 (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b); 2714 } 2715 }; 2716 2717 // Thanks to http://www.switchonthecode.com !! 2718 this.cancelEvent = function(e) { 2719 var e = (e.original) ? e.original : (e) ? e : window.event||false; 2720 if (!e) return false; 2721 if(e.preventDefault) e.preventDefault(); 2722 if(e.stopPropagation) e.stopPropagation(); 2723 if(e.preventManipulation) e.preventManipulation(); //IE10 2724 e.cancelBubble = true; 2725 e.cancel = true; 2726 e.returnValue = false; 2727 return false; 2728 }; 2729 2730 this.stopPropagation = function(e) { 2731 var e = (e.original) ? e.original : (e) ? e : window.event||false; 2732 if (!e) return false; 2733 if (e.stopPropagation) return e.stopPropagation(); 2734 if (e.cancelBubble) e.cancelBubble=true; 2735 return false; 2736 } 2737 2738 this.showRail = function() { 2739 if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) { 2740 self.visibility = true; 2741 self.rail.visibility = true; 2742 self.rail.css('display','block'); 2743 } 2744 return self; 2745 }; 2746 2747 this.showRailHr = function() { 2748 if (!self.railh) return self; 2749 if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) { 2750 self.railh.visibility = true; 2751 self.railh.css('display','block'); 2752 } 2753 return self; 2754 }; 2755 2756 this.hideRail = function() { 2757 self.visibility = false; 2758 self.rail.visibility = false; 2759 self.rail.css('display','none'); 2760 return self; 2761 }; 2762 2763 this.hideRailHr = function() { 2764 if (!self.railh) return self; 2765 self.railh.visibility = false; 2766 self.railh.css('display','none'); 2767 return self; 2768 }; 2769 2770 this.show = function() { 2771 self.hidden = false; 2772 self.locked = false; 2773 return self.showRail().showRailHr(); 2774 }; 2775 2776 this.hide = function() { 2777 self.hidden = true; 2778 self.locked = true; 2779 return self.hideRail().hideRailHr(); 2780 }; 2781 2782 this.toggle = function() { 2783 return (self.hidden) ? self.show() : self.hide(); 2784 }; 2785 2786 this.remove = function() { 2787 self.stop(); 2788 if (self.cursortimeout) clearTimeout(self.cursortimeout); 2789 self.doZoomOut(); 2790 self.unbindAll(); 2791 2792 if (cap.isie9) self.win[0].detachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug 2793 2794 if (self.observer !== false) self.observer.disconnect(); 2795 if (self.observerremover !== false) self.observerremover.disconnect(); 2796 2797 self.events = null; 2798 2799 if (self.cursor) { 2800 self.cursor.remove(); 2801 } 2802 if (self.cursorh) { 2803 self.cursorh.remove(); 2804 } 2805 if (self.rail) { 2806 self.rail.remove(); 2807 } 2808 if (self.railh) { 2809 self.railh.remove(); 2810 } 2811 if (self.zoom) { 2812 self.zoom.remove(); 2813 } 2814 for(var a=0;a<self.saved.css.length;a++) { 2815 var d=self.saved.css[a]; 2816 d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]); 2817 } 2818 self.saved = false; 2819 self.me.data('__nicescroll',''); //erase all traces 2820 2821 // memory leak fixed by GianlucaGuarini - thanks a lot! 2822 // remove the current nicescroll from the $.nicescroll array & normalize array 2823 var lst = $.nicescroll; 2824 lst.each(function(i){ 2825 if (!this) return; 2826 if(this.id === self.id) { 2827 delete lst[i]; 2828 for(var b=++i;b<lst.length;b++,i++) lst[i]=lst[b]; 2829 lst.length--; 2830 if (lst.length) delete lst[lst.length]; 2831 } 2832 }); 2833 2834 for (var i in self) { 2835 self[i] = null; 2836 delete self[i]; 2837 } 2838 2839 self = null; 2840 2841 }; 2842 2843 this.scrollstart = function(fn) { 2844 this.onscrollstart = fn; 2845 return self; 2846 } 2847 this.scrollend = function(fn) { 2848 this.onscrollend = fn; 2849 return self; 2850 } 2851 this.scrollcancel = function(fn) { 2852 this.onscrollcancel = fn; 2853 return self; 2854 } 2855 2856 this.zoomin = function(fn) { 2857 this.onzoomin = fn; 2858 return self; 2859 } 2860 this.zoomout = function(fn) { 2861 this.onzoomout = fn; 2862 return self; 2863 } 2864 2865 this.isScrollable = function(e) { 2866 var dom = (e.target) ? e.target : e; 2867 if (dom.nodeName == 'OPTION') return true; 2868 while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { 2869 var dd = $(dom); 2870 var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; 2871 if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight); 2872 dom = (dom.parentNode) ? dom.parentNode : false;
2873 } 2874 return false; 2875 }; 2876 2877 this.getViewport = function(me) { 2878 var dom = (me&&me.parentNode) ? me.parentNode : false; 2879 while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) { 2880 var dd = $(dom); 2881 var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||''; 2882 if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd; 2883 if (dd.getNiceScroll().length>0) return dd; 2884 dom = (dom.parentNode) ? dom.parentNode : false; 2885 } 2886 return false; 2887 }; 2888 2889 function execScrollWheel(e,hr,chkscroll) { 2890 var px,py; 2891 var rt = 1; 2892 2893 if (e.deltaMode==0) { // PIXEL 2894 px = -Math.floor(e.deltaX*(self.opt.mousescrollstep/(18*3))); 2895 py = -Math.floor(e.deltaY*(self.opt.mousescrollstep/(18*3))); 2896 } 2897 else if (e.deltaMode==1) { // LINE 2898 px = -Math.floor(e.deltaX*self.opt.mousescrollstep); 2899 py = -Math.floor(e.deltaY*self.opt.mousescrollstep); 2900 } 2901 2902 if (hr&&self.opt.oneaxismousemode&&(px==0)&&py) { // classic vertical-only mousewheel + browser with x/y support 2903 px = py; 2904 py = 0; 2905 } 2906 2907 if (px) { 2908 if (self.scrollmom) {self.scrollmom.stop()} 2909 self.lastdeltax+=px; 2910 self.debounced("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}},120); 2911 } 2912 if (py) { 2913 if (self.opt.nativeparentscrolling&&chkscroll&&!self.ispage&&!self.zoomactive) { 2914 if (py<0) { 2915 if (self.getScrollTop()>=self.page.maxh) return true; 2916 } else { 2917 if (self.getScrollTop()<=0) return true; 2918 } 2919 } 2920 if (self.scrollmom) {self.scrollmom.stop()} 2921 self.lastdeltay+=py; 2922 self.debounced("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}},120); 2923 } 2924 2925 e.stopImmediatePropagation(); 2926 return e.preventDefault(); 2927// return self.cancelEvent(e); 2928 }; 2929 2930 this.onmousewheel = function(e) { 2931 if (self.locked) { 2932 self.debounced("checkunlock",self.resize,250); 2933 return true; 2934 } 2935 if (self.rail.drag) return self.cancelEvent(e); 2936 2937 if (self.opt.oneaxismousemode=="auto"&&e.deltaX!=0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) 2938 2939 if (self.opt.oneaxismousemode&&e.deltaX==0) { 2940 if (!self.rail.scrollable) { 2941 if (self.railh&&self.railh.scrollable) { 2942 return self.onmousewheelhr(e); 2943 } else { 2944 return true; 2945 } 2946 } 2947 } 2948 2949 var nw = +(new Date()); 2950 var chk = false; 2951 if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { 2952// self.checkarea = false; 2953 self.nativescrollingarea = self.isScrollable(e); 2954 chk = true; 2955 } 2956 self.checkarea = nw; 2957 if (self.nativescrollingarea) return true; // this isn't my business 2958// if (self.locked) return self.cancelEvent(e); 2959 var ret = execScrollWheel(e,false,chk); 2960 if (ret) self.checkarea = 0; 2961 return ret; 2962 }; 2963 2964 this.onmousewheelhr = function(e) { 2965 if (self.locked||!self.railh.scrollable) return true; 2966 if (self.rail.drag) return self.cancelEvent(e); 2967 2968 var nw = +(new Date()); 2969 var chk = false; 2970 if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { 2971// self.checkarea = false; 2972 self.nativescrollingarea = self.isScrollable(e); 2973 chk = true; 2974 } 2975 self.checkarea = nw; 2976 if (self.nativescrollingarea) return true; // this isn't my business 2977 if (self.locked) return self.cancelEvent(e); 2978 2979 return execScrollWheel(e,true,chk); 2980 }; 2981 2982 this.stop = function() { 2983 self.cancelScroll(); 2984 if (self.scrollmon) self.scrollmon.stop(); 2985 self.cursorfreezed = false; 2986 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 2987 self.noticeCursor(); 2988 return self; 2989 }; 2990 2991 this.getTransitionSpeed = function(dif) { 2992 var sp = Math.round(self.opt.scrollspeed*10); 2993 var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed)); 2994 return (ex>
299420) ? ex : 0; 2995 } 2996 2997 if (!self.opt.smoothscroll) { 2998 this.doScrollLeft = function(x,spd) { //direct 2999 var y = self.getScrollTop(); 3000 self.doScrollPos(x,y,spd); 3001 } 3002 this.doScrollTop = function(y,spd) { //direct 3003 var x = self.getScrollLeft(); 3004 self.doScrollPos(x,y,spd); 3005 } 3006 this.doScrollPos = function(x,y,spd) { //direct 3007 var nx = (x>self.page.maxw) ? self.page.maxw : x; 3008 if (nx<0) nx=0; 3009 var ny = (y>self.page.maxh) ? self.page.maxh : y; 3010 if (ny<0) ny=0; 3011 self.synched('scroll',function(){ 3012 self.setScrollTop(ny); 3013 self.setScrollLeft(nx); 3014 }); 3015 } 3016 this.cancelScroll = function() {}; // direct 3017 } 3018 else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) { 3019 this.prepareTransition = function(dif,istime) { 3020 var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif); 3021 var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : ''; 3022 if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) { 3023 self.lasttransitionstyle = trans; 3024 self.doc.css(cap.transitionstyle,trans); 3025 } 3026 return ex; 3027 }; 3028 3029 this.doScrollLeft = function(x,spd) { //trans 3030 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 3031 self.doScrollPos(x,y,spd); 3032 } 3033 3034 this.doScrollTop = function(y,spd) { //trans 3035 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 3036 self.doScrollPos(x,y,spd); 3037 } 3038 3039 this.doScrollPos = function(x,y,spd) { //trans 3040 3041 var py = self.getScrollTop(); 3042 var px = self.getScrollLeft(); 3043 3044 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 3045 3046 if (self.opt.bouncescroll==false) { 3047 if (y<0) y=0; 3048 else if (y>self.page.maxh) y=self.page.maxh; 3049 if (x<0) x=0; 3050 else if (x>self.page.maxw) x=self.page.maxw; 3051 } 3052 3053 if (self.scrollrunning&&x==self.newscrollx&&y==self.newscrolly) return false; 3054 3055 self.newscrolly = y; 3056 self.newscrollx = x; 3057 3058 self.newscrollspeed = spd||false; 3059 3060 if (self.timer) return false; 3061 3062 self.timer = setTimeout(function(){ 3063 3064 var top = self.getScrollTop(); 3065 var lft = self.getScrollLeft(); 3066 3067 var dst = {}; 3068 dst.x = x-lft; 3069 dst.y = y-top; 3070 dst.px = lft; 3071 dst.py = top; 3072 3073 var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2))); 3074 3075// var df = (self.newscrollspeed) ? self.newscrollspeed : dd; 3076 3077 var ms = (self.newscrollspeed && self.newscrollspeed>1) ? self.newscrollspeed : self.getTransitionSpeed(dd); 3078 if (self.newscrollspeed&&self.newscrollspeed<=1) ms*=self.newscrollspeed; 3079 3080 self.prepareTransition(ms,true); 3081 3082 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 3083 3084 if (ms>0) { 3085 3086 if (!self.scrollrunning&&self.onscrollstart) { 3087 var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 3088 self.onscrollstart.call(self,info); 3089 } 3090 3091 if (cap.transitionend) { 3092 if (!self.scrollendtrapped) { 3093 self.scrollendtrapped = true; 3094 self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!! 3095 } 3096 } else { 3097 if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); 3098 self.scrollendtrapped = setTimeout(self.onScrollEnd,ms); // simulate transitionend event 3099 } 3100 3101 var py = top; 3102 var px = lft; 3103 self.timerscroll = { 3104 bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1), 3105 bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1) 3106 }; 3107 if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60); 3108 3109 } 3110 3111 self.synched("doScroll-set",function(){ 3112 self.timer = 0; 3113 if (self.scrollendtrapped) self.scrollrunning = true; 3114 self.setScrollTop(self.newscrolly); 3115 self.setScrollLeft(self.newscrollx); 3116 if (!self.scrollendtrapped) self.onScrollEnd(); 3117 }); 3118 3119 3120 },50); 3121 3122 }; 3123 3124 this.cancelScroll = function() { 3125 if (!self.scrollendtrapped) return true; 3126 var py = self.getScrollTop(); 3127 var px = self.getScrollLeft(); 3128 self.scrollrunning = false;
3129 if (!cap.transitionend) clearTimeout(cap.transitionend); 3130 self.scrollendtrapped = false; 3131 self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 3132 self.prepareTransition(0); 3133 self.setScrollTop(py); // fire event onscroll 3134 if (self.railh) self.setScrollLeft(px); 3135 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 3136 self.timerscroll = false; 3137 3138 self.cursorfreezed = false; 3139 3140 //self.noticeCursor(false,py,px); 3141 self.showCursor(py,px); 3142 return self; 3143 }; 3144 this.onScrollEnd = function() { 3145 if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd); 3146 self.scrollendtrapped = false; 3147 self.prepareTransition(0); 3148 if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm); 3149 self.timerscroll = false; 3150 var py = self.getScrollTop(); 3151 var px = self.getScrollLeft(); 3152 self.setScrollTop(py); // fire event onscroll 3153 if (self.railh) self.setScrollLeft(px); // fire event onscroll left 3154 3155 self.noticeCursor(false,py,px); 3156 3157 self.cursorfreezed = false; 3158 3159 if (py<0) py=0 3160 else if (py>self.page.maxh) py=self.page.maxh; 3161 if (px<0) px=0 3162 else if (px>self.page.maxw) px=self.page.maxw; 3163 if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed); 3164 3165 if (self.onscrollend&&self.scrollrunning) { 3166 var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 3167 self.onscrollend.call(self,info); 3168 } 3169 self.scrollrunning = false; 3170 3171 }; 3172 3173 } else { 3174 3175 this.doScrollLeft = function(x,spd) { //no-trans 3176 var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); 3177 self.doScrollPos(x,y,spd); 3178 } 3179 3180 this.doScrollTop = function(y,spd) { //no-trans 3181 var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); 3182 self.doScrollPos(x,y,spd); 3183 } 3184 3185 this.doScrollPos = function(x,y,spd) { //no-trans 3186 var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y; 3187 3188 if ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true; 3189 3190 if (self.timer) clearAnimationFrame(self.timer); 3191 self.timer = 0; 3192 3193 var py = self.getScrollTop(); 3194 var px = self.getScrollLeft(); 3195 3196 if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection 3197 3198 self.newscrolly = y; 3199 self.newscrollx = x; 3200 3201 if (!self.bouncescroll||!self.rail.visibility) { 3202 if (self.newscrolly<0) { 3203 self.newscrolly = 0; 3204 } 3205 else if (self.newscrolly>self.page.maxh) { 3206 self.newscrolly = self.page.maxh; 3207 } 3208 } 3209 if (!self.bouncescroll||!self.railh.visibility) { 3210 if (self.newscrollx<0) { 3211 self.newscrollx = 0; 3212 } 3213 else if (self.newscrollx>self.page.maxw) { 3214 self.newscrollx = self.page.maxw; 3215 } 3216 } 3217 3218 self.dst = {}; 3219 self.dst.x = x-px; 3220 self.dst.y = y-py; 3221 self.dst.px = px; 3222 self.dst.py = py; 3223 3224 var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2))); 3225 3226 self.dst.ax = self.dst.x / dst; 3227 self.dst.ay = self.dst.y / dst; 3228 3229 var pa = 0; 3230 var pe = dst; 3231 3232 if (self.dst.x==0) { 3233 pa = py; 3234 pe = y; 3235 self.dst.ay = 1; 3236 self.dst.py = 0; 3237 } else if (self.dst.y==0) { 3238 pa = px; 3239 pe = x; 3240 self.dst.ax = 1; 3241 self.dst.px = 0; 3242 } 3243 3244 var ms = self.getTransitionSpeed(dst); 3245 if (spd&&spd<=1) ms*=spd; 3246 if (ms>0) { 3247 self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1); 3248 } else { 3249 self.bzscroll = false; 3250 } 3251 3252 if (self.timer) return; 3253 3254 if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize(); 3255 3256 var sync = 1; 3257 3258 function scrolling() { 3259 if (self.cancelAnimationFrame) return true; 3260 3261 self.scrollrunning = true; 3262 3263 sync = 1-sync; 3264 if (sync) return (self.timer = setAnimationFrame(scrolling)||1); 3265 3266 var done = 0; 3267 3268 var sc = sy = self.getScrollTop(); 3269 if (self.dst.ay) { 3270 sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()
3270*self.dst.ay) : self.newscrolly; 3271 var dr=sc-sy; 3272 if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly; 3273 self.setScrollTop(sc); 3274 if (sc == self.newscrolly) done=1; 3275 } else { 3276 done=1; 3277 } 3278 3279 var scx = sx = self.getScrollLeft(); 3280 if (self.dst.ax) { 3281 scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx; 3282 var dr=scx-sx; 3283 if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx; 3284 self.setScrollLeft(scx); 3285 if (scx == self.newscrollx) done+=1; 3286 } else { 3287 done+=1; 3288 } 3289 3290 if (done==2) { 3291 self.timer = 0; 3292 self.cursorfreezed = false; 3293 self.bzscroll = false; 3294 self.scrollrunning = false; 3295 if (sc<0) sc=0; 3296 else if (sc>self.page.maxh) sc=self.page.maxh; 3297 if (scx<0) scx=0; 3298 else if (scx>self.page.maxw) scx=self.page.maxw; 3299 if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc); 3300 else { 3301 if (self.onscrollend) { 3302 var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}}; 3303 self.onscrollend.call(self,info); 3304 } 3305 } 3306 } else { 3307 self.timer = setAnimationFrame(scrolling)||1; 3308 } 3309 }; 3310 self.cancelAnimationFrame=false; 3311 self.timer = 1; 3312 3313 if (self.onscrollstart&&!self.scrollrunning) { 3314 var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms}; 3315 self.onscrollstart.call(self,info); 3316 } 3317 3318 scrolling(); 3319 3320 if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize(); 3321 3322 self.noticeCursor(); 3323 }; 3324 3325 this.cancelScroll = function() { 3326 if (self.timer) clearAnimationFrame(self.timer); 3327 self.timer = 0; 3328 self.bzscroll = false; 3329 self.scrollrunning = false; 3330 return self; 3331 }; 3332 3333 } 3334 3335 this.doScrollBy = function(stp,relative) { 3336 var ny = 0; 3337 if (relative) { 3338 ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y) 3339 } else { 3340 var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true); 3341 ny = sy-stp; 3342 } 3343 if (self.bouncescroll) { 3344 var haf = Math.round(self.view.h/2); 3345 if (ny<-haf) ny=-haf 3346 else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf); 3347 } 3348 self.cursorfreezed = false; 3349 3350 py = self.getScrollTop(true); 3351 if (ny<0&&py<=0) return self.noticeCursor(); 3352 else if (ny>self.page.maxh&&py>=self.page.maxh) { 3353 self.checkContentSize(); 3354 return self.noticeCursor(); 3355 } 3356 3357 self.doScrollTop(ny); 3358 }; 3359 3360 this.doScrollLeftBy = function(stp,relative) { 3361 var nx = 0; 3362 if (relative) { 3363 nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x) 3364 } else { 3365 var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true); 3366 nx = sx-stp; 3367 } 3368 if (self.bouncescroll) { 3369 var haf = Math.round(self.view.w/2); 3370 if (nx<-haf) nx=-haf 3371 else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf); 3372 } 3373 self.cursorfreezed = false; 3374 3375 px = self.getScrollLeft(true); 3376 if (nx<0&&px<=0) return self.noticeCursor(); 3377 else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor(); 3378 3379 self.doScrollLeft(nx); 3380 }; 3381 3382 this.doScrollTo = function(pos,relative) { 3383 var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos; 3384 if (ny<0) ny=0 3385 else if (ny>self.page.maxh) ny = self.page.maxh; 3386 self.cursorfreezed = false; 3387 self.doScrollTop(pos); 3388 }; 3389 3390 this.checkContentSize = function() { 3391 var pg = self.getContentSize(); 3392 if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg); 3393 }; 3394 3395 self.onscroll = function(e) { 3396 if (self.rail.drag) return; 3397 if (!self.cursorfreezed) { 3398 self.synched('scroll',function(){ 3399 self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y)); 3400 if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x)); 3401 self.noticeCursor(); 3402 }); 3403 } 3404 }; 3405 self.bind(self.docscroll,"scroll",self.onscroll); 3406 3407 this.doZoomIn = function(e) { 3408 if (self.zoomactive) return; 3409 self.zoomactive = true; 3410 3411 self.zoomrestore = { 3412 style:{} 3413 }; 3414 var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight']; 3415 var win = self.win[0].style; 3416 for(var a in lst) { 3417 var pp = lst[a]; 3418 self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : ''; 3419 } 3420 3421 self.zoomrestore.style.width = self.win.css('width'); 3422 self.zoomrestore.style.height = self.win.css('height'); 3423 3424 self.zoomrestore.padding = { 3425 w:self.win.outerWidth()-self.win.width(), 3426 h:self.win.outerHeight()-self.win.height() 3427 }; 3428 3429 if (cap.isios4) { 3430 self.zoomrestore.scrollTop = $(window).scrollTop(); 3431 $(window).scrollTop(0); 3432 } 3433 3434 self.win.css({ 3435 "position":(cap.isios4)?"absolute":"fixed", 3436 "top":0, 3437 "left":0, 3438 "z-index":globalmaxzindex+100, 3439 "margin":"0px" 3440 }); 3441 var bkg = self.win.css("backgroundColor");
3442 if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff"); 3443 self.rail.css({"z-index":globalmaxzindex+101}); 3444 self.zoom.css({"z-index":globalmaxzindex+102}); 3445 self.zoom.css('backgroundPosition','0px -18px'); 3446 self.resizeZoom(); 3447 3448 if (self.onzoomin) self.onzoomin.call(self); 3449 3450 return self.cancelEvent(e); 3451 }; 3452 3453 this.doZoomOut = function(e) { 3454 if (!self.zoomactive) return; 3455 self.zoomactive = false; 3456 3457 self.win.css("margin",""); 3458 self.win.css(self.zoomrestore.style); 3459 3460 if (cap.isios4) { 3461 $(window).scrollTop(self.zoomrestore.scrollTop); 3462 } 3463 3464 self.rail.css({"z-index":self.zindex}); 3465 self.zoom.css({"z-index":self.zindex}); 3466 self.zoomrestore = false; 3467 self.zoom.css('backgroundPosition','0px 0px'); 3468 self.onResize(); 3469 3470 if (self.onzoomout) self.onzoomout.call(self); 3471 3472 return self.cancelEvent(e); 3473 }; 3474 3475 this.doZoom = function(e) { 3476 return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); 3477 }; 3478 3479 this.resizeZoom = function() { 3480 if (!self.zoomactive) return; 3481 3482 var py = self.getScrollTop(); //preserve scrolling position 3483 self.win.css({ 3484 width:$(window).width()-self.zoomrestore.padding.w+"px", 3485 height:$(window).height()-self.zoomrestore.padding.h+"px" 3486 }); 3487 self.onResize(); 3488 3489 self.setScrollTop(Math.min(self.page.maxh,py)); 3490 }; 3491 3492 this.init(); 3493 3494 $.nicescroll.push(this); 3495 3496 }; 3497 3498// Inspired by the work of Kin Blas 3499// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js 3500 3501 3502 var ScrollMomentumClass2D = function(nc) { 3503 var self = this; 3504 this.nc = nc; 3505 3506 this.lastx = 0; 3507 this.lasty = 0; 3508 this.speedx = 0; 3509 this.speedy = 0; 3510 this.lasttime = 0; 3511 this.steptime = 0; 3512 this.snapx = false; 3513 this.snapy = false; 3514 this.demulx = 0; 3515 this.demuly = 0; 3516 3517 this.lastscrollx = -1; 3518 this.lastscrolly = -1; 3519 3520 this.chkx = 0; 3521 this.chky = 0; 3522 3523 this.timer = 0; 3524 3525 this.time = function() { 3526 return +new Date();//beautifull hack 3527 }; 3528 3529 this.reset = function(px,py) { 3530 self.stop(); 3531 var now = self.time(); 3532 self.steptime = 0; 3533 self.lasttime = now; 3534 self.speedx = 0; 3535 self.speedy = 0; 3536 self.lastx = px; 3537 self.lasty = py; 3538 self.lastscrollx = -1; 3539 self.lastscrolly = -1; 3540 }; 3541 3542 this.update = function(px,py) { 3543 var now = self.time(); 3544 self.steptime = now - self.lasttime; 3545 self.lasttime = now; 3546 var dy = py - self.lasty; 3547 var dx = px - self.lastx; 3548 var sy = self.nc.getScrollTop(); 3549 var sx = self.nc.getScrollLeft(); 3550 var newy = sy + dy; 3551 var newx = sx + dx; 3552 self.snapx = (newx<0)||(newx>self.nc.page.maxw); 3553 self.snapy = (newy<0)||(newy>self.nc.page.maxh); 3554 self.speedx = dx; 3555 self.speedy = dy; 3556 self.lastx = px; 3557 self.lasty = py; 3558 }; 3559 3560 this.stop = function() { 3561 self.nc.unsynched("domomentum2d"); 3562 if (self.timer) clearTimeout(self.timer); 3563 self.timer = 0; 3564 self.lastscrollx = -1; 3565 self.lastscrolly = -1; 3566 }; 3567 3568 this.doSnapy = function(nx,ny) { 3569 var snap = false; 3570 3571 if (ny<0) { 3572 ny=0; 3573 snap=true; 3574 } 3575 else if (ny>self.nc.page.maxh) { 3576 ny=self.nc.page.maxh; 3577 snap=true; 3578 } 3579 3580 if (nx<0) { 3581 nx=0; 3582 snap=true; 3583 } 3584 else if (nx>self.nc.page.maxw) { 3585 nx=self.nc.page.maxw; 3586 snap=true; 3587 } 3588 3589 if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed); 3590 }; 3591 3592 this.doMomentum = function(gp) { 3593 var t = self.time(); 3594 var l = (gp) ? t+gp : self.lasttime; 3595 3596 var sl = self.nc.getScrollLeft(); 3597 var st = self.nc.getScrollTop(); 3598 3599 var pageh = self.nc.page.maxh; 3600 var pagew = self.nc.page.maxw; 3601 3602 self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0; 3603 self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0; 3604 3605 var chk = l && (t - l) <= 60; 3606 3607 if ((st<0)||(st>pageh)||(sl<0)||(sl>
3607pagew)) chk = false; 3608 3609 var sy = (self.speedy && chk) ? self.speedy : false; 3610 var sx = (self.speedx && chk) ? self.speedx : false; 3611 3612 if (sy||sx) { 3613 var tm = Math.max(16,self.steptime); //timeout granularity 3614 3615 if (tm>50) { // do smooth 3616 var xm = tm/50; 3617 self.speedx*=xm; 3618 self.speedy*=xm; 3619 tm = 50; 3620 } 3621 3622 self.demulxy = 0; 3623 3624 self.lastscrollx = self.nc.getScrollLeft(); 3625 self.chkx = self.lastscrollx; 3626 self.lastscrolly = self.nc.getScrollTop(); 3627 self.chky = self.lastscrolly; 3628 3629 var nx = self.lastscrollx; 3630 var ny = self.lastscrolly; 3631 3632 var onscroll = function(){ 3633 var df = ((self.time()-t)>600) ? 0.04 : 0.02; 3634 3635 if (self.speedx) { 3636 nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy))); 3637 self.lastscrollx = nx; 3638 if ((nx<0)||(nx>pagew)) df=0.10; 3639 } 3640 3641 if (self.speedy) { 3642 ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy))); 3643 self.lastscrolly = ny; 3644 if ((ny<0)||(ny>pageh)) df=0.10; 3645 } 3646 3647 self.demulxy = Math.min(1,self.demulxy+df); 3648 3649 self.nc.synched("domomentum2d",function(){ 3650 3651 if (self.speedx) { 3652 var scx = self.nc.getScrollLeft(); 3653 if (scx!=self.chkx) self.stop(); 3654 self.chkx=nx; 3655 self.nc.setScrollLeft(nx); 3656 } 3657 3658 if (self.speedy) { 3659 var scy = self.nc.getScrollTop(); 3660 if (scy!=self.chky) self.stop(); 3661 self.chky=ny; 3662 self.nc.setScrollTop(ny); 3663 } 3664 3665 if(!self.timer) { 3666 self.nc.hideCursor(); 3667 self.doSnapy(nx,ny); 3668 } 3669 3670 }); 3671 3672 if (self.demulxy<1) { 3673 self.timer = setTimeout(onscroll,tm); 3674 } else { 3675 self.stop(); 3676 self.nc.hideCursor(); 3677 self.doSnapy(nx,ny); 3678 } 3679 }; 3680 3681 onscroll(); 3682 3683 } else { 3684 self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop()); 3685 } 3686 3687 } 3688 3689 }; 3690 3691 3692// override jQuery scrollTop 3693 3694 var _scrollTop = jQuery.fn.scrollTop; // preserve original function 3695 3696 jQuery.cssHooks["pageYOffset"] = { 3697 get: function(elem,computed,extra) { 3698 var nice = $.data(elem,'__nicescroll')||false; 3699 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); 3700 }, 3701 set: function(elem,value) { 3702 var nice = $.data(elem,'__nicescroll')||false; 3703 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value); 3704 return this; 3705 } 3706 }; 3707 3708/* 3709 $.fx.step["scrollTop"] = function(fx){ 3710 $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); 3711 }; 3712*/ 3713 3714 jQuery.fn.scrollTop = function(value) { 3715 if (typeof value == "undefined") { 3716 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; 3717 return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); 3718 } else { 3719 return this.each(function() { 3720 var nice = $.data(this,'__nicescroll')||false; 3721 (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value); 3722 }); 3723 } 3724 } 3725 3726// override jQuery scrollLeft 3727 3728 var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function 3729 3730 $.cssHooks.pageXOffset = { 3731 get: function(elem,computed,extra) { 3732 var nice = $.data(elem,'__nicescroll')||false; 3733 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); 3734 }, 3735 set: function(elem,value) { 3736 var nice = $.data(elem,'__nicescroll')||false; 3737 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value); 3738 return this; 3739 } 3740 }; 3741 3742/* 3743 $.fx.step["scrollLeft"] = function(fx){ 3744 $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); 3745 }; 3746*/ 3747 3748 jQuery.fn.scrollLeft = function(value) { 3749 if (typeof value == "undefined") { 3750 var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false; 3751 return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); 3752 } else { 3753 return this.each(function() { 3754 var nice = $.data(this,'__nicescroll')||false; 3755 (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value); 3756 }); 3757 } 3758 } 3759 3760 var NiceScrollArray = function(doms) { 3761 var self = this; 3762 this.length = 0; 3763 this.name = "nicescrollarray"; 3764 3765 this.each = function(fn) { 3766 for(var a=0,i=0;a<self.length;a++) fn.call(self[a],i++); 3767 return self; 3768 }; 3769 3770 this.push = function(nice) { 3771 self[self.length]=nice; 3772 self.length++; 3773 }; 3774 3775 this.eq = function(idx) { 3776 return self[idx]; 3777 }; 3778 3779 if (doms) { 3780 for(a=0;a<doms.length;a++) { 3781 var nice = $.data(doms[a],'__nicescroll')||false; 3782 if (nice) { 3783 this[this.length]=nice; 3784 this.length++; 3785 } 3786 }; 3787 } 3788 3789 return this; 3790 }; 3791 3792 function mplex(el,lst,fn) { 3793 for(var a=0;a<lst.length;a++) fn(el,lst[a]); 3794 }; 3795 mplex( 3796 NiceScrollArray.prototype,
3797 ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'], 3798 function(e,n) { 3799 e[n] = function(){ 3800 var args = arguments; 3801 return this.each(function(){ 3802 this[n].apply(this,args); 3803 }); 3804 }; 3805 } 3806 ); 3807 3808 jQuery.fn.getNiceScroll = function(index) { 3809 if (typeof index == "undefined") { 3810 return new NiceScrollArray(this); 3811 } else { 3812 var nice = this[index]&&$.data(this[index],'__nicescroll')||false; 3813 return nice; 3814 } 3815 }; 3816 3817 jQuery.extend(jQuery.expr[':'], { 3818 nicescroll: function(a) { 3819 return ($.data(a,'__nicescroll'))?true:false; 3820 } 3821 }); 3822 3823 $.fn.niceScroll = function(wrapper,opt) { 3824 if (typeof opt=="undefined") { 3825 if ((typeof wrapper=="object")&&!("jquery" in wrapper)) { 3826 opt = wrapper; 3827 wrapper = false; 3828 } 3829 } 3830 var ret = new NiceScrollArray(); 3831 if (typeof opt=="undefined") opt = {}; 3832 3833 if (wrapper||false) { 3834 opt.doc = $(wrapper); 3835 opt.win = $(this); 3836 } 3837 var docundef = !("doc" in opt); 3838 if (!docundef&&!("win" in opt)) opt.win = $(this); 3839 3840 this.each(function() { 3841 var nice = $(this).data('__nicescroll')||false; 3842 if (!nice) { 3843 opt.doc = (docundef) ? $(this) : opt.doc; 3844 nice = new NiceScrollClass(opt,$(this)); 3845 $(this).data('__nicescroll',nice); 3846 } 3847 ret.push(nice); 3848 }); 3849 return (ret.length==1) ? ret[0] : ret; 3850 }; 3851 3852 window.NiceScroll = { 3853 getjQuery:function(){return jQuery} 3854 }; 3855 3856 if (!$.nicescroll) { 3857 $.nicescroll = new NiceScrollArray(); 3858 $.nicescroll.options = _globaloptions; 3859 } 3860 3861})( jQuery ); 3862 3863 3864 3865 3866 3867 3868 3869 3870/* 3871 * jQuery FlexSlider v2.5.0 3872 * Copyright 2012 WooThemes 3873 * Contributing Author: Tyler Smith 3874 */!function($){$.flexslider=function(e,t){var a=$(e);a.vars=$.extend({},$.flexslider.defaults,t);var n=a.vars.namespace,i=window.navigator&&window.navigator.msPointerEnabled&&window.MSGesture,s=("ontouchstart"in window||i||window.DocumentTouch&&document instanceof DocumentTouch)&&a.vars.touch,r="click touchend MSPointerUp keyup",o="",l,c="vertical"===a.vars.direction,d=a.vars.reverse,u=a.vars.itemWidth>0,v="fade"===a.vars.animation,p=""!==a.vars.asNavFor,m={},f=!0;$.data(e,"flexslider",a),m={init:function(){a.animating=!1,a.currentSlide=parseInt(a.vars.startAt?a.vars.startAt:0,10),isNaN(a.currentSlide)&&(a.currentSlide=0),a.animatingTo=a.currentSlide,a.atEnd=0===a.currentSlide||a.currentSlide===a.last,a.containerSelector=a.vars.selector.substr(0,a.vars.selector.search(" ")),a.slides=$(a.vars.selector,a),a.container=$(a.containerSelector,a),a.count=a.slides.length,a.syncExists=$(a.vars.sync).length>0,"slide"===a.vars.animation&&(a.vars.animation="swing"),a.prop=c?"top":"marginLeft",a.args={},a.manualPause=!1,a.stopped=!1,a.started=!1,a.startTimeout=null,a.transitions=!a.vars.video&&!v&&a.vars.useCSS&&function(){var e=document.createElement("div"),t=["perspectiveProperty","WebkitPerspective","MozPerspective","OPerspective","msPerspective"];for(var n in t)if(void 0!==e.style[t[n]])return a.pfx=t[n].replace("Perspective","").toLowerCase(),a.prop="-"+a.pfx+"-transform",!0;return!1}(),a.ensureAnimationEnd="",""!==a.vars.controlsContainer&&(a.controlsContainer=$(a.vars.controlsContainer).length>0&&$(a.vars.controlsContainer)),""!==a.vars.manualControls&&(a.manualControls=$(a.vars.manualControls).length>0&&$(a.vars.manualControls)),""!==a.vars.customDirectionNav&&(a.customDirectionNav=2===$(a.vars.customDirectionNav).length&&$(a.vars.customDirectionNav)),a.vars.randomize&&(a.slides.sort(function(){return Math.round(Math.random())-.5}),a.container.empty().append(a.slides)),a.doMath(),a.setup("init"),a.vars.controlNav&&m.controlNav.setup(),a.vars.directionNav&&m.directionNav.setup(),a.vars.keyboard&&(1===$(a.containerSelector).length||a.vars.multipleKeyboard)&&$(document).bind("keyup",function(e){var t=e.keyCode;if(!a.animating&&(39===t||37===t)){var n=39===t?a.getTarget("next"):37===t?a.getTarget("prev"):!1;a.flexAnimate(n,a.vars.pauseOnAction)}}),a.vars.mousewheel&&a.bind("mousewheel",function(e,t,n,i){e.preventDefault();var s=a.getTarget(0>t?"next":"prev");a.flexAnimate(s,a.vars.pauseOnAction)}),a.vars.pausePlay&&m.pausePlay.setup(),a.vars.slideshow&&a.vars.pauseInvisible&&m.pauseInvisible.init(
3874),a.vars.slideshow&&(a.vars.pauseOnHover&&a.hover(function(){a.manualPlay||a.manualPause||a.pause()},function(){a.manualPause||a.manualPlay||a.stopped||a.play()}),a.vars.pauseInvisible&&m.pauseInvisible.isHidden()||(a.vars.initDelay>0?a.startTimeout=setTimeout(a.play,a.vars.initDelay):a.play())),p&&m.asNav.setup(),s&&a.vars.touch&&m.touch(),(!v||v&&a.vars.smoothHeight)&&$(window).bind("resize orientationchange focus",m.resize),a.find("img").attr("draggable","false"),setTimeout(function(){a.vars.start(a)},200)},asNav:{setup:function(){a.asNav=!0,a.animatingTo=Math.floor(a.currentSlide/a.move),a.currentItem=a.currentSlide,a.slides.removeClass(n+"active-slide").eq(a.currentItem).addClass(n+"active-slide"),i?(e._slider=a,a.slides.each(function(){var e=this;e._gesture=new MSGesture,e._gesture.target=e,e.addEventListener("MSPointerDown",function(e){e.preventDefault(),e.currentTarget._gesture&&e.currentTarget._gesture.addPointer(e.pointerId)},!1),e.addEventListener("MSGestureTap",function(e){e.preventDefault();var t=$(this),n=t.index();$(a.vars.asNavFor).data("flexslider").animating||t.hasClass("active")||(a.direction=a.currentItem<n?"next":"prev",a.flexAnimate(n,a.vars.pauseOnAction,!1,!0,!0))})})):a.slides.on(r,function(e){e.preventDefault();var t=$(this),i=t.index(),s=t.offset().left-$(a).scrollLeft();0>=s&&t.hasClass(n+"active-slide")?a.flexAnimate(a.getTarget("prev"),!0):$(a.vars.asNavFor).data("flexslider").animating||t.hasClass(n+"active-slide")||(a.direction=a.currentItem<i?"next":"prev",a.flexAnimate(i,a.vars.pauseOnAction,!1,!0,!0))})}},controlNav:{setup:function(){a.manualControls?m.controlNav.setupManual():m.controlNav.setupPaging()},setupPaging:function(){var e="thumbnails"===a.vars.controlNav?"control-thumbs":"control-paging",t=1,i,s;if(a.controlNavScaffold=$('<ol class="'+n+"control-nav "+n+e+'"></ol>'),a.pagingCount>1)for(var l=0;l<a.pagingCount;l++){if(s=a.slides.eq(l),i="thumbnails"===a.vars.controlNav?'<img src="'+s.attr("data-thumb")+'"/>':"<a>"+t+"</a>","thumbnails"===a.vars.controlNav&&!0===a.vars.thumbCaptions){var c=s.attr("data-thumbcaption");""!==c&&void 0!==c&&(i+='<span class="'+n+'caption">'+c+"</span>")}a.controlNavScaffold.append("<li>"+i+"</li>"),t++}a.controlsContainer?$(a.controlsContainer).append(a.controlNavScaffold):a.append(a.controlNavScaffold),m.controlNav.set(),m.controlNav.active(),a.controlNavScaffold.delegate("a, img",r,function(e){if(e.preventDefault(),""===o||o===e.type){var t=$(this),i=a.controlNav.index(t);t.hasClass(n+"active")||(a.direction=i>a.currentSlide?"next":"prev",a.flexAnimate(i,a.vars.pauseOnAction))}""===o&&(o=e.type),m.setToClearWatchedEvent()})},setupManual:function(){a.controlNav=a.manualControls,m.controlNav.active(),a.controlNav.bind(r,function(e){if(e.preventDefault(),""===o||o===e.type){var t=$(this),i=a.controlNav.index(t);t.hasClass(n+"active")||(a.direction=i>a.currentSlide?"next":"prev",a.flexAnimate(i,a.vars.pauseOnAction))}""===o&&(o=e.type),m.setToClearWatchedEvent()})},set:function(){var e="thumbnails"===a.vars.controlNav?"img":"a";a.controlNav=$("."+n+"control-nav li "+e,a.controlsContainer?a.controlsContainer:a)},active:function(){a.controlNav.removeClass(n+"active").eq(a.animatingTo).addClass(n+"active")},update:function(e,t){a.pagingCount>1&&"add"===e?a.controlNavScaffold.append($("<li><a>"+a.count+"</a></li>")):1===a.pagingCount?a.controlNavScaffold.find("li").remove():a.controlNav.eq(t).closest("li").remove(),m.controlNav.set(),a.pagingCount>1&&a.pagingCount!==a.controlNav.length?a.update(t,e):m.controlNav.active()}}
3874,directionNav:{setup:function(){var e=$('<ul class="'+n+'direction-nav"><li class="'+n+'nav-prev"><a class="'+n+'prev" href="#">'+a.vars.prevText+'</a></li><li class="'+n+'nav-next"><a class="'+n+'next" href="#">'+a.vars.nextText+"</a></li></ul>");a.customDirectionNav?a.directionNav=a.customDirectionNav:a.controlsContainer?($(a.controlsContainer).append(e),a.directionNav=$("."+n+"direction-nav li a",a.controlsContainer)):(a.append(e),a.directionNav=$("."+n+"direction-nav li a",a)),m.directionNav.update(),a.directionNav.bind(r,function(e){e.preventDefault();var t;(""===o||o===e.type)&&(t=a.getTarget($(this).hasClass(n+"next")?"next":"prev"),a.flexAnimate(t,a.vars.pauseOnAction)),""===o&&(o=e.type),m.setToClearWatchedEvent()})},update:function(){var e=n+"disabled";1===a.pagingCount?a.directionNav.addClass(e).attr("tabindex","-1"):a.vars.animationLoop?a.directionNav.removeClass(e).removeAttr("tabindex"):0===a.animatingTo?a.directionNav.removeClass(e).filter("."+n+"prev").addClass(e).attr("tabindex","-1"):a.animatingTo===a.last?a.directionNav.removeClass(e).filter("."+n+"next").addClass(e).attr("tabindex","-1"):a.directionNav.removeClass(e).removeAttr("tabindex")}}
3874,pausePlay:{setup:function(){var e=$('<div class="'+n+'pauseplay"><a></a></div>');a.controlsContainer?(a.controlsContainer.append(e),a.pausePlay=$("."+n+"pauseplay a",a.controlsContainer)):(a.append(e),a.pausePlay=$("."+n+"pauseplay a",a)),m.pausePlay.update(a.vars.slideshow?n+"pause":n+"play"),a.pausePlay.bind(r,function(e){e.preventDefault(),(""===o||o===e.type)&&($(this).hasClass(n+"pause")?(a.manualPause=!0,a.manualPlay=!1,a.pause()):(a.manualPause=!1,a.manualPlay=!0,a.play())),""===o&&(o=e.type),m.setToClearWatchedEvent()})},update:function(e){"play"===e?a.pausePlay.removeClass(n+"pause").addClass(n+"play").html(a.vars.playText):a.pausePlay.removeClass(n+"play").addClass(n+"pause").html(a.vars.pauseText)}},touch:function(){function t(t){t.stopPropagation(),a.animating?t.preventDefault():(a.pause(),e._gesture.addPointer(t.pointerId),w=0,p=c?a.h:a.w,f=Number(new Date),l=u&&d&&a.animatingTo===a.last?0:u&&d?a.limit-(a.itemW+a.vars.itemMargin)*a.move*a.animatingTo:u&&a.currentSlide===a.last?a.limit:u?(a.itemW+a.vars.itemMargin)*a.move*a.currentSlide:d?(a.last-a.currentSlide+a.cloneOffset)*p:(a.currentSlide+a.cloneOffset)*p)}function n(t){t.stopPropagation();var a=t.target._slider;if(a){var n=-t.translationX,i=-t.translationY;return w+=c?i:n,m=w,y=c?Math.abs(w)<Math.abs(-n):Math.abs(w)<Math.abs(-i),t.detail===t.MSGESTURE_FLAG_INERTIA?void setImmediate(function(){e._gesture.stop()}):void((!y||Number(new Date)-f>500)&&(t.preventDefault(),!v&&a.transitions&&(a.vars.animationLoop||(m=w/(0===a.currentSlide&&0>w||a.currentSlide===a.last&&w>0?Math.abs(w)/p+2:1)),a.setProps(l+m,"setTouch"))))}}function s(e){e.stopPropagation();var t=e.target._slider;if(t){if(t.animatingTo===t.currentSlide&&!y&&null!==m){var a=d?-m:m,n=t.getTarget(a>0?"next":"prev");t.canAdvance(n)&&(Number(new Date)-f<550&&Math.abs(a)>50||Math.abs(a)>p/2)?t.flexAnimate(n,t.vars.pauseOnAction):v||t.flexAnimate(t.currentSlide,t.vars.pauseOnAction,!0)}r=null,o=null,m=null,l=null,w=0}}var r,o,l,p,m,f,g,h,S,y=!1,x=0,b=0,w=0;i?(e.style.msTouchAction="none",e._gesture=new MSGesture,e._gesture.target=e,e.addEventListener("MSPointerDown",t,!1),e._slider=a,e.addEventListener("MSGestureChange",n,!1),e.addEventListener("MSGestureEnd",s,!1)):(g=function(t){a.animating?t.preventDefault():(window.navigator.msPointerEnabled||1===t.touches.length)&&(a.pause(),p=c?a.h:a.w,f=Number(new Date),x=t.touches[0].pageX,b=t.touches[0].pageY,l=u&&d&&a.animatingTo===a.last?0:u&&d?a.limit-(a.itemW+a.vars.itemMargin)*a.move*a.animatingTo:u&&a.currentSlide===a.last?a.limit:u?(a.itemW+a.vars.itemMargin)*a.move*a.currentSlide:d?(a.last-a.currentSlide+a.cloneOffset)*p:(a.currentSlide+a.cloneOffset)*p,r=c?b:x,o=c?x:b,e.addEventListener("touchmove",h,!1),e.addEventListener("touchend",S,!1))},h=function(e){x=e.touches[0].pageX,b=e.touches[0].pageY,m=c?r-b:r-x,y=c?Math.abs(m)<Math.abs(x-o):Math.abs(m)<Math.abs(b-o);var t=500;(!y||Number(new Date)-f>t)&&(e.preventDefault(),!v&&a.transitions&&(a.vars.animationLoop||(m/=0===a.currentSlide&&0>m||a.currentSlide===a.last&&m>0?Math.abs(m)/p+2:1),a.setProps(l+m,"setTouch")))},S=function(t){if(e.removeEventListener("touchmove",h,!1),a.animatingTo===a.currentSlide&&!y&&null!==m){var n=d?-m:m,i=a.getTarget(n>0?"next":"prev");a.canAdvance(i)&&(Number(new Date)-f<550&&Math.abs(n)>50||Math.abs(n)>p/2)?a.flexAnimate(i,a.vars.pauseOnAction):v||a.flexAnimate(a.currentSlide,a.vars.pauseOnAction,!0)}e.removeEventListener("touchend",S,!1),r=null,o=null,m=null,l=null},e.addEventListener("touchstart",g,!1))},resize:function(){!a.animating&&a.is(":visible")&&(u||a.doMath(),v?m.smoothHeight():u?(a.slides.width(a.computedW),a.update(a.pagingCount),a.setProps()):c?(a.viewport.height(a.h),a.setProps(a.h,"setTotal")):(a.vars.smoothHeight&&m.smoothHeight(),a.newSlides.width(a.computedW),a.setProps(a.computedW,"setTotal")))},smoothHeight:function(e){if(!c||v){var t=v?a:a.viewport;e?t.animate({height:a.slides.eq(a.animatingTo).height()},e):t.height(a.slides.eq(a.animatingTo).height())}},sync:function(e){var t=$(a.vars.sync).data("flexslider"),n=a.animatingTo;switch(e){case"animate":t.flexAnimate(n,a.vars.pauseOnAction,!1,!0);break;case"play":t.playing||t.asNav||t.play();break;case"pause":t.pause()}},uniqueID:function(e){return e.filter("[id]").add(e.find("[id]")).each(function(){var e=$
vendor: 10,368 bytes, line 3874
3874(this);e.attr("id",e.attr("id")+"_clone")}),e},pauseInvisible:{visProp:null,init:function(){var e=m.pauseInvisible.getHiddenProp();if(e){var t=e.replace(/[H|h]idden/,"")+"visibilitychange";document.addEventListener(t,function(){m.pauseInvisible.isHidden()?a.startTimeout?clearTimeout(a.startTimeout):a.pause():a.started?a.play():a.vars.initDelay>0?setTimeout(a.play,a.vars.initDelay):a.play()})}},isHidden:function(){var e=m.pauseInvisible.getHiddenProp();return e?document[e]:!1},getHiddenProp:function(){var e=["webkit","moz","ms","o"];if("hidden"in document)return"hidden";for(var t=0;t<e.length;t++)if(e[t]+"Hidden"in document)return e[t]+"Hidden";return null}},setToClearWatchedEvent:function(){clearTimeout(l),l=setTimeout(function(){o=""},3e3)}},a.flexAnimate=function(e,t,i,r,o){if(a.vars.animationLoop||e===a.currentSlide||(a.direction=e>a.currentSlide?"next":"prev"),p&&1===a.pagingCount&&(a.direction=a.currentItem<e?"next":"prev"),!a.animating&&(a.canAdvance(e,o)||i)&&a.is(":visible")){if(p&&r){var l=$(a.vars.asNavFor).data("flexslider");if(a.atEnd=0===e||e===a.count-1,l.flexAnimate(e,!0,!1,!0,o),a.direction=a.currentItem<e?"next":"prev",l.direction=a.direction,Math.ceil((e+1)/a.visible)-1===a.currentSlide||0===e)return a.currentItem=e,a.slides.removeClass(n+"active-slide").eq(e).addClass(n+"active-slide"),!1;a.currentItem=e,a.slides.removeClass(n+"active-slide").eq(e).addClass(n+"active-slide"),e=Math.floor(e/a.visible)}if(a.animating=!0,a.animatingTo=e,t&&a.pause(),a.vars.before(a),a.syncExists&&!o&&m.sync("animate"),a.vars.controlNav&&m.controlNav.active(),u||a.slides.removeClass(n+"active-slide").eq(e).addClass(n+"active-slide"),a.atEnd=0===e||e===a.last,a.vars.directionNav&&m.directionNav.update(),e===a.last&&(a.vars.end(a),a.vars.animationLoop||a.pause()),v)s?(a.slides.eq(a.currentSlide).css({opacity:0,zIndex:1}),a.slides.eq(e).css({opacity:1,zIndex:2}),a.wrapup(f)):(a.slides.eq(a.currentSlide).css({zIndex:1}).animate({opacity:0},a.vars.animationSpeed,a.vars.easing),a.slides.eq(e).css({zIndex:2}).animate({opacity:1},a.vars.animationSpeed,a.vars.easing,a.wrapup));else{var f=c?a.slides.filter(":first").height():a.computedW,g,h,S;u?(g=a.vars.itemMargin,S=(a.itemW+g)*a.move*a.animatingTo,h=S>a.limit&&1!==a.visible?a.limit:S):h=0===a.currentSlide&&e===a.count-1&&a.vars.animationLoop&&"next"!==a.direction?d?(a.count+a.cloneOffset)*f:0:a.currentSlide===a.last&&0===e&&a.vars.animationLoop&&"prev"!==a.direction?d?0:(a.count+1)*f:d?(a.count-1-e+a.cloneOffset)*f:(e+a.cloneOffset)*f,a.setProps(h,"",a.vars.animationSpeed),a.transitions?(a.vars.animationLoop&&a.atEnd||(a.animating=!1,a.currentSlide=a.animatingTo),a.container.unbind("webkitTransitionEnd transitionend"),a.container.bind("webkitTransitionEnd transitionend",function(){clearTimeout(a.ensureAnimationEnd),a.wrapup(f)}),clearTimeout(a.ensureAnimationEnd),a.ensureAnimationEnd=setTimeout(function(){a.wrapup(f)},a.vars.animationSpeed+100)):a.container.animate(a.args,a.vars.animationSpeed,a.vars.easing,function(){a.wrapup(f)})}a.vars.smoothHeight&&m.smoothHeight(a.vars.animationSpeed)}},a.wrapup=function(e){v||u||(0===a.currentSlide&&a.animatingTo===a.last&&a.vars.animationLoop?a.setProps(e,"jumpEnd"):a.currentSlide===a.last&&0===a.animatingTo&&a.vars.animationLoop&&a.setProps(e,"jumpStart")),a.animating=!1,a.currentSlide=a.animatingTo,a.vars.after(a)},a.animateSlides=function(){!a.animating&&f&&a.flexAnimate(a.getTarget("next"))},a.pause=function(){clearInterval(a.animatedSlides),a.animatedSlides=null,a.playing=!1,a.vars.pausePlay&&m.pausePlay.update("play"),a.syncExists&&m.sync("pause")},a.play=function(){a.playing&&clearInterval(a.animatedSlides),a.animatedSlides=a.animatedSlides||setInterval(a.animateSlides,a.vars.slideshowSpeed),a.started=a.playing=!0,a.vars.pausePlay&&m.pausePlay.update("pause"),a.syncExists&&m.sync("play")},a.stop=function(){a.pause(),a.stopped=!0},a.canAdvance=function(e,t){var n=p?a.pagingCount-1:a.last;return t?!0:p&&a.currentItem===a.count-1&&0===e&&"prev"===a.direction?!0:p&&0===a.currentItem&&e===a.pagingCount-1&&"next"!==a.direction?!1:e!==a.currentSlide||p?a.vars.animationLoop?!0:a.atEnd&&0===a.currentSlide&&e===n&&"next"!==a.direction?!1:a.atEnd&&a.currentSlide===n&&0===e&&"next"===a.direction?!1:!0:!1},a.getTarget=function(e){return a.direction=e,"next"===e?a.currentSlide===a.last?0:a.currentSlide+1:0===a.currentSlide?a.last:a.currentSlide-1},a.setProps=function(e,t,n){var i=function(){var n=e?e:(a.itemW+a.vars.itemMargin)*a.move*a.animatingTo,i=function(){if(u)return"setTouch"===t?e:d&&a.animatingTo===a.last?0:d?a.limit-(a.itemW+a.vars.itemMargin)*a.move*a.animatingTo:a.animatingTo===a.last?a.limit:n;switch(t){case"setTotal":return d?(a.count-1-a.currentSlide+a.cloneOffset)*e:(a.currentSlide+a.cloneOffset)*e;case"setTouch":return d?e:e;case"jumpEnd":return d?e:a.count*e;case"jumpStart":return d?a.count*e:e;default:return e}}();return-1*i+"px"}();a.transitions&&(i=c?"translate3d(0,"+i+",0)":"translate3d("+i+",0,0)",n=void 0!==n?n/1e3+"s":"0s",a.container.css("-"+a.pfx+"-transition-duration",n),a.container.css("transition-duration",n)),a.args[a.prop]=i,(a.transitions||void 0===n)&&a.container.css(a.args),a.container.css("transform",i)},a.setup=function(e){if(v)a.slides.css({width:"100%","float":"left",marginRight:"-100%",position:"relative"}),"init"===e&&(s?a.slides.css({opacity:0,display:"block",webkitTransition:"opacity "+a.vars.animationSpeed/1e3+"s ease",zIndex:1}).eq(a.currentSlide).css({opacity:1,zIndex:2}):0==a.vars.fadeFirstSlide?a.slides.css({opacity:0,display:"block",zIndex:1}).eq(a.currentSlide).css({zIndex:2}).css({opacity:1}):a.slides.css({opacity:0,display:"block",zIndex:1}).eq(a.currentSlide).css({zIndex:2}).animate({opacity:1},a.vars.animationSpeed,a.vars.easing)),a.vars.smoothHeight&&m.smoothHeight();else{var t,i;"init"===e&&(a.viewport=$('<div class="'+n+'viewport"></div>').css({overflow:"hidden",position:"relative"}).appendTo(a).append(a.container),a.cloneCount=0,a.cloneOffset=0,d&&(i=$.makeArray(a.slides).reverse(),a.slides=$(i),a.container.empty().append(a.slides))),a.vars.animationLoop&&!u&&(a.cloneCount=2,a.cloneOffset=1,"init"!==e&&a.container.find(".clone").remove(),a.container.append(m.uniqueID(a.slides.first().clone().addClass("clone")).attr("aria-hidden","true")).prepend(m.uniqueID(a.slides.last().clone().addClass("clone")).attr("aria-hidden","true"))),a.newSlides=$(a.vars.selector,a),t=d?a.count-1-a.currentSlide+a.cloneOffset:a.currentSlide+a.cloneOffset,c&&!u?(a.container.height(200*(a.count+a.cloneCount)+"%").css("position","absolute").width("100%"),setTimeout(function(){a.newSlides.css({display:"block"}),a.doMath(),a.viewport.height(a.h),a.setProps(t*a.h,"init")},"init"===e?100:0)):(a.container.width(200*(a.count+a.cloneCount)+"%"),a.setProps(t*a.computedW,"init"),setTimeout(function(){a.doMath(),a.newSlides.css({width:a.computedW,"float":"left",display:"block"}),a.vars.smoothHeight&&m.smoothHeight()},"init"===e?100:0))}u||a.slides.removeClass(n+"active-slide").eq(a.currentSlide).addClass(n+"active-slide"),a.vars.init(a)},a.doMath=function(){var e=a.slides.first(),t=a.vars.itemMargin,n=a.vars.minItems,i=a.vars.maxItems;a.w=void 0===a.viewport?a.width():a.viewport.width(),a.h=e.height(),a.boxPadding=e.outerWidth()-e.width(),u?(a.itemT=a.vars.itemWidth+t,a.minW=n?n*a.itemT:a.w,a.maxW=i?i*a.itemT-t:a.w,a.itemW=a.minW>a.w?(a.w-t*(n-1))/n:a.maxW<a.w?(a.w-t*(i-1))/i:a.vars.itemWidth>a.w?a.w:a.vars.itemWidth,a.visible=Math.floor(a.w/a.itemW),a.move=a.vars.move>0&&a.vars.move<a.visible?a.vars.move:a.visible,a.pagingCount=Math.ceil((a.count-a.visible)/a.move+1),a.last=a.pagingCount-1,a.limit=1===a.pagingCount?0:a.vars.itemWidth>a.w?a.itemW*(a.count-1)+t*(a.count-1):(a.itemW+t)*a.count-a.w-t):(a.itemW=a.w,a.pagingCount=a.count,a.last=a.count-1),a.computedW=a.itemW-a.boxPadding},a.update=function(e,t){a.doMath(),u||(e<a.currentSlide?a.currentSlide+=1:e<=a.currentSlide&&0!==e&&(a.currentSlide-=1),a.animatingTo=a.currentSlide),a.vars.controlNav&&!a.manualControls&&("add"===t&&!u||a.pagingCount>a.controlNav.length?m.controlNav.update("add"):("remove"===t&&!u||a.pagingCount<a.controlNav.length)&&(u&&a.currentSlide>a.last&&(a.currentSlide-=1,a.animatingTo-=1),m.controlNav.update("remove",a.last))),a.vars.directionNav&&m.directionNav.update()},a.addSlide=function(e,t){var n=$(e);a.count+=1,a.last=a.count-1,c&&d?void 0!==t?a.slides.eq(a.count-t).after(n):a.container.prepend(n):void 0!==t?a.slides.eq(t).before(n):a.container.append(n),a.update(t,"add"),a.slides=$(a.vars.selector+":not(.clone)",a),a.setup(),a.vars.added(a)},a.removeSlide=function(e){var t=isNaN(e)?a.slides.index($(e)):e;a.count-=1,a.last=a.count-1,isNaN(e)?$(e,a.slides).remove():c&&d?a.slides.eq(a.last).remove():a.slides.eq(e).remove(),a.doMath(),a.update(t,"remove"),a.slides=$(a.vars.selector+":not(.clone)",a),a.setup(),a.vars.removed(a)},m.init()},$(window).blur(function(e){focused=!1}).focus(function(e){focused=!0}),$.flexslider.defaults={namespace:"flex-",selector:".slides > li",animation:"fade",easing:"swing",direction:"horizontal",reverse:!1,animationLoop:!0,smoothHeight:!1,startAt:0,slideshow:!0,slideshowSpeed:7e3,animationSpeed:600,initDelay:0,randomize:!1,fadeFirstSlide:!0,thumbCaptions:!1,pauseOnAction:!0,pauseOnHover:!1,pauseInvisible:!0,useCSS:!0,touch:!0,video:!1,controlNav:!0,directionNav:!0,prevText:"Previous",nextText:"Next",keyboard:!0,multipleKeyboard:!1,mousewheel:!1,pausePlay:!1,pauseText:"Pause",playText:"Play",controlsContainer:"",manualControls:"",customDirectionNav:"",sync:"",asNavFor:"",itemWidth:0,itemMargin:0,minItems:1,maxItems:0,move:0,allowOneSlide:!0,start:function(){},before:function(){},after:function(){},end:function(){},added:function(){},removed:function(){},init:function(){}},$.fn.flexslider=function(e){if(void 0===e&&(e={}),"object"==typeof e)return this.each(function(){var t=$(this),a=e.selector?e.selector:".slides > li",n=t.find(a);1===n.length&&e.allowOneSlide===!0||0===n.length?(n.fadeIn(400),e.start&&e.start(t)):void 0===t.data("flexslider")&&new $.flexslider(this,e)});var t=$(this).data("flexslider");switch(e){case"play":t.play();break;case"pause":t.pause();break;case"stop":t.stop();break;case"next":t.flexAnimate(t.getTarget("next"),!0);break;case"prev":case"previous":t.flexAnimate(t.getTarget("prev"),!0);break;default:"number"==typeof e&&t.flexAnimate(e,!0)}}}(jQuery);
Line numbers count LF bytes from the start of the resource, as the search results do. Vendor segments are library code the classifier recognised; they are stored but not indexed. Bytes are shown as Latin1 characters, one per byte.